From a2c408c63d164c982d81454e5615e2475846d4ff Mon Sep 17 00:00:00 2001 From: Wathanyu Phromma Date: Sun, 20 Mar 2022 14:01:35 +0700 Subject: [PATCH] fix: validate status and some security --- README.md | 170 +- action.yml | 19 +- dist/index.js | 44 +- dist/index.js.map | 2 +- dist/output.js | 30 +- dist/output.js.map | 2 +- dist/requestconf.js | 109 +- dist/requestconf.js.map | 2 +- dist/util.js | 143 +- dist/util.js.map | 2 +- node_modules/.bin/js-yaml | 1 + node_modules/.package-lock.json | 138 + node_modules/@actions/core/LICENSE.md | 9 + node_modules/@actions/core/README.md | 178 +- node_modules/@actions/core/lib/command.d.ts | 7 +- node_modules/@actions/core/lib/command.js | 22 +- node_modules/@actions/core/lib/command.js.map | 2 +- node_modules/@actions/core/lib/core.d.ts | 96 +- node_modules/@actions/core/lib/core.js | 145 +- node_modules/@actions/core/lib/core.js.map | 2 +- .../@actions/core/lib/file-command.d.ts | 1 + .../@actions/core/lib/file-command.js | 42 + .../@actions/core/lib/file-command.js.map | 1 + .../@actions/core/lib/oidc-utils.d.ts | 7 + node_modules/@actions/core/lib/oidc-utils.js | 77 + .../@actions/core/lib/oidc-utils.js.map | 1 + node_modules/@actions/core/lib/utils.d.ts | 14 + node_modules/@actions/core/lib/utils.js | 40 + node_modules/@actions/core/lib/utils.js.map | 1 + node_modules/@actions/core/package.json | 69 +- node_modules/@actions/http-client/LICENSE | 21 + node_modules/@actions/http-client/README.md | 79 + node_modules/@actions/http-client/RELEASES.md | 26 + node_modules/@actions/http-client/actions.png | Bin 0 -> 33889 bytes node_modules/@actions/http-client/auth.d.ts | 23 + node_modules/@actions/http-client/auth.js | 58 + node_modules/@actions/http-client/index.d.ts | 124 + node_modules/@actions/http-client/index.js | 537 +++ .../@actions/http-client/interfaces.d.ts | 49 + .../@actions/http-client/interfaces.js | 2 + .../@actions/http-client/package.json | 39 + node_modules/@actions/http-client/proxy.d.ts | 2 + node_modules/@actions/http-client/proxy.js | 57 + node_modules/@babel/runtime/LICENSE | 22 + node_modules/@babel/runtime/README.md | 19 + .../@babel/runtime/helpers/AsyncGenerator.js | 98 + .../@babel/runtime/helpers/AwaitValue.js | 5 + .../helpers/applyDecoratedDescriptor.js | 30 + .../@babel/runtime/helpers/applyDecs.js | 284 ++ .../runtime/helpers/arrayLikeToArray.js | 11 + .../@babel/runtime/helpers/arrayWithHoles.js | 5 + .../runtime/helpers/arrayWithoutHoles.js | 7 + .../runtime/helpers/assertThisInitialized.js | 9 + .../runtime/helpers/asyncGeneratorDelegate.js | 56 + .../@babel/runtime/helpers/asyncIterator.js | 50 + .../runtime/helpers/asyncToGenerator.js | 37 + .../runtime/helpers/awaitAsyncGenerator.js | 7 + .../helpers/checkPrivateRedeclaration.js | 7 + .../classApplyDescriptorDestructureSet.js | 22 + .../helpers/classApplyDescriptorGet.js | 9 + .../helpers/classApplyDescriptorSet.js | 13 + .../@babel/runtime/helpers/classCallCheck.js | 7 + .../helpers/classCheckPrivateStaticAccess.js | 7 + .../classCheckPrivateStaticFieldDescriptor.js | 7 + .../helpers/classExtractFieldDescriptor.js | 9 + .../runtime/helpers/classNameTDZError.js | 5 + .../classPrivateFieldDestructureSet.js | 10 + .../runtime/helpers/classPrivateFieldGet.js | 10 + .../helpers/classPrivateFieldInitSpec.js | 8 + .../helpers/classPrivateFieldLooseBase.js | 9 + .../helpers/classPrivateFieldLooseKey.js | 7 + .../runtime/helpers/classPrivateFieldSet.js | 11 + .../runtime/helpers/classPrivateMethodGet.js | 9 + .../helpers/classPrivateMethodInitSpec.js | 8 + .../runtime/helpers/classPrivateMethodSet.js | 5 + .../classStaticPrivateFieldDestructureSet.js | 13 + .../helpers/classStaticPrivateFieldSpecGet.js | 13 + .../helpers/classStaticPrivateFieldSpecSet.js | 14 + .../helpers/classStaticPrivateMethodGet.js | 8 + .../helpers/classStaticPrivateMethodSet.js | 5 + .../@babel/runtime/helpers/construct.js | 22 + .../@babel/runtime/helpers/createClass.js | 20 + .../helpers/createForOfIteratorHelper.js | 60 + .../helpers/createForOfIteratorHelperLoose.js | 24 + .../@babel/runtime/helpers/createSuper.js | 24 + .../@babel/runtime/helpers/decorate.js | 400 ++ .../@babel/runtime/helpers/defaults.js | 16 + .../helpers/defineEnumerableProperties.js | 24 + .../@babel/runtime/helpers/defineProperty.js | 16 + .../runtime/helpers/esm/AsyncGenerator.js | 95 + .../@babel/runtime/helpers/esm/AwaitValue.js | 3 + .../helpers/esm/applyDecoratedDescriptor.js | 28 + .../@babel/runtime/helpers/esm/applyDecs.js | 282 ++ .../runtime/helpers/esm/arrayLikeToArray.js | 9 + .../runtime/helpers/esm/arrayWithHoles.js | 3 + .../runtime/helpers/esm/arrayWithoutHoles.js | 4 + .../helpers/esm/assertThisInitialized.js | 7 + .../helpers/esm/asyncGeneratorDelegate.js | 54 + .../runtime/helpers/esm/asyncIterator.js | 48 + .../runtime/helpers/esm/asyncToGenerator.js | 35 + .../helpers/esm/awaitAsyncGenerator.js | 4 + .../helpers/esm/checkPrivateRedeclaration.js | 5 + .../esm/classApplyDescriptorDestructureSet.js | 20 + .../helpers/esm/classApplyDescriptorGet.js | 7 + .../helpers/esm/classApplyDescriptorSet.js | 11 + .../runtime/helpers/esm/classCallCheck.js | 5 + .../esm/classCheckPrivateStaticAccess.js | 5 + .../classCheckPrivateStaticFieldDescriptor.js | 5 + .../esm/classExtractFieldDescriptor.js | 7 + .../runtime/helpers/esm/classNameTDZError.js | 3 + .../esm/classPrivateFieldDestructureSet.js | 6 + .../helpers/esm/classPrivateFieldGet.js | 6 + .../helpers/esm/classPrivateFieldInitSpec.js | 5 + .../helpers/esm/classPrivateFieldLooseBase.js | 7 + .../helpers/esm/classPrivateFieldLooseKey.js | 4 + .../helpers/esm/classPrivateFieldSet.js | 7 + .../helpers/esm/classPrivateMethodGet.js | 7 + .../helpers/esm/classPrivateMethodInitSpec.js | 5 + .../helpers/esm/classPrivateMethodSet.js | 3 + .../classStaticPrivateFieldDestructureSet.js | 8 + .../esm/classStaticPrivateFieldSpecGet.js | 8 + .../esm/classStaticPrivateFieldSpecSet.js | 9 + .../esm/classStaticPrivateMethodGet.js | 5 + .../esm/classStaticPrivateMethodSet.js | 3 + .../@babel/runtime/helpers/esm/construct.js | 18 + .../@babel/runtime/helpers/esm/createClass.js | 18 + .../helpers/esm/createForOfIteratorHelper.js | 57 + .../esm/createForOfIteratorHelperLoose.js | 21 + .../@babel/runtime/helpers/esm/createSuper.js | 19 + .../@babel/runtime/helpers/esm/decorate.js | 396 ++ .../@babel/runtime/helpers/esm/defaults.js | 14 + .../helpers/esm/defineEnumerableProperties.js | 22 + .../runtime/helpers/esm/defineProperty.js | 14 + .../@babel/runtime/helpers/esm/extends.js | 17 + .../@babel/runtime/helpers/esm/get.js | 20 + .../runtime/helpers/esm/getPrototypeOf.js | 6 + .../@babel/runtime/helpers/esm/identity.js | 3 + .../@babel/runtime/helpers/esm/inherits.js | 18 + .../runtime/helpers/esm/inheritsLoose.js | 6 + .../helpers/esm/initializerDefineProperty.js | 9 + .../helpers/esm/initializerWarningHelper.js | 3 + .../@babel/runtime/helpers/esm/instanceof.js | 7 + .../helpers/esm/interopRequireDefault.js | 5 + .../helpers/esm/interopRequireWildcard.js | 51 + .../runtime/helpers/esm/isNativeFunction.js | 3 + .../helpers/esm/isNativeReflectConstruct.js | 12 + .../runtime/helpers/esm/iterableToArray.js | 3 + .../helpers/esm/iterableToArrayLimit.js | 29 + .../helpers/esm/iterableToArrayLimitLoose.js | 14 + .../@babel/runtime/helpers/esm/jsx.js | 26 + .../runtime/helpers/esm/maybeArrayLike.js | 9 + .../runtime/helpers/esm/newArrowCheck.js | 5 + .../runtime/helpers/esm/nonIterableRest.js | 3 + .../runtime/helpers/esm/nonIterableSpread.js | 3 + .../helpers/esm/objectDestructuringEmpty.js | 3 + .../runtime/helpers/esm/objectSpread.js | 19 + .../runtime/helpers/esm/objectSpread2.js | 27 + .../helpers/esm/objectWithoutProperties.js | 19 + .../esm/objectWithoutPropertiesLoose.js | 14 + .../@babel/runtime/helpers/esm/package.json | 3 + .../helpers/esm/possibleConstructorReturn.js | 11 + .../runtime/helpers/esm/readOnlyError.js | 3 + .../@babel/runtime/helpers/esm/set.js | 51 + .../runtime/helpers/esm/setPrototypeOf.js | 8 + .../helpers/esm/skipFirstGeneratorNext.js | 7 + .../runtime/helpers/esm/slicedToArray.js | 7 + .../runtime/helpers/esm/slicedToArrayLoose.js | 7 + .../runtime/helpers/esm/superPropBase.js | 9 + .../helpers/esm/taggedTemplateLiteral.js | 11 + .../helpers/esm/taggedTemplateLiteralLoose.js | 8 + .../@babel/runtime/helpers/esm/tdz.js | 3 + .../@babel/runtime/helpers/esm/temporalRef.js | 5 + .../runtime/helpers/esm/temporalUndefined.js | 1 + .../@babel/runtime/helpers/esm/toArray.js | 7 + .../runtime/helpers/esm/toConsumableArray.js | 7 + .../@babel/runtime/helpers/esm/toPrimitive.js | 13 + .../runtime/helpers/esm/toPropertyKey.js | 6 + .../@babel/runtime/helpers/esm/typeof.js | 9 + .../helpers/esm/unsupportedIterableToArray.js | 9 + .../runtime/helpers/esm/wrapAsyncGenerator.js | 6 + .../runtime/helpers/esm/wrapNativeSuper.js | 37 + .../@babel/runtime/helpers/esm/wrapRegExp.js | 50 + .../runtime/helpers/esm/writeOnlyError.js | 3 + .../@babel/runtime/helpers/extends.js | 18 + node_modules/@babel/runtime/helpers/get.js | 23 + .../@babel/runtime/helpers/getPrototypeOf.js | 8 + .../@babel/runtime/helpers/identity.js | 5 + .../@babel/runtime/helpers/inherits.js | 21 + .../@babel/runtime/helpers/inheritsLoose.js | 9 + .../helpers/initializerDefineProperty.js | 11 + .../helpers/initializerWarningHelper.js | 5 + .../@babel/runtime/helpers/instanceof.js | 9 + .../runtime/helpers/interopRequireDefault.js | 7 + .../runtime/helpers/interopRequireWildcard.js | 53 + .../runtime/helpers/isNativeFunction.js | 5 + .../helpers/isNativeReflectConstruct.js | 14 + .../@babel/runtime/helpers/iterableToArray.js | 5 + .../runtime/helpers/iterableToArrayLimit.js | 31 + .../helpers/iterableToArrayLimitLoose.js | 16 + node_modules/@babel/runtime/helpers/jsx.js | 29 + .../@babel/runtime/helpers/maybeArrayLike.js | 12 + .../@babel/runtime/helpers/newArrowCheck.js | 7 + .../@babel/runtime/helpers/nonIterableRest.js | 5 + .../runtime/helpers/nonIterableSpread.js | 5 + .../helpers/objectDestructuringEmpty.js | 5 + .../@babel/runtime/helpers/objectSpread.js | 22 + .../@babel/runtime/helpers/objectSpread2.js | 29 + .../helpers/objectWithoutProperties.js | 22 + .../helpers/objectWithoutPropertiesLoose.js | 16 + .../helpers/possibleConstructorReturn.js | 15 + .../@babel/runtime/helpers/readOnlyError.js | 5 + node_modules/@babel/runtime/helpers/set.js | 54 + .../@babel/runtime/helpers/setPrototypeOf.js | 9 + .../runtime/helpers/skipFirstGeneratorNext.js | 9 + .../@babel/runtime/helpers/slicedToArray.js | 13 + .../runtime/helpers/slicedToArrayLoose.js | 13 + .../@babel/runtime/helpers/superPropBase.js | 12 + .../runtime/helpers/taggedTemplateLiteral.js | 13 + .../helpers/taggedTemplateLiteralLoose.js | 10 + node_modules/@babel/runtime/helpers/tdz.js | 5 + .../@babel/runtime/helpers/temporalRef.js | 9 + .../runtime/helpers/temporalUndefined.js | 3 + .../@babel/runtime/helpers/toArray.js | 13 + .../runtime/helpers/toConsumableArray.js | 13 + .../@babel/runtime/helpers/toPrimitive.js | 16 + .../@babel/runtime/helpers/toPropertyKey.js | 10 + node_modules/@babel/runtime/helpers/typeof.js | 11 + .../helpers/unsupportedIterableToArray.js | 12 + .../runtime/helpers/wrapAsyncGenerator.js | 9 + .../@babel/runtime/helpers/wrapNativeSuper.js | 42 + .../@babel/runtime/helpers/wrapRegExp.js | 55 + .../@babel/runtime/helpers/writeOnlyError.js | 5 + node_modules/@babel/runtime/package.json | 866 ++++ .../@babel/runtime/regenerator/index.js | 1 + node_modules/@types/js-yaml/LICENSE | 21 + node_modules/@types/js-yaml/README.md | 16 + node_modules/@types/js-yaml/index.d.mts | 2 + node_modules/@types/js-yaml/index.d.ts | 154 + node_modules/@types/js-yaml/package.json | 53 + node_modules/argparse/CHANGELOG.md | 216 + node_modules/argparse/LICENSE | 254 ++ node_modules/argparse/README.md | 84 + node_modules/argparse/argparse.js | 3707 ++++++++++++++++ node_modules/argparse/lib/sub.js | 67 + node_modules/argparse/lib/textwrap.js | 440 ++ node_modules/argparse/package.json | 31 + node_modules/axios-retry/CHANGELOG.md | 152 + node_modules/axios-retry/LICENSE | 13 + node_modules/axios-retry/README.md | 84 + node_modules/axios-retry/es/index.mjs | 249 ++ node_modules/axios-retry/index.d.ts | 66 + node_modules/axios-retry/index.js | 4 + node_modules/axios-retry/lib/cjs/index.js | 339 ++ node_modules/axios-retry/lib/cjs/index.js.map | 1 + node_modules/axios-retry/lib/cjs/package.json | 3 + node_modules/axios-retry/lib/esm/index.js | 270 ++ node_modules/axios-retry/lib/esm/index.js.map | 1 + node_modules/axios-retry/lib/esm/package.json | 3 + node_modules/axios-retry/package.json | 72 + node_modules/axios/CHANGELOG.md | 501 ++- node_modules/axios/README.md | 250 +- node_modules/axios/SECURITY.md | 5 + node_modules/axios/UPGRADE_GUIDE.md | 8 +- node_modules/axios/dist/axios.js | 3716 +++++++++------- node_modules/axios/dist/axios.map | 2 +- node_modules/axios/dist/axios.min.js | 3 +- node_modules/axios/dist/axios.min.map | 2 +- node_modules/axios/index.d.ts | 146 +- node_modules/axios/lib/adapters/http.js | 217 +- node_modules/axios/lib/adapters/xhr.js | 106 +- node_modules/axios/lib/axios.js | 14 +- node_modules/axios/lib/cancel/CancelToken.js | 62 + node_modules/axios/lib/core/Axios.js | 84 +- .../axios/lib/core/InterceptorManager.js | 6 +- node_modules/axios/lib/core/README.md | 1 + .../axios/lib/core/dispatchRequest.js | 14 +- node_modules/axios/lib/core/enhanceError.js | 5 +- node_modules/axios/lib/core/mergeConfig.js | 116 +- node_modules/axios/lib/core/settle.js | 2 +- node_modules/axios/lib/core/transformData.js | 4 +- .../lib/{defaults.js => defaults/index.js} | 66 +- .../axios/lib/defaults/transitional.js | 7 + node_modules/axios/lib/env/README.md | 3 + node_modules/axios/lib/env/data.js | 3 + node_modules/axios/lib/helpers/buildURL.js | 1 - .../axios/lib/helpers/isAbsoluteURL.js | 2 +- .../axios/lib/helpers/isAxiosError.js | 13 + node_modules/axios/lib/helpers/toFormData.js | 55 + node_modules/axios/lib/helpers/validator.js | 82 + node_modules/axios/lib/utils.js | 77 +- node_modules/axios/package.json | 170 +- node_modules/axios/tsconfig.json | 14 + node_modules/axios/tslint.json | 6 + node_modules/debug/.coveralls.yml | 1 - node_modules/debug/.eslintrc | 14 - node_modules/debug/.npmignore | 9 - node_modules/debug/.travis.yml | 20 - node_modules/debug/CHANGELOG.md | 395 -- node_modules/debug/LICENSE | 19 - node_modules/debug/Makefile | 58 - node_modules/debug/README.md | 368 -- node_modules/debug/karma.conf.js | 70 - node_modules/debug/node.js | 1 - node_modules/debug/package.json | 85 - node_modules/debug/src/browser.js | 195 - node_modules/debug/src/debug.js | 225 - node_modules/debug/src/index.js | 10 - node_modules/debug/src/node.js | 186 - node_modules/follow-redirects/README.md | 83 +- node_modules/follow-redirects/debug.js | 15 + node_modules/follow-redirects/index.js | 494 ++- node_modules/follow-redirects/package.json | 124 +- node_modules/is-retry-allowed/index.d.ts | 22 + node_modules/is-retry-allowed/index.js | 39 + node_modules/is-retry-allowed/license | 10 + node_modules/is-retry-allowed/package.json | 40 + node_modules/is-retry-allowed/readme.md | 46 + node_modules/js-yaml/CHANGELOG.md | 616 +++ node_modules/js-yaml/LICENSE | 21 + node_modules/js-yaml/README.md | 246 ++ node_modules/js-yaml/bin/js-yaml.js | 126 + node_modules/js-yaml/dist/js-yaml.js | 3874 +++++++++++++++++ node_modules/js-yaml/dist/js-yaml.min.js | 2 + node_modules/js-yaml/dist/js-yaml.mjs | 3851 ++++++++++++++++ node_modules/js-yaml/index.js | 47 + node_modules/js-yaml/lib/common.js | 59 + node_modules/js-yaml/lib/dumper.js | 965 ++++ node_modules/js-yaml/lib/exception.js | 55 + node_modules/js-yaml/lib/loader.js | 1727 ++++++++ node_modules/js-yaml/lib/schema.js | 121 + node_modules/js-yaml/lib/schema/core.js | 11 + node_modules/js-yaml/lib/schema/default.js | 22 + node_modules/js-yaml/lib/schema/failsafe.js | 17 + node_modules/js-yaml/lib/schema/json.js | 19 + node_modules/js-yaml/lib/snippet.js | 101 + node_modules/js-yaml/lib/type.js | 66 + node_modules/js-yaml/lib/type/binary.js | 125 + node_modules/js-yaml/lib/type/bool.js | 35 + node_modules/js-yaml/lib/type/float.js | 97 + node_modules/js-yaml/lib/type/int.js | 156 + node_modules/js-yaml/lib/type/map.js | 8 + node_modules/js-yaml/lib/type/merge.js | 12 + node_modules/js-yaml/lib/type/null.js | 35 + node_modules/js-yaml/lib/type/omap.js | 44 + node_modules/js-yaml/lib/type/pairs.js | 53 + node_modules/js-yaml/lib/type/seq.js | 8 + node_modules/js-yaml/lib/type/set.js | 29 + node_modules/js-yaml/lib/type/str.js | 8 + node_modules/js-yaml/lib/type/timestamp.js | 88 + node_modules/js-yaml/package.json | 66 + node_modules/ms/index.js | 152 - node_modules/ms/package.json | 72 - node_modules/ms/readme.md | 51 - .../LICENSE} | 4 +- node_modules/regenerator-runtime/README.md | 31 + node_modules/regenerator-runtime/package.json | 19 + node_modules/regenerator-runtime/path.js | 11 + node_modules/regenerator-runtime/runtime.js | 754 ++++ node_modules/retry-axios/LICENSE | 202 + node_modules/retry-axios/README.md | 170 + node_modules/retry-axios/dist/index.js | 2 + node_modules/retry-axios/dist/index.js.map | 1 + node_modules/retry-axios/dist/index.module.js | 2 + .../retry-axios/dist/index.module.js.map | 1 + node_modules/retry-axios/dist/index.umd.js | 2 + .../retry-axios/dist/index.umd.js.map | 1 + node_modules/retry-axios/dist/src/index.d.ts | 91 + node_modules/retry-axios/dist/test/index.d.ts | 1 + node_modules/retry-axios/package.json | 68 + node_modules/tunnel/.idea/encodings.xml | 6 + node_modules/tunnel/.idea/modules.xml | 8 + node_modules/tunnel/.idea/node-tunnel.iml | 12 + node_modules/tunnel/.idea/vcs.xml | 6 + node_modules/tunnel/.idea/workspace.xml | 797 ++++ node_modules/tunnel/.travis.yml | 6 + node_modules/tunnel/CHANGELOG.md | 22 + node_modules/tunnel/LICENSE | 21 + node_modules/tunnel/README.md | 185 + node_modules/tunnel/index.js | 1 + node_modules/tunnel/lib/tunnel.js | 264 ++ node_modules/tunnel/package.json | 34 + package-lock.json | 246 +- package.json | 10 +- src/index.ts | 50 +- src/output.ts | 29 +- src/requestconf.ts | 190 +- src/util.ts | 109 +- 387 files changed, 33710 insertions(+), 4612 deletions(-) create mode 120000 node_modules/.bin/js-yaml create mode 100644 node_modules/.package-lock.json create mode 100644 node_modules/@actions/core/LICENSE.md create mode 100644 node_modules/@actions/core/lib/file-command.d.ts create mode 100644 node_modules/@actions/core/lib/file-command.js create mode 100644 node_modules/@actions/core/lib/file-command.js.map create mode 100644 node_modules/@actions/core/lib/oidc-utils.d.ts create mode 100644 node_modules/@actions/core/lib/oidc-utils.js create mode 100644 node_modules/@actions/core/lib/oidc-utils.js.map create mode 100644 node_modules/@actions/core/lib/utils.d.ts create mode 100644 node_modules/@actions/core/lib/utils.js create mode 100644 node_modules/@actions/core/lib/utils.js.map create mode 100644 node_modules/@actions/http-client/LICENSE create mode 100644 node_modules/@actions/http-client/README.md create mode 100644 node_modules/@actions/http-client/RELEASES.md create mode 100644 node_modules/@actions/http-client/actions.png create mode 100644 node_modules/@actions/http-client/auth.d.ts create mode 100644 node_modules/@actions/http-client/auth.js create mode 100644 node_modules/@actions/http-client/index.d.ts create mode 100644 node_modules/@actions/http-client/index.js create mode 100644 node_modules/@actions/http-client/interfaces.d.ts create mode 100644 node_modules/@actions/http-client/interfaces.js create mode 100644 node_modules/@actions/http-client/package.json create mode 100644 node_modules/@actions/http-client/proxy.d.ts create mode 100644 node_modules/@actions/http-client/proxy.js create mode 100644 node_modules/@babel/runtime/LICENSE create mode 100644 node_modules/@babel/runtime/README.md create mode 100644 node_modules/@babel/runtime/helpers/AsyncGenerator.js create mode 100644 node_modules/@babel/runtime/helpers/AwaitValue.js create mode 100644 node_modules/@babel/runtime/helpers/applyDecoratedDescriptor.js create mode 100644 node_modules/@babel/runtime/helpers/applyDecs.js create mode 100644 node_modules/@babel/runtime/helpers/arrayLikeToArray.js create mode 100644 node_modules/@babel/runtime/helpers/arrayWithHoles.js create mode 100644 node_modules/@babel/runtime/helpers/arrayWithoutHoles.js create mode 100644 node_modules/@babel/runtime/helpers/assertThisInitialized.js create mode 100644 node_modules/@babel/runtime/helpers/asyncGeneratorDelegate.js create mode 100644 node_modules/@babel/runtime/helpers/asyncIterator.js create mode 100644 node_modules/@babel/runtime/helpers/asyncToGenerator.js create mode 100644 node_modules/@babel/runtime/helpers/awaitAsyncGenerator.js create mode 100644 node_modules/@babel/runtime/helpers/checkPrivateRedeclaration.js create mode 100644 node_modules/@babel/runtime/helpers/classApplyDescriptorDestructureSet.js create mode 100644 node_modules/@babel/runtime/helpers/classApplyDescriptorGet.js create mode 100644 node_modules/@babel/runtime/helpers/classApplyDescriptorSet.js create mode 100644 node_modules/@babel/runtime/helpers/classCallCheck.js create mode 100644 node_modules/@babel/runtime/helpers/classCheckPrivateStaticAccess.js create mode 100644 node_modules/@babel/runtime/helpers/classCheckPrivateStaticFieldDescriptor.js create mode 100644 node_modules/@babel/runtime/helpers/classExtractFieldDescriptor.js create mode 100644 node_modules/@babel/runtime/helpers/classNameTDZError.js create mode 100644 node_modules/@babel/runtime/helpers/classPrivateFieldDestructureSet.js create mode 100644 node_modules/@babel/runtime/helpers/classPrivateFieldGet.js create mode 100644 node_modules/@babel/runtime/helpers/classPrivateFieldInitSpec.js create mode 100644 node_modules/@babel/runtime/helpers/classPrivateFieldLooseBase.js create mode 100644 node_modules/@babel/runtime/helpers/classPrivateFieldLooseKey.js create mode 100644 node_modules/@babel/runtime/helpers/classPrivateFieldSet.js create mode 100644 node_modules/@babel/runtime/helpers/classPrivateMethodGet.js create mode 100644 node_modules/@babel/runtime/helpers/classPrivateMethodInitSpec.js create mode 100644 node_modules/@babel/runtime/helpers/classPrivateMethodSet.js create mode 100644 node_modules/@babel/runtime/helpers/classStaticPrivateFieldDestructureSet.js create mode 100644 node_modules/@babel/runtime/helpers/classStaticPrivateFieldSpecGet.js create mode 100644 node_modules/@babel/runtime/helpers/classStaticPrivateFieldSpecSet.js create mode 100644 node_modules/@babel/runtime/helpers/classStaticPrivateMethodGet.js create mode 100644 node_modules/@babel/runtime/helpers/classStaticPrivateMethodSet.js create mode 100644 node_modules/@babel/runtime/helpers/construct.js create mode 100644 node_modules/@babel/runtime/helpers/createClass.js create mode 100644 node_modules/@babel/runtime/helpers/createForOfIteratorHelper.js create mode 100644 node_modules/@babel/runtime/helpers/createForOfIteratorHelperLoose.js create mode 100644 node_modules/@babel/runtime/helpers/createSuper.js create mode 100644 node_modules/@babel/runtime/helpers/decorate.js create mode 100644 node_modules/@babel/runtime/helpers/defaults.js create mode 100644 node_modules/@babel/runtime/helpers/defineEnumerableProperties.js create mode 100644 node_modules/@babel/runtime/helpers/defineProperty.js create mode 100644 node_modules/@babel/runtime/helpers/esm/AsyncGenerator.js create mode 100644 node_modules/@babel/runtime/helpers/esm/AwaitValue.js create mode 100644 node_modules/@babel/runtime/helpers/esm/applyDecoratedDescriptor.js create mode 100644 node_modules/@babel/runtime/helpers/esm/applyDecs.js create mode 100644 node_modules/@babel/runtime/helpers/esm/arrayLikeToArray.js create mode 100644 node_modules/@babel/runtime/helpers/esm/arrayWithHoles.js create mode 100644 node_modules/@babel/runtime/helpers/esm/arrayWithoutHoles.js create mode 100644 node_modules/@babel/runtime/helpers/esm/assertThisInitialized.js create mode 100644 node_modules/@babel/runtime/helpers/esm/asyncGeneratorDelegate.js create mode 100644 node_modules/@babel/runtime/helpers/esm/asyncIterator.js create mode 100644 node_modules/@babel/runtime/helpers/esm/asyncToGenerator.js create mode 100644 node_modules/@babel/runtime/helpers/esm/awaitAsyncGenerator.js create mode 100644 node_modules/@babel/runtime/helpers/esm/checkPrivateRedeclaration.js create mode 100644 node_modules/@babel/runtime/helpers/esm/classApplyDescriptorDestructureSet.js create mode 100644 node_modules/@babel/runtime/helpers/esm/classApplyDescriptorGet.js create mode 100644 node_modules/@babel/runtime/helpers/esm/classApplyDescriptorSet.js create mode 100644 node_modules/@babel/runtime/helpers/esm/classCallCheck.js create mode 100644 node_modules/@babel/runtime/helpers/esm/classCheckPrivateStaticAccess.js create mode 100644 node_modules/@babel/runtime/helpers/esm/classCheckPrivateStaticFieldDescriptor.js create mode 100644 node_modules/@babel/runtime/helpers/esm/classExtractFieldDescriptor.js create mode 100644 node_modules/@babel/runtime/helpers/esm/classNameTDZError.js create mode 100644 node_modules/@babel/runtime/helpers/esm/classPrivateFieldDestructureSet.js create mode 100644 node_modules/@babel/runtime/helpers/esm/classPrivateFieldGet.js create mode 100644 node_modules/@babel/runtime/helpers/esm/classPrivateFieldInitSpec.js create mode 100644 node_modules/@babel/runtime/helpers/esm/classPrivateFieldLooseBase.js create mode 100644 node_modules/@babel/runtime/helpers/esm/classPrivateFieldLooseKey.js create mode 100644 node_modules/@babel/runtime/helpers/esm/classPrivateFieldSet.js create mode 100644 node_modules/@babel/runtime/helpers/esm/classPrivateMethodGet.js create mode 100644 node_modules/@babel/runtime/helpers/esm/classPrivateMethodInitSpec.js create mode 100644 node_modules/@babel/runtime/helpers/esm/classPrivateMethodSet.js create mode 100644 node_modules/@babel/runtime/helpers/esm/classStaticPrivateFieldDestructureSet.js create mode 100644 node_modules/@babel/runtime/helpers/esm/classStaticPrivateFieldSpecGet.js create mode 100644 node_modules/@babel/runtime/helpers/esm/classStaticPrivateFieldSpecSet.js create mode 100644 node_modules/@babel/runtime/helpers/esm/classStaticPrivateMethodGet.js create mode 100644 node_modules/@babel/runtime/helpers/esm/classStaticPrivateMethodSet.js create mode 100644 node_modules/@babel/runtime/helpers/esm/construct.js create mode 100644 node_modules/@babel/runtime/helpers/esm/createClass.js create mode 100644 node_modules/@babel/runtime/helpers/esm/createForOfIteratorHelper.js create mode 100644 node_modules/@babel/runtime/helpers/esm/createForOfIteratorHelperLoose.js create mode 100644 node_modules/@babel/runtime/helpers/esm/createSuper.js create mode 100644 node_modules/@babel/runtime/helpers/esm/decorate.js create mode 100644 node_modules/@babel/runtime/helpers/esm/defaults.js create mode 100644 node_modules/@babel/runtime/helpers/esm/defineEnumerableProperties.js create mode 100644 node_modules/@babel/runtime/helpers/esm/defineProperty.js create mode 100644 node_modules/@babel/runtime/helpers/esm/extends.js create mode 100644 node_modules/@babel/runtime/helpers/esm/get.js create mode 100644 node_modules/@babel/runtime/helpers/esm/getPrototypeOf.js create mode 100644 node_modules/@babel/runtime/helpers/esm/identity.js create mode 100644 node_modules/@babel/runtime/helpers/esm/inherits.js create mode 100644 node_modules/@babel/runtime/helpers/esm/inheritsLoose.js create mode 100644 node_modules/@babel/runtime/helpers/esm/initializerDefineProperty.js create mode 100644 node_modules/@babel/runtime/helpers/esm/initializerWarningHelper.js create mode 100644 node_modules/@babel/runtime/helpers/esm/instanceof.js create mode 100644 node_modules/@babel/runtime/helpers/esm/interopRequireDefault.js create mode 100644 node_modules/@babel/runtime/helpers/esm/interopRequireWildcard.js create mode 100644 node_modules/@babel/runtime/helpers/esm/isNativeFunction.js create mode 100644 node_modules/@babel/runtime/helpers/esm/isNativeReflectConstruct.js create mode 100644 node_modules/@babel/runtime/helpers/esm/iterableToArray.js create mode 100644 node_modules/@babel/runtime/helpers/esm/iterableToArrayLimit.js create mode 100644 node_modules/@babel/runtime/helpers/esm/iterableToArrayLimitLoose.js create mode 100644 node_modules/@babel/runtime/helpers/esm/jsx.js create mode 100644 node_modules/@babel/runtime/helpers/esm/maybeArrayLike.js create mode 100644 node_modules/@babel/runtime/helpers/esm/newArrowCheck.js create mode 100644 node_modules/@babel/runtime/helpers/esm/nonIterableRest.js create mode 100644 node_modules/@babel/runtime/helpers/esm/nonIterableSpread.js create mode 100644 node_modules/@babel/runtime/helpers/esm/objectDestructuringEmpty.js create mode 100644 node_modules/@babel/runtime/helpers/esm/objectSpread.js create mode 100644 node_modules/@babel/runtime/helpers/esm/objectSpread2.js create mode 100644 node_modules/@babel/runtime/helpers/esm/objectWithoutProperties.js create mode 100644 node_modules/@babel/runtime/helpers/esm/objectWithoutPropertiesLoose.js create mode 100644 node_modules/@babel/runtime/helpers/esm/package.json create mode 100644 node_modules/@babel/runtime/helpers/esm/possibleConstructorReturn.js create mode 100644 node_modules/@babel/runtime/helpers/esm/readOnlyError.js create mode 100644 node_modules/@babel/runtime/helpers/esm/set.js create mode 100644 node_modules/@babel/runtime/helpers/esm/setPrototypeOf.js create mode 100644 node_modules/@babel/runtime/helpers/esm/skipFirstGeneratorNext.js create mode 100644 node_modules/@babel/runtime/helpers/esm/slicedToArray.js create mode 100644 node_modules/@babel/runtime/helpers/esm/slicedToArrayLoose.js create mode 100644 node_modules/@babel/runtime/helpers/esm/superPropBase.js create mode 100644 node_modules/@babel/runtime/helpers/esm/taggedTemplateLiteral.js create mode 100644 node_modules/@babel/runtime/helpers/esm/taggedTemplateLiteralLoose.js create mode 100644 node_modules/@babel/runtime/helpers/esm/tdz.js create mode 100644 node_modules/@babel/runtime/helpers/esm/temporalRef.js create mode 100644 node_modules/@babel/runtime/helpers/esm/temporalUndefined.js create mode 100644 node_modules/@babel/runtime/helpers/esm/toArray.js create mode 100644 node_modules/@babel/runtime/helpers/esm/toConsumableArray.js create mode 100644 node_modules/@babel/runtime/helpers/esm/toPrimitive.js create mode 100644 node_modules/@babel/runtime/helpers/esm/toPropertyKey.js create mode 100644 node_modules/@babel/runtime/helpers/esm/typeof.js create mode 100644 node_modules/@babel/runtime/helpers/esm/unsupportedIterableToArray.js create mode 100644 node_modules/@babel/runtime/helpers/esm/wrapAsyncGenerator.js create mode 100644 node_modules/@babel/runtime/helpers/esm/wrapNativeSuper.js create mode 100644 node_modules/@babel/runtime/helpers/esm/wrapRegExp.js create mode 100644 node_modules/@babel/runtime/helpers/esm/writeOnlyError.js create mode 100644 node_modules/@babel/runtime/helpers/extends.js create mode 100644 node_modules/@babel/runtime/helpers/get.js create mode 100644 node_modules/@babel/runtime/helpers/getPrototypeOf.js create mode 100644 node_modules/@babel/runtime/helpers/identity.js create mode 100644 node_modules/@babel/runtime/helpers/inherits.js create mode 100644 node_modules/@babel/runtime/helpers/inheritsLoose.js create mode 100644 node_modules/@babel/runtime/helpers/initializerDefineProperty.js create mode 100644 node_modules/@babel/runtime/helpers/initializerWarningHelper.js create mode 100644 node_modules/@babel/runtime/helpers/instanceof.js create mode 100644 node_modules/@babel/runtime/helpers/interopRequireDefault.js create mode 100644 node_modules/@babel/runtime/helpers/interopRequireWildcard.js create mode 100644 node_modules/@babel/runtime/helpers/isNativeFunction.js create mode 100644 node_modules/@babel/runtime/helpers/isNativeReflectConstruct.js create mode 100644 node_modules/@babel/runtime/helpers/iterableToArray.js create mode 100644 node_modules/@babel/runtime/helpers/iterableToArrayLimit.js create mode 100644 node_modules/@babel/runtime/helpers/iterableToArrayLimitLoose.js create mode 100644 node_modules/@babel/runtime/helpers/jsx.js create mode 100644 node_modules/@babel/runtime/helpers/maybeArrayLike.js create mode 100644 node_modules/@babel/runtime/helpers/newArrowCheck.js create mode 100644 node_modules/@babel/runtime/helpers/nonIterableRest.js create mode 100644 node_modules/@babel/runtime/helpers/nonIterableSpread.js create mode 100644 node_modules/@babel/runtime/helpers/objectDestructuringEmpty.js create mode 100644 node_modules/@babel/runtime/helpers/objectSpread.js create mode 100644 node_modules/@babel/runtime/helpers/objectSpread2.js create mode 100644 node_modules/@babel/runtime/helpers/objectWithoutProperties.js create mode 100644 node_modules/@babel/runtime/helpers/objectWithoutPropertiesLoose.js create mode 100644 node_modules/@babel/runtime/helpers/possibleConstructorReturn.js create mode 100644 node_modules/@babel/runtime/helpers/readOnlyError.js create mode 100644 node_modules/@babel/runtime/helpers/set.js create mode 100644 node_modules/@babel/runtime/helpers/setPrototypeOf.js create mode 100644 node_modules/@babel/runtime/helpers/skipFirstGeneratorNext.js create mode 100644 node_modules/@babel/runtime/helpers/slicedToArray.js create mode 100644 node_modules/@babel/runtime/helpers/slicedToArrayLoose.js create mode 100644 node_modules/@babel/runtime/helpers/superPropBase.js create mode 100644 node_modules/@babel/runtime/helpers/taggedTemplateLiteral.js create mode 100644 node_modules/@babel/runtime/helpers/taggedTemplateLiteralLoose.js create mode 100644 node_modules/@babel/runtime/helpers/tdz.js create mode 100644 node_modules/@babel/runtime/helpers/temporalRef.js create mode 100644 node_modules/@babel/runtime/helpers/temporalUndefined.js create mode 100644 node_modules/@babel/runtime/helpers/toArray.js create mode 100644 node_modules/@babel/runtime/helpers/toConsumableArray.js create mode 100644 node_modules/@babel/runtime/helpers/toPrimitive.js create mode 100644 node_modules/@babel/runtime/helpers/toPropertyKey.js create mode 100644 node_modules/@babel/runtime/helpers/typeof.js create mode 100644 node_modules/@babel/runtime/helpers/unsupportedIterableToArray.js create mode 100644 node_modules/@babel/runtime/helpers/wrapAsyncGenerator.js create mode 100644 node_modules/@babel/runtime/helpers/wrapNativeSuper.js create mode 100644 node_modules/@babel/runtime/helpers/wrapRegExp.js create mode 100644 node_modules/@babel/runtime/helpers/writeOnlyError.js create mode 100644 node_modules/@babel/runtime/package.json create mode 100644 node_modules/@babel/runtime/regenerator/index.js create mode 100755 node_modules/@types/js-yaml/LICENSE create mode 100755 node_modules/@types/js-yaml/README.md create mode 100755 node_modules/@types/js-yaml/index.d.mts create mode 100755 node_modules/@types/js-yaml/index.d.ts create mode 100755 node_modules/@types/js-yaml/package.json create mode 100644 node_modules/argparse/CHANGELOG.md create mode 100644 node_modules/argparse/LICENSE create mode 100644 node_modules/argparse/README.md create mode 100644 node_modules/argparse/argparse.js create mode 100644 node_modules/argparse/lib/sub.js create mode 100644 node_modules/argparse/lib/textwrap.js create mode 100644 node_modules/argparse/package.json create mode 100644 node_modules/axios-retry/CHANGELOG.md create mode 100644 node_modules/axios-retry/LICENSE create mode 100644 node_modules/axios-retry/README.md create mode 100644 node_modules/axios-retry/es/index.mjs create mode 100644 node_modules/axios-retry/index.d.ts create mode 100644 node_modules/axios-retry/index.js create mode 100644 node_modules/axios-retry/lib/cjs/index.js create mode 100644 node_modules/axios-retry/lib/cjs/index.js.map create mode 100644 node_modules/axios-retry/lib/cjs/package.json create mode 100644 node_modules/axios-retry/lib/esm/index.js create mode 100644 node_modules/axios-retry/lib/esm/index.js.map create mode 100644 node_modules/axios-retry/lib/esm/package.json create mode 100644 node_modules/axios-retry/package.json create mode 100644 node_modules/axios/SECURITY.md rename node_modules/axios/lib/{defaults.js => defaults/index.js} (55%) create mode 100644 node_modules/axios/lib/defaults/transitional.js create mode 100644 node_modules/axios/lib/env/README.md create mode 100644 node_modules/axios/lib/env/data.js create mode 100644 node_modules/axios/lib/helpers/isAxiosError.js create mode 100644 node_modules/axios/lib/helpers/toFormData.js create mode 100644 node_modules/axios/lib/helpers/validator.js create mode 100644 node_modules/axios/tsconfig.json create mode 100644 node_modules/axios/tslint.json delete mode 100644 node_modules/debug/.coveralls.yml delete mode 100644 node_modules/debug/.eslintrc delete mode 100644 node_modules/debug/.npmignore delete mode 100644 node_modules/debug/.travis.yml delete mode 100644 node_modules/debug/CHANGELOG.md delete mode 100644 node_modules/debug/LICENSE delete mode 100644 node_modules/debug/Makefile delete mode 100644 node_modules/debug/README.md delete mode 100644 node_modules/debug/karma.conf.js delete mode 100644 node_modules/debug/node.js delete mode 100644 node_modules/debug/package.json delete mode 100644 node_modules/debug/src/browser.js delete mode 100644 node_modules/debug/src/debug.js delete mode 100644 node_modules/debug/src/index.js delete mode 100644 node_modules/debug/src/node.js create mode 100644 node_modules/follow-redirects/debug.js create mode 100644 node_modules/is-retry-allowed/index.d.ts create mode 100644 node_modules/is-retry-allowed/index.js create mode 100644 node_modules/is-retry-allowed/license create mode 100644 node_modules/is-retry-allowed/package.json create mode 100644 node_modules/is-retry-allowed/readme.md create mode 100644 node_modules/js-yaml/CHANGELOG.md create mode 100644 node_modules/js-yaml/LICENSE create mode 100644 node_modules/js-yaml/README.md create mode 100755 node_modules/js-yaml/bin/js-yaml.js create mode 100644 node_modules/js-yaml/dist/js-yaml.js create mode 100644 node_modules/js-yaml/dist/js-yaml.min.js create mode 100644 node_modules/js-yaml/dist/js-yaml.mjs create mode 100644 node_modules/js-yaml/index.js create mode 100644 node_modules/js-yaml/lib/common.js create mode 100644 node_modules/js-yaml/lib/dumper.js create mode 100644 node_modules/js-yaml/lib/exception.js create mode 100644 node_modules/js-yaml/lib/loader.js create mode 100644 node_modules/js-yaml/lib/schema.js create mode 100644 node_modules/js-yaml/lib/schema/core.js create mode 100644 node_modules/js-yaml/lib/schema/default.js create mode 100644 node_modules/js-yaml/lib/schema/failsafe.js create mode 100644 node_modules/js-yaml/lib/schema/json.js create mode 100644 node_modules/js-yaml/lib/snippet.js create mode 100644 node_modules/js-yaml/lib/type.js create mode 100644 node_modules/js-yaml/lib/type/binary.js create mode 100644 node_modules/js-yaml/lib/type/bool.js create mode 100644 node_modules/js-yaml/lib/type/float.js create mode 100644 node_modules/js-yaml/lib/type/int.js create mode 100644 node_modules/js-yaml/lib/type/map.js create mode 100644 node_modules/js-yaml/lib/type/merge.js create mode 100644 node_modules/js-yaml/lib/type/null.js create mode 100644 node_modules/js-yaml/lib/type/omap.js create mode 100644 node_modules/js-yaml/lib/type/pairs.js create mode 100644 node_modules/js-yaml/lib/type/seq.js create mode 100644 node_modules/js-yaml/lib/type/set.js create mode 100644 node_modules/js-yaml/lib/type/str.js create mode 100644 node_modules/js-yaml/lib/type/timestamp.js create mode 100644 node_modules/js-yaml/package.json delete mode 100644 node_modules/ms/index.js delete mode 100644 node_modules/ms/package.json delete mode 100644 node_modules/ms/readme.md rename node_modules/{ms/license.md => regenerator-runtime/LICENSE} (94%) create mode 100644 node_modules/regenerator-runtime/README.md create mode 100644 node_modules/regenerator-runtime/package.json create mode 100644 node_modules/regenerator-runtime/path.js create mode 100644 node_modules/regenerator-runtime/runtime.js create mode 100644 node_modules/retry-axios/LICENSE create mode 100644 node_modules/retry-axios/README.md create mode 100644 node_modules/retry-axios/dist/index.js create mode 100644 node_modules/retry-axios/dist/index.js.map create mode 100644 node_modules/retry-axios/dist/index.module.js create mode 100644 node_modules/retry-axios/dist/index.module.js.map create mode 100644 node_modules/retry-axios/dist/index.umd.js create mode 100644 node_modules/retry-axios/dist/index.umd.js.map create mode 100644 node_modules/retry-axios/dist/src/index.d.ts create mode 100644 node_modules/retry-axios/dist/test/index.d.ts create mode 100644 node_modules/retry-axios/package.json create mode 100644 node_modules/tunnel/.idea/encodings.xml create mode 100644 node_modules/tunnel/.idea/modules.xml create mode 100644 node_modules/tunnel/.idea/node-tunnel.iml create mode 100644 node_modules/tunnel/.idea/vcs.xml create mode 100644 node_modules/tunnel/.idea/workspace.xml create mode 100644 node_modules/tunnel/.travis.yml create mode 100644 node_modules/tunnel/CHANGELOG.md create mode 100644 node_modules/tunnel/LICENSE create mode 100644 node_modules/tunnel/README.md create mode 100644 node_modules/tunnel/index.js create mode 100644 node_modules/tunnel/lib/tunnel.js create mode 100644 node_modules/tunnel/package.json diff --git a/README.md b/README.md index 372989f..4e2b503 100644 --- a/README.md +++ b/README.md @@ -1,79 +1,83 @@ # cURL for Github Action -You can use this action to perform REST API base on [axios](https://github.com/axios/axios) module. - +You can use this action to perform REST API base on [axios](https://github.com/axios/axios) module. # Usage + ```yaml name: Example of cURL action -on: [ push ] +on: [push] jobs: - test-curl-action: - name: 'Perform REST API' - runs-on: ubuntu-latest - steps: - - name: 'Call API' - uses: indiesdev/curl@v1 - with: - # The target URL - # Required: true if custom-config is not set - url: https://reqres.in/api/users - - # The request method, basically it's one of GET|POST|PUT|PATCH - # Default is GET - method: 'POST' + test-curl-action: + name: "Perform REST API" + runs-on: ubuntu-latest + steps: + - name: "Call API" + uses: indiesdev/curl@v1.1 + with: + # The target URL + # Required: true if custom-config is not set + url: https://reqres.in/api/users - # List of response status codes to be accepted, else it will set the job to be failed - # If more than one value is needed, you can use comma(,) as seperator - # In this case if the response status code is not one of 200, 201 and 204, the job will be failed - # Default is 200,201,204 - accept: 200,201,204 + # The request method, basically it's one of GET|POST|PUT|PATCH + # Default is GET + method: "POST" - # Headers can be passed through json object string - headers: '{ "custom-header": "value" }' + # List of response status codes to be accepted, else it will set the job to be failed + # If more than one value is needed, you can use comma(,) as seperator + # In this case if the response status code is not one of 200, 201 and 204, the job will be failed + # Default is 200,201,204 + accept: 200,201,204 - # Params can be passed through json object string - params: '{ "param1": "value", "param2": "value2" }' - - # Body request - # Apply only to POST|PUT request - body: '{ "name": "breeze", "job": "devops" }' + # Headers can be passed through json object string + headers: '{ "custom-header": "value" }' - # Request timeout (millisec) - # Default: 1000 - timeout: 1000 - - # Basic authentication using username and password - # This will override the Authorization header, for example Authorization: Basic QWxhZGRpbjpPcGVuU2VzYW1l - # Format => username:password - basic-auth: ${{ secrets.curl_auth_username }}:${{ secrets.curl_auth_password }} - - # The authentication using token - # This will override the Authorization header, for example Authorization: Bearer QWxhZGRpbjpPcGVuU2VzYW1l - bearer-token: ${{ secrets.bearer_token }} + # Params can be passed through json object string + params: '{ "param1": "value", "param2": "value2" }' - # If you want to use proxy with the request, you can use proxy-url - # Format => host:port - proxy-url: https://proxy-url:3000 + # Body request + # Apply only to POST|PUT request + body: '{ "name": "breeze", "job": "devops" }' - # If the proxy host requires the authentication, you can use proxy-auth to pass credentials - # Format => username:password - proxy-auth: ${{ secrets.proxy_auth_username }}:${{ secrets.proxy_auth_password }} + # Request timeout (millisec) + # Default: 1000 + timeout: 1000 - # If it is set to true, it will show the response log in the Github UI - # Default: false - is_debug: false + # Basic authentication using username and password + # This will override the Authorization header, for example Authorization: Basic QWxhZGRpbjpPcGVuU2VzYW1l + # Format => username:password as base 64 + basic-auth-token: ${{ secrets.curl_auth_token }} - # If you want to use axios config directly, you can pass config file to the action - # The file is just basically a json file that has the same format as axios config https://github.com/axios/axios#request-config - # If this input is set, it will ignore other inputs that related to the config - # The path file is start from root directory of the repo - custom-config: .github/workflows/curl-config.json - - ``` + # The authentication using token + # This will override the Authorization header, for example Authorization: Bearer QWxhZGRpbjpPcGVuU2VzYW1l + bearer-token: ${{ secrets.bearer_token }} + + # If you want to use proxy with the request, you can use proxy-url + # Format => host:port + proxy-url: https://proxy-url:3000 + + # If the proxy host requires the authentication, you can use proxy-auth to pass credentials + # Format => username:password as base64 + proxy-auth-token: ${{ secrets.proxy_auth_token }} + + # If it is set to true, it will show the response log in the Github UI + # Default: false + log-response: false + + # Retries specify the number of retry attemps before giving up. + # Default: 1 + retries: 3 + + # If you want to use axios config directly, you can pass config file to the action + # The file is just basically a json file that has the same format as axios config https://github.com/axios/axios#request-config + # If this input is set, it will ignore other inputs that related to the config + # The path file is start from root directory of the repo + custom-config: .github/workflows/curl-config.json +``` # Response object + ```javascript { // `data` is the response that was provided by the server @@ -91,29 +95,37 @@ jobs: ``` +# Use Response -# Use Response ```yaml name: Example of cURL action -on: [ push ] +on: [push] jobs: - test-curl-action: - name: 'Perform REST API' - runs-on: ubuntu-latest - steps: - - name: 'Call API' - uses: indiesdev/curl@v1 - id: api - with: - url: https://reqres.in/api/users - method: 'POST' - accept: 201 - body: '{ "name": "breeze", "job": "devops" }' - - name: 'Use response' - run: echo ${{ steps.api.outputs.response }} - - - ``` - - + test-curl-action: + name: "Perform REST API" + runs-on: ubuntu-latest + steps: + - name: "Call API 1" + uses: indiesdev/curl@v1.1 + id: api + with: + url: https://reqres.in/api/users + method: "POST" + accept: 201 + body: '{ "name": "breeze", "job": "devops" }' + log-response: true + - name: "Call API 2" + uses: indiesdev/curl@v1.1 + id: api2 + with: + url: https://reqres.in/api/users + method: "POST" + accept: 201 + body: | + name: breeze + job: devops + log-response: true + - name: "Use response" + run: echo ${{ steps.api.outputs.response }} +``` diff --git a/action.yml b/action.yml index 413034f..daa5608 100644 --- a/action.yml +++ b/action.yml @@ -18,19 +18,20 @@ inputs: timeout: description: 'timeout (millisec)' default: 1000 - basic-auth: - description: 'Basic authentication, format => username:password' + basic-auth-token: + description: 'Basic authentication token, format => username:password as base64' bearer-token: description: 'Bearer Token' proxy-url: description: 'Proxy host, format => host:port' - proxy-auth: - description: 'Proxy authentication, format => username:password' - is_debug: - description: 'show debug message of response' - default: false - retry: - default: 1/1 + proxy-auth-token: + description: 'Proxy authentication token, format => username:password as base64' + log-response: + description: 'Should log the response' + default: 'false' + retries: + description: 'retries number' + default: 1 custom-config: description: custom config diff --git a/dist/index.js b/dist/index.js index 492b134..ab49ef9 100644 --- a/dist/index.js +++ b/dist/index.js @@ -1,36 +1,50 @@ "use strict"; -var __importDefault = (this && this.__importDefault) || function (mod) { - return (mod && mod.__esModule) ? mod : { "default": mod }; -}; +var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + var desc = Object.getOwnPropertyDescriptor(m, k); + if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { + desc = { enumerable: true, get: function() { return m[k]; } }; + } + Object.defineProperty(o, k2, desc); +}) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; +})); +var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) { + Object.defineProperty(o, "default", { enumerable: true, value: v }); +}) : function(o, v) { + o["default"] = v; +}); var __importStar = (this && this.__importStar) || function (mod) { if (mod && mod.__esModule) return mod; var result = {}; - if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k]; - result["default"] = mod; + if (mod != null) for (var k in mod) if (k !== "default" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + __setModuleDefault(result, mod); return result; }; Object.defineProperty(exports, "__esModule", { value: true }); -var requestconf_1 = __importDefault(require("./requestconf")); +var requestconf_1 = __importStar(require("./requestconf")); var core = __importStar(require("@actions/core")); var fs = __importStar(require("fs")); var util_1 = require("./util"); try { - if (core.getInput('custom-config')) { - var configPath = core.getInput('custom-config'); + if (requestconf_1.INPUT_CUSTOM_CONFIG_FILE) { + core.info("Using custom axios config file"); var basePath = process.env.GITHUB_WORKSPACE; - var path = basePath + "/" + configPath; - core.info("Path is " + path); - if (configPath.split('.').pop() !== 'json') { - throw new Error('Config must be json file'); + var path = "".concat(basePath, "/").concat(requestconf_1.INPUT_CUSTOM_CONFIG_FILE); + core.debug("Path is ".concat(path)); + if (requestconf_1.INPUT_CUSTOM_CONFIG_FILE.split(".").pop() !== "json") { + throw new Error("Config must be json file"); } if (!fs.existsSync(path)) { - throw new Error('Config file not found, meybe you need to use action/checkout before this step or there is typo on file name'); + throw new Error("Config file not found, meybe you need to use action/checkout before this step or there is typo on file name"); } var customConfig = JSON.parse(fs.readFileSync(path).toString()); - util_1.sendRequestWithRetry(customConfig); + (0, util_1.sendRequestWithRetry)(customConfig); } else { - util_1.sendRequestWithRetry(requestconf_1.default); + core.info("Using config from action params"); + (0, util_1.sendRequestWithRetry)(requestconf_1.default); } } catch (err) { diff --git a/dist/index.js.map b/dist/index.js.map index 9915314..9bfab95 100644 --- a/dist/index.js.map +++ b/dist/index.js.map @@ -1 +1 @@ -{"version":3,"file":"index.js","sourceRoot":"./src/","sources":["index.ts"],"names":[],"mappings":";;;;;;;;;;;;AAEA,8DAAkC;AAClC,kDAAqC;AACrC,qCAAwB;AACxB,+BAA6C;AAG7C,IAAI;IACA,IAAG,IAAI,CAAC,QAAQ,CAAC,eAAe,CAAC,EAAC;QAC9B,IAAM,UAAU,GAAG,IAAI,CAAC,QAAQ,CAAC,eAAe,CAAC,CAAC;QAClD,IAAM,QAAQ,GAAG,OAAO,CAAC,GAAG,CAAC,gBAAgB,CAAC;QAC9C,IAAM,IAAI,GAAM,QAAQ,SAAI,UAAY,CAAC;QACzC,IAAI,CAAC,IAAI,CAAC,aAAW,IAAM,CAAC,CAAC;QAC7B,IAAG,UAAU,CAAC,KAAK,CAAC,GAAG,CAAC,CAAC,GAAG,EAAE,KAAK,MAAM,EAAC;YACtC,MAAM,IAAI,KAAK,CAAC,0BAA0B,CAAC,CAAA;SAC9C;QACD,IAAG,CAAC,EAAE,CAAC,UAAU,CAAC,IAAI,CAAC,EAAC;YACpB,MAAM,IAAI,KAAK,CAAC,6GAA6G,CAAC,CAAA;SACjI;QACD,IAAI,YAAY,GAAwB,IAAI,CAAC,KAAK,CAAC,EAAE,CAAC,YAAY,CAAC,IAAI,CAAC,CAAC,QAAQ,EAAE,CAAuB,CAAC;QAC3G,2BAAoB,CAAC,YAAY,CAAC,CAAA;KACrC;SAAI;QACD,2BAAoB,CAAC,qBAAM,CAAC,CAAA;KAC/B;CACJ;AAAC,OAAO,GAAG,EAAE;IACV,IAAI,CAAC,SAAS,CAAC,GAAG,CAAC,OAAO,CAAC,CAAC;CAC/B"} \ No newline at end of file +{"version":3,"file":"index.js","sourceRoot":"./src/","sources":["index.ts"],"names":[],"mappings":";;;;;;;;;;;;;;;;;;;;;;;;;AACA,2DAAiE;AACjE,kDAAsC;AACtC,qCAAyB;AACzB,+BAA8C;AAE9C,IAAI;IACF,IAAI,sCAAwB,EAAE;QAC5B,IAAI,CAAC,IAAI,CAAC,gCAAgC,CAAC,CAAC;QAC5C,IAAM,QAAQ,GAAG,OAAO,CAAC,GAAG,CAAC,gBAAgB,CAAC;QAC9C,IAAM,IAAI,GAAG,UAAG,QAAQ,cAAI,sCAAwB,CAAE,CAAC;QACvD,IAAI,CAAC,KAAK,CAAC,kBAAW,IAAI,CAAE,CAAC,CAAC;QAC9B,IAAK,sCAAmC,CAAC,KAAK,CAAC,GAAG,CAAC,CAAC,GAAG,EAAE,KAAK,MAAM,EAAE;YACpE,MAAM,IAAI,KAAK,CAAC,0BAA0B,CAAC,CAAC;SAC7C;QACD,IAAI,CAAC,EAAE,CAAC,UAAU,CAAC,IAAI,CAAC,EAAE;YACxB,MAAM,IAAI,KAAK,CACb,6GAA6G,CAC9G,CAAC;SACH;QACD,IAAM,YAAY,GAAuB,IAAI,CAAC,KAAK,CACjD,EAAE,CAAC,YAAY,CAAC,IAAI,CAAC,CAAC,QAAQ,EAAE,CACX,CAAC;QACxB,IAAA,2BAAoB,EAAC,YAAY,CAAC,CAAC;KACpC;SAAM;QACL,IAAI,CAAC,IAAI,CAAC,iCAAiC,CAAC,CAAC;QAC7C,IAAA,2BAAoB,EAAC,qBAAM,CAAC,CAAC;KAC9B;CACF;AAAC,OAAO,GAAG,EAAE;IACZ,IAAI,CAAC,SAAS,CAAE,GAAa,CAAC,OAAO,CAAC,CAAC;CACxC"} \ No newline at end of file diff --git a/dist/output.js b/dist/output.js index 3dce68c..894f076 100644 --- a/dist/output.js +++ b/dist/output.js @@ -1,23 +1,39 @@ "use strict"; +var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + var desc = Object.getOwnPropertyDescriptor(m, k); + if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { + desc = { enumerable: true, get: function() { return m[k]; } }; + } + Object.defineProperty(o, k2, desc); +}) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; +})); +var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) { + Object.defineProperty(o, "default", { enumerable: true, value: v }); +}) : function(o, v) { + o["default"] = v; +}); var __importStar = (this && this.__importStar) || function (mod) { if (mod && mod.__esModule) return mod; var result = {}; - if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k]; - result["default"] = mod; + if (mod != null) for (var k in mod) if (k !== "default" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + __setModuleDefault(result, mod); return result; }; Object.defineProperty(exports, "__esModule", { value: true }); +var requestconf_1 = require("./requestconf"); var core = __importStar(require("@actions/core")); var util = __importStar(require("./util")); var setOutput = function (res) { if (!res) { - throw new Error('No response from request'); + throw new Error("No response from request"); } - util.validateStatusCode(res.status.toString()); - if (core.getInput('is_debug') === 'true') { - core.info(util.buildOutput(res)); + if (requestconf_1.INPUT_LOG_RESPONSE) { + core.info("Response: ".concat(util.buildOutput(res))); } - core.setOutput('response', util.buildOutput(res)); + core.setOutput("response", util.buildOutput(res)); }; exports.default = setOutput; //# sourceMappingURL=output.js.map \ No newline at end of file diff --git a/dist/output.js.map b/dist/output.js.map index 327ba80..0e8e539 100644 --- a/dist/output.js.map +++ b/dist/output.js.map @@ -1 +1 @@ -{"version":3,"file":"output.js","sourceRoot":"./src/","sources":["output.ts"],"names":[],"mappings":";;;;;;;;;AAAA,kDAAqC;AACrC,2CAA8B;AAG9B,IAAM,SAAS,GAAG,UAAC,GAA+B;IAC9C,IAAG,CAAC,GAAG,EAAC;QACJ,MAAM,IAAI,KAAK,CAAC,0BAA0B,CAAC,CAAA;KAC9C;IACD,IAAI,CAAC,kBAAkB,CAAC,GAAG,CAAC,MAAM,CAAC,QAAQ,EAAE,CAAC,CAAC;IAC/C,IAAG,IAAI,CAAC,QAAQ,CAAC,UAAU,CAAC,KAAK,MAAM,EAAC;QACpC,IAAI,CAAC,IAAI,CAAC,IAAI,CAAC,WAAW,CAAC,GAAG,CAAC,CAAC,CAAC;KACpC;IACD,IAAI,CAAC,SAAS,CAAC,UAAU,EAAE,IAAI,CAAC,WAAW,CAAC,GAAG,CAAC,CAAC,CAAC;AACtD,CAAC,CAAA;AAGD,kBAAe,SAAS,CAAA"} \ No newline at end of file +{"version":3,"file":"output.js","sourceRoot":"./src/","sources":["output.ts"],"names":[],"mappings":";;;;;;;;;;;;;;;;;;;;;;;;;AAAA,6CAAmD;AACnD,kDAAsC;AACtC,2CAA+B;AAG/B,IAAM,SAAS,GAAG,UAAC,GAA8B;IAC/C,IAAI,CAAC,GAAG,EAAE;QACR,MAAM,IAAI,KAAK,CAAC,0BAA0B,CAAC,CAAC;KAC7C;IACD,IAAI,gCAAkB,EAAE;QACtB,IAAI,CAAC,IAAI,CAAC,oBAAa,IAAI,CAAC,WAAW,CAAC,GAAG,CAAC,CAAE,CAAC,CAAC;KACjD;IACD,IAAI,CAAC,SAAS,CAAC,UAAU,EAAE,IAAI,CAAC,WAAW,CAAC,GAAG,CAAC,CAAC,CAAC;AACpD,CAAC,CAAC;AAEF,kBAAe,SAAS,CAAC"} \ No newline at end of file diff --git a/dist/requestconf.js b/dist/requestconf.js index 2fc1ac6..fbe9c73 100644 --- a/dist/requestconf.js +++ b/dist/requestconf.js @@ -10,89 +10,132 @@ var __assign = (this && this.__assign) || function () { }; return __assign.apply(this, arguments); }; +var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + var desc = Object.getOwnPropertyDescriptor(m, k); + if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { + desc = { enumerable: true, get: function() { return m[k]; } }; + } + Object.defineProperty(o, k2, desc); +}) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; +})); +var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) { + Object.defineProperty(o, "default", { enumerable: true, value: v }); +}) : function(o, v) { + o["default"] = v; +}); var __importStar = (this && this.__importStar) || function (mod) { if (mod && mod.__esModule) return mod; var result = {}; - if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k]; - result["default"] = mod; + if (mod != null) for (var k in mod) if (k !== "default" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + __setModuleDefault(result, mod); return result; }; Object.defineProperty(exports, "__esModule", { value: true }); +exports.INPUT_RETRIES = exports.INPUT_CUSTOM_CONFIG_FILE = exports.INPUT_LOG_RESPONSE = exports.INPUT_ACCEPT = exports.INPUT_TIMEOUT = exports.INPUT_METHOD = exports.INPUT_BODY = exports.INPUT_PARAMS = exports.INPUT_HEADERS = exports.INPUT_URL = exports.INPUT_PROXY_AUTH_TOKEN = exports.INPUT_PROXY_URL = exports.INPUT_BEARER_TOKEN = exports.INPUT_BASIC_AUTH_TOKEN = void 0; +var util_1 = require("./util"); var core = __importStar(require("@actions/core")); // builder for request config +// inputs +exports.INPUT_BASIC_AUTH_TOKEN = core.getInput("basic-auth-token"); +exports.INPUT_BEARER_TOKEN = core.getInput("bearer-token"); +exports.INPUT_PROXY_URL = core.getInput("proxy-url"); +exports.INPUT_PROXY_AUTH_TOKEN = core.getInput("proxy-auth-token"); +exports.INPUT_URL = core.getInput("url", { + required: true, +}); +exports.INPUT_HEADERS = core.getInput("headers"); +exports.INPUT_PARAMS = core.getInput("params"); +exports.INPUT_BODY = core.getInput("body"); +exports.INPUT_METHOD = core.getInput("method"); +exports.INPUT_TIMEOUT = core.getInput("timeout"); +exports.INPUT_ACCEPT = core.getInput("accept"); +exports.INPUT_LOG_RESPONSE = core.getBooleanInput("log-response"); +exports.INPUT_CUSTOM_CONFIG_FILE = core.getInput("custom-config"); +exports.INPUT_RETRIES = core.getInput("retries"); var builder = { basicAuth: function () { - var authArr = core.getInput('basic-auth').trim().split(':'); - if (authArr.length !== 2) { - throw new Error('basic-auth format is invalid. The valid format should be username:password.'); + var basicAuthString = Buffer.from(exports.INPUT_BASIC_AUTH_TOKEN, "base64").toString(); + var basicAuthArr = basicAuthString.trim().split(":"); + if (basicAuthArr.length !== 2) { + throw new Error("basic-auth-token format is invalid. The valid format should be username:password as base64."); } return { - username: authArr[0], - password: authArr[1] + username: basicAuthArr[0], + password: basicAuthArr[1], }; }, bearerToken: function () { - return "Bearer " + core.getInput('bearer-token'); + return "Bearer ".concat(exports.INPUT_BEARER_TOKEN); }, proxy: function () { var proxy; - if (core.getInput('proxy-url').includes('//')) { - var proxyUrlArr = core.getInput('proxy-url').replace('//', '').trim().split(':'); + if (exports.INPUT_PROXY_URL.includes("//")) { + var proxyUrlArr = exports.INPUT_PROXY_URL.replace("//", "") + .trim() + .split(":"); if (proxyUrlArr.length !== 3) { - throw new Error('proxy-url format is invalid. The valid format should be host:port.'); + throw new Error("proxy-url format is invalid. The valid format should be host:port."); } proxy = { protocol: proxyUrlArr[0], host: proxyUrlArr[1], - port: Number(proxyUrlArr[2]) + port: Number(proxyUrlArr[2]), }; } else { - var proxyUrlArr = core.getInput('proxy-url').trim().split(':'); + var proxyUrlArr = exports.INPUT_PROXY_URL.trim().split(":"); if (proxyUrlArr.length !== 2) { - throw new Error('proxy-url format is invalid. The valid format should be host:port.'); + throw new Error("proxy-url format is invalid. The valid format should be host:port."); } proxy = { host: proxyUrlArr[0], - port: Number(proxyUrlArr[1]) + port: Number(proxyUrlArr[1]), }; } - if (core.getInput('proxy-auth')) { - var proxyAuthArr = core.getInput('proxy-auth').trim().split(':'); + if (exports.INPUT_PROXY_AUTH_TOKEN) { + var proxyAuthString = Buffer.from(exports.INPUT_PROXY_AUTH_TOKEN, "base64").toString(); + var proxyAuthArr = proxyAuthString.trim().split(":"); if (proxyAuthArr.length !== 2) { - throw new Error('proxy-auth format is invalid. The valid format should be username:password.'); + throw new Error("proxy-auth format is invalid. The valid format should be username:password as base64."); } proxy.auth = { username: proxyAuthArr[0], - password: proxyAuthArr[1] + password: proxyAuthArr[1], }; } return proxy; - } + }, }; -// Request config +// Request config var config = { - url: core.getInput('url'), - method: core.getInput('method'), - timeout: Number(core.getInput('timeout')) + url: exports.INPUT_URL, + method: exports.INPUT_METHOD, + timeout: Number(exports.INPUT_TIMEOUT), }; -if (core.getInput('basic-auth')) { +if (exports.INPUT_BASIC_AUTH_TOKEN) { config.auth = builder.basicAuth(); } -if (core.getInput('headers')) { - config.headers = JSON.parse(core.getInput('headers')); +if (exports.INPUT_HEADERS) { + config.headers = (0, util_1.tryToParseJson)(exports.INPUT_HEADERS); } -if (core.getInput('params')) { - config.params = JSON.parse(core.getInput('params')); +if (exports.INPUT_PARAMS) { + config.params = (0, util_1.tryToParseJson)(exports.INPUT_PARAMS); } -if (core.getInput('body')) { - config.data = core.getInput('body'); +if (exports.INPUT_BODY) { + config.data = (0, util_1.tryToParseJson)(exports.INPUT_BODY); } -if (core.getInput('bearer-token')) { +if (exports.INPUT_BEARER_TOKEN) { config.headers = __assign(__assign({}, config.headers), { Authorization: builder.bearerToken() }); } -if (core.getInput('proxy-url')) { +if (exports.INPUT_PROXY_URL) { config.proxy = builder.proxy(); } +if (exports.INPUT_ACCEPT) { + var accepts_1 = (0, util_1.getAcceptedStatusCodes)(); + config.validateStatus = function (status) { return accepts_1.includes(status); }; +} exports.default = config; //# sourceMappingURL=requestconf.js.map \ No newline at end of file diff --git a/dist/requestconf.js.map b/dist/requestconf.js.map index d41ef9c..3c7c51c 100644 --- a/dist/requestconf.js.map +++ b/dist/requestconf.js.map @@ -1 +1 @@ -{"version":3,"file":"requestconf.js","sourceRoot":"./src/","sources":["requestconf.ts"],"names":[],"mappings":";;;;;;;;;;;;;;;;;;;;AAEA,kDAAqC;AAGrC,6BAA6B;AAE7B,IAAM,OAAO,GAAG;IACZ,SAAS,EAAE;QACP,IAAI,OAAO,GAAa,IAAI,CAAC,QAAQ,CAAC,YAAY,CAAC,CAAC,IAAI,EAAE,CAAC,KAAK,CAAC,GAAG,CAAC,CAAC;QACtE,IAAG,OAAO,CAAC,MAAM,KAAK,CAAC,EAAC;YACpB,MAAM,IAAI,KAAK,CAAC,6EAA6E,CAAC,CAAC;SAClG;QACD,OAAO;YACH,QAAQ,EAAE,OAAO,CAAC,CAAC,CAAC;YACpB,QAAQ,EAAE,OAAO,CAAC,CAAC,CAAC;SACvB,CAAA;IACL,CAAC;IACD,WAAW,EAAE;QACT,OAAO,YAAU,IAAI,CAAC,QAAQ,CAAC,cAAc,CAAG,CAAC;IACrD,CAAC;IACD,KAAK,EAAE;QACH,IAAI,KAAuB,CAAC;QAC5B,IAAG,IAAI,CAAC,QAAQ,CAAC,WAAW,CAAC,CAAC,QAAQ,CAAC,IAAI,CAAC,EAAC;YACzC,IAAM,WAAW,GAAa,IAAI,CAAC,QAAQ,CAAC,WAAW,CAAC,CAAC,OAAO,CAAC,IAAI,EAAE,EAAE,CAAC,CAAC,IAAI,EAAE,CAAC,KAAK,CAAC,GAAG,CAAC,CAAC;YAC7F,IAAG,WAAW,CAAC,MAAM,KAAK,CAAC,EAAC;gBACxB,MAAM,IAAI,KAAK,CAAC,oEAAoE,CAAC,CAAC;aACzF;YACD,KAAK,GAAG;gBACJ,QAAQ,EAAE,WAAW,CAAC,CAAC,CAAC;gBACxB,IAAI,EAAE,WAAW,CAAC,CAAC,CAAC;gBACpB,IAAI,EAAE,MAAM,CAAC,WAAW,CAAC,CAAC,CAAC,CAAC;aAC/B,CAAA;SACJ;aAAI;YACD,IAAM,WAAW,GAAa,IAAI,CAAC,QAAQ,CAAC,WAAW,CAAC,CAAC,IAAI,EAAE,CAAC,KAAK,CAAC,GAAG,CAAC,CAAC;YAC3E,IAAG,WAAW,CAAC,MAAM,KAAK,CAAC,EAAC;gBACxB,MAAM,IAAI,KAAK,CAAC,oEAAoE,CAAC,CAAC;aACzF;YACD,KAAK,GAAG;gBACJ,IAAI,EAAE,WAAW,CAAC,CAAC,CAAC;gBACpB,IAAI,EAAE,MAAM,CAAC,WAAW,CAAC,CAAC,CAAC,CAAC;aAC/B,CAAA;SACJ;QACD,IAAG,IAAI,CAAC,QAAQ,CAAC,YAAY,CAAC,EAAC;YAC3B,IAAM,YAAY,GAAa,IAAI,CAAC,QAAQ,CAAC,YAAY,CAAC,CAAC,IAAI,EAAE,CAAC,KAAK,CAAC,GAAG,CAAC,CAAC;YAC7E,IAAG,YAAY,CAAC,MAAM,KAAK,CAAC,EAAC;gBACzB,MAAM,IAAI,KAAK,CAAC,6EAA6E,CAAC,CAAC;aAClG;YACD,KAAK,CAAC,IAAI,GAAG;gBACT,QAAQ,EAAE,YAAY,CAAC,CAAC,CAAC;gBACzB,QAAQ,EAAE,YAAY,CAAC,CAAC,CAAC;aAC5B,CAAA;SACJ;QACD,OAAO,KAAK,CAAC;IACjB,CAAC;CACJ,CAAA;AAGD,mBAAmB;AAEnB,IAAM,MAAM,GAAuB;IAC/B,GAAG,EAAE,IAAI,CAAC,QAAQ,CAAC,KAAK,CAAC;IACzB,MAAM,EAAE,IAAI,CAAC,QAAQ,CAAC,QAAQ,CAAW;IACzC,OAAO,EAAE,MAAM,CAAC,IAAI,CAAC,QAAQ,CAAC,SAAS,CAAC,CAAC;CAC5C,CAAA;AAED,IAAG,IAAI,CAAC,QAAQ,CAAC,YAAY,CAAC,EAAC;IAC3B,MAAM,CAAC,IAAI,GAAG,OAAO,CAAC,SAAS,EAAE,CAAA;CACpC;AAED,IAAG,IAAI,CAAC,QAAQ,CAAC,SAAS,CAAC,EAAC;IACxB,MAAM,CAAC,OAAO,GAAG,IAAI,CAAC,KAAK,CAAC,IAAI,CAAC,QAAQ,CAAC,SAAS,CAAC,CAAC,CAAA;CACxD;AAED,IAAG,IAAI,CAAC,QAAQ,CAAC,QAAQ,CAAC,EAAC;IACvB,MAAM,CAAC,MAAM,GAAG,IAAI,CAAC,KAAK,CAAC,IAAI,CAAC,QAAQ,CAAC,QAAQ,CAAC,CAAC,CAAA;CACtD;AAED,IAAG,IAAI,CAAC,QAAQ,CAAC,MAAM,CAAC,EAAC;IACrB,MAAM,CAAC,IAAI,GAAG,IAAI,CAAC,QAAQ,CAAC,MAAM,CAAC,CAAA;CACtC;AAED,IAAG,IAAI,CAAC,QAAQ,CAAC,cAAc,CAAC,EAAC;IAC7B,MAAM,CAAC,OAAO,yBAAQ,MAAM,CAAC,OAAO,KAAE,aAAa,EAAE,OAAO,CAAC,WAAW,EAAE,GAAE,CAAA;CAC/E;AAED,IAAG,IAAI,CAAC,QAAQ,CAAC,WAAW,CAAC,EAAC;IAC1B,MAAM,CAAC,KAAK,GAAG,OAAO,CAAC,KAAK,EAAE,CAAA;CACjC;AAGD,kBAAe,MAAM,CAAA"} \ No newline at end of file +{"version":3,"file":"requestconf.js","sourceRoot":"./src/","sources":["requestconf.ts"],"names":[],"mappings":";;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;AAAA,+BAAgE;AAChE,kDAAsC;AAUtC,6BAA6B;AAE7B,SAAS;AACI,QAAA,sBAAsB,GACjC,IAAI,CAAC,QAAQ,CAAC,kBAAkB,CAAC,CAAC;AACvB,QAAA,kBAAkB,GAC7B,IAAI,CAAC,QAAQ,CAAC,cAAc,CAAC,CAAC;AACnB,QAAA,eAAe,GAAqB,IAAI,CAAC,QAAQ,CAAC,WAAW,CAAC,CAAC;AAC/D,QAAA,sBAAsB,GACjC,IAAI,CAAC,QAAQ,CAAC,kBAAkB,CAAC,CAAC;AACvB,QAAA,SAAS,GAAqB,IAAI,CAAC,QAAQ,CAAC,KAAK,EAAE;IAC9D,QAAQ,EAAE,IAAI;CACf,CAAC,CAAC;AACU,QAAA,aAAa,GAAqB,IAAI,CAAC,QAAQ,CAAC,SAAS,CAAC,CAAC;AAC3D,QAAA,YAAY,GAAqB,IAAI,CAAC,QAAQ,CAAC,QAAQ,CAAC,CAAC;AACzD,QAAA,UAAU,GAAqB,IAAI,CAAC,QAAQ,CAAC,MAAM,CAAC,CAAC;AACrD,QAAA,YAAY,GAAqB,IAAI,CAAC,QAAQ,CAAC,QAAQ,CAAW,CAAC;AACnE,QAAA,aAAa,GAAqB,IAAI,CAAC,QAAQ,CAAC,SAAS,CAAC,CAAC;AAC3D,QAAA,YAAY,GAAqB,IAAI,CAAC,QAAQ,CAAC,QAAQ,CAAC,CAAC;AACzD,QAAA,kBAAkB,GAC7B,IAAI,CAAC,eAAe,CAAC,cAAc,CAAC,CAAC;AAC1B,QAAA,wBAAwB,GACnC,IAAI,CAAC,QAAQ,CAAC,eAAe,CAAC,CAAC;AACpB,QAAA,aAAa,GAAqB,IAAI,CAAC,QAAQ,CAAC,SAAS,CAAC,CAAC;AAExE,IAAM,OAAO,GAAG;IACd,SAAS,EAAE;QACT,IAAM,eAAe,GAAW,MAAM,CAAC,IAAI,CACzC,8BAAsB,EACtB,QAAQ,CACT,CAAC,QAAQ,EAAE,CAAC;QACb,IAAM,YAAY,GAAa,eAAe,CAAC,IAAI,EAAE,CAAC,KAAK,CAAC,GAAG,CAAC,CAAC;QACjE,IAAI,YAAY,CAAC,MAAM,KAAK,CAAC,EAAE;YAC7B,MAAM,IAAI,KAAK,CACb,6FAA6F,CAC9F,CAAC;SACH;QACD,OAAO;YACL,QAAQ,EAAE,YAAY,CAAC,CAAC,CAAC;YACzB,QAAQ,EAAE,YAAY,CAAC,CAAC,CAAC;SAC1B,CAAC;IACJ,CAAC;IACD,WAAW,EAAE;QACX,OAAO,iBAAU,0BAAkB,CAAE,CAAC;IACxC,CAAC;IACD,KAAK,EAAE;QACL,IAAI,KAAuB,CAAC;QAC5B,IAAI,uBAAe,CAAC,QAAQ,CAAC,IAAI,CAAC,EAAE;YAClC,IAAM,WAAW,GAAa,uBAAe,CAAC,OAAO,CAAC,IAAI,EAAE,EAAE,CAAC;iBAC5D,IAAI,EAAE;iBACN,KAAK,CAAC,GAAG,CAAC,CAAC;YACd,IAAI,WAAW,CAAC,MAAM,KAAK,CAAC,EAAE;gBAC5B,MAAM,IAAI,KAAK,CACb,oEAAoE,CACrE,CAAC;aACH;YACD,KAAK,GAAG;gBACN,QAAQ,EAAE,WAAW,CAAC,CAAC,CAAC;gBACxB,IAAI,EAAE,WAAW,CAAC,CAAC,CAAC;gBACpB,IAAI,EAAE,MAAM,CAAC,WAAW,CAAC,CAAC,CAAC,CAAC;aAC7B,CAAC;SACH;aAAM;YACL,IAAM,WAAW,GAAa,uBAAe,CAAC,IAAI,EAAE,CAAC,KAAK,CAAC,GAAG,CAAC,CAAC;YAChE,IAAI,WAAW,CAAC,MAAM,KAAK,CAAC,EAAE;gBAC5B,MAAM,IAAI,KAAK,CACb,oEAAoE,CACrE,CAAC;aACH;YACD,KAAK,GAAG;gBACN,IAAI,EAAE,WAAW,CAAC,CAAC,CAAC;gBACpB,IAAI,EAAE,MAAM,CAAC,WAAW,CAAC,CAAC,CAAC,CAAC;aAC7B,CAAC;SACH;QACD,IAAI,8BAAsB,EAAE;YAC1B,IAAM,eAAe,GAAW,MAAM,CAAC,IAAI,CACzC,8BAAsB,EACtB,QAAQ,CACT,CAAC,QAAQ,EAAE,CAAC;YACb,IAAM,YAAY,GAAa,eAAe,CAAC,IAAI,EAAE,CAAC,KAAK,CAAC,GAAG,CAAC,CAAC;YACjE,IAAI,YAAY,CAAC,MAAM,KAAK,CAAC,EAAE;gBAC7B,MAAM,IAAI,KAAK,CACb,uFAAuF,CACxF,CAAC;aACH;YACD,KAAK,CAAC,IAAI,GAAG;gBACX,QAAQ,EAAE,YAAY,CAAC,CAAC,CAAC;gBACzB,QAAQ,EAAE,YAAY,CAAC,CAAC,CAAC;aAC1B,CAAC;SACH;QACD,OAAO,KAAK,CAAC;IACf,CAAC;CACF,CAAC;AAEF,iBAAiB;AAEjB,IAAM,MAAM,GAAuB;IACjC,GAAG,EAAE,iBAAS;IACd,MAAM,EAAE,oBAAY;IACpB,OAAO,EAAE,MAAM,CAAC,qBAAa,CAAC;CAC/B,CAAC;AAEF,IAAI,8BAAsB,EAAE;IAC1B,MAAM,CAAC,IAAI,GAAG,OAAO,CAAC,SAAS,EAAE,CAAC;CACnC;AAED,IAAI,qBAAa,EAAE;IACjB,MAAM,CAAC,OAAO,GAAG,IAAA,qBAAc,EAAC,qBAAa,CAAwB,CAAC;CACvE;AAED,IAAI,oBAAY,EAAE;IAChB,MAAM,CAAC,MAAM,GAAG,IAAA,qBAAc,EAAC,oBAAY,CAAC,CAAC;CAC9C;AAED,IAAI,kBAAU,EAAE;IACd,MAAM,CAAC,IAAI,GAAG,IAAA,qBAAc,EAAC,kBAAU,CAAC,CAAC;CAC1C;AAED,IAAI,0BAAkB,EAAE;IACtB,MAAM,CAAC,OAAO,yBAAQ,MAAM,CAAC,OAAO,KAAE,aAAa,EAAE,OAAO,CAAC,WAAW,EAAE,GAAE,CAAC;CAC9E;AAED,IAAI,uBAAe,EAAE;IACnB,MAAM,CAAC,KAAK,GAAG,OAAO,CAAC,KAAK,EAAE,CAAC;CAChC;AAED,IAAI,oBAAY,EAAE;IAChB,IAAM,SAAO,GAAG,IAAA,6BAAsB,GAAE,CAAC;IACzC,MAAM,CAAC,cAAc,GAAG,UAAC,MAAM,IAAK,OAAA,SAAO,CAAC,QAAQ,CAAC,MAAM,CAAC,EAAxB,CAAwB,CAAC;CAC9D;AAED,kBAAe,MAAM,CAAC"} \ No newline at end of file diff --git a/dist/util.js b/dist/util.js index 19bc17b..0f68a1d 100644 --- a/dist/util.js +++ b/dist/util.js @@ -1,4 +1,27 @@ "use strict"; +var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + var desc = Object.getOwnPropertyDescriptor(m, k); + if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { + desc = { enumerable: true, get: function() { return m[k]; } }; + } + Object.defineProperty(o, k2, desc); +}) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; +})); +var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) { + Object.defineProperty(o, "default", { enumerable: true, value: v }); +}) : function(o, v) { + o["default"] = v; +}); +var __importStar = (this && this.__importStar) || function (mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) for (var k in mod) if (k !== "default" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + __setModuleDefault(result, mod); + return result; +}; var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } return new (P || (P = Promise))(function (resolve, reject) { @@ -35,76 +58,86 @@ var __generator = (this && this.__generator) || function (thisArg, body) { if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true }; } }; -var __importStar = (this && this.__importStar) || function (mod) { - if (mod && mod.__esModule) return mod; - var result = {}; - if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k]; - result["default"] = mod; - return result; -}; var __importDefault = (this && this.__importDefault) || function (mod) { return (mod && mod.__esModule) ? mod : { "default": mod }; }; Object.defineProperty(exports, "__esModule", { value: true }); +exports.sendRequestWithRetry = exports.tryToParseJson = exports.buildOutput = exports.getAcceptedStatusCodes = void 0; +var requestconf_1 = require("./requestconf"); var core = __importStar(require("@actions/core")); var axios_1 = __importDefault(require("axios")); var output_1 = __importDefault(require("./output")); -exports.validateStatusCode = function (actualStatusCode) { - var acceptedStatusCode = core.getInput('accept') - .split(",").filter(function (x) { return x !== ""; }) +var rax = __importStar(require("retry-axios")); +var yaml = __importStar(require("js-yaml")); +var getAcceptedStatusCodes = function () { + var acceptedStatusCodes = requestconf_1.INPUT_ACCEPT + .split(",") + .filter(function (x) { return x !== ""; }) .map(function (x) { return x.trim(); }); - if (!acceptedStatusCode.includes(actualStatusCode)) { - throw new Error("The accepted status code is " + acceptedStatusCode + " but got " + actualStatusCode); + var output = []; + for (var _i = 0, acceptedStatusCodes_1 = acceptedStatusCodes; _i < acceptedStatusCodes_1.length; _i++) { + var acceptedStatusCode = acceptedStatusCodes_1[_i]; + if (isNaN(Number(acceptedStatusCode))) { + throw new Error("Accept status ".concat(acceptedStatusCode, " is invalid")); + } + output.push(Number(acceptedStatusCode)); } + return output; }; -exports.buildOutput = function (res) { +exports.getAcceptedStatusCodes = getAcceptedStatusCodes; +var buildOutput = function (res) { return JSON.stringify({ - "status_code": res.status, - "data": res.data, - "headers": res.headers + status_code: res.status, + data: res.data, + headers: res.headers, }); }; -exports.sendRequestWithRetry = function (config) { return __awaiter(void 0, void 0, void 0, function () { - var exit, countRetry, retryArr, numberOfRetry, backoff, res, err_1; +exports.buildOutput = buildOutput; +var tryToParseJson = function (data) { + var output = data; + // try to parse json directly + try { + output = JSON.parse(data); + return output; + } + catch (_a) { + // do nothing + } + // try to parse json from yaml + try { + output = yaml.load(data, { json: true }); + return output; + } + catch (_b) { + // do nothing + } + return data; +}; +exports.tryToParseJson = tryToParseJson; +var sendRequestWithRetry = function (config) { return __awaiter(void 0, void 0, void 0, function () { + var client; return __generator(this, function (_a) { - switch (_a.label) { - case 0: - exit = false; - countRetry = 0; - retryArr = core.getInput('retry').split('/'); - numberOfRetry = Number(retryArr[0]); - backoff = Number(retryArr[1]); - _a.label = 1; - case 1: - _a.trys.push([1, 3, , 7]); - return [4 /*yield*/, axios_1.default(config)]; - case 2: - res = _a.sent(); - output_1.default(res); - exit = true; - return [3 /*break*/, 7]; - case 3: - err_1 = _a.sent(); - countRetry += 1; - if (!(countRetry <= numberOfRetry)) return [3 /*break*/, 5]; - core.info("retry: " + countRetry); - return [4 /*yield*/, sleep(backoff * 1000)]; - case 4: - _a.sent(); - return [3 /*break*/, 6]; - case 5: - exit = true; - core.setFailed(err_1); - _a.label = 6; - case 6: return [3 /*break*/, 7]; - case 7: - if (!exit) return [3 /*break*/, 1]; - _a.label = 8; - case 8: return [2 /*return*/]; + client = axios_1.default.create(); + if (requestconf_1.INPUT_RETRIES) { + if (isNaN(Number(requestconf_1.INPUT_RETRIES))) { + throw new Error("retries should be number"); + } + client.defaults.raxConfig = { + instance: client, + retry: Number(requestconf_1.INPUT_RETRIES), + onRetryAttempt: function (err) { + var cfg = rax.getConfig(err); + core.info("Retry attempt #".concat(cfg === null || cfg === void 0 ? void 0 : cfg.currentRetryAttempt)); + }, + }; + rax.attach(client); } + client + .request(config) + .then(function (resp) { return (0, output_1.default)(resp); }) + .catch(function (err) { return core.setFailed(err); }); + return [2 /*return*/]; }); }); }; -function sleep(ms) { - return new Promise(function (resolve) { return setTimeout(resolve, ms); }); -} +exports.sendRequestWithRetry = sendRequestWithRetry; //# sourceMappingURL=util.js.map \ No newline at end of file diff --git a/dist/util.js.map b/dist/util.js.map index d5996df..f527346 100644 --- a/dist/util.js.map +++ b/dist/util.js.map @@ -1 +1 @@ -{"version":3,"file":"util.js","sourceRoot":"./src/","sources":["util.ts"],"names":[],"mappings":";;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;AAAA,kDAAqC;AACrC,gDAAgE;AAChE,oDAAgC;AAEnB,QAAA,kBAAkB,GAAG,UAAC,gBAAwB;IACvD,IAAM,kBAAkB,GAAa,IAAI,CAAC,QAAQ,CAAC,QAAQ,CAAC;SACvD,KAAK,CAAC,GAAG,CAAC,CAAC,MAAM,CAAC,UAAA,CAAC,IAAI,OAAA,CAAC,KAAK,EAAE,EAAR,CAAQ,CAAC;SAChC,GAAG,CAAC,UAAA,CAAC,IAAI,OAAA,CAAC,CAAC,IAAI,EAAE,EAAR,CAAQ,CAAC,CAAC;IACxB,IAAI,CAAC,kBAAkB,CAAC,QAAQ,CAAC,gBAAgB,CAAC,EAAE;QAChD,MAAM,IAAI,KAAK,CAAC,iCAA+B,kBAAkB,iBAAY,gBAAkB,CAAC,CAAA;KACnG;AACL,CAAC,CAAA;AAEY,QAAA,WAAW,GAAG,UAAC,GAAuB;IAC/C,OAAO,IAAI,CAAC,SAAS,CAAC;QAClB,aAAa,EAAE,GAAG,CAAC,MAAM;QACzB,MAAM,EAAE,GAAG,CAAC,IAAI;QAChB,SAAS,EAAE,GAAG,CAAC,OAAO;KACzB,CAAC,CAAA;AACN,CAAC,CAAA;AAEY,QAAA,oBAAoB,GAAG,UAAO,MAA0B;;;;;gBAC7D,IAAI,GAAG,KAAK,CAAA;gBACZ,UAAU,GAAG,CAAC,CAAA;gBACZ,QAAQ,GAAa,IAAI,CAAC,QAAQ,CAAC,OAAO,CAAC,CAAC,KAAK,CAAC,GAAG,CAAC,CAAA;gBACtD,aAAa,GAAW,MAAM,CAAC,QAAQ,CAAC,CAAC,CAAC,CAAC,CAAA;gBAC3C,OAAO,GAAW,MAAM,CAAC,QAAQ,CAAC,CAAC,CAAC,CAAC,CAAA;;;;gBAGvB,qBAAM,eAAK,CAAC,MAAM,CAAC,EAAA;;gBAAzB,GAAG,GAAG,SAAmB;gBAC/B,gBAAS,CAAC,GAAG,CAAC,CAAA;gBACd,IAAI,GAAG,IAAI,CAAA;;;;gBAEX,UAAU,IAAI,CAAC,CAAA;qBACX,CAAA,UAAU,IAAI,aAAa,CAAA,EAA3B,wBAA2B;gBAC3B,IAAI,CAAC,IAAI,CAAC,YAAU,UAAY,CAAC,CAAA;gBACjC,qBAAM,KAAK,CAAC,OAAO,GAAG,IAAI,CAAC,EAAA;;gBAA3B,SAA2B,CAAA;;;gBAE3B,IAAI,GAAG,IAAI,CAAA;gBACX,IAAI,CAAC,SAAS,CAAC,KAAG,CAAC,CAAA;;;;oBAGtB,CAAC,IAAI;;;;;KACjB,CAAA;AAED,SAAS,KAAK,CAAC,EAAU;IACrB,OAAO,IAAI,OAAO,CAAC,UAAA,OAAO,IAAI,OAAA,UAAU,CAAC,OAAO,EAAE,EAAE,CAAC,EAAvB,CAAuB,CAAC,CAAC;AAC3D,CAAC"} \ No newline at end of file +{"version":3,"file":"util.js","sourceRoot":"./src/","sources":["util.ts"],"names":[],"mappings":";;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;AAAA,6CAA4D;AAC5D,kDAAsC;AACtC,gDAAiE;AACjE,oDAAiC;AACjC,+CAAmC;AACnC,4CAAgC;AAEzB,IAAM,sBAAsB,GAAG;IACpC,IAAM,mBAAmB,GAAc,0BAAuB;SAC3D,KAAK,CAAC,GAAG,CAAC;SACV,MAAM,CAAC,UAAC,CAAC,IAAK,OAAA,CAAC,KAAK,EAAE,EAAR,CAAQ,CAAC;SACvB,GAAG,CAAC,UAAC,CAAC,IAAK,OAAA,CAAC,CAAC,IAAI,EAAE,EAAR,CAAQ,CAAC,CAAC;IACxB,IAAI,MAAM,GAAa,EAAE,CAAC;IAC1B,KAA+B,UAAmB,EAAnB,2CAAmB,EAAnB,iCAAmB,EAAnB,IAAmB,EAAE;QAA/C,IAAI,kBAAkB,4BAAA;QACzB,IAAI,KAAK,CAAC,MAAM,CAAC,kBAAkB,CAAC,CAAC,EAAE;YACrC,MAAM,IAAI,KAAK,CAAC,wBAAiB,kBAAkB,gBAAa,CAAC,CAAC;SACnE;QACD,MAAM,CAAC,IAAI,CAAC,MAAM,CAAC,kBAAkB,CAAC,CAAC,CAAC;KACzC;IACD,OAAO,MAAM,CAAC;AAChB,CAAC,CAAC;AAbW,QAAA,sBAAsB,0BAajC;AAEK,IAAM,WAAW,GAAG,UAAC,GAAuB;IACjD,OAAO,IAAI,CAAC,SAAS,CAAC;QACpB,WAAW,EAAE,GAAG,CAAC,MAAM;QACvB,IAAI,EAAE,GAAG,CAAC,IAAI;QACd,OAAO,EAAE,GAAG,CAAC,OAAO;KACrB,CAAC,CAAC;AACL,CAAC,CAAC;AANW,QAAA,WAAW,eAMtB;AAEK,IAAM,cAAc,GAAG,UAAC,IAAY;IACzC,IAAI,MAAM,GAAqB,IAAI,CAAC;IAEpC,6BAA6B;IAC7B,IAAI;QACF,MAAM,GAAG,IAAI,CAAC,KAAK,CAAC,IAAI,CAAC,CAAC;QAC1B,OAAO,MAAM,CAAC;KACf;IAAC,WAAM;QACN,aAAa;KACd;IAED,8BAA8B;IAC9B,IAAI;QACF,MAAM,GAAG,IAAI,CAAC,IAAI,CAAC,IAAI,EAAE,EAAE,IAAI,EAAE,IAAI,EAAE,CAAC,CAAC;QACzC,OAAO,MAAM,CAAC;KACf;IAAC,WAAM;QACN,aAAa;KACd;IACD,OAAO,IAAI,CAAC;AACd,CAAC,CAAC;AAnBW,QAAA,cAAc,kBAmBzB;AAEK,IAAM,oBAAoB,GAAG,UAAO,MAA0B;;;QAC7D,MAAM,GAAG,eAAK,CAAC,MAAM,EAAE,CAAC;QAC9B,IAAI,2BAAa,EAAE;YACjB,IAAI,KAAK,CAAC,MAAM,CAAC,2BAAa,CAAC,CAAC,EAAE;gBAChC,MAAM,IAAI,KAAK,CAAC,0BAA0B,CAAC,CAAC;aAC7C;YACD,MAAM,CAAC,QAAQ,CAAC,SAAS,GAAG;gBAC1B,QAAQ,EAAE,MAAM;gBAChB,KAAK,EAAE,MAAM,CAAC,2BAAa,CAAC;gBAC5B,cAAc,EAAE,UAAC,GAAG;oBAClB,IAAM,GAAG,GAAG,GAAG,CAAC,SAAS,CAAC,GAAG,CAAC,CAAC;oBAC/B,IAAI,CAAC,IAAI,CAAC,yBAAkB,GAAG,aAAH,GAAG,uBAAH,GAAG,CAAE,mBAAmB,CAAE,CAAC,CAAC;gBAC1D,CAAC;aACF,CAAC;YACF,GAAG,CAAC,MAAM,CAAC,MAAM,CAAC,CAAC;SACpB;QACD,MAAM;aACH,OAAO,CAAC,MAAM,CAAC;aACf,IAAI,CAAC,UAAC,IAAI,IAAK,OAAA,IAAA,gBAAS,EAAC,IAAI,CAAC,EAAf,CAAe,CAAC;aAC/B,KAAK,CAAC,UAAC,GAAG,IAAK,OAAA,IAAI,CAAC,SAAS,CAAC,GAAG,CAAC,EAAnB,CAAmB,CAAC,CAAC;;;KACxC,CAAC;AApBW,QAAA,oBAAoB,wBAoB/B"} \ No newline at end of file diff --git a/node_modules/.bin/js-yaml b/node_modules/.bin/js-yaml new file mode 120000 index 0000000..9dbd010 --- /dev/null +++ b/node_modules/.bin/js-yaml @@ -0,0 +1 @@ +../js-yaml/bin/js-yaml.js \ No newline at end of file diff --git a/node_modules/.package-lock.json b/node_modules/.package-lock.json new file mode 100644 index 0000000..378d789 --- /dev/null +++ b/node_modules/.package-lock.json @@ -0,0 +1,138 @@ +{ + "name": "curl", + "version": "1.0.0", + "lockfileVersion": 2, + "requires": true, + "packages": { + "node_modules/@actions/core": { + "version": "1.6.0", + "resolved": "https://registry.npmjs.org/@actions/core/-/core-1.6.0.tgz", + "integrity": "sha512-NB1UAZomZlCV/LmJqkLhNTqtKfFXJZAUPcfl/zqG7EfsQdeUJtaWO98SGbuQ3pydJ3fHl2CvI/51OKYlCYYcaw==", + "dependencies": { + "@actions/http-client": "^1.0.11" + } + }, + "node_modules/@actions/http-client": { + "version": "1.0.11", + "resolved": "https://registry.npmjs.org/@actions/http-client/-/http-client-1.0.11.tgz", + "integrity": "sha512-VRYHGQV1rqnROJqdMvGUbY/Kn8vriQe/F9HR2AlYHzmKuM/p3kjNuXhmdBfcVgsvRWTz5C5XW5xvndZrVBuAYg==", + "dependencies": { + "tunnel": "0.0.6" + } + }, + "node_modules/@babel/runtime": { + "version": "7.17.8", + "resolved": "https://registry.npmjs.org/@babel/runtime/-/runtime-7.17.8.tgz", + "integrity": "sha512-dQpEpK0O9o6lj6oPu0gRDbbnk+4LeHlNcBpspf6Olzt3GIX4P1lWF1gS+pHLDFlaJvbR6q7jCfQ08zA4QJBnmA==", + "dependencies": { + "regenerator-runtime": "^0.13.4" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@types/js-yaml": { + "version": "4.0.5", + "resolved": "https://registry.npmjs.org/@types/js-yaml/-/js-yaml-4.0.5.tgz", + "integrity": "sha512-FhpRzf927MNQdRZP0J5DLIdTXhjLYzeUTmLAu69mnVksLH9CJY3IuSeEgbKUki7GQZm0WqDkGzyxju2EZGD2wA==" + }, + "node_modules/@types/node": { + "version": "13.11.1", + "resolved": "https://registry.npmjs.org/@types/node/-/node-13.11.1.tgz", + "integrity": "sha512-eWQGP3qtxwL8FGneRrC5DwrJLGN4/dH1clNTuLfN81HCrxVtxRjygDTUoZJ5ASlDEeo0ppYFQjQIlXhtXpOn6g==", + "dev": true + }, + "node_modules/argparse": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/argparse/-/argparse-2.0.1.tgz", + "integrity": "sha512-8+9WqebbFzpX9OR+Wa6O29asIogeRMzcGtAINdpMHHyAg10f05aSFVBbcEqGf/PXw1EjAZ+q2/bEBg3DvurK3Q==" + }, + "node_modules/axios": { + "version": "0.26.1", + "resolved": "https://registry.npmjs.org/axios/-/axios-0.26.1.tgz", + "integrity": "sha512-fPwcX4EvnSHuInCMItEhAGnaSEXRBjtzh9fOtsE6E1G6p7vl7edEeZe11QHf18+6+9gR5PbKV/sGKNaD8YaMeA==", + "dependencies": { + "follow-redirects": "^1.14.8" + } + }, + "node_modules/axios-retry": { + "version": "3.2.4", + "resolved": "https://registry.npmjs.org/axios-retry/-/axios-retry-3.2.4.tgz", + "integrity": "sha512-Co3UXiv4npi6lM963mfnuH90/YFLKWWDmoBYfxkHT5xtkSSWNqK9zdG3fw5/CP/dsoKB5aMMJCsgab+tp1OxLQ==", + "dependencies": { + "@babel/runtime": "^7.15.4", + "is-retry-allowed": "^2.2.0" + } + }, + "node_modules/follow-redirects": { + "version": "1.14.9", + "resolved": "https://registry.npmjs.org/follow-redirects/-/follow-redirects-1.14.9.tgz", + "integrity": "sha512-MQDfihBQYMcyy5dhRDJUHcw7lb2Pv/TuE6xP1vyraLukNDHKbDxDNaOE3NbCAdKQApno+GPRyo1YAp89yCjK4w==", + "funding": [ + { + "type": "individual", + "url": "https://github.com/sponsors/RubenVerborgh" + } + ], + "engines": { + "node": ">=4.0" + }, + "peerDependenciesMeta": { + "debug": { + "optional": true + } + } + }, + "node_modules/fs": { + "version": "0.0.1-security", + "resolved": "https://registry.npmjs.org/fs/-/fs-0.0.1-security.tgz", + "integrity": "sha1-invTcYa23d84E/I4WLV+yq9eQdQ=" + }, + "node_modules/is-retry-allowed": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/is-retry-allowed/-/is-retry-allowed-2.2.0.tgz", + "integrity": "sha512-XVm7LOeLpTW4jV19QSH38vkswxoLud8sQ57YwJVTPWdiaI9I8keEhGFpBlslyVsgdQy4Opg8QOLb8YRgsyZiQg==", + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/js-yaml": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/js-yaml/-/js-yaml-4.1.0.tgz", + "integrity": "sha512-wpxZs9NoxZaJESJGIZTyDEaYpl0FKSA+FB9aJiyemKhMwkxQg63h4T1KJgUGHpTqPDNRcmmYLugrRjJlBtWvRA==", + "dependencies": { + "argparse": "^2.0.1" + }, + "bin": { + "js-yaml": "bin/js-yaml.js" + } + }, + "node_modules/regenerator-runtime": { + "version": "0.13.9", + "resolved": "https://registry.npmjs.org/regenerator-runtime/-/regenerator-runtime-0.13.9.tgz", + "integrity": "sha512-p3VT+cOEgxFsRRA9X4lkI1E+k2/CtnKtU4gcxyaCUreilL/vqI6CdZ3wxVUx3UOUg+gnUOQQcRI7BmSI656MYA==" + }, + "node_modules/retry-axios": { + "version": "2.6.0", + "resolved": "https://registry.npmjs.org/retry-axios/-/retry-axios-2.6.0.tgz", + "integrity": "sha512-pOLi+Gdll3JekwuFjXO3fTq+L9lzMQGcSq7M5gIjExcl3Gu1hd4XXuf5o3+LuSBsaULQH7DiNbsqPd1chVpQGQ==", + "engines": { + "node": ">=10.7.0" + }, + "peerDependencies": { + "axios": "*" + } + }, + "node_modules/tunnel": { + "version": "0.0.6", + "resolved": "https://registry.npmjs.org/tunnel/-/tunnel-0.0.6.tgz", + "integrity": "sha512-1h/Lnq9yajKY2PEbBadPXj3VxsDDu844OnaAo52UVmIzIvwwtBPIuNvkjuzBlTWpfJyUbG3ez0KSBibQkj4ojg==", + "engines": { + "node": ">=0.6.11 <=0.7.0 || >=0.7.3" + } + } + } +} diff --git a/node_modules/@actions/core/LICENSE.md b/node_modules/@actions/core/LICENSE.md new file mode 100644 index 0000000..dbae2ed --- /dev/null +++ b/node_modules/@actions/core/LICENSE.md @@ -0,0 +1,9 @@ +The MIT License (MIT) + +Copyright 2019 GitHub + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. \ No newline at end of file diff --git a/node_modules/@actions/core/README.md b/node_modules/@actions/core/README.md index 5ad27ee..8f227a8 100644 --- a/node_modules/@actions/core/README.md +++ b/node_modules/@actions/core/README.md @@ -16,11 +16,14 @@ import * as core from '@actions/core'; #### Inputs/Outputs -Action inputs can be read with `getInput`. Outputs can be set with `setOutput` which makes them available to be mapped into inputs of other actions to ensure they are decoupled. +Action inputs can be read with `getInput` which returns a `string` or `getBooleanInput` which parses a boolean based on the [yaml 1.2 specification](https://yaml.org/spec/1.2/spec.html#id2804923). If `required` set to be false, the input should have a default value in `action.yml`. + +Outputs can be set with `setOutput` which makes them available to be mapped into inputs of other actions to ensure they are decoupled. ```js const myInput = core.getInput('inputName', { required: true }); - +const myBooleanInput = core.getBooleanInput('booleanInputName', { required: true }); +const myMultilineInput = core.getMultilineInput('multilineInputName', { required: true }); core.setOutput('outputKey', 'outputVal'); ``` @@ -62,11 +65,10 @@ catch (err) { // setFailed logs the message and sets a failing exit code core.setFailed(`Action failed with error ${err}`); } +``` Note that `setNeutral` is not yet implemented in actions V2 but equivalent functionality is being planned. -``` - #### Logging Finally, this library provides some utilities for logging. Note that debug logging is hidden from the logs by default. This behavior can be toggled by enabling the [Step Debug Logs](../../docs/action-debugging.md#step-debug-logs). @@ -89,6 +91,9 @@ try { } // Do stuff + core.info('Output to the actions build log') + + core.notice('This is a message that will also emit an annotation') } catch (err) { core.error(`Error ${err}, action may still succeed though`); @@ -112,11 +117,123 @@ const result = await core.group('Do something async', async () => { }) ``` +#### Annotations + +This library has 3 methods that will produce [annotations](https://docs.github.com/en/rest/reference/checks#create-a-check-run). +```js +core.error('This is a bad error. This will also fail the build.') + +core.warning('Something went wrong, but it\'s not bad enough to fail the build.') + +core.notice('Something happened that you might want to know about.') +``` + +These will surface to the UI in the Actions page and on Pull Requests. They look something like this: + +![Annotations Image](../../docs/assets/annotations.png) + +These annotations can also be attached to particular lines and columns of your source files to show exactly where a problem is occuring. + +These options are: +```typescript +export interface AnnotationProperties { + /** + * A title for the annotation. + */ + title?: string + + /** + * The name of the file for which the annotation should be created. + */ + file?: string + + /** + * The start line for the annotation. + */ + startLine?: number + + /** + * The end line for the annotation. Defaults to `startLine` when `startLine` is provided. + */ + endLine?: number + + /** + * The start column for the annotation. Cannot be sent when `startLine` and `endLine` are different values. + */ + startColumn?: number + + /** + * The start column for the annotation. Cannot be sent when `startLine` and `endLine` are different values. + * Defaults to `startColumn` when `startColumn` is provided. + */ + endColumn?: number +} +``` + +#### Styling output + +Colored output is supported in the Action logs via standard [ANSI escape codes](https://en.wikipedia.org/wiki/ANSI_escape_code). 3/4 bit, 8 bit and 24 bit colors are all supported. + +Foreground colors: + +```js +// 3/4 bit +core.info('\u001b[35mThis foreground will be magenta') + +// 8 bit +core.info('\u001b[38;5;6mThis foreground will be cyan') + +// 24 bit +core.info('\u001b[38;2;255;0;0mThis foreground will be bright red') +``` + +Background colors: + +```js +// 3/4 bit +core.info('\u001b[43mThis background will be yellow'); + +// 8 bit +core.info('\u001b[48;5;6mThis background will be cyan') + +// 24 bit +core.info('\u001b[48;2;255;0;0mThis background will be bright red') +``` + +Special styles: + +```js +core.info('\u001b[1mBold text') +core.info('\u001b[3mItalic text') +core.info('\u001b[4mUnderlined text') +``` + +ANSI escape codes can be combined with one another: + +```js +core.info('\u001b[31;46mRed foreground with a cyan background and \u001b[1mbold text at the end'); +``` + +> Note: Escape codes reset at the start of each line + +```js +core.info('\u001b[35mThis foreground will be magenta') +core.info('This foreground will reset to the default') +``` + +Manually typing escape codes can be a little difficult, but you can use third party modules such as [ansi-styles](https://github.com/chalk/ansi-styles). + +```js +const style = require('ansi-styles'); +core.info(style.color.ansi16m.hex('#abcdef') + 'Hello world!') +``` + #### Action state -You can use this library to save state and get state for sharing information between a given wrapper action: +You can use this library to save state and get state for sharing information between a given wrapper action: + +**action.yml**: -**action.yml** ```yaml name: 'Wrapper action sample' inputs: @@ -137,10 +254,59 @@ core.saveState("pidToKill", 12345); ``` In action's `cleanup.js`: + ```js const core = require('@actions/core'); var pid = core.getState("pidToKill"); process.kill(pid); +``` + +#### OIDC Token + +You can use these methods to interact with the GitHub OIDC provider and get a JWT ID token which would help to get access token from third party cloud providers. + +**Method Name**: getIDToken() + +**Inputs** + +audience : optional + +**Outputs** + +A [JWT](https://jwt.io/) ID Token + +In action's `main.ts`: +```js +const core = require('@actions/core'); +async function getIDTokenAction(): Promise { + + const audience = core.getInput('audience', {required: false}) + + const id_token1 = await core.getIDToken() // ID Token with default audience + const id_token2 = await core.getIDToken(audience) // ID token with custom audience + + // this id_token can be used to get access token from third party cloud providers +} +getIDTokenAction() +``` + +In action's `actions.yml`: + +```yaml +name: 'GetIDToken' +description: 'Get ID token from Github OIDC provider' +inputs: + audience: + description: 'Audience for which the ID token is intended for' + required: false +outputs: + id_token1: + description: 'ID token obtained from OIDC provider' + id_token2: + description: 'ID token obtained from OIDC provider' +runs: + using: 'node12' + main: 'dist/index.js' ``` \ No newline at end of file diff --git a/node_modules/@actions/core/lib/command.d.ts b/node_modules/@actions/core/lib/command.d.ts index 51b8f11..53f8f4b 100644 --- a/node_modules/@actions/core/lib/command.d.ts +++ b/node_modules/@actions/core/lib/command.d.ts @@ -1,5 +1,5 @@ -interface CommandProperties { - [key: string]: string; +export interface CommandProperties { + [key: string]: any; } /** * Commands @@ -11,6 +11,5 @@ interface CommandProperties { * ::warning::This is the message * ::set-env name=MY_VAR::some value */ -export declare function issueCommand(command: string, properties: CommandProperties, message: string): void; +export declare function issueCommand(command: string, properties: CommandProperties, message: any): void; export declare function issue(name: string, message?: string): void; -export {}; diff --git a/node_modules/@actions/core/lib/command.js b/node_modules/@actions/core/lib/command.js index eeef233..0b28c66 100644 --- a/node_modules/@actions/core/lib/command.js +++ b/node_modules/@actions/core/lib/command.js @@ -1,13 +1,27 @@ "use strict"; +var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; } }); +}) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; +})); +var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) { + Object.defineProperty(o, "default", { enumerable: true, value: v }); +}) : function(o, v) { + o["default"] = v; +}); var __importStar = (this && this.__importStar) || function (mod) { if (mod && mod.__esModule) return mod; var result = {}; - if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k]; - result["default"] = mod; + if (mod != null) for (var k in mod) if (k !== "default" && Object.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + __setModuleDefault(result, mod); return result; }; Object.defineProperty(exports, "__esModule", { value: true }); +exports.issue = exports.issueCommand = void 0; const os = __importStar(require("os")); +const utils_1 = require("./utils"); /** * Commands * @@ -62,13 +76,13 @@ class Command { } } function escapeData(s) { - return (s || '') + return utils_1.toCommandValue(s) .replace(/%/g, '%25') .replace(/\r/g, '%0D') .replace(/\n/g, '%0A'); } function escapeProperty(s) { - return (s || '') + return utils_1.toCommandValue(s) .replace(/%/g, '%25') .replace(/\r/g, '%0D') .replace(/\n/g, '%0A') diff --git a/node_modules/@actions/core/lib/command.js.map b/node_modules/@actions/core/lib/command.js.map index 00a9861..51c7c63 100644 --- a/node_modules/@actions/core/lib/command.js.map +++ b/node_modules/@actions/core/lib/command.js.map @@ -1 +1 @@ -{"version":3,"file":"command.js","sourceRoot":"","sources":["../src/command.ts"],"names":[],"mappings":";;;;;;;;;AAAA,uCAAwB;AAQxB;;;;;;;;;GASG;AACH,SAAgB,YAAY,CAC1B,OAAe,EACf,UAA6B,EAC7B,OAAe;IAEf,MAAM,GAAG,GAAG,IAAI,OAAO,CAAC,OAAO,EAAE,UAAU,EAAE,OAAO,CAAC,CAAA;IACrD,OAAO,CAAC,MAAM,CAAC,KAAK,CAAC,GAAG,CAAC,QAAQ,EAAE,GAAG,EAAE,CAAC,GAAG,CAAC,CAAA;AAC/C,CAAC;AAPD,oCAOC;AAED,SAAgB,KAAK,CAAC,IAAY,EAAE,UAAkB,EAAE;IACtD,YAAY,CAAC,IAAI,EAAE,EAAE,EAAE,OAAO,CAAC,CAAA;AACjC,CAAC;AAFD,sBAEC;AAED,MAAM,UAAU,GAAG,IAAI,CAAA;AAEvB,MAAM,OAAO;IAKX,YAAY,OAAe,EAAE,UAA6B,EAAE,OAAe;QACzE,IAAI,CAAC,OAAO,EAAE;YACZ,OAAO,GAAG,iBAAiB,CAAA;SAC5B;QAED,IAAI,CAAC,OAAO,GAAG,OAAO,CAAA;QACtB,IAAI,CAAC,UAAU,GAAG,UAAU,CAAA;QAC5B,IAAI,CAAC,OAAO,GAAG,OAAO,CAAA;IACxB,CAAC;IAED,QAAQ;QACN,IAAI,MAAM,GAAG,UAAU,GAAG,IAAI,CAAC,OAAO,CAAA;QAEtC,IAAI,IAAI,CAAC,UAAU,IAAI,MAAM,CAAC,IAAI,CAAC,IAAI,CAAC,UAAU,CAAC,CAAC,MAAM,GAAG,CAAC,EAAE;YAC9D,MAAM,IAAI,GAAG,CAAA;YACb,IAAI,KAAK,GAAG,IAAI,CAAA;YAChB,KAAK,MAAM,GAAG,IAAI,IAAI,CAAC,UAAU,EAAE;gBACjC,IAAI,IAAI,CAAC,UAAU,CAAC,cAAc,CAAC,GAAG,CAAC,EAAE;oBACvC,MAAM,GAAG,GAAG,IAAI,CAAC,UAAU,CAAC,GAAG,CAAC,CAAA;oBAChC,IAAI,GAAG,EAAE;wBACP,IAAI,KAAK,EAAE;4BACT,KAAK,GAAG,KAAK,CAAA;yBACd;6BAAM;4BACL,MAAM,IAAI,GAAG,CAAA;yBACd;wBAED,MAAM,IAAI,GAAG,GAAG,IAAI,cAAc,CAAC,GAAG,CAAC,EAAE,CAAA;qBAC1C;iBACF;aACF;SACF;QAED,MAAM,IAAI,GAAG,UAAU,GAAG,UAAU,CAAC,IAAI,CAAC,OAAO,CAAC,EAAE,CAAA;QACpD,OAAO,MAAM,CAAA;IACf,CAAC;CACF;AAED,SAAS,UAAU,CAAC,CAAS;IAC3B,OAAO,CAAC,CAAC,IAAI,EAAE,CAAC;SACb,OAAO,CAAC,IAAI,EAAE,KAAK,CAAC;SACpB,OAAO,CAAC,KAAK,EAAE,KAAK,CAAC;SACrB,OAAO,CAAC,KAAK,EAAE,KAAK,CAAC,CAAA;AAC1B,CAAC;AAED,SAAS,cAAc,CAAC,CAAS;IAC/B,OAAO,CAAC,CAAC,IAAI,EAAE,CAAC;SACb,OAAO,CAAC,IAAI,EAAE,KAAK,CAAC;SACpB,OAAO,CAAC,KAAK,EAAE,KAAK,CAAC;SACrB,OAAO,CAAC,KAAK,EAAE,KAAK,CAAC;SACrB,OAAO,CAAC,IAAI,EAAE,KAAK,CAAC;SACpB,OAAO,CAAC,IAAI,EAAE,KAAK,CAAC,CAAA;AACzB,CAAC"} \ No newline at end of file +{"version":3,"file":"command.js","sourceRoot":"","sources":["../src/command.ts"],"names":[],"mappings":";;;;;;;;;;;;;;;;;;;;;;AAAA,uCAAwB;AACxB,mCAAsC;AAWtC;;;;;;;;;GASG;AACH,SAAgB,YAAY,CAC1B,OAAe,EACf,UAA6B,EAC7B,OAAY;IAEZ,MAAM,GAAG,GAAG,IAAI,OAAO,CAAC,OAAO,EAAE,UAAU,EAAE,OAAO,CAAC,CAAA;IACrD,OAAO,CAAC,MAAM,CAAC,KAAK,CAAC,GAAG,CAAC,QAAQ,EAAE,GAAG,EAAE,CAAC,GAAG,CAAC,CAAA;AAC/C,CAAC;AAPD,oCAOC;AAED,SAAgB,KAAK,CAAC,IAAY,EAAE,OAAO,GAAG,EAAE;IAC9C,YAAY,CAAC,IAAI,EAAE,EAAE,EAAE,OAAO,CAAC,CAAA;AACjC,CAAC;AAFD,sBAEC;AAED,MAAM,UAAU,GAAG,IAAI,CAAA;AAEvB,MAAM,OAAO;IAKX,YAAY,OAAe,EAAE,UAA6B,EAAE,OAAe;QACzE,IAAI,CAAC,OAAO,EAAE;YACZ,OAAO,GAAG,iBAAiB,CAAA;SAC5B;QAED,IAAI,CAAC,OAAO,GAAG,OAAO,CAAA;QACtB,IAAI,CAAC,UAAU,GAAG,UAAU,CAAA;QAC5B,IAAI,CAAC,OAAO,GAAG,OAAO,CAAA;IACxB,CAAC;IAED,QAAQ;QACN,IAAI,MAAM,GAAG,UAAU,GAAG,IAAI,CAAC,OAAO,CAAA;QAEtC,IAAI,IAAI,CAAC,UAAU,IAAI,MAAM,CAAC,IAAI,CAAC,IAAI,CAAC,UAAU,CAAC,CAAC,MAAM,GAAG,CAAC,EAAE;YAC9D,MAAM,IAAI,GAAG,CAAA;YACb,IAAI,KAAK,GAAG,IAAI,CAAA;YAChB,KAAK,MAAM,GAAG,IAAI,IAAI,CAAC,UAAU,EAAE;gBACjC,IAAI,IAAI,CAAC,UAAU,CAAC,cAAc,CAAC,GAAG,CAAC,EAAE;oBACvC,MAAM,GAAG,GAAG,IAAI,CAAC,UAAU,CAAC,GAAG,CAAC,CAAA;oBAChC,IAAI,GAAG,EAAE;wBACP,IAAI,KAAK,EAAE;4BACT,KAAK,GAAG,KAAK,CAAA;yBACd;6BAAM;4BACL,MAAM,IAAI,GAAG,CAAA;yBACd;wBAED,MAAM,IAAI,GAAG,GAAG,IAAI,cAAc,CAAC,GAAG,CAAC,EAAE,CAAA;qBAC1C;iBACF;aACF;SACF;QAED,MAAM,IAAI,GAAG,UAAU,GAAG,UAAU,CAAC,IAAI,CAAC,OAAO,CAAC,EAAE,CAAA;QACpD,OAAO,MAAM,CAAA;IACf,CAAC;CACF;AAED,SAAS,UAAU,CAAC,CAAM;IACxB,OAAO,sBAAc,CAAC,CAAC,CAAC;SACrB,OAAO,CAAC,IAAI,EAAE,KAAK,CAAC;SACpB,OAAO,CAAC,KAAK,EAAE,KAAK,CAAC;SACrB,OAAO,CAAC,KAAK,EAAE,KAAK,CAAC,CAAA;AAC1B,CAAC;AAED,SAAS,cAAc,CAAC,CAAM;IAC5B,OAAO,sBAAc,CAAC,CAAC,CAAC;SACrB,OAAO,CAAC,IAAI,EAAE,KAAK,CAAC;SACpB,OAAO,CAAC,KAAK,EAAE,KAAK,CAAC;SACrB,OAAO,CAAC,KAAK,EAAE,KAAK,CAAC;SACrB,OAAO,CAAC,IAAI,EAAE,KAAK,CAAC;SACpB,OAAO,CAAC,IAAI,EAAE,KAAK,CAAC,CAAA;AACzB,CAAC"} \ No newline at end of file diff --git a/node_modules/@actions/core/lib/core.d.ts b/node_modules/@actions/core/lib/core.d.ts index 8fcc31b..356872e 100644 --- a/node_modules/@actions/core/lib/core.d.ts +++ b/node_modules/@actions/core/lib/core.d.ts @@ -4,6 +4,8 @@ export interface InputOptions { /** Optional. Whether the input is required. If required and not present, will throw. Defaults to false */ required?: boolean; + /** Optional. Whether leading/trailing whitespace will be trimmed for the input. Defaults to true */ + trimWhitespace?: boolean; } /** * The code to exit an action @@ -18,12 +20,43 @@ export declare enum ExitCode { */ Failure = 1 } +/** + * Optional properties that can be sent with annotatation commands (notice, error, and warning) + * See: https://docs.github.com/en/rest/reference/checks#create-a-check-run for more information about annotations. + */ +export interface AnnotationProperties { + /** + * A title for the annotation. + */ + title?: string; + /** + * The path of the file for which the annotation should be created. + */ + file?: string; + /** + * The start line for the annotation. + */ + startLine?: number; + /** + * The end line for the annotation. Defaults to `startLine` when `startLine` is provided. + */ + endLine?: number; + /** + * The start column for the annotation. Cannot be sent when `startLine` and `endLine` are different values. + */ + startColumn?: number; + /** + * The start column for the annotation. Cannot be sent when `startLine` and `endLine` are different values. + * Defaults to `startColumn` when `startColumn` is provided. + */ + endColumn?: number; +} /** * Sets env variable for this action and future actions in the job * @param name the name of the variable to set - * @param val the value of the variable + * @param val the value of the variable. Non-string values will be converted to a string via JSON.stringify */ -export declare function exportVariable(name: string, val: string): void; +export declare function exportVariable(name: string, val: any): void; /** * Registers a secret which will get masked from logs * @param secret value of the secret @@ -35,26 +68,54 @@ export declare function setSecret(secret: string): void; */ export declare function addPath(inputPath: string): void; /** - * Gets the value of an input. The value is also trimmed. + * Gets the value of an input. + * Unless trimWhitespace is set to false in InputOptions, the value is also trimmed. + * Returns an empty string if the value is not defined. * * @param name name of the input to get * @param options optional. See InputOptions. * @returns string */ export declare function getInput(name: string, options?: InputOptions): string; +/** + * Gets the values of an multiline input. Each value is also trimmed. + * + * @param name name of the input to get + * @param options optional. See InputOptions. + * @returns string[] + * + */ +export declare function getMultilineInput(name: string, options?: InputOptions): string[]; +/** + * Gets the input value of the boolean type in the YAML 1.2 "core schema" specification. + * Support boolean input list: `true | True | TRUE | false | False | FALSE` . + * The return value is also in boolean type. + * ref: https://yaml.org/spec/1.2/spec.html#id2804923 + * + * @param name name of the input to get + * @param options optional. See InputOptions. + * @returns boolean + */ +export declare function getBooleanInput(name: string, options?: InputOptions): boolean; /** * Sets the value of an output. * * @param name name of the output to set - * @param value value to store + * @param value value to store. Non-string values will be converted to a string via JSON.stringify */ -export declare function setOutput(name: string, value: string): void; +export declare function setOutput(name: string, value: any): void; +/** + * Enables or disables the echoing of commands into stdout for the rest of the step. + * Echoing is disabled by default if ACTIONS_STEP_DEBUG is not set. + * + */ +export declare function setCommandEcho(enabled: boolean): void; /** * Sets the action status to failed. * When the action exits it will be with an exit code of 1 * @param message add error issue message */ -export declare function setFailed(message: string): void; +export declare function setFailed(message: string | Error): void; /** * Gets whether Actions Step Debug is on or not */ @@ -66,14 +127,22 @@ export declare function isDebug(): boolean; export declare function debug(message: string): void; /** * Adds an error issue - * @param message error issue message + * @param message error issue message. Errors will be converted to string via toString() + * @param properties optional properties to add to the annotation. */ -export declare function error(message: string): void; +export declare function error(message: string | Error, properties?: AnnotationProperties): void; /** - * Adds an warning issue - * @param message warning issue message + * Adds a warning issue + * @param message warning issue message. Errors will be converted to string via toString() + * @param properties optional properties to add to the annotation. */ -export declare function warning(message: string): void; +export declare function warning(message: string | Error, properties?: AnnotationProperties): void; +/** + * Adds a notice issue + * @param message notice issue message. Errors will be converted to string via toString() + * @param properties optional properties to add to the annotation. + */ +export declare function notice(message: string | Error, properties?: AnnotationProperties): void; /** * Writes info to log with console.log. * @param message info message @@ -104,9 +173,9 @@ export declare function group(name: string, fn: () => Promise): Promise * Saves state for current action, the state can only be retrieved by this action's post job execution. * * @param name name of the state to store - * @param value value to store + * @param value value to store. Non-string values will be converted to a string via JSON.stringify */ -export declare function saveState(name: string, value: string): void; +export declare function saveState(name: string, value: any): void; /** * Gets the value of an state set by this action's main execution. * @@ -114,3 +183,4 @@ export declare function saveState(name: string, value: string): void; * @returns string */ export declare function getState(name: string): string; +export declare function getIDToken(aud?: string): Promise; diff --git a/node_modules/@actions/core/lib/core.js b/node_modules/@actions/core/lib/core.js index b7ec8ab..e0ceced 100644 --- a/node_modules/@actions/core/lib/core.js +++ b/node_modules/@actions/core/lib/core.js @@ -1,4 +1,23 @@ "use strict"; +var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; } }); +}) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; +})); +var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) { + Object.defineProperty(o, "default", { enumerable: true, value: v }); +}) : function(o, v) { + o["default"] = v; +}); +var __importStar = (this && this.__importStar) || function (mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) for (var k in mod) if (k !== "default" && Object.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + __setModuleDefault(result, mod); + return result; +}; var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } return new (P || (P = Promise))(function (resolve, reject) { @@ -8,17 +27,14 @@ var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, ge step((generator = generator.apply(thisArg, _arguments || [])).next()); }); }; -var __importStar = (this && this.__importStar) || function (mod) { - if (mod && mod.__esModule) return mod; - var result = {}; - if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k]; - result["default"] = mod; - return result; -}; Object.defineProperty(exports, "__esModule", { value: true }); +exports.getIDToken = exports.getState = exports.saveState = exports.group = exports.endGroup = exports.startGroup = exports.info = exports.notice = exports.warning = exports.error = exports.debug = exports.isDebug = exports.setFailed = exports.setCommandEcho = exports.setOutput = exports.getBooleanInput = exports.getMultilineInput = exports.getInput = exports.addPath = exports.setSecret = exports.exportVariable = exports.ExitCode = void 0; const command_1 = require("./command"); +const file_command_1 = require("./file-command"); +const utils_1 = require("./utils"); const os = __importStar(require("os")); const path = __importStar(require("path")); +const oidc_utils_1 = require("./oidc-utils"); /** * The code to exit an action */ @@ -39,11 +55,21 @@ var ExitCode; /** * Sets env variable for this action and future actions in the job * @param name the name of the variable to set - * @param val the value of the variable + * @param val the value of the variable. Non-string values will be converted to a string via JSON.stringify */ +// eslint-disable-next-line @typescript-eslint/no-explicit-any function exportVariable(name, val) { - process.env[name] = val; - command_1.issueCommand('set-env', { name }, val); + const convertedVal = utils_1.toCommandValue(val); + process.env[name] = convertedVal; + const filePath = process.env['GITHUB_ENV'] || ''; + if (filePath) { + const delimiter = '_GitHubActionsFileCommandDelimeter_'; + const commandValue = `${name}<<${delimiter}${os.EOL}${convertedVal}${os.EOL}${delimiter}`; + file_command_1.issueCommand('ENV', commandValue); + } + else { + command_1.issueCommand('set-env', { name }, convertedVal); + } } exports.exportVariable = exportVariable; /** @@ -59,12 +85,20 @@ exports.setSecret = setSecret; * @param inputPath */ function addPath(inputPath) { - command_1.issueCommand('add-path', {}, inputPath); + const filePath = process.env['GITHUB_PATH'] || ''; + if (filePath) { + file_command_1.issueCommand('PATH', inputPath); + } + else { + command_1.issueCommand('add-path', {}, inputPath); + } process.env['PATH'] = `${inputPath}${path.delimiter}${process.env['PATH']}`; } exports.addPath = addPath; /** - * Gets the value of an input. The value is also trimmed. + * Gets the value of an input. + * Unless trimWhitespace is set to false in InputOptions, the value is also trimmed. + * Returns an empty string if the value is not defined. * * @param name name of the input to get * @param options optional. See InputOptions. @@ -75,19 +109,70 @@ function getInput(name, options) { if (options && options.required && !val) { throw new Error(`Input required and not supplied: ${name}`); } + if (options && options.trimWhitespace === false) { + return val; + } return val.trim(); } exports.getInput = getInput; +/** + * Gets the values of an multiline input. Each value is also trimmed. + * + * @param name name of the input to get + * @param options optional. See InputOptions. + * @returns string[] + * + */ +function getMultilineInput(name, options) { + const inputs = getInput(name, options) + .split('\n') + .filter(x => x !== ''); + return inputs; +} +exports.getMultilineInput = getMultilineInput; +/** + * Gets the input value of the boolean type in the YAML 1.2 "core schema" specification. + * Support boolean input list: `true | True | TRUE | false | False | FALSE` . + * The return value is also in boolean type. + * ref: https://yaml.org/spec/1.2/spec.html#id2804923 + * + * @param name name of the input to get + * @param options optional. See InputOptions. + * @returns boolean + */ +function getBooleanInput(name, options) { + const trueValue = ['true', 'True', 'TRUE']; + const falseValue = ['false', 'False', 'FALSE']; + const val = getInput(name, options); + if (trueValue.includes(val)) + return true; + if (falseValue.includes(val)) + return false; + throw new TypeError(`Input does not meet YAML 1.2 "Core Schema" specification: ${name}\n` + + `Support boolean input list: \`true | True | TRUE | false | False | FALSE\``); +} +exports.getBooleanInput = getBooleanInput; /** * Sets the value of an output. * * @param name name of the output to set - * @param value value to store + * @param value value to store. Non-string values will be converted to a string via JSON.stringify */ +// eslint-disable-next-line @typescript-eslint/no-explicit-any function setOutput(name, value) { + process.stdout.write(os.EOL); command_1.issueCommand('set-output', { name }, value); } exports.setOutput = setOutput; +/** + * Enables or disables the echoing of commands into stdout for the rest of the step. + * Echoing is disabled by default if ACTIONS_STEP_DEBUG is not set. + * + */ +function setCommandEcho(enabled) { + command_1.issue('echo', enabled ? 'on' : 'off'); +} +exports.setCommandEcho = setCommandEcho; //----------------------------------------------------------------------- // Results //----------------------------------------------------------------------- @@ -121,20 +206,31 @@ function debug(message) { exports.debug = debug; /** * Adds an error issue - * @param message error issue message + * @param message error issue message. Errors will be converted to string via toString() + * @param properties optional properties to add to the annotation. */ -function error(message) { - command_1.issue('error', message); +function error(message, properties = {}) { + command_1.issueCommand('error', utils_1.toCommandProperties(properties), message instanceof Error ? message.toString() : message); } exports.error = error; /** - * Adds an warning issue - * @param message warning issue message + * Adds a warning issue + * @param message warning issue message. Errors will be converted to string via toString() + * @param properties optional properties to add to the annotation. */ -function warning(message) { - command_1.issue('warning', message); +function warning(message, properties = {}) { + command_1.issueCommand('warning', utils_1.toCommandProperties(properties), message instanceof Error ? message.toString() : message); } exports.warning = warning; +/** + * Adds a notice issue + * @param message notice issue message. Errors will be converted to string via toString() + * @param properties optional properties to add to the annotation. + */ +function notice(message, properties = {}) { + command_1.issueCommand('notice', utils_1.toCommandProperties(properties), message instanceof Error ? message.toString() : message); +} +exports.notice = notice; /** * Writes info to log with console.log. * @param message info message @@ -190,8 +286,9 @@ exports.group = group; * Saves state for current action, the state can only be retrieved by this action's post job execution. * * @param name name of the state to store - * @param value value to store + * @param value value to store. Non-string values will be converted to a string via JSON.stringify */ +// eslint-disable-next-line @typescript-eslint/no-explicit-any function saveState(name, value) { command_1.issueCommand('save-state', { name }, value); } @@ -206,4 +303,10 @@ function getState(name) { return process.env[`STATE_${name}`] || ''; } exports.getState = getState; +function getIDToken(aud) { + return __awaiter(this, void 0, void 0, function* () { + return yield oidc_utils_1.OidcClient.getIDToken(aud); + }); +} +exports.getIDToken = getIDToken; //# sourceMappingURL=core.js.map \ No newline at end of file diff --git a/node_modules/@actions/core/lib/core.js.map b/node_modules/@actions/core/lib/core.js.map index fb93bd3..087a91d 100644 --- a/node_modules/@actions/core/lib/core.js.map +++ b/node_modules/@actions/core/lib/core.js.map @@ -1 +1 @@ -{"version":3,"file":"core.js","sourceRoot":"","sources":["../src/core.ts"],"names":[],"mappings":";;;;;;;;;;;;;;;;;;AAAA,uCAA6C;AAE7C,uCAAwB;AACxB,2CAA4B;AAU5B;;GAEG;AACH,IAAY,QAUX;AAVD,WAAY,QAAQ;IAClB;;OAEG;IACH,6CAAW,CAAA;IAEX;;OAEG;IACH,6CAAW,CAAA;AACb,CAAC,EAVW,QAAQ,GAAR,gBAAQ,KAAR,gBAAQ,QAUnB;AAED,yEAAyE;AACzE,YAAY;AACZ,yEAAyE;AAEzE;;;;GAIG;AACH,SAAgB,cAAc,CAAC,IAAY,EAAE,GAAW;IACtD,OAAO,CAAC,GAAG,CAAC,IAAI,CAAC,GAAG,GAAG,CAAA;IACvB,sBAAY,CAAC,SAAS,EAAE,EAAC,IAAI,EAAC,EAAE,GAAG,CAAC,CAAA;AACtC,CAAC;AAHD,wCAGC;AAED;;;GAGG;AACH,SAAgB,SAAS,CAAC,MAAc;IACtC,sBAAY,CAAC,UAAU,EAAE,EAAE,EAAE,MAAM,CAAC,CAAA;AACtC,CAAC;AAFD,8BAEC;AAED;;;GAGG;AACH,SAAgB,OAAO,CAAC,SAAiB;IACvC,sBAAY,CAAC,UAAU,EAAE,EAAE,EAAE,SAAS,CAAC,CAAA;IACvC,OAAO,CAAC,GAAG,CAAC,MAAM,CAAC,GAAG,GAAG,SAAS,GAAG,IAAI,CAAC,SAAS,GAAG,OAAO,CAAC,GAAG,CAAC,MAAM,CAAC,EAAE,CAAA;AAC7E,CAAC;AAHD,0BAGC;AAED;;;;;;GAMG;AACH,SAAgB,QAAQ,CAAC,IAAY,EAAE,OAAsB;IAC3D,MAAM,GAAG,GACP,OAAO,CAAC,GAAG,CAAC,SAAS,IAAI,CAAC,OAAO,CAAC,IAAI,EAAE,GAAG,CAAC,CAAC,WAAW,EAAE,EAAE,CAAC,IAAI,EAAE,CAAA;IACrE,IAAI,OAAO,IAAI,OAAO,CAAC,QAAQ,IAAI,CAAC,GAAG,EAAE;QACvC,MAAM,IAAI,KAAK,CAAC,oCAAoC,IAAI,EAAE,CAAC,CAAA;KAC5D;IAED,OAAO,GAAG,CAAC,IAAI,EAAE,CAAA;AACnB,CAAC;AARD,4BAQC;AAED;;;;;GAKG;AACH,SAAgB,SAAS,CAAC,IAAY,EAAE,KAAa;IACnD,sBAAY,CAAC,YAAY,EAAE,EAAC,IAAI,EAAC,EAAE,KAAK,CAAC,CAAA;AAC3C,CAAC;AAFD,8BAEC;AAED,yEAAyE;AACzE,UAAU;AACV,yEAAyE;AAEzE;;;;GAIG;AACH,SAAgB,SAAS,CAAC,OAAe;IACvC,OAAO,CAAC,QAAQ,GAAG,QAAQ,CAAC,OAAO,CAAA;IACnC,KAAK,CAAC,OAAO,CAAC,CAAA;AAChB,CAAC;AAHD,8BAGC;AAED,yEAAyE;AACzE,mBAAmB;AACnB,yEAAyE;AAEzE;;GAEG;AACH,SAAgB,OAAO;IACrB,OAAO,OAAO,CAAC,GAAG,CAAC,cAAc,CAAC,KAAK,GAAG,CAAA;AAC5C,CAAC;AAFD,0BAEC;AAED;;;GAGG;AACH,SAAgB,KAAK,CAAC,OAAe;IACnC,sBAAY,CAAC,OAAO,EAAE,EAAE,EAAE,OAAO,CAAC,CAAA;AACpC,CAAC;AAFD,sBAEC;AAED;;;GAGG;AACH,SAAgB,KAAK,CAAC,OAAe;IACnC,eAAK,CAAC,OAAO,EAAE,OAAO,CAAC,CAAA;AACzB,CAAC;AAFD,sBAEC;AAED;;;GAGG;AACH,SAAgB,OAAO,CAAC,OAAe;IACrC,eAAK,CAAC,SAAS,EAAE,OAAO,CAAC,CAAA;AAC3B,CAAC;AAFD,0BAEC;AAED;;;GAGG;AACH,SAAgB,IAAI,CAAC,OAAe;IAClC,OAAO,CAAC,MAAM,CAAC,KAAK,CAAC,OAAO,GAAG,EAAE,CAAC,GAAG,CAAC,CAAA;AACxC,CAAC;AAFD,oBAEC;AAED;;;;;;GAMG;AACH,SAAgB,UAAU,CAAC,IAAY;IACrC,eAAK,CAAC,OAAO,EAAE,IAAI,CAAC,CAAA;AACtB,CAAC;AAFD,gCAEC;AAED;;GAEG;AACH,SAAgB,QAAQ;IACtB,eAAK,CAAC,UAAU,CAAC,CAAA;AACnB,CAAC;AAFD,4BAEC;AAED;;;;;;;GAOG;AACH,SAAsB,KAAK,CAAI,IAAY,EAAE,EAAoB;;QAC/D,UAAU,CAAC,IAAI,CAAC,CAAA;QAEhB,IAAI,MAAS,CAAA;QAEb,IAAI;YACF,MAAM,GAAG,MAAM,EAAE,EAAE,CAAA;SACpB;gBAAS;YACR,QAAQ,EAAE,CAAA;SACX;QAED,OAAO,MAAM,CAAA;IACf,CAAC;CAAA;AAZD,sBAYC;AAED,yEAAyE;AACzE,uBAAuB;AACvB,yEAAyE;AAEzE;;;;;GAKG;AACH,SAAgB,SAAS,CAAC,IAAY,EAAE,KAAa;IACnD,sBAAY,CAAC,YAAY,EAAE,EAAC,IAAI,EAAC,EAAE,KAAK,CAAC,CAAA;AAC3C,CAAC;AAFD,8BAEC;AAED;;;;;GAKG;AACH,SAAgB,QAAQ,CAAC,IAAY;IACnC,OAAO,OAAO,CAAC,GAAG,CAAC,SAAS,IAAI,EAAE,CAAC,IAAI,EAAE,CAAA;AAC3C,CAAC;AAFD,4BAEC"} \ No newline at end of file +{"version":3,"file":"core.js","sourceRoot":"","sources":["../src/core.ts"],"names":[],"mappings":";;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;AAAA,uCAA6C;AAC7C,iDAA+D;AAC/D,mCAA2D;AAE3D,uCAAwB;AACxB,2CAA4B;AAE5B,6CAAuC;AAavC;;GAEG;AACH,IAAY,QAUX;AAVD,WAAY,QAAQ;IAClB;;OAEG;IACH,6CAAW,CAAA;IAEX;;OAEG;IACH,6CAAW,CAAA;AACb,CAAC,EAVW,QAAQ,GAAR,gBAAQ,KAAR,gBAAQ,QAUnB;AAuCD,yEAAyE;AACzE,YAAY;AACZ,yEAAyE;AAEzE;;;;GAIG;AACH,8DAA8D;AAC9D,SAAgB,cAAc,CAAC,IAAY,EAAE,GAAQ;IACnD,MAAM,YAAY,GAAG,sBAAc,CAAC,GAAG,CAAC,CAAA;IACxC,OAAO,CAAC,GAAG,CAAC,IAAI,CAAC,GAAG,YAAY,CAAA;IAEhC,MAAM,QAAQ,GAAG,OAAO,CAAC,GAAG,CAAC,YAAY,CAAC,IAAI,EAAE,CAAA;IAChD,IAAI,QAAQ,EAAE;QACZ,MAAM,SAAS,GAAG,qCAAqC,CAAA;QACvD,MAAM,YAAY,GAAG,GAAG,IAAI,KAAK,SAAS,GAAG,EAAE,CAAC,GAAG,GAAG,YAAY,GAAG,EAAE,CAAC,GAAG,GAAG,SAAS,EAAE,CAAA;QACzF,2BAAgB,CAAC,KAAK,EAAE,YAAY,CAAC,CAAA;KACtC;SAAM;QACL,sBAAY,CAAC,SAAS,EAAE,EAAC,IAAI,EAAC,EAAE,YAAY,CAAC,CAAA;KAC9C;AACH,CAAC;AAZD,wCAYC;AAED;;;GAGG;AACH,SAAgB,SAAS,CAAC,MAAc;IACtC,sBAAY,CAAC,UAAU,EAAE,EAAE,EAAE,MAAM,CAAC,CAAA;AACtC,CAAC;AAFD,8BAEC;AAED;;;GAGG;AACH,SAAgB,OAAO,CAAC,SAAiB;IACvC,MAAM,QAAQ,GAAG,OAAO,CAAC,GAAG,CAAC,aAAa,CAAC,IAAI,EAAE,CAAA;IACjD,IAAI,QAAQ,EAAE;QACZ,2BAAgB,CAAC,MAAM,EAAE,SAAS,CAAC,CAAA;KACpC;SAAM;QACL,sBAAY,CAAC,UAAU,EAAE,EAAE,EAAE,SAAS,CAAC,CAAA;KACxC;IACD,OAAO,CAAC,GAAG,CAAC,MAAM,CAAC,GAAG,GAAG,SAAS,GAAG,IAAI,CAAC,SAAS,GAAG,OAAO,CAAC,GAAG,CAAC,MAAM,CAAC,EAAE,CAAA;AAC7E,CAAC;AARD,0BAQC;AAED;;;;;;;;GAQG;AACH,SAAgB,QAAQ,CAAC,IAAY,EAAE,OAAsB;IAC3D,MAAM,GAAG,GACP,OAAO,CAAC,GAAG,CAAC,SAAS,IAAI,CAAC,OAAO,CAAC,IAAI,EAAE,GAAG,CAAC,CAAC,WAAW,EAAE,EAAE,CAAC,IAAI,EAAE,CAAA;IACrE,IAAI,OAAO,IAAI,OAAO,CAAC,QAAQ,IAAI,CAAC,GAAG,EAAE;QACvC,MAAM,IAAI,KAAK,CAAC,oCAAoC,IAAI,EAAE,CAAC,CAAA;KAC5D;IAED,IAAI,OAAO,IAAI,OAAO,CAAC,cAAc,KAAK,KAAK,EAAE;QAC/C,OAAO,GAAG,CAAA;KACX;IAED,OAAO,GAAG,CAAC,IAAI,EAAE,CAAA;AACnB,CAAC;AAZD,4BAYC;AAED;;;;;;;GAOG;AACH,SAAgB,iBAAiB,CAC/B,IAAY,EACZ,OAAsB;IAEtB,MAAM,MAAM,GAAa,QAAQ,CAAC,IAAI,EAAE,OAAO,CAAC;SAC7C,KAAK,CAAC,IAAI,CAAC;SACX,MAAM,CAAC,CAAC,CAAC,EAAE,CAAC,CAAC,KAAK,EAAE,CAAC,CAAA;IAExB,OAAO,MAAM,CAAA;AACf,CAAC;AATD,8CASC;AAED;;;;;;;;;GASG;AACH,SAAgB,eAAe,CAAC,IAAY,EAAE,OAAsB;IAClE,MAAM,SAAS,GAAG,CAAC,MAAM,EAAE,MAAM,EAAE,MAAM,CAAC,CAAA;IAC1C,MAAM,UAAU,GAAG,CAAC,OAAO,EAAE,OAAO,EAAE,OAAO,CAAC,CAAA;IAC9C,MAAM,GAAG,GAAG,QAAQ,CAAC,IAAI,EAAE,OAAO,CAAC,CAAA;IACnC,IAAI,SAAS,CAAC,QAAQ,CAAC,GAAG,CAAC;QAAE,OAAO,IAAI,CAAA;IACxC,IAAI,UAAU,CAAC,QAAQ,CAAC,GAAG,CAAC;QAAE,OAAO,KAAK,CAAA;IAC1C,MAAM,IAAI,SAAS,CACjB,6DAA6D,IAAI,IAAI;QACnE,4EAA4E,CAC/E,CAAA;AACH,CAAC;AAVD,0CAUC;AAED;;;;;GAKG;AACH,8DAA8D;AAC9D,SAAgB,SAAS,CAAC,IAAY,EAAE,KAAU;IAChD,OAAO,CAAC,MAAM,CAAC,KAAK,CAAC,EAAE,CAAC,GAAG,CAAC,CAAA;IAC5B,sBAAY,CAAC,YAAY,EAAE,EAAC,IAAI,EAAC,EAAE,KAAK,CAAC,CAAA;AAC3C,CAAC;AAHD,8BAGC;AAED;;;;GAIG;AACH,SAAgB,cAAc,CAAC,OAAgB;IAC7C,eAAK,CAAC,MAAM,EAAE,OAAO,CAAC,CAAC,CAAC,IAAI,CAAC,CAAC,CAAC,KAAK,CAAC,CAAA;AACvC,CAAC;AAFD,wCAEC;AAED,yEAAyE;AACzE,UAAU;AACV,yEAAyE;AAEzE;;;;GAIG;AACH,SAAgB,SAAS,CAAC,OAAuB;IAC/C,OAAO,CAAC,QAAQ,GAAG,QAAQ,CAAC,OAAO,CAAA;IAEnC,KAAK,CAAC,OAAO,CAAC,CAAA;AAChB,CAAC;AAJD,8BAIC;AAED,yEAAyE;AACzE,mBAAmB;AACnB,yEAAyE;AAEzE;;GAEG;AACH,SAAgB,OAAO;IACrB,OAAO,OAAO,CAAC,GAAG,CAAC,cAAc,CAAC,KAAK,GAAG,CAAA;AAC5C,CAAC;AAFD,0BAEC;AAED;;;GAGG;AACH,SAAgB,KAAK,CAAC,OAAe;IACnC,sBAAY,CAAC,OAAO,EAAE,EAAE,EAAE,OAAO,CAAC,CAAA;AACpC,CAAC;AAFD,sBAEC;AAED;;;;GAIG;AACH,SAAgB,KAAK,CACnB,OAAuB,EACvB,aAAmC,EAAE;IAErC,sBAAY,CACV,OAAO,EACP,2BAAmB,CAAC,UAAU,CAAC,EAC/B,OAAO,YAAY,KAAK,CAAC,CAAC,CAAC,OAAO,CAAC,QAAQ,EAAE,CAAC,CAAC,CAAC,OAAO,CACxD,CAAA;AACH,CAAC;AATD,sBASC;AAED;;;;GAIG;AACH,SAAgB,OAAO,CACrB,OAAuB,EACvB,aAAmC,EAAE;IAErC,sBAAY,CACV,SAAS,EACT,2BAAmB,CAAC,UAAU,CAAC,EAC/B,OAAO,YAAY,KAAK,CAAC,CAAC,CAAC,OAAO,CAAC,QAAQ,EAAE,CAAC,CAAC,CAAC,OAAO,CACxD,CAAA;AACH,CAAC;AATD,0BASC;AAED;;;;GAIG;AACH,SAAgB,MAAM,CACpB,OAAuB,EACvB,aAAmC,EAAE;IAErC,sBAAY,CACV,QAAQ,EACR,2BAAmB,CAAC,UAAU,CAAC,EAC/B,OAAO,YAAY,KAAK,CAAC,CAAC,CAAC,OAAO,CAAC,QAAQ,EAAE,CAAC,CAAC,CAAC,OAAO,CACxD,CAAA;AACH,CAAC;AATD,wBASC;AAED;;;GAGG;AACH,SAAgB,IAAI,CAAC,OAAe;IAClC,OAAO,CAAC,MAAM,CAAC,KAAK,CAAC,OAAO,GAAG,EAAE,CAAC,GAAG,CAAC,CAAA;AACxC,CAAC;AAFD,oBAEC;AAED;;;;;;GAMG;AACH,SAAgB,UAAU,CAAC,IAAY;IACrC,eAAK,CAAC,OAAO,EAAE,IAAI,CAAC,CAAA;AACtB,CAAC;AAFD,gCAEC;AAED;;GAEG;AACH,SAAgB,QAAQ;IACtB,eAAK,CAAC,UAAU,CAAC,CAAA;AACnB,CAAC;AAFD,4BAEC;AAED;;;;;;;GAOG;AACH,SAAsB,KAAK,CAAI,IAAY,EAAE,EAAoB;;QAC/D,UAAU,CAAC,IAAI,CAAC,CAAA;QAEhB,IAAI,MAAS,CAAA;QAEb,IAAI;YACF,MAAM,GAAG,MAAM,EAAE,EAAE,CAAA;SACpB;gBAAS;YACR,QAAQ,EAAE,CAAA;SACX;QAED,OAAO,MAAM,CAAA;IACf,CAAC;CAAA;AAZD,sBAYC;AAED,yEAAyE;AACzE,uBAAuB;AACvB,yEAAyE;AAEzE;;;;;GAKG;AACH,8DAA8D;AAC9D,SAAgB,SAAS,CAAC,IAAY,EAAE,KAAU;IAChD,sBAAY,CAAC,YAAY,EAAE,EAAC,IAAI,EAAC,EAAE,KAAK,CAAC,CAAA;AAC3C,CAAC;AAFD,8BAEC;AAED;;;;;GAKG;AACH,SAAgB,QAAQ,CAAC,IAAY;IACnC,OAAO,OAAO,CAAC,GAAG,CAAC,SAAS,IAAI,EAAE,CAAC,IAAI,EAAE,CAAA;AAC3C,CAAC;AAFD,4BAEC;AAED,SAAsB,UAAU,CAAC,GAAY;;QAC3C,OAAO,MAAM,uBAAU,CAAC,UAAU,CAAC,GAAG,CAAC,CAAA;IACzC,CAAC;CAAA;AAFD,gCAEC"} \ No newline at end of file diff --git a/node_modules/@actions/core/lib/file-command.d.ts b/node_modules/@actions/core/lib/file-command.d.ts new file mode 100644 index 0000000..ed408eb --- /dev/null +++ b/node_modules/@actions/core/lib/file-command.d.ts @@ -0,0 +1 @@ +export declare function issueCommand(command: string, message: any): void; diff --git a/node_modules/@actions/core/lib/file-command.js b/node_modules/@actions/core/lib/file-command.js new file mode 100644 index 0000000..55e3e9f --- /dev/null +++ b/node_modules/@actions/core/lib/file-command.js @@ -0,0 +1,42 @@ +"use strict"; +// For internal use, subject to change. +var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; } }); +}) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; +})); +var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) { + Object.defineProperty(o, "default", { enumerable: true, value: v }); +}) : function(o, v) { + o["default"] = v; +}); +var __importStar = (this && this.__importStar) || function (mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) for (var k in mod) if (k !== "default" && Object.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + __setModuleDefault(result, mod); + return result; +}; +Object.defineProperty(exports, "__esModule", { value: true }); +exports.issueCommand = void 0; +// We use any as a valid input type +/* eslint-disable @typescript-eslint/no-explicit-any */ +const fs = __importStar(require("fs")); +const os = __importStar(require("os")); +const utils_1 = require("./utils"); +function issueCommand(command, message) { + const filePath = process.env[`GITHUB_${command}`]; + if (!filePath) { + throw new Error(`Unable to find environment variable for file command ${command}`); + } + if (!fs.existsSync(filePath)) { + throw new Error(`Missing file at path: ${filePath}`); + } + fs.appendFileSync(filePath, `${utils_1.toCommandValue(message)}${os.EOL}`, { + encoding: 'utf8' + }); +} +exports.issueCommand = issueCommand; +//# sourceMappingURL=file-command.js.map \ No newline at end of file diff --git a/node_modules/@actions/core/lib/file-command.js.map b/node_modules/@actions/core/lib/file-command.js.map new file mode 100644 index 0000000..ee35699 --- /dev/null +++ b/node_modules/@actions/core/lib/file-command.js.map @@ -0,0 +1 @@ +{"version":3,"file":"file-command.js","sourceRoot":"","sources":["../src/file-command.ts"],"names":[],"mappings":";AAAA,uCAAuC;;;;;;;;;;;;;;;;;;;;;;AAEvC,mCAAmC;AACnC,uDAAuD;AAEvD,uCAAwB;AACxB,uCAAwB;AACxB,mCAAsC;AAEtC,SAAgB,YAAY,CAAC,OAAe,EAAE,OAAY;IACxD,MAAM,QAAQ,GAAG,OAAO,CAAC,GAAG,CAAC,UAAU,OAAO,EAAE,CAAC,CAAA;IACjD,IAAI,CAAC,QAAQ,EAAE;QACb,MAAM,IAAI,KAAK,CACb,wDAAwD,OAAO,EAAE,CAClE,CAAA;KACF;IACD,IAAI,CAAC,EAAE,CAAC,UAAU,CAAC,QAAQ,CAAC,EAAE;QAC5B,MAAM,IAAI,KAAK,CAAC,yBAAyB,QAAQ,EAAE,CAAC,CAAA;KACrD;IAED,EAAE,CAAC,cAAc,CAAC,QAAQ,EAAE,GAAG,sBAAc,CAAC,OAAO,CAAC,GAAG,EAAE,CAAC,GAAG,EAAE,EAAE;QACjE,QAAQ,EAAE,MAAM;KACjB,CAAC,CAAA;AACJ,CAAC;AAdD,oCAcC"} \ No newline at end of file diff --git a/node_modules/@actions/core/lib/oidc-utils.d.ts b/node_modules/@actions/core/lib/oidc-utils.d.ts new file mode 100644 index 0000000..657c7f4 --- /dev/null +++ b/node_modules/@actions/core/lib/oidc-utils.d.ts @@ -0,0 +1,7 @@ +export declare class OidcClient { + private static createHttpClient; + private static getRequestToken; + private static getIDTokenUrl; + private static getCall; + static getIDToken(audience?: string): Promise; +} diff --git a/node_modules/@actions/core/lib/oidc-utils.js b/node_modules/@actions/core/lib/oidc-utils.js new file mode 100644 index 0000000..9ee10fa --- /dev/null +++ b/node_modules/@actions/core/lib/oidc-utils.js @@ -0,0 +1,77 @@ +"use strict"; +var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { + function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } + return new (P || (P = Promise))(function (resolve, reject) { + function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } + function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } + function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } + step((generator = generator.apply(thisArg, _arguments || [])).next()); + }); +}; +Object.defineProperty(exports, "__esModule", { value: true }); +exports.OidcClient = void 0; +const http_client_1 = require("@actions/http-client"); +const auth_1 = require("@actions/http-client/auth"); +const core_1 = require("./core"); +class OidcClient { + static createHttpClient(allowRetry = true, maxRetry = 10) { + const requestOptions = { + allowRetries: allowRetry, + maxRetries: maxRetry + }; + return new http_client_1.HttpClient('actions/oidc-client', [new auth_1.BearerCredentialHandler(OidcClient.getRequestToken())], requestOptions); + } + static getRequestToken() { + const token = process.env['ACTIONS_ID_TOKEN_REQUEST_TOKEN']; + if (!token) { + throw new Error('Unable to get ACTIONS_ID_TOKEN_REQUEST_TOKEN env variable'); + } + return token; + } + static getIDTokenUrl() { + const runtimeUrl = process.env['ACTIONS_ID_TOKEN_REQUEST_URL']; + if (!runtimeUrl) { + throw new Error('Unable to get ACTIONS_ID_TOKEN_REQUEST_URL env variable'); + } + return runtimeUrl; + } + static getCall(id_token_url) { + var _a; + return __awaiter(this, void 0, void 0, function* () { + const httpclient = OidcClient.createHttpClient(); + const res = yield httpclient + .getJson(id_token_url) + .catch(error => { + throw new Error(`Failed to get ID Token. \n + Error Code : ${error.statusCode}\n + Error Message: ${error.result.message}`); + }); + const id_token = (_a = res.result) === null || _a === void 0 ? void 0 : _a.value; + if (!id_token) { + throw new Error('Response json body do not have ID Token field'); + } + return id_token; + }); + } + static getIDToken(audience) { + return __awaiter(this, void 0, void 0, function* () { + try { + // New ID Token is requested from action service + let id_token_url = OidcClient.getIDTokenUrl(); + if (audience) { + const encodedAudience = encodeURIComponent(audience); + id_token_url = `${id_token_url}&audience=${encodedAudience}`; + } + core_1.debug(`ID token url is ${id_token_url}`); + const id_token = yield OidcClient.getCall(id_token_url); + core_1.setSecret(id_token); + return id_token; + } + catch (error) { + throw new Error(`Error message: ${error.message}`); + } + }); + } +} +exports.OidcClient = OidcClient; +//# sourceMappingURL=oidc-utils.js.map \ No newline at end of file diff --git a/node_modules/@actions/core/lib/oidc-utils.js.map b/node_modules/@actions/core/lib/oidc-utils.js.map new file mode 100644 index 0000000..0ddbca9 --- /dev/null +++ b/node_modules/@actions/core/lib/oidc-utils.js.map @@ -0,0 +1 @@ +{"version":3,"file":"oidc-utils.js","sourceRoot":"","sources":["../src/oidc-utils.ts"],"names":[],"mappings":";;;;;;;;;;;;AAGA,sDAA+C;AAC/C,oDAAiE;AACjE,iCAAuC;AAKvC,MAAa,UAAU;IACb,MAAM,CAAC,gBAAgB,CAC7B,UAAU,GAAG,IAAI,EACjB,QAAQ,GAAG,EAAE;QAEb,MAAM,cAAc,GAAoB;YACtC,YAAY,EAAE,UAAU;YACxB,UAAU,EAAE,QAAQ;SACrB,CAAA;QAED,OAAO,IAAI,wBAAU,CACnB,qBAAqB,EACrB,CAAC,IAAI,8BAAuB,CAAC,UAAU,CAAC,eAAe,EAAE,CAAC,CAAC,EAC3D,cAAc,CACf,CAAA;IACH,CAAC;IAEO,MAAM,CAAC,eAAe;QAC5B,MAAM,KAAK,GAAG,OAAO,CAAC,GAAG,CAAC,gCAAgC,CAAC,CAAA;QAC3D,IAAI,CAAC,KAAK,EAAE;YACV,MAAM,IAAI,KAAK,CACb,2DAA2D,CAC5D,CAAA;SACF;QACD,OAAO,KAAK,CAAA;IACd,CAAC;IAEO,MAAM,CAAC,aAAa;QAC1B,MAAM,UAAU,GAAG,OAAO,CAAC,GAAG,CAAC,8BAA8B,CAAC,CAAA;QAC9D,IAAI,CAAC,UAAU,EAAE;YACf,MAAM,IAAI,KAAK,CAAC,yDAAyD,CAAC,CAAA;SAC3E;QACD,OAAO,UAAU,CAAA;IACnB,CAAC;IAEO,MAAM,CAAO,OAAO,CAAC,YAAoB;;;YAC/C,MAAM,UAAU,GAAG,UAAU,CAAC,gBAAgB,EAAE,CAAA;YAEhD,MAAM,GAAG,GAAG,MAAM,UAAU;iBACzB,OAAO,CAAgB,YAAY,CAAC;iBACpC,KAAK,CAAC,KAAK,CAAC,EAAE;gBACb,MAAM,IAAI,KAAK,CACb;uBACa,KAAK,CAAC,UAAU;yBACd,KAAK,CAAC,MAAM,CAAC,OAAO,EAAE,CACtC,CAAA;YACH,CAAC,CAAC,CAAA;YAEJ,MAAM,QAAQ,SAAG,GAAG,CAAC,MAAM,0CAAE,KAAK,CAAA;YAClC,IAAI,CAAC,QAAQ,EAAE;gBACb,MAAM,IAAI,KAAK,CAAC,+CAA+C,CAAC,CAAA;aACjE;YACD,OAAO,QAAQ,CAAA;;KAChB;IAED,MAAM,CAAO,UAAU,CAAC,QAAiB;;YACvC,IAAI;gBACF,gDAAgD;gBAChD,IAAI,YAAY,GAAW,UAAU,CAAC,aAAa,EAAE,CAAA;gBACrD,IAAI,QAAQ,EAAE;oBACZ,MAAM,eAAe,GAAG,kBAAkB,CAAC,QAAQ,CAAC,CAAA;oBACpD,YAAY,GAAG,GAAG,YAAY,aAAa,eAAe,EAAE,CAAA;iBAC7D;gBAED,YAAK,CAAC,mBAAmB,YAAY,EAAE,CAAC,CAAA;gBAExC,MAAM,QAAQ,GAAG,MAAM,UAAU,CAAC,OAAO,CAAC,YAAY,CAAC,CAAA;gBACvD,gBAAS,CAAC,QAAQ,CAAC,CAAA;gBACnB,OAAO,QAAQ,CAAA;aAChB;YAAC,OAAO,KAAK,EAAE;gBACd,MAAM,IAAI,KAAK,CAAC,kBAAkB,KAAK,CAAC,OAAO,EAAE,CAAC,CAAA;aACnD;QACH,CAAC;KAAA;CACF;AAzED,gCAyEC"} \ No newline at end of file diff --git a/node_modules/@actions/core/lib/utils.d.ts b/node_modules/@actions/core/lib/utils.d.ts new file mode 100644 index 0000000..3b9e28d --- /dev/null +++ b/node_modules/@actions/core/lib/utils.d.ts @@ -0,0 +1,14 @@ +import { AnnotationProperties } from './core'; +import { CommandProperties } from './command'; +/** + * Sanitizes an input into a string so it can be passed into issueCommand safely + * @param input input to sanitize into a string + */ +export declare function toCommandValue(input: any): string; +/** + * + * @param annotationProperties + * @returns The command properties to send with the actual annotation command + * See IssueCommandProperties: https://github.com/actions/runner/blob/main/src/Runner.Worker/ActionCommandManager.cs#L646 + */ +export declare function toCommandProperties(annotationProperties: AnnotationProperties): CommandProperties; diff --git a/node_modules/@actions/core/lib/utils.js b/node_modules/@actions/core/lib/utils.js new file mode 100644 index 0000000..9b5ca44 --- /dev/null +++ b/node_modules/@actions/core/lib/utils.js @@ -0,0 +1,40 @@ +"use strict"; +// We use any as a valid input type +/* eslint-disable @typescript-eslint/no-explicit-any */ +Object.defineProperty(exports, "__esModule", { value: true }); +exports.toCommandProperties = exports.toCommandValue = void 0; +/** + * Sanitizes an input into a string so it can be passed into issueCommand safely + * @param input input to sanitize into a string + */ +function toCommandValue(input) { + if (input === null || input === undefined) { + return ''; + } + else if (typeof input === 'string' || input instanceof String) { + return input; + } + return JSON.stringify(input); +} +exports.toCommandValue = toCommandValue; +/** + * + * @param annotationProperties + * @returns The command properties to send with the actual annotation command + * See IssueCommandProperties: https://github.com/actions/runner/blob/main/src/Runner.Worker/ActionCommandManager.cs#L646 + */ +function toCommandProperties(annotationProperties) { + if (!Object.keys(annotationProperties).length) { + return {}; + } + return { + title: annotationProperties.title, + file: annotationProperties.file, + line: annotationProperties.startLine, + endLine: annotationProperties.endLine, + col: annotationProperties.startColumn, + endColumn: annotationProperties.endColumn + }; +} +exports.toCommandProperties = toCommandProperties; +//# sourceMappingURL=utils.js.map \ No newline at end of file diff --git a/node_modules/@actions/core/lib/utils.js.map b/node_modules/@actions/core/lib/utils.js.map new file mode 100644 index 0000000..8211bb7 --- /dev/null +++ b/node_modules/@actions/core/lib/utils.js.map @@ -0,0 +1 @@ +{"version":3,"file":"utils.js","sourceRoot":"","sources":["../src/utils.ts"],"names":[],"mappings":";AAAA,mCAAmC;AACnC,uDAAuD;;;AAKvD;;;GAGG;AACH,SAAgB,cAAc,CAAC,KAAU;IACvC,IAAI,KAAK,KAAK,IAAI,IAAI,KAAK,KAAK,SAAS,EAAE;QACzC,OAAO,EAAE,CAAA;KACV;SAAM,IAAI,OAAO,KAAK,KAAK,QAAQ,IAAI,KAAK,YAAY,MAAM,EAAE;QAC/D,OAAO,KAAe,CAAA;KACvB;IACD,OAAO,IAAI,CAAC,SAAS,CAAC,KAAK,CAAC,CAAA;AAC9B,CAAC;AAPD,wCAOC;AAED;;;;;GAKG;AACH,SAAgB,mBAAmB,CACjC,oBAA0C;IAE1C,IAAI,CAAC,MAAM,CAAC,IAAI,CAAC,oBAAoB,CAAC,CAAC,MAAM,EAAE;QAC7C,OAAO,EAAE,CAAA;KACV;IAED,OAAO;QACL,KAAK,EAAE,oBAAoB,CAAC,KAAK;QACjC,IAAI,EAAE,oBAAoB,CAAC,IAAI;QAC/B,IAAI,EAAE,oBAAoB,CAAC,SAAS;QACpC,OAAO,EAAE,oBAAoB,CAAC,OAAO;QACrC,GAAG,EAAE,oBAAoB,CAAC,WAAW;QACrC,SAAS,EAAE,oBAAoB,CAAC,SAAS;KAC1C,CAAA;AACH,CAAC;AAfD,kDAeC"} \ No newline at end of file diff --git a/node_modules/@actions/core/package.json b/node_modules/@actions/core/package.json index 2a1e099..8d7a399 100644 --- a/node_modules/@actions/core/package.json +++ b/node_modules/@actions/core/package.json @@ -1,56 +1,24 @@ { - "_args": [ - [ - "@actions/core@1.2.3", - "/Users/wphromma/workspace/actions-curl" - ] - ], - "_from": "@actions/core@1.2.3", - "_id": "@actions/core@1.2.3", - "_inBundle": false, - "_integrity": "sha512-Wp4xnyokakM45Uuj4WLUxdsa8fJjKVl1fDTsPbTEcTcuu0Nb26IPQbOtjmnfaCPGcaoPOOqId8H9NapZ8gii4w==", - "_location": "/@actions/core", - "_phantomChildren": {}, - "_requested": { - "type": "version", - "registry": true, - "raw": "@actions/core@1.2.3", - "name": "@actions/core", - "escapedName": "@actions%2fcore", - "scope": "@actions", - "rawSpec": "1.2.3", - "saveSpec": null, - "fetchSpec": "1.2.3" - }, - "_requiredBy": [ - "/" - ], - "_resolved": "https://registry.npmjs.org/@actions/core/-/core-1.2.3.tgz", - "_spec": "1.2.3", - "_where": "/Users/wphromma/workspace/actions-curl", - "bugs": { - "url": "https://github.com/actions/toolkit/issues" - }, + "name": "@actions/core", + "version": "1.6.0", "description": "Actions core lib", - "devDependencies": { - "@types/node": "^12.0.2" - }, - "directories": { - "lib": "lib", - "test": "__tests__" - }, - "files": [ - "lib" - ], - "homepage": "https://github.com/actions/toolkit/tree/master/packages/core", "keywords": [ "github", "actions", "core" ], + "homepage": "https://github.com/actions/toolkit/tree/main/packages/core", "license": "MIT", "main": "lib/core.js", - "name": "@actions/core", + "types": "lib/core.d.ts", + "directories": { + "lib": "lib", + "test": "__tests__" + }, + "files": [ + "lib", + "!.DS_Store" + ], "publishConfig": { "access": "public" }, @@ -60,10 +28,17 @@ "directory": "packages/core" }, "scripts": { - "audit-moderate": "npm install && npm audit --audit-level=moderate", + "audit-moderate": "npm install && npm audit --json --audit-level=moderate > audit.json", "test": "echo \"Error: run tests from root\" && exit 1", "tsc": "tsc" }, - "types": "lib/core.d.ts", - "version": "1.2.3" + "bugs": { + "url": "https://github.com/actions/toolkit/issues" + }, + "dependencies": { + "@actions/http-client": "^1.0.11" + }, + "devDependencies": { + "@types/node": "^12.0.2" + } } diff --git a/node_modules/@actions/http-client/LICENSE b/node_modules/@actions/http-client/LICENSE new file mode 100644 index 0000000..5823a51 --- /dev/null +++ b/node_modules/@actions/http-client/LICENSE @@ -0,0 +1,21 @@ +Actions Http Client for Node.js + +Copyright (c) GitHub, Inc. + +All rights reserved. + +MIT License + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and +associated documentation files (the "Software"), to deal in the Software without restriction, +including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, +and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED *AS IS*, WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT +LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/@actions/http-client/README.md b/node_modules/@actions/http-client/README.md new file mode 100644 index 0000000..be61eb3 --- /dev/null +++ b/node_modules/@actions/http-client/README.md @@ -0,0 +1,79 @@ + +

+ +

+ +# Actions Http-Client + +[![Http Status](https://github.com/actions/http-client/workflows/http-tests/badge.svg)](https://github.com/actions/http-client/actions) + +A lightweight HTTP client optimized for use with actions, TypeScript with generics and async await. + +## Features + + - HTTP client with TypeScript generics and async/await/Promises + - Typings included so no need to acquire separately (great for intellisense and no versioning drift) + - [Proxy support](https://help.github.com/en/actions/automating-your-workflow-with-github-actions/about-self-hosted-runners#using-a-proxy-server-with-self-hosted-runners) just works with actions and the runner + - Targets ES2019 (runner runs actions with node 12+). Only supported on node 12+. + - Basic, Bearer and PAT Support out of the box. Extensible handlers for others. + - Redirects supported + +Features and releases [here](./RELEASES.md) + +## Install + +``` +npm install @actions/http-client --save +``` + +## Samples + +See the [HTTP](./__tests__) tests for detailed examples. + +## Errors + +### HTTP + +The HTTP client does not throw unless truly exceptional. + +* A request that successfully executes resulting in a 404, 500 etc... will return a response object with a status code and a body. +* Redirects (3xx) will be followed by default. + +See [HTTP tests](./__tests__) for detailed examples. + +## Debugging + +To enable detailed console logging of all HTTP requests and responses, set the NODE_DEBUG environment varible: + +``` +export NODE_DEBUG=http +``` + +## Node support + +The http-client is built using the latest LTS version of Node 12. It may work on previous node LTS versions but it's tested and officially supported on Node12+. + +## Support and Versioning + +We follow semver and will hold compatibility between major versions and increment the minor version with new features and capabilities (while holding compat). + +## Contributing + +We welcome PRs. Please create an issue and if applicable, a design before proceeding with code. + +once: + +```bash +$ npm install +``` + +To build: + +```bash +$ npm run build +``` + +To run all tests: +```bash +$ npm test +``` diff --git a/node_modules/@actions/http-client/RELEASES.md b/node_modules/@actions/http-client/RELEASES.md new file mode 100644 index 0000000..935178a --- /dev/null +++ b/node_modules/@actions/http-client/RELEASES.md @@ -0,0 +1,26 @@ +## Releases + +## 1.0.10 + +Contains a bug fix where proxy is defined without a user and password. see [PR here](https://github.com/actions/http-client/pull/42) + +## 1.0.9 +Throw HttpClientError instead of a generic Error from the \Json() helper methods when the server responds with a non-successful status code. + +## 1.0.8 +Fixed security issue where a redirect (e.g. 302) to another domain would pass headers. The fix was to strip the authorization header if the hostname was different. More [details in PR #27](https://github.com/actions/http-client/pull/27) + +## 1.0.7 +Update NPM dependencies and add 429 to the list of HttpCodes + +## 1.0.6 +Automatically sends Content-Type and Accept application/json headers for \Json() helper methods if not set in the client or parameters. + +## 1.0.5 +Adds \Json() helper methods for json over http scenarios. + +## 1.0.4 +Started to add \Json() helper methods. Do not use this release for that. Use >= 1.0.5 since there was an issue with types. + +## 1.0.1 to 1.0.3 +Adds proxy support. diff --git a/node_modules/@actions/http-client/actions.png b/node_modules/@actions/http-client/actions.png new file mode 100644 index 0000000000000000000000000000000000000000..1857ef375592b5bbce3f2b225865d32428c13acb GIT binary patch literal 33889 zcmdSAWpo|Qt{`fRDQ0Hon3-{RMHd;v*6ILy$;QPLW6i;9yF`M$b-X%*4t`#KA?+ z#Lmjd!v2MbnURT$fsvDeiG_}liJOs~n~j6$UyTGv&B4TsTUk{6U$lUCd?eqTob0$6 z7+hUl>0Mdq0S@L2Ok7+*9Lx;N%yd8qI!AX~Cqp+nTSwA=V-PiUGqpm$->BgQ>Nt zjj64ZBM_G9Kd^S+08RkMZ-D;|>i=~APXvIXm6Q7qjsJEmHa7nu;pimh0%YS~0{L&D z9aY`!Oc|6-9Rbb`#-?H}z+sa9;l_?z#KF|i3E-d#09gNfq7?r>^ zQFH*9Sy%%*9F--6iKN6t*qON4+3A?+nf?w}PL5m3*3rq(*4R`^l#c``9(oH46K)PB zE@o3k7Bf0CP9sJ-RxV=>I!;bjLpoLyBMwt8BMv53HXxzDbH*(SFn0c<1pj{D&H2-K1x1@z5a9-X2WjrdT_W!!FwjlbeFx-a5e++?-#Q2W}n3|CM z>#@cEwFLe_>-x1p?x8CM7DQ>Xvbu>DsQVHXoAhy>gqn z>gjO-V?maH7Jj?#i42M?D)#mzCxD8^MN~)-DP~>fTP~Eaq_D@u-aXHQd^VTk z*#p~?@D6P5-#$zn4QM@GVC$S}5kA}ow(HF`j3C7vn>+O_4d)TbAk)uwf) z8;`w+c_-s`{uq~fjZSKU_(txjUVgLF*r5@ox2}yds~nRvKJyBai8*h+XH2)_>wTS z>l>Cf1-`Q0bUD!G6Sg1=Z<@HccOuqJ)EsrAraGJyemSn=tSgGU-n(ge*Qke?Lon^l z?f1>*6$Tmu5zz`T$xn#I@~f& z)pq!{S}#k>bKTr=N^hC(h);+CEkfc1iXaJ9q0Y#`1A*|Yu1<@p)7(Dd(r7v8b&;db zu$R>JYHJ~4F>}(7bbZ6G1k|A{pfV+U6N2{EUV5Od|Hk>Y#Q${^^64;TR=x9xurQK0 zu3rbGQIv=kNf|UT0AxS>S27VABpwn9p!2)Xnam!MLiW|{D#oal$#a2e-HeZ2dS;se z@`zkYY480XjfMtl^s;#@3L3g9KCgToH`{B56`>S-+msKMuhddBK6q)MI=vtm0uj|~ zNAa+{UxOgkS5+93PuEQTir%EnoqMmh7l8pBU*%fYcygXFQ#fzF)-sOev%*Hr5*l|Qyo3@&8%9t6QQm@_JH{{3oCP_Azu?;k zcAQh%v=Hv zhbCMA5+8oN%C?IdyQ5s%+dW`Cg(lNylrZhV(L{L8{y2;9Oay4)}%s;!3-7zJ-?i zQ6<)XIp58`w70Ia`zp(?I|{RNLM+eit)nk{^19n_n8oUlJVgpOa+^w42j^q?oGB-z4tGyF#M9r(w8^bq_8lF^DllFIQre4Y@tMkw? zkBWO$ZtWG}i&|sX`!(tYK+Z&&3MxZHdHzVPXu6I+DsyBzC{8nLs!R}rg6$oheC0i~ z+h4t)aHA)*nY^!fD6cc$6r*|^y;z4F8Xpbxr`qHCfE+`Q)t}kSBsPg~+orc$jo2Jl5r%Z*sut1@U940uk?wYH?73~ksYH4FLwAS)n)a7$OSL1yPaQje?MRSE`^?ZbodVPvxus+MXIGbB!(vwU6~tN z4V*196SUlB`3oiWMnY4|1dq}4vRT8|4M7n1uoCXE**BlNHrFN_+Db$LthFSf>|Y;? zCJEBiN^0n8YOx>W+h^M|sKC{1#`ueu@7B4iq`$R+#1WJP;&OY`>KwiQN(Tj1Hxscj z&u0OlC)2)i$1YlZuT=I6u16Gn*3OnR!w{i#R~|KkXOuTTalu8^3Q;&6ntO>e1NjS5 zabyBs9HY#zBCKz)*Q60%D7jQ6x!fyB07-n6=En>S@1;@n+~e$LWwA_DB0R;NOKs!6 z4e`v^AMk`3Eg$VBDmZk97qKS~*>O^2SdAN;MFgygqP$n`gi#S={DJ>SxQ2x!L3vw> zlCk=Qm^O3gJ*OgnuwKR}a$9hP7TXR=4thakK^euwzR9rUkEv-b5TKk*z+4!uNfjn~A>jGPV-|pP6~@Twd|@oAm9M3i zlOEL3LR;+}Kd=i@c2baZ&_<%09w|Ze@iF)8O1Iqhm{$nIkSrt$DFfjdA^Qj#tEyY~ zeJJ8bMI5ZljqVD&O>SN@((oc~(zbj}uQq--%R5 zCSCI&DnD~)zpdu);cmQ4hvk0^dI*})1*Hxwugk78Qa9_Qq+4(rR1rRBPW;m8BfPcP z^y6SO{m!&Cy5ZT(&_bL3gE-Mc^!J#4c*rgr{OFk)+#kV;h&Gm zPJiZ_*~qoqVqA@fHfzaZCC{p?;u`%DzgYyOy(s|U-NeT0&O&-uttsk@ODYApq*?vz zo9803%|-XljrV%!?sna;P1szSXySZ)5R+~DXL+2-CZ&xoh zAr!d4g9N1p4i5!#6pVF_Og&Jj=<&I^6w7mb9A;gcOf_uv8=1$-7_xf~4N0%YITI?7 z+#E8k`8MlFb!Jg*zgU?_xRjP*xRUr|LHl0xi9mVVq|Nd?u%K2&yE#y)+ct}0A4#HF zOP2-S9?x$V7?5r(B*X*cI> zWx7wV#oezuAEkM*{#062W)j@(0GpZ*+-&dwcfo~2Zl?fOqXUPaGPcplk5%_t^n{nd zVD9X&fLJ}45sCDDQ$j?%J47_E1oH((d2et^Y!Ms45Vsr3>KiIO(irvlgSVz@_y@x* z5n6SzW9Pgo%0f{ zmI`V@=<~ai$7&J~S}clWX<^>;@SKRTP~Zw(IK*jh$wso=vv4#^Q90EMHGDU)k|jt2 zpFebS`bhrJwchlVNn48AqauE(MasJ6N#k3oa6utNP@X`f<#}2vNe=~=M5Q8_<$}OM zIHqMV2`FSF^e`{gT|NW)RV!+{_&d&g{S&_kg=;x%K2?D3WPyz*>K%(2^IJPySaTzq z@Q^6pMz{XhM^jX>Iv}n%q%XKc`6keK#{8(#ks@@l^SMA}rRJAfT5WLndS@_yhcq&I zq2$8@~RomQQ88|x3}+mCY#^3a01Ev)*k&`@|pJ8LR0uVS5rWJLN)M{AZu>ez}^oKWBmSIh9ZQ`%sT7P`Ok&-}oB zI;p=B^k-Af&| z2_i`$a3KQRmmK_67ESvdjp@-78czdXT?RJQlq!fR8Dh4Ny+!^MzH*CN$}lt>Gezo4Mfdvkn5{KaV?h=O|Mp9I zFYTv2=W@`_=yW(%J1CwQa^z-Ar zn#uvPkWlJ`537bveayM1JX)#PGKPMwKU%|Gl)ne*Sg#J4BL4M-s(4PwmQowY^4fD} zkNinF&&1if9L?@KmeBAJc#_sV?Cq-Hc`1rFQk+S_>RNIJ6U1q7D*1cZNIoa~lPp90 ztF5{F51AJueduyI--5lRVZuM{vEfw8IY<|?KXt6Q*gFdF+=!5`$3EPjMc^Qij*=FL z!Ehl9PEaECA@*>14X#Z77%-08G!Z;}Pb*`gzo;%XTIP@Er0G`w+P&IEzR^OkMfcPm zJq*<9{y$os|9s6Ob5=1+xk~W^e{asut4-uB*kDcHcMF~8HAr$R_E;+MaCAqX;Km+p#6dKhwkaG`>fVpwrX~d(?$7~pV*;cw4$Y}3mF#Se_taq zXO(pTcPQj|L&Sh(H?)X$N?`Wm&yFhM&w?KUBP0>#VC@o?KGnliUpihlaH5tS;slGh zbcN?pLm;%_>n@-iP$cOj7c&Mk-V#_m7NOTD=K=ajIn*Uh9PV@zmg(Z2gBaGFGWHgvJDY-%0&E~|VVtr*k!jq9 z?y6`CJu$Y$cnx1iy6*1I5JQ*itg)Y(5QK{}L^%^E=B>AHlD?*aK671+6YN#s&1yG( zXvEz=UhJlqUS!cEqI|A4SDha(z0*g`M2PwI!_0F80#7E728E|2eN^2c#V@(H!J2?| z9``a~AxE6wmsqyAE|P%9FRmtAl(|nJ(*T&e0IO%f9Cv*(5UCsL7NtVNII%9itlmLG zyH>%O6=+Y~;dBGXG1DH>w|02s6j&*G!gGe5AZo5B1 z2Pq@65Y`n2lQgrruGFc~W;bNB>9z%+N%n^}ifwa7#Y=E69C(bG)h8sm9qDKYQ`}H9 z{{ZI9Hi2Qh%rC>QJ6~&MczARD;vLZ_6JzBm!0Q+lsHJvN_PZK!^;D$TT~XBfRB5zx z#hV(gsIx z2Tg=PAvv{>!jaFN&pOCwj88Rr8c;B{n6`Y~y{BRkas^}HJ;+znb|SB+HT{wlVl}$4 zeQs-G^#g6!R)}#L@Z5Nf%u{h-+@Z>79e+K4IIN1Jz@YK@*^(3QN_=`fl#eq_*QSXJ z9QV^;bAc|I>Ir8Xysn+l99j5v81NP$33bE?LF2(v^6_rsXp4@GnXK?nY=f<5ufnoo z973oxz7fMN*`=@DYOvAiBlo4D?W8V65MA@bC^IQ%aqK?PN^8ZFrqK+JJB|k8=(*=D znWA`oZm*h`tprV*->^mn0y4)x(>d?X+i3BGb^%3aR$5BaeBLEgPM(|}JRw6Y0{`eB z*|Jm-c4)(!K)Rq^>PmEq=K1XaQwBO{s^%JnN4E!IcAGL6YwBmBeV_E@OFLQok#{3) z0?=y&{|yuNL=2+YtVEhk#C;hEr>0Fik+9PEA@6=3SXyGfhevi1fHW4S&Xt-Yb)BN{ zuZbGxy5``2uJPXdI-|o4V};#n9kHl>tU(zU2#^$?&yfI^Fh8i%VxnO~|K7EtMOa!( zZ&&g9iBdBhITAS{VVd`dgn91k$QP7!6u>exW!1B*8!>*3HooO#7pt1*mFb5PCB+b! z3>fzJOq9n2GBqm$AtKk4!WK&Fc?qJ%;MPasnWISB0DAgt6ks;N<8!@fVj}Vt`ec|U zk4Hh1PGmc*^>UT0ZZkc|mN2NYqmJLGOC~>BK%YY1%M1VJO|7LBYWnj$>UAL#?U1a` z2jAQNnH4AFwu+M1z-zi*k?;f_RicT<>e&0#{pgxNZ1Ed2X<>Lk;5OpTsFjR`?=i~d zcVWnj!9rHuw?{?52Wia;TpyKw%#$qh`?gFu+*sg;HbPpS#V)roS!?U1hKADK;&5o$ zh!rlj`#ozwHE&P@{uKYy4o$(2$|p&yEu)fSVEW49@6wLN=?2XP@7+v?wY!m^DOIW8 zKrqai(g-Cx3+5XUc|>khv@Nl4CuDF%@bn{;_+_4yIh(NtBvn?b5dh)ohOR9`bBgPI ze}}(iuQ4i~Ael2I>M8+Y9>@sWs;-UiYd#gbRh`J7d(~srJV9zufm#L|no_F5{uS1= z6d@>YbDAvoEgIUoE_A%cm5X2t^tOM-ra7y2YUJG$hF@9?-8d9}dlQ_&d?Ie(i@Q1e z^VLuu4Xj1SXSA1W*ewJ+4G5rRqW|@y?AA+?RkSiI^)|6MryQmd6p=ygl)tM#4o9G} zcqiQG&niKOgr!W~=B;WH@qf_Vhs8qxKGF*KOntAHg(%(M-fWfXwzRhg;8k6;ImnQ} zkn<*vJ>EjXClPJWtO(4TLr!Y=3WJ4NW{9U}{H<+GytH5}H3w>Kq(8^E%5-tOGr+w> zImL;shJw^%OW!l-@Eq4Rx^&J8QDyT|Qlmlgq(dHkEpo)Fyx3w}X?gxVJHo+b&E&mw zl0H=!V)K)L5;M8uPx_xvTtb4N)|C1#wDU<Y(@RL4IBsb1^-j$$C-CaoyDS7-&)bxDG9z?juL3R6*fu zUkV^Q4X56BH_XkG+Wpn_A4c9Kh-*}+Z)cPn?9ffk<<0vC%xkX@U1t^&#YRdrxkd!E z5P&t1r_XESL={n8D1D+OLGy^`TQL%vK z5qx0$%ixgvX;9qSNHxm|bQ-f6MduOaiL^7=W-B}!Sk4K0nRYy4nkmkbzrMYh4qC6Y{muPK8fhoD)SNSJ!z9!l*KaO5KpBmCTY1%HGKJemUB+Yu0A2~j z{p=^C-p_+ZLP$YKNE*z#gvSXmeR&Eq7g9oc;=K>Kn#pWEdnf`#f>$CgY$jv$t@blaj)>X6+g2hyqWi6_ ziryNNl~fb0xd+3*5r48MExeTc05~fDY*vgE|0Y<=Ye9hs+IKu^o#Jg{V6$_^%snbQ zUE^4$0wSFA4dJ^rY@JbY2vuuTmUWTS-c6Ts|CV{aB|l!co=49~d3F-#b5*v@n#%**);wSf zCb-tQ1|I#DjqJmPhXq03Q@k3S;dSptW_Pi7PgsR@c)weU^C>NMw8Qwty7hkT;;od4 z=~feL<(#XyjAZJRGxb|o=S~r$#i3#nq}mEJ5`DEO3%ke(?Pq?f;iT35*vUCPD>p6^ z4dbB9P)Pt5q3-L8lTFyVdFGGS6XC!eL6YxWPFS_^3Io_ISYL*V;H)x%lk ze60aN?dc3YHdX?EUvltN^IWAHH<JwGY?=EKa6+x0<=1dnX0p17ZI;OA&?hHXrHHBog&b0Or zD}+8WV+yuIT^;qCa!z(_#6Me3^Z$moqUmX_@6ic)RqU zRPL|%7vHLbjx%RRv=I-sEtsR^vZ+zAQ)ZW5&vg!$!p_Y)!x1G)+(owvkECjU{K_4IOMvJynI7e(A?|Jt6;c-I+sPeJWYG-l2>1-as zJM673w!2=OtuD;N4`9IAeSx#kQdL(qLckqAY_-Iz4mW%AOf&-)!95Uw8M7JV5}%Dp zo$hFylKxSrspo@P{Ro zb9Pb|NP)nT)4&Gr3hzVv1-^GMXMv8SSFKRP=k|hit)P`Dzb(K0k{oJ6rcNtZO_#{- z1lmpm_m#|OTI$bgYo;tv4lpAzrLQfM+D{Fsp+$of+PLW!8%oMbt> zLaj=`BpH7+E^@0^6dKxKxW(rZ`PW+V+CpMf>uMih7Jf>}KW3RV_rp*Na zR_FcRx(TMX1z{coprCbMvW%V!`ofid>kP0y($uxq4Qie#wcOk(&ipB=3=>5xGg=$n zng|-=Ek=H(hTUb;#^t+50u6e>NK|(C3@9bTRW!1zXLj2QWnUit?axhGs_^b`+aZp3 zlcH!sNfmy7r&Her#*u*mQ^MXK!0MJc#GyXkM9xiZwGYSB`o=|Er|=B9;^BK0Iy0YK z+ieY7y7(72Qu|Fg+6MnUeoAl?MQ@?G986??UDi*2+RDKblpKb3byA~X2&-hd5Bg&U zZQBSxD;!gO5*QPEBQ2QRC04$YllA0Y=U!sbkFyObeF@DO%ArBanMSB#p7lenB1;}` zH3Uk{7aOUt#(>+RytJQ!=+6oa`QYiB?(vj?*bk4;hnt))Q6&sj(gKB5~#o1+3^(y_s zUdWAy;pEzX$p7Wb@Bto4G4;cfM}#Bl#HJf~$?}&gFCM}KS;Lzp3szQJ@llUv*)-s| zh=HE#6ju^=>&o~5UR>6`N?!A+axAMEu)xL;F4V(@m?NYm86z_$8PBwREO`-YAQO>z z)4+Xk`kOroCf^AiOYYY4+bqZ$NHMFQwifc7@SDe88Wswc>&mx!cD`ATuctj$It5e6 z32NnSV!0&)M^n(Z=jrX8zXr{H60$NW0Z-6PmBfUlMLVY~-}ILv4`-$dM5VP(?P4WB z@mQjyF~DnFYni2C8)eW_2b*R}#J9MV&q==*3KLcGhL;hk;#yEJy$0{NxNsrD*Sre0 zL(*YFtwlHJMTd>~68_8V{t}1Uu?(mdzxO*_GC)V$Fn%VrdV&bv7cUrG*C^! zci2^UiUHQxB_f9kIwuth5NthWoANfV*tH@dqo4YtnmYXQc&RsHxtzi5;?u2bTJ0CR zpl;ePqrl=FP8p0hxN$T={8>rbZ_a2?mv9j6T#>oa0@6sdsG6C0DO=Gy<;7KxVwpX)@%oR?y3FhoiAVdQ`Xat zTfIvvx<=5Jxw)?p>`AD6>*I&8(4qKGS*0x9Pgf6ucOcwU`uG#YJGq(K#C8B%t zKvvkpl%WABA31BU`)o&plV{7*lraqDy|PwcvBG3O8Lm>f3o6-F;1Qs(9=zo?b9g8u zCMIXMZ)+^%Y7Yp7q$aQm>=LO$8lpWI!)CMxHZS@Vb4&GHuhv)gtib7e8LNzuir~_i zKV8Go8R`rZpriP2nM`LuFihyPH@qFv{@Undb#}YGh`fU5Qay8<5LyCr@}C05&Bzd) z?%~{(P3l7US!tkMXQ=xWkGlUZhIZ*vYoT&;t!;O9@jZ8LFd)b?*K(e)u`Rz|G&#!f6WNs&9lPmFp4J`5= zcI7fc{hf^Q(}>!UtFc=EidQqjos2j&&T zlE2CDi2Lk8Jv868&U|o&Y~T{rAPGI zY+wslqAw`y3h0ZjIZ3Vo@6|bcGk2E0)%K5{py(xSXYi<;cXj2zDL$Y%i6&Fy1{n(@ z!ow{^kF#|lf*=7H1v#UUGKw-}yO~=a_Jb?qE9#VQY38^+)Lii4rC*|*t0Sp;vaTdC z=JMJ7E+2g)c6}zHt!DO;*XE`u+agb&h;9DTPbnI%EbUZ{sip>JmE`HBJI^Z04)>jG z7v&MBY}f`aqiv99GfDN#&#q89HzZ@Jkn?e}Xqd303AV()H=9_%FOT|-LLY@1*UOS( zVsY4c?ZO^qDeu}idUas$=1(@+8%IoV-M^twP&~IT*~@$$%GaC2VQBmVszBWQ==^iycY^92kUEE4mmMyw3Zg#hAvx?k^6q2t3GU`U6w}tL^)Wa zv-L(x?5k3u<`rwW-LNM(r_5q58S1bXLG*HPQn>LQe2hFtMy{%^orDJ+=sY;Tw|PVn ze(2XgI=BFmgn)YCeKPe=ta3T0b$C?dkL`Y!J8pye){9Z;E9f=?bcc8JWBoI3G9-_z zHql^QfB198Eq5mIsGGFNK(^*yjkOd99F&Y%wP(HFAtLnOHZuaE$*?z4`+k z8g`?Lt2WibiSnlio| z8Y*wQWJl)>FsXg6cR5V56E?)X$j1i-sP^Y12OGQ2!QzjR&&`Z4L{>FQ@L`0aO%cLn z4ac}pWQ->Zk$W9X(s~AnQkHZ^69DKbrb)pDz?qG!5`W;TuRf7+Mv(-}^H;Y2f@YIU zoQIKDHWGz!NUl&r7qUd|Q*Tgfr)?yi)c#ls{^hlEm(1llgSE1=9Q{)g%wVc7zUvv^ z>Yz)Zrs0+}{n1-L=~t@6>&i#|N3BH2!UyStn+JYq*&zMwcyMk_{a3E9L4xzcaWWM( zi`DBPWu=nTq6Gl#&bnH+%QU6$=X7MOXEjRPIsG}_=m)=Oe->OUoh{;P95oEGWLdhT zmH@NFzky-?UKfJc^e{|t1%A%$8B}UTg_+1y{cE2oUoa?F@m($P{g}W*rT2G)N`ap{ z(Z#t2e54#4H}6Rkn(xoTEmYwONt@6$V>E}ejo;VN-P_S)PEa17?}|z{MjD#0R`hdk+3;6Rp6PLyhEmHhG()rT_9V zwsY~2y;hWkhE=mcePmM?y@k4DM*Lj@EDh8wAxF(~w{I?*OI3sCAjsc(X>4cxti zJU1M{PmwLd3r~h4(Wcyuv31U|gmT;#IkTZhR+1N(K@@cF8U9?;a*=9m$YNWu=-zIS&l`I*!GvXCUoSNTX&p1uzM;| zyheBXcNO||1dRa%fqkHHH1gMO5e%f#n^KXppO@J^8d)Gomt% z4UPRzjahUR;G^ddC{VZ3F`Z3`9mTF$KHbZaH%kg@NRrjQzLC<&3S+3ZRza@>mc80O zc&xb5Z_k-IPg86v3??Rb{ZWKwv(u4NOBSP;IZI#N&;YvuZ5Q*s`Ia)&VQZlPAwg#% zND~!{-YujpJGW*XDR)S5_9%|S!n?*5o_q#}1j^n?0BA81I*q>6lj_s!R5f$qg->}D z`f8TD36}M_L0&Y$&>$}Q6{XGWvW7gHSph8_QdrG!Olr9p91ERX@S0m9e0zK%>Xq!4>Eml&Rpz_)7u52Ug0j;?U#i*7 z{LYP&^p=6&P0zc-WzDhgYX`=&wOHVkvR|L)zRyMDO^7saNVT*l;D?hz91T*4XL^5G zzv#R~x6$7PW9A_oq^~GmDcw&{kkX&N81{cS6r`y%-pNM|(+OzL&*#JurXf4+jlaQS zWh;`h$!zPzUH39NEQ$EFaUFCQnp4et%CR)reC@`qL^y^wU_wC)mQ`!SV}?6#t2(*cSl`U{Vr@dFYT>z$`F*r2 zck2WTQdkh#_dLghl9E1;Y})BuMs6Nw(KU9jkyV7jCS0ZfL-zE$@AG`+)(;jVba<=94LZ%^kxQSFH!y)oEw;aT6Bn9}P*1s2*-zxqNvXk+{-|KAsIybh zX?ji_*Plo~1#!Arp*lGeAv~c(?VM_6L||dFS5zx;H24D+wb(%mecaCH`=t`ibv>@# z)_hJI&G(UFwA4TU4BDR~dCulUVh5OY%|;tfj})tnJQYY$CsNcOz2(1~ z1IK^!xN(tyTGe(e4UyW%PD<{+Z{D32uQ{AYMH&Zr8+sEA-^nTm=(bQ}mIy1Mp=9d0 zk(kQz-eWa^pbkbGK7TL1c}7LtI-AF|&{|sl+{p~Tk-}gw%ajb;Hx{*v#{+Lfb`_#e z8?}6Wrg6YMUvZf@t2;4%zPc;r+R)dZz`vc!trL#;WRrI6d3l zAF%G(8?anCLHYYq-bX(By`z2YCsX(*mjD#=amYo4-`oe=LV*%(1R}}5@c$HTBEz3o zqJNtg&OXwPj?nAMSrCP(!QF3D%nf2S))N*D7RPnDBGjvbPcYiu>UH)+VEtrY30YiP zFXMhx?2XI}EvrKU*z6{$Hrd)1aw5t1_QjNkoo7Yv0t!92k1^x01~EwmT1BpVxVpD zEAzku?#Ub+@4wMLC7H&KXk4ycWC>T7DRW+iT{3ya9o63@Vt;041vvJ0DXuyZ0e9Ozv$RM zfO&liuq|@D!8tx28##&N7mlHUaeQc{=!}bDb?R(ofq;F{Pg6z&^Xhf*35jr<1va)be@+VMsgHyuR>*r zhYIXX!Ml32OR7H5Bg2eAByK|ixdQK8#>sR!rL53?h|rICI5xhD{?BwHUmcV6vBxH! zm>j!)VoXr#oX%WrAS%4=Z%icRH41@7`vs|ZXzz?QzX=aHU6;~-QpoH{F8YWe^9#Di zlP&$SM@2a#hu9v;>BhaEG_W-KF7X_qvYt6l4bhK^z~;P9Dv@aI_I2|0?laEs=x-;? zO+F_&b9nYNR&U0fM#Ds(iIPT$As*X5`70tR=|h22AhDD!OnFD zdgck;%uxJP>RQ@)&#K;e1)IL1Gad#$m{Xx2o|<$>js&&>mFa!^CUfG8+Zqe%QL>Sy z+r`2#kJ)i!b`tS`DR1DttDpZ~!V>wME3vGH#%x$0Gix zi+bpn)dcb`PxO@46k43=PAaD(qYk^R+1pGZ1PQV=4D-5F(IOK2j~8wo^#Y&kV}m`l zD0wNlGYvv&p54T1Td%$EF1a|8s|6jegSev#EpLpDEaX&vV4#re-fP^W(Dy%;a811; znPvtG&Ht&k+Fv$wFxyJX)aEt{uc3igcOKXjfW(3VT09bvo*wK`7NHRzzKLgf@z<}q zz;5!{!S-lm7o7#lx1NSu=;KrQ=)o}zTQ}vOO$+dIm**oFx2G}nIkA6UCzSJz3_I_m zx-u^PDg~t`Z4JBcBqsPB@m!Zu!OdYOhO*s5=#)k8b0zN^Eh3EL)~*fWMiV*n6Oy!f zRG&b}&BZd7M6MzgsX2O`s!SB0yZ9`AH2;QGH>db1M|eTw%hNtSqhI_>w=q|G(~o=2 z4~S3B5kx3+NMTKM3IM&EgRL;CB8V5^)Cq$bRMYqF#4bb z3}mY%Kd}JW${Yyh*LtBFPl5*H3P;8GCfJr>moW)xIM> zDn$eW%rl)v@8(zhcJ@!Mf9s0hR@>dHBhx9wh*j0^+A3r- z_;O`xd0V-~9Ke9rg<}sWItJ6Q^P~HC!K*aUIFAw15vE69=n^)>BV~P?Xw>1xY_?^j zHh5x9T*kH@h2t&rFN3{COJYVxQx)q0bpjrV?* z@uOR=qR%UDn)!MBi$NWa$sXIn#^k|0=#}x|Z7F7Yi$=cXQj~^@_oMI15teheJ1}*Y zH5$;lBfETChI(~08l_7x1{Zr)&9}hji?J6gZCOkx*sFo~i$RR#GpiaM*=H#vVWAS5 z@YDiUt63!sv)YT8whF}EVEyc+=@Ajgy7EBO#?5YSx?R>L_Qtw14&R*J%Qy)URC;dO z4P{O!H7Fj)oApTioF)!)&dj~+Egj(Z5C(sXQ6fqYQRcEjv~%+bZEG-1~{9 zbgXS>Rno=*7`=16r4u0jInkX^lijPEN6fVI^FJ7vW~i2b+C-&&SMhNQ=hzarAxjyCODN`LxTCUwKt(yWIA1C+%_d+!#` zc#eVPT#y84#@q}3oWE<9dOQ8O8uG(*$tNG1q)s!c_vC7vS>`7DH(zB7*Ncwe zX6Id;jLwbc1wLoB@vGCvmz3#;Sl(deG87-=FH!9cKmodSfa1XkgA+47q;6=*;X0Op zipyn>_JBh%0<0RS7xDDMlw1@aYN^Y*Q7kVi=y3S+n*$=oy8fR2864$uydQ1RFAo%5 z(;R}nTb?eS8VOW{X2YxKN^HPbUu>Fq$x!EiRcu3TU0lr}`s@MX1Yr_B8L0=RLD+V1 z%E>j1y@aZOzo<-u(9?d+Ll(uAk(Bu4=%7&kpf1nm74Z~9D>aIfEJI|$ZO#+>`X#mhG4+2Lnuih>Q+ zbJb04uyn~mAOmO({KISL`7ccs^`s;2h}R`?XrobOtZ1kPqd8^mH&L;UzFs4BNfWyg zKg{-K_S%_FxTqFfO0j;&Dh^1X8YSvQ-^HU?KU}8ZLw%%_Idx&?MOG|6g%0(N+DwA# z;U=Ius|{F!MMKDx6Ffbj^LAD;JN1t(zjZC*!5M7VQ;DwEkRIROhAgyI@lP16Jh!ON zVEVlk=?8y7JP3ocEH7}_P+1U}Qua~d+56d~x&X1{Q; zi~6_Uj!0WbBsQhY)fmETFxp5J6eE_-yCO}3)2oGf!7feOCw`M-L%xHxs)!#rF!&1W z)QMkH@Tc{Mp>PjIzBg+iuI`R(KI|T&pn&*EBz{lJgksl4?G_f_2+!h;P}nt2JMb`q->AkMpIj^KG;)G z!TlWSl>br&TfffA%Gj#@TaSHUx^H~TcH2<Db7`gcYd{7r8^Cs;_OT98(uRsoC!?66d~da zD#P4*7L)?TMoLa38dAA~$+mM!M3ANMs8m^pXD&>pw^z8ZrlxHcva{)o=kEL5MzgZV zLQ+9(6lzlfxutBp8Q|AQdjITkeb1LWn5!0#bIPk0v*7RY7$GgJz8;`JPeha^vlxCg zmB@?p)L(WP;xmrsQ3{T>+j~;S(ol=3M*Rm849yt@ioTt5nP**$OKqmL*`26ZANf*3W59;f9_|C*ATw^+QS(Plru<9Y(1% zTrl$i^9Ci>X=ChYcPysy_@cl&8HI^B1d(wWQ>OCHT2S8TK5{LvF@_xaBkw_~Z?e-_ zY=YLT!lb2ECJ=6~58acDGncn>JWmBmuF~t4uk!P^erfR|K6~c)D87*6+_&$F-%!z| zRI1;D-yAGl!bX#`^NUlx~|#Swr$(CjgD<6 zJ5D<6*zDN0(Q(JNZQDG#`?;?7H=O->eVJ>|nzP0jRkhCjLBEe{V)}vCMdyL2E8|kk zKV)sgeE?m{(_YIfb`ov7UG7jWB6-M#f`0fPmuYWMdJgNIChJ5@KK|{N4a_?Pvb- z1|K5>3Ow@p`H1C6$L$It3tDbx2G^wV5rI-}Jw5T+%V~;;oNjg;H6U&0yiKxxZfm>l z1{R7%35BWDJdjsgl-@qP zLqbAxFy}e1@F=tsll|lhx`ZsQjV1LE-8yKJ#4c+m|g@ zW!j&lf=L{mxyKhV1|O>^t+|(9_|i-h!ca==4y}etSk8}>BULL9`V*P#(wje%M636z zGrXAJ>fV(95?Wi3fk}nqJBZDU9eZ3pa>~TK*r}9yDXsnr&4MFaYfMXC801$kP%Q9T z{*jO_zHl1a0x9xB%7MUtrEbySSDHw#06!K;rENBS)5ka|)BP9!$^rZd?YR-G;@j#5e2b{Kxto z&;9CuKU~E`{!;srJ`4+nQ*t>G52L?Wo|%l@njcqHQ5DavOsQ^ixq;Vx%!ZQZ2_^%# zk-)geIVBm=b<1!4=rq9IWWgcy0x3fmP#As3t;TswO>;gF)h$wy;v3;%@(?_WsW$LC zNT}9Ls0S{XMt4+E200LZ)%(=b->TepaOmH=L$0Qytojz2c226aU=+J6!zi0`KtE<; z9_|knaa~_y(;2kJ9S&ls#n#>7*}~?XB;f%N+%zGzrF{aFOKKErjH6CzGeb9^!$ZJX0=@dSWVpsB%-5hV4 zv7l6&NE!mak`-7!=I_#OuQzOg8+X;}cYXyAY{ScPYita-lv*O`WN2&oS#G)Re7t_1 zF}6pJS%m#}cSxA!2>i!fQ~KskG2Nmz61WBA1mF)$yhtYngWv088BJ&Xj)@Ss_le|K z6*v5MY%jDQ?wcv@(*3QmHmGA?G>&2Le=d{>ew=ke&W|2yA@YeXQqdKbNrY{FPS(^s z(OVUou9~^oq^i6fBy_|7xPMmEtkQ{Q_wwtIiJ5%FfQso8^c6fsB#=JSx!Qf1n}`ww z@M!uRzbn?|LfBCcutY{|(O{l$1t&Ha$xY_$vXYCAU`Qbn^^v%<{# z-r7PP)N^<=?Pn=6P*_dy(V$)LWAa%onMd%)^RYN%#6vm5#o&ZUI!zEIHjj+Wg3fzY zO&Of!A6=d0v<;OglJMJ_@}DZ?gs?Q-b&RF=(kcy;OmpJ$s(9nKKGC)O3@E01$JfCl&62| z5rA(8y})X<0kC8C{LPHDaTbCkJ_fOzH}l#Kh$7yo;9*nf_STm_E$Ayf&l9!|2!3Yo z>`6Gk4_MqRMmiYf8FAFeQsGy5prPxr&)hK|c74LIaG-pIjUm%^gSgeXicJneodWO$ zvTzNqw>Da{l+h0iF)I$Jcz#f~;}EuAUN+Gl`QEQb5y|A@jUz}Pr1jrJ7f4ySNUcdE zBd|1_1hoX!h4Qe(N6PYn+XR#PKjcb0cDt%?+;Pn4iKm7y$V8zpVr{>@Xm*@upGLnRm6O%vT_2C?E zlt+DQNLn~Y!i!Sn^6Ryt#lnW;s%Y~Lf2ViZm>Y~QLIy_i2ZvzR`n1X?-7I&X5Y0-4 zunvzEEF2lChGiBjq24{E+v`Q+27vE#aU!V*zwi|N1dXT1f_E7Hd;$`6>eJ+nMS%tu zom~Y;BQMcMdSW)`sG{@i*!z`XP;C1Br*Va5;*U?@-c@}#?B&>)qipgVR$-_@JCkMV zK|QW#bC=uk22|K?)yQGpm9c@%BL6_=rXe27Y&kgeZ&c3H-4Bod^tjc;P08X|PLoKArztsdd zoptqF++c&zef0wKqN4*vq5p22-%gvJ-^XPv>%1Rc446UJHoe+t1v7wAnn*=sG|4G3 zufwP1q6mzBL9Xzj2{-jg;1 zKZ1}z`VHD*_G`0gIOw(Ds|iegI51r%oWWK^$gpR5wCZo@)?`rTHYQPIv_E*R`)$jB- zef16w1*1tVE-}6Yw&@?d54D3$P43V;R!E+1i}vVoW1`}<2dgtnSuG@q9Lu&VIn7`7 zkz@LQ|Lg0U>{M!bo9Wh|7gaR3*nvH*|A$cQ(vDr2+wwp&QE4Wjt((1Cl6XWrDk(N~ z7GZmBZM{XW5tE9sPvv||UOMmyL@|u!YP)BN(F9e#p=;65ep}k5m^hS7zKAIy&`K^Y z^PMq+RZph9{-WZ}j$g1XQx_j5Y)vt8b+Qt5_EwW%eqkx3BC_4)KkuH%?jvHuBt_KA zT5hq(;mH!HRYuU7?XG@sg4H4e2IowTYc|jE`F_g$Oy(Qe!{j}!qJg36iWt?kS(#(( z8q7kM{s@W7UdwKjH|>gppec$Nf*@bgqg4=}Xx=6rsW-<-nb?6mTYT)CPn8VIKSF|e zj0B+JJnqe;805U&A?o{JS2fxniP#@))-8VLJK_ARL?9HiJ2VI3%cvItNz^Z5bz21I z_N8A~!C-3@)7rLFwDcKbd;wKHjSj{niGNkKV!sv$`Qui&oP(^ex*Zp`pqXl!nrF<$~phHiMhn09CeRvAhb8(B#&a+CgB6p8*xH z;ec_@J4jpWJ<`AGzHV{x`_d%e{h<)Uf4oFVDzq<5V@R7@Jm;fJZbM8Kb4pB*_`Li) z*A-e&{WFQshQsnSMoYn`H&826=?eS8)nY=4m%ib0v?L|Wf7!ALIkCBX-tTEcMeYhH zDP8%~3NykMH@H*$&ez?%D7XWRb)V@H>!5N5)Ptc*XRH?u%m-KvYOYtP|oTl014Ez1ut zYJ5`EAGA01aHbBqaQrDinhv7Q{%AOjqNJ@%N7pr0edh^v@2(NUt;j#=pOnV9D(54h ztNRH4Z%(*0FY?kOQsANE*p8f;wlM2xyCZtH2 zPijt6q7jAAkq$(nkk>XqNkR?HBZFW87e3n2rihRzhhnl)g_mlN7S1Fi1b!Sj4x z-+)F)uk|K+QSiMs;D2kghJah9-3w`A%RcN8WS{q=t49hL=mJpnE}0j!G#Q7I60(!1 z(8-&NA{<}oef~KPQHL$?wRm56M0}_;XW4`%37xT#Pa3dkFs~R@ZH0yi(tau}?J<|A`R5EI8tZy@~)U^E6)!!2p>Uawv_OIfE;ia~FLe zJ6|C+s-1>8tV= ztXNnAzY!{ggFd$($jXb2K&lD*Jl@uS1)EmN9lOwCspS&EGff zDO=9NA3ASq^XDzr1xx?QD>tWk#A*!rod1{FU=K@RnBSt)Q-g?%lKQL!c(y4_ti_tH zI9>Kx1@FB#?$75nP~0x}H8$ji*Fw!|+u>YrG(AnH!Z-~I^Ly-NjLHXxpx(rG`X z$YHP~`@t`zWB-V)X_7RJeu#4$u5eCbb8#9Cyl#m?OpqX;UjwePBVf0Tq@|NOUhAcg zj@e(U=`OY5^l5LvO&Rk#c?oxx!_4iiPwWHHpk;JWzQA+Lczn^BtpIO`MG0U~XFS#2 zV0pGX+web}c%2;lSM)@nRGge)1-xd3yejUHuA`DbrWjB%-#OCQf3Ygm)=C{pF{!~+ zB~q=D!~7x6$FOxxFlLE1D*!7OiZ(0}Qibz+!u>t*GFC5KV>qS)gii^ta!i#@XvHm6 zRoiccF_f%fgfLrJ3x_!iJ9JYg6>f4UxDf9BAkwEe8^Qohu7adkq(q;=0Hzlc6cDgm zQP>0F6=;mkRf z|7`&Im&i5PbMy9%9#QLvg&7nh@)xVdSOIsqCd6HRhC6W%FCO}f!gXaEGIxTDyUMpQMY-e=paTv z;zCh~3WfBc=9P#$szB=PpfTuwL=By7>@mwy&j7M+PhocP?R=ccitBwpFixGB>e+{$`;W>ZASmI4@b- z7Q#lb0Tu947Y|!loOLi`L}#fBR<*`SYR| zCcCdEp~$1zzW3$@_*#;r(x5i(f>vWY%ZG`^P^uO`LzAE*)@th&qg-kDs8{n$c$i{* z9wG{7SVsEpal&Js$CfrW?*v>n5I$QUa=UCLY2RyU(vjJAPnWH3^F6AfGJJ{&XSK=n8RKqEMF`5sN5};7+eIinno1cO zu6l+NcSqshWM4xowOgUV5F#k?frut$b*)}A$pvL)c-f&4uD>=W7I{&84oM-{thp%< zq7cTN-2M(3(jWmUo1n(uxH~ubw{;8mZaP_Oql~<7ZyS(Atk6n$b38HPCrCtz9r5ti z1~H*>y*s&L8ph^Jg|L84p8%#a7RSFaA{2>$=+_{)xb$>->guZKv^gTo{Kp4s6RFwI zfX|~Uz=jKXMh;=J*i;6_SJbT#RUQQGw0yJ_5T8Zh2jQX+))x83=8T zIMsm6W)3Wfq)eenff-7YSO-}7SOqF|vDhmd4F1bQhRv*7=_D@P$%%(%SG^h=P7%7i z^zpSg$W?N1qh&`Mx)u&~W219}xZbDizxJrdSsvumXsbkZat!lFQBB8^!kbvHlEWDR zo+#vzDg~nq(R-h)ziKJ&qoR+G3Ki5?e}!2*3k9DqWz3oGtgG|>unwXOgM5^OFR)-x zOs?}iGS^137TV)tov@P;_|T> zv7PKy9;8b^FGWrp9QVrVp$YhEK2vxZ00SjRYM!ZsWd}irvj~kp6bb z4~eBY{RJnu%qjWV|FfTq5T4#WY3($Dc?m2Wpz*f3`@NOxv!m(MZ>Fxbq8Wh+SU~~F z)x^H4Wo{2X{60wj>R^k`Ct}evb%w4djUhxm!+LSCsrYGXuERLap(IM2i3Wx0ydfjH z^Na>OivcyDitL+alGIaZl3(#WLo0mq1l>D7)jSJ z@9rTHom7p}et!0ihg*YKCHRC$!mVRG08(ECX(YVG0?hL5n|H<9<;O?~LB(Ou305M7 z2}L4dxAIM--jp~r1f1W}iu+b$snt3vt*O05&Y{3ho`OAJ_FYVm#dSo{O#Y^Yz9$AbBgO%6aByc?28N*s_FxvjRb$M z7z{tei{HhR*XVA*HQrK*4eU{F+YXkA-Ewzxm`LR_Y|iN$rd^t6>1>eUX8A1f&?& zAg?f|^6BD~;xYUYngNQ=vI}e1p*it~uV22Erj96RT(RR;f)^5kl0sp&F5bwdA@mVr zqhc%zI^I+gHPT8_lUUA#(-U}oCUw|o#^%F@0uXL7Jcz4<2Lrdk?Xzyf2b!Y=ckud2 z%1lQdT|JyW1AOItVw!S4w^h3d5FqV=1@3ltzK5OQ|KJ?`rdOvqxKQ}ZLCD#rOH9jQ z2)nw}ABYtu5BM(vu0ux=mmM`_XvA|ImJAvkrMPqrR82^+aaY@6&gB%-ZDW60+w(_= zz>QwlV8d4O+7IEXaR(D`~ikn-C0^lcRF@)YvgTP+Y<=?`L)wM=gz z%Kha6QUh~y0Oz{{Y%Wdf`y)JM-4Yi3#tFHC>QS!0pZQ4*(6sz}NhSyew~y2zoZ%3r zrurfUlPo~4dYaB-Au#!jZ-IQO(su2AmsfLK*JZJ##`0yA(J%S)fz*%D`+P_9xwDIZ=7a%-PtJQjANj^RW^lpZn$ma(zBcHDhsUaDw`{5~r=$V)iaJX+ zO5p1SLQP)piJuM1h*hrc_ma2n*5T!!b&`Vd8^tG?h2Nv2)wN^gHMN-6L94s;v&A%H zG5`6N%OBmYcyco(;#cD!J8nuRuhW5|y}XWwzvY=db5@q?oK59~6oY*Lsd~EA>swXC;AVpNw=@17$d-r5p+co_Uwb>sdDS8wxvdWw>Q~l8YiGWv? zRUbFE7djg^(@NLy9k6XOJvM6jTyRygBCeJX7nkeDG=e<$1a<+2=`m^!pMYB@Nm$ZnlG>6owirK}ic9RkVZ zHCqnDQkR_jqyO#t3_ZcLYadl*#_~o~&O@Ol?lvUIa(@TMhVwPW;j+hqBjkxwYkgN* zV?ACS$GFB2SAzOZoJiFg?`jjo6QH?$h!!#{Q!uH3%)`JyU^ggb`h7|JzW1<06$nF` zDA4nl{{vB#(APozHpHFtt;^^KjRZ4~8oE;FbaO(^=e;-QI6j)vX51%>N?FueR^Nfk z(7!I9&uwQXrw328vdUt+Q{~-#aSPTVJxn+f(Og(lwtyfaycO4Ydds{sT#%F}_JJ93 zv+EDF z3v-Mmmmg!S&*kxxmoqjBbI=@iCaqJURaSqhP-TP$ii@i`;t0L^t`@5Ua{Wr6%w3dJ z5X{PwQw5m3A1@?h+aZ8|r$nInh;YI|i;(Z3orZ;|s|==Sc60mA3Xd(>GIloE@Inl* z>xhPWpj1r}OMcRDTrK=nwX3V{1@$)a6KTTxj^qBPaQJ}9b>pPSI98r~x1{}^HebURPEU2BC?k&Hp0)Zr?t|TdwVM!61 z1?ijmcpgDAtOZiR8l<_Lg!^mAnZ@6I$3`dfiI7j`bg0|d!sjoW!%WX5_zbj7_O1RJ zV9voHwJxPUn?cl9Pw?~pbu0>-Ew{F2gJ9xzT>I^;rphdM>W>T0{CJQt7ao^*8&~^q z8|_-!7W>JADzRG|dkcl*rtisQ^l5)o;nznpTEDIg6fTnmJL=V+hY5$~&il|a35Cok zJKm1F)yS{DO;#zjb_$Tw4E0^KMt*Ql4!BrzaRpEZ(3)~w~v%{xm zGjjvKi~{X2#I%JfOSG%$&-;%9MXje)Nu_xz)=QtYZk3zb`?5; z4Yw_;!>PqJJ(pDE3qdSYkC&MvCHCkKTsHlYmc)}`)G^Uy196$G+uA<=Ac)>driL7! zm~m*yM4Bog>9qZyu4a36EzyD>ZOK6xKd=GnMM`jd(4YDXsNPv`1*{iC4jp>0W0B-5 zJx+LN;zsw&$Vpf{Fid_gGTIt75||*o8TniLA2y4HZwA{xa;aJ5HZdm_f=>KYxDyny#HLU=mgfzOMF4HoEKVKKA>JMa<#URDgyA zQ^Dv6i?0tEJ<o|v*m)sQf zK()QT@{0hxe|v&iZKo@U8ecbf%|C8&9q3OMV&%^`R2HT)Dnb$WqgQG`#tR z_=8E^F-9lN=98`aUgI9=gH<|?{!t}y0F@?Z(H@lcq^hG$`UWB6s+&T zvXfRiO>_Bqr9|UoitnG7xQ&zWcuu#{9znpyIxW|uS?;U_?gk(P7pS-&FnNZu0eM2y zzb;WQGkqyS@ovb0LgrH~oQZ#S^f+d_;&&iskBm4dmn|W={3{@q5C#QE!f~^F7!DA3YId6VjJy^zZh- zLkTDZzXn}p@S5c>T9H>(P@&nbfPC7`JK8cmt6EYuJ;Qo^W>v})-UIS{BA99^e<`9sm!5qpjPr(bvp-;WgLKnaE)8(o7SU#$?lWVdrXd8p<&3Y z&K!J|i$8OtPkn?=LtcOn?>Z1enSsJ8m{1X=sGw`~szwbG4d6xdT7qPO*i zCwsm7W}mz&9LY;Gz9FaIEtb%ov>wmTR-_n^qr)`rk^(FQ{)W_xXfG zV_h4Va%7*!*L~A|Z8jCs?66}!0ii|Lnt%KY;qE1g!St)H#G5qJp7QjlNbzmYhW8&yb^+)G49(!BAXi(M#0d6pOo5xUJF=$D`6a=(eBa+vPxHe7(F>=w>^^DQIelokO ztIiyLRk5&Nhku={VG+%*gTc)Y$WUnY1e*IITLEm@JjGzvbS3z?^*n4u&UzT&cOMoAZK@Ent&t- z&Y{{pxK}9)j#+hbLqUrz(Vs$w7O{~n8Ch%Dj9IS@Sk*@daGxGiw%lfP2ZaS^s% zNT18&W(wC8XB{Dj2?5p?;ahwkY%1{eL^nhai;)65E(|GahE5;Vc~C%y)0smEeaK?@ z0sI2ns4#Oopy>^ZkM3K;)#~V1*OxBCrsSd_3s2Zuss>LEUDMyiIP~|e`;NG0SRrt| zfaH4~Y=FnZ{H||2d*WxGKBQEi>k*kDtpwLY7nXlGhlVDTiAK)LBMpfC4LTRZzEc^# z=JTqY1cy8Ef|)5^W9VO$_3`BGBH*Vv=P?Re+s^Nky92-ZhkHlP=AK%sn{xQ6`it8u zKe@WSj&w79j9(qYi~!MRx(qL3(%0(u<-=P7z2FP<6`gKGx?RzGp9 z=$645->%rs2#{+qHD_jYwP*@RoK!}O>FJ;EFV%0B8=Jx9zCK%GqKUS4QRG?adrR_J z96vqknOx+A&~2N<%_t;YxBT`NT%BGjzdL#dez?#g3qm#KAziNzg9(Tflczd2dMh($ zI&EMAdT7Ns?p#yuCm_U6rrwRhvBWM%*~hj5Cmsq5=!2fOh(s2DGoZa{h$?zMU?Np1P|&f=#|H*Q4osp$?Np5824UsjhKR7;eM?y$INl@6vdj81AUq`j zfF%P1|9^VyZ{Ha-L6DdPuv?dT{+9aPKE1_*a+KD&!F8yV z+n9k-2d0^H+sbh$vl!=^^7i42X&&%IGxc}Z-_*3YG7Q{VdE zBYbx{`e29n03!8HFB1*KSMPzwtL#qd%Z!~nAxV%)KB4uepu|aSZoe6AkR7Pht!G(~ zX8EOQf!MJ!$<73iF>baJ8dLS~E)wq{&6+OTk)0tz`TEAp7CI_*W7|!x#`dPV-?pk9 z(qkhK@(JoxT=W+mFY7L*_1HcSSNu+g(NA5ij>rZH*2L3IbN;@e!BuZ^Vln(r z!BaS{3Sq7qPVJzapQ8Mf#$h7OMKF^bVM`NOnSwRDRX(}EC5l*Ii%U>P%|}BIXFN?L z+kfh7QaA5VC&xfflOThsz@f|1V7r}X&UaoRtcHZBA z9KE08P$;JN*!csC0e#UvQoWHwAAr{>k#R-LHqA?7uC|y-r$tF7Lt{i`4R7H{>;l;&W~9<3iwk4zKc$#9iLhI&DA<7jwP# zK-?cwU{qO2j9DlJ6A?tR+8@d(2poWEukyMB3SXHbj8)4+Pe1E=Si5N9y_i2)17P&* zuS(|5zhegeeLu~BD|m0)!Dt6!8*NvpnKxYxy$}81 zSf6pU*)EKdKtb;Hu5n8ZWNiMy_IOna-tq6&<-y_C8}#NalSB?g)8RX1s2AxUw2Ma} zhGt*U_mq-!_E_=u#*pa9lw4`)Sruk=WWmigQ*nqKkg65Y-G>gt`;Z0E%E7V+T0#rJTVzunZ%-RjvJg^e{|ZKIsmy<$()2f z-)8t*^$>XMh^?amH@D_674`4%kyMv=`Rj~#K! zpT#wG-%hH)Z!|IhLE%|VTU!NFEdzJC-`Q2>bOItBz8L9MPrVhB2CVoy;Sy-aM<)DQ zyBX$Y7Q#@7SRI*~gceiC0*H_bnCQ#U(B~%$fx;c}uD#;T)Ol?osdoz6I}$KC?f1$o zBhq0fht9;9y(Th^>{ThKvW;(Jf&mZ|3gL7Sn=g%Rwj&y7IjKUPV(;?899a5nKZ|BmY1pKkPw zCn}Ql3!x~~ja@PXWCZr4BqVY6OnkNG9R9kqI*U-&&}c5`@uEmP_{}Kai!E^1uYQ)N zOFz%fbjM^%)W}(7P;WkvLHl3tWeV{dfx2$JPA~`4^Wu@iRcoWy5OWGInjLe6kJ*+& zM!u6^MPw|s@4*$ZIIGXA_-3F(@e?J}^|a772)&neRE^g4D$+nA?7s1(f2xXHhZM+v z680S(C~iID*yMOw5AA*UxxOlUVQY8&>I=*P;RYtx;T*?hx5A4Sr6@S1iBLK|Jtx7Y zH+=kO9)i#~FBS{>dcrKT!rYK|@WxuM=2P6FTl8c-`y>fGLUQMk=? zwLdVbn%G9u!wG>*p&N6^*uJC3VsRBY74%v8c6pP2w^^L1Nq`NeMJcZrvm8*iPKyeC zn9^dFGh}|(6rgb?fD7jB*|l~QHhyH+@58=Wss?h95C6GKnSQDbDuX-?FrOf{4O{6e$ApaMPlFqK{Q_>sgv9N;{VM(cts5%UZ{u zO0LeWvbb8|>@Avkxl9qfIlV~BG2`4*c3-?691*Pz)N~HbURaE8RE{9% zlH-tE^Z$8|kpbt0p(|USUYdlMF^hg86R={2=n;y4vk-GAQb>~}vMaN(9AI#k zm>ApjxEv|V(#F?b?bI)KhE`H%3;6RhuHPzn!bB7f;e^e z9wspzxy6wVB2Ud!d7=38h1Mc|xGkLJe?6vFwD6?V+TE-+zPIHwB^Ee`o>;gLM;>kb zhLf~4{vgGi?|e5A+I2P9X2$)H%1IGu#$^z+9N}+_+HHTN>gRvu8RQS{5vNJ{YaC0& zOIu(G`al`4Vf_3!)U}p?A288*9wQ|K1e6yYAMbiK47e9=W*txiL*AM(QN1n_BI0Pt zP8z5yu?i`xvz)+{CF{*EF1cK|3hvc;e+HL(0teWch1qG{K9alBWt-vVk+T0WEV}mG z{&=E(IOjah{+XJ^`cVuz6{QE58dKBI0P(R7$^o*K++|e@6v)~Xj@Ez@Z0P&KbUtqX z{JPliwoN|3hrGVJ>$+;|INF4zFH*9kY+Tn-69RTZ_{}gFfN5%N9A#>6I$7!@E7xI| zf?cu;&$;ni6%{`@7b*f2jLwKEU)OY98|FYIx9G{GyJM(+4#&}$xkM=J=rvwPlqc3`qu48Y%CD&3ebK-z5ZG-(0Y&beh>0R16ckKyV10NCUU z{AE($hP~sy9?T}4zZ+R`A#aUK$tr#Ifcch27yH#erbKT#Wg1&q8&SW|N7cM+GNR z&rS_!t%Q1Yz3SVMS3rx+3R7|t9Ijc1g(NnVVZ3dw{-i>y@gy@&np*NcOSA@J5qjl% zzbxl=$g8*|_su<=F#$zFZILAb7*Y@zHsWJ4Fj*KOsU^ zM1Y{+>nL%vU2jB^jE{Z_ffNH$U}Mej;IV&{BfcP->hZ1Bl`Dx47li^Qr-wR5>RckG zmnzzp5;ts>LxZDP>@X?WXnJ|>*^0%l3Pn*S3g5Jvvpp*s!89r8Ho5}km3hC`h<#7- zaudUZ2#T|nhX!S+fE+mSE!A;?yJ^u7n(J<3p-2wKj{fVu@jjG*Iwo1fu|rW3a89Dl zkc0vWv{Umbeul7KKiZeiQIX%APjsb9JSS8Ssc}k{gdUO-{0yiK}8fpmb=mMf%pQyMnPLE++7HSYLz%fGOyNj83geSr_lv+xv2x zlk3qtZp#EnP`A>oW?FAJL>-1?&jn2d9D7qNPCNpdo?E3B zJb+z>>m4UJ9#(i?LfHvOm}te*@~81y`B9P^x18zQ+XFkvJ&{g|JQfe2q+zN8Nu<|+ z3uz-u&wJ2x)#BnJr=`3}Z_MSi?bZp#5!>J1YI!9r9$D+fN2|_*&xfzccX)iLrRCjZ z#NOaqs{T*z_qcLr_4au>e}uBCqx|vjEFr*Z+LQxK-Cn-d-LtU(=^|%|p}pF5gb*Pr zhX=GhFRPA&dgj+45g89H2$MXVl`cfv4N-N++h)cR=KFn7C$3`&wklHbFnk5j4w%R< zoM7M&A=2{TlG0IS7hE_X>g1}r6#~%4ETL&yBKezWRcYB?ZjszlIxlzOi!<2J1vs&_ zQNLYAozr-k;#Z&0kh$>eW)2U~0D&CH`ec2HnDYMH1Dl)8*&-eDDer5TtLyNw7`7eA zG^p*#D&JF{?U{gF2BfpV7RX6y^1mU9?RmFGmN;=ErX{xCv;JW~0|f9Im#^yftnqok z(2z{Ucn^dfH|rB+?W$*KOssh$8eU%gbZ8(6h3Mg1fG2sPtz{9?)IwlPQ{o3JJ92Cy+QA zne_AZGQ69wN4ZN2oMq0S27@ZW zl`037`Ti26@6Yvzo=XgK-0%2@gqZIP*mT(uX`?s4b?u2bntO~qr%#7m znh+fvQKC+EB3DyNNtfIG=)y-5H4zH1DS^r_d{@OXeAsf6(B>N1Aplu4P(Czl`&Ouu zGV(h(xGzC(KFRN&U)ZA86-g?NJb2d_soRkgIc%CdXBL?41q}!`;hiFoUVShsKkd?# zvv4jR2uk!39ifO)z!G4FIZdKz4ZPhHY&LFJzzGaAK*`y#()~+n zK`tJ2p6;(cEf+KEPG~>W@vn+uk)#1SNH0KOaVH>Zd@ZPK;KM&2nOlK&AW$w)E= zl5`F3FGk{Bm>|RhUZ^6(mv&*ia|fKRy6YiPGzPhQXG6KSxubrg+?(RsL^2ap=qNG= zh9((!&p%M6obN)E6gUeoEeu9eu*^1&Vsl@>$6M83s% z9}ZRzA617#7b$|zv5dLo`Pt(hZlW`yzFNFo>`EAu!&6wY`-3&TBgl}u!?E0fa3w3% z1~|^yL#b49`s0xF26>9_%{rI$)7tFWbV8i9c%oF#x3!(Crc!&(tPCYxmIezbDZZ|+ zT*zT{Yq{0^vj6sicB%5!BkXd6smUBhqc8T8yoibItntJk|B4iXc*dP9uIh9a9Si7V zV*$&=6v6s{%j3Ci&4BgiU0}&>3bZHXV_1h8E}jg?AyGVCwb0R|=aqZEn`Gi&^NpZE z^f%;a1W7cn$Df_BdOuaArSe1(F+`u9M14g`Y4Be;{PvHV2Vis1Wm6fCDRs4LX@Mo> zdgp;{;>w;%qt1UCPr_et3Ve{!Y$yX7-ANF7WMm6jP$Ci)?)`)uVOf!pSFpeINJ&U^ zOps8J#vjK;J)UaRsqz5yQa$2bqkT3;+NC literal 0 HcmV?d00001 diff --git a/node_modules/@actions/http-client/auth.d.ts b/node_modules/@actions/http-client/auth.d.ts new file mode 100644 index 0000000..1094189 --- /dev/null +++ b/node_modules/@actions/http-client/auth.d.ts @@ -0,0 +1,23 @@ +import ifm = require('./interfaces'); +export declare class BasicCredentialHandler implements ifm.IRequestHandler { + username: string; + password: string; + constructor(username: string, password: string); + prepareRequest(options: any): void; + canHandleAuthentication(response: ifm.IHttpClientResponse): boolean; + handleAuthentication(httpClient: ifm.IHttpClient, requestInfo: ifm.IRequestInfo, objs: any): Promise; +} +export declare class BearerCredentialHandler implements ifm.IRequestHandler { + token: string; + constructor(token: string); + prepareRequest(options: any): void; + canHandleAuthentication(response: ifm.IHttpClientResponse): boolean; + handleAuthentication(httpClient: ifm.IHttpClient, requestInfo: ifm.IRequestInfo, objs: any): Promise; +} +export declare class PersonalAccessTokenCredentialHandler implements ifm.IRequestHandler { + token: string; + constructor(token: string); + prepareRequest(options: any): void; + canHandleAuthentication(response: ifm.IHttpClientResponse): boolean; + handleAuthentication(httpClient: ifm.IHttpClient, requestInfo: ifm.IRequestInfo, objs: any): Promise; +} diff --git a/node_modules/@actions/http-client/auth.js b/node_modules/@actions/http-client/auth.js new file mode 100644 index 0000000..67a58aa --- /dev/null +++ b/node_modules/@actions/http-client/auth.js @@ -0,0 +1,58 @@ +"use strict"; +Object.defineProperty(exports, "__esModule", { value: true }); +class BasicCredentialHandler { + constructor(username, password) { + this.username = username; + this.password = password; + } + prepareRequest(options) { + options.headers['Authorization'] = + 'Basic ' + + Buffer.from(this.username + ':' + this.password).toString('base64'); + } + // This handler cannot handle 401 + canHandleAuthentication(response) { + return false; + } + handleAuthentication(httpClient, requestInfo, objs) { + return null; + } +} +exports.BasicCredentialHandler = BasicCredentialHandler; +class BearerCredentialHandler { + constructor(token) { + this.token = token; + } + // currently implements pre-authorization + // TODO: support preAuth = false where it hooks on 401 + prepareRequest(options) { + options.headers['Authorization'] = 'Bearer ' + this.token; + } + // This handler cannot handle 401 + canHandleAuthentication(response) { + return false; + } + handleAuthentication(httpClient, requestInfo, objs) { + return null; + } +} +exports.BearerCredentialHandler = BearerCredentialHandler; +class PersonalAccessTokenCredentialHandler { + constructor(token) { + this.token = token; + } + // currently implements pre-authorization + // TODO: support preAuth = false where it hooks on 401 + prepareRequest(options) { + options.headers['Authorization'] = + 'Basic ' + Buffer.from('PAT:' + this.token).toString('base64'); + } + // This handler cannot handle 401 + canHandleAuthentication(response) { + return false; + } + handleAuthentication(httpClient, requestInfo, objs) { + return null; + } +} +exports.PersonalAccessTokenCredentialHandler = PersonalAccessTokenCredentialHandler; diff --git a/node_modules/@actions/http-client/index.d.ts b/node_modules/@actions/http-client/index.d.ts new file mode 100644 index 0000000..9583dc7 --- /dev/null +++ b/node_modules/@actions/http-client/index.d.ts @@ -0,0 +1,124 @@ +/// +import http = require('http'); +import ifm = require('./interfaces'); +export declare enum HttpCodes { + OK = 200, + MultipleChoices = 300, + MovedPermanently = 301, + ResourceMoved = 302, + SeeOther = 303, + NotModified = 304, + UseProxy = 305, + SwitchProxy = 306, + TemporaryRedirect = 307, + PermanentRedirect = 308, + BadRequest = 400, + Unauthorized = 401, + PaymentRequired = 402, + Forbidden = 403, + NotFound = 404, + MethodNotAllowed = 405, + NotAcceptable = 406, + ProxyAuthenticationRequired = 407, + RequestTimeout = 408, + Conflict = 409, + Gone = 410, + TooManyRequests = 429, + InternalServerError = 500, + NotImplemented = 501, + BadGateway = 502, + ServiceUnavailable = 503, + GatewayTimeout = 504 +} +export declare enum Headers { + Accept = "accept", + ContentType = "content-type" +} +export declare enum MediaTypes { + ApplicationJson = "application/json" +} +/** + * Returns the proxy URL, depending upon the supplied url and proxy environment variables. + * @param serverUrl The server URL where the request will be sent. For example, https://api.github.com + */ +export declare function getProxyUrl(serverUrl: string): string; +export declare class HttpClientError extends Error { + constructor(message: string, statusCode: number); + statusCode: number; + result?: any; +} +export declare class HttpClientResponse implements ifm.IHttpClientResponse { + constructor(message: http.IncomingMessage); + message: http.IncomingMessage; + readBody(): Promise; +} +export declare function isHttps(requestUrl: string): boolean; +export declare class HttpClient { + userAgent: string | undefined; + handlers: ifm.IRequestHandler[]; + requestOptions: ifm.IRequestOptions; + private _ignoreSslError; + private _socketTimeout; + private _allowRedirects; + private _allowRedirectDowngrade; + private _maxRedirects; + private _allowRetries; + private _maxRetries; + private _agent; + private _proxyAgent; + private _keepAlive; + private _disposed; + constructor(userAgent?: string, handlers?: ifm.IRequestHandler[], requestOptions?: ifm.IRequestOptions); + options(requestUrl: string, additionalHeaders?: ifm.IHeaders): Promise; + get(requestUrl: string, additionalHeaders?: ifm.IHeaders): Promise; + del(requestUrl: string, additionalHeaders?: ifm.IHeaders): Promise; + post(requestUrl: string, data: string, additionalHeaders?: ifm.IHeaders): Promise; + patch(requestUrl: string, data: string, additionalHeaders?: ifm.IHeaders): Promise; + put(requestUrl: string, data: string, additionalHeaders?: ifm.IHeaders): Promise; + head(requestUrl: string, additionalHeaders?: ifm.IHeaders): Promise; + sendStream(verb: string, requestUrl: string, stream: NodeJS.ReadableStream, additionalHeaders?: ifm.IHeaders): Promise; + /** + * Gets a typed object from an endpoint + * Be aware that not found returns a null. Other errors (4xx, 5xx) reject the promise + */ + getJson(requestUrl: string, additionalHeaders?: ifm.IHeaders): Promise>; + postJson(requestUrl: string, obj: any, additionalHeaders?: ifm.IHeaders): Promise>; + putJson(requestUrl: string, obj: any, additionalHeaders?: ifm.IHeaders): Promise>; + patchJson(requestUrl: string, obj: any, additionalHeaders?: ifm.IHeaders): Promise>; + /** + * Makes a raw http request. + * All other methods such as get, post, patch, and request ultimately call this. + * Prefer get, del, post and patch + */ + request(verb: string, requestUrl: string, data: string | NodeJS.ReadableStream, headers: ifm.IHeaders): Promise; + /** + * Needs to be called if keepAlive is set to true in request options. + */ + dispose(): void; + /** + * Raw request. + * @param info + * @param data + */ + requestRaw(info: ifm.IRequestInfo, data: string | NodeJS.ReadableStream): Promise; + /** + * Raw request with callback. + * @param info + * @param data + * @param onResult + */ + requestRawWithCallback(info: ifm.IRequestInfo, data: string | NodeJS.ReadableStream, onResult: (err: any, res: ifm.IHttpClientResponse) => void): void; + /** + * Gets an http agent. This function is useful when you need an http agent that handles + * routing through a proxy server - depending upon the url and proxy environment variables. + * @param serverUrl The server URL where the request will be sent. For example, https://api.github.com + */ + getAgent(serverUrl: string): http.Agent; + private _prepareRequest; + private _mergeHeaders; + private _getExistingOrDefaultHeader; + private _getAgent; + private _performExponentialBackoff; + private static dateTimeDeserializer; + private _processResponse; +} diff --git a/node_modules/@actions/http-client/index.js b/node_modules/@actions/http-client/index.js new file mode 100644 index 0000000..43b2b10 --- /dev/null +++ b/node_modules/@actions/http-client/index.js @@ -0,0 +1,537 @@ +"use strict"; +Object.defineProperty(exports, "__esModule", { value: true }); +const http = require("http"); +const https = require("https"); +const pm = require("./proxy"); +let tunnel; +var HttpCodes; +(function (HttpCodes) { + HttpCodes[HttpCodes["OK"] = 200] = "OK"; + HttpCodes[HttpCodes["MultipleChoices"] = 300] = "MultipleChoices"; + HttpCodes[HttpCodes["MovedPermanently"] = 301] = "MovedPermanently"; + HttpCodes[HttpCodes["ResourceMoved"] = 302] = "ResourceMoved"; + HttpCodes[HttpCodes["SeeOther"] = 303] = "SeeOther"; + HttpCodes[HttpCodes["NotModified"] = 304] = "NotModified"; + HttpCodes[HttpCodes["UseProxy"] = 305] = "UseProxy"; + HttpCodes[HttpCodes["SwitchProxy"] = 306] = "SwitchProxy"; + HttpCodes[HttpCodes["TemporaryRedirect"] = 307] = "TemporaryRedirect"; + HttpCodes[HttpCodes["PermanentRedirect"] = 308] = "PermanentRedirect"; + HttpCodes[HttpCodes["BadRequest"] = 400] = "BadRequest"; + HttpCodes[HttpCodes["Unauthorized"] = 401] = "Unauthorized"; + HttpCodes[HttpCodes["PaymentRequired"] = 402] = "PaymentRequired"; + HttpCodes[HttpCodes["Forbidden"] = 403] = "Forbidden"; + HttpCodes[HttpCodes["NotFound"] = 404] = "NotFound"; + HttpCodes[HttpCodes["MethodNotAllowed"] = 405] = "MethodNotAllowed"; + HttpCodes[HttpCodes["NotAcceptable"] = 406] = "NotAcceptable"; + HttpCodes[HttpCodes["ProxyAuthenticationRequired"] = 407] = "ProxyAuthenticationRequired"; + HttpCodes[HttpCodes["RequestTimeout"] = 408] = "RequestTimeout"; + HttpCodes[HttpCodes["Conflict"] = 409] = "Conflict"; + HttpCodes[HttpCodes["Gone"] = 410] = "Gone"; + HttpCodes[HttpCodes["TooManyRequests"] = 429] = "TooManyRequests"; + HttpCodes[HttpCodes["InternalServerError"] = 500] = "InternalServerError"; + HttpCodes[HttpCodes["NotImplemented"] = 501] = "NotImplemented"; + HttpCodes[HttpCodes["BadGateway"] = 502] = "BadGateway"; + HttpCodes[HttpCodes["ServiceUnavailable"] = 503] = "ServiceUnavailable"; + HttpCodes[HttpCodes["GatewayTimeout"] = 504] = "GatewayTimeout"; +})(HttpCodes = exports.HttpCodes || (exports.HttpCodes = {})); +var Headers; +(function (Headers) { + Headers["Accept"] = "accept"; + Headers["ContentType"] = "content-type"; +})(Headers = exports.Headers || (exports.Headers = {})); +var MediaTypes; +(function (MediaTypes) { + MediaTypes["ApplicationJson"] = "application/json"; +})(MediaTypes = exports.MediaTypes || (exports.MediaTypes = {})); +/** + * Returns the proxy URL, depending upon the supplied url and proxy environment variables. + * @param serverUrl The server URL where the request will be sent. For example, https://api.github.com + */ +function getProxyUrl(serverUrl) { + let proxyUrl = pm.getProxyUrl(new URL(serverUrl)); + return proxyUrl ? proxyUrl.href : ''; +} +exports.getProxyUrl = getProxyUrl; +const HttpRedirectCodes = [ + HttpCodes.MovedPermanently, + HttpCodes.ResourceMoved, + HttpCodes.SeeOther, + HttpCodes.TemporaryRedirect, + HttpCodes.PermanentRedirect +]; +const HttpResponseRetryCodes = [ + HttpCodes.BadGateway, + HttpCodes.ServiceUnavailable, + HttpCodes.GatewayTimeout +]; +const RetryableHttpVerbs = ['OPTIONS', 'GET', 'DELETE', 'HEAD']; +const ExponentialBackoffCeiling = 10; +const ExponentialBackoffTimeSlice = 5; +class HttpClientError extends Error { + constructor(message, statusCode) { + super(message); + this.name = 'HttpClientError'; + this.statusCode = statusCode; + Object.setPrototypeOf(this, HttpClientError.prototype); + } +} +exports.HttpClientError = HttpClientError; +class HttpClientResponse { + constructor(message) { + this.message = message; + } + readBody() { + return new Promise(async (resolve, reject) => { + let output = Buffer.alloc(0); + this.message.on('data', (chunk) => { + output = Buffer.concat([output, chunk]); + }); + this.message.on('end', () => { + resolve(output.toString()); + }); + }); + } +} +exports.HttpClientResponse = HttpClientResponse; +function isHttps(requestUrl) { + let parsedUrl = new URL(requestUrl); + return parsedUrl.protocol === 'https:'; +} +exports.isHttps = isHttps; +class HttpClient { + constructor(userAgent, handlers, requestOptions) { + this._ignoreSslError = false; + this._allowRedirects = true; + this._allowRedirectDowngrade = false; + this._maxRedirects = 50; + this._allowRetries = false; + this._maxRetries = 1; + this._keepAlive = false; + this._disposed = false; + this.userAgent = userAgent; + this.handlers = handlers || []; + this.requestOptions = requestOptions; + if (requestOptions) { + if (requestOptions.ignoreSslError != null) { + this._ignoreSslError = requestOptions.ignoreSslError; + } + this._socketTimeout = requestOptions.socketTimeout; + if (requestOptions.allowRedirects != null) { + this._allowRedirects = requestOptions.allowRedirects; + } + if (requestOptions.allowRedirectDowngrade != null) { + this._allowRedirectDowngrade = requestOptions.allowRedirectDowngrade; + } + if (requestOptions.maxRedirects != null) { + this._maxRedirects = Math.max(requestOptions.maxRedirects, 0); + } + if (requestOptions.keepAlive != null) { + this._keepAlive = requestOptions.keepAlive; + } + if (requestOptions.allowRetries != null) { + this._allowRetries = requestOptions.allowRetries; + } + if (requestOptions.maxRetries != null) { + this._maxRetries = requestOptions.maxRetries; + } + } + } + options(requestUrl, additionalHeaders) { + return this.request('OPTIONS', requestUrl, null, additionalHeaders || {}); + } + get(requestUrl, additionalHeaders) { + return this.request('GET', requestUrl, null, additionalHeaders || {}); + } + del(requestUrl, additionalHeaders) { + return this.request('DELETE', requestUrl, null, additionalHeaders || {}); + } + post(requestUrl, data, additionalHeaders) { + return this.request('POST', requestUrl, data, additionalHeaders || {}); + } + patch(requestUrl, data, additionalHeaders) { + return this.request('PATCH', requestUrl, data, additionalHeaders || {}); + } + put(requestUrl, data, additionalHeaders) { + return this.request('PUT', requestUrl, data, additionalHeaders || {}); + } + head(requestUrl, additionalHeaders) { + return this.request('HEAD', requestUrl, null, additionalHeaders || {}); + } + sendStream(verb, requestUrl, stream, additionalHeaders) { + return this.request(verb, requestUrl, stream, additionalHeaders); + } + /** + * Gets a typed object from an endpoint + * Be aware that not found returns a null. Other errors (4xx, 5xx) reject the promise + */ + async getJson(requestUrl, additionalHeaders = {}) { + additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson); + let res = await this.get(requestUrl, additionalHeaders); + return this._processResponse(res, this.requestOptions); + } + async postJson(requestUrl, obj, additionalHeaders = {}) { + let data = JSON.stringify(obj, null, 2); + additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson); + additionalHeaders[Headers.ContentType] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.ContentType, MediaTypes.ApplicationJson); + let res = await this.post(requestUrl, data, additionalHeaders); + return this._processResponse(res, this.requestOptions); + } + async putJson(requestUrl, obj, additionalHeaders = {}) { + let data = JSON.stringify(obj, null, 2); + additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson); + additionalHeaders[Headers.ContentType] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.ContentType, MediaTypes.ApplicationJson); + let res = await this.put(requestUrl, data, additionalHeaders); + return this._processResponse(res, this.requestOptions); + } + async patchJson(requestUrl, obj, additionalHeaders = {}) { + let data = JSON.stringify(obj, null, 2); + additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson); + additionalHeaders[Headers.ContentType] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.ContentType, MediaTypes.ApplicationJson); + let res = await this.patch(requestUrl, data, additionalHeaders); + return this._processResponse(res, this.requestOptions); + } + /** + * Makes a raw http request. + * All other methods such as get, post, patch, and request ultimately call this. + * Prefer get, del, post and patch + */ + async request(verb, requestUrl, data, headers) { + if (this._disposed) { + throw new Error('Client has already been disposed.'); + } + let parsedUrl = new URL(requestUrl); + let info = this._prepareRequest(verb, parsedUrl, headers); + // Only perform retries on reads since writes may not be idempotent. + let maxTries = this._allowRetries && RetryableHttpVerbs.indexOf(verb) != -1 + ? this._maxRetries + 1 + : 1; + let numTries = 0; + let response; + while (numTries < maxTries) { + response = await this.requestRaw(info, data); + // Check if it's an authentication challenge + if (response && + response.message && + response.message.statusCode === HttpCodes.Unauthorized) { + let authenticationHandler; + for (let i = 0; i < this.handlers.length; i++) { + if (this.handlers[i].canHandleAuthentication(response)) { + authenticationHandler = this.handlers[i]; + break; + } + } + if (authenticationHandler) { + return authenticationHandler.handleAuthentication(this, info, data); + } + else { + // We have received an unauthorized response but have no handlers to handle it. + // Let the response return to the caller. + return response; + } + } + let redirectsRemaining = this._maxRedirects; + while (HttpRedirectCodes.indexOf(response.message.statusCode) != -1 && + this._allowRedirects && + redirectsRemaining > 0) { + const redirectUrl = response.message.headers['location']; + if (!redirectUrl) { + // if there's no location to redirect to, we won't + break; + } + let parsedRedirectUrl = new URL(redirectUrl); + if (parsedUrl.protocol == 'https:' && + parsedUrl.protocol != parsedRedirectUrl.protocol && + !this._allowRedirectDowngrade) { + throw new Error('Redirect from HTTPS to HTTP protocol. This downgrade is not allowed for security reasons. If you want to allow this behavior, set the allowRedirectDowngrade option to true.'); + } + // we need to finish reading the response before reassigning response + // which will leak the open socket. + await response.readBody(); + // strip authorization header if redirected to a different hostname + if (parsedRedirectUrl.hostname !== parsedUrl.hostname) { + for (let header in headers) { + // header names are case insensitive + if (header.toLowerCase() === 'authorization') { + delete headers[header]; + } + } + } + // let's make the request with the new redirectUrl + info = this._prepareRequest(verb, parsedRedirectUrl, headers); + response = await this.requestRaw(info, data); + redirectsRemaining--; + } + if (HttpResponseRetryCodes.indexOf(response.message.statusCode) == -1) { + // If not a retry code, return immediately instead of retrying + return response; + } + numTries += 1; + if (numTries < maxTries) { + await response.readBody(); + await this._performExponentialBackoff(numTries); + } + } + return response; + } + /** + * Needs to be called if keepAlive is set to true in request options. + */ + dispose() { + if (this._agent) { + this._agent.destroy(); + } + this._disposed = true; + } + /** + * Raw request. + * @param info + * @param data + */ + requestRaw(info, data) { + return new Promise((resolve, reject) => { + let callbackForResult = function (err, res) { + if (err) { + reject(err); + } + resolve(res); + }; + this.requestRawWithCallback(info, data, callbackForResult); + }); + } + /** + * Raw request with callback. + * @param info + * @param data + * @param onResult + */ + requestRawWithCallback(info, data, onResult) { + let socket; + if (typeof data === 'string') { + info.options.headers['Content-Length'] = Buffer.byteLength(data, 'utf8'); + } + let callbackCalled = false; + let handleResult = (err, res) => { + if (!callbackCalled) { + callbackCalled = true; + onResult(err, res); + } + }; + let req = info.httpModule.request(info.options, (msg) => { + let res = new HttpClientResponse(msg); + handleResult(null, res); + }); + req.on('socket', sock => { + socket = sock; + }); + // If we ever get disconnected, we want the socket to timeout eventually + req.setTimeout(this._socketTimeout || 3 * 60000, () => { + if (socket) { + socket.end(); + } + handleResult(new Error('Request timeout: ' + info.options.path), null); + }); + req.on('error', function (err) { + // err has statusCode property + // res should have headers + handleResult(err, null); + }); + if (data && typeof data === 'string') { + req.write(data, 'utf8'); + } + if (data && typeof data !== 'string') { + data.on('close', function () { + req.end(); + }); + data.pipe(req); + } + else { + req.end(); + } + } + /** + * Gets an http agent. This function is useful when you need an http agent that handles + * routing through a proxy server - depending upon the url and proxy environment variables. + * @param serverUrl The server URL where the request will be sent. For example, https://api.github.com + */ + getAgent(serverUrl) { + let parsedUrl = new URL(serverUrl); + return this._getAgent(parsedUrl); + } + _prepareRequest(method, requestUrl, headers) { + const info = {}; + info.parsedUrl = requestUrl; + const usingSsl = info.parsedUrl.protocol === 'https:'; + info.httpModule = usingSsl ? https : http; + const defaultPort = usingSsl ? 443 : 80; + info.options = {}; + info.options.host = info.parsedUrl.hostname; + info.options.port = info.parsedUrl.port + ? parseInt(info.parsedUrl.port) + : defaultPort; + info.options.path = + (info.parsedUrl.pathname || '') + (info.parsedUrl.search || ''); + info.options.method = method; + info.options.headers = this._mergeHeaders(headers); + if (this.userAgent != null) { + info.options.headers['user-agent'] = this.userAgent; + } + info.options.agent = this._getAgent(info.parsedUrl); + // gives handlers an opportunity to participate + if (this.handlers) { + this.handlers.forEach(handler => { + handler.prepareRequest(info.options); + }); + } + return info; + } + _mergeHeaders(headers) { + const lowercaseKeys = obj => Object.keys(obj).reduce((c, k) => ((c[k.toLowerCase()] = obj[k]), c), {}); + if (this.requestOptions && this.requestOptions.headers) { + return Object.assign({}, lowercaseKeys(this.requestOptions.headers), lowercaseKeys(headers)); + } + return lowercaseKeys(headers || {}); + } + _getExistingOrDefaultHeader(additionalHeaders, header, _default) { + const lowercaseKeys = obj => Object.keys(obj).reduce((c, k) => ((c[k.toLowerCase()] = obj[k]), c), {}); + let clientHeader; + if (this.requestOptions && this.requestOptions.headers) { + clientHeader = lowercaseKeys(this.requestOptions.headers)[header]; + } + return additionalHeaders[header] || clientHeader || _default; + } + _getAgent(parsedUrl) { + let agent; + let proxyUrl = pm.getProxyUrl(parsedUrl); + let useProxy = proxyUrl && proxyUrl.hostname; + if (this._keepAlive && useProxy) { + agent = this._proxyAgent; + } + if (this._keepAlive && !useProxy) { + agent = this._agent; + } + // if agent is already assigned use that agent. + if (!!agent) { + return agent; + } + const usingSsl = parsedUrl.protocol === 'https:'; + let maxSockets = 100; + if (!!this.requestOptions) { + maxSockets = this.requestOptions.maxSockets || http.globalAgent.maxSockets; + } + if (useProxy) { + // If using proxy, need tunnel + if (!tunnel) { + tunnel = require('tunnel'); + } + const agentOptions = { + maxSockets: maxSockets, + keepAlive: this._keepAlive, + proxy: { + ...((proxyUrl.username || proxyUrl.password) && { + proxyAuth: `${proxyUrl.username}:${proxyUrl.password}` + }), + host: proxyUrl.hostname, + port: proxyUrl.port + } + }; + let tunnelAgent; + const overHttps = proxyUrl.protocol === 'https:'; + if (usingSsl) { + tunnelAgent = overHttps ? tunnel.httpsOverHttps : tunnel.httpsOverHttp; + } + else { + tunnelAgent = overHttps ? tunnel.httpOverHttps : tunnel.httpOverHttp; + } + agent = tunnelAgent(agentOptions); + this._proxyAgent = agent; + } + // if reusing agent across request and tunneling agent isn't assigned create a new agent + if (this._keepAlive && !agent) { + const options = { keepAlive: this._keepAlive, maxSockets: maxSockets }; + agent = usingSsl ? new https.Agent(options) : new http.Agent(options); + this._agent = agent; + } + // if not using private agent and tunnel agent isn't setup then use global agent + if (!agent) { + agent = usingSsl ? https.globalAgent : http.globalAgent; + } + if (usingSsl && this._ignoreSslError) { + // we don't want to set NODE_TLS_REJECT_UNAUTHORIZED=0 since that will affect request for entire process + // http.RequestOptions doesn't expose a way to modify RequestOptions.agent.options + // we have to cast it to any and change it directly + agent.options = Object.assign(agent.options || {}, { + rejectUnauthorized: false + }); + } + return agent; + } + _performExponentialBackoff(retryNumber) { + retryNumber = Math.min(ExponentialBackoffCeiling, retryNumber); + const ms = ExponentialBackoffTimeSlice * Math.pow(2, retryNumber); + return new Promise(resolve => setTimeout(() => resolve(), ms)); + } + static dateTimeDeserializer(key, value) { + if (typeof value === 'string') { + let a = new Date(value); + if (!isNaN(a.valueOf())) { + return a; + } + } + return value; + } + async _processResponse(res, options) { + return new Promise(async (resolve, reject) => { + const statusCode = res.message.statusCode; + const response = { + statusCode: statusCode, + result: null, + headers: {} + }; + // not found leads to null obj returned + if (statusCode == HttpCodes.NotFound) { + resolve(response); + } + let obj; + let contents; + // get the result from the body + try { + contents = await res.readBody(); + if (contents && contents.length > 0) { + if (options && options.deserializeDates) { + obj = JSON.parse(contents, HttpClient.dateTimeDeserializer); + } + else { + obj = JSON.parse(contents); + } + response.result = obj; + } + response.headers = res.message.headers; + } + catch (err) { + // Invalid resource (contents not json); leaving result obj null + } + // note that 3xx redirects are handled by the http layer. + if (statusCode > 299) { + let msg; + // if exception/error in body, attempt to get better error + if (obj && obj.message) { + msg = obj.message; + } + else if (contents && contents.length > 0) { + // it may be the case that the exception is in the body message as string + msg = contents; + } + else { + msg = 'Failed request: (' + statusCode + ')'; + } + let err = new HttpClientError(msg, statusCode); + err.result = response.result; + reject(err); + } + else { + resolve(response); + } + }); + } +} +exports.HttpClient = HttpClient; diff --git a/node_modules/@actions/http-client/interfaces.d.ts b/node_modules/@actions/http-client/interfaces.d.ts new file mode 100644 index 0000000..78bd85b --- /dev/null +++ b/node_modules/@actions/http-client/interfaces.d.ts @@ -0,0 +1,49 @@ +/// +import http = require('http'); +export interface IHeaders { + [key: string]: any; +} +export interface IHttpClient { + options(requestUrl: string, additionalHeaders?: IHeaders): Promise; + get(requestUrl: string, additionalHeaders?: IHeaders): Promise; + del(requestUrl: string, additionalHeaders?: IHeaders): Promise; + post(requestUrl: string, data: string, additionalHeaders?: IHeaders): Promise; + patch(requestUrl: string, data: string, additionalHeaders?: IHeaders): Promise; + put(requestUrl: string, data: string, additionalHeaders?: IHeaders): Promise; + sendStream(verb: string, requestUrl: string, stream: NodeJS.ReadableStream, additionalHeaders?: IHeaders): Promise; + request(verb: string, requestUrl: string, data: string | NodeJS.ReadableStream, headers: IHeaders): Promise; + requestRaw(info: IRequestInfo, data: string | NodeJS.ReadableStream): Promise; + requestRawWithCallback(info: IRequestInfo, data: string | NodeJS.ReadableStream, onResult: (err: any, res: IHttpClientResponse) => void): void; +} +export interface IRequestHandler { + prepareRequest(options: http.RequestOptions): void; + canHandleAuthentication(response: IHttpClientResponse): boolean; + handleAuthentication(httpClient: IHttpClient, requestInfo: IRequestInfo, objs: any): Promise; +} +export interface IHttpClientResponse { + message: http.IncomingMessage; + readBody(): Promise; +} +export interface IRequestInfo { + options: http.RequestOptions; + parsedUrl: URL; + httpModule: any; +} +export interface IRequestOptions { + headers?: IHeaders; + socketTimeout?: number; + ignoreSslError?: boolean; + allowRedirects?: boolean; + allowRedirectDowngrade?: boolean; + maxRedirects?: number; + maxSockets?: number; + keepAlive?: boolean; + deserializeDates?: boolean; + allowRetries?: boolean; + maxRetries?: number; +} +export interface ITypedResponse { + statusCode: number; + result: T | null; + headers: Object; +} diff --git a/node_modules/@actions/http-client/interfaces.js b/node_modules/@actions/http-client/interfaces.js new file mode 100644 index 0000000..c8ad2e5 --- /dev/null +++ b/node_modules/@actions/http-client/interfaces.js @@ -0,0 +1,2 @@ +"use strict"; +Object.defineProperty(exports, "__esModule", { value: true }); diff --git a/node_modules/@actions/http-client/package.json b/node_modules/@actions/http-client/package.json new file mode 100644 index 0000000..0c99fd4 --- /dev/null +++ b/node_modules/@actions/http-client/package.json @@ -0,0 +1,39 @@ +{ + "name": "@actions/http-client", + "version": "1.0.11", + "description": "Actions Http Client", + "main": "index.js", + "scripts": { + "build": "rm -Rf ./_out && tsc && cp package*.json ./_out && cp *.md ./_out && cp LICENSE ./_out && cp actions.png ./_out", + "test": "jest", + "format": "prettier --write *.ts && prettier --write **/*.ts", + "format-check": "prettier --check *.ts && prettier --check **/*.ts", + "audit-check": "npm audit --audit-level=moderate" + }, + "repository": { + "type": "git", + "url": "git+https://github.com/actions/http-client.git" + }, + "keywords": [ + "Actions", + "Http" + ], + "author": "GitHub, Inc.", + "license": "MIT", + "bugs": { + "url": "https://github.com/actions/http-client/issues" + }, + "homepage": "https://github.com/actions/http-client#readme", + "devDependencies": { + "@types/jest": "^25.1.4", + "@types/node": "^12.12.31", + "jest": "^25.1.0", + "prettier": "^2.0.4", + "proxy": "^1.0.1", + "ts-jest": "^25.2.1", + "typescript": "^3.8.3" + }, + "dependencies": { + "tunnel": "0.0.6" + } +} diff --git a/node_modules/@actions/http-client/proxy.d.ts b/node_modules/@actions/http-client/proxy.d.ts new file mode 100644 index 0000000..4599865 --- /dev/null +++ b/node_modules/@actions/http-client/proxy.d.ts @@ -0,0 +1,2 @@ +export declare function getProxyUrl(reqUrl: URL): URL | undefined; +export declare function checkBypass(reqUrl: URL): boolean; diff --git a/node_modules/@actions/http-client/proxy.js b/node_modules/@actions/http-client/proxy.js new file mode 100644 index 0000000..88f00ec --- /dev/null +++ b/node_modules/@actions/http-client/proxy.js @@ -0,0 +1,57 @@ +"use strict"; +Object.defineProperty(exports, "__esModule", { value: true }); +function getProxyUrl(reqUrl) { + let usingSsl = reqUrl.protocol === 'https:'; + let proxyUrl; + if (checkBypass(reqUrl)) { + return proxyUrl; + } + let proxyVar; + if (usingSsl) { + proxyVar = process.env['https_proxy'] || process.env['HTTPS_PROXY']; + } + else { + proxyVar = process.env['http_proxy'] || process.env['HTTP_PROXY']; + } + if (proxyVar) { + proxyUrl = new URL(proxyVar); + } + return proxyUrl; +} +exports.getProxyUrl = getProxyUrl; +function checkBypass(reqUrl) { + if (!reqUrl.hostname) { + return false; + } + let noProxy = process.env['no_proxy'] || process.env['NO_PROXY'] || ''; + if (!noProxy) { + return false; + } + // Determine the request port + let reqPort; + if (reqUrl.port) { + reqPort = Number(reqUrl.port); + } + else if (reqUrl.protocol === 'http:') { + reqPort = 80; + } + else if (reqUrl.protocol === 'https:') { + reqPort = 443; + } + // Format the request hostname and hostname with port + let upperReqHosts = [reqUrl.hostname.toUpperCase()]; + if (typeof reqPort === 'number') { + upperReqHosts.push(`${upperReqHosts[0]}:${reqPort}`); + } + // Compare request host against noproxy + for (let upperNoProxyItem of noProxy + .split(',') + .map(x => x.trim().toUpperCase()) + .filter(x => x)) { + if (upperReqHosts.some(x => x === upperNoProxyItem)) { + return true; + } + } + return false; +} +exports.checkBypass = checkBypass; diff --git a/node_modules/@babel/runtime/LICENSE b/node_modules/@babel/runtime/LICENSE new file mode 100644 index 0000000..f31575e --- /dev/null +++ b/node_modules/@babel/runtime/LICENSE @@ -0,0 +1,22 @@ +MIT License + +Copyright (c) 2014-present Sebastian McKenzie and other contributors + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE +LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION +OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION +WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/@babel/runtime/README.md b/node_modules/@babel/runtime/README.md new file mode 100644 index 0000000..be27e83 --- /dev/null +++ b/node_modules/@babel/runtime/README.md @@ -0,0 +1,19 @@ +# @babel/runtime + +> babel's modular runtime helpers + +See our website [@babel/runtime](https://babeljs.io/docs/en/babel-runtime) for more information. + +## Install + +Using npm: + +```sh +npm install --save @babel/runtime +``` + +or using yarn: + +```sh +yarn add @babel/runtime +``` diff --git a/node_modules/@babel/runtime/helpers/AsyncGenerator.js b/node_modules/@babel/runtime/helpers/AsyncGenerator.js new file mode 100644 index 0000000..e6a15a7 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/AsyncGenerator.js @@ -0,0 +1,98 @@ +var AwaitValue = require("./AwaitValue.js"); + +function AsyncGenerator(gen) { + var front, back; + + function send(key, arg) { + return new Promise(function (resolve, reject) { + var request = { + key: key, + arg: arg, + resolve: resolve, + reject: reject, + next: null + }; + + if (back) { + back = back.next = request; + } else { + front = back = request; + resume(key, arg); + } + }); + } + + function resume(key, arg) { + try { + var result = gen[key](arg); + var value = result.value; + var wrappedAwait = value instanceof AwaitValue; + Promise.resolve(wrappedAwait ? value.wrapped : value).then(function (arg) { + if (wrappedAwait) { + resume(key === "return" ? "return" : "next", arg); + return; + } + + settle(result.done ? "return" : "normal", arg); + }, function (err) { + resume("throw", err); + }); + } catch (err) { + settle("throw", err); + } + } + + function settle(type, value) { + switch (type) { + case "return": + front.resolve({ + value: value, + done: true + }); + break; + + case "throw": + front.reject(value); + break; + + default: + front.resolve({ + value: value, + done: false + }); + break; + } + + front = front.next; + + if (front) { + resume(front.key, front.arg); + } else { + back = null; + } + } + + this._invoke = send; + + if (typeof gen["return"] !== "function") { + this["return"] = undefined; + } +} + +AsyncGenerator.prototype[typeof Symbol === "function" && Symbol.asyncIterator || "@@asyncIterator"] = function () { + return this; +}; + +AsyncGenerator.prototype.next = function (arg) { + return this._invoke("next", arg); +}; + +AsyncGenerator.prototype["throw"] = function (arg) { + return this._invoke("throw", arg); +}; + +AsyncGenerator.prototype["return"] = function (arg) { + return this._invoke("return", arg); +}; + +module.exports = AsyncGenerator, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/AwaitValue.js b/node_modules/@babel/runtime/helpers/AwaitValue.js new file mode 100644 index 0000000..5ddee2e --- /dev/null +++ b/node_modules/@babel/runtime/helpers/AwaitValue.js @@ -0,0 +1,5 @@ +function _AwaitValue(value) { + this.wrapped = value; +} + +module.exports = _AwaitValue, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/applyDecoratedDescriptor.js b/node_modules/@babel/runtime/helpers/applyDecoratedDescriptor.js new file mode 100644 index 0000000..9080fd6 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/applyDecoratedDescriptor.js @@ -0,0 +1,30 @@ +function _applyDecoratedDescriptor(target, property, decorators, descriptor, context) { + var desc = {}; + Object.keys(descriptor).forEach(function (key) { + desc[key] = descriptor[key]; + }); + desc.enumerable = !!desc.enumerable; + desc.configurable = !!desc.configurable; + + if ('value' in desc || desc.initializer) { + desc.writable = true; + } + + desc = decorators.slice().reverse().reduce(function (desc, decorator) { + return decorator(target, property, desc) || desc; + }, desc); + + if (context && desc.initializer !== void 0) { + desc.value = desc.initializer ? desc.initializer.call(context) : void 0; + desc.initializer = undefined; + } + + if (desc.initializer === void 0) { + Object.defineProperty(target, property, desc); + desc = null; + } + + return desc; +} + +module.exports = _applyDecoratedDescriptor, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/applyDecs.js b/node_modules/@babel/runtime/helpers/applyDecs.js new file mode 100644 index 0000000..b27baad --- /dev/null +++ b/node_modules/@babel/runtime/helpers/applyDecs.js @@ -0,0 +1,284 @@ +var _typeof = require("./typeof.js")["default"]; + +function createMetadataMethodsForProperty(metadataMap, kind, property, decoratorFinishedRef) { + return { + getMetadata: function getMetadata(key) { + assertNotFinished(decoratorFinishedRef, "getMetadata"), assertMetadataKey(key); + var metadataForKey = metadataMap[key]; + if (void 0 !== metadataForKey) if (1 === kind) { + var pub = metadataForKey["public"]; + if (void 0 !== pub) return pub[property]; + } else if (2 === kind) { + var priv = metadataForKey["private"]; + if (void 0 !== priv) return priv.get(property); + } else if (Object.hasOwnProperty.call(metadataForKey, "constructor")) return metadataForKey.constructor; + }, + setMetadata: function setMetadata(key, value) { + assertNotFinished(decoratorFinishedRef, "setMetadata"), assertMetadataKey(key); + var metadataForKey = metadataMap[key]; + + if (void 0 === metadataForKey && (metadataForKey = metadataMap[key] = {}), 1 === kind) { + var pub = metadataForKey["public"]; + void 0 === pub && (pub = metadataForKey["public"] = {}), pub[property] = value; + } else if (2 === kind) { + var priv = metadataForKey.priv; + void 0 === priv && (priv = metadataForKey["private"] = new Map()), priv.set(property, value); + } else metadataForKey.constructor = value; + } + }; +} + +function convertMetadataMapToFinal(obj, metadataMap) { + var parentMetadataMap = obj[Symbol.metadata || Symbol["for"]("Symbol.metadata")], + metadataKeys = Object.getOwnPropertySymbols(metadataMap); + + if (0 !== metadataKeys.length) { + for (var i = 0; i < metadataKeys.length; i++) { + var key = metadataKeys[i], + metaForKey = metadataMap[key], + parentMetaForKey = parentMetadataMap ? parentMetadataMap[key] : null, + pub = metaForKey["public"], + parentPub = parentMetaForKey ? parentMetaForKey["public"] : null; + pub && parentPub && Object.setPrototypeOf(pub, parentPub); + var priv = metaForKey["private"]; + + if (priv) { + var privArr = Array.from(priv.values()), + parentPriv = parentMetaForKey ? parentMetaForKey["private"] : null; + parentPriv && (privArr = privArr.concat(parentPriv)), metaForKey["private"] = privArr; + } + + parentMetaForKey && Object.setPrototypeOf(metaForKey, parentMetaForKey); + } + + parentMetadataMap && Object.setPrototypeOf(metadataMap, parentMetadataMap), obj[Symbol.metadata || Symbol["for"]("Symbol.metadata")] = metadataMap; + } +} + +function createAddInitializerMethod(initializers, decoratorFinishedRef) { + return function (initializer) { + assertNotFinished(decoratorFinishedRef, "addInitializer"), assertCallable(initializer, "An initializer"), initializers.push(initializer); + }; +} + +function memberDec(dec, name, desc, metadataMap, initializers, kind, isStatic, isPrivate, value) { + var kindStr; + + switch (kind) { + case 1: + kindStr = "accessor"; + break; + + case 2: + kindStr = "method"; + break; + + case 3: + kindStr = "getter"; + break; + + case 4: + kindStr = "setter"; + break; + + default: + kindStr = "field"; + } + + var metadataKind, + metadataName, + ctx = { + kind: kindStr, + name: isPrivate ? "#" + name : name, + isStatic: isStatic, + isPrivate: isPrivate + }, + decoratorFinishedRef = { + v: !1 + }; + + if (0 !== kind && (ctx.addInitializer = createAddInitializerMethod(initializers, decoratorFinishedRef)), isPrivate) { + metadataKind = 2, metadataName = Symbol(name); + var access = {}; + 0 === kind ? (access.get = desc.get, access.set = desc.set) : 2 === kind ? access.get = function () { + return desc.value; + } : (1 !== kind && 3 !== kind || (access.get = function () { + return desc.get.call(this); + }), 1 !== kind && 4 !== kind || (access.set = function (v) { + desc.set.call(this, v); + })), ctx.access = access; + } else metadataKind = 1, metadataName = name; + + try { + return dec(value, Object.assign(ctx, createMetadataMethodsForProperty(metadataMap, metadataKind, metadataName, decoratorFinishedRef))); + } finally { + decoratorFinishedRef.v = !0; + } +} + +function assertNotFinished(decoratorFinishedRef, fnName) { + if (decoratorFinishedRef.v) throw new Error("attempted to call " + fnName + " after decoration was finished"); +} + +function assertMetadataKey(key) { + if ("symbol" != _typeof(key)) throw new TypeError("Metadata keys must be symbols, received: " + key); +} + +function assertCallable(fn, hint) { + if ("function" != typeof fn) throw new TypeError(hint + " must be a function"); +} + +function assertValidReturnValue(kind, value) { + var type = _typeof(value); + + if (1 === kind) { + if ("object" !== type || null === value) throw new TypeError("accessor decorators must return an object with get, set, or init properties or void 0"); + void 0 !== value.get && assertCallable(value.get, "accessor.get"), void 0 !== value.set && assertCallable(value.set, "accessor.set"), void 0 !== value.init && assertCallable(value.init, "accessor.init"), void 0 !== value.initializer && assertCallable(value.initializer, "accessor.initializer"); + } else if ("function" !== type) { + var hint; + throw hint = 0 === kind ? "field" : 10 === kind ? "class" : "method", new TypeError(hint + " decorators must return a function or void 0"); + } +} + +function getInit(desc) { + var initializer; + return null == (initializer = desc.init) && (initializer = desc.initializer) && "undefined" != typeof console && console.warn(".initializer has been renamed to .init as of March 2022"), initializer; +} + +function applyMemberDec(ret, base, decInfo, name, kind, isStatic, isPrivate, metadataMap, initializers) { + var desc, + initializer, + value, + newValue, + get, + set, + decs = decInfo[0]; + if (isPrivate ? desc = 0 === kind || 1 === kind ? { + get: decInfo[3], + set: decInfo[4] + } : 3 === kind ? { + get: decInfo[3] + } : 4 === kind ? { + set: decInfo[3] + } : { + value: decInfo[3] + } : 0 !== kind && (desc = Object.getOwnPropertyDescriptor(base, name)), 1 === kind ? value = { + get: desc.get, + set: desc.set + } : 2 === kind ? value = desc.value : 3 === kind ? value = desc.get : 4 === kind && (value = desc.set), "function" == typeof decs) void 0 !== (newValue = memberDec(decs, name, desc, metadataMap, initializers, kind, isStatic, isPrivate, value)) && (assertValidReturnValue(kind, newValue), 0 === kind ? initializer = newValue : 1 === kind ? (initializer = getInit(newValue), get = newValue.get || value.get, set = newValue.set || value.set, value = { + get: get, + set: set + }) : value = newValue);else for (var i = decs.length - 1; i >= 0; i--) { + var newInit; + if (void 0 !== (newValue = memberDec(decs[i], name, desc, metadataMap, initializers, kind, isStatic, isPrivate, value))) assertValidReturnValue(kind, newValue), 0 === kind ? newInit = newValue : 1 === kind ? (newInit = getInit(newValue), get = newValue.get || value.get, set = newValue.set || value.set, value = { + get: get, + set: set + }) : value = newValue, void 0 !== newInit && (void 0 === initializer ? initializer = newInit : "function" == typeof initializer ? initializer = [initializer, newInit] : initializer.push(newInit)); + } + + if (0 === kind || 1 === kind) { + if (void 0 === initializer) initializer = function initializer(instance, init) { + return init; + };else if ("function" != typeof initializer) { + var ownInitializers = initializer; + + initializer = function initializer(instance, init) { + for (var value = init, i = 0; i < ownInitializers.length; i++) { + value = ownInitializers[i].call(instance, value); + } + + return value; + }; + } else { + var originalInitializer = initializer; + + initializer = function initializer(instance, init) { + return originalInitializer.call(instance, init); + }; + } + ret.push(initializer); + } + + 0 !== kind && (1 === kind ? (desc.get = value.get, desc.set = value.set) : 2 === kind ? desc.value = value : 3 === kind ? desc.get = value : 4 === kind && (desc.set = value), isPrivate ? 1 === kind ? (ret.push(function (instance, args) { + return value.get.call(instance, args); + }), ret.push(function (instance, args) { + return value.set.call(instance, args); + })) : 2 === kind ? ret.push(value) : ret.push(function (instance, args) { + return value.call(instance, args); + }) : Object.defineProperty(base, name, desc)); +} + +function applyMemberDecs(ret, Class, protoMetadataMap, staticMetadataMap, decInfos) { + for (var protoInitializers, staticInitializers, existingProtoNonFields = new Map(), existingStaticNonFields = new Map(), i = 0; i < decInfos.length; i++) { + var decInfo = decInfos[i]; + + if (Array.isArray(decInfo)) { + var base, + metadataMap, + initializers, + kind = decInfo[1], + name = decInfo[2], + isPrivate = decInfo.length > 3, + isStatic = kind >= 5; + + if (isStatic ? (base = Class, metadataMap = staticMetadataMap, 0 !== (kind -= 5) && (initializers = staticInitializers = staticInitializers || [])) : (base = Class.prototype, metadataMap = protoMetadataMap, 0 !== kind && (initializers = protoInitializers = protoInitializers || [])), 0 !== kind && !isPrivate) { + var existingNonFields = isStatic ? existingStaticNonFields : existingProtoNonFields, + existingKind = existingNonFields.get(name) || 0; + if (!0 === existingKind || 3 === existingKind && 4 !== kind || 4 === existingKind && 3 !== kind) throw new Error("Attempted to decorate a public method/accessor that has the same name as a previously decorated public method/accessor. This is not currently supported by the decorators plugin. Property name was: " + name); + !existingKind && kind > 2 ? existingNonFields.set(name, kind) : existingNonFields.set(name, !0); + } + + applyMemberDec(ret, base, decInfo, name, kind, isStatic, isPrivate, metadataMap, initializers); + } + } + + pushInitializers(ret, protoInitializers), pushInitializers(ret, staticInitializers); +} + +function pushInitializers(ret, initializers) { + initializers && ret.push(function (instance) { + for (var i = 0; i < initializers.length; i++) { + initializers[i].call(instance); + } + + return instance; + }); +} + +function applyClassDecs(ret, targetClass, metadataMap, classDecs) { + if (classDecs.length > 0) { + for (var initializers = [], newClass = targetClass, name = targetClass.name, i = classDecs.length - 1; i >= 0; i--) { + var decoratorFinishedRef = { + v: !1 + }; + + try { + var ctx = Object.assign({ + kind: "class", + name: name, + addInitializer: createAddInitializerMethod(initializers, decoratorFinishedRef) + }, createMetadataMethodsForProperty(metadataMap, 0, name, decoratorFinishedRef)), + nextNewClass = classDecs[i](newClass, ctx); + } finally { + decoratorFinishedRef.v = !0; + } + + void 0 !== nextNewClass && (assertValidReturnValue(10, nextNewClass), newClass = nextNewClass); + } + + ret.push(newClass, function () { + for (var i = 0; i < initializers.length; i++) { + initializers[i].call(newClass); + } + }); + } +} + +function applyDecs(targetClass, memberDecs, classDecs) { + var ret = [], + staticMetadataMap = {}, + protoMetadataMap = {}; + return applyMemberDecs(ret, targetClass, protoMetadataMap, staticMetadataMap, memberDecs), convertMetadataMapToFinal(targetClass.prototype, protoMetadataMap), applyClassDecs(ret, targetClass, staticMetadataMap, classDecs), convertMetadataMapToFinal(targetClass, staticMetadataMap), ret; +} + +module.exports = applyDecs, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/arrayLikeToArray.js b/node_modules/@babel/runtime/helpers/arrayLikeToArray.js new file mode 100644 index 0000000..465974f --- /dev/null +++ b/node_modules/@babel/runtime/helpers/arrayLikeToArray.js @@ -0,0 +1,11 @@ +function _arrayLikeToArray(arr, len) { + if (len == null || len > arr.length) len = arr.length; + + for (var i = 0, arr2 = new Array(len); i < len; i++) { + arr2[i] = arr[i]; + } + + return arr2; +} + +module.exports = _arrayLikeToArray, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/arrayWithHoles.js b/node_modules/@babel/runtime/helpers/arrayWithHoles.js new file mode 100644 index 0000000..b5680a0 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/arrayWithHoles.js @@ -0,0 +1,5 @@ +function _arrayWithHoles(arr) { + if (Array.isArray(arr)) return arr; +} + +module.exports = _arrayWithHoles, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/arrayWithoutHoles.js b/node_modules/@babel/runtime/helpers/arrayWithoutHoles.js new file mode 100644 index 0000000..30bf377 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/arrayWithoutHoles.js @@ -0,0 +1,7 @@ +var arrayLikeToArray = require("./arrayLikeToArray.js"); + +function _arrayWithoutHoles(arr) { + if (Array.isArray(arr)) return arrayLikeToArray(arr); +} + +module.exports = _arrayWithoutHoles, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/assertThisInitialized.js b/node_modules/@babel/runtime/helpers/assertThisInitialized.js new file mode 100644 index 0000000..70ea855 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/assertThisInitialized.js @@ -0,0 +1,9 @@ +function _assertThisInitialized(self) { + if (self === void 0) { + throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); + } + + return self; +} + +module.exports = _assertThisInitialized, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/asyncGeneratorDelegate.js b/node_modules/@babel/runtime/helpers/asyncGeneratorDelegate.js new file mode 100644 index 0000000..cf7d480 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/asyncGeneratorDelegate.js @@ -0,0 +1,56 @@ +function _asyncGeneratorDelegate(inner, awaitWrap) { + var iter = {}, + waiting = false; + + function pump(key, value) { + waiting = true; + value = new Promise(function (resolve) { + resolve(inner[key](value)); + }); + return { + done: false, + value: awaitWrap(value) + }; + } + + ; + + iter[typeof Symbol !== "undefined" && Symbol.iterator || "@@iterator"] = function () { + return this; + }; + + iter.next = function (value) { + if (waiting) { + waiting = false; + return value; + } + + return pump("next", value); + }; + + if (typeof inner["throw"] === "function") { + iter["throw"] = function (value) { + if (waiting) { + waiting = false; + throw value; + } + + return pump("throw", value); + }; + } + + if (typeof inner["return"] === "function") { + iter["return"] = function (value) { + if (waiting) { + waiting = false; + return value; + } + + return pump("return", value); + }; + } + + return iter; +} + +module.exports = _asyncGeneratorDelegate, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/asyncIterator.js b/node_modules/@babel/runtime/helpers/asyncIterator.js new file mode 100644 index 0000000..d8e11f0 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/asyncIterator.js @@ -0,0 +1,50 @@ +function _asyncIterator(iterable) { + var method, + async, + sync, + retry = 2; + + for ("undefined" != typeof Symbol && (async = Symbol.asyncIterator, sync = Symbol.iterator); retry--;) { + if (async && null != (method = iterable[async])) return method.call(iterable); + if (sync && null != (method = iterable[sync])) return new AsyncFromSyncIterator(method.call(iterable)); + async = "@@asyncIterator", sync = "@@iterator"; + } + + throw new TypeError("Object is not async iterable"); +} + +function AsyncFromSyncIterator(s) { + function AsyncFromSyncIteratorContinuation(r) { + if (Object(r) !== r) return Promise.reject(new TypeError(r + " is not an object.")); + var done = r.done; + return Promise.resolve(r.value).then(function (value) { + return { + value: value, + done: done + }; + }); + } + + return AsyncFromSyncIterator = function AsyncFromSyncIterator(s) { + this.s = s, this.n = s.next; + }, AsyncFromSyncIterator.prototype = { + s: null, + n: null, + next: function next() { + return AsyncFromSyncIteratorContinuation(this.n.apply(this.s, arguments)); + }, + "return": function _return(value) { + var ret = this.s["return"]; + return void 0 === ret ? Promise.resolve({ + value: value, + done: !0 + }) : AsyncFromSyncIteratorContinuation(ret.apply(this.s, arguments)); + }, + "throw": function _throw(value) { + var thr = this.s["return"]; + return void 0 === thr ? Promise.reject(value) : AsyncFromSyncIteratorContinuation(thr.apply(this.s, arguments)); + } + }, new AsyncFromSyncIterator(s); +} + +module.exports = _asyncIterator, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/asyncToGenerator.js b/node_modules/@babel/runtime/helpers/asyncToGenerator.js new file mode 100644 index 0000000..becd163 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/asyncToGenerator.js @@ -0,0 +1,37 @@ +function asyncGeneratorStep(gen, resolve, reject, _next, _throw, key, arg) { + try { + var info = gen[key](arg); + var value = info.value; + } catch (error) { + reject(error); + return; + } + + if (info.done) { + resolve(value); + } else { + Promise.resolve(value).then(_next, _throw); + } +} + +function _asyncToGenerator(fn) { + return function () { + var self = this, + args = arguments; + return new Promise(function (resolve, reject) { + var gen = fn.apply(self, args); + + function _next(value) { + asyncGeneratorStep(gen, resolve, reject, _next, _throw, "next", value); + } + + function _throw(err) { + asyncGeneratorStep(gen, resolve, reject, _next, _throw, "throw", err); + } + + _next(undefined); + }); + }; +} + +module.exports = _asyncToGenerator, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/awaitAsyncGenerator.js b/node_modules/@babel/runtime/helpers/awaitAsyncGenerator.js new file mode 100644 index 0000000..f0f30ed --- /dev/null +++ b/node_modules/@babel/runtime/helpers/awaitAsyncGenerator.js @@ -0,0 +1,7 @@ +var AwaitValue = require("./AwaitValue.js"); + +function _awaitAsyncGenerator(value) { + return new AwaitValue(value); +} + +module.exports = _awaitAsyncGenerator, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/checkPrivateRedeclaration.js b/node_modules/@babel/runtime/helpers/checkPrivateRedeclaration.js new file mode 100644 index 0000000..6cd0fcb --- /dev/null +++ b/node_modules/@babel/runtime/helpers/checkPrivateRedeclaration.js @@ -0,0 +1,7 @@ +function _checkPrivateRedeclaration(obj, privateCollection) { + if (privateCollection.has(obj)) { + throw new TypeError("Cannot initialize the same private elements twice on an object"); + } +} + +module.exports = _checkPrivateRedeclaration, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/classApplyDescriptorDestructureSet.js b/node_modules/@babel/runtime/helpers/classApplyDescriptorDestructureSet.js new file mode 100644 index 0000000..ea1c860 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/classApplyDescriptorDestructureSet.js @@ -0,0 +1,22 @@ +function _classApplyDescriptorDestructureSet(receiver, descriptor) { + if (descriptor.set) { + if (!("__destrObj" in descriptor)) { + descriptor.__destrObj = { + set value(v) { + descriptor.set.call(receiver, v); + } + + }; + } + + return descriptor.__destrObj; + } else { + if (!descriptor.writable) { + throw new TypeError("attempted to set read only private field"); + } + + return descriptor; + } +} + +module.exports = _classApplyDescriptorDestructureSet, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/classApplyDescriptorGet.js b/node_modules/@babel/runtime/helpers/classApplyDescriptorGet.js new file mode 100644 index 0000000..b9d0e94 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/classApplyDescriptorGet.js @@ -0,0 +1,9 @@ +function _classApplyDescriptorGet(receiver, descriptor) { + if (descriptor.get) { + return descriptor.get.call(receiver); + } + + return descriptor.value; +} + +module.exports = _classApplyDescriptorGet, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/classApplyDescriptorSet.js b/node_modules/@babel/runtime/helpers/classApplyDescriptorSet.js new file mode 100644 index 0000000..9824b5c --- /dev/null +++ b/node_modules/@babel/runtime/helpers/classApplyDescriptorSet.js @@ -0,0 +1,13 @@ +function _classApplyDescriptorSet(receiver, descriptor, value) { + if (descriptor.set) { + descriptor.set.call(receiver, value); + } else { + if (!descriptor.writable) { + throw new TypeError("attempted to set read only private field"); + } + + descriptor.value = value; + } +} + +module.exports = _classApplyDescriptorSet, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/classCallCheck.js b/node_modules/@babel/runtime/helpers/classCallCheck.js new file mode 100644 index 0000000..1418845 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/classCallCheck.js @@ -0,0 +1,7 @@ +function _classCallCheck(instance, Constructor) { + if (!(instance instanceof Constructor)) { + throw new TypeError("Cannot call a class as a function"); + } +} + +module.exports = _classCallCheck, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/classCheckPrivateStaticAccess.js b/node_modules/@babel/runtime/helpers/classCheckPrivateStaticAccess.js new file mode 100644 index 0000000..7f5213b --- /dev/null +++ b/node_modules/@babel/runtime/helpers/classCheckPrivateStaticAccess.js @@ -0,0 +1,7 @@ +function _classCheckPrivateStaticAccess(receiver, classConstructor) { + if (receiver !== classConstructor) { + throw new TypeError("Private static access of wrong provenance"); + } +} + +module.exports = _classCheckPrivateStaticAccess, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/classCheckPrivateStaticFieldDescriptor.js b/node_modules/@babel/runtime/helpers/classCheckPrivateStaticFieldDescriptor.js new file mode 100644 index 0000000..87ec4ea --- /dev/null +++ b/node_modules/@babel/runtime/helpers/classCheckPrivateStaticFieldDescriptor.js @@ -0,0 +1,7 @@ +function _classCheckPrivateStaticFieldDescriptor(descriptor, action) { + if (descriptor === undefined) { + throw new TypeError("attempted to " + action + " private static field before its declaration"); + } +} + +module.exports = _classCheckPrivateStaticFieldDescriptor, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/classExtractFieldDescriptor.js b/node_modules/@babel/runtime/helpers/classExtractFieldDescriptor.js new file mode 100644 index 0000000..5c422bf --- /dev/null +++ b/node_modules/@babel/runtime/helpers/classExtractFieldDescriptor.js @@ -0,0 +1,9 @@ +function _classExtractFieldDescriptor(receiver, privateMap, action) { + if (!privateMap.has(receiver)) { + throw new TypeError("attempted to " + action + " private field on non-instance"); + } + + return privateMap.get(receiver); +} + +module.exports = _classExtractFieldDescriptor, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/classNameTDZError.js b/node_modules/@babel/runtime/helpers/classNameTDZError.js new file mode 100644 index 0000000..9a48c70 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/classNameTDZError.js @@ -0,0 +1,5 @@ +function _classNameTDZError(name) { + throw new Error("Class \"" + name + "\" cannot be referenced in computed property keys."); +} + +module.exports = _classNameTDZError, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/classPrivateFieldDestructureSet.js b/node_modules/@babel/runtime/helpers/classPrivateFieldDestructureSet.js new file mode 100644 index 0000000..07abfe5 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/classPrivateFieldDestructureSet.js @@ -0,0 +1,10 @@ +var classApplyDescriptorDestructureSet = require("./classApplyDescriptorDestructureSet.js"); + +var classExtractFieldDescriptor = require("./classExtractFieldDescriptor.js"); + +function _classPrivateFieldDestructureSet(receiver, privateMap) { + var descriptor = classExtractFieldDescriptor(receiver, privateMap, "set"); + return classApplyDescriptorDestructureSet(receiver, descriptor); +} + +module.exports = _classPrivateFieldDestructureSet, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/classPrivateFieldGet.js b/node_modules/@babel/runtime/helpers/classPrivateFieldGet.js new file mode 100644 index 0000000..470ded7 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/classPrivateFieldGet.js @@ -0,0 +1,10 @@ +var classApplyDescriptorGet = require("./classApplyDescriptorGet.js"); + +var classExtractFieldDescriptor = require("./classExtractFieldDescriptor.js"); + +function _classPrivateFieldGet(receiver, privateMap) { + var descriptor = classExtractFieldDescriptor(receiver, privateMap, "get"); + return classApplyDescriptorGet(receiver, descriptor); +} + +module.exports = _classPrivateFieldGet, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/classPrivateFieldInitSpec.js b/node_modules/@babel/runtime/helpers/classPrivateFieldInitSpec.js new file mode 100644 index 0000000..a6243c2 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/classPrivateFieldInitSpec.js @@ -0,0 +1,8 @@ +var checkPrivateRedeclaration = require("./checkPrivateRedeclaration.js"); + +function _classPrivateFieldInitSpec(obj, privateMap, value) { + checkPrivateRedeclaration(obj, privateMap); + privateMap.set(obj, value); +} + +module.exports = _classPrivateFieldInitSpec, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/classPrivateFieldLooseBase.js b/node_modules/@babel/runtime/helpers/classPrivateFieldLooseBase.js new file mode 100644 index 0000000..571109f --- /dev/null +++ b/node_modules/@babel/runtime/helpers/classPrivateFieldLooseBase.js @@ -0,0 +1,9 @@ +function _classPrivateFieldBase(receiver, privateKey) { + if (!Object.prototype.hasOwnProperty.call(receiver, privateKey)) { + throw new TypeError("attempted to use private field on non-instance"); + } + + return receiver; +} + +module.exports = _classPrivateFieldBase, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/classPrivateFieldLooseKey.js b/node_modules/@babel/runtime/helpers/classPrivateFieldLooseKey.js new file mode 100644 index 0000000..b05e194 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/classPrivateFieldLooseKey.js @@ -0,0 +1,7 @@ +var id = 0; + +function _classPrivateFieldKey(name) { + return "__private_" + id++ + "_" + name; +} + +module.exports = _classPrivateFieldKey, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/classPrivateFieldSet.js b/node_modules/@babel/runtime/helpers/classPrivateFieldSet.js new file mode 100644 index 0000000..f8ab842 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/classPrivateFieldSet.js @@ -0,0 +1,11 @@ +var classApplyDescriptorSet = require("./classApplyDescriptorSet.js"); + +var classExtractFieldDescriptor = require("./classExtractFieldDescriptor.js"); + +function _classPrivateFieldSet(receiver, privateMap, value) { + var descriptor = classExtractFieldDescriptor(receiver, privateMap, "set"); + classApplyDescriptorSet(receiver, descriptor, value); + return value; +} + +module.exports = _classPrivateFieldSet, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/classPrivateMethodGet.js b/node_modules/@babel/runtime/helpers/classPrivateMethodGet.js new file mode 100644 index 0000000..540a1f3 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/classPrivateMethodGet.js @@ -0,0 +1,9 @@ +function _classPrivateMethodGet(receiver, privateSet, fn) { + if (!privateSet.has(receiver)) { + throw new TypeError("attempted to get private field on non-instance"); + } + + return fn; +} + +module.exports = _classPrivateMethodGet, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/classPrivateMethodInitSpec.js b/node_modules/@babel/runtime/helpers/classPrivateMethodInitSpec.js new file mode 100644 index 0000000..6c4df76 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/classPrivateMethodInitSpec.js @@ -0,0 +1,8 @@ +var checkPrivateRedeclaration = require("./checkPrivateRedeclaration.js"); + +function _classPrivateMethodInitSpec(obj, privateSet) { + checkPrivateRedeclaration(obj, privateSet); + privateSet.add(obj); +} + +module.exports = _classPrivateMethodInitSpec, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/classPrivateMethodSet.js b/node_modules/@babel/runtime/helpers/classPrivateMethodSet.js new file mode 100644 index 0000000..226789d --- /dev/null +++ b/node_modules/@babel/runtime/helpers/classPrivateMethodSet.js @@ -0,0 +1,5 @@ +function _classPrivateMethodSet() { + throw new TypeError("attempted to reassign private method"); +} + +module.exports = _classPrivateMethodSet, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/classStaticPrivateFieldDestructureSet.js b/node_modules/@babel/runtime/helpers/classStaticPrivateFieldDestructureSet.js new file mode 100644 index 0000000..120c74d --- /dev/null +++ b/node_modules/@babel/runtime/helpers/classStaticPrivateFieldDestructureSet.js @@ -0,0 +1,13 @@ +var classApplyDescriptorDestructureSet = require("./classApplyDescriptorDestructureSet.js"); + +var classCheckPrivateStaticAccess = require("./classCheckPrivateStaticAccess.js"); + +var classCheckPrivateStaticFieldDescriptor = require("./classCheckPrivateStaticFieldDescriptor.js"); + +function _classStaticPrivateFieldDestructureSet(receiver, classConstructor, descriptor) { + classCheckPrivateStaticAccess(receiver, classConstructor); + classCheckPrivateStaticFieldDescriptor(descriptor, "set"); + return classApplyDescriptorDestructureSet(receiver, descriptor); +} + +module.exports = _classStaticPrivateFieldDestructureSet, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/classStaticPrivateFieldSpecGet.js b/node_modules/@babel/runtime/helpers/classStaticPrivateFieldSpecGet.js new file mode 100644 index 0000000..d7201c3 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/classStaticPrivateFieldSpecGet.js @@ -0,0 +1,13 @@ +var classApplyDescriptorGet = require("./classApplyDescriptorGet.js"); + +var classCheckPrivateStaticAccess = require("./classCheckPrivateStaticAccess.js"); + +var classCheckPrivateStaticFieldDescriptor = require("./classCheckPrivateStaticFieldDescriptor.js"); + +function _classStaticPrivateFieldSpecGet(receiver, classConstructor, descriptor) { + classCheckPrivateStaticAccess(receiver, classConstructor); + classCheckPrivateStaticFieldDescriptor(descriptor, "get"); + return classApplyDescriptorGet(receiver, descriptor); +} + +module.exports = _classStaticPrivateFieldSpecGet, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/classStaticPrivateFieldSpecSet.js b/node_modules/@babel/runtime/helpers/classStaticPrivateFieldSpecSet.js new file mode 100644 index 0000000..2aa13ef --- /dev/null +++ b/node_modules/@babel/runtime/helpers/classStaticPrivateFieldSpecSet.js @@ -0,0 +1,14 @@ +var classApplyDescriptorSet = require("./classApplyDescriptorSet.js"); + +var classCheckPrivateStaticAccess = require("./classCheckPrivateStaticAccess.js"); + +var classCheckPrivateStaticFieldDescriptor = require("./classCheckPrivateStaticFieldDescriptor.js"); + +function _classStaticPrivateFieldSpecSet(receiver, classConstructor, descriptor, value) { + classCheckPrivateStaticAccess(receiver, classConstructor); + classCheckPrivateStaticFieldDescriptor(descriptor, "set"); + classApplyDescriptorSet(receiver, descriptor, value); + return value; +} + +module.exports = _classStaticPrivateFieldSpecSet, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/classStaticPrivateMethodGet.js b/node_modules/@babel/runtime/helpers/classStaticPrivateMethodGet.js new file mode 100644 index 0000000..d77c842 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/classStaticPrivateMethodGet.js @@ -0,0 +1,8 @@ +var classCheckPrivateStaticAccess = require("./classCheckPrivateStaticAccess.js"); + +function _classStaticPrivateMethodGet(receiver, classConstructor, method) { + classCheckPrivateStaticAccess(receiver, classConstructor); + return method; +} + +module.exports = _classStaticPrivateMethodGet, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/classStaticPrivateMethodSet.js b/node_modules/@babel/runtime/helpers/classStaticPrivateMethodSet.js new file mode 100644 index 0000000..2e1c83f --- /dev/null +++ b/node_modules/@babel/runtime/helpers/classStaticPrivateMethodSet.js @@ -0,0 +1,5 @@ +function _classStaticPrivateMethodSet() { + throw new TypeError("attempted to set read only static private field"); +} + +module.exports = _classStaticPrivateMethodSet, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/construct.js b/node_modules/@babel/runtime/helpers/construct.js new file mode 100644 index 0000000..c2518af --- /dev/null +++ b/node_modules/@babel/runtime/helpers/construct.js @@ -0,0 +1,22 @@ +var setPrototypeOf = require("./setPrototypeOf.js"); + +var isNativeReflectConstruct = require("./isNativeReflectConstruct.js"); + +function _construct(Parent, args, Class) { + if (isNativeReflectConstruct()) { + module.exports = _construct = Reflect.construct, module.exports.__esModule = true, module.exports["default"] = module.exports; + } else { + module.exports = _construct = function _construct(Parent, args, Class) { + var a = [null]; + a.push.apply(a, args); + var Constructor = Function.bind.apply(Parent, a); + var instance = new Constructor(); + if (Class) setPrototypeOf(instance, Class.prototype); + return instance; + }, module.exports.__esModule = true, module.exports["default"] = module.exports; + } + + return _construct.apply(null, arguments); +} + +module.exports = _construct, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/createClass.js b/node_modules/@babel/runtime/helpers/createClass.js new file mode 100644 index 0000000..4273e7a --- /dev/null +++ b/node_modules/@babel/runtime/helpers/createClass.js @@ -0,0 +1,20 @@ +function _defineProperties(target, props) { + for (var i = 0; i < props.length; i++) { + var descriptor = props[i]; + descriptor.enumerable = descriptor.enumerable || false; + descriptor.configurable = true; + if ("value" in descriptor) descriptor.writable = true; + Object.defineProperty(target, descriptor.key, descriptor); + } +} + +function _createClass(Constructor, protoProps, staticProps) { + if (protoProps) _defineProperties(Constructor.prototype, protoProps); + if (staticProps) _defineProperties(Constructor, staticProps); + Object.defineProperty(Constructor, "prototype", { + writable: false + }); + return Constructor; +} + +module.exports = _createClass, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/createForOfIteratorHelper.js b/node_modules/@babel/runtime/helpers/createForOfIteratorHelper.js new file mode 100644 index 0000000..0835893 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/createForOfIteratorHelper.js @@ -0,0 +1,60 @@ +var unsupportedIterableToArray = require("./unsupportedIterableToArray.js"); + +function _createForOfIteratorHelper(o, allowArrayLike) { + var it = typeof Symbol !== "undefined" && o[Symbol.iterator] || o["@@iterator"]; + + if (!it) { + if (Array.isArray(o) || (it = unsupportedIterableToArray(o)) || allowArrayLike && o && typeof o.length === "number") { + if (it) o = it; + var i = 0; + + var F = function F() {}; + + return { + s: F, + n: function n() { + if (i >= o.length) return { + done: true + }; + return { + done: false, + value: o[i++] + }; + }, + e: function e(_e) { + throw _e; + }, + f: F + }; + } + + throw new TypeError("Invalid attempt to iterate non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method."); + } + + var normalCompletion = true, + didErr = false, + err; + return { + s: function s() { + it = it.call(o); + }, + n: function n() { + var step = it.next(); + normalCompletion = step.done; + return step; + }, + e: function e(_e2) { + didErr = true; + err = _e2; + }, + f: function f() { + try { + if (!normalCompletion && it["return"] != null) it["return"](); + } finally { + if (didErr) throw err; + } + } + }; +} + +module.exports = _createForOfIteratorHelper, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/createForOfIteratorHelperLoose.js b/node_modules/@babel/runtime/helpers/createForOfIteratorHelperLoose.js new file mode 100644 index 0000000..65d3bc9 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/createForOfIteratorHelperLoose.js @@ -0,0 +1,24 @@ +var unsupportedIterableToArray = require("./unsupportedIterableToArray.js"); + +function _createForOfIteratorHelperLoose(o, allowArrayLike) { + var it = typeof Symbol !== "undefined" && o[Symbol.iterator] || o["@@iterator"]; + if (it) return (it = it.call(o)).next.bind(it); + + if (Array.isArray(o) || (it = unsupportedIterableToArray(o)) || allowArrayLike && o && typeof o.length === "number") { + if (it) o = it; + var i = 0; + return function () { + if (i >= o.length) return { + done: true + }; + return { + done: false, + value: o[i++] + }; + }; + } + + throw new TypeError("Invalid attempt to iterate non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method."); +} + +module.exports = _createForOfIteratorHelperLoose, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/createSuper.js b/node_modules/@babel/runtime/helpers/createSuper.js new file mode 100644 index 0000000..624728b --- /dev/null +++ b/node_modules/@babel/runtime/helpers/createSuper.js @@ -0,0 +1,24 @@ +var getPrototypeOf = require("./getPrototypeOf.js"); + +var isNativeReflectConstruct = require("./isNativeReflectConstruct.js"); + +var possibleConstructorReturn = require("./possibleConstructorReturn.js"); + +function _createSuper(Derived) { + var hasNativeReflectConstruct = isNativeReflectConstruct(); + return function _createSuperInternal() { + var Super = getPrototypeOf(Derived), + result; + + if (hasNativeReflectConstruct) { + var NewTarget = getPrototypeOf(this).constructor; + result = Reflect.construct(Super, arguments, NewTarget); + } else { + result = Super.apply(this, arguments); + } + + return possibleConstructorReturn(this, result); + }; +} + +module.exports = _createSuper, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/decorate.js b/node_modules/@babel/runtime/helpers/decorate.js new file mode 100644 index 0000000..3bd35e7 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/decorate.js @@ -0,0 +1,400 @@ +var toArray = require("./toArray.js"); + +var toPropertyKey = require("./toPropertyKey.js"); + +function _decorate(decorators, factory, superClass, mixins) { + var api = _getDecoratorsApi(); + + if (mixins) { + for (var i = 0; i < mixins.length; i++) { + api = mixins[i](api); + } + } + + var r = factory(function initialize(O) { + api.initializeInstanceElements(O, decorated.elements); + }, superClass); + var decorated = api.decorateClass(_coalesceClassElements(r.d.map(_createElementDescriptor)), decorators); + api.initializeClassElements(r.F, decorated.elements); + return api.runClassFinishers(r.F, decorated.finishers); +} + +function _getDecoratorsApi() { + _getDecoratorsApi = function _getDecoratorsApi() { + return api; + }; + + var api = { + elementsDefinitionOrder: [["method"], ["field"]], + initializeInstanceElements: function initializeInstanceElements(O, elements) { + ["method", "field"].forEach(function (kind) { + elements.forEach(function (element) { + if (element.kind === kind && element.placement === "own") { + this.defineClassElement(O, element); + } + }, this); + }, this); + }, + initializeClassElements: function initializeClassElements(F, elements) { + var proto = F.prototype; + ["method", "field"].forEach(function (kind) { + elements.forEach(function (element) { + var placement = element.placement; + + if (element.kind === kind && (placement === "static" || placement === "prototype")) { + var receiver = placement === "static" ? F : proto; + this.defineClassElement(receiver, element); + } + }, this); + }, this); + }, + defineClassElement: function defineClassElement(receiver, element) { + var descriptor = element.descriptor; + + if (element.kind === "field") { + var initializer = element.initializer; + descriptor = { + enumerable: descriptor.enumerable, + writable: descriptor.writable, + configurable: descriptor.configurable, + value: initializer === void 0 ? void 0 : initializer.call(receiver) + }; + } + + Object.defineProperty(receiver, element.key, descriptor); + }, + decorateClass: function decorateClass(elements, decorators) { + var newElements = []; + var finishers = []; + var placements = { + "static": [], + prototype: [], + own: [] + }; + elements.forEach(function (element) { + this.addElementPlacement(element, placements); + }, this); + elements.forEach(function (element) { + if (!_hasDecorators(element)) return newElements.push(element); + var elementFinishersExtras = this.decorateElement(element, placements); + newElements.push(elementFinishersExtras.element); + newElements.push.apply(newElements, elementFinishersExtras.extras); + finishers.push.apply(finishers, elementFinishersExtras.finishers); + }, this); + + if (!decorators) { + return { + elements: newElements, + finishers: finishers + }; + } + + var result = this.decorateConstructor(newElements, decorators); + finishers.push.apply(finishers, result.finishers); + result.finishers = finishers; + return result; + }, + addElementPlacement: function addElementPlacement(element, placements, silent) { + var keys = placements[element.placement]; + + if (!silent && keys.indexOf(element.key) !== -1) { + throw new TypeError("Duplicated element (" + element.key + ")"); + } + + keys.push(element.key); + }, + decorateElement: function decorateElement(element, placements) { + var extras = []; + var finishers = []; + + for (var decorators = element.decorators, i = decorators.length - 1; i >= 0; i--) { + var keys = placements[element.placement]; + keys.splice(keys.indexOf(element.key), 1); + var elementObject = this.fromElementDescriptor(element); + var elementFinisherExtras = this.toElementFinisherExtras((0, decorators[i])(elementObject) || elementObject); + element = elementFinisherExtras.element; + this.addElementPlacement(element, placements); + + if (elementFinisherExtras.finisher) { + finishers.push(elementFinisherExtras.finisher); + } + + var newExtras = elementFinisherExtras.extras; + + if (newExtras) { + for (var j = 0; j < newExtras.length; j++) { + this.addElementPlacement(newExtras[j], placements); + } + + extras.push.apply(extras, newExtras); + } + } + + return { + element: element, + finishers: finishers, + extras: extras + }; + }, + decorateConstructor: function decorateConstructor(elements, decorators) { + var finishers = []; + + for (var i = decorators.length - 1; i >= 0; i--) { + var obj = this.fromClassDescriptor(elements); + var elementsAndFinisher = this.toClassDescriptor((0, decorators[i])(obj) || obj); + + if (elementsAndFinisher.finisher !== undefined) { + finishers.push(elementsAndFinisher.finisher); + } + + if (elementsAndFinisher.elements !== undefined) { + elements = elementsAndFinisher.elements; + + for (var j = 0; j < elements.length - 1; j++) { + for (var k = j + 1; k < elements.length; k++) { + if (elements[j].key === elements[k].key && elements[j].placement === elements[k].placement) { + throw new TypeError("Duplicated element (" + elements[j].key + ")"); + } + } + } + } + } + + return { + elements: elements, + finishers: finishers + }; + }, + fromElementDescriptor: function fromElementDescriptor(element) { + var obj = { + kind: element.kind, + key: element.key, + placement: element.placement, + descriptor: element.descriptor + }; + var desc = { + value: "Descriptor", + configurable: true + }; + Object.defineProperty(obj, Symbol.toStringTag, desc); + if (element.kind === "field") obj.initializer = element.initializer; + return obj; + }, + toElementDescriptors: function toElementDescriptors(elementObjects) { + if (elementObjects === undefined) return; + return toArray(elementObjects).map(function (elementObject) { + var element = this.toElementDescriptor(elementObject); + this.disallowProperty(elementObject, "finisher", "An element descriptor"); + this.disallowProperty(elementObject, "extras", "An element descriptor"); + return element; + }, this); + }, + toElementDescriptor: function toElementDescriptor(elementObject) { + var kind = String(elementObject.kind); + + if (kind !== "method" && kind !== "field") { + throw new TypeError('An element descriptor\'s .kind property must be either "method" or' + ' "field", but a decorator created an element descriptor with' + ' .kind "' + kind + '"'); + } + + var key = toPropertyKey(elementObject.key); + var placement = String(elementObject.placement); + + if (placement !== "static" && placement !== "prototype" && placement !== "own") { + throw new TypeError('An element descriptor\'s .placement property must be one of "static",' + ' "prototype" or "own", but a decorator created an element descriptor' + ' with .placement "' + placement + '"'); + } + + var descriptor = elementObject.descriptor; + this.disallowProperty(elementObject, "elements", "An element descriptor"); + var element = { + kind: kind, + key: key, + placement: placement, + descriptor: Object.assign({}, descriptor) + }; + + if (kind !== "field") { + this.disallowProperty(elementObject, "initializer", "A method descriptor"); + } else { + this.disallowProperty(descriptor, "get", "The property descriptor of a field descriptor"); + this.disallowProperty(descriptor, "set", "The property descriptor of a field descriptor"); + this.disallowProperty(descriptor, "value", "The property descriptor of a field descriptor"); + element.initializer = elementObject.initializer; + } + + return element; + }, + toElementFinisherExtras: function toElementFinisherExtras(elementObject) { + var element = this.toElementDescriptor(elementObject); + + var finisher = _optionalCallableProperty(elementObject, "finisher"); + + var extras = this.toElementDescriptors(elementObject.extras); + return { + element: element, + finisher: finisher, + extras: extras + }; + }, + fromClassDescriptor: function fromClassDescriptor(elements) { + var obj = { + kind: "class", + elements: elements.map(this.fromElementDescriptor, this) + }; + var desc = { + value: "Descriptor", + configurable: true + }; + Object.defineProperty(obj, Symbol.toStringTag, desc); + return obj; + }, + toClassDescriptor: function toClassDescriptor(obj) { + var kind = String(obj.kind); + + if (kind !== "class") { + throw new TypeError('A class descriptor\'s .kind property must be "class", but a decorator' + ' created a class descriptor with .kind "' + kind + '"'); + } + + this.disallowProperty(obj, "key", "A class descriptor"); + this.disallowProperty(obj, "placement", "A class descriptor"); + this.disallowProperty(obj, "descriptor", "A class descriptor"); + this.disallowProperty(obj, "initializer", "A class descriptor"); + this.disallowProperty(obj, "extras", "A class descriptor"); + + var finisher = _optionalCallableProperty(obj, "finisher"); + + var elements = this.toElementDescriptors(obj.elements); + return { + elements: elements, + finisher: finisher + }; + }, + runClassFinishers: function runClassFinishers(constructor, finishers) { + for (var i = 0; i < finishers.length; i++) { + var newConstructor = (0, finishers[i])(constructor); + + if (newConstructor !== undefined) { + if (typeof newConstructor !== "function") { + throw new TypeError("Finishers must return a constructor."); + } + + constructor = newConstructor; + } + } + + return constructor; + }, + disallowProperty: function disallowProperty(obj, name, objectType) { + if (obj[name] !== undefined) { + throw new TypeError(objectType + " can't have a ." + name + " property."); + } + } + }; + return api; +} + +function _createElementDescriptor(def) { + var key = toPropertyKey(def.key); + var descriptor; + + if (def.kind === "method") { + descriptor = { + value: def.value, + writable: true, + configurable: true, + enumerable: false + }; + } else if (def.kind === "get") { + descriptor = { + get: def.value, + configurable: true, + enumerable: false + }; + } else if (def.kind === "set") { + descriptor = { + set: def.value, + configurable: true, + enumerable: false + }; + } else if (def.kind === "field") { + descriptor = { + configurable: true, + writable: true, + enumerable: true + }; + } + + var element = { + kind: def.kind === "field" ? "field" : "method", + key: key, + placement: def["static"] ? "static" : def.kind === "field" ? "own" : "prototype", + descriptor: descriptor + }; + if (def.decorators) element.decorators = def.decorators; + if (def.kind === "field") element.initializer = def.value; + return element; +} + +function _coalesceGetterSetter(element, other) { + if (element.descriptor.get !== undefined) { + other.descriptor.get = element.descriptor.get; + } else { + other.descriptor.set = element.descriptor.set; + } +} + +function _coalesceClassElements(elements) { + var newElements = []; + + var isSameElement = function isSameElement(other) { + return other.kind === "method" && other.key === element.key && other.placement === element.placement; + }; + + for (var i = 0; i < elements.length; i++) { + var element = elements[i]; + var other; + + if (element.kind === "method" && (other = newElements.find(isSameElement))) { + if (_isDataDescriptor(element.descriptor) || _isDataDescriptor(other.descriptor)) { + if (_hasDecorators(element) || _hasDecorators(other)) { + throw new ReferenceError("Duplicated methods (" + element.key + ") can't be decorated."); + } + + other.descriptor = element.descriptor; + } else { + if (_hasDecorators(element)) { + if (_hasDecorators(other)) { + throw new ReferenceError("Decorators can't be placed on different accessors with for " + "the same property (" + element.key + ")."); + } + + other.decorators = element.decorators; + } + + _coalesceGetterSetter(element, other); + } + } else { + newElements.push(element); + } + } + + return newElements; +} + +function _hasDecorators(element) { + return element.decorators && element.decorators.length; +} + +function _isDataDescriptor(desc) { + return desc !== undefined && !(desc.value === undefined && desc.writable === undefined); +} + +function _optionalCallableProperty(obj, name) { + var value = obj[name]; + + if (value !== undefined && typeof value !== "function") { + throw new TypeError("Expected '" + name + "' to be a function"); + } + + return value; +} + +module.exports = _decorate, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/defaults.js b/node_modules/@babel/runtime/helpers/defaults.js new file mode 100644 index 0000000..6c1c196 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/defaults.js @@ -0,0 +1,16 @@ +function _defaults(obj, defaults) { + var keys = Object.getOwnPropertyNames(defaults); + + for (var i = 0; i < keys.length; i++) { + var key = keys[i]; + var value = Object.getOwnPropertyDescriptor(defaults, key); + + if (value && value.configurable && obj[key] === undefined) { + Object.defineProperty(obj, key, value); + } + } + + return obj; +} + +module.exports = _defaults, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/defineEnumerableProperties.js b/node_modules/@babel/runtime/helpers/defineEnumerableProperties.js new file mode 100644 index 0000000..cd49128 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/defineEnumerableProperties.js @@ -0,0 +1,24 @@ +function _defineEnumerableProperties(obj, descs) { + for (var key in descs) { + var desc = descs[key]; + desc.configurable = desc.enumerable = true; + if ("value" in desc) desc.writable = true; + Object.defineProperty(obj, key, desc); + } + + if (Object.getOwnPropertySymbols) { + var objectSymbols = Object.getOwnPropertySymbols(descs); + + for (var i = 0; i < objectSymbols.length; i++) { + var sym = objectSymbols[i]; + var desc = descs[sym]; + desc.configurable = desc.enumerable = true; + if ("value" in desc) desc.writable = true; + Object.defineProperty(obj, sym, desc); + } + } + + return obj; +} + +module.exports = _defineEnumerableProperties, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/defineProperty.js b/node_modules/@babel/runtime/helpers/defineProperty.js new file mode 100644 index 0000000..fe7d6bb --- /dev/null +++ b/node_modules/@babel/runtime/helpers/defineProperty.js @@ -0,0 +1,16 @@ +function _defineProperty(obj, key, value) { + if (key in obj) { + Object.defineProperty(obj, key, { + value: value, + enumerable: true, + configurable: true, + writable: true + }); + } else { + obj[key] = value; + } + + return obj; +} + +module.exports = _defineProperty, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/AsyncGenerator.js b/node_modules/@babel/runtime/helpers/esm/AsyncGenerator.js new file mode 100644 index 0000000..919aab8 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/AsyncGenerator.js @@ -0,0 +1,95 @@ +import AwaitValue from "./AwaitValue.js"; +export default function AsyncGenerator(gen) { + var front, back; + + function send(key, arg) { + return new Promise(function (resolve, reject) { + var request = { + key: key, + arg: arg, + resolve: resolve, + reject: reject, + next: null + }; + + if (back) { + back = back.next = request; + } else { + front = back = request; + resume(key, arg); + } + }); + } + + function resume(key, arg) { + try { + var result = gen[key](arg); + var value = result.value; + var wrappedAwait = value instanceof AwaitValue; + Promise.resolve(wrappedAwait ? value.wrapped : value).then(function (arg) { + if (wrappedAwait) { + resume(key === "return" ? "return" : "next", arg); + return; + } + + settle(result.done ? "return" : "normal", arg); + }, function (err) { + resume("throw", err); + }); + } catch (err) { + settle("throw", err); + } + } + + function settle(type, value) { + switch (type) { + case "return": + front.resolve({ + value: value, + done: true + }); + break; + + case "throw": + front.reject(value); + break; + + default: + front.resolve({ + value: value, + done: false + }); + break; + } + + front = front.next; + + if (front) { + resume(front.key, front.arg); + } else { + back = null; + } + } + + this._invoke = send; + + if (typeof gen["return"] !== "function") { + this["return"] = undefined; + } +} + +AsyncGenerator.prototype[typeof Symbol === "function" && Symbol.asyncIterator || "@@asyncIterator"] = function () { + return this; +}; + +AsyncGenerator.prototype.next = function (arg) { + return this._invoke("next", arg); +}; + +AsyncGenerator.prototype["throw"] = function (arg) { + return this._invoke("throw", arg); +}; + +AsyncGenerator.prototype["return"] = function (arg) { + return this._invoke("return", arg); +}; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/AwaitValue.js b/node_modules/@babel/runtime/helpers/esm/AwaitValue.js new file mode 100644 index 0000000..5237e18 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/AwaitValue.js @@ -0,0 +1,3 @@ +export default function _AwaitValue(value) { + this.wrapped = value; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/applyDecoratedDescriptor.js b/node_modules/@babel/runtime/helpers/esm/applyDecoratedDescriptor.js new file mode 100644 index 0000000..84b5961 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/applyDecoratedDescriptor.js @@ -0,0 +1,28 @@ +export default function _applyDecoratedDescriptor(target, property, decorators, descriptor, context) { + var desc = {}; + Object.keys(descriptor).forEach(function (key) { + desc[key] = descriptor[key]; + }); + desc.enumerable = !!desc.enumerable; + desc.configurable = !!desc.configurable; + + if ('value' in desc || desc.initializer) { + desc.writable = true; + } + + desc = decorators.slice().reverse().reduce(function (desc, decorator) { + return decorator(target, property, desc) || desc; + }, desc); + + if (context && desc.initializer !== void 0) { + desc.value = desc.initializer ? desc.initializer.call(context) : void 0; + desc.initializer = undefined; + } + + if (desc.initializer === void 0) { + Object.defineProperty(target, property, desc); + desc = null; + } + + return desc; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/applyDecs.js b/node_modules/@babel/runtime/helpers/esm/applyDecs.js new file mode 100644 index 0000000..a6187c0 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/applyDecs.js @@ -0,0 +1,282 @@ +import _typeof from "./typeof.js"; + +function createMetadataMethodsForProperty(metadataMap, kind, property, decoratorFinishedRef) { + return { + getMetadata: function getMetadata(key) { + assertNotFinished(decoratorFinishedRef, "getMetadata"), assertMetadataKey(key); + var metadataForKey = metadataMap[key]; + if (void 0 !== metadataForKey) if (1 === kind) { + var pub = metadataForKey["public"]; + if (void 0 !== pub) return pub[property]; + } else if (2 === kind) { + var priv = metadataForKey["private"]; + if (void 0 !== priv) return priv.get(property); + } else if (Object.hasOwnProperty.call(metadataForKey, "constructor")) return metadataForKey.constructor; + }, + setMetadata: function setMetadata(key, value) { + assertNotFinished(decoratorFinishedRef, "setMetadata"), assertMetadataKey(key); + var metadataForKey = metadataMap[key]; + + if (void 0 === metadataForKey && (metadataForKey = metadataMap[key] = {}), 1 === kind) { + var pub = metadataForKey["public"]; + void 0 === pub && (pub = metadataForKey["public"] = {}), pub[property] = value; + } else if (2 === kind) { + var priv = metadataForKey.priv; + void 0 === priv && (priv = metadataForKey["private"] = new Map()), priv.set(property, value); + } else metadataForKey.constructor = value; + } + }; +} + +function convertMetadataMapToFinal(obj, metadataMap) { + var parentMetadataMap = obj[Symbol.metadata || Symbol["for"]("Symbol.metadata")], + metadataKeys = Object.getOwnPropertySymbols(metadataMap); + + if (0 !== metadataKeys.length) { + for (var i = 0; i < metadataKeys.length; i++) { + var key = metadataKeys[i], + metaForKey = metadataMap[key], + parentMetaForKey = parentMetadataMap ? parentMetadataMap[key] : null, + pub = metaForKey["public"], + parentPub = parentMetaForKey ? parentMetaForKey["public"] : null; + pub && parentPub && Object.setPrototypeOf(pub, parentPub); + var priv = metaForKey["private"]; + + if (priv) { + var privArr = Array.from(priv.values()), + parentPriv = parentMetaForKey ? parentMetaForKey["private"] : null; + parentPriv && (privArr = privArr.concat(parentPriv)), metaForKey["private"] = privArr; + } + + parentMetaForKey && Object.setPrototypeOf(metaForKey, parentMetaForKey); + } + + parentMetadataMap && Object.setPrototypeOf(metadataMap, parentMetadataMap), obj[Symbol.metadata || Symbol["for"]("Symbol.metadata")] = metadataMap; + } +} + +function createAddInitializerMethod(initializers, decoratorFinishedRef) { + return function (initializer) { + assertNotFinished(decoratorFinishedRef, "addInitializer"), assertCallable(initializer, "An initializer"), initializers.push(initializer); + }; +} + +function memberDec(dec, name, desc, metadataMap, initializers, kind, isStatic, isPrivate, value) { + var kindStr; + + switch (kind) { + case 1: + kindStr = "accessor"; + break; + + case 2: + kindStr = "method"; + break; + + case 3: + kindStr = "getter"; + break; + + case 4: + kindStr = "setter"; + break; + + default: + kindStr = "field"; + } + + var metadataKind, + metadataName, + ctx = { + kind: kindStr, + name: isPrivate ? "#" + name : name, + isStatic: isStatic, + isPrivate: isPrivate + }, + decoratorFinishedRef = { + v: !1 + }; + + if (0 !== kind && (ctx.addInitializer = createAddInitializerMethod(initializers, decoratorFinishedRef)), isPrivate) { + metadataKind = 2, metadataName = Symbol(name); + var access = {}; + 0 === kind ? (access.get = desc.get, access.set = desc.set) : 2 === kind ? access.get = function () { + return desc.value; + } : (1 !== kind && 3 !== kind || (access.get = function () { + return desc.get.call(this); + }), 1 !== kind && 4 !== kind || (access.set = function (v) { + desc.set.call(this, v); + })), ctx.access = access; + } else metadataKind = 1, metadataName = name; + + try { + return dec(value, Object.assign(ctx, createMetadataMethodsForProperty(metadataMap, metadataKind, metadataName, decoratorFinishedRef))); + } finally { + decoratorFinishedRef.v = !0; + } +} + +function assertNotFinished(decoratorFinishedRef, fnName) { + if (decoratorFinishedRef.v) throw new Error("attempted to call " + fnName + " after decoration was finished"); +} + +function assertMetadataKey(key) { + if ("symbol" != _typeof(key)) throw new TypeError("Metadata keys must be symbols, received: " + key); +} + +function assertCallable(fn, hint) { + if ("function" != typeof fn) throw new TypeError(hint + " must be a function"); +} + +function assertValidReturnValue(kind, value) { + var type = _typeof(value); + + if (1 === kind) { + if ("object" !== type || null === value) throw new TypeError("accessor decorators must return an object with get, set, or init properties or void 0"); + void 0 !== value.get && assertCallable(value.get, "accessor.get"), void 0 !== value.set && assertCallable(value.set, "accessor.set"), void 0 !== value.init && assertCallable(value.init, "accessor.init"), void 0 !== value.initializer && assertCallable(value.initializer, "accessor.initializer"); + } else if ("function" !== type) { + var hint; + throw hint = 0 === kind ? "field" : 10 === kind ? "class" : "method", new TypeError(hint + " decorators must return a function or void 0"); + } +} + +function getInit(desc) { + var initializer; + return null == (initializer = desc.init) && (initializer = desc.initializer) && "undefined" != typeof console && console.warn(".initializer has been renamed to .init as of March 2022"), initializer; +} + +function applyMemberDec(ret, base, decInfo, name, kind, isStatic, isPrivate, metadataMap, initializers) { + var desc, + initializer, + value, + newValue, + get, + set, + decs = decInfo[0]; + if (isPrivate ? desc = 0 === kind || 1 === kind ? { + get: decInfo[3], + set: decInfo[4] + } : 3 === kind ? { + get: decInfo[3] + } : 4 === kind ? { + set: decInfo[3] + } : { + value: decInfo[3] + } : 0 !== kind && (desc = Object.getOwnPropertyDescriptor(base, name)), 1 === kind ? value = { + get: desc.get, + set: desc.set + } : 2 === kind ? value = desc.value : 3 === kind ? value = desc.get : 4 === kind && (value = desc.set), "function" == typeof decs) void 0 !== (newValue = memberDec(decs, name, desc, metadataMap, initializers, kind, isStatic, isPrivate, value)) && (assertValidReturnValue(kind, newValue), 0 === kind ? initializer = newValue : 1 === kind ? (initializer = getInit(newValue), get = newValue.get || value.get, set = newValue.set || value.set, value = { + get: get, + set: set + }) : value = newValue);else for (var i = decs.length - 1; i >= 0; i--) { + var newInit; + if (void 0 !== (newValue = memberDec(decs[i], name, desc, metadataMap, initializers, kind, isStatic, isPrivate, value))) assertValidReturnValue(kind, newValue), 0 === kind ? newInit = newValue : 1 === kind ? (newInit = getInit(newValue), get = newValue.get || value.get, set = newValue.set || value.set, value = { + get: get, + set: set + }) : value = newValue, void 0 !== newInit && (void 0 === initializer ? initializer = newInit : "function" == typeof initializer ? initializer = [initializer, newInit] : initializer.push(newInit)); + } + + if (0 === kind || 1 === kind) { + if (void 0 === initializer) initializer = function initializer(instance, init) { + return init; + };else if ("function" != typeof initializer) { + var ownInitializers = initializer; + + initializer = function initializer(instance, init) { + for (var value = init, i = 0; i < ownInitializers.length; i++) { + value = ownInitializers[i].call(instance, value); + } + + return value; + }; + } else { + var originalInitializer = initializer; + + initializer = function initializer(instance, init) { + return originalInitializer.call(instance, init); + }; + } + ret.push(initializer); + } + + 0 !== kind && (1 === kind ? (desc.get = value.get, desc.set = value.set) : 2 === kind ? desc.value = value : 3 === kind ? desc.get = value : 4 === kind && (desc.set = value), isPrivate ? 1 === kind ? (ret.push(function (instance, args) { + return value.get.call(instance, args); + }), ret.push(function (instance, args) { + return value.set.call(instance, args); + })) : 2 === kind ? ret.push(value) : ret.push(function (instance, args) { + return value.call(instance, args); + }) : Object.defineProperty(base, name, desc)); +} + +function applyMemberDecs(ret, Class, protoMetadataMap, staticMetadataMap, decInfos) { + for (var protoInitializers, staticInitializers, existingProtoNonFields = new Map(), existingStaticNonFields = new Map(), i = 0; i < decInfos.length; i++) { + var decInfo = decInfos[i]; + + if (Array.isArray(decInfo)) { + var base, + metadataMap, + initializers, + kind = decInfo[1], + name = decInfo[2], + isPrivate = decInfo.length > 3, + isStatic = kind >= 5; + + if (isStatic ? (base = Class, metadataMap = staticMetadataMap, 0 !== (kind -= 5) && (initializers = staticInitializers = staticInitializers || [])) : (base = Class.prototype, metadataMap = protoMetadataMap, 0 !== kind && (initializers = protoInitializers = protoInitializers || [])), 0 !== kind && !isPrivate) { + var existingNonFields = isStatic ? existingStaticNonFields : existingProtoNonFields, + existingKind = existingNonFields.get(name) || 0; + if (!0 === existingKind || 3 === existingKind && 4 !== kind || 4 === existingKind && 3 !== kind) throw new Error("Attempted to decorate a public method/accessor that has the same name as a previously decorated public method/accessor. This is not currently supported by the decorators plugin. Property name was: " + name); + !existingKind && kind > 2 ? existingNonFields.set(name, kind) : existingNonFields.set(name, !0); + } + + applyMemberDec(ret, base, decInfo, name, kind, isStatic, isPrivate, metadataMap, initializers); + } + } + + pushInitializers(ret, protoInitializers), pushInitializers(ret, staticInitializers); +} + +function pushInitializers(ret, initializers) { + initializers && ret.push(function (instance) { + for (var i = 0; i < initializers.length; i++) { + initializers[i].call(instance); + } + + return instance; + }); +} + +function applyClassDecs(ret, targetClass, metadataMap, classDecs) { + if (classDecs.length > 0) { + for (var initializers = [], newClass = targetClass, name = targetClass.name, i = classDecs.length - 1; i >= 0; i--) { + var decoratorFinishedRef = { + v: !1 + }; + + try { + var ctx = Object.assign({ + kind: "class", + name: name, + addInitializer: createAddInitializerMethod(initializers, decoratorFinishedRef) + }, createMetadataMethodsForProperty(metadataMap, 0, name, decoratorFinishedRef)), + nextNewClass = classDecs[i](newClass, ctx); + } finally { + decoratorFinishedRef.v = !0; + } + + void 0 !== nextNewClass && (assertValidReturnValue(10, nextNewClass), newClass = nextNewClass); + } + + ret.push(newClass, function () { + for (var i = 0; i < initializers.length; i++) { + initializers[i].call(newClass); + } + }); + } +} + +export default function applyDecs(targetClass, memberDecs, classDecs) { + var ret = [], + staticMetadataMap = {}, + protoMetadataMap = {}; + return applyMemberDecs(ret, targetClass, protoMetadataMap, staticMetadataMap, memberDecs), convertMetadataMapToFinal(targetClass.prototype, protoMetadataMap), applyClassDecs(ret, targetClass, staticMetadataMap, classDecs), convertMetadataMapToFinal(targetClass, staticMetadataMap), ret; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/arrayLikeToArray.js b/node_modules/@babel/runtime/helpers/esm/arrayLikeToArray.js new file mode 100644 index 0000000..edbeb8e --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/arrayLikeToArray.js @@ -0,0 +1,9 @@ +export default function _arrayLikeToArray(arr, len) { + if (len == null || len > arr.length) len = arr.length; + + for (var i = 0, arr2 = new Array(len); i < len; i++) { + arr2[i] = arr[i]; + } + + return arr2; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/arrayWithHoles.js b/node_modules/@babel/runtime/helpers/esm/arrayWithHoles.js new file mode 100644 index 0000000..be734fc --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/arrayWithHoles.js @@ -0,0 +1,3 @@ +export default function _arrayWithHoles(arr) { + if (Array.isArray(arr)) return arr; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/arrayWithoutHoles.js b/node_modules/@babel/runtime/helpers/esm/arrayWithoutHoles.js new file mode 100644 index 0000000..f7d8dc7 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/arrayWithoutHoles.js @@ -0,0 +1,4 @@ +import arrayLikeToArray from "./arrayLikeToArray.js"; +export default function _arrayWithoutHoles(arr) { + if (Array.isArray(arr)) return arrayLikeToArray(arr); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/assertThisInitialized.js b/node_modules/@babel/runtime/helpers/esm/assertThisInitialized.js new file mode 100644 index 0000000..bbf849c --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/assertThisInitialized.js @@ -0,0 +1,7 @@ +export default function _assertThisInitialized(self) { + if (self === void 0) { + throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); + } + + return self; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/asyncGeneratorDelegate.js b/node_modules/@babel/runtime/helpers/esm/asyncGeneratorDelegate.js new file mode 100644 index 0000000..a7ccd67 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/asyncGeneratorDelegate.js @@ -0,0 +1,54 @@ +export default function _asyncGeneratorDelegate(inner, awaitWrap) { + var iter = {}, + waiting = false; + + function pump(key, value) { + waiting = true; + value = new Promise(function (resolve) { + resolve(inner[key](value)); + }); + return { + done: false, + value: awaitWrap(value) + }; + } + + ; + + iter[typeof Symbol !== "undefined" && Symbol.iterator || "@@iterator"] = function () { + return this; + }; + + iter.next = function (value) { + if (waiting) { + waiting = false; + return value; + } + + return pump("next", value); + }; + + if (typeof inner["throw"] === "function") { + iter["throw"] = function (value) { + if (waiting) { + waiting = false; + throw value; + } + + return pump("throw", value); + }; + } + + if (typeof inner["return"] === "function") { + iter["return"] = function (value) { + if (waiting) { + waiting = false; + return value; + } + + return pump("return", value); + }; + } + + return iter; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/asyncIterator.js b/node_modules/@babel/runtime/helpers/esm/asyncIterator.js new file mode 100644 index 0000000..030c44e --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/asyncIterator.js @@ -0,0 +1,48 @@ +export default function _asyncIterator(iterable) { + var method, + async, + sync, + retry = 2; + + for ("undefined" != typeof Symbol && (async = Symbol.asyncIterator, sync = Symbol.iterator); retry--;) { + if (async && null != (method = iterable[async])) return method.call(iterable); + if (sync && null != (method = iterable[sync])) return new AsyncFromSyncIterator(method.call(iterable)); + async = "@@asyncIterator", sync = "@@iterator"; + } + + throw new TypeError("Object is not async iterable"); +} + +function AsyncFromSyncIterator(s) { + function AsyncFromSyncIteratorContinuation(r) { + if (Object(r) !== r) return Promise.reject(new TypeError(r + " is not an object.")); + var done = r.done; + return Promise.resolve(r.value).then(function (value) { + return { + value: value, + done: done + }; + }); + } + + return AsyncFromSyncIterator = function AsyncFromSyncIterator(s) { + this.s = s, this.n = s.next; + }, AsyncFromSyncIterator.prototype = { + s: null, + n: null, + next: function next() { + return AsyncFromSyncIteratorContinuation(this.n.apply(this.s, arguments)); + }, + "return": function _return(value) { + var ret = this.s["return"]; + return void 0 === ret ? Promise.resolve({ + value: value, + done: !0 + }) : AsyncFromSyncIteratorContinuation(ret.apply(this.s, arguments)); + }, + "throw": function _throw(value) { + var thr = this.s["return"]; + return void 0 === thr ? Promise.reject(value) : AsyncFromSyncIteratorContinuation(thr.apply(this.s, arguments)); + } + }, new AsyncFromSyncIterator(s); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/asyncToGenerator.js b/node_modules/@babel/runtime/helpers/esm/asyncToGenerator.js new file mode 100644 index 0000000..2a25f54 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/asyncToGenerator.js @@ -0,0 +1,35 @@ +function asyncGeneratorStep(gen, resolve, reject, _next, _throw, key, arg) { + try { + var info = gen[key](arg); + var value = info.value; + } catch (error) { + reject(error); + return; + } + + if (info.done) { + resolve(value); + } else { + Promise.resolve(value).then(_next, _throw); + } +} + +export default function _asyncToGenerator(fn) { + return function () { + var self = this, + args = arguments; + return new Promise(function (resolve, reject) { + var gen = fn.apply(self, args); + + function _next(value) { + asyncGeneratorStep(gen, resolve, reject, _next, _throw, "next", value); + } + + function _throw(err) { + asyncGeneratorStep(gen, resolve, reject, _next, _throw, "throw", err); + } + + _next(undefined); + }); + }; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/awaitAsyncGenerator.js b/node_modules/@babel/runtime/helpers/esm/awaitAsyncGenerator.js new file mode 100644 index 0000000..ccca65e --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/awaitAsyncGenerator.js @@ -0,0 +1,4 @@ +import AwaitValue from "./AwaitValue.js"; +export default function _awaitAsyncGenerator(value) { + return new AwaitValue(value); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/checkPrivateRedeclaration.js b/node_modules/@babel/runtime/helpers/esm/checkPrivateRedeclaration.js new file mode 100644 index 0000000..9901403 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/checkPrivateRedeclaration.js @@ -0,0 +1,5 @@ +export default function _checkPrivateRedeclaration(obj, privateCollection) { + if (privateCollection.has(obj)) { + throw new TypeError("Cannot initialize the same private elements twice on an object"); + } +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/classApplyDescriptorDestructureSet.js b/node_modules/@babel/runtime/helpers/esm/classApplyDescriptorDestructureSet.js new file mode 100644 index 0000000..4472adc --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/classApplyDescriptorDestructureSet.js @@ -0,0 +1,20 @@ +export default function _classApplyDescriptorDestructureSet(receiver, descriptor) { + if (descriptor.set) { + if (!("__destrObj" in descriptor)) { + descriptor.__destrObj = { + set value(v) { + descriptor.set.call(receiver, v); + } + + }; + } + + return descriptor.__destrObj; + } else { + if (!descriptor.writable) { + throw new TypeError("attempted to set read only private field"); + } + + return descriptor; + } +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/classApplyDescriptorGet.js b/node_modules/@babel/runtime/helpers/esm/classApplyDescriptorGet.js new file mode 100644 index 0000000..0fad169 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/classApplyDescriptorGet.js @@ -0,0 +1,7 @@ +export default function _classApplyDescriptorGet(receiver, descriptor) { + if (descriptor.get) { + return descriptor.get.call(receiver); + } + + return descriptor.value; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/classApplyDescriptorSet.js b/node_modules/@babel/runtime/helpers/esm/classApplyDescriptorSet.js new file mode 100644 index 0000000..f295f3e --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/classApplyDescriptorSet.js @@ -0,0 +1,11 @@ +export default function _classApplyDescriptorSet(receiver, descriptor, value) { + if (descriptor.set) { + descriptor.set.call(receiver, value); + } else { + if (!descriptor.writable) { + throw new TypeError("attempted to set read only private field"); + } + + descriptor.value = value; + } +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/classCallCheck.js b/node_modules/@babel/runtime/helpers/esm/classCallCheck.js new file mode 100644 index 0000000..2f1738a --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/classCallCheck.js @@ -0,0 +1,5 @@ +export default function _classCallCheck(instance, Constructor) { + if (!(instance instanceof Constructor)) { + throw new TypeError("Cannot call a class as a function"); + } +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/classCheckPrivateStaticAccess.js b/node_modules/@babel/runtime/helpers/esm/classCheckPrivateStaticAccess.js new file mode 100644 index 0000000..098ed30 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/classCheckPrivateStaticAccess.js @@ -0,0 +1,5 @@ +export default function _classCheckPrivateStaticAccess(receiver, classConstructor) { + if (receiver !== classConstructor) { + throw new TypeError("Private static access of wrong provenance"); + } +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/classCheckPrivateStaticFieldDescriptor.js b/node_modules/@babel/runtime/helpers/esm/classCheckPrivateStaticFieldDescriptor.js new file mode 100644 index 0000000..0ef34b8 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/classCheckPrivateStaticFieldDescriptor.js @@ -0,0 +1,5 @@ +export default function _classCheckPrivateStaticFieldDescriptor(descriptor, action) { + if (descriptor === undefined) { + throw new TypeError("attempted to " + action + " private static field before its declaration"); + } +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/classExtractFieldDescriptor.js b/node_modules/@babel/runtime/helpers/esm/classExtractFieldDescriptor.js new file mode 100644 index 0000000..8dabe9a --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/classExtractFieldDescriptor.js @@ -0,0 +1,7 @@ +export default function _classExtractFieldDescriptor(receiver, privateMap, action) { + if (!privateMap.has(receiver)) { + throw new TypeError("attempted to " + action + " private field on non-instance"); + } + + return privateMap.get(receiver); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/classNameTDZError.js b/node_modules/@babel/runtime/helpers/esm/classNameTDZError.js new file mode 100644 index 0000000..f7b6dd5 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/classNameTDZError.js @@ -0,0 +1,3 @@ +export default function _classNameTDZError(name) { + throw new Error("Class \"" + name + "\" cannot be referenced in computed property keys."); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/classPrivateFieldDestructureSet.js b/node_modules/@babel/runtime/helpers/esm/classPrivateFieldDestructureSet.js new file mode 100644 index 0000000..fb58833 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/classPrivateFieldDestructureSet.js @@ -0,0 +1,6 @@ +import classApplyDescriptorDestructureSet from "./classApplyDescriptorDestructureSet.js"; +import classExtractFieldDescriptor from "./classExtractFieldDescriptor.js"; +export default function _classPrivateFieldDestructureSet(receiver, privateMap) { + var descriptor = classExtractFieldDescriptor(receiver, privateMap, "set"); + return classApplyDescriptorDestructureSet(receiver, descriptor); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/classPrivateFieldGet.js b/node_modules/@babel/runtime/helpers/esm/classPrivateFieldGet.js new file mode 100644 index 0000000..53cd137 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/classPrivateFieldGet.js @@ -0,0 +1,6 @@ +import classApplyDescriptorGet from "./classApplyDescriptorGet.js"; +import classExtractFieldDescriptor from "./classExtractFieldDescriptor.js"; +export default function _classPrivateFieldGet(receiver, privateMap) { + var descriptor = classExtractFieldDescriptor(receiver, privateMap, "get"); + return classApplyDescriptorGet(receiver, descriptor); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/classPrivateFieldInitSpec.js b/node_modules/@babel/runtime/helpers/esm/classPrivateFieldInitSpec.js new file mode 100644 index 0000000..2253dd8 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/classPrivateFieldInitSpec.js @@ -0,0 +1,5 @@ +import checkPrivateRedeclaration from "./checkPrivateRedeclaration.js"; +export default function _classPrivateFieldInitSpec(obj, privateMap, value) { + checkPrivateRedeclaration(obj, privateMap); + privateMap.set(obj, value); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/classPrivateFieldLooseBase.js b/node_modules/@babel/runtime/helpers/esm/classPrivateFieldLooseBase.js new file mode 100644 index 0000000..5b10916 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/classPrivateFieldLooseBase.js @@ -0,0 +1,7 @@ +export default function _classPrivateFieldBase(receiver, privateKey) { + if (!Object.prototype.hasOwnProperty.call(receiver, privateKey)) { + throw new TypeError("attempted to use private field on non-instance"); + } + + return receiver; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/classPrivateFieldLooseKey.js b/node_modules/@babel/runtime/helpers/esm/classPrivateFieldLooseKey.js new file mode 100644 index 0000000..5b7e5ac --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/classPrivateFieldLooseKey.js @@ -0,0 +1,4 @@ +var id = 0; +export default function _classPrivateFieldKey(name) { + return "__private_" + id++ + "_" + name; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/classPrivateFieldSet.js b/node_modules/@babel/runtime/helpers/esm/classPrivateFieldSet.js new file mode 100644 index 0000000..ad91be4 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/classPrivateFieldSet.js @@ -0,0 +1,7 @@ +import classApplyDescriptorSet from "./classApplyDescriptorSet.js"; +import classExtractFieldDescriptor from "./classExtractFieldDescriptor.js"; +export default function _classPrivateFieldSet(receiver, privateMap, value) { + var descriptor = classExtractFieldDescriptor(receiver, privateMap, "set"); + classApplyDescriptorSet(receiver, descriptor, value); + return value; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/classPrivateMethodGet.js b/node_modules/@babel/runtime/helpers/esm/classPrivateMethodGet.js new file mode 100644 index 0000000..38b9d58 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/classPrivateMethodGet.js @@ -0,0 +1,7 @@ +export default function _classPrivateMethodGet(receiver, privateSet, fn) { + if (!privateSet.has(receiver)) { + throw new TypeError("attempted to get private field on non-instance"); + } + + return fn; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/classPrivateMethodInitSpec.js b/node_modules/@babel/runtime/helpers/esm/classPrivateMethodInitSpec.js new file mode 100644 index 0000000..18d1291 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/classPrivateMethodInitSpec.js @@ -0,0 +1,5 @@ +import checkPrivateRedeclaration from "./checkPrivateRedeclaration.js"; +export default function _classPrivateMethodInitSpec(obj, privateSet) { + checkPrivateRedeclaration(obj, privateSet); + privateSet.add(obj); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/classPrivateMethodSet.js b/node_modules/@babel/runtime/helpers/esm/classPrivateMethodSet.js new file mode 100644 index 0000000..2bbaf3a --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/classPrivateMethodSet.js @@ -0,0 +1,3 @@ +export default function _classPrivateMethodSet() { + throw new TypeError("attempted to reassign private method"); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/classStaticPrivateFieldDestructureSet.js b/node_modules/@babel/runtime/helpers/esm/classStaticPrivateFieldDestructureSet.js new file mode 100644 index 0000000..77afcfb --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/classStaticPrivateFieldDestructureSet.js @@ -0,0 +1,8 @@ +import classApplyDescriptorDestructureSet from "./classApplyDescriptorDestructureSet.js"; +import classCheckPrivateStaticAccess from "./classCheckPrivateStaticAccess.js"; +import classCheckPrivateStaticFieldDescriptor from "./classCheckPrivateStaticFieldDescriptor.js"; +export default function _classStaticPrivateFieldDestructureSet(receiver, classConstructor, descriptor) { + classCheckPrivateStaticAccess(receiver, classConstructor); + classCheckPrivateStaticFieldDescriptor(descriptor, "set"); + return classApplyDescriptorDestructureSet(receiver, descriptor); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/classStaticPrivateFieldSpecGet.js b/node_modules/@babel/runtime/helpers/esm/classStaticPrivateFieldSpecGet.js new file mode 100644 index 0000000..d253d31 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/classStaticPrivateFieldSpecGet.js @@ -0,0 +1,8 @@ +import classApplyDescriptorGet from "./classApplyDescriptorGet.js"; +import classCheckPrivateStaticAccess from "./classCheckPrivateStaticAccess.js"; +import classCheckPrivateStaticFieldDescriptor from "./classCheckPrivateStaticFieldDescriptor.js"; +export default function _classStaticPrivateFieldSpecGet(receiver, classConstructor, descriptor) { + classCheckPrivateStaticAccess(receiver, classConstructor); + classCheckPrivateStaticFieldDescriptor(descriptor, "get"); + return classApplyDescriptorGet(receiver, descriptor); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/classStaticPrivateFieldSpecSet.js b/node_modules/@babel/runtime/helpers/esm/classStaticPrivateFieldSpecSet.js new file mode 100644 index 0000000..b0b0cc6 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/classStaticPrivateFieldSpecSet.js @@ -0,0 +1,9 @@ +import classApplyDescriptorSet from "./classApplyDescriptorSet.js"; +import classCheckPrivateStaticAccess from "./classCheckPrivateStaticAccess.js"; +import classCheckPrivateStaticFieldDescriptor from "./classCheckPrivateStaticFieldDescriptor.js"; +export default function _classStaticPrivateFieldSpecSet(receiver, classConstructor, descriptor, value) { + classCheckPrivateStaticAccess(receiver, classConstructor); + classCheckPrivateStaticFieldDescriptor(descriptor, "set"); + classApplyDescriptorSet(receiver, descriptor, value); + return value; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/classStaticPrivateMethodGet.js b/node_modules/@babel/runtime/helpers/esm/classStaticPrivateMethodGet.js new file mode 100644 index 0000000..fddc7b2 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/classStaticPrivateMethodGet.js @@ -0,0 +1,5 @@ +import classCheckPrivateStaticAccess from "./classCheckPrivateStaticAccess.js"; +export default function _classStaticPrivateMethodGet(receiver, classConstructor, method) { + classCheckPrivateStaticAccess(receiver, classConstructor); + return method; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/classStaticPrivateMethodSet.js b/node_modules/@babel/runtime/helpers/esm/classStaticPrivateMethodSet.js new file mode 100644 index 0000000..d5ab60a --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/classStaticPrivateMethodSet.js @@ -0,0 +1,3 @@ +export default function _classStaticPrivateMethodSet() { + throw new TypeError("attempted to set read only static private field"); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/construct.js b/node_modules/@babel/runtime/helpers/esm/construct.js new file mode 100644 index 0000000..0c39835 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/construct.js @@ -0,0 +1,18 @@ +import setPrototypeOf from "./setPrototypeOf.js"; +import isNativeReflectConstruct from "./isNativeReflectConstruct.js"; +export default function _construct(Parent, args, Class) { + if (isNativeReflectConstruct()) { + _construct = Reflect.construct; + } else { + _construct = function _construct(Parent, args, Class) { + var a = [null]; + a.push.apply(a, args); + var Constructor = Function.bind.apply(Parent, a); + var instance = new Constructor(); + if (Class) setPrototypeOf(instance, Class.prototype); + return instance; + }; + } + + return _construct.apply(null, arguments); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/createClass.js b/node_modules/@babel/runtime/helpers/esm/createClass.js new file mode 100644 index 0000000..b320731 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/createClass.js @@ -0,0 +1,18 @@ +function _defineProperties(target, props) { + for (var i = 0; i < props.length; i++) { + var descriptor = props[i]; + descriptor.enumerable = descriptor.enumerable || false; + descriptor.configurable = true; + if ("value" in descriptor) descriptor.writable = true; + Object.defineProperty(target, descriptor.key, descriptor); + } +} + +export default function _createClass(Constructor, protoProps, staticProps) { + if (protoProps) _defineProperties(Constructor.prototype, protoProps); + if (staticProps) _defineProperties(Constructor, staticProps); + Object.defineProperty(Constructor, "prototype", { + writable: false + }); + return Constructor; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/createForOfIteratorHelper.js b/node_modules/@babel/runtime/helpers/esm/createForOfIteratorHelper.js new file mode 100644 index 0000000..a7a2a50 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/createForOfIteratorHelper.js @@ -0,0 +1,57 @@ +import unsupportedIterableToArray from "./unsupportedIterableToArray.js"; +export default function _createForOfIteratorHelper(o, allowArrayLike) { + var it = typeof Symbol !== "undefined" && o[Symbol.iterator] || o["@@iterator"]; + + if (!it) { + if (Array.isArray(o) || (it = unsupportedIterableToArray(o)) || allowArrayLike && o && typeof o.length === "number") { + if (it) o = it; + var i = 0; + + var F = function F() {}; + + return { + s: F, + n: function n() { + if (i >= o.length) return { + done: true + }; + return { + done: false, + value: o[i++] + }; + }, + e: function e(_e) { + throw _e; + }, + f: F + }; + } + + throw new TypeError("Invalid attempt to iterate non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method."); + } + + var normalCompletion = true, + didErr = false, + err; + return { + s: function s() { + it = it.call(o); + }, + n: function n() { + var step = it.next(); + normalCompletion = step.done; + return step; + }, + e: function e(_e2) { + didErr = true; + err = _e2; + }, + f: function f() { + try { + if (!normalCompletion && it["return"] != null) it["return"](); + } finally { + if (didErr) throw err; + } + } + }; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/createForOfIteratorHelperLoose.js b/node_modules/@babel/runtime/helpers/esm/createForOfIteratorHelperLoose.js new file mode 100644 index 0000000..640ec68 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/createForOfIteratorHelperLoose.js @@ -0,0 +1,21 @@ +import unsupportedIterableToArray from "./unsupportedIterableToArray.js"; +export default function _createForOfIteratorHelperLoose(o, allowArrayLike) { + var it = typeof Symbol !== "undefined" && o[Symbol.iterator] || o["@@iterator"]; + if (it) return (it = it.call(o)).next.bind(it); + + if (Array.isArray(o) || (it = unsupportedIterableToArray(o)) || allowArrayLike && o && typeof o.length === "number") { + if (it) o = it; + var i = 0; + return function () { + if (i >= o.length) return { + done: true + }; + return { + done: false, + value: o[i++] + }; + }; + } + + throw new TypeError("Invalid attempt to iterate non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method."); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/createSuper.js b/node_modules/@babel/runtime/helpers/esm/createSuper.js new file mode 100644 index 0000000..ea5ea99 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/createSuper.js @@ -0,0 +1,19 @@ +import getPrototypeOf from "./getPrototypeOf.js"; +import isNativeReflectConstruct from "./isNativeReflectConstruct.js"; +import possibleConstructorReturn from "./possibleConstructorReturn.js"; +export default function _createSuper(Derived) { + var hasNativeReflectConstruct = isNativeReflectConstruct(); + return function _createSuperInternal() { + var Super = getPrototypeOf(Derived), + result; + + if (hasNativeReflectConstruct) { + var NewTarget = getPrototypeOf(this).constructor; + result = Reflect.construct(Super, arguments, NewTarget); + } else { + result = Super.apply(this, arguments); + } + + return possibleConstructorReturn(this, result); + }; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/decorate.js b/node_modules/@babel/runtime/helpers/esm/decorate.js new file mode 100644 index 0000000..daf56da --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/decorate.js @@ -0,0 +1,396 @@ +import toArray from "./toArray.js"; +import toPropertyKey from "./toPropertyKey.js"; +export default function _decorate(decorators, factory, superClass, mixins) { + var api = _getDecoratorsApi(); + + if (mixins) { + for (var i = 0; i < mixins.length; i++) { + api = mixins[i](api); + } + } + + var r = factory(function initialize(O) { + api.initializeInstanceElements(O, decorated.elements); + }, superClass); + var decorated = api.decorateClass(_coalesceClassElements(r.d.map(_createElementDescriptor)), decorators); + api.initializeClassElements(r.F, decorated.elements); + return api.runClassFinishers(r.F, decorated.finishers); +} + +function _getDecoratorsApi() { + _getDecoratorsApi = function _getDecoratorsApi() { + return api; + }; + + var api = { + elementsDefinitionOrder: [["method"], ["field"]], + initializeInstanceElements: function initializeInstanceElements(O, elements) { + ["method", "field"].forEach(function (kind) { + elements.forEach(function (element) { + if (element.kind === kind && element.placement === "own") { + this.defineClassElement(O, element); + } + }, this); + }, this); + }, + initializeClassElements: function initializeClassElements(F, elements) { + var proto = F.prototype; + ["method", "field"].forEach(function (kind) { + elements.forEach(function (element) { + var placement = element.placement; + + if (element.kind === kind && (placement === "static" || placement === "prototype")) { + var receiver = placement === "static" ? F : proto; + this.defineClassElement(receiver, element); + } + }, this); + }, this); + }, + defineClassElement: function defineClassElement(receiver, element) { + var descriptor = element.descriptor; + + if (element.kind === "field") { + var initializer = element.initializer; + descriptor = { + enumerable: descriptor.enumerable, + writable: descriptor.writable, + configurable: descriptor.configurable, + value: initializer === void 0 ? void 0 : initializer.call(receiver) + }; + } + + Object.defineProperty(receiver, element.key, descriptor); + }, + decorateClass: function decorateClass(elements, decorators) { + var newElements = []; + var finishers = []; + var placements = { + "static": [], + prototype: [], + own: [] + }; + elements.forEach(function (element) { + this.addElementPlacement(element, placements); + }, this); + elements.forEach(function (element) { + if (!_hasDecorators(element)) return newElements.push(element); + var elementFinishersExtras = this.decorateElement(element, placements); + newElements.push(elementFinishersExtras.element); + newElements.push.apply(newElements, elementFinishersExtras.extras); + finishers.push.apply(finishers, elementFinishersExtras.finishers); + }, this); + + if (!decorators) { + return { + elements: newElements, + finishers: finishers + }; + } + + var result = this.decorateConstructor(newElements, decorators); + finishers.push.apply(finishers, result.finishers); + result.finishers = finishers; + return result; + }, + addElementPlacement: function addElementPlacement(element, placements, silent) { + var keys = placements[element.placement]; + + if (!silent && keys.indexOf(element.key) !== -1) { + throw new TypeError("Duplicated element (" + element.key + ")"); + } + + keys.push(element.key); + }, + decorateElement: function decorateElement(element, placements) { + var extras = []; + var finishers = []; + + for (var decorators = element.decorators, i = decorators.length - 1; i >= 0; i--) { + var keys = placements[element.placement]; + keys.splice(keys.indexOf(element.key), 1); + var elementObject = this.fromElementDescriptor(element); + var elementFinisherExtras = this.toElementFinisherExtras((0, decorators[i])(elementObject) || elementObject); + element = elementFinisherExtras.element; + this.addElementPlacement(element, placements); + + if (elementFinisherExtras.finisher) { + finishers.push(elementFinisherExtras.finisher); + } + + var newExtras = elementFinisherExtras.extras; + + if (newExtras) { + for (var j = 0; j < newExtras.length; j++) { + this.addElementPlacement(newExtras[j], placements); + } + + extras.push.apply(extras, newExtras); + } + } + + return { + element: element, + finishers: finishers, + extras: extras + }; + }, + decorateConstructor: function decorateConstructor(elements, decorators) { + var finishers = []; + + for (var i = decorators.length - 1; i >= 0; i--) { + var obj = this.fromClassDescriptor(elements); + var elementsAndFinisher = this.toClassDescriptor((0, decorators[i])(obj) || obj); + + if (elementsAndFinisher.finisher !== undefined) { + finishers.push(elementsAndFinisher.finisher); + } + + if (elementsAndFinisher.elements !== undefined) { + elements = elementsAndFinisher.elements; + + for (var j = 0; j < elements.length - 1; j++) { + for (var k = j + 1; k < elements.length; k++) { + if (elements[j].key === elements[k].key && elements[j].placement === elements[k].placement) { + throw new TypeError("Duplicated element (" + elements[j].key + ")"); + } + } + } + } + } + + return { + elements: elements, + finishers: finishers + }; + }, + fromElementDescriptor: function fromElementDescriptor(element) { + var obj = { + kind: element.kind, + key: element.key, + placement: element.placement, + descriptor: element.descriptor + }; + var desc = { + value: "Descriptor", + configurable: true + }; + Object.defineProperty(obj, Symbol.toStringTag, desc); + if (element.kind === "field") obj.initializer = element.initializer; + return obj; + }, + toElementDescriptors: function toElementDescriptors(elementObjects) { + if (elementObjects === undefined) return; + return toArray(elementObjects).map(function (elementObject) { + var element = this.toElementDescriptor(elementObject); + this.disallowProperty(elementObject, "finisher", "An element descriptor"); + this.disallowProperty(elementObject, "extras", "An element descriptor"); + return element; + }, this); + }, + toElementDescriptor: function toElementDescriptor(elementObject) { + var kind = String(elementObject.kind); + + if (kind !== "method" && kind !== "field") { + throw new TypeError('An element descriptor\'s .kind property must be either "method" or' + ' "field", but a decorator created an element descriptor with' + ' .kind "' + kind + '"'); + } + + var key = toPropertyKey(elementObject.key); + var placement = String(elementObject.placement); + + if (placement !== "static" && placement !== "prototype" && placement !== "own") { + throw new TypeError('An element descriptor\'s .placement property must be one of "static",' + ' "prototype" or "own", but a decorator created an element descriptor' + ' with .placement "' + placement + '"'); + } + + var descriptor = elementObject.descriptor; + this.disallowProperty(elementObject, "elements", "An element descriptor"); + var element = { + kind: kind, + key: key, + placement: placement, + descriptor: Object.assign({}, descriptor) + }; + + if (kind !== "field") { + this.disallowProperty(elementObject, "initializer", "A method descriptor"); + } else { + this.disallowProperty(descriptor, "get", "The property descriptor of a field descriptor"); + this.disallowProperty(descriptor, "set", "The property descriptor of a field descriptor"); + this.disallowProperty(descriptor, "value", "The property descriptor of a field descriptor"); + element.initializer = elementObject.initializer; + } + + return element; + }, + toElementFinisherExtras: function toElementFinisherExtras(elementObject) { + var element = this.toElementDescriptor(elementObject); + + var finisher = _optionalCallableProperty(elementObject, "finisher"); + + var extras = this.toElementDescriptors(elementObject.extras); + return { + element: element, + finisher: finisher, + extras: extras + }; + }, + fromClassDescriptor: function fromClassDescriptor(elements) { + var obj = { + kind: "class", + elements: elements.map(this.fromElementDescriptor, this) + }; + var desc = { + value: "Descriptor", + configurable: true + }; + Object.defineProperty(obj, Symbol.toStringTag, desc); + return obj; + }, + toClassDescriptor: function toClassDescriptor(obj) { + var kind = String(obj.kind); + + if (kind !== "class") { + throw new TypeError('A class descriptor\'s .kind property must be "class", but a decorator' + ' created a class descriptor with .kind "' + kind + '"'); + } + + this.disallowProperty(obj, "key", "A class descriptor"); + this.disallowProperty(obj, "placement", "A class descriptor"); + this.disallowProperty(obj, "descriptor", "A class descriptor"); + this.disallowProperty(obj, "initializer", "A class descriptor"); + this.disallowProperty(obj, "extras", "A class descriptor"); + + var finisher = _optionalCallableProperty(obj, "finisher"); + + var elements = this.toElementDescriptors(obj.elements); + return { + elements: elements, + finisher: finisher + }; + }, + runClassFinishers: function runClassFinishers(constructor, finishers) { + for (var i = 0; i < finishers.length; i++) { + var newConstructor = (0, finishers[i])(constructor); + + if (newConstructor !== undefined) { + if (typeof newConstructor !== "function") { + throw new TypeError("Finishers must return a constructor."); + } + + constructor = newConstructor; + } + } + + return constructor; + }, + disallowProperty: function disallowProperty(obj, name, objectType) { + if (obj[name] !== undefined) { + throw new TypeError(objectType + " can't have a ." + name + " property."); + } + } + }; + return api; +} + +function _createElementDescriptor(def) { + var key = toPropertyKey(def.key); + var descriptor; + + if (def.kind === "method") { + descriptor = { + value: def.value, + writable: true, + configurable: true, + enumerable: false + }; + } else if (def.kind === "get") { + descriptor = { + get: def.value, + configurable: true, + enumerable: false + }; + } else if (def.kind === "set") { + descriptor = { + set: def.value, + configurable: true, + enumerable: false + }; + } else if (def.kind === "field") { + descriptor = { + configurable: true, + writable: true, + enumerable: true + }; + } + + var element = { + kind: def.kind === "field" ? "field" : "method", + key: key, + placement: def["static"] ? "static" : def.kind === "field" ? "own" : "prototype", + descriptor: descriptor + }; + if (def.decorators) element.decorators = def.decorators; + if (def.kind === "field") element.initializer = def.value; + return element; +} + +function _coalesceGetterSetter(element, other) { + if (element.descriptor.get !== undefined) { + other.descriptor.get = element.descriptor.get; + } else { + other.descriptor.set = element.descriptor.set; + } +} + +function _coalesceClassElements(elements) { + var newElements = []; + + var isSameElement = function isSameElement(other) { + return other.kind === "method" && other.key === element.key && other.placement === element.placement; + }; + + for (var i = 0; i < elements.length; i++) { + var element = elements[i]; + var other; + + if (element.kind === "method" && (other = newElements.find(isSameElement))) { + if (_isDataDescriptor(element.descriptor) || _isDataDescriptor(other.descriptor)) { + if (_hasDecorators(element) || _hasDecorators(other)) { + throw new ReferenceError("Duplicated methods (" + element.key + ") can't be decorated."); + } + + other.descriptor = element.descriptor; + } else { + if (_hasDecorators(element)) { + if (_hasDecorators(other)) { + throw new ReferenceError("Decorators can't be placed on different accessors with for " + "the same property (" + element.key + ")."); + } + + other.decorators = element.decorators; + } + + _coalesceGetterSetter(element, other); + } + } else { + newElements.push(element); + } + } + + return newElements; +} + +function _hasDecorators(element) { + return element.decorators && element.decorators.length; +} + +function _isDataDescriptor(desc) { + return desc !== undefined && !(desc.value === undefined && desc.writable === undefined); +} + +function _optionalCallableProperty(obj, name) { + var value = obj[name]; + + if (value !== undefined && typeof value !== "function") { + throw new TypeError("Expected '" + name + "' to be a function"); + } + + return value; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/defaults.js b/node_modules/@babel/runtime/helpers/esm/defaults.js new file mode 100644 index 0000000..3de1d8e --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/defaults.js @@ -0,0 +1,14 @@ +export default function _defaults(obj, defaults) { + var keys = Object.getOwnPropertyNames(defaults); + + for (var i = 0; i < keys.length; i++) { + var key = keys[i]; + var value = Object.getOwnPropertyDescriptor(defaults, key); + + if (value && value.configurable && obj[key] === undefined) { + Object.defineProperty(obj, key, value); + } + } + + return obj; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/defineEnumerableProperties.js b/node_modules/@babel/runtime/helpers/esm/defineEnumerableProperties.js new file mode 100644 index 0000000..7981acd --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/defineEnumerableProperties.js @@ -0,0 +1,22 @@ +export default function _defineEnumerableProperties(obj, descs) { + for (var key in descs) { + var desc = descs[key]; + desc.configurable = desc.enumerable = true; + if ("value" in desc) desc.writable = true; + Object.defineProperty(obj, key, desc); + } + + if (Object.getOwnPropertySymbols) { + var objectSymbols = Object.getOwnPropertySymbols(descs); + + for (var i = 0; i < objectSymbols.length; i++) { + var sym = objectSymbols[i]; + var desc = descs[sym]; + desc.configurable = desc.enumerable = true; + if ("value" in desc) desc.writable = true; + Object.defineProperty(obj, sym, desc); + } + } + + return obj; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/defineProperty.js b/node_modules/@babel/runtime/helpers/esm/defineProperty.js new file mode 100644 index 0000000..7cf6e59 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/defineProperty.js @@ -0,0 +1,14 @@ +export default function _defineProperty(obj, key, value) { + if (key in obj) { + Object.defineProperty(obj, key, { + value: value, + enumerable: true, + configurable: true, + writable: true + }); + } else { + obj[key] = value; + } + + return obj; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/extends.js b/node_modules/@babel/runtime/helpers/esm/extends.js new file mode 100644 index 0000000..b9b138d --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/extends.js @@ -0,0 +1,17 @@ +export default function _extends() { + _extends = Object.assign || function (target) { + for (var i = 1; i < arguments.length; i++) { + var source = arguments[i]; + + for (var key in source) { + if (Object.prototype.hasOwnProperty.call(source, key)) { + target[key] = source[key]; + } + } + } + + return target; + }; + + return _extends.apply(this, arguments); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/get.js b/node_modules/@babel/runtime/helpers/esm/get.js new file mode 100644 index 0000000..92038bd --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/get.js @@ -0,0 +1,20 @@ +import superPropBase from "./superPropBase.js"; +export default function _get() { + if (typeof Reflect !== "undefined" && Reflect.get) { + _get = Reflect.get; + } else { + _get = function _get(target, property, receiver) { + var base = superPropBase(target, property); + if (!base) return; + var desc = Object.getOwnPropertyDescriptor(base, property); + + if (desc.get) { + return desc.get.call(arguments.length < 3 ? target : receiver); + } + + return desc.value; + }; + } + + return _get.apply(this, arguments); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/getPrototypeOf.js b/node_modules/@babel/runtime/helpers/esm/getPrototypeOf.js new file mode 100644 index 0000000..5abafe3 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/getPrototypeOf.js @@ -0,0 +1,6 @@ +export default function _getPrototypeOf(o) { + _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { + return o.__proto__ || Object.getPrototypeOf(o); + }; + return _getPrototypeOf(o); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/identity.js b/node_modules/@babel/runtime/helpers/esm/identity.js new file mode 100644 index 0000000..a1e7e4c --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/identity.js @@ -0,0 +1,3 @@ +export default function _identity(x) { + return x; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/inherits.js b/node_modules/@babel/runtime/helpers/esm/inherits.js new file mode 100644 index 0000000..e099909 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/inherits.js @@ -0,0 +1,18 @@ +import setPrototypeOf from "./setPrototypeOf.js"; +export default function _inherits(subClass, superClass) { + if (typeof superClass !== "function" && superClass !== null) { + throw new TypeError("Super expression must either be null or a function"); + } + + subClass.prototype = Object.create(superClass && superClass.prototype, { + constructor: { + value: subClass, + writable: true, + configurable: true + } + }); + Object.defineProperty(subClass, "prototype", { + writable: false + }); + if (superClass) setPrototypeOf(subClass, superClass); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/inheritsLoose.js b/node_modules/@babel/runtime/helpers/esm/inheritsLoose.js new file mode 100644 index 0000000..90bb796 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/inheritsLoose.js @@ -0,0 +1,6 @@ +import setPrototypeOf from "./setPrototypeOf.js"; +export default function _inheritsLoose(subClass, superClass) { + subClass.prototype = Object.create(superClass.prototype); + subClass.prototype.constructor = subClass; + setPrototypeOf(subClass, superClass); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/initializerDefineProperty.js b/node_modules/@babel/runtime/helpers/esm/initializerDefineProperty.js new file mode 100644 index 0000000..26fdea0 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/initializerDefineProperty.js @@ -0,0 +1,9 @@ +export default function _initializerDefineProperty(target, property, descriptor, context) { + if (!descriptor) return; + Object.defineProperty(target, property, { + enumerable: descriptor.enumerable, + configurable: descriptor.configurable, + writable: descriptor.writable, + value: descriptor.initializer ? descriptor.initializer.call(context) : void 0 + }); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/initializerWarningHelper.js b/node_modules/@babel/runtime/helpers/esm/initializerWarningHelper.js new file mode 100644 index 0000000..30d518c --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/initializerWarningHelper.js @@ -0,0 +1,3 @@ +export default function _initializerWarningHelper(descriptor, context) { + throw new Error('Decorating class property failed. Please ensure that ' + 'proposal-class-properties is enabled and runs after the decorators transform.'); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/instanceof.js b/node_modules/@babel/runtime/helpers/esm/instanceof.js new file mode 100644 index 0000000..8c43b71 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/instanceof.js @@ -0,0 +1,7 @@ +export default function _instanceof(left, right) { + if (right != null && typeof Symbol !== "undefined" && right[Symbol.hasInstance]) { + return !!right[Symbol.hasInstance](left); + } else { + return left instanceof right; + } +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/interopRequireDefault.js b/node_modules/@babel/runtime/helpers/esm/interopRequireDefault.js new file mode 100644 index 0000000..c2df7b6 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/interopRequireDefault.js @@ -0,0 +1,5 @@ +export default function _interopRequireDefault(obj) { + return obj && obj.__esModule ? obj : { + "default": obj + }; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/interopRequireWildcard.js b/node_modules/@babel/runtime/helpers/esm/interopRequireWildcard.js new file mode 100644 index 0000000..01ee6b3 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/interopRequireWildcard.js @@ -0,0 +1,51 @@ +import _typeof from "./typeof.js"; + +function _getRequireWildcardCache(nodeInterop) { + if (typeof WeakMap !== "function") return null; + var cacheBabelInterop = new WeakMap(); + var cacheNodeInterop = new WeakMap(); + return (_getRequireWildcardCache = function _getRequireWildcardCache(nodeInterop) { + return nodeInterop ? cacheNodeInterop : cacheBabelInterop; + })(nodeInterop); +} + +export default function _interopRequireWildcard(obj, nodeInterop) { + if (!nodeInterop && obj && obj.__esModule) { + return obj; + } + + if (obj === null || _typeof(obj) !== "object" && typeof obj !== "function") { + return { + "default": obj + }; + } + + var cache = _getRequireWildcardCache(nodeInterop); + + if (cache && cache.has(obj)) { + return cache.get(obj); + } + + var newObj = {}; + var hasPropertyDescriptor = Object.defineProperty && Object.getOwnPropertyDescriptor; + + for (var key in obj) { + if (key !== "default" && Object.prototype.hasOwnProperty.call(obj, key)) { + var desc = hasPropertyDescriptor ? Object.getOwnPropertyDescriptor(obj, key) : null; + + if (desc && (desc.get || desc.set)) { + Object.defineProperty(newObj, key, desc); + } else { + newObj[key] = obj[key]; + } + } + } + + newObj["default"] = obj; + + if (cache) { + cache.set(obj, newObj); + } + + return newObj; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/isNativeFunction.js b/node_modules/@babel/runtime/helpers/esm/isNativeFunction.js new file mode 100644 index 0000000..7b1bc82 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/isNativeFunction.js @@ -0,0 +1,3 @@ +export default function _isNativeFunction(fn) { + return Function.toString.call(fn).indexOf("[native code]") !== -1; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/isNativeReflectConstruct.js b/node_modules/@babel/runtime/helpers/esm/isNativeReflectConstruct.js new file mode 100644 index 0000000..0da1624 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/isNativeReflectConstruct.js @@ -0,0 +1,12 @@ +export default function _isNativeReflectConstruct() { + if (typeof Reflect === "undefined" || !Reflect.construct) return false; + if (Reflect.construct.sham) return false; + if (typeof Proxy === "function") return true; + + try { + Boolean.prototype.valueOf.call(Reflect.construct(Boolean, [], function () {})); + return true; + } catch (e) { + return false; + } +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/iterableToArray.js b/node_modules/@babel/runtime/helpers/esm/iterableToArray.js new file mode 100644 index 0000000..cfe9fbd --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/iterableToArray.js @@ -0,0 +1,3 @@ +export default function _iterableToArray(iter) { + if (typeof Symbol !== "undefined" && iter[Symbol.iterator] != null || iter["@@iterator"] != null) return Array.from(iter); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/iterableToArrayLimit.js b/node_modules/@babel/runtime/helpers/esm/iterableToArrayLimit.js new file mode 100644 index 0000000..c72ca94 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/iterableToArrayLimit.js @@ -0,0 +1,29 @@ +export default function _iterableToArrayLimit(arr, i) { + var _i = arr == null ? null : typeof Symbol !== "undefined" && arr[Symbol.iterator] || arr["@@iterator"]; + + if (_i == null) return; + var _arr = []; + var _n = true; + var _d = false; + + var _s, _e; + + try { + for (_i = _i.call(arr); !(_n = (_s = _i.next()).done); _n = true) { + _arr.push(_s.value); + + if (i && _arr.length === i) break; + } + } catch (err) { + _d = true; + _e = err; + } finally { + try { + if (!_n && _i["return"] != null) _i["return"](); + } finally { + if (_d) throw _e; + } + } + + return _arr; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/iterableToArrayLimitLoose.js b/node_modules/@babel/runtime/helpers/esm/iterableToArrayLimitLoose.js new file mode 100644 index 0000000..27c15e0 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/iterableToArrayLimitLoose.js @@ -0,0 +1,14 @@ +export default function _iterableToArrayLimitLoose(arr, i) { + var _i = arr && (typeof Symbol !== "undefined" && arr[Symbol.iterator] || arr["@@iterator"]); + + if (_i == null) return; + var _arr = []; + + for (_i = _i.call(arr), _step; !(_step = _i.next()).done;) { + _arr.push(_step.value); + + if (i && _arr.length === i) break; + } + + return _arr; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/jsx.js b/node_modules/@babel/runtime/helpers/esm/jsx.js new file mode 100644 index 0000000..9a6a94c --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/jsx.js @@ -0,0 +1,26 @@ +var REACT_ELEMENT_TYPE; +export default function _createRawReactElement(type, props, key, children) { + REACT_ELEMENT_TYPE || (REACT_ELEMENT_TYPE = "function" == typeof Symbol && Symbol["for"] && Symbol["for"]("react.element") || 60103); + var defaultProps = type && type.defaultProps, + childrenLength = arguments.length - 3; + if (props || 0 === childrenLength || (props = { + children: void 0 + }), 1 === childrenLength) props.children = children;else if (childrenLength > 1) { + for (var childArray = new Array(childrenLength), i = 0; i < childrenLength; i++) { + childArray[i] = arguments[i + 3]; + } + + props.children = childArray; + } + if (props && defaultProps) for (var propName in defaultProps) { + void 0 === props[propName] && (props[propName] = defaultProps[propName]); + } else props || (props = defaultProps || {}); + return { + $$typeof: REACT_ELEMENT_TYPE, + type: type, + key: void 0 === key ? null : "" + key, + ref: null, + props: props, + _owner: null + }; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/maybeArrayLike.js b/node_modules/@babel/runtime/helpers/esm/maybeArrayLike.js new file mode 100644 index 0000000..f687959 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/maybeArrayLike.js @@ -0,0 +1,9 @@ +import arrayLikeToArray from "./arrayLikeToArray.js"; +export default function _maybeArrayLike(next, arr, i) { + if (arr && !Array.isArray(arr) && typeof arr.length === "number") { + var len = arr.length; + return arrayLikeToArray(arr, i !== void 0 && i < len ? i : len); + } + + return next(arr, i); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/newArrowCheck.js b/node_modules/@babel/runtime/helpers/esm/newArrowCheck.js new file mode 100644 index 0000000..d6cd864 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/newArrowCheck.js @@ -0,0 +1,5 @@ +export default function _newArrowCheck(innerThis, boundThis) { + if (innerThis !== boundThis) { + throw new TypeError("Cannot instantiate an arrow function"); + } +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/nonIterableRest.js b/node_modules/@babel/runtime/helpers/esm/nonIterableRest.js new file mode 100644 index 0000000..b349d00 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/nonIterableRest.js @@ -0,0 +1,3 @@ +export default function _nonIterableRest() { + throw new TypeError("Invalid attempt to destructure non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method."); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/nonIterableSpread.js b/node_modules/@babel/runtime/helpers/esm/nonIterableSpread.js new file mode 100644 index 0000000..82d8296 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/nonIterableSpread.js @@ -0,0 +1,3 @@ +export default function _nonIterableSpread() { + throw new TypeError("Invalid attempt to spread non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method."); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/objectDestructuringEmpty.js b/node_modules/@babel/runtime/helpers/esm/objectDestructuringEmpty.js new file mode 100644 index 0000000..82b67d2 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/objectDestructuringEmpty.js @@ -0,0 +1,3 @@ +export default function _objectDestructuringEmpty(obj) { + if (obj == null) throw new TypeError("Cannot destructure undefined"); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/objectSpread.js b/node_modules/@babel/runtime/helpers/esm/objectSpread.js new file mode 100644 index 0000000..889a5f0 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/objectSpread.js @@ -0,0 +1,19 @@ +import defineProperty from "./defineProperty.js"; +export default function _objectSpread(target) { + for (var i = 1; i < arguments.length; i++) { + var source = arguments[i] != null ? Object(arguments[i]) : {}; + var ownKeys = Object.keys(source); + + if (typeof Object.getOwnPropertySymbols === 'function') { + ownKeys.push.apply(ownKeys, Object.getOwnPropertySymbols(source).filter(function (sym) { + return Object.getOwnPropertyDescriptor(source, sym).enumerable; + })); + } + + ownKeys.forEach(function (key) { + defineProperty(target, key, source[key]); + }); + } + + return target; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/objectSpread2.js b/node_modules/@babel/runtime/helpers/esm/objectSpread2.js new file mode 100644 index 0000000..76f2968 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/objectSpread2.js @@ -0,0 +1,27 @@ +import defineProperty from "./defineProperty.js"; + +function ownKeys(object, enumerableOnly) { + var keys = Object.keys(object); + + if (Object.getOwnPropertySymbols) { + var symbols = Object.getOwnPropertySymbols(object); + enumerableOnly && (symbols = symbols.filter(function (sym) { + return Object.getOwnPropertyDescriptor(object, sym).enumerable; + })), keys.push.apply(keys, symbols); + } + + return keys; +} + +export default function _objectSpread2(target) { + for (var i = 1; i < arguments.length; i++) { + var source = null != arguments[i] ? arguments[i] : {}; + i % 2 ? ownKeys(Object(source), !0).forEach(function (key) { + defineProperty(target, key, source[key]); + }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys(Object(source)).forEach(function (key) { + Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); + }); + } + + return target; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/objectWithoutProperties.js b/node_modules/@babel/runtime/helpers/esm/objectWithoutProperties.js new file mode 100644 index 0000000..0fef321 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/objectWithoutProperties.js @@ -0,0 +1,19 @@ +import objectWithoutPropertiesLoose from "./objectWithoutPropertiesLoose.js"; +export default function _objectWithoutProperties(source, excluded) { + if (source == null) return {}; + var target = objectWithoutPropertiesLoose(source, excluded); + var key, i; + + if (Object.getOwnPropertySymbols) { + var sourceSymbolKeys = Object.getOwnPropertySymbols(source); + + for (i = 0; i < sourceSymbolKeys.length; i++) { + key = sourceSymbolKeys[i]; + if (excluded.indexOf(key) >= 0) continue; + if (!Object.prototype.propertyIsEnumerable.call(source, key)) continue; + target[key] = source[key]; + } + } + + return target; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/objectWithoutPropertiesLoose.js b/node_modules/@babel/runtime/helpers/esm/objectWithoutPropertiesLoose.js new file mode 100644 index 0000000..c36815c --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/objectWithoutPropertiesLoose.js @@ -0,0 +1,14 @@ +export default function _objectWithoutPropertiesLoose(source, excluded) { + if (source == null) return {}; + var target = {}; + var sourceKeys = Object.keys(source); + var key, i; + + for (i = 0; i < sourceKeys.length; i++) { + key = sourceKeys[i]; + if (excluded.indexOf(key) >= 0) continue; + target[key] = source[key]; + } + + return target; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/package.json b/node_modules/@babel/runtime/helpers/esm/package.json new file mode 100644 index 0000000..aead43d --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/package.json @@ -0,0 +1,3 @@ +{ + "type": "module" +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/possibleConstructorReturn.js b/node_modules/@babel/runtime/helpers/esm/possibleConstructorReturn.js new file mode 100644 index 0000000..56d5544 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/possibleConstructorReturn.js @@ -0,0 +1,11 @@ +import _typeof from "./typeof.js"; +import assertThisInitialized from "./assertThisInitialized.js"; +export default function _possibleConstructorReturn(self, call) { + if (call && (_typeof(call) === "object" || typeof call === "function")) { + return call; + } else if (call !== void 0) { + throw new TypeError("Derived constructors may only return object or undefined"); + } + + return assertThisInitialized(self); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/readOnlyError.js b/node_modules/@babel/runtime/helpers/esm/readOnlyError.js new file mode 100644 index 0000000..166e40e --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/readOnlyError.js @@ -0,0 +1,3 @@ +export default function _readOnlyError(name) { + throw new TypeError("\"" + name + "\" is read-only"); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/set.js b/node_modules/@babel/runtime/helpers/esm/set.js new file mode 100644 index 0000000..9c54773 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/set.js @@ -0,0 +1,51 @@ +import superPropBase from "./superPropBase.js"; +import defineProperty from "./defineProperty.js"; + +function set(target, property, value, receiver) { + if (typeof Reflect !== "undefined" && Reflect.set) { + set = Reflect.set; + } else { + set = function set(target, property, value, receiver) { + var base = superPropBase(target, property); + var desc; + + if (base) { + desc = Object.getOwnPropertyDescriptor(base, property); + + if (desc.set) { + desc.set.call(receiver, value); + return true; + } else if (!desc.writable) { + return false; + } + } + + desc = Object.getOwnPropertyDescriptor(receiver, property); + + if (desc) { + if (!desc.writable) { + return false; + } + + desc.value = value; + Object.defineProperty(receiver, property, desc); + } else { + defineProperty(receiver, property, value); + } + + return true; + }; + } + + return set(target, property, value, receiver); +} + +export default function _set(target, property, value, receiver, isStrict) { + var s = set(target, property, value, receiver || target); + + if (!s && isStrict) { + throw new Error('failed to set property'); + } + + return value; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/setPrototypeOf.js b/node_modules/@babel/runtime/helpers/esm/setPrototypeOf.js new file mode 100644 index 0000000..e6ef03e --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/setPrototypeOf.js @@ -0,0 +1,8 @@ +export default function _setPrototypeOf(o, p) { + _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { + o.__proto__ = p; + return o; + }; + + return _setPrototypeOf(o, p); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/skipFirstGeneratorNext.js b/node_modules/@babel/runtime/helpers/esm/skipFirstGeneratorNext.js new file mode 100644 index 0000000..cadd9bb --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/skipFirstGeneratorNext.js @@ -0,0 +1,7 @@ +export default function _skipFirstGeneratorNext(fn) { + return function () { + var it = fn.apply(this, arguments); + it.next(); + return it; + }; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/slicedToArray.js b/node_modules/@babel/runtime/helpers/esm/slicedToArray.js new file mode 100644 index 0000000..618200b --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/slicedToArray.js @@ -0,0 +1,7 @@ +import arrayWithHoles from "./arrayWithHoles.js"; +import iterableToArrayLimit from "./iterableToArrayLimit.js"; +import unsupportedIterableToArray from "./unsupportedIterableToArray.js"; +import nonIterableRest from "./nonIterableRest.js"; +export default function _slicedToArray(arr, i) { + return arrayWithHoles(arr) || iterableToArrayLimit(arr, i) || unsupportedIterableToArray(arr, i) || nonIterableRest(); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/slicedToArrayLoose.js b/node_modules/@babel/runtime/helpers/esm/slicedToArrayLoose.js new file mode 100644 index 0000000..efc7429 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/slicedToArrayLoose.js @@ -0,0 +1,7 @@ +import arrayWithHoles from "./arrayWithHoles.js"; +import iterableToArrayLimitLoose from "./iterableToArrayLimitLoose.js"; +import unsupportedIterableToArray from "./unsupportedIterableToArray.js"; +import nonIterableRest from "./nonIterableRest.js"; +export default function _slicedToArrayLoose(arr, i) { + return arrayWithHoles(arr) || iterableToArrayLimitLoose(arr, i) || unsupportedIterableToArray(arr, i) || nonIterableRest(); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/superPropBase.js b/node_modules/@babel/runtime/helpers/esm/superPropBase.js new file mode 100644 index 0000000..feffe6f --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/superPropBase.js @@ -0,0 +1,9 @@ +import getPrototypeOf from "./getPrototypeOf.js"; +export default function _superPropBase(object, property) { + while (!Object.prototype.hasOwnProperty.call(object, property)) { + object = getPrototypeOf(object); + if (object === null) break; + } + + return object; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/taggedTemplateLiteral.js b/node_modules/@babel/runtime/helpers/esm/taggedTemplateLiteral.js new file mode 100644 index 0000000..421f18a --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/taggedTemplateLiteral.js @@ -0,0 +1,11 @@ +export default function _taggedTemplateLiteral(strings, raw) { + if (!raw) { + raw = strings.slice(0); + } + + return Object.freeze(Object.defineProperties(strings, { + raw: { + value: Object.freeze(raw) + } + })); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/taggedTemplateLiteralLoose.js b/node_modules/@babel/runtime/helpers/esm/taggedTemplateLiteralLoose.js new file mode 100644 index 0000000..c8f081e --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/taggedTemplateLiteralLoose.js @@ -0,0 +1,8 @@ +export default function _taggedTemplateLiteralLoose(strings, raw) { + if (!raw) { + raw = strings.slice(0); + } + + strings.raw = raw; + return strings; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/tdz.js b/node_modules/@babel/runtime/helpers/esm/tdz.js new file mode 100644 index 0000000..d5d0adc --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/tdz.js @@ -0,0 +1,3 @@ +export default function _tdzError(name) { + throw new ReferenceError(name + " is not defined - temporal dead zone"); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/temporalRef.js b/node_modules/@babel/runtime/helpers/esm/temporalRef.js new file mode 100644 index 0000000..b25f7c4 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/temporalRef.js @@ -0,0 +1,5 @@ +import undef from "./temporalUndefined.js"; +import err from "./tdz.js"; +export default function _temporalRef(val, name) { + return val === undef ? err(name) : val; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/temporalUndefined.js b/node_modules/@babel/runtime/helpers/esm/temporalUndefined.js new file mode 100644 index 0000000..1a35717 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/temporalUndefined.js @@ -0,0 +1 @@ +export default function _temporalUndefined() {} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/toArray.js b/node_modules/@babel/runtime/helpers/esm/toArray.js new file mode 100644 index 0000000..ad7c871 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/toArray.js @@ -0,0 +1,7 @@ +import arrayWithHoles from "./arrayWithHoles.js"; +import iterableToArray from "./iterableToArray.js"; +import unsupportedIterableToArray from "./unsupportedIterableToArray.js"; +import nonIterableRest from "./nonIterableRest.js"; +export default function _toArray(arr) { + return arrayWithHoles(arr) || iterableToArray(arr) || unsupportedIterableToArray(arr) || nonIterableRest(); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/toConsumableArray.js b/node_modules/@babel/runtime/helpers/esm/toConsumableArray.js new file mode 100644 index 0000000..bd91285 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/toConsumableArray.js @@ -0,0 +1,7 @@ +import arrayWithoutHoles from "./arrayWithoutHoles.js"; +import iterableToArray from "./iterableToArray.js"; +import unsupportedIterableToArray from "./unsupportedIterableToArray.js"; +import nonIterableSpread from "./nonIterableSpread.js"; +export default function _toConsumableArray(arr) { + return arrayWithoutHoles(arr) || iterableToArray(arr) || unsupportedIterableToArray(arr) || nonIterableSpread(); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/toPrimitive.js b/node_modules/@babel/runtime/helpers/esm/toPrimitive.js new file mode 100644 index 0000000..fa32dda --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/toPrimitive.js @@ -0,0 +1,13 @@ +import _typeof from "./typeof.js"; +export default function _toPrimitive(input, hint) { + if (_typeof(input) !== "object" || input === null) return input; + var prim = input[Symbol.toPrimitive]; + + if (prim !== undefined) { + var res = prim.call(input, hint || "default"); + if (_typeof(res) !== "object") return res; + throw new TypeError("@@toPrimitive must return a primitive value."); + } + + return (hint === "string" ? String : Number)(input); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/toPropertyKey.js b/node_modules/@babel/runtime/helpers/esm/toPropertyKey.js new file mode 100644 index 0000000..0fcc93b --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/toPropertyKey.js @@ -0,0 +1,6 @@ +import _typeof from "./typeof.js"; +import toPrimitive from "./toPrimitive.js"; +export default function _toPropertyKey(arg) { + var key = toPrimitive(arg, "string"); + return _typeof(key) === "symbol" ? key : String(key); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/typeof.js b/node_modules/@babel/runtime/helpers/esm/typeof.js new file mode 100644 index 0000000..92100c6 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/typeof.js @@ -0,0 +1,9 @@ +export default function _typeof(obj) { + "@babel/helpers - typeof"; + + return _typeof = "function" == typeof Symbol && "symbol" == typeof Symbol.iterator ? function (obj) { + return typeof obj; + } : function (obj) { + return obj && "function" == typeof Symbol && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; + }, _typeof(obj); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/unsupportedIterableToArray.js b/node_modules/@babel/runtime/helpers/esm/unsupportedIterableToArray.js new file mode 100644 index 0000000..c0f63bd --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/unsupportedIterableToArray.js @@ -0,0 +1,9 @@ +import arrayLikeToArray from "./arrayLikeToArray.js"; +export default function _unsupportedIterableToArray(o, minLen) { + if (!o) return; + if (typeof o === "string") return arrayLikeToArray(o, minLen); + var n = Object.prototype.toString.call(o).slice(8, -1); + if (n === "Object" && o.constructor) n = o.constructor.name; + if (n === "Map" || n === "Set") return Array.from(o); + if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return arrayLikeToArray(o, minLen); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/wrapAsyncGenerator.js b/node_modules/@babel/runtime/helpers/esm/wrapAsyncGenerator.js new file mode 100644 index 0000000..723b2dd --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/wrapAsyncGenerator.js @@ -0,0 +1,6 @@ +import AsyncGenerator from "./AsyncGenerator.js"; +export default function _wrapAsyncGenerator(fn) { + return function () { + return new AsyncGenerator(fn.apply(this, arguments)); + }; +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/wrapNativeSuper.js b/node_modules/@babel/runtime/helpers/esm/wrapNativeSuper.js new file mode 100644 index 0000000..512630d --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/wrapNativeSuper.js @@ -0,0 +1,37 @@ +import getPrototypeOf from "./getPrototypeOf.js"; +import setPrototypeOf from "./setPrototypeOf.js"; +import isNativeFunction from "./isNativeFunction.js"; +import construct from "./construct.js"; +export default function _wrapNativeSuper(Class) { + var _cache = typeof Map === "function" ? new Map() : undefined; + + _wrapNativeSuper = function _wrapNativeSuper(Class) { + if (Class === null || !isNativeFunction(Class)) return Class; + + if (typeof Class !== "function") { + throw new TypeError("Super expression must either be null or a function"); + } + + if (typeof _cache !== "undefined") { + if (_cache.has(Class)) return _cache.get(Class); + + _cache.set(Class, Wrapper); + } + + function Wrapper() { + return construct(Class, arguments, getPrototypeOf(this).constructor); + } + + Wrapper.prototype = Object.create(Class.prototype, { + constructor: { + value: Wrapper, + enumerable: false, + writable: true, + configurable: true + } + }); + return setPrototypeOf(Wrapper, Class); + }; + + return _wrapNativeSuper(Class); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/wrapRegExp.js b/node_modules/@babel/runtime/helpers/esm/wrapRegExp.js new file mode 100644 index 0000000..beac1e1 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/wrapRegExp.js @@ -0,0 +1,50 @@ +import _typeof from "./typeof.js"; +import setPrototypeOf from "./setPrototypeOf.js"; +import inherits from "./inherits.js"; +export default function _wrapRegExp() { + _wrapRegExp = function _wrapRegExp(re, groups) { + return new BabelRegExp(re, void 0, groups); + }; + + var _super = RegExp.prototype, + _groups = new WeakMap(); + + function BabelRegExp(re, flags, groups) { + var _this = new RegExp(re, flags); + + return _groups.set(_this, groups || _groups.get(re)), setPrototypeOf(_this, BabelRegExp.prototype); + } + + function buildGroups(result, re) { + var g = _groups.get(re); + + return Object.keys(g).reduce(function (groups, name) { + return groups[name] = result[g[name]], groups; + }, Object.create(null)); + } + + return inherits(BabelRegExp, RegExp), BabelRegExp.prototype.exec = function (str) { + var result = _super.exec.call(this, str); + + return result && (result.groups = buildGroups(result, this)), result; + }, BabelRegExp.prototype[Symbol.replace] = function (str, substitution) { + if ("string" == typeof substitution) { + var groups = _groups.get(this); + + return _super[Symbol.replace].call(this, str, substitution.replace(/\$<([^>]+)>/g, function (_, name) { + return "$" + groups[name]; + })); + } + + if ("function" == typeof substitution) { + var _this = this; + + return _super[Symbol.replace].call(this, str, function () { + var args = arguments; + return "object" != _typeof(args[args.length - 1]) && (args = [].slice.call(args)).push(buildGroups(args, _this)), substitution.apply(this, args); + }); + } + + return _super[Symbol.replace].call(this, str, substitution); + }, _wrapRegExp.apply(this, arguments); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/esm/writeOnlyError.js b/node_modules/@babel/runtime/helpers/esm/writeOnlyError.js new file mode 100644 index 0000000..9170bd4 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/esm/writeOnlyError.js @@ -0,0 +1,3 @@ +export default function _writeOnlyError(name) { + throw new TypeError("\"" + name + "\" is write-only"); +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/extends.js b/node_modules/@babel/runtime/helpers/extends.js new file mode 100644 index 0000000..e8509df --- /dev/null +++ b/node_modules/@babel/runtime/helpers/extends.js @@ -0,0 +1,18 @@ +function _extends() { + module.exports = _extends = Object.assign || function (target) { + for (var i = 1; i < arguments.length; i++) { + var source = arguments[i]; + + for (var key in source) { + if (Object.prototype.hasOwnProperty.call(source, key)) { + target[key] = source[key]; + } + } + } + + return target; + }, module.exports.__esModule = true, module.exports["default"] = module.exports; + return _extends.apply(this, arguments); +} + +module.exports = _extends, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/get.js b/node_modules/@babel/runtime/helpers/get.js new file mode 100644 index 0000000..7ddd81b --- /dev/null +++ b/node_modules/@babel/runtime/helpers/get.js @@ -0,0 +1,23 @@ +var superPropBase = require("./superPropBase.js"); + +function _get() { + if (typeof Reflect !== "undefined" && Reflect.get) { + module.exports = _get = Reflect.get, module.exports.__esModule = true, module.exports["default"] = module.exports; + } else { + module.exports = _get = function _get(target, property, receiver) { + var base = superPropBase(target, property); + if (!base) return; + var desc = Object.getOwnPropertyDescriptor(base, property); + + if (desc.get) { + return desc.get.call(arguments.length < 3 ? target : receiver); + } + + return desc.value; + }, module.exports.__esModule = true, module.exports["default"] = module.exports; + } + + return _get.apply(this, arguments); +} + +module.exports = _get, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/getPrototypeOf.js b/node_modules/@babel/runtime/helpers/getPrototypeOf.js new file mode 100644 index 0000000..02da563 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/getPrototypeOf.js @@ -0,0 +1,8 @@ +function _getPrototypeOf(o) { + module.exports = _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { + return o.__proto__ || Object.getPrototypeOf(o); + }, module.exports.__esModule = true, module.exports["default"] = module.exports; + return _getPrototypeOf(o); +} + +module.exports = _getPrototypeOf, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/identity.js b/node_modules/@babel/runtime/helpers/identity.js new file mode 100644 index 0000000..3d00062 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/identity.js @@ -0,0 +1,5 @@ +function _identity(x) { + return x; +} + +module.exports = _identity, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/inherits.js b/node_modules/@babel/runtime/helpers/inherits.js new file mode 100644 index 0000000..0b10f28 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/inherits.js @@ -0,0 +1,21 @@ +var setPrototypeOf = require("./setPrototypeOf.js"); + +function _inherits(subClass, superClass) { + if (typeof superClass !== "function" && superClass !== null) { + throw new TypeError("Super expression must either be null or a function"); + } + + subClass.prototype = Object.create(superClass && superClass.prototype, { + constructor: { + value: subClass, + writable: true, + configurable: true + } + }); + Object.defineProperty(subClass, "prototype", { + writable: false + }); + if (superClass) setPrototypeOf(subClass, superClass); +} + +module.exports = _inherits, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/inheritsLoose.js b/node_modules/@babel/runtime/helpers/inheritsLoose.js new file mode 100644 index 0000000..df6de46 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/inheritsLoose.js @@ -0,0 +1,9 @@ +var setPrototypeOf = require("./setPrototypeOf.js"); + +function _inheritsLoose(subClass, superClass) { + subClass.prototype = Object.create(superClass.prototype); + subClass.prototype.constructor = subClass; + setPrototypeOf(subClass, superClass); +} + +module.exports = _inheritsLoose, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/initializerDefineProperty.js b/node_modules/@babel/runtime/helpers/initializerDefineProperty.js new file mode 100644 index 0000000..5a595a7 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/initializerDefineProperty.js @@ -0,0 +1,11 @@ +function _initializerDefineProperty(target, property, descriptor, context) { + if (!descriptor) return; + Object.defineProperty(target, property, { + enumerable: descriptor.enumerable, + configurable: descriptor.configurable, + writable: descriptor.writable, + value: descriptor.initializer ? descriptor.initializer.call(context) : void 0 + }); +} + +module.exports = _initializerDefineProperty, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/initializerWarningHelper.js b/node_modules/@babel/runtime/helpers/initializerWarningHelper.js new file mode 100644 index 0000000..001d8a3 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/initializerWarningHelper.js @@ -0,0 +1,5 @@ +function _initializerWarningHelper(descriptor, context) { + throw new Error('Decorating class property failed. Please ensure that ' + 'proposal-class-properties is enabled and runs after the decorators transform.'); +} + +module.exports = _initializerWarningHelper, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/instanceof.js b/node_modules/@babel/runtime/helpers/instanceof.js new file mode 100644 index 0000000..08eea81 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/instanceof.js @@ -0,0 +1,9 @@ +function _instanceof(left, right) { + if (right != null && typeof Symbol !== "undefined" && right[Symbol.hasInstance]) { + return !!right[Symbol.hasInstance](left); + } else { + return left instanceof right; + } +} + +module.exports = _instanceof, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/interopRequireDefault.js b/node_modules/@babel/runtime/helpers/interopRequireDefault.js new file mode 100644 index 0000000..5faa0e4 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/interopRequireDefault.js @@ -0,0 +1,7 @@ +function _interopRequireDefault(obj) { + return obj && obj.__esModule ? obj : { + "default": obj + }; +} + +module.exports = _interopRequireDefault, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/interopRequireWildcard.js b/node_modules/@babel/runtime/helpers/interopRequireWildcard.js new file mode 100644 index 0000000..0f8ffbf --- /dev/null +++ b/node_modules/@babel/runtime/helpers/interopRequireWildcard.js @@ -0,0 +1,53 @@ +var _typeof = require("./typeof.js")["default"]; + +function _getRequireWildcardCache(nodeInterop) { + if (typeof WeakMap !== "function") return null; + var cacheBabelInterop = new WeakMap(); + var cacheNodeInterop = new WeakMap(); + return (_getRequireWildcardCache = function _getRequireWildcardCache(nodeInterop) { + return nodeInterop ? cacheNodeInterop : cacheBabelInterop; + })(nodeInterop); +} + +function _interopRequireWildcard(obj, nodeInterop) { + if (!nodeInterop && obj && obj.__esModule) { + return obj; + } + + if (obj === null || _typeof(obj) !== "object" && typeof obj !== "function") { + return { + "default": obj + }; + } + + var cache = _getRequireWildcardCache(nodeInterop); + + if (cache && cache.has(obj)) { + return cache.get(obj); + } + + var newObj = {}; + var hasPropertyDescriptor = Object.defineProperty && Object.getOwnPropertyDescriptor; + + for (var key in obj) { + if (key !== "default" && Object.prototype.hasOwnProperty.call(obj, key)) { + var desc = hasPropertyDescriptor ? Object.getOwnPropertyDescriptor(obj, key) : null; + + if (desc && (desc.get || desc.set)) { + Object.defineProperty(newObj, key, desc); + } else { + newObj[key] = obj[key]; + } + } + } + + newObj["default"] = obj; + + if (cache) { + cache.set(obj, newObj); + } + + return newObj; +} + +module.exports = _interopRequireWildcard, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/isNativeFunction.js b/node_modules/@babel/runtime/helpers/isNativeFunction.js new file mode 100644 index 0000000..5c3d98f --- /dev/null +++ b/node_modules/@babel/runtime/helpers/isNativeFunction.js @@ -0,0 +1,5 @@ +function _isNativeFunction(fn) { + return Function.toString.call(fn).indexOf("[native code]") !== -1; +} + +module.exports = _isNativeFunction, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/isNativeReflectConstruct.js b/node_modules/@babel/runtime/helpers/isNativeReflectConstruct.js new file mode 100644 index 0000000..f07899d --- /dev/null +++ b/node_modules/@babel/runtime/helpers/isNativeReflectConstruct.js @@ -0,0 +1,14 @@ +function _isNativeReflectConstruct() { + if (typeof Reflect === "undefined" || !Reflect.construct) return false; + if (Reflect.construct.sham) return false; + if (typeof Proxy === "function") return true; + + try { + Boolean.prototype.valueOf.call(Reflect.construct(Boolean, [], function () {})); + return true; + } catch (e) { + return false; + } +} + +module.exports = _isNativeReflectConstruct, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/iterableToArray.js b/node_modules/@babel/runtime/helpers/iterableToArray.js new file mode 100644 index 0000000..5b9038a --- /dev/null +++ b/node_modules/@babel/runtime/helpers/iterableToArray.js @@ -0,0 +1,5 @@ +function _iterableToArray(iter) { + if (typeof Symbol !== "undefined" && iter[Symbol.iterator] != null || iter["@@iterator"] != null) return Array.from(iter); +} + +module.exports = _iterableToArray, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/iterableToArrayLimit.js b/node_modules/@babel/runtime/helpers/iterableToArrayLimit.js new file mode 100644 index 0000000..8d01fb3 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/iterableToArrayLimit.js @@ -0,0 +1,31 @@ +function _iterableToArrayLimit(arr, i) { + var _i = arr == null ? null : typeof Symbol !== "undefined" && arr[Symbol.iterator] || arr["@@iterator"]; + + if (_i == null) return; + var _arr = []; + var _n = true; + var _d = false; + + var _s, _e; + + try { + for (_i = _i.call(arr); !(_n = (_s = _i.next()).done); _n = true) { + _arr.push(_s.value); + + if (i && _arr.length === i) break; + } + } catch (err) { + _d = true; + _e = err; + } finally { + try { + if (!_n && _i["return"] != null) _i["return"](); + } finally { + if (_d) throw _e; + } + } + + return _arr; +} + +module.exports = _iterableToArrayLimit, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/iterableToArrayLimitLoose.js b/node_modules/@babel/runtime/helpers/iterableToArrayLimitLoose.js new file mode 100644 index 0000000..bca5452 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/iterableToArrayLimitLoose.js @@ -0,0 +1,16 @@ +function _iterableToArrayLimitLoose(arr, i) { + var _i = arr && (typeof Symbol !== "undefined" && arr[Symbol.iterator] || arr["@@iterator"]); + + if (_i == null) return; + var _arr = []; + + for (_i = _i.call(arr), _step; !(_step = _i.next()).done;) { + _arr.push(_step.value); + + if (i && _arr.length === i) break; + } + + return _arr; +} + +module.exports = _iterableToArrayLimitLoose, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/jsx.js b/node_modules/@babel/runtime/helpers/jsx.js new file mode 100644 index 0000000..bc19ec4 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/jsx.js @@ -0,0 +1,29 @@ +var REACT_ELEMENT_TYPE; + +function _createRawReactElement(type, props, key, children) { + REACT_ELEMENT_TYPE || (REACT_ELEMENT_TYPE = "function" == typeof Symbol && Symbol["for"] && Symbol["for"]("react.element") || 60103); + var defaultProps = type && type.defaultProps, + childrenLength = arguments.length - 3; + if (props || 0 === childrenLength || (props = { + children: void 0 + }), 1 === childrenLength) props.children = children;else if (childrenLength > 1) { + for (var childArray = new Array(childrenLength), i = 0; i < childrenLength; i++) { + childArray[i] = arguments[i + 3]; + } + + props.children = childArray; + } + if (props && defaultProps) for (var propName in defaultProps) { + void 0 === props[propName] && (props[propName] = defaultProps[propName]); + } else props || (props = defaultProps || {}); + return { + $$typeof: REACT_ELEMENT_TYPE, + type: type, + key: void 0 === key ? null : "" + key, + ref: null, + props: props, + _owner: null + }; +} + +module.exports = _createRawReactElement, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/maybeArrayLike.js b/node_modules/@babel/runtime/helpers/maybeArrayLike.js new file mode 100644 index 0000000..212d68c --- /dev/null +++ b/node_modules/@babel/runtime/helpers/maybeArrayLike.js @@ -0,0 +1,12 @@ +var arrayLikeToArray = require("./arrayLikeToArray.js"); + +function _maybeArrayLike(next, arr, i) { + if (arr && !Array.isArray(arr) && typeof arr.length === "number") { + var len = arr.length; + return arrayLikeToArray(arr, i !== void 0 && i < len ? i : len); + } + + return next(arr, i); +} + +module.exports = _maybeArrayLike, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/newArrowCheck.js b/node_modules/@babel/runtime/helpers/newArrowCheck.js new file mode 100644 index 0000000..86a91f2 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/newArrowCheck.js @@ -0,0 +1,7 @@ +function _newArrowCheck(innerThis, boundThis) { + if (innerThis !== boundThis) { + throw new TypeError("Cannot instantiate an arrow function"); + } +} + +module.exports = _newArrowCheck, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/nonIterableRest.js b/node_modules/@babel/runtime/helpers/nonIterableRest.js new file mode 100644 index 0000000..e791108 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/nonIterableRest.js @@ -0,0 +1,5 @@ +function _nonIterableRest() { + throw new TypeError("Invalid attempt to destructure non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method."); +} + +module.exports = _nonIterableRest, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/nonIterableSpread.js b/node_modules/@babel/runtime/helpers/nonIterableSpread.js new file mode 100644 index 0000000..64379ea --- /dev/null +++ b/node_modules/@babel/runtime/helpers/nonIterableSpread.js @@ -0,0 +1,5 @@ +function _nonIterableSpread() { + throw new TypeError("Invalid attempt to spread non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method."); +} + +module.exports = _nonIterableSpread, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/objectDestructuringEmpty.js b/node_modules/@babel/runtime/helpers/objectDestructuringEmpty.js new file mode 100644 index 0000000..cb0866e --- /dev/null +++ b/node_modules/@babel/runtime/helpers/objectDestructuringEmpty.js @@ -0,0 +1,5 @@ +function _objectDestructuringEmpty(obj) { + if (obj == null) throw new TypeError("Cannot destructure undefined"); +} + +module.exports = _objectDestructuringEmpty, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/objectSpread.js b/node_modules/@babel/runtime/helpers/objectSpread.js new file mode 100644 index 0000000..cfb4309 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/objectSpread.js @@ -0,0 +1,22 @@ +var defineProperty = require("./defineProperty.js"); + +function _objectSpread(target) { + for (var i = 1; i < arguments.length; i++) { + var source = arguments[i] != null ? Object(arguments[i]) : {}; + var ownKeys = Object.keys(source); + + if (typeof Object.getOwnPropertySymbols === 'function') { + ownKeys.push.apply(ownKeys, Object.getOwnPropertySymbols(source).filter(function (sym) { + return Object.getOwnPropertyDescriptor(source, sym).enumerable; + })); + } + + ownKeys.forEach(function (key) { + defineProperty(target, key, source[key]); + }); + } + + return target; +} + +module.exports = _objectSpread, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/objectSpread2.js b/node_modules/@babel/runtime/helpers/objectSpread2.js new file mode 100644 index 0000000..7e5db07 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/objectSpread2.js @@ -0,0 +1,29 @@ +var defineProperty = require("./defineProperty.js"); + +function ownKeys(object, enumerableOnly) { + var keys = Object.keys(object); + + if (Object.getOwnPropertySymbols) { + var symbols = Object.getOwnPropertySymbols(object); + enumerableOnly && (symbols = symbols.filter(function (sym) { + return Object.getOwnPropertyDescriptor(object, sym).enumerable; + })), keys.push.apply(keys, symbols); + } + + return keys; +} + +function _objectSpread2(target) { + for (var i = 1; i < arguments.length; i++) { + var source = null != arguments[i] ? arguments[i] : {}; + i % 2 ? ownKeys(Object(source), !0).forEach(function (key) { + defineProperty(target, key, source[key]); + }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys(Object(source)).forEach(function (key) { + Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); + }); + } + + return target; +} + +module.exports = _objectSpread2, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/objectWithoutProperties.js b/node_modules/@babel/runtime/helpers/objectWithoutProperties.js new file mode 100644 index 0000000..8cf3ab8 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/objectWithoutProperties.js @@ -0,0 +1,22 @@ +var objectWithoutPropertiesLoose = require("./objectWithoutPropertiesLoose.js"); + +function _objectWithoutProperties(source, excluded) { + if (source == null) return {}; + var target = objectWithoutPropertiesLoose(source, excluded); + var key, i; + + if (Object.getOwnPropertySymbols) { + var sourceSymbolKeys = Object.getOwnPropertySymbols(source); + + for (i = 0; i < sourceSymbolKeys.length; i++) { + key = sourceSymbolKeys[i]; + if (excluded.indexOf(key) >= 0) continue; + if (!Object.prototype.propertyIsEnumerable.call(source, key)) continue; + target[key] = source[key]; + } + } + + return target; +} + +module.exports = _objectWithoutProperties, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/objectWithoutPropertiesLoose.js b/node_modules/@babel/runtime/helpers/objectWithoutPropertiesLoose.js new file mode 100644 index 0000000..44d5771 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/objectWithoutPropertiesLoose.js @@ -0,0 +1,16 @@ +function _objectWithoutPropertiesLoose(source, excluded) { + if (source == null) return {}; + var target = {}; + var sourceKeys = Object.keys(source); + var key, i; + + for (i = 0; i < sourceKeys.length; i++) { + key = sourceKeys[i]; + if (excluded.indexOf(key) >= 0) continue; + target[key] = source[key]; + } + + return target; +} + +module.exports = _objectWithoutPropertiesLoose, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/possibleConstructorReturn.js b/node_modules/@babel/runtime/helpers/possibleConstructorReturn.js new file mode 100644 index 0000000..e1997be --- /dev/null +++ b/node_modules/@babel/runtime/helpers/possibleConstructorReturn.js @@ -0,0 +1,15 @@ +var _typeof = require("./typeof.js")["default"]; + +var assertThisInitialized = require("./assertThisInitialized.js"); + +function _possibleConstructorReturn(self, call) { + if (call && (_typeof(call) === "object" || typeof call === "function")) { + return call; + } else if (call !== void 0) { + throw new TypeError("Derived constructors may only return object or undefined"); + } + + return assertThisInitialized(self); +} + +module.exports = _possibleConstructorReturn, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/readOnlyError.js b/node_modules/@babel/runtime/helpers/readOnlyError.js new file mode 100644 index 0000000..93cb90c --- /dev/null +++ b/node_modules/@babel/runtime/helpers/readOnlyError.js @@ -0,0 +1,5 @@ +function _readOnlyError(name) { + throw new TypeError("\"" + name + "\" is read-only"); +} + +module.exports = _readOnlyError, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/set.js b/node_modules/@babel/runtime/helpers/set.js new file mode 100644 index 0000000..6438def --- /dev/null +++ b/node_modules/@babel/runtime/helpers/set.js @@ -0,0 +1,54 @@ +var superPropBase = require("./superPropBase.js"); + +var defineProperty = require("./defineProperty.js"); + +function set(target, property, value, receiver) { + if (typeof Reflect !== "undefined" && Reflect.set) { + set = Reflect.set; + } else { + set = function set(target, property, value, receiver) { + var base = superPropBase(target, property); + var desc; + + if (base) { + desc = Object.getOwnPropertyDescriptor(base, property); + + if (desc.set) { + desc.set.call(receiver, value); + return true; + } else if (!desc.writable) { + return false; + } + } + + desc = Object.getOwnPropertyDescriptor(receiver, property); + + if (desc) { + if (!desc.writable) { + return false; + } + + desc.value = value; + Object.defineProperty(receiver, property, desc); + } else { + defineProperty(receiver, property, value); + } + + return true; + }; + } + + return set(target, property, value, receiver); +} + +function _set(target, property, value, receiver, isStrict) { + var s = set(target, property, value, receiver || target); + + if (!s && isStrict) { + throw new Error('failed to set property'); + } + + return value; +} + +module.exports = _set, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/setPrototypeOf.js b/node_modules/@babel/runtime/helpers/setPrototypeOf.js new file mode 100644 index 0000000..7efecad --- /dev/null +++ b/node_modules/@babel/runtime/helpers/setPrototypeOf.js @@ -0,0 +1,9 @@ +function _setPrototypeOf(o, p) { + module.exports = _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { + o.__proto__ = p; + return o; + }, module.exports.__esModule = true, module.exports["default"] = module.exports; + return _setPrototypeOf(o, p); +} + +module.exports = _setPrototypeOf, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/skipFirstGeneratorNext.js b/node_modules/@babel/runtime/helpers/skipFirstGeneratorNext.js new file mode 100644 index 0000000..8890896 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/skipFirstGeneratorNext.js @@ -0,0 +1,9 @@ +function _skipFirstGeneratorNext(fn) { + return function () { + var it = fn.apply(this, arguments); + it.next(); + return it; + }; +} + +module.exports = _skipFirstGeneratorNext, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/slicedToArray.js b/node_modules/@babel/runtime/helpers/slicedToArray.js new file mode 100644 index 0000000..bce5fc0 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/slicedToArray.js @@ -0,0 +1,13 @@ +var arrayWithHoles = require("./arrayWithHoles.js"); + +var iterableToArrayLimit = require("./iterableToArrayLimit.js"); + +var unsupportedIterableToArray = require("./unsupportedIterableToArray.js"); + +var nonIterableRest = require("./nonIterableRest.js"); + +function _slicedToArray(arr, i) { + return arrayWithHoles(arr) || iterableToArrayLimit(arr, i) || unsupportedIterableToArray(arr, i) || nonIterableRest(); +} + +module.exports = _slicedToArray, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/slicedToArrayLoose.js b/node_modules/@babel/runtime/helpers/slicedToArrayLoose.js new file mode 100644 index 0000000..cc9ace2 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/slicedToArrayLoose.js @@ -0,0 +1,13 @@ +var arrayWithHoles = require("./arrayWithHoles.js"); + +var iterableToArrayLimitLoose = require("./iterableToArrayLimitLoose.js"); + +var unsupportedIterableToArray = require("./unsupportedIterableToArray.js"); + +var nonIterableRest = require("./nonIterableRest.js"); + +function _slicedToArrayLoose(arr, i) { + return arrayWithHoles(arr) || iterableToArrayLimitLoose(arr, i) || unsupportedIterableToArray(arr, i) || nonIterableRest(); +} + +module.exports = _slicedToArrayLoose, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/superPropBase.js b/node_modules/@babel/runtime/helpers/superPropBase.js new file mode 100644 index 0000000..dd47fff --- /dev/null +++ b/node_modules/@babel/runtime/helpers/superPropBase.js @@ -0,0 +1,12 @@ +var getPrototypeOf = require("./getPrototypeOf.js"); + +function _superPropBase(object, property) { + while (!Object.prototype.hasOwnProperty.call(object, property)) { + object = getPrototypeOf(object); + if (object === null) break; + } + + return object; +} + +module.exports = _superPropBase, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/taggedTemplateLiteral.js b/node_modules/@babel/runtime/helpers/taggedTemplateLiteral.js new file mode 100644 index 0000000..6d9738c --- /dev/null +++ b/node_modules/@babel/runtime/helpers/taggedTemplateLiteral.js @@ -0,0 +1,13 @@ +function _taggedTemplateLiteral(strings, raw) { + if (!raw) { + raw = strings.slice(0); + } + + return Object.freeze(Object.defineProperties(strings, { + raw: { + value: Object.freeze(raw) + } + })); +} + +module.exports = _taggedTemplateLiteral, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/taggedTemplateLiteralLoose.js b/node_modules/@babel/runtime/helpers/taggedTemplateLiteralLoose.js new file mode 100644 index 0000000..4f151ca --- /dev/null +++ b/node_modules/@babel/runtime/helpers/taggedTemplateLiteralLoose.js @@ -0,0 +1,10 @@ +function _taggedTemplateLiteralLoose(strings, raw) { + if (!raw) { + raw = strings.slice(0); + } + + strings.raw = raw; + return strings; +} + +module.exports = _taggedTemplateLiteralLoose, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/tdz.js b/node_modules/@babel/runtime/helpers/tdz.js new file mode 100644 index 0000000..91ec2b2 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/tdz.js @@ -0,0 +1,5 @@ +function _tdzError(name) { + throw new ReferenceError(name + " is not defined - temporal dead zone"); +} + +module.exports = _tdzError, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/temporalRef.js b/node_modules/@babel/runtime/helpers/temporalRef.js new file mode 100644 index 0000000..6afd932 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/temporalRef.js @@ -0,0 +1,9 @@ +var temporalUndefined = require("./temporalUndefined.js"); + +var tdz = require("./tdz.js"); + +function _temporalRef(val, name) { + return val === temporalUndefined ? tdz(name) : val; +} + +module.exports = _temporalRef, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/temporalUndefined.js b/node_modules/@babel/runtime/helpers/temporalUndefined.js new file mode 100644 index 0000000..7aca810 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/temporalUndefined.js @@ -0,0 +1,3 @@ +function _temporalUndefined() {} + +module.exports = _temporalUndefined, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/toArray.js b/node_modules/@babel/runtime/helpers/toArray.js new file mode 100644 index 0000000..d0af0e9 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/toArray.js @@ -0,0 +1,13 @@ +var arrayWithHoles = require("./arrayWithHoles.js"); + +var iterableToArray = require("./iterableToArray.js"); + +var unsupportedIterableToArray = require("./unsupportedIterableToArray.js"); + +var nonIterableRest = require("./nonIterableRest.js"); + +function _toArray(arr) { + return arrayWithHoles(arr) || iterableToArray(arr) || unsupportedIterableToArray(arr) || nonIterableRest(); +} + +module.exports = _toArray, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/toConsumableArray.js b/node_modules/@babel/runtime/helpers/toConsumableArray.js new file mode 100644 index 0000000..9c69072 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/toConsumableArray.js @@ -0,0 +1,13 @@ +var arrayWithoutHoles = require("./arrayWithoutHoles.js"); + +var iterableToArray = require("./iterableToArray.js"); + +var unsupportedIterableToArray = require("./unsupportedIterableToArray.js"); + +var nonIterableSpread = require("./nonIterableSpread.js"); + +function _toConsumableArray(arr) { + return arrayWithoutHoles(arr) || iterableToArray(arr) || unsupportedIterableToArray(arr) || nonIterableSpread(); +} + +module.exports = _toConsumableArray, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/toPrimitive.js b/node_modules/@babel/runtime/helpers/toPrimitive.js new file mode 100644 index 0000000..dc4da81 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/toPrimitive.js @@ -0,0 +1,16 @@ +var _typeof = require("./typeof.js")["default"]; + +function _toPrimitive(input, hint) { + if (_typeof(input) !== "object" || input === null) return input; + var prim = input[Symbol.toPrimitive]; + + if (prim !== undefined) { + var res = prim.call(input, hint || "default"); + if (_typeof(res) !== "object") return res; + throw new TypeError("@@toPrimitive must return a primitive value."); + } + + return (hint === "string" ? String : Number)(input); +} + +module.exports = _toPrimitive, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/toPropertyKey.js b/node_modules/@babel/runtime/helpers/toPropertyKey.js new file mode 100644 index 0000000..61367cf --- /dev/null +++ b/node_modules/@babel/runtime/helpers/toPropertyKey.js @@ -0,0 +1,10 @@ +var _typeof = require("./typeof.js")["default"]; + +var toPrimitive = require("./toPrimitive.js"); + +function _toPropertyKey(arg) { + var key = toPrimitive(arg, "string"); + return _typeof(key) === "symbol" ? key : String(key); +} + +module.exports = _toPropertyKey, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/typeof.js b/node_modules/@babel/runtime/helpers/typeof.js new file mode 100644 index 0000000..6c7860f --- /dev/null +++ b/node_modules/@babel/runtime/helpers/typeof.js @@ -0,0 +1,11 @@ +function _typeof(obj) { + "@babel/helpers - typeof"; + + return (module.exports = _typeof = "function" == typeof Symbol && "symbol" == typeof Symbol.iterator ? function (obj) { + return typeof obj; + } : function (obj) { + return obj && "function" == typeof Symbol && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; + }, module.exports.__esModule = true, module.exports["default"] = module.exports), _typeof(obj); +} + +module.exports = _typeof, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/unsupportedIterableToArray.js b/node_modules/@babel/runtime/helpers/unsupportedIterableToArray.js new file mode 100644 index 0000000..bfe65e4 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/unsupportedIterableToArray.js @@ -0,0 +1,12 @@ +var arrayLikeToArray = require("./arrayLikeToArray.js"); + +function _unsupportedIterableToArray(o, minLen) { + if (!o) return; + if (typeof o === "string") return arrayLikeToArray(o, minLen); + var n = Object.prototype.toString.call(o).slice(8, -1); + if (n === "Object" && o.constructor) n = o.constructor.name; + if (n === "Map" || n === "Set") return Array.from(o); + if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return arrayLikeToArray(o, minLen); +} + +module.exports = _unsupportedIterableToArray, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/wrapAsyncGenerator.js b/node_modules/@babel/runtime/helpers/wrapAsyncGenerator.js new file mode 100644 index 0000000..1fb4fd7 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/wrapAsyncGenerator.js @@ -0,0 +1,9 @@ +var AsyncGenerator = require("./AsyncGenerator.js"); + +function _wrapAsyncGenerator(fn) { + return function () { + return new AsyncGenerator(fn.apply(this, arguments)); + }; +} + +module.exports = _wrapAsyncGenerator, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/wrapNativeSuper.js b/node_modules/@babel/runtime/helpers/wrapNativeSuper.js new file mode 100644 index 0000000..516220b --- /dev/null +++ b/node_modules/@babel/runtime/helpers/wrapNativeSuper.js @@ -0,0 +1,42 @@ +var getPrototypeOf = require("./getPrototypeOf.js"); + +var setPrototypeOf = require("./setPrototypeOf.js"); + +var isNativeFunction = require("./isNativeFunction.js"); + +var construct = require("./construct.js"); + +function _wrapNativeSuper(Class) { + var _cache = typeof Map === "function" ? new Map() : undefined; + + module.exports = _wrapNativeSuper = function _wrapNativeSuper(Class) { + if (Class === null || !isNativeFunction(Class)) return Class; + + if (typeof Class !== "function") { + throw new TypeError("Super expression must either be null or a function"); + } + + if (typeof _cache !== "undefined") { + if (_cache.has(Class)) return _cache.get(Class); + + _cache.set(Class, Wrapper); + } + + function Wrapper() { + return construct(Class, arguments, getPrototypeOf(this).constructor); + } + + Wrapper.prototype = Object.create(Class.prototype, { + constructor: { + value: Wrapper, + enumerable: false, + writable: true, + configurable: true + } + }); + return setPrototypeOf(Wrapper, Class); + }, module.exports.__esModule = true, module.exports["default"] = module.exports; + return _wrapNativeSuper(Class); +} + +module.exports = _wrapNativeSuper, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/wrapRegExp.js b/node_modules/@babel/runtime/helpers/wrapRegExp.js new file mode 100644 index 0000000..5b8342b --- /dev/null +++ b/node_modules/@babel/runtime/helpers/wrapRegExp.js @@ -0,0 +1,55 @@ +var _typeof = require("./typeof.js")["default"]; + +var setPrototypeOf = require("./setPrototypeOf.js"); + +var inherits = require("./inherits.js"); + +function _wrapRegExp() { + module.exports = _wrapRegExp = function _wrapRegExp(re, groups) { + return new BabelRegExp(re, void 0, groups); + }, module.exports.__esModule = true, module.exports["default"] = module.exports; + + var _super = RegExp.prototype, + _groups = new WeakMap(); + + function BabelRegExp(re, flags, groups) { + var _this = new RegExp(re, flags); + + return _groups.set(_this, groups || _groups.get(re)), setPrototypeOf(_this, BabelRegExp.prototype); + } + + function buildGroups(result, re) { + var g = _groups.get(re); + + return Object.keys(g).reduce(function (groups, name) { + return groups[name] = result[g[name]], groups; + }, Object.create(null)); + } + + return inherits(BabelRegExp, RegExp), BabelRegExp.prototype.exec = function (str) { + var result = _super.exec.call(this, str); + + return result && (result.groups = buildGroups(result, this)), result; + }, BabelRegExp.prototype[Symbol.replace] = function (str, substitution) { + if ("string" == typeof substitution) { + var groups = _groups.get(this); + + return _super[Symbol.replace].call(this, str, substitution.replace(/\$<([^>]+)>/g, function (_, name) { + return "$" + groups[name]; + })); + } + + if ("function" == typeof substitution) { + var _this = this; + + return _super[Symbol.replace].call(this, str, function () { + var args = arguments; + return "object" != _typeof(args[args.length - 1]) && (args = [].slice.call(args)).push(buildGroups(args, _this)), substitution.apply(this, args); + }); + } + + return _super[Symbol.replace].call(this, str, substitution); + }, _wrapRegExp.apply(this, arguments); +} + +module.exports = _wrapRegExp, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/helpers/writeOnlyError.js b/node_modules/@babel/runtime/helpers/writeOnlyError.js new file mode 100644 index 0000000..1329487 --- /dev/null +++ b/node_modules/@babel/runtime/helpers/writeOnlyError.js @@ -0,0 +1,5 @@ +function _writeOnlyError(name) { + throw new TypeError("\"" + name + "\" is write-only"); +} + +module.exports = _writeOnlyError, module.exports.__esModule = true, module.exports["default"] = module.exports; \ No newline at end of file diff --git a/node_modules/@babel/runtime/package.json b/node_modules/@babel/runtime/package.json new file mode 100644 index 0000000..cc7c58c --- /dev/null +++ b/node_modules/@babel/runtime/package.json @@ -0,0 +1,866 @@ +{ + "name": "@babel/runtime", + "version": "7.17.8", + "description": "babel's modular runtime helpers", + "license": "MIT", + "publishConfig": { + "access": "public" + }, + "repository": { + "type": "git", + "url": "https://github.com/babel/babel.git", + "directory": "packages/babel-runtime" + }, + "homepage": "https://babel.dev/docs/en/next/babel-runtime", + "author": "The Babel Team (https://babel.dev/team)", + "dependencies": { + "regenerator-runtime": "^0.13.4" + }, + "exports": { + "./helpers/applyDecs": [ + { + "node": "./helpers/applyDecs.js", + "import": "./helpers/esm/applyDecs.js", + "default": "./helpers/applyDecs.js" + }, + "./helpers/applyDecs.js" + ], + "./helpers/esm/applyDecs": "./helpers/esm/applyDecs.js", + "./helpers/asyncIterator": [ + { + "node": "./helpers/asyncIterator.js", + "import": "./helpers/esm/asyncIterator.js", + "default": "./helpers/asyncIterator.js" + }, + "./helpers/asyncIterator.js" + ], + "./helpers/esm/asyncIterator": "./helpers/esm/asyncIterator.js", + "./helpers/jsx": [ + { + "node": "./helpers/jsx.js", + "import": "./helpers/esm/jsx.js", + "default": "./helpers/jsx.js" + }, + "./helpers/jsx.js" + ], + "./helpers/esm/jsx": "./helpers/esm/jsx.js", + "./helpers/objectSpread2": [ + { + "node": "./helpers/objectSpread2.js", + "import": "./helpers/esm/objectSpread2.js", + "default": "./helpers/objectSpread2.js" + }, + "./helpers/objectSpread2.js" + ], + "./helpers/esm/objectSpread2": "./helpers/esm/objectSpread2.js", + "./helpers/typeof": [ + { + "node": "./helpers/typeof.js", + "import": "./helpers/esm/typeof.js", + "default": "./helpers/typeof.js" + }, + "./helpers/typeof.js" + ], + "./helpers/esm/typeof": "./helpers/esm/typeof.js", + "./helpers/wrapRegExp": [ + { + "node": "./helpers/wrapRegExp.js", + "import": "./helpers/esm/wrapRegExp.js", + "default": "./helpers/wrapRegExp.js" + }, + "./helpers/wrapRegExp.js" + ], + "./helpers/esm/wrapRegExp": "./helpers/esm/wrapRegExp.js", + "./helpers/AwaitValue": [ + { + "node": "./helpers/AwaitValue.js", + "import": "./helpers/esm/AwaitValue.js", + "default": "./helpers/AwaitValue.js" + }, + "./helpers/AwaitValue.js" + ], + "./helpers/esm/AwaitValue": "./helpers/esm/AwaitValue.js", + "./helpers/AsyncGenerator": [ + { + "node": "./helpers/AsyncGenerator.js", + "import": "./helpers/esm/AsyncGenerator.js", + "default": "./helpers/AsyncGenerator.js" + }, + "./helpers/AsyncGenerator.js" + ], + "./helpers/esm/AsyncGenerator": "./helpers/esm/AsyncGenerator.js", + "./helpers/wrapAsyncGenerator": [ + { + "node": "./helpers/wrapAsyncGenerator.js", + "import": "./helpers/esm/wrapAsyncGenerator.js", + "default": "./helpers/wrapAsyncGenerator.js" + }, + "./helpers/wrapAsyncGenerator.js" + ], + "./helpers/esm/wrapAsyncGenerator": "./helpers/esm/wrapAsyncGenerator.js", + "./helpers/awaitAsyncGenerator": [ + { + "node": "./helpers/awaitAsyncGenerator.js", + "import": "./helpers/esm/awaitAsyncGenerator.js", + "default": "./helpers/awaitAsyncGenerator.js" + }, + "./helpers/awaitAsyncGenerator.js" + ], + "./helpers/esm/awaitAsyncGenerator": "./helpers/esm/awaitAsyncGenerator.js", + "./helpers/asyncGeneratorDelegate": [ + { + "node": "./helpers/asyncGeneratorDelegate.js", + "import": "./helpers/esm/asyncGeneratorDelegate.js", + "default": "./helpers/asyncGeneratorDelegate.js" + }, + "./helpers/asyncGeneratorDelegate.js" + ], + "./helpers/esm/asyncGeneratorDelegate": "./helpers/esm/asyncGeneratorDelegate.js", + "./helpers/asyncToGenerator": [ + { + "node": "./helpers/asyncToGenerator.js", + "import": "./helpers/esm/asyncToGenerator.js", + "default": "./helpers/asyncToGenerator.js" + }, + "./helpers/asyncToGenerator.js" + ], + "./helpers/esm/asyncToGenerator": "./helpers/esm/asyncToGenerator.js", + "./helpers/classCallCheck": [ + { + "node": "./helpers/classCallCheck.js", + "import": "./helpers/esm/classCallCheck.js", + "default": "./helpers/classCallCheck.js" + }, + "./helpers/classCallCheck.js" + ], + "./helpers/esm/classCallCheck": "./helpers/esm/classCallCheck.js", + "./helpers/createClass": [ + { + "node": "./helpers/createClass.js", + "import": "./helpers/esm/createClass.js", + "default": "./helpers/createClass.js" + }, + "./helpers/createClass.js" + ], + "./helpers/esm/createClass": "./helpers/esm/createClass.js", + "./helpers/defineEnumerableProperties": [ + { + "node": "./helpers/defineEnumerableProperties.js", + "import": "./helpers/esm/defineEnumerableProperties.js", + "default": "./helpers/defineEnumerableProperties.js" + }, + "./helpers/defineEnumerableProperties.js" + ], + "./helpers/esm/defineEnumerableProperties": "./helpers/esm/defineEnumerableProperties.js", + "./helpers/defaults": [ + { + "node": "./helpers/defaults.js", + "import": "./helpers/esm/defaults.js", + "default": "./helpers/defaults.js" + }, + "./helpers/defaults.js" + ], + "./helpers/esm/defaults": "./helpers/esm/defaults.js", + "./helpers/defineProperty": [ + { + "node": "./helpers/defineProperty.js", + "import": "./helpers/esm/defineProperty.js", + "default": "./helpers/defineProperty.js" + }, + "./helpers/defineProperty.js" + ], + "./helpers/esm/defineProperty": "./helpers/esm/defineProperty.js", + "./helpers/extends": [ + { + "node": "./helpers/extends.js", + "import": "./helpers/esm/extends.js", + "default": "./helpers/extends.js" + }, + "./helpers/extends.js" + ], + "./helpers/esm/extends": "./helpers/esm/extends.js", + "./helpers/objectSpread": [ + { + "node": "./helpers/objectSpread.js", + "import": "./helpers/esm/objectSpread.js", + "default": "./helpers/objectSpread.js" + }, + "./helpers/objectSpread.js" + ], + "./helpers/esm/objectSpread": "./helpers/esm/objectSpread.js", + "./helpers/inherits": [ + { + "node": "./helpers/inherits.js", + "import": "./helpers/esm/inherits.js", + "default": "./helpers/inherits.js" + }, + "./helpers/inherits.js" + ], + "./helpers/esm/inherits": "./helpers/esm/inherits.js", + "./helpers/inheritsLoose": [ + { + "node": "./helpers/inheritsLoose.js", + "import": "./helpers/esm/inheritsLoose.js", + "default": "./helpers/inheritsLoose.js" + }, + "./helpers/inheritsLoose.js" + ], + "./helpers/esm/inheritsLoose": "./helpers/esm/inheritsLoose.js", + "./helpers/getPrototypeOf": [ + { + "node": "./helpers/getPrototypeOf.js", + "import": "./helpers/esm/getPrototypeOf.js", + "default": "./helpers/getPrototypeOf.js" + }, + "./helpers/getPrototypeOf.js" + ], + "./helpers/esm/getPrototypeOf": "./helpers/esm/getPrototypeOf.js", + "./helpers/setPrototypeOf": [ + { + "node": "./helpers/setPrototypeOf.js", + "import": "./helpers/esm/setPrototypeOf.js", + "default": "./helpers/setPrototypeOf.js" + }, + "./helpers/setPrototypeOf.js" + ], + "./helpers/esm/setPrototypeOf": "./helpers/esm/setPrototypeOf.js", + "./helpers/isNativeReflectConstruct": [ + { + "node": "./helpers/isNativeReflectConstruct.js", + "import": "./helpers/esm/isNativeReflectConstruct.js", + "default": "./helpers/isNativeReflectConstruct.js" + }, + "./helpers/isNativeReflectConstruct.js" + ], + "./helpers/esm/isNativeReflectConstruct": "./helpers/esm/isNativeReflectConstruct.js", + "./helpers/construct": [ + { + "node": "./helpers/construct.js", + "import": "./helpers/esm/construct.js", + "default": "./helpers/construct.js" + }, + "./helpers/construct.js" + ], + "./helpers/esm/construct": "./helpers/esm/construct.js", + "./helpers/isNativeFunction": [ + { + "node": "./helpers/isNativeFunction.js", + "import": "./helpers/esm/isNativeFunction.js", + "default": "./helpers/isNativeFunction.js" + }, + "./helpers/isNativeFunction.js" + ], + "./helpers/esm/isNativeFunction": "./helpers/esm/isNativeFunction.js", + "./helpers/wrapNativeSuper": [ + { + "node": "./helpers/wrapNativeSuper.js", + "import": "./helpers/esm/wrapNativeSuper.js", + "default": "./helpers/wrapNativeSuper.js" + }, + "./helpers/wrapNativeSuper.js" + ], + "./helpers/esm/wrapNativeSuper": "./helpers/esm/wrapNativeSuper.js", + "./helpers/instanceof": [ + { + "node": "./helpers/instanceof.js", + "import": "./helpers/esm/instanceof.js", + "default": "./helpers/instanceof.js" + }, + "./helpers/instanceof.js" + ], + "./helpers/esm/instanceof": "./helpers/esm/instanceof.js", + "./helpers/interopRequireDefault": [ + { + "node": "./helpers/interopRequireDefault.js", + "import": "./helpers/esm/interopRequireDefault.js", + "default": "./helpers/interopRequireDefault.js" + }, + "./helpers/interopRequireDefault.js" + ], + "./helpers/esm/interopRequireDefault": "./helpers/esm/interopRequireDefault.js", + "./helpers/interopRequireWildcard": [ + { + "node": "./helpers/interopRequireWildcard.js", + "import": "./helpers/esm/interopRequireWildcard.js", + "default": "./helpers/interopRequireWildcard.js" + }, + "./helpers/interopRequireWildcard.js" + ], + "./helpers/esm/interopRequireWildcard": "./helpers/esm/interopRequireWildcard.js", + "./helpers/newArrowCheck": [ + { + "node": "./helpers/newArrowCheck.js", + "import": "./helpers/esm/newArrowCheck.js", + "default": "./helpers/newArrowCheck.js" + }, + "./helpers/newArrowCheck.js" + ], + "./helpers/esm/newArrowCheck": "./helpers/esm/newArrowCheck.js", + "./helpers/objectDestructuringEmpty": [ + { + "node": "./helpers/objectDestructuringEmpty.js", + "import": "./helpers/esm/objectDestructuringEmpty.js", + "default": "./helpers/objectDestructuringEmpty.js" + }, + "./helpers/objectDestructuringEmpty.js" + ], + "./helpers/esm/objectDestructuringEmpty": "./helpers/esm/objectDestructuringEmpty.js", + "./helpers/objectWithoutPropertiesLoose": [ + { + "node": "./helpers/objectWithoutPropertiesLoose.js", + "import": "./helpers/esm/objectWithoutPropertiesLoose.js", + "default": "./helpers/objectWithoutPropertiesLoose.js" + }, + "./helpers/objectWithoutPropertiesLoose.js" + ], + "./helpers/esm/objectWithoutPropertiesLoose": "./helpers/esm/objectWithoutPropertiesLoose.js", + "./helpers/objectWithoutProperties": [ + { + "node": "./helpers/objectWithoutProperties.js", + "import": "./helpers/esm/objectWithoutProperties.js", + "default": "./helpers/objectWithoutProperties.js" + }, + "./helpers/objectWithoutProperties.js" + ], + "./helpers/esm/objectWithoutProperties": "./helpers/esm/objectWithoutProperties.js", + "./helpers/assertThisInitialized": [ + { + "node": "./helpers/assertThisInitialized.js", + "import": "./helpers/esm/assertThisInitialized.js", + "default": "./helpers/assertThisInitialized.js" + }, + "./helpers/assertThisInitialized.js" + ], + "./helpers/esm/assertThisInitialized": "./helpers/esm/assertThisInitialized.js", + "./helpers/possibleConstructorReturn": [ + { + "node": "./helpers/possibleConstructorReturn.js", + "import": "./helpers/esm/possibleConstructorReturn.js", + "default": "./helpers/possibleConstructorReturn.js" + }, + "./helpers/possibleConstructorReturn.js" + ], + "./helpers/esm/possibleConstructorReturn": "./helpers/esm/possibleConstructorReturn.js", + "./helpers/createSuper": [ + { + "node": "./helpers/createSuper.js", + "import": "./helpers/esm/createSuper.js", + "default": "./helpers/createSuper.js" + }, + "./helpers/createSuper.js" + ], + "./helpers/esm/createSuper": "./helpers/esm/createSuper.js", + "./helpers/superPropBase": [ + { + "node": "./helpers/superPropBase.js", + "import": "./helpers/esm/superPropBase.js", + "default": "./helpers/superPropBase.js" + }, + "./helpers/superPropBase.js" + ], + "./helpers/esm/superPropBase": "./helpers/esm/superPropBase.js", + "./helpers/get": [ + { + "node": "./helpers/get.js", + "import": "./helpers/esm/get.js", + "default": "./helpers/get.js" + }, + "./helpers/get.js" + ], + "./helpers/esm/get": "./helpers/esm/get.js", + "./helpers/set": [ + { + "node": "./helpers/set.js", + "import": "./helpers/esm/set.js", + "default": "./helpers/set.js" + }, + "./helpers/set.js" + ], + "./helpers/esm/set": "./helpers/esm/set.js", + "./helpers/taggedTemplateLiteral": [ + { + "node": "./helpers/taggedTemplateLiteral.js", + "import": "./helpers/esm/taggedTemplateLiteral.js", + "default": "./helpers/taggedTemplateLiteral.js" + }, + "./helpers/taggedTemplateLiteral.js" + ], + "./helpers/esm/taggedTemplateLiteral": "./helpers/esm/taggedTemplateLiteral.js", + "./helpers/taggedTemplateLiteralLoose": [ + { + "node": "./helpers/taggedTemplateLiteralLoose.js", + "import": "./helpers/esm/taggedTemplateLiteralLoose.js", + "default": "./helpers/taggedTemplateLiteralLoose.js" + }, + "./helpers/taggedTemplateLiteralLoose.js" + ], + "./helpers/esm/taggedTemplateLiteralLoose": "./helpers/esm/taggedTemplateLiteralLoose.js", + "./helpers/readOnlyError": [ + { + "node": "./helpers/readOnlyError.js", + "import": "./helpers/esm/readOnlyError.js", + "default": "./helpers/readOnlyError.js" + }, + "./helpers/readOnlyError.js" + ], + "./helpers/esm/readOnlyError": "./helpers/esm/readOnlyError.js", + "./helpers/writeOnlyError": [ + { + "node": "./helpers/writeOnlyError.js", + "import": "./helpers/esm/writeOnlyError.js", + "default": "./helpers/writeOnlyError.js" + }, + "./helpers/writeOnlyError.js" + ], + "./helpers/esm/writeOnlyError": "./helpers/esm/writeOnlyError.js", + "./helpers/classNameTDZError": [ + { + "node": "./helpers/classNameTDZError.js", + "import": "./helpers/esm/classNameTDZError.js", + "default": "./helpers/classNameTDZError.js" + }, + "./helpers/classNameTDZError.js" + ], + "./helpers/esm/classNameTDZError": "./helpers/esm/classNameTDZError.js", + "./helpers/temporalUndefined": [ + { + "node": "./helpers/temporalUndefined.js", + "import": "./helpers/esm/temporalUndefined.js", + "default": "./helpers/temporalUndefined.js" + }, + "./helpers/temporalUndefined.js" + ], + "./helpers/esm/temporalUndefined": "./helpers/esm/temporalUndefined.js", + "./helpers/tdz": [ + { + "node": "./helpers/tdz.js", + "import": "./helpers/esm/tdz.js", + "default": "./helpers/tdz.js" + }, + "./helpers/tdz.js" + ], + "./helpers/esm/tdz": "./helpers/esm/tdz.js", + "./helpers/temporalRef": [ + { + "node": "./helpers/temporalRef.js", + "import": "./helpers/esm/temporalRef.js", + "default": "./helpers/temporalRef.js" + }, + "./helpers/temporalRef.js" + ], + "./helpers/esm/temporalRef": "./helpers/esm/temporalRef.js", + "./helpers/slicedToArray": [ + { + "node": "./helpers/slicedToArray.js", + "import": "./helpers/esm/slicedToArray.js", + "default": "./helpers/slicedToArray.js" + }, + "./helpers/slicedToArray.js" + ], + "./helpers/esm/slicedToArray": "./helpers/esm/slicedToArray.js", + "./helpers/slicedToArrayLoose": [ + { + "node": "./helpers/slicedToArrayLoose.js", + "import": "./helpers/esm/slicedToArrayLoose.js", + "default": "./helpers/slicedToArrayLoose.js" + }, + "./helpers/slicedToArrayLoose.js" + ], + "./helpers/esm/slicedToArrayLoose": "./helpers/esm/slicedToArrayLoose.js", + "./helpers/toArray": [ + { + "node": "./helpers/toArray.js", + "import": "./helpers/esm/toArray.js", + "default": "./helpers/toArray.js" + }, + "./helpers/toArray.js" + ], + "./helpers/esm/toArray": "./helpers/esm/toArray.js", + "./helpers/toConsumableArray": [ + { + "node": "./helpers/toConsumableArray.js", + "import": "./helpers/esm/toConsumableArray.js", + "default": "./helpers/toConsumableArray.js" + }, + "./helpers/toConsumableArray.js" + ], + "./helpers/esm/toConsumableArray": "./helpers/esm/toConsumableArray.js", + "./helpers/arrayWithoutHoles": [ + { + "node": "./helpers/arrayWithoutHoles.js", + "import": "./helpers/esm/arrayWithoutHoles.js", + "default": "./helpers/arrayWithoutHoles.js" + }, + "./helpers/arrayWithoutHoles.js" + ], + "./helpers/esm/arrayWithoutHoles": "./helpers/esm/arrayWithoutHoles.js", + "./helpers/arrayWithHoles": [ + { + "node": "./helpers/arrayWithHoles.js", + "import": "./helpers/esm/arrayWithHoles.js", + "default": "./helpers/arrayWithHoles.js" + }, + "./helpers/arrayWithHoles.js" + ], + "./helpers/esm/arrayWithHoles": "./helpers/esm/arrayWithHoles.js", + "./helpers/maybeArrayLike": [ + { + "node": "./helpers/maybeArrayLike.js", + "import": "./helpers/esm/maybeArrayLike.js", + "default": "./helpers/maybeArrayLike.js" + }, + "./helpers/maybeArrayLike.js" + ], + "./helpers/esm/maybeArrayLike": "./helpers/esm/maybeArrayLike.js", + "./helpers/iterableToArray": [ + { + "node": "./helpers/iterableToArray.js", + "import": "./helpers/esm/iterableToArray.js", + "default": "./helpers/iterableToArray.js" + }, + "./helpers/iterableToArray.js" + ], + "./helpers/esm/iterableToArray": "./helpers/esm/iterableToArray.js", + "./helpers/iterableToArrayLimit": [ + { + "node": "./helpers/iterableToArrayLimit.js", + "import": "./helpers/esm/iterableToArrayLimit.js", + "default": "./helpers/iterableToArrayLimit.js" + }, + "./helpers/iterableToArrayLimit.js" + ], + "./helpers/esm/iterableToArrayLimit": "./helpers/esm/iterableToArrayLimit.js", + "./helpers/iterableToArrayLimitLoose": [ + { + "node": "./helpers/iterableToArrayLimitLoose.js", + "import": "./helpers/esm/iterableToArrayLimitLoose.js", + "default": "./helpers/iterableToArrayLimitLoose.js" + }, + "./helpers/iterableToArrayLimitLoose.js" + ], + "./helpers/esm/iterableToArrayLimitLoose": "./helpers/esm/iterableToArrayLimitLoose.js", + "./helpers/unsupportedIterableToArray": [ + { + "node": "./helpers/unsupportedIterableToArray.js", + "import": "./helpers/esm/unsupportedIterableToArray.js", + "default": "./helpers/unsupportedIterableToArray.js" + }, + "./helpers/unsupportedIterableToArray.js" + ], + "./helpers/esm/unsupportedIterableToArray": "./helpers/esm/unsupportedIterableToArray.js", + "./helpers/arrayLikeToArray": [ + { + "node": "./helpers/arrayLikeToArray.js", + "import": "./helpers/esm/arrayLikeToArray.js", + "default": "./helpers/arrayLikeToArray.js" + }, + "./helpers/arrayLikeToArray.js" + ], + "./helpers/esm/arrayLikeToArray": "./helpers/esm/arrayLikeToArray.js", + "./helpers/nonIterableSpread": [ + { + "node": "./helpers/nonIterableSpread.js", + "import": "./helpers/esm/nonIterableSpread.js", + "default": "./helpers/nonIterableSpread.js" + }, + "./helpers/nonIterableSpread.js" + ], + "./helpers/esm/nonIterableSpread": "./helpers/esm/nonIterableSpread.js", + "./helpers/nonIterableRest": [ + { + "node": "./helpers/nonIterableRest.js", + "import": "./helpers/esm/nonIterableRest.js", + "default": "./helpers/nonIterableRest.js" + }, + "./helpers/nonIterableRest.js" + ], + "./helpers/esm/nonIterableRest": "./helpers/esm/nonIterableRest.js", + "./helpers/createForOfIteratorHelper": [ + { + "node": "./helpers/createForOfIteratorHelper.js", + "import": "./helpers/esm/createForOfIteratorHelper.js", + "default": "./helpers/createForOfIteratorHelper.js" + }, + "./helpers/createForOfIteratorHelper.js" + ], + "./helpers/esm/createForOfIteratorHelper": "./helpers/esm/createForOfIteratorHelper.js", + "./helpers/createForOfIteratorHelperLoose": [ + { + "node": "./helpers/createForOfIteratorHelperLoose.js", + "import": "./helpers/esm/createForOfIteratorHelperLoose.js", + "default": "./helpers/createForOfIteratorHelperLoose.js" + }, + "./helpers/createForOfIteratorHelperLoose.js" + ], + "./helpers/esm/createForOfIteratorHelperLoose": "./helpers/esm/createForOfIteratorHelperLoose.js", + "./helpers/skipFirstGeneratorNext": [ + { + "node": "./helpers/skipFirstGeneratorNext.js", + "import": "./helpers/esm/skipFirstGeneratorNext.js", + "default": "./helpers/skipFirstGeneratorNext.js" + }, + "./helpers/skipFirstGeneratorNext.js" + ], + "./helpers/esm/skipFirstGeneratorNext": "./helpers/esm/skipFirstGeneratorNext.js", + "./helpers/toPrimitive": [ + { + "node": "./helpers/toPrimitive.js", + "import": "./helpers/esm/toPrimitive.js", + "default": "./helpers/toPrimitive.js" + }, + "./helpers/toPrimitive.js" + ], + "./helpers/esm/toPrimitive": "./helpers/esm/toPrimitive.js", + "./helpers/toPropertyKey": [ + { + "node": "./helpers/toPropertyKey.js", + "import": "./helpers/esm/toPropertyKey.js", + "default": "./helpers/toPropertyKey.js" + }, + "./helpers/toPropertyKey.js" + ], + "./helpers/esm/toPropertyKey": "./helpers/esm/toPropertyKey.js", + "./helpers/initializerWarningHelper": [ + { + "node": "./helpers/initializerWarningHelper.js", + "import": "./helpers/esm/initializerWarningHelper.js", + "default": "./helpers/initializerWarningHelper.js" + }, + "./helpers/initializerWarningHelper.js" + ], + "./helpers/esm/initializerWarningHelper": "./helpers/esm/initializerWarningHelper.js", + "./helpers/initializerDefineProperty": [ + { + "node": "./helpers/initializerDefineProperty.js", + "import": "./helpers/esm/initializerDefineProperty.js", + "default": "./helpers/initializerDefineProperty.js" + }, + "./helpers/initializerDefineProperty.js" + ], + "./helpers/esm/initializerDefineProperty": "./helpers/esm/initializerDefineProperty.js", + "./helpers/applyDecoratedDescriptor": [ + { + "node": "./helpers/applyDecoratedDescriptor.js", + "import": "./helpers/esm/applyDecoratedDescriptor.js", + "default": "./helpers/applyDecoratedDescriptor.js" + }, + "./helpers/applyDecoratedDescriptor.js" + ], + "./helpers/esm/applyDecoratedDescriptor": "./helpers/esm/applyDecoratedDescriptor.js", + "./helpers/classPrivateFieldLooseKey": [ + { + "node": "./helpers/classPrivateFieldLooseKey.js", + "import": "./helpers/esm/classPrivateFieldLooseKey.js", + "default": "./helpers/classPrivateFieldLooseKey.js" + }, + "./helpers/classPrivateFieldLooseKey.js" + ], + "./helpers/esm/classPrivateFieldLooseKey": "./helpers/esm/classPrivateFieldLooseKey.js", + "./helpers/classPrivateFieldLooseBase": [ + { + "node": "./helpers/classPrivateFieldLooseBase.js", + "import": "./helpers/esm/classPrivateFieldLooseBase.js", + "default": "./helpers/classPrivateFieldLooseBase.js" + }, + "./helpers/classPrivateFieldLooseBase.js" + ], + "./helpers/esm/classPrivateFieldLooseBase": "./helpers/esm/classPrivateFieldLooseBase.js", + "./helpers/classPrivateFieldGet": [ + { + "node": "./helpers/classPrivateFieldGet.js", + "import": "./helpers/esm/classPrivateFieldGet.js", + "default": "./helpers/classPrivateFieldGet.js" + }, + "./helpers/classPrivateFieldGet.js" + ], + "./helpers/esm/classPrivateFieldGet": "./helpers/esm/classPrivateFieldGet.js", + "./helpers/classPrivateFieldSet": [ + { + "node": "./helpers/classPrivateFieldSet.js", + "import": "./helpers/esm/classPrivateFieldSet.js", + "default": "./helpers/classPrivateFieldSet.js" + }, + "./helpers/classPrivateFieldSet.js" + ], + "./helpers/esm/classPrivateFieldSet": "./helpers/esm/classPrivateFieldSet.js", + "./helpers/classPrivateFieldDestructureSet": [ + { + "node": "./helpers/classPrivateFieldDestructureSet.js", + "import": "./helpers/esm/classPrivateFieldDestructureSet.js", + "default": "./helpers/classPrivateFieldDestructureSet.js" + }, + "./helpers/classPrivateFieldDestructureSet.js" + ], + "./helpers/esm/classPrivateFieldDestructureSet": "./helpers/esm/classPrivateFieldDestructureSet.js", + "./helpers/classExtractFieldDescriptor": [ + { + "node": "./helpers/classExtractFieldDescriptor.js", + "import": "./helpers/esm/classExtractFieldDescriptor.js", + "default": "./helpers/classExtractFieldDescriptor.js" + }, + "./helpers/classExtractFieldDescriptor.js" + ], + "./helpers/esm/classExtractFieldDescriptor": "./helpers/esm/classExtractFieldDescriptor.js", + "./helpers/classStaticPrivateFieldSpecGet": [ + { + "node": "./helpers/classStaticPrivateFieldSpecGet.js", + "import": "./helpers/esm/classStaticPrivateFieldSpecGet.js", + "default": "./helpers/classStaticPrivateFieldSpecGet.js" + }, + "./helpers/classStaticPrivateFieldSpecGet.js" + ], + "./helpers/esm/classStaticPrivateFieldSpecGet": "./helpers/esm/classStaticPrivateFieldSpecGet.js", + "./helpers/classStaticPrivateFieldSpecSet": [ + { + "node": "./helpers/classStaticPrivateFieldSpecSet.js", + "import": "./helpers/esm/classStaticPrivateFieldSpecSet.js", + "default": "./helpers/classStaticPrivateFieldSpecSet.js" + }, + "./helpers/classStaticPrivateFieldSpecSet.js" + ], + "./helpers/esm/classStaticPrivateFieldSpecSet": "./helpers/esm/classStaticPrivateFieldSpecSet.js", + "./helpers/classStaticPrivateMethodGet": [ + { + "node": "./helpers/classStaticPrivateMethodGet.js", + "import": "./helpers/esm/classStaticPrivateMethodGet.js", + "default": "./helpers/classStaticPrivateMethodGet.js" + }, + "./helpers/classStaticPrivateMethodGet.js" + ], + "./helpers/esm/classStaticPrivateMethodGet": "./helpers/esm/classStaticPrivateMethodGet.js", + "./helpers/classStaticPrivateMethodSet": [ + { + "node": "./helpers/classStaticPrivateMethodSet.js", + "import": "./helpers/esm/classStaticPrivateMethodSet.js", + "default": "./helpers/classStaticPrivateMethodSet.js" + }, + "./helpers/classStaticPrivateMethodSet.js" + ], + "./helpers/esm/classStaticPrivateMethodSet": "./helpers/esm/classStaticPrivateMethodSet.js", + "./helpers/classApplyDescriptorGet": [ + { + "node": "./helpers/classApplyDescriptorGet.js", + "import": "./helpers/esm/classApplyDescriptorGet.js", + "default": "./helpers/classApplyDescriptorGet.js" + }, + "./helpers/classApplyDescriptorGet.js" + ], + "./helpers/esm/classApplyDescriptorGet": "./helpers/esm/classApplyDescriptorGet.js", + "./helpers/classApplyDescriptorSet": [ + { + "node": "./helpers/classApplyDescriptorSet.js", + "import": "./helpers/esm/classApplyDescriptorSet.js", + "default": "./helpers/classApplyDescriptorSet.js" + }, + "./helpers/classApplyDescriptorSet.js" + ], + "./helpers/esm/classApplyDescriptorSet": "./helpers/esm/classApplyDescriptorSet.js", + "./helpers/classApplyDescriptorDestructureSet": [ + { + "node": "./helpers/classApplyDescriptorDestructureSet.js", + "import": "./helpers/esm/classApplyDescriptorDestructureSet.js", + "default": "./helpers/classApplyDescriptorDestructureSet.js" + }, + "./helpers/classApplyDescriptorDestructureSet.js" + ], + "./helpers/esm/classApplyDescriptorDestructureSet": "./helpers/esm/classApplyDescriptorDestructureSet.js", + "./helpers/classStaticPrivateFieldDestructureSet": [ + { + "node": "./helpers/classStaticPrivateFieldDestructureSet.js", + "import": "./helpers/esm/classStaticPrivateFieldDestructureSet.js", + "default": "./helpers/classStaticPrivateFieldDestructureSet.js" + }, + "./helpers/classStaticPrivateFieldDestructureSet.js" + ], + "./helpers/esm/classStaticPrivateFieldDestructureSet": "./helpers/esm/classStaticPrivateFieldDestructureSet.js", + "./helpers/classCheckPrivateStaticAccess": [ + { + "node": "./helpers/classCheckPrivateStaticAccess.js", + "import": "./helpers/esm/classCheckPrivateStaticAccess.js", + "default": "./helpers/classCheckPrivateStaticAccess.js" + }, + "./helpers/classCheckPrivateStaticAccess.js" + ], + "./helpers/esm/classCheckPrivateStaticAccess": "./helpers/esm/classCheckPrivateStaticAccess.js", + "./helpers/classCheckPrivateStaticFieldDescriptor": [ + { + "node": "./helpers/classCheckPrivateStaticFieldDescriptor.js", + "import": "./helpers/esm/classCheckPrivateStaticFieldDescriptor.js", + "default": "./helpers/classCheckPrivateStaticFieldDescriptor.js" + }, + "./helpers/classCheckPrivateStaticFieldDescriptor.js" + ], + "./helpers/esm/classCheckPrivateStaticFieldDescriptor": "./helpers/esm/classCheckPrivateStaticFieldDescriptor.js", + "./helpers/decorate": [ + { + "node": "./helpers/decorate.js", + "import": "./helpers/esm/decorate.js", + "default": "./helpers/decorate.js" + }, + "./helpers/decorate.js" + ], + "./helpers/esm/decorate": "./helpers/esm/decorate.js", + "./helpers/classPrivateMethodGet": [ + { + "node": "./helpers/classPrivateMethodGet.js", + "import": "./helpers/esm/classPrivateMethodGet.js", + "default": "./helpers/classPrivateMethodGet.js" + }, + "./helpers/classPrivateMethodGet.js" + ], + "./helpers/esm/classPrivateMethodGet": "./helpers/esm/classPrivateMethodGet.js", + "./helpers/checkPrivateRedeclaration": [ + { + "node": "./helpers/checkPrivateRedeclaration.js", + "import": "./helpers/esm/checkPrivateRedeclaration.js", + "default": "./helpers/checkPrivateRedeclaration.js" + }, + "./helpers/checkPrivateRedeclaration.js" + ], + "./helpers/esm/checkPrivateRedeclaration": "./helpers/esm/checkPrivateRedeclaration.js", + "./helpers/classPrivateFieldInitSpec": [ + { + "node": "./helpers/classPrivateFieldInitSpec.js", + "import": "./helpers/esm/classPrivateFieldInitSpec.js", + "default": "./helpers/classPrivateFieldInitSpec.js" + }, + "./helpers/classPrivateFieldInitSpec.js" + ], + "./helpers/esm/classPrivateFieldInitSpec": "./helpers/esm/classPrivateFieldInitSpec.js", + "./helpers/classPrivateMethodInitSpec": [ + { + "node": "./helpers/classPrivateMethodInitSpec.js", + "import": "./helpers/esm/classPrivateMethodInitSpec.js", + "default": "./helpers/classPrivateMethodInitSpec.js" + }, + "./helpers/classPrivateMethodInitSpec.js" + ], + "./helpers/esm/classPrivateMethodInitSpec": "./helpers/esm/classPrivateMethodInitSpec.js", + "./helpers/classPrivateMethodSet": [ + { + "node": "./helpers/classPrivateMethodSet.js", + "import": "./helpers/esm/classPrivateMethodSet.js", + "default": "./helpers/classPrivateMethodSet.js" + }, + "./helpers/classPrivateMethodSet.js" + ], + "./helpers/esm/classPrivateMethodSet": "./helpers/esm/classPrivateMethodSet.js", + "./helpers/identity": [ + { + "node": "./helpers/identity.js", + "import": "./helpers/esm/identity.js", + "default": "./helpers/identity.js" + }, + "./helpers/identity.js" + ], + "./helpers/esm/identity": "./helpers/esm/identity.js", + "./package": "./package.json", + "./package.json": "./package.json", + "./regenerator": "./regenerator/index.js", + "./regenerator/*.js": "./regenerator/*.js", + "./regenerator/": "./regenerator/" + }, + "engines": { + "node": ">=6.9.0" + } +} \ No newline at end of file diff --git a/node_modules/@babel/runtime/regenerator/index.js b/node_modules/@babel/runtime/regenerator/index.js new file mode 100644 index 0000000..9fd4158 --- /dev/null +++ b/node_modules/@babel/runtime/regenerator/index.js @@ -0,0 +1 @@ +module.exports = require("regenerator-runtime"); diff --git a/node_modules/@types/js-yaml/LICENSE b/node_modules/@types/js-yaml/LICENSE new file mode 100755 index 0000000..9e841e7 --- /dev/null +++ b/node_modules/@types/js-yaml/LICENSE @@ -0,0 +1,21 @@ + MIT License + + Copyright (c) Microsoft Corporation. + + Permission is hereby granted, free of charge, to any person obtaining a copy + of this software and associated documentation files (the "Software"), to deal + in the Software without restriction, including without limitation the rights + to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + copies of the Software, and to permit persons to whom the Software is + furnished to do so, subject to the following conditions: + + The above copyright notice and this permission notice shall be included in all + copies or substantial portions of the Software. + + THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE + SOFTWARE diff --git a/node_modules/@types/js-yaml/README.md b/node_modules/@types/js-yaml/README.md new file mode 100755 index 0000000..fbd44dd --- /dev/null +++ b/node_modules/@types/js-yaml/README.md @@ -0,0 +1,16 @@ +# Installation +> `npm install --save @types/js-yaml` + +# Summary +This package contains type definitions for js-yaml (https://github.com/nodeca/js-yaml). + +# Details +Files were exported from https://github.com/DefinitelyTyped/DefinitelyTyped/tree/master/types/js-yaml. + +### Additional Details + * Last updated: Fri, 19 Nov 2021 18:01:12 GMT + * Dependencies: none + * Global values: `jsyaml` + +# Credits +These definitions were written by [Bart van der Schoor](https://github.com/Bartvds), [Sebastian Clausen](https://github.com/sclausen), [ExE Boss](https://github.com/ExE-Boss), [Armaan Tobaccowalla](https://github.com/ArmaanT), and [Linus Unnebäck](https://github.com/LinusU). diff --git a/node_modules/@types/js-yaml/index.d.mts b/node_modules/@types/js-yaml/index.d.mts new file mode 100755 index 0000000..8faff01 --- /dev/null +++ b/node_modules/@types/js-yaml/index.d.mts @@ -0,0 +1,2 @@ +export * from "./index.js"; +export { default } from "./index.js"; \ No newline at end of file diff --git a/node_modules/@types/js-yaml/index.d.ts b/node_modules/@types/js-yaml/index.d.ts new file mode 100755 index 0000000..cfb9b45 --- /dev/null +++ b/node_modules/@types/js-yaml/index.d.ts @@ -0,0 +1,154 @@ +// Type definitions for js-yaml 4.0 +// Project: https://github.com/nodeca/js-yaml +// Definitions by: Bart van der Schoor +// Sebastian Clausen +// ExE Boss +// Armaan Tobaccowalla +// Linus Unnebäck +// Definitions: https://github.com/DefinitelyTyped/DefinitelyTyped +// TypeScript Version: 2.2 + +export as namespace jsyaml; + +export function load(str: string, opts?: LoadOptions): unknown; + +export class Type { + constructor(tag: string, opts?: TypeConstructorOptions); + kind: 'sequence' | 'scalar' | 'mapping' | null; + resolve(data: any): boolean; + construct(data: any, type?: string): any; + instanceOf: object | null; + predicate: ((data: object) => boolean) | null; + represent: ((data: object) => any) | { [x: string]: (data: object) => any } | null; + representName: ((data: object) => any) | null; + defaultStyle: string | null; + multi: boolean; + styleAliases: { [x: string]: any }; +} + +export class Schema { + constructor(definition: SchemaDefinition | Type[] | Type); + extend(types: SchemaDefinition | Type[] | Type): Schema; +} + +export function loadAll(str: string, iterator?: null, opts?: LoadOptions): unknown[]; +export function loadAll(str: string, iterator: (doc: unknown) => void, opts?: LoadOptions): void; + +export function dump(obj: any, opts?: DumpOptions): string; + +export interface LoadOptions { + /** string to be used as a file path in error/warning messages. */ + filename?: string | undefined; + /** function to call on warning messages. */ + onWarning?(this: null, e: YAMLException): void; + /** specifies a schema to use. */ + schema?: Schema | undefined; + /** compatibility with JSON.parse behaviour. */ + json?: boolean | undefined; + /** listener for parse events */ + listener?(this: State, eventType: EventType, state: State): void; +} + +export type EventType = 'open' | 'close'; + +export interface State { + input: string; + filename: string | null; + schema: Schema; + onWarning: (this: null, e: YAMLException) => void; + json: boolean; + length: number; + position: number; + line: number; + lineStart: number; + lineIndent: number; + version: null | number; + checkLineBreaks: boolean; + kind: string; + result: any; + implicitTypes: Type[]; +} + +export interface DumpOptions { + /** indentation width to use (in spaces). */ + indent?: number | undefined; + /** when true, will not add an indentation level to array elements */ + noArrayIndent?: boolean | undefined; + /** do not throw on invalid types (like function in the safe schema) and skip pairs and single values with such types. */ + skipInvalid?: boolean | undefined; + /** specifies level of nesting, when to switch from block to flow style for collections. -1 means block style everwhere */ + flowLevel?: number | undefined; + /** Each tag may have own set of styles. - "tag" => "style" map. */ + styles?: { [x: string]: any } | undefined; + /** specifies a schema to use. */ + schema?: Schema | undefined; + /** if true, sort keys when dumping YAML. If a function, use the function to sort the keys. (default: false) */ + sortKeys?: boolean | ((a: any, b: any) => number) | undefined; + /** set max line width. (default: 80) */ + lineWidth?: number | undefined; + /** if true, don't convert duplicate objects into references (default: false) */ + noRefs?: boolean | undefined; + /** if true don't try to be compatible with older yaml versions. Currently: don't quote "yes", "no" and so on, as required for YAML 1.1 (default: false) */ + noCompatMode?: boolean | undefined; + /** + * if true flow sequences will be condensed, omitting the space between `key: value` or `a, b`. Eg. `'[a,b]'` or `{a:{b:c}}`. + * Can be useful when using yaml for pretty URL query params as spaces are %-encoded. (default: false). + */ + condenseFlow?: boolean | undefined; + /** strings will be quoted using this quoting style. If you specify single quotes, double quotes will still be used for non-printable characters. (default: `'`) */ + quotingType?: "'" | '"' | undefined; + /** if true, all non-key strings will be quoted even if they normally don't need to. (default: false) */ + forceQuotes?: boolean | undefined; + /** callback `function (key, value)` called recursively on each key/value in source object (see `replacer` docs for `JSON.stringify`). */ + replacer?: ((key: string, value: any) => any) | undefined; +} + +export interface TypeConstructorOptions { + kind?: 'sequence' | 'scalar' | 'mapping' | undefined; + resolve?: ((data: any) => boolean) | undefined; + construct?: ((data: any, type?: string) => any) | undefined; + instanceOf?: object | undefined; + predicate?: ((data: object) => boolean) | undefined; + represent?: ((data: object) => any) | { [x: string]: (data: object) => any } | undefined; + representName?: ((data: object) => any) | undefined; + defaultStyle?: string | undefined; + multi?: boolean | undefined; + styleAliases?: { [x: string]: any } | undefined; +} + +export interface SchemaDefinition { + implicit?: Type[] | undefined; + explicit?: Type[] | undefined; +} + +/** only strings, arrays and plain objects: http://www.yaml.org/spec/1.2/spec.html#id2802346 */ +export let FAILSAFE_SCHEMA: Schema; +/** only strings, arrays and plain objects: http://www.yaml.org/spec/1.2/spec.html#id2802346 */ +export let JSON_SCHEMA: Schema; +/** same as JSON_SCHEMA: http://www.yaml.org/spec/1.2/spec.html#id2804923 */ +export let CORE_SCHEMA: Schema; +/** all supported YAML types */ +export let DEFAULT_SCHEMA: Schema; + +export interface Mark { + buffer: string; + column: number; + line: number; + name: string; + position: number; + snippet: string; +} + +export class YAMLException extends Error { + constructor(reason?: string, mark?: Mark); + + toString(compact?: boolean): string; + + name: string; + + reason: string; + + message: string; + + mark: Mark; +} diff --git a/node_modules/@types/js-yaml/package.json b/node_modules/@types/js-yaml/package.json new file mode 100755 index 0000000..1d8d7e9 --- /dev/null +++ b/node_modules/@types/js-yaml/package.json @@ -0,0 +1,53 @@ +{ + "name": "@types/js-yaml", + "version": "4.0.5", + "description": "TypeScript definitions for js-yaml", + "homepage": "https://github.com/DefinitelyTyped/DefinitelyTyped/tree/master/types/js-yaml", + "license": "MIT", + "contributors": [ + { + "name": "Bart van der Schoor", + "url": "https://github.com/Bartvds", + "githubUsername": "Bartvds" + }, + { + "name": "Sebastian Clausen", + "url": "https://github.com/sclausen", + "githubUsername": "sclausen" + }, + { + "name": "ExE Boss", + "url": "https://github.com/ExE-Boss", + "githubUsername": "ExE-Boss" + }, + { + "name": "Armaan Tobaccowalla", + "url": "https://github.com/ArmaanT", + "githubUsername": "ArmaanT" + }, + { + "name": "Linus Unnebäck", + "url": "https://github.com/LinusU", + "githubUsername": "LinusU" + } + ], + "main": "", + "types": "index.d.ts", + "repository": { + "type": "git", + "url": "https://github.com/DefinitelyTyped/DefinitelyTyped.git", + "directory": "types/js-yaml" + }, + "scripts": {}, + "dependencies": {}, + "typesPublisherContentHash": "6f40877154edac83ffa22d53a6aca74f151a0d094074c81ce7fb21df57ea5725", + "typeScriptVersion": "3.8", + "exports": { + ".": { + "types": { + "import": "./index.d.mts", + "default": "./index.d.ts" + } + } + } +} \ No newline at end of file diff --git a/node_modules/argparse/CHANGELOG.md b/node_modules/argparse/CHANGELOG.md new file mode 100644 index 0000000..dc39ed6 --- /dev/null +++ b/node_modules/argparse/CHANGELOG.md @@ -0,0 +1,216 @@ +# Changelog + +All notable changes to this project will be documented in this file. + +The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/), +and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html). + + +## [2.0.1] - 2020-08-29 +### Fixed +- Fix issue with `process.argv` when used with interpreters (`coffee`, `ts-node`, etc.), #150. + + +## [2.0.0] - 2020-08-14 +### Changed +- Full rewrite. Now port from python 3.9.0 & more precise following. + See [doc](./doc) for difference and migration info. +- node.js 10+ required +- Removed most of local docs in favour of original ones. + + +## [1.0.10] - 2018-02-15 +### Fixed +- Use .concat instead of + for arrays, #122. + + +## [1.0.9] - 2016-09-29 +### Changed +- Rerelease after 1.0.8 - deps cleanup. + + +## [1.0.8] - 2016-09-29 +### Changed +- Maintenance (deps bump, fix node 6.5+ tests, coverage report). + + +## [1.0.7] - 2016-03-17 +### Changed +- Teach `addArgument` to accept string arg names. #97, @tomxtobin. + + +## [1.0.6] - 2016-02-06 +### Changed +- Maintenance: moved to eslint & updated CS. + + +## [1.0.5] - 2016-02-05 +### Changed +- Removed lodash dependency to significantly reduce install size. + Thanks to @mourner. + + +## [1.0.4] - 2016-01-17 +### Changed +- Maintenance: lodash update to 4.0.0. + + +## [1.0.3] - 2015-10-27 +### Fixed +- Fix parse `=` in args: `--examplepath="C:\myfolder\env=x64"`. #84, @CatWithApple. + + +## [1.0.2] - 2015-03-22 +### Changed +- Relaxed lodash version dependency. + + +## [1.0.1] - 2015-02-20 +### Changed +- Changed dependencies to be compatible with ancient nodejs. + + +## [1.0.0] - 2015-02-19 +### Changed +- Maintenance release. +- Replaced `underscore` with `lodash`. +- Bumped version to 1.0.0 to better reflect semver meaning. +- HISTORY.md -> CHANGELOG.md + + +## [0.1.16] - 2013-12-01 +### Changed +- Maintenance release. Updated dependencies and docs. + + +## [0.1.15] - 2013-05-13 +### Fixed +- Fixed #55, @trebor89 + + +## [0.1.14] - 2013-05-12 +### Fixed +- Fixed #62, @maxtaco + + +## [0.1.13] - 2013-04-08 +### Changed +- Added `.npmignore` to reduce package size + + +## [0.1.12] - 2013-02-10 +### Fixed +- Fixed conflictHandler (#46), @hpaulj + + +## [0.1.11] - 2013-02-07 +### Added +- Added 70+ tests (ported from python), @hpaulj +- Added conflictHandler, @applepicke +- Added fromfilePrefixChar, @hpaulj + +### Fixed +- Multiple bugfixes, @hpaulj + + +## [0.1.10] - 2012-12-30 +### Added +- Added [mutual exclusion](http://docs.python.org/dev/library/argparse.html#mutual-exclusion) + support, thanks to @hpaulj + +### Fixed +- Fixed options check for `storeConst` & `appendConst` actions, thanks to @hpaulj + + +## [0.1.9] - 2012-12-27 +### Fixed +- Fixed option dest interferens with other options (issue #23), thanks to @hpaulj +- Fixed default value behavior with `*` positionals, thanks to @hpaulj +- Improve `getDefault()` behavior, thanks to @hpaulj +- Improve negative argument parsing, thanks to @hpaulj + + +## [0.1.8] - 2012-12-01 +### Fixed +- Fixed parser parents (issue #19), thanks to @hpaulj +- Fixed negative argument parse (issue #20), thanks to @hpaulj + + +## [0.1.7] - 2012-10-14 +### Fixed +- Fixed 'choices' argument parse (issue #16) +- Fixed stderr output (issue #15) + + +## [0.1.6] - 2012-09-09 +### Fixed +- Fixed check for conflict of options (thanks to @tomxtobin) + + +## [0.1.5] - 2012-09-03 +### Fixed +- Fix parser #setDefaults method (thanks to @tomxtobin) + + +## [0.1.4] - 2012-07-30 +### Fixed +- Fixed pseudo-argument support (thanks to @CGamesPlay) +- Fixed addHelp default (should be true), if not set (thanks to @benblank) + + +## [0.1.3] - 2012-06-27 +### Fixed +- Fixed formatter api name: Formatter -> HelpFormatter + + +## [0.1.2] - 2012-05-29 +### Fixed +- Removed excess whitespace in help +- Fixed error reporting, when parcer with subcommands + called with empty arguments + +### Added +- Added basic tests + + +## [0.1.1] - 2012-05-23 +### Fixed +- Fixed line wrapping in help formatter +- Added better error reporting on invalid arguments + + +## [0.1.0] - 2012-05-16 +### Added +- First release. + + +[2.0.1]: https://github.com/nodeca/argparse/compare/2.0.0...2.0.1 +[2.0.0]: https://github.com/nodeca/argparse/compare/1.0.10...2.0.0 +[1.0.10]: https://github.com/nodeca/argparse/compare/1.0.9...1.0.10 +[1.0.9]: https://github.com/nodeca/argparse/compare/1.0.8...1.0.9 +[1.0.8]: https://github.com/nodeca/argparse/compare/1.0.7...1.0.8 +[1.0.7]: https://github.com/nodeca/argparse/compare/1.0.6...1.0.7 +[1.0.6]: https://github.com/nodeca/argparse/compare/1.0.5...1.0.6 +[1.0.5]: https://github.com/nodeca/argparse/compare/1.0.4...1.0.5 +[1.0.4]: https://github.com/nodeca/argparse/compare/1.0.3...1.0.4 +[1.0.3]: https://github.com/nodeca/argparse/compare/1.0.2...1.0.3 +[1.0.2]: https://github.com/nodeca/argparse/compare/1.0.1...1.0.2 +[1.0.1]: https://github.com/nodeca/argparse/compare/1.0.0...1.0.1 +[1.0.0]: https://github.com/nodeca/argparse/compare/0.1.16...1.0.0 +[0.1.16]: https://github.com/nodeca/argparse/compare/0.1.15...0.1.16 +[0.1.15]: https://github.com/nodeca/argparse/compare/0.1.14...0.1.15 +[0.1.14]: https://github.com/nodeca/argparse/compare/0.1.13...0.1.14 +[0.1.13]: https://github.com/nodeca/argparse/compare/0.1.12...0.1.13 +[0.1.12]: https://github.com/nodeca/argparse/compare/0.1.11...0.1.12 +[0.1.11]: https://github.com/nodeca/argparse/compare/0.1.10...0.1.11 +[0.1.10]: https://github.com/nodeca/argparse/compare/0.1.9...0.1.10 +[0.1.9]: https://github.com/nodeca/argparse/compare/0.1.8...0.1.9 +[0.1.8]: https://github.com/nodeca/argparse/compare/0.1.7...0.1.8 +[0.1.7]: https://github.com/nodeca/argparse/compare/0.1.6...0.1.7 +[0.1.6]: https://github.com/nodeca/argparse/compare/0.1.5...0.1.6 +[0.1.5]: https://github.com/nodeca/argparse/compare/0.1.4...0.1.5 +[0.1.4]: https://github.com/nodeca/argparse/compare/0.1.3...0.1.4 +[0.1.3]: https://github.com/nodeca/argparse/compare/0.1.2...0.1.3 +[0.1.2]: https://github.com/nodeca/argparse/compare/0.1.1...0.1.2 +[0.1.1]: https://github.com/nodeca/argparse/compare/0.1.0...0.1.1 +[0.1.0]: https://github.com/nodeca/argparse/releases/tag/0.1.0 diff --git a/node_modules/argparse/LICENSE b/node_modules/argparse/LICENSE new file mode 100644 index 0000000..66a3ac8 --- /dev/null +++ b/node_modules/argparse/LICENSE @@ -0,0 +1,254 @@ +A. HISTORY OF THE SOFTWARE +========================== + +Python was created in the early 1990s by Guido van Rossum at Stichting +Mathematisch Centrum (CWI, see http://www.cwi.nl) in the Netherlands +as a successor of a language called ABC. Guido remains Python's +principal author, although it includes many contributions from others. + +In 1995, Guido continued his work on Python at the Corporation for +National Research Initiatives (CNRI, see http://www.cnri.reston.va.us) +in Reston, Virginia where he released several versions of the +software. + +In May 2000, Guido and the Python core development team moved to +BeOpen.com to form the BeOpen PythonLabs team. In October of the same +year, the PythonLabs team moved to Digital Creations, which became +Zope Corporation. In 2001, the Python Software Foundation (PSF, see +https://www.python.org/psf/) was formed, a non-profit organization +created specifically to own Python-related Intellectual Property. +Zope Corporation was a sponsoring member of the PSF. + +All Python releases are Open Source (see http://www.opensource.org for +the Open Source Definition). Historically, most, but not all, Python +releases have also been GPL-compatible; the table below summarizes +the various releases. + + Release Derived Year Owner GPL- + from compatible? (1) + + 0.9.0 thru 1.2 1991-1995 CWI yes + 1.3 thru 1.5.2 1.2 1995-1999 CNRI yes + 1.6 1.5.2 2000 CNRI no + 2.0 1.6 2000 BeOpen.com no + 1.6.1 1.6 2001 CNRI yes (2) + 2.1 2.0+1.6.1 2001 PSF no + 2.0.1 2.0+1.6.1 2001 PSF yes + 2.1.1 2.1+2.0.1 2001 PSF yes + 2.1.2 2.1.1 2002 PSF yes + 2.1.3 2.1.2 2002 PSF yes + 2.2 and above 2.1.1 2001-now PSF yes + +Footnotes: + +(1) GPL-compatible doesn't mean that we're distributing Python under + the GPL. All Python licenses, unlike the GPL, let you distribute + a modified version without making your changes open source. The + GPL-compatible licenses make it possible to combine Python with + other software that is released under the GPL; the others don't. + +(2) According to Richard Stallman, 1.6.1 is not GPL-compatible, + because its license has a choice of law clause. According to + CNRI, however, Stallman's lawyer has told CNRI's lawyer that 1.6.1 + is "not incompatible" with the GPL. + +Thanks to the many outside volunteers who have worked under Guido's +direction to make these releases possible. + + +B. TERMS AND CONDITIONS FOR ACCESSING OR OTHERWISE USING PYTHON +=============================================================== + +PYTHON SOFTWARE FOUNDATION LICENSE VERSION 2 +-------------------------------------------- + +1. This LICENSE AGREEMENT is between the Python Software Foundation +("PSF"), and the Individual or Organization ("Licensee") accessing and +otherwise using this software ("Python") in source or binary form and +its associated documentation. + +2. Subject to the terms and conditions of this License Agreement, PSF hereby +grants Licensee a nonexclusive, royalty-free, world-wide license to reproduce, +analyze, test, perform and/or display publicly, prepare derivative works, +distribute, and otherwise use Python alone or in any derivative version, +provided, however, that PSF's License Agreement and PSF's notice of copyright, +i.e., "Copyright (c) 2001, 2002, 2003, 2004, 2005, 2006, 2007, 2008, 2009, 2010, +2011, 2012, 2013, 2014, 2015, 2016, 2017, 2018, 2019, 2020 Python Software Foundation; +All Rights Reserved" are retained in Python alone or in any derivative version +prepared by Licensee. + +3. In the event Licensee prepares a derivative work that is based on +or incorporates Python or any part thereof, and wants to make +the derivative work available to others as provided herein, then +Licensee hereby agrees to include in any such work a brief summary of +the changes made to Python. + +4. PSF is making Python available to Licensee on an "AS IS" +basis. PSF MAKES NO REPRESENTATIONS OR WARRANTIES, EXPRESS OR +IMPLIED. BY WAY OF EXAMPLE, BUT NOT LIMITATION, PSF MAKES NO AND +DISCLAIMS ANY REPRESENTATION OR WARRANTY OF MERCHANTABILITY OR FITNESS +FOR ANY PARTICULAR PURPOSE OR THAT THE USE OF PYTHON WILL NOT +INFRINGE ANY THIRD PARTY RIGHTS. + +5. PSF SHALL NOT BE LIABLE TO LICENSEE OR ANY OTHER USERS OF PYTHON +FOR ANY INCIDENTAL, SPECIAL, OR CONSEQUENTIAL DAMAGES OR LOSS AS +A RESULT OF MODIFYING, DISTRIBUTING, OR OTHERWISE USING PYTHON, +OR ANY DERIVATIVE THEREOF, EVEN IF ADVISED OF THE POSSIBILITY THEREOF. + +6. This License Agreement will automatically terminate upon a material +breach of its terms and conditions. + +7. Nothing in this License Agreement shall be deemed to create any +relationship of agency, partnership, or joint venture between PSF and +Licensee. This License Agreement does not grant permission to use PSF +trademarks or trade name in a trademark sense to endorse or promote +products or services of Licensee, or any third party. + +8. By copying, installing or otherwise using Python, Licensee +agrees to be bound by the terms and conditions of this License +Agreement. + + +BEOPEN.COM LICENSE AGREEMENT FOR PYTHON 2.0 +------------------------------------------- + +BEOPEN PYTHON OPEN SOURCE LICENSE AGREEMENT VERSION 1 + +1. This LICENSE AGREEMENT is between BeOpen.com ("BeOpen"), having an +office at 160 Saratoga Avenue, Santa Clara, CA 95051, and the +Individual or Organization ("Licensee") accessing and otherwise using +this software in source or binary form and its associated +documentation ("the Software"). + +2. Subject to the terms and conditions of this BeOpen Python License +Agreement, BeOpen hereby grants Licensee a non-exclusive, +royalty-free, world-wide license to reproduce, analyze, test, perform +and/or display publicly, prepare derivative works, distribute, and +otherwise use the Software alone or in any derivative version, +provided, however, that the BeOpen Python License is retained in the +Software, alone or in any derivative version prepared by Licensee. + +3. BeOpen is making the Software available to Licensee on an "AS IS" +basis. BEOPEN MAKES NO REPRESENTATIONS OR WARRANTIES, EXPRESS OR +IMPLIED. BY WAY OF EXAMPLE, BUT NOT LIMITATION, BEOPEN MAKES NO AND +DISCLAIMS ANY REPRESENTATION OR WARRANTY OF MERCHANTABILITY OR FITNESS +FOR ANY PARTICULAR PURPOSE OR THAT THE USE OF THE SOFTWARE WILL NOT +INFRINGE ANY THIRD PARTY RIGHTS. + +4. BEOPEN SHALL NOT BE LIABLE TO LICENSEE OR ANY OTHER USERS OF THE +SOFTWARE FOR ANY INCIDENTAL, SPECIAL, OR CONSEQUENTIAL DAMAGES OR LOSS +AS A RESULT OF USING, MODIFYING OR DISTRIBUTING THE SOFTWARE, OR ANY +DERIVATIVE THEREOF, EVEN IF ADVISED OF THE POSSIBILITY THEREOF. + +5. This License Agreement will automatically terminate upon a material +breach of its terms and conditions. + +6. This License Agreement shall be governed by and interpreted in all +respects by the law of the State of California, excluding conflict of +law provisions. Nothing in this License Agreement shall be deemed to +create any relationship of agency, partnership, or joint venture +between BeOpen and Licensee. This License Agreement does not grant +permission to use BeOpen trademarks or trade names in a trademark +sense to endorse or promote products or services of Licensee, or any +third party. As an exception, the "BeOpen Python" logos available at +http://www.pythonlabs.com/logos.html may be used according to the +permissions granted on that web page. + +7. By copying, installing or otherwise using the software, Licensee +agrees to be bound by the terms and conditions of this License +Agreement. + + +CNRI LICENSE AGREEMENT FOR PYTHON 1.6.1 +--------------------------------------- + +1. This LICENSE AGREEMENT is between the Corporation for National +Research Initiatives, having an office at 1895 Preston White Drive, +Reston, VA 20191 ("CNRI"), and the Individual or Organization +("Licensee") accessing and otherwise using Python 1.6.1 software in +source or binary form and its associated documentation. + +2. Subject to the terms and conditions of this License Agreement, CNRI +hereby grants Licensee a nonexclusive, royalty-free, world-wide +license to reproduce, analyze, test, perform and/or display publicly, +prepare derivative works, distribute, and otherwise use Python 1.6.1 +alone or in any derivative version, provided, however, that CNRI's +License Agreement and CNRI's notice of copyright, i.e., "Copyright (c) +1995-2001 Corporation for National Research Initiatives; All Rights +Reserved" are retained in Python 1.6.1 alone or in any derivative +version prepared by Licensee. Alternately, in lieu of CNRI's License +Agreement, Licensee may substitute the following text (omitting the +quotes): "Python 1.6.1 is made available subject to the terms and +conditions in CNRI's License Agreement. This Agreement together with +Python 1.6.1 may be located on the Internet using the following +unique, persistent identifier (known as a handle): 1895.22/1013. This +Agreement may also be obtained from a proxy server on the Internet +using the following URL: http://hdl.handle.net/1895.22/1013". + +3. In the event Licensee prepares a derivative work that is based on +or incorporates Python 1.6.1 or any part thereof, and wants to make +the derivative work available to others as provided herein, then +Licensee hereby agrees to include in any such work a brief summary of +the changes made to Python 1.6.1. + +4. CNRI is making Python 1.6.1 available to Licensee on an "AS IS" +basis. CNRI MAKES NO REPRESENTATIONS OR WARRANTIES, EXPRESS OR +IMPLIED. BY WAY OF EXAMPLE, BUT NOT LIMITATION, CNRI MAKES NO AND +DISCLAIMS ANY REPRESENTATION OR WARRANTY OF MERCHANTABILITY OR FITNESS +FOR ANY PARTICULAR PURPOSE OR THAT THE USE OF PYTHON 1.6.1 WILL NOT +INFRINGE ANY THIRD PARTY RIGHTS. + +5. CNRI SHALL NOT BE LIABLE TO LICENSEE OR ANY OTHER USERS OF PYTHON +1.6.1 FOR ANY INCIDENTAL, SPECIAL, OR CONSEQUENTIAL DAMAGES OR LOSS AS +A RESULT OF MODIFYING, DISTRIBUTING, OR OTHERWISE USING PYTHON 1.6.1, +OR ANY DERIVATIVE THEREOF, EVEN IF ADVISED OF THE POSSIBILITY THEREOF. + +6. This License Agreement will automatically terminate upon a material +breach of its terms and conditions. + +7. This License Agreement shall be governed by the federal +intellectual property law of the United States, including without +limitation the federal copyright law, and, to the extent such +U.S. federal law does not apply, by the law of the Commonwealth of +Virginia, excluding Virginia's conflict of law provisions. +Notwithstanding the foregoing, with regard to derivative works based +on Python 1.6.1 that incorporate non-separable material that was +previously distributed under the GNU General Public License (GPL), the +law of the Commonwealth of Virginia shall govern this License +Agreement only as to issues arising under or with respect to +Paragraphs 4, 5, and 7 of this License Agreement. Nothing in this +License Agreement shall be deemed to create any relationship of +agency, partnership, or joint venture between CNRI and Licensee. This +License Agreement does not grant permission to use CNRI trademarks or +trade name in a trademark sense to endorse or promote products or +services of Licensee, or any third party. + +8. By clicking on the "ACCEPT" button where indicated, or by copying, +installing or otherwise using Python 1.6.1, Licensee agrees to be +bound by the terms and conditions of this License Agreement. + + ACCEPT + + +CWI LICENSE AGREEMENT FOR PYTHON 0.9.0 THROUGH 1.2 +-------------------------------------------------- + +Copyright (c) 1991 - 1995, Stichting Mathematisch Centrum Amsterdam, +The Netherlands. All rights reserved. + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Stichting Mathematisch +Centrum or CWI not be used in advertising or publicity pertaining to +distribution of the software without specific, written prior +permission. + +STICHTING MATHEMATISCH CENTRUM DISCLAIMS ALL WARRANTIES WITH REGARD TO +THIS SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND +FITNESS, IN NO EVENT SHALL STICHTING MATHEMATISCH CENTRUM BE LIABLE +FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT +OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/node_modules/argparse/README.md b/node_modules/argparse/README.md new file mode 100644 index 0000000..550b5c9 --- /dev/null +++ b/node_modules/argparse/README.md @@ -0,0 +1,84 @@ +argparse +======== + +[![Build Status](https://secure.travis-ci.org/nodeca/argparse.svg?branch=master)](http://travis-ci.org/nodeca/argparse) +[![NPM version](https://img.shields.io/npm/v/argparse.svg)](https://www.npmjs.org/package/argparse) + +CLI arguments parser for node.js, with [sub-commands](https://docs.python.org/3.9/library/argparse.html#sub-commands) support. Port of python's [argparse](http://docs.python.org/dev/library/argparse.html) (version [3.9.0](https://github.com/python/cpython/blob/v3.9.0rc1/Lib/argparse.py)). + +**Difference with original.** + +- JS has no keyword arguments support. + - Pass options instead: `new ArgumentParser({ description: 'example', add_help: true })`. +- JS has no python's types `int`, `float`, ... + - Use string-typed names: `.add_argument('-b', { type: 'int', help: 'help' })`. +- `%r` format specifier uses `require('util').inspect()`. + +More details in [doc](./doc). + + +Example +------- + +`test.js` file: + +```javascript +#!/usr/bin/env node +'use strict'; + +const { ArgumentParser } = require('argparse'); +const { version } = require('./package.json'); + +const parser = new ArgumentParser({ + description: 'Argparse example' +}); + +parser.add_argument('-v', '--version', { action: 'version', version }); +parser.add_argument('-f', '--foo', { help: 'foo bar' }); +parser.add_argument('-b', '--bar', { help: 'bar foo' }); +parser.add_argument('--baz', { help: 'baz bar' }); + +console.dir(parser.parse_args()); +``` + +Display help: + +``` +$ ./test.js -h +usage: test.js [-h] [-v] [-f FOO] [-b BAR] [--baz BAZ] + +Argparse example + +optional arguments: + -h, --help show this help message and exit + -v, --version show program's version number and exit + -f FOO, --foo FOO foo bar + -b BAR, --bar BAR bar foo + --baz BAZ baz bar +``` + +Parse arguments: + +``` +$ ./test.js -f=3 --bar=4 --baz 5 +{ foo: '3', bar: '4', baz: '5' } +``` + + +API docs +-------- + +Since this is a port with minimal divergence, there's no separate documentation. +Use original one instead, with notes about difference. + +1. [Original doc](https://docs.python.org/3.9/library/argparse.html). +2. [Original tutorial](https://docs.python.org/3.9/howto/argparse.html). +3. [Difference with python](./doc). + + +argparse for enterprise +----------------------- + +Available as part of the Tidelift Subscription + +The maintainers of argparse and thousands of other packages are working with Tidelift to deliver commercial support and maintenance for the open source dependencies you use to build your applications. Save time, reduce risk, and improve code health, while paying the maintainers of the exact dependencies you use. [Learn more.](https://tidelift.com/subscription/pkg/npm-argparse?utm_source=npm-argparse&utm_medium=referral&utm_campaign=enterprise&utm_term=repo) diff --git a/node_modules/argparse/argparse.js b/node_modules/argparse/argparse.js new file mode 100644 index 0000000..2b8c8c6 --- /dev/null +++ b/node_modules/argparse/argparse.js @@ -0,0 +1,3707 @@ +// Port of python's argparse module, version 3.9.0: +// https://github.com/python/cpython/blob/v3.9.0rc1/Lib/argparse.py + +'use strict' + +// Copyright (C) 2010-2020 Python Software Foundation. +// Copyright (C) 2020 argparse.js authors + +/* + * Command-line parsing library + * + * This module is an optparse-inspired command-line parsing library that: + * + * - handles both optional and positional arguments + * - produces highly informative usage messages + * - supports parsers that dispatch to sub-parsers + * + * The following is a simple usage example that sums integers from the + * command-line and writes the result to a file:: + * + * parser = argparse.ArgumentParser( + * description='sum the integers at the command line') + * parser.add_argument( + * 'integers', metavar='int', nargs='+', type=int, + * help='an integer to be summed') + * parser.add_argument( + * '--log', default=sys.stdout, type=argparse.FileType('w'), + * help='the file where the sum should be written') + * args = parser.parse_args() + * args.log.write('%s' % sum(args.integers)) + * args.log.close() + * + * The module contains the following public classes: + * + * - ArgumentParser -- The main entry point for command-line parsing. As the + * example above shows, the add_argument() method is used to populate + * the parser with actions for optional and positional arguments. Then + * the parse_args() method is invoked to convert the args at the + * command-line into an object with attributes. + * + * - ArgumentError -- The exception raised by ArgumentParser objects when + * there are errors with the parser's actions. Errors raised while + * parsing the command-line are caught by ArgumentParser and emitted + * as command-line messages. + * + * - FileType -- A factory for defining types of files to be created. As the + * example above shows, instances of FileType are typically passed as + * the type= argument of add_argument() calls. + * + * - Action -- The base class for parser actions. Typically actions are + * selected by passing strings like 'store_true' or 'append_const' to + * the action= argument of add_argument(). However, for greater + * customization of ArgumentParser actions, subclasses of Action may + * be defined and passed as the action= argument. + * + * - HelpFormatter, RawDescriptionHelpFormatter, RawTextHelpFormatter, + * ArgumentDefaultsHelpFormatter -- Formatter classes which + * may be passed as the formatter_class= argument to the + * ArgumentParser constructor. HelpFormatter is the default, + * RawDescriptionHelpFormatter and RawTextHelpFormatter tell the parser + * not to change the formatting for help text, and + * ArgumentDefaultsHelpFormatter adds information about argument defaults + * to the help. + * + * All other classes in this module are considered implementation details. + * (Also note that HelpFormatter and RawDescriptionHelpFormatter are only + * considered public as object names -- the API of the formatter objects is + * still considered an implementation detail.) + */ + +const SUPPRESS = '==SUPPRESS==' + +const OPTIONAL = '?' +const ZERO_OR_MORE = '*' +const ONE_OR_MORE = '+' +const PARSER = 'A...' +const REMAINDER = '...' +const _UNRECOGNIZED_ARGS_ATTR = '_unrecognized_args' + + +// ================================== +// Utility functions used for porting +// ================================== +const assert = require('assert') +const util = require('util') +const fs = require('fs') +const sub = require('./lib/sub') +const path = require('path') +const repr = util.inspect + +function get_argv() { + // omit first argument (which is assumed to be interpreter - `node`, `coffee`, `ts-node`, etc.) + return process.argv.slice(1) +} + +function get_terminal_size() { + return { + columns: +process.env.COLUMNS || process.stdout.columns || 80 + } +} + +function hasattr(object, name) { + return Object.prototype.hasOwnProperty.call(object, name) +} + +function getattr(object, name, value) { + return hasattr(object, name) ? object[name] : value +} + +function setattr(object, name, value) { + object[name] = value +} + +function setdefault(object, name, value) { + if (!hasattr(object, name)) object[name] = value + return object[name] +} + +function delattr(object, name) { + delete object[name] +} + +function range(from, to, step=1) { + // range(10) is equivalent to range(0, 10) + if (arguments.length === 1) [ to, from ] = [ from, 0 ] + if (typeof from !== 'number' || typeof to !== 'number' || typeof step !== 'number') { + throw new TypeError('argument cannot be interpreted as an integer') + } + if (step === 0) throw new TypeError('range() arg 3 must not be zero') + + let result = [] + if (step > 0) { + for (let i = from; i < to; i += step) result.push(i) + } else { + for (let i = from; i > to; i += step) result.push(i) + } + return result +} + +function splitlines(str, keepends = false) { + let result + if (!keepends) { + result = str.split(/\r\n|[\n\r\v\f\x1c\x1d\x1e\x85\u2028\u2029]/) + } else { + result = [] + let parts = str.split(/(\r\n|[\n\r\v\f\x1c\x1d\x1e\x85\u2028\u2029])/) + for (let i = 0; i < parts.length; i += 2) { + result.push(parts[i] + (i + 1 < parts.length ? parts[i + 1] : '')) + } + } + if (!result[result.length - 1]) result.pop() + return result +} + +function _string_lstrip(string, prefix_chars) { + let idx = 0 + while (idx < string.length && prefix_chars.includes(string[idx])) idx++ + return idx ? string.slice(idx) : string +} + +function _string_split(string, sep, maxsplit) { + let result = string.split(sep) + if (result.length > maxsplit) { + result = result.slice(0, maxsplit).concat([ result.slice(maxsplit).join(sep) ]) + } + return result +} + +function _array_equal(array1, array2) { + if (array1.length !== array2.length) return false + for (let i = 0; i < array1.length; i++) { + if (array1[i] !== array2[i]) return false + } + return true +} + +function _array_remove(array, item) { + let idx = array.indexOf(item) + if (idx === -1) throw new TypeError(sub('%r not in list', item)) + array.splice(idx, 1) +} + +// normalize choices to array; +// this isn't required in python because `in` and `map` operators work with anything, +// but in js dealing with multiple types here is too clunky +function _choices_to_array(choices) { + if (choices === undefined) { + return [] + } else if (Array.isArray(choices)) { + return choices + } else if (choices !== null && typeof choices[Symbol.iterator] === 'function') { + return Array.from(choices) + } else if (typeof choices === 'object' && choices !== null) { + return Object.keys(choices) + } else { + throw new Error(sub('invalid choices value: %r', choices)) + } +} + +// decorator that allows a class to be called without new +function _callable(cls) { + let result = { // object is needed for inferred class name + [cls.name]: function (...args) { + let this_class = new.target === result || !new.target + return Reflect.construct(cls, args, this_class ? cls : new.target) + } + } + result[cls.name].prototype = cls.prototype + // fix default tag for toString, e.g. [object Action] instead of [object Object] + cls.prototype[Symbol.toStringTag] = cls.name + return result[cls.name] +} + +function _alias(object, from, to) { + try { + let name = object.constructor.name + Object.defineProperty(object, from, { + value: util.deprecate(object[to], sub('%s.%s() is renamed to %s.%s()', + name, from, name, to)), + enumerable: false + }) + } catch {} +} + +// decorator that allows snake_case class methods to be called with camelCase and vice versa +function _camelcase_alias(_class) { + for (let name of Object.getOwnPropertyNames(_class.prototype)) { + let camelcase = name.replace(/\w_[a-z]/g, s => s[0] + s[2].toUpperCase()) + if (camelcase !== name) _alias(_class.prototype, camelcase, name) + } + return _class +} + +function _to_legacy_name(key) { + key = key.replace(/\w_[a-z]/g, s => s[0] + s[2].toUpperCase()) + if (key === 'default') key = 'defaultValue' + if (key === 'const') key = 'constant' + return key +} + +function _to_new_name(key) { + if (key === 'defaultValue') key = 'default' + if (key === 'constant') key = 'const' + key = key.replace(/[A-Z]/g, c => '_' + c.toLowerCase()) + return key +} + +// parse options +let no_default = Symbol('no_default_value') +function _parse_opts(args, descriptor) { + function get_name() { + let stack = new Error().stack.split('\n') + .map(x => x.match(/^ at (.*) \(.*\)$/)) + .filter(Boolean) + .map(m => m[1]) + .map(fn => fn.match(/[^ .]*$/)[0]) + + if (stack.length && stack[0] === get_name.name) stack.shift() + if (stack.length && stack[0] === _parse_opts.name) stack.shift() + return stack.length ? stack[0] : '' + } + + args = Array.from(args) + let kwargs = {} + let result = [] + let last_opt = args.length && args[args.length - 1] + + if (typeof last_opt === 'object' && last_opt !== null && !Array.isArray(last_opt) && + (!last_opt.constructor || last_opt.constructor.name === 'Object')) { + kwargs = Object.assign({}, args.pop()) + } + + // LEGACY (v1 compatibility): camelcase + let renames = [] + for (let key of Object.keys(descriptor)) { + let old_name = _to_legacy_name(key) + if (old_name !== key && (old_name in kwargs)) { + if (key in kwargs) { + // default and defaultValue specified at the same time, happens often in old tests + //throw new TypeError(sub('%s() got multiple values for argument %r', get_name(), key)) + } else { + kwargs[key] = kwargs[old_name] + } + renames.push([ old_name, key ]) + delete kwargs[old_name] + } + } + if (renames.length) { + let name = get_name() + deprecate('camelcase_' + name, sub('%s(): following options are renamed: %s', + name, renames.map(([ a, b ]) => sub('%r -> %r', a, b)))) + } + // end + + let missing_positionals = [] + let positional_count = args.length + + for (let [ key, def ] of Object.entries(descriptor)) { + if (key[0] === '*') { + if (key.length > 0 && key[1] === '*') { + // LEGACY (v1 compatibility): camelcase + let renames = [] + for (let key of Object.keys(kwargs)) { + let new_name = _to_new_name(key) + if (new_name !== key && (key in kwargs)) { + if (new_name in kwargs) { + // default and defaultValue specified at the same time, happens often in old tests + //throw new TypeError(sub('%s() got multiple values for argument %r', get_name(), new_name)) + } else { + kwargs[new_name] = kwargs[key] + } + renames.push([ key, new_name ]) + delete kwargs[key] + } + } + if (renames.length) { + let name = get_name() + deprecate('camelcase_' + name, sub('%s(): following options are renamed: %s', + name, renames.map(([ a, b ]) => sub('%r -> %r', a, b)))) + } + // end + result.push(kwargs) + kwargs = {} + } else { + result.push(args) + args = [] + } + } else if (key in kwargs && args.length > 0) { + throw new TypeError(sub('%s() got multiple values for argument %r', get_name(), key)) + } else if (key in kwargs) { + result.push(kwargs[key]) + delete kwargs[key] + } else if (args.length > 0) { + result.push(args.shift()) + } else if (def !== no_default) { + result.push(def) + } else { + missing_positionals.push(key) + } + } + + if (Object.keys(kwargs).length) { + throw new TypeError(sub('%s() got an unexpected keyword argument %r', + get_name(), Object.keys(kwargs)[0])) + } + + if (args.length) { + let from = Object.entries(descriptor).filter(([ k, v ]) => k[0] !== '*' && v !== no_default).length + let to = Object.entries(descriptor).filter(([ k ]) => k[0] !== '*').length + throw new TypeError(sub('%s() takes %s positional argument%s but %s %s given', + get_name(), + from === to ? sub('from %s to %s', from, to) : to, + from === to && to === 1 ? '' : 's', + positional_count, + positional_count === 1 ? 'was' : 'were')) + } + + if (missing_positionals.length) { + let strs = missing_positionals.map(repr) + if (strs.length > 1) strs[strs.length - 1] = 'and ' + strs[strs.length - 1] + let str_joined = strs.join(strs.length === 2 ? '' : ', ') + throw new TypeError(sub('%s() missing %i required positional argument%s: %s', + get_name(), strs.length, strs.length === 1 ? '' : 's', str_joined)) + } + + return result +} + +let _deprecations = {} +function deprecate(id, string) { + _deprecations[id] = _deprecations[id] || util.deprecate(() => {}, string) + _deprecations[id]() +} + + +// ============================= +// Utility functions and classes +// ============================= +function _AttributeHolder(cls = Object) { + /* + * Abstract base class that provides __repr__. + * + * The __repr__ method returns a string in the format:: + * ClassName(attr=name, attr=name, ...) + * The attributes are determined either by a class-level attribute, + * '_kwarg_names', or by inspecting the instance __dict__. + */ + + return class _AttributeHolder extends cls { + [util.inspect.custom]() { + let type_name = this.constructor.name + let arg_strings = [] + let star_args = {} + for (let arg of this._get_args()) { + arg_strings.push(repr(arg)) + } + for (let [ name, value ] of this._get_kwargs()) { + if (/^[a-z_][a-z0-9_$]*$/i.test(name)) { + arg_strings.push(sub('%s=%r', name, value)) + } else { + star_args[name] = value + } + } + if (Object.keys(star_args).length) { + arg_strings.push(sub('**%s', repr(star_args))) + } + return sub('%s(%s)', type_name, arg_strings.join(', ')) + } + + toString() { + return this[util.inspect.custom]() + } + + _get_kwargs() { + return Object.entries(this) + } + + _get_args() { + return [] + } + } +} + + +function _copy_items(items) { + if (items === undefined) { + return [] + } + return items.slice(0) +} + + +// =============== +// Formatting Help +// =============== +const HelpFormatter = _camelcase_alias(_callable(class HelpFormatter { + /* + * Formatter for generating usage messages and argument help strings. + * + * Only the name of this class is considered a public API. All the methods + * provided by the class are considered an implementation detail. + */ + + constructor() { + let [ + prog, + indent_increment, + max_help_position, + width + ] = _parse_opts(arguments, { + prog: no_default, + indent_increment: 2, + max_help_position: 24, + width: undefined + }) + + // default setting for width + if (width === undefined) { + width = get_terminal_size().columns + width -= 2 + } + + this._prog = prog + this._indent_increment = indent_increment + this._max_help_position = Math.min(max_help_position, + Math.max(width - 20, indent_increment * 2)) + this._width = width + + this._current_indent = 0 + this._level = 0 + this._action_max_length = 0 + + this._root_section = this._Section(this, undefined) + this._current_section = this._root_section + + this._whitespace_matcher = /[ \t\n\r\f\v]+/g // equivalent to python /\s+/ with ASCII flag + this._long_break_matcher = /\n\n\n+/g + } + + // =============================== + // Section and indentation methods + // =============================== + _indent() { + this._current_indent += this._indent_increment + this._level += 1 + } + + _dedent() { + this._current_indent -= this._indent_increment + assert(this._current_indent >= 0, 'Indent decreased below 0.') + this._level -= 1 + } + + _add_item(func, args) { + this._current_section.items.push([ func, args ]) + } + + // ======================== + // Message building methods + // ======================== + start_section(heading) { + this._indent() + let section = this._Section(this, this._current_section, heading) + this._add_item(section.format_help.bind(section), []) + this._current_section = section + } + + end_section() { + this._current_section = this._current_section.parent + this._dedent() + } + + add_text(text) { + if (text !== SUPPRESS && text !== undefined) { + this._add_item(this._format_text.bind(this), [text]) + } + } + + add_usage(usage, actions, groups, prefix = undefined) { + if (usage !== SUPPRESS) { + let args = [ usage, actions, groups, prefix ] + this._add_item(this._format_usage.bind(this), args) + } + } + + add_argument(action) { + if (action.help !== SUPPRESS) { + + // find all invocations + let invocations = [this._format_action_invocation(action)] + for (let subaction of this._iter_indented_subactions(action)) { + invocations.push(this._format_action_invocation(subaction)) + } + + // update the maximum item length + let invocation_length = Math.max(...invocations.map(invocation => invocation.length)) + let action_length = invocation_length + this._current_indent + this._action_max_length = Math.max(this._action_max_length, + action_length) + + // add the item to the list + this._add_item(this._format_action.bind(this), [action]) + } + } + + add_arguments(actions) { + for (let action of actions) { + this.add_argument(action) + } + } + + // ======================= + // Help-formatting methods + // ======================= + format_help() { + let help = this._root_section.format_help() + if (help) { + help = help.replace(this._long_break_matcher, '\n\n') + help = help.replace(/^\n+|\n+$/g, '') + '\n' + } + return help + } + + _join_parts(part_strings) { + return part_strings.filter(part => part && part !== SUPPRESS).join('') + } + + _format_usage(usage, actions, groups, prefix) { + if (prefix === undefined) { + prefix = 'usage: ' + } + + // if usage is specified, use that + if (usage !== undefined) { + usage = sub(usage, { prog: this._prog }) + + // if no optionals or positionals are available, usage is just prog + } else if (usage === undefined && !actions.length) { + usage = sub('%(prog)s', { prog: this._prog }) + + // if optionals and positionals are available, calculate usage + } else if (usage === undefined) { + let prog = sub('%(prog)s', { prog: this._prog }) + + // split optionals from positionals + let optionals = [] + let positionals = [] + for (let action of actions) { + if (action.option_strings.length) { + optionals.push(action) + } else { + positionals.push(action) + } + } + + // build full usage string + let action_usage = this._format_actions_usage([].concat(optionals).concat(positionals), groups) + usage = [ prog, action_usage ].map(String).join(' ') + + // wrap the usage parts if it's too long + let text_width = this._width - this._current_indent + if (prefix.length + usage.length > text_width) { + + // break usage into wrappable parts + let part_regexp = /\(.*?\)+(?=\s|$)|\[.*?\]+(?=\s|$)|\S+/g + let opt_usage = this._format_actions_usage(optionals, groups) + let pos_usage = this._format_actions_usage(positionals, groups) + let opt_parts = opt_usage.match(part_regexp) || [] + let pos_parts = pos_usage.match(part_regexp) || [] + assert(opt_parts.join(' ') === opt_usage) + assert(pos_parts.join(' ') === pos_usage) + + // helper for wrapping lines + let get_lines = (parts, indent, prefix = undefined) => { + let lines = [] + let line = [] + let line_len + if (prefix !== undefined) { + line_len = prefix.length - 1 + } else { + line_len = indent.length - 1 + } + for (let part of parts) { + if (line_len + 1 + part.length > text_width && line) { + lines.push(indent + line.join(' ')) + line = [] + line_len = indent.length - 1 + } + line.push(part) + line_len += part.length + 1 + } + if (line.length) { + lines.push(indent + line.join(' ')) + } + if (prefix !== undefined) { + lines[0] = lines[0].slice(indent.length) + } + return lines + } + + let lines + + // if prog is short, follow it with optionals or positionals + if (prefix.length + prog.length <= 0.75 * text_width) { + let indent = ' '.repeat(prefix.length + prog.length + 1) + if (opt_parts.length) { + lines = get_lines([prog].concat(opt_parts), indent, prefix) + lines = lines.concat(get_lines(pos_parts, indent)) + } else if (pos_parts.length) { + lines = get_lines([prog].concat(pos_parts), indent, prefix) + } else { + lines = [prog] + } + + // if prog is long, put it on its own line + } else { + let indent = ' '.repeat(prefix.length) + let parts = [].concat(opt_parts).concat(pos_parts) + lines = get_lines(parts, indent) + if (lines.length > 1) { + lines = [] + lines = lines.concat(get_lines(opt_parts, indent)) + lines = lines.concat(get_lines(pos_parts, indent)) + } + lines = [prog].concat(lines) + } + + // join lines into usage + usage = lines.join('\n') + } + } + + // prefix with 'usage:' + return sub('%s%s\n\n', prefix, usage) + } + + _format_actions_usage(actions, groups) { + // find group indices and identify actions in groups + let group_actions = new Set() + let inserts = {} + for (let group of groups) { + let start = actions.indexOf(group._group_actions[0]) + if (start === -1) { + continue + } else { + let end = start + group._group_actions.length + if (_array_equal(actions.slice(start, end), group._group_actions)) { + for (let action of group._group_actions) { + group_actions.add(action) + } + if (!group.required) { + if (start in inserts) { + inserts[start] += ' [' + } else { + inserts[start] = '[' + } + if (end in inserts) { + inserts[end] += ']' + } else { + inserts[end] = ']' + } + } else { + if (start in inserts) { + inserts[start] += ' (' + } else { + inserts[start] = '(' + } + if (end in inserts) { + inserts[end] += ')' + } else { + inserts[end] = ')' + } + } + for (let i of range(start + 1, end)) { + inserts[i] = '|' + } + } + } + } + + // collect all actions format strings + let parts = [] + for (let [ i, action ] of Object.entries(actions)) { + + // suppressed arguments are marked with None + // remove | separators for suppressed arguments + if (action.help === SUPPRESS) { + parts.push(undefined) + if (inserts[+i] === '|') { + delete inserts[+i] + } else if (inserts[+i + 1] === '|') { + delete inserts[+i + 1] + } + + // produce all arg strings + } else if (!action.option_strings.length) { + let default_value = this._get_default_metavar_for_positional(action) + let part = this._format_args(action, default_value) + + // if it's in a group, strip the outer [] + if (group_actions.has(action)) { + if (part[0] === '[' && part[part.length - 1] === ']') { + part = part.slice(1, -1) + } + } + + // add the action string to the list + parts.push(part) + + // produce the first way to invoke the option in brackets + } else { + let option_string = action.option_strings[0] + let part + + // if the Optional doesn't take a value, format is: + // -s or --long + if (action.nargs === 0) { + part = action.format_usage() + + // if the Optional takes a value, format is: + // -s ARGS or --long ARGS + } else { + let default_value = this._get_default_metavar_for_optional(action) + let args_string = this._format_args(action, default_value) + part = sub('%s %s', option_string, args_string) + } + + // make it look optional if it's not required or in a group + if (!action.required && !group_actions.has(action)) { + part = sub('[%s]', part) + } + + // add the action string to the list + parts.push(part) + } + } + + // insert things at the necessary indices + for (let i of Object.keys(inserts).map(Number).sort((a, b) => b - a)) { + parts.splice(+i, 0, inserts[+i]) + } + + // join all the action items with spaces + let text = parts.filter(Boolean).join(' ') + + // clean up separators for mutually exclusive groups + text = text.replace(/([\[(]) /g, '$1') + text = text.replace(/ ([\])])/g, '$1') + text = text.replace(/[\[(] *[\])]/g, '') + text = text.replace(/\(([^|]*)\)/g, '$1', text) + text = text.trim() + + // return the text + return text + } + + _format_text(text) { + if (text.includes('%(prog)')) { + text = sub(text, { prog: this._prog }) + } + let text_width = Math.max(this._width - this._current_indent, 11) + let indent = ' '.repeat(this._current_indent) + return this._fill_text(text, text_width, indent) + '\n\n' + } + + _format_action(action) { + // determine the required width and the entry label + let help_position = Math.min(this._action_max_length + 2, + this._max_help_position) + let help_width = Math.max(this._width - help_position, 11) + let action_width = help_position - this._current_indent - 2 + let action_header = this._format_action_invocation(action) + let indent_first + + // no help; start on same line and add a final newline + if (!action.help) { + let tup = [ this._current_indent, '', action_header ] + action_header = sub('%*s%s\n', ...tup) + + // short action name; start on the same line and pad two spaces + } else if (action_header.length <= action_width) { + let tup = [ this._current_indent, '', action_width, action_header ] + action_header = sub('%*s%-*s ', ...tup) + indent_first = 0 + + // long action name; start on the next line + } else { + let tup = [ this._current_indent, '', action_header ] + action_header = sub('%*s%s\n', ...tup) + indent_first = help_position + } + + // collect the pieces of the action help + let parts = [action_header] + + // if there was help for the action, add lines of help text + if (action.help) { + let help_text = this._expand_help(action) + let help_lines = this._split_lines(help_text, help_width) + parts.push(sub('%*s%s\n', indent_first, '', help_lines[0])) + for (let line of help_lines.slice(1)) { + parts.push(sub('%*s%s\n', help_position, '', line)) + } + + // or add a newline if the description doesn't end with one + } else if (!action_header.endsWith('\n')) { + parts.push('\n') + } + + // if there are any sub-actions, add their help as well + for (let subaction of this._iter_indented_subactions(action)) { + parts.push(this._format_action(subaction)) + } + + // return a single string + return this._join_parts(parts) + } + + _format_action_invocation(action) { + if (!action.option_strings.length) { + let default_value = this._get_default_metavar_for_positional(action) + let metavar = this._metavar_formatter(action, default_value)(1)[0] + return metavar + + } else { + let parts = [] + + // if the Optional doesn't take a value, format is: + // -s, --long + if (action.nargs === 0) { + parts = parts.concat(action.option_strings) + + // if the Optional takes a value, format is: + // -s ARGS, --long ARGS + } else { + let default_value = this._get_default_metavar_for_optional(action) + let args_string = this._format_args(action, default_value) + for (let option_string of action.option_strings) { + parts.push(sub('%s %s', option_string, args_string)) + } + } + + return parts.join(', ') + } + } + + _metavar_formatter(action, default_metavar) { + let result + if (action.metavar !== undefined) { + result = action.metavar + } else if (action.choices !== undefined) { + let choice_strs = _choices_to_array(action.choices).map(String) + result = sub('{%s}', choice_strs.join(',')) + } else { + result = default_metavar + } + + function format(tuple_size) { + if (Array.isArray(result)) { + return result + } else { + return Array(tuple_size).fill(result) + } + } + return format + } + + _format_args(action, default_metavar) { + let get_metavar = this._metavar_formatter(action, default_metavar) + let result + if (action.nargs === undefined) { + result = sub('%s', ...get_metavar(1)) + } else if (action.nargs === OPTIONAL) { + result = sub('[%s]', ...get_metavar(1)) + } else if (action.nargs === ZERO_OR_MORE) { + let metavar = get_metavar(1) + if (metavar.length === 2) { + result = sub('[%s [%s ...]]', ...metavar) + } else { + result = sub('[%s ...]', ...metavar) + } + } else if (action.nargs === ONE_OR_MORE) { + result = sub('%s [%s ...]', ...get_metavar(2)) + } else if (action.nargs === REMAINDER) { + result = '...' + } else if (action.nargs === PARSER) { + result = sub('%s ...', ...get_metavar(1)) + } else if (action.nargs === SUPPRESS) { + result = '' + } else { + let formats + try { + formats = range(action.nargs).map(() => '%s') + } catch (err) { + throw new TypeError('invalid nargs value') + } + result = sub(formats.join(' '), ...get_metavar(action.nargs)) + } + return result + } + + _expand_help(action) { + let params = Object.assign({ prog: this._prog }, action) + for (let name of Object.keys(params)) { + if (params[name] === SUPPRESS) { + delete params[name] + } + } + for (let name of Object.keys(params)) { + if (params[name] && params[name].name) { + params[name] = params[name].name + } + } + if (params.choices !== undefined) { + let choices_str = _choices_to_array(params.choices).map(String).join(', ') + params.choices = choices_str + } + // LEGACY (v1 compatibility): camelcase + for (let key of Object.keys(params)) { + let old_name = _to_legacy_name(key) + if (old_name !== key) { + params[old_name] = params[key] + } + } + // end + return sub(this._get_help_string(action), params) + } + + * _iter_indented_subactions(action) { + if (typeof action._get_subactions === 'function') { + this._indent() + yield* action._get_subactions() + this._dedent() + } + } + + _split_lines(text, width) { + text = text.replace(this._whitespace_matcher, ' ').trim() + // The textwrap module is used only for formatting help. + // Delay its import for speeding up the common usage of argparse. + let textwrap = require('./lib/textwrap') + return textwrap.wrap(text, { width }) + } + + _fill_text(text, width, indent) { + text = text.replace(this._whitespace_matcher, ' ').trim() + let textwrap = require('./lib/textwrap') + return textwrap.fill(text, { width, + initial_indent: indent, + subsequent_indent: indent }) + } + + _get_help_string(action) { + return action.help + } + + _get_default_metavar_for_optional(action) { + return action.dest.toUpperCase() + } + + _get_default_metavar_for_positional(action) { + return action.dest + } +})) + +HelpFormatter.prototype._Section = _callable(class _Section { + + constructor(formatter, parent, heading = undefined) { + this.formatter = formatter + this.parent = parent + this.heading = heading + this.items = [] + } + + format_help() { + // format the indented section + if (this.parent !== undefined) { + this.formatter._indent() + } + let item_help = this.formatter._join_parts(this.items.map(([ func, args ]) => func.apply(null, args))) + if (this.parent !== undefined) { + this.formatter._dedent() + } + + // return nothing if the section was empty + if (!item_help) { + return '' + } + + // add the heading if the section was non-empty + let heading + if (this.heading !== SUPPRESS && this.heading !== undefined) { + let current_indent = this.formatter._current_indent + heading = sub('%*s%s:\n', current_indent, '', this.heading) + } else { + heading = '' + } + + // join the section-initial newline, the heading and the help + return this.formatter._join_parts(['\n', heading, item_help, '\n']) + } +}) + + +const RawDescriptionHelpFormatter = _camelcase_alias(_callable(class RawDescriptionHelpFormatter extends HelpFormatter { + /* + * Help message formatter which retains any formatting in descriptions. + * + * Only the name of this class is considered a public API. All the methods + * provided by the class are considered an implementation detail. + */ + + _fill_text(text, width, indent) { + return splitlines(text, true).map(line => indent + line).join('') + } +})) + + +const RawTextHelpFormatter = _camelcase_alias(_callable(class RawTextHelpFormatter extends RawDescriptionHelpFormatter { + /* + * Help message formatter which retains formatting of all help text. + * + * Only the name of this class is considered a public API. All the methods + * provided by the class are considered an implementation detail. + */ + + _split_lines(text/*, width*/) { + return splitlines(text) + } +})) + + +const ArgumentDefaultsHelpFormatter = _camelcase_alias(_callable(class ArgumentDefaultsHelpFormatter extends HelpFormatter { + /* + * Help message formatter which adds default values to argument help. + * + * Only the name of this class is considered a public API. All the methods + * provided by the class are considered an implementation detail. + */ + + _get_help_string(action) { + let help = action.help + // LEGACY (v1 compatibility): additional check for defaultValue needed + if (!action.help.includes('%(default)') && !action.help.includes('%(defaultValue)')) { + if (action.default !== SUPPRESS) { + let defaulting_nargs = [OPTIONAL, ZERO_OR_MORE] + if (action.option_strings.length || defaulting_nargs.includes(action.nargs)) { + help += ' (default: %(default)s)' + } + } + } + return help + } +})) + + +const MetavarTypeHelpFormatter = _camelcase_alias(_callable(class MetavarTypeHelpFormatter extends HelpFormatter { + /* + * Help message formatter which uses the argument 'type' as the default + * metavar value (instead of the argument 'dest') + * + * Only the name of this class is considered a public API. All the methods + * provided by the class are considered an implementation detail. + */ + + _get_default_metavar_for_optional(action) { + return typeof action.type === 'function' ? action.type.name : action.type + } + + _get_default_metavar_for_positional(action) { + return typeof action.type === 'function' ? action.type.name : action.type + } +})) + + +// ===================== +// Options and Arguments +// ===================== +function _get_action_name(argument) { + if (argument === undefined) { + return undefined + } else if (argument.option_strings.length) { + return argument.option_strings.join('/') + } else if (![ undefined, SUPPRESS ].includes(argument.metavar)) { + return argument.metavar + } else if (![ undefined, SUPPRESS ].includes(argument.dest)) { + return argument.dest + } else { + return undefined + } +} + + +const ArgumentError = _callable(class ArgumentError extends Error { + /* + * An error from creating or using an argument (optional or positional). + * + * The string value of this exception is the message, augmented with + * information about the argument that caused it. + */ + + constructor(argument, message) { + super() + this.name = 'ArgumentError' + this._argument_name = _get_action_name(argument) + this._message = message + this.message = this.str() + } + + str() { + let format + if (this._argument_name === undefined) { + format = '%(message)s' + } else { + format = 'argument %(argument_name)s: %(message)s' + } + return sub(format, { message: this._message, + argument_name: this._argument_name }) + } +}) + + +const ArgumentTypeError = _callable(class ArgumentTypeError extends Error { + /* + * An error from trying to convert a command line string to a type. + */ + + constructor(message) { + super(message) + this.name = 'ArgumentTypeError' + } +}) + + +// ============== +// Action classes +// ============== +const Action = _camelcase_alias(_callable(class Action extends _AttributeHolder(Function) { + /* + * Information about how to convert command line strings to Python objects. + * + * Action objects are used by an ArgumentParser to represent the information + * needed to parse a single argument from one or more strings from the + * command line. The keyword arguments to the Action constructor are also + * all attributes of Action instances. + * + * Keyword Arguments: + * + * - option_strings -- A list of command-line option strings which + * should be associated with this action. + * + * - dest -- The name of the attribute to hold the created object(s) + * + * - nargs -- The number of command-line arguments that should be + * consumed. By default, one argument will be consumed and a single + * value will be produced. Other values include: + * - N (an integer) consumes N arguments (and produces a list) + * - '?' consumes zero or one arguments + * - '*' consumes zero or more arguments (and produces a list) + * - '+' consumes one or more arguments (and produces a list) + * Note that the difference between the default and nargs=1 is that + * with the default, a single value will be produced, while with + * nargs=1, a list containing a single value will be produced. + * + * - const -- The value to be produced if the option is specified and the + * option uses an action that takes no values. + * + * - default -- The value to be produced if the option is not specified. + * + * - type -- A callable that accepts a single string argument, and + * returns the converted value. The standard Python types str, int, + * float, and complex are useful examples of such callables. If None, + * str is used. + * + * - choices -- A container of values that should be allowed. If not None, + * after a command-line argument has been converted to the appropriate + * type, an exception will be raised if it is not a member of this + * collection. + * + * - required -- True if the action must always be specified at the + * command line. This is only meaningful for optional command-line + * arguments. + * + * - help -- The help string describing the argument. + * + * - metavar -- The name to be used for the option's argument with the + * help string. If None, the 'dest' value will be used as the name. + */ + + constructor() { + let [ + option_strings, + dest, + nargs, + const_value, + default_value, + type, + choices, + required, + help, + metavar + ] = _parse_opts(arguments, { + option_strings: no_default, + dest: no_default, + nargs: undefined, + const: undefined, + default: undefined, + type: undefined, + choices: undefined, + required: false, + help: undefined, + metavar: undefined + }) + + // when this class is called as a function, redirect it to .call() method of itself + super('return arguments.callee.call.apply(arguments.callee, arguments)') + + this.option_strings = option_strings + this.dest = dest + this.nargs = nargs + this.const = const_value + this.default = default_value + this.type = type + this.choices = choices + this.required = required + this.help = help + this.metavar = metavar + } + + _get_kwargs() { + let names = [ + 'option_strings', + 'dest', + 'nargs', + 'const', + 'default', + 'type', + 'choices', + 'help', + 'metavar' + ] + return names.map(name => [ name, getattr(this, name) ]) + } + + format_usage() { + return this.option_strings[0] + } + + call(/*parser, namespace, values, option_string = undefined*/) { + throw new Error('.call() not defined') + } +})) + + +const BooleanOptionalAction = _camelcase_alias(_callable(class BooleanOptionalAction extends Action { + + constructor() { + let [ + option_strings, + dest, + default_value, + type, + choices, + required, + help, + metavar + ] = _parse_opts(arguments, { + option_strings: no_default, + dest: no_default, + default: undefined, + type: undefined, + choices: undefined, + required: false, + help: undefined, + metavar: undefined + }) + + let _option_strings = [] + for (let option_string of option_strings) { + _option_strings.push(option_string) + + if (option_string.startsWith('--')) { + option_string = '--no-' + option_string.slice(2) + _option_strings.push(option_string) + } + } + + if (help !== undefined && default_value !== undefined) { + help += ` (default: ${default_value})` + } + + super({ + option_strings: _option_strings, + dest, + nargs: 0, + default: default_value, + type, + choices, + required, + help, + metavar + }) + } + + call(parser, namespace, values, option_string = undefined) { + if (this.option_strings.includes(option_string)) { + setattr(namespace, this.dest, !option_string.startsWith('--no-')) + } + } + + format_usage() { + return this.option_strings.join(' | ') + } +})) + + +const _StoreAction = _callable(class _StoreAction extends Action { + + constructor() { + let [ + option_strings, + dest, + nargs, + const_value, + default_value, + type, + choices, + required, + help, + metavar + ] = _parse_opts(arguments, { + option_strings: no_default, + dest: no_default, + nargs: undefined, + const: undefined, + default: undefined, + type: undefined, + choices: undefined, + required: false, + help: undefined, + metavar: undefined + }) + + if (nargs === 0) { + throw new TypeError('nargs for store actions must be != 0; if you ' + + 'have nothing to store, actions such as store ' + + 'true or store const may be more appropriate') + } + if (const_value !== undefined && nargs !== OPTIONAL) { + throw new TypeError(sub('nargs must be %r to supply const', OPTIONAL)) + } + super({ + option_strings, + dest, + nargs, + const: const_value, + default: default_value, + type, + choices, + required, + help, + metavar + }) + } + + call(parser, namespace, values/*, option_string = undefined*/) { + setattr(namespace, this.dest, values) + } +}) + + +const _StoreConstAction = _callable(class _StoreConstAction extends Action { + + constructor() { + let [ + option_strings, + dest, + const_value, + default_value, + required, + help + //, metavar + ] = _parse_opts(arguments, { + option_strings: no_default, + dest: no_default, + const: no_default, + default: undefined, + required: false, + help: undefined, + metavar: undefined + }) + + super({ + option_strings, + dest, + nargs: 0, + const: const_value, + default: default_value, + required, + help + }) + } + + call(parser, namespace/*, values, option_string = undefined*/) { + setattr(namespace, this.dest, this.const) + } +}) + + +const _StoreTrueAction = _callable(class _StoreTrueAction extends _StoreConstAction { + + constructor() { + let [ + option_strings, + dest, + default_value, + required, + help + ] = _parse_opts(arguments, { + option_strings: no_default, + dest: no_default, + default: false, + required: false, + help: undefined + }) + + super({ + option_strings, + dest, + const: true, + default: default_value, + required, + help + }) + } +}) + + +const _StoreFalseAction = _callable(class _StoreFalseAction extends _StoreConstAction { + + constructor() { + let [ + option_strings, + dest, + default_value, + required, + help + ] = _parse_opts(arguments, { + option_strings: no_default, + dest: no_default, + default: true, + required: false, + help: undefined + }) + + super({ + option_strings, + dest, + const: false, + default: default_value, + required, + help + }) + } +}) + + +const _AppendAction = _callable(class _AppendAction extends Action { + + constructor() { + let [ + option_strings, + dest, + nargs, + const_value, + default_value, + type, + choices, + required, + help, + metavar + ] = _parse_opts(arguments, { + option_strings: no_default, + dest: no_default, + nargs: undefined, + const: undefined, + default: undefined, + type: undefined, + choices: undefined, + required: false, + help: undefined, + metavar: undefined + }) + + if (nargs === 0) { + throw new TypeError('nargs for append actions must be != 0; if arg ' + + 'strings are not supplying the value to append, ' + + 'the append const action may be more appropriate') + } + if (const_value !== undefined && nargs !== OPTIONAL) { + throw new TypeError(sub('nargs must be %r to supply const', OPTIONAL)) + } + super({ + option_strings, + dest, + nargs, + const: const_value, + default: default_value, + type, + choices, + required, + help, + metavar + }) + } + + call(parser, namespace, values/*, option_string = undefined*/) { + let items = getattr(namespace, this.dest, undefined) + items = _copy_items(items) + items.push(values) + setattr(namespace, this.dest, items) + } +}) + + +const _AppendConstAction = _callable(class _AppendConstAction extends Action { + + constructor() { + let [ + option_strings, + dest, + const_value, + default_value, + required, + help, + metavar + ] = _parse_opts(arguments, { + option_strings: no_default, + dest: no_default, + const: no_default, + default: undefined, + required: false, + help: undefined, + metavar: undefined + }) + + super({ + option_strings, + dest, + nargs: 0, + const: const_value, + default: default_value, + required, + help, + metavar + }) + } + + call(parser, namespace/*, values, option_string = undefined*/) { + let items = getattr(namespace, this.dest, undefined) + items = _copy_items(items) + items.push(this.const) + setattr(namespace, this.dest, items) + } +}) + + +const _CountAction = _callable(class _CountAction extends Action { + + constructor() { + let [ + option_strings, + dest, + default_value, + required, + help + ] = _parse_opts(arguments, { + option_strings: no_default, + dest: no_default, + default: undefined, + required: false, + help: undefined + }) + + super({ + option_strings, + dest, + nargs: 0, + default: default_value, + required, + help + }) + } + + call(parser, namespace/*, values, option_string = undefined*/) { + let count = getattr(namespace, this.dest, undefined) + if (count === undefined) { + count = 0 + } + setattr(namespace, this.dest, count + 1) + } +}) + + +const _HelpAction = _callable(class _HelpAction extends Action { + + constructor() { + let [ + option_strings, + dest, + default_value, + help + ] = _parse_opts(arguments, { + option_strings: no_default, + dest: SUPPRESS, + default: SUPPRESS, + help: undefined + }) + + super({ + option_strings, + dest, + default: default_value, + nargs: 0, + help + }) + } + + call(parser/*, namespace, values, option_string = undefined*/) { + parser.print_help() + parser.exit() + } +}) + + +const _VersionAction = _callable(class _VersionAction extends Action { + + constructor() { + let [ + option_strings, + version, + dest, + default_value, + help + ] = _parse_opts(arguments, { + option_strings: no_default, + version: undefined, + dest: SUPPRESS, + default: SUPPRESS, + help: "show program's version number and exit" + }) + + super({ + option_strings, + dest, + default: default_value, + nargs: 0, + help + }) + this.version = version + } + + call(parser/*, namespace, values, option_string = undefined*/) { + let version = this.version + if (version === undefined) { + version = parser.version + } + let formatter = parser._get_formatter() + formatter.add_text(version) + parser._print_message(formatter.format_help(), process.stdout) + parser.exit() + } +}) + + +const _SubParsersAction = _camelcase_alias(_callable(class _SubParsersAction extends Action { + + constructor() { + let [ + option_strings, + prog, + parser_class, + dest, + required, + help, + metavar + ] = _parse_opts(arguments, { + option_strings: no_default, + prog: no_default, + parser_class: no_default, + dest: SUPPRESS, + required: false, + help: undefined, + metavar: undefined + }) + + let name_parser_map = {} + + super({ + option_strings, + dest, + nargs: PARSER, + choices: name_parser_map, + required, + help, + metavar + }) + + this._prog_prefix = prog + this._parser_class = parser_class + this._name_parser_map = name_parser_map + this._choices_actions = [] + } + + add_parser() { + let [ + name, + kwargs + ] = _parse_opts(arguments, { + name: no_default, + '**kwargs': no_default + }) + + // set prog from the existing prefix + if (kwargs.prog === undefined) { + kwargs.prog = sub('%s %s', this._prog_prefix, name) + } + + let aliases = getattr(kwargs, 'aliases', []) + delete kwargs.aliases + + // create a pseudo-action to hold the choice help + if ('help' in kwargs) { + let help = kwargs.help + delete kwargs.help + let choice_action = this._ChoicesPseudoAction(name, aliases, help) + this._choices_actions.push(choice_action) + } + + // create the parser and add it to the map + let parser = new this._parser_class(kwargs) + this._name_parser_map[name] = parser + + // make parser available under aliases also + for (let alias of aliases) { + this._name_parser_map[alias] = parser + } + + return parser + } + + _get_subactions() { + return this._choices_actions + } + + call(parser, namespace, values/*, option_string = undefined*/) { + let parser_name = values[0] + let arg_strings = values.slice(1) + + // set the parser name if requested + if (this.dest !== SUPPRESS) { + setattr(namespace, this.dest, parser_name) + } + + // select the parser + if (hasattr(this._name_parser_map, parser_name)) { + parser = this._name_parser_map[parser_name] + } else { + let args = {parser_name, + choices: this._name_parser_map.join(', ')} + let msg = sub('unknown parser %(parser_name)r (choices: %(choices)s)', args) + throw new ArgumentError(this, msg) + } + + // parse all the remaining options into the namespace + // store any unrecognized options on the object, so that the top + // level parser can decide what to do with them + + // In case this subparser defines new defaults, we parse them + // in a new namespace object and then update the original + // namespace for the relevant parts. + let subnamespace + [ subnamespace, arg_strings ] = parser.parse_known_args(arg_strings, undefined) + for (let [ key, value ] of Object.entries(subnamespace)) { + setattr(namespace, key, value) + } + + if (arg_strings.length) { + setdefault(namespace, _UNRECOGNIZED_ARGS_ATTR, []) + getattr(namespace, _UNRECOGNIZED_ARGS_ATTR).push(...arg_strings) + } + } +})) + + +_SubParsersAction.prototype._ChoicesPseudoAction = _callable(class _ChoicesPseudoAction extends Action { + constructor(name, aliases, help) { + let metavar = name, dest = name + if (aliases.length) { + metavar += sub(' (%s)', aliases.join(', ')) + } + super({ option_strings: [], dest, help, metavar }) + } +}) + + +const _ExtendAction = _callable(class _ExtendAction extends _AppendAction { + call(parser, namespace, values/*, option_string = undefined*/) { + let items = getattr(namespace, this.dest, undefined) + items = _copy_items(items) + items = items.concat(values) + setattr(namespace, this.dest, items) + } +}) + + +// ============== +// Type classes +// ============== +const FileType = _callable(class FileType extends Function { + /* + * Factory for creating file object types + * + * Instances of FileType are typically passed as type= arguments to the + * ArgumentParser add_argument() method. + * + * Keyword Arguments: + * - mode -- A string indicating how the file is to be opened. Accepts the + * same values as the builtin open() function. + * - bufsize -- The file's desired buffer size. Accepts the same values as + * the builtin open() function. + * - encoding -- The file's encoding. Accepts the same values as the + * builtin open() function. + * - errors -- A string indicating how encoding and decoding errors are to + * be handled. Accepts the same value as the builtin open() function. + */ + + constructor() { + let [ + flags, + encoding, + mode, + autoClose, + emitClose, + start, + end, + highWaterMark, + fs + ] = _parse_opts(arguments, { + flags: 'r', + encoding: undefined, + mode: undefined, // 0o666 + autoClose: undefined, // true + emitClose: undefined, // false + start: undefined, // 0 + end: undefined, // Infinity + highWaterMark: undefined, // 64 * 1024 + fs: undefined + }) + + // when this class is called as a function, redirect it to .call() method of itself + super('return arguments.callee.call.apply(arguments.callee, arguments)') + + Object.defineProperty(this, 'name', { + get() { + return sub('FileType(%r)', flags) + } + }) + this._flags = flags + this._options = {} + if (encoding !== undefined) this._options.encoding = encoding + if (mode !== undefined) this._options.mode = mode + if (autoClose !== undefined) this._options.autoClose = autoClose + if (emitClose !== undefined) this._options.emitClose = emitClose + if (start !== undefined) this._options.start = start + if (end !== undefined) this._options.end = end + if (highWaterMark !== undefined) this._options.highWaterMark = highWaterMark + if (fs !== undefined) this._options.fs = fs + } + + call(string) { + // the special argument "-" means sys.std{in,out} + if (string === '-') { + if (this._flags.includes('r')) { + return process.stdin + } else if (this._flags.includes('w')) { + return process.stdout + } else { + let msg = sub('argument "-" with mode %r', this._flags) + throw new TypeError(msg) + } + } + + // all other arguments are used as file names + let fd + try { + fd = fs.openSync(string, this._flags, this._options.mode) + } catch (e) { + let args = { filename: string, error: e.message } + let message = "can't open '%(filename)s': %(error)s" + throw new ArgumentTypeError(sub(message, args)) + } + + let options = Object.assign({ fd, flags: this._flags }, this._options) + if (this._flags.includes('r')) { + return fs.createReadStream(undefined, options) + } else if (this._flags.includes('w')) { + return fs.createWriteStream(undefined, options) + } else { + let msg = sub('argument "%s" with mode %r', string, this._flags) + throw new TypeError(msg) + } + } + + [util.inspect.custom]() { + let args = [ this._flags ] + let kwargs = Object.entries(this._options).map(([ k, v ]) => { + if (k === 'mode') v = { value: v, [util.inspect.custom]() { return '0o' + this.value.toString(8) } } + return [ k, v ] + }) + let args_str = [] + .concat(args.filter(arg => arg !== -1).map(repr)) + .concat(kwargs.filter(([/*kw*/, arg]) => arg !== undefined) + .map(([kw, arg]) => sub('%s=%r', kw, arg))) + .join(', ') + return sub('%s(%s)', this.constructor.name, args_str) + } + + toString() { + return this[util.inspect.custom]() + } +}) + +// =========================== +// Optional and Positional Parsing +// =========================== +const Namespace = _callable(class Namespace extends _AttributeHolder() { + /* + * Simple object for storing attributes. + * + * Implements equality by attribute names and values, and provides a simple + * string representation. + */ + + constructor(options = {}) { + super() + Object.assign(this, options) + } +}) + +// unset string tag to mimic plain object +Namespace.prototype[Symbol.toStringTag] = undefined + + +const _ActionsContainer = _camelcase_alias(_callable(class _ActionsContainer { + + constructor() { + let [ + description, + prefix_chars, + argument_default, + conflict_handler + ] = _parse_opts(arguments, { + description: no_default, + prefix_chars: no_default, + argument_default: no_default, + conflict_handler: no_default + }) + + this.description = description + this.argument_default = argument_default + this.prefix_chars = prefix_chars + this.conflict_handler = conflict_handler + + // set up registries + this._registries = {} + + // register actions + this.register('action', undefined, _StoreAction) + this.register('action', 'store', _StoreAction) + this.register('action', 'store_const', _StoreConstAction) + this.register('action', 'store_true', _StoreTrueAction) + this.register('action', 'store_false', _StoreFalseAction) + this.register('action', 'append', _AppendAction) + this.register('action', 'append_const', _AppendConstAction) + this.register('action', 'count', _CountAction) + this.register('action', 'help', _HelpAction) + this.register('action', 'version', _VersionAction) + this.register('action', 'parsers', _SubParsersAction) + this.register('action', 'extend', _ExtendAction) + // LEGACY (v1 compatibility): camelcase variants + ;[ 'storeConst', 'storeTrue', 'storeFalse', 'appendConst' ].forEach(old_name => { + let new_name = _to_new_name(old_name) + this.register('action', old_name, util.deprecate(this._registry_get('action', new_name), + sub('{action: "%s"} is renamed to {action: "%s"}', old_name, new_name))) + }) + // end + + // raise an exception if the conflict handler is invalid + this._get_handler() + + // action storage + this._actions = [] + this._option_string_actions = {} + + // groups + this._action_groups = [] + this._mutually_exclusive_groups = [] + + // defaults storage + this._defaults = {} + + // determines whether an "option" looks like a negative number + this._negative_number_matcher = /^-\d+$|^-\d*\.\d+$/ + + // whether or not there are any optionals that look like negative + // numbers -- uses a list so it can be shared and edited + this._has_negative_number_optionals = [] + } + + // ==================== + // Registration methods + // ==================== + register(registry_name, value, object) { + let registry = setdefault(this._registries, registry_name, {}) + registry[value] = object + } + + _registry_get(registry_name, value, default_value = undefined) { + return getattr(this._registries[registry_name], value, default_value) + } + + // ================================== + // Namespace default accessor methods + // ================================== + set_defaults(kwargs) { + Object.assign(this._defaults, kwargs) + + // if these defaults match any existing arguments, replace + // the previous default on the object with the new one + for (let action of this._actions) { + if (action.dest in kwargs) { + action.default = kwargs[action.dest] + } + } + } + + get_default(dest) { + for (let action of this._actions) { + if (action.dest === dest && action.default !== undefined) { + return action.default + } + } + return this._defaults[dest] + } + + + // ======================= + // Adding argument actions + // ======================= + add_argument() { + /* + * add_argument(dest, ..., name=value, ...) + * add_argument(option_string, option_string, ..., name=value, ...) + */ + let [ + args, + kwargs + ] = _parse_opts(arguments, { + '*args': no_default, + '**kwargs': no_default + }) + // LEGACY (v1 compatibility), old-style add_argument([ args ], { options }) + if (args.length === 1 && Array.isArray(args[0])) { + args = args[0] + deprecate('argument-array', + sub('use add_argument(%(args)s, {...}) instead of add_argument([ %(args)s ], { ... })', { + args: args.map(repr).join(', ') + })) + } + // end + + // if no positional args are supplied or only one is supplied and + // it doesn't look like an option string, parse a positional + // argument + let chars = this.prefix_chars + if (!args.length || args.length === 1 && !chars.includes(args[0][0])) { + if (args.length && 'dest' in kwargs) { + throw new TypeError('dest supplied twice for positional argument') + } + kwargs = this._get_positional_kwargs(...args, kwargs) + + // otherwise, we're adding an optional argument + } else { + kwargs = this._get_optional_kwargs(...args, kwargs) + } + + // if no default was supplied, use the parser-level default + if (!('default' in kwargs)) { + let dest = kwargs.dest + if (dest in this._defaults) { + kwargs.default = this._defaults[dest] + } else if (this.argument_default !== undefined) { + kwargs.default = this.argument_default + } + } + + // create the action object, and add it to the parser + let action_class = this._pop_action_class(kwargs) + if (typeof action_class !== 'function') { + throw new TypeError(sub('unknown action "%s"', action_class)) + } + // eslint-disable-next-line new-cap + let action = new action_class(kwargs) + + // raise an error if the action type is not callable + let type_func = this._registry_get('type', action.type, action.type) + if (typeof type_func !== 'function') { + throw new TypeError(sub('%r is not callable', type_func)) + } + + if (type_func === FileType) { + throw new TypeError(sub('%r is a FileType class object, instance of it' + + ' must be passed', type_func)) + } + + // raise an error if the metavar does not match the type + if ('_get_formatter' in this) { + try { + this._get_formatter()._format_args(action, undefined) + } catch (err) { + // check for 'invalid nargs value' is an artifact of TypeError and ValueError in js being the same + if (err instanceof TypeError && err.message !== 'invalid nargs value') { + throw new TypeError('length of metavar tuple does not match nargs') + } else { + throw err + } + } + } + + return this._add_action(action) + } + + add_argument_group() { + let group = _ArgumentGroup(this, ...arguments) + this._action_groups.push(group) + return group + } + + add_mutually_exclusive_group() { + // eslint-disable-next-line no-use-before-define + let group = _MutuallyExclusiveGroup(this, ...arguments) + this._mutually_exclusive_groups.push(group) + return group + } + + _add_action(action) { + // resolve any conflicts + this._check_conflict(action) + + // add to actions list + this._actions.push(action) + action.container = this + + // index the action by any option strings it has + for (let option_string of action.option_strings) { + this._option_string_actions[option_string] = action + } + + // set the flag if any option strings look like negative numbers + for (let option_string of action.option_strings) { + if (this._negative_number_matcher.test(option_string)) { + if (!this._has_negative_number_optionals.length) { + this._has_negative_number_optionals.push(true) + } + } + } + + // return the created action + return action + } + + _remove_action(action) { + _array_remove(this._actions, action) + } + + _add_container_actions(container) { + // collect groups by titles + let title_group_map = {} + for (let group of this._action_groups) { + if (group.title in title_group_map) { + let msg = 'cannot merge actions - two groups are named %r' + throw new TypeError(sub(msg, group.title)) + } + title_group_map[group.title] = group + } + + // map each action to its group + let group_map = new Map() + for (let group of container._action_groups) { + + // if a group with the title exists, use that, otherwise + // create a new group matching the container's group + if (!(group.title in title_group_map)) { + title_group_map[group.title] = this.add_argument_group({ + title: group.title, + description: group.description, + conflict_handler: group.conflict_handler + }) + } + + // map the actions to their new group + for (let action of group._group_actions) { + group_map.set(action, title_group_map[group.title]) + } + } + + // add container's mutually exclusive groups + // NOTE: if add_mutually_exclusive_group ever gains title= and + // description= then this code will need to be expanded as above + for (let group of container._mutually_exclusive_groups) { + let mutex_group = this.add_mutually_exclusive_group({ + required: group.required + }) + + // map the actions to their new mutex group + for (let action of group._group_actions) { + group_map.set(action, mutex_group) + } + } + + // add all actions to this container or their group + for (let action of container._actions) { + group_map.get(action)._add_action(action) + } + } + + _get_positional_kwargs() { + let [ + dest, + kwargs + ] = _parse_opts(arguments, { + dest: no_default, + '**kwargs': no_default + }) + + // make sure required is not specified + if ('required' in kwargs) { + let msg = "'required' is an invalid argument for positionals" + throw new TypeError(msg) + } + + // mark positional arguments as required if at least one is + // always required + if (![OPTIONAL, ZERO_OR_MORE].includes(kwargs.nargs)) { + kwargs.required = true + } + if (kwargs.nargs === ZERO_OR_MORE && !('default' in kwargs)) { + kwargs.required = true + } + + // return the keyword arguments with no option strings + return Object.assign(kwargs, { dest, option_strings: [] }) + } + + _get_optional_kwargs() { + let [ + args, + kwargs + ] = _parse_opts(arguments, { + '*args': no_default, + '**kwargs': no_default + }) + + // determine short and long option strings + let option_strings = [] + let long_option_strings = [] + let option_string + for (option_string of args) { + // error on strings that don't start with an appropriate prefix + if (!this.prefix_chars.includes(option_string[0])) { + let args = {option: option_string, + prefix_chars: this.prefix_chars} + let msg = 'invalid option string %(option)r: ' + + 'must start with a character %(prefix_chars)r' + throw new TypeError(sub(msg, args)) + } + + // strings starting with two prefix characters are long options + option_strings.push(option_string) + if (option_string.length > 1 && this.prefix_chars.includes(option_string[1])) { + long_option_strings.push(option_string) + } + } + + // infer destination, '--foo-bar' -> 'foo_bar' and '-x' -> 'x' + let dest = kwargs.dest + delete kwargs.dest + if (dest === undefined) { + let dest_option_string + if (long_option_strings.length) { + dest_option_string = long_option_strings[0] + } else { + dest_option_string = option_strings[0] + } + dest = _string_lstrip(dest_option_string, this.prefix_chars) + if (!dest) { + let msg = 'dest= is required for options like %r' + throw new TypeError(sub(msg, option_string)) + } + dest = dest.replace(/-/g, '_') + } + + // return the updated keyword arguments + return Object.assign(kwargs, { dest, option_strings }) + } + + _pop_action_class(kwargs, default_value = undefined) { + let action = getattr(kwargs, 'action', default_value) + delete kwargs.action + return this._registry_get('action', action, action) + } + + _get_handler() { + // determine function from conflict handler string + let handler_func_name = sub('_handle_conflict_%s', this.conflict_handler) + if (typeof this[handler_func_name] === 'function') { + return this[handler_func_name] + } else { + let msg = 'invalid conflict_resolution value: %r' + throw new TypeError(sub(msg, this.conflict_handler)) + } + } + + _check_conflict(action) { + + // find all options that conflict with this option + let confl_optionals = [] + for (let option_string of action.option_strings) { + if (hasattr(this._option_string_actions, option_string)) { + let confl_optional = this._option_string_actions[option_string] + confl_optionals.push([ option_string, confl_optional ]) + } + } + + // resolve any conflicts + if (confl_optionals.length) { + let conflict_handler = this._get_handler() + conflict_handler.call(this, action, confl_optionals) + } + } + + _handle_conflict_error(action, conflicting_actions) { + let message = conflicting_actions.length === 1 ? + 'conflicting option string: %s' : + 'conflicting option strings: %s' + let conflict_string = conflicting_actions.map(([ option_string/*, action*/ ]) => option_string).join(', ') + throw new ArgumentError(action, sub(message, conflict_string)) + } + + _handle_conflict_resolve(action, conflicting_actions) { + + // remove all conflicting options + for (let [ option_string, action ] of conflicting_actions) { + + // remove the conflicting option + _array_remove(action.option_strings, option_string) + delete this._option_string_actions[option_string] + + // if the option now has no option string, remove it from the + // container holding it + if (!action.option_strings.length) { + action.container._remove_action(action) + } + } + } +})) + + +const _ArgumentGroup = _callable(class _ArgumentGroup extends _ActionsContainer { + + constructor() { + let [ + container, + title, + description, + kwargs + ] = _parse_opts(arguments, { + container: no_default, + title: undefined, + description: undefined, + '**kwargs': no_default + }) + + // add any missing keyword arguments by checking the container + setdefault(kwargs, 'conflict_handler', container.conflict_handler) + setdefault(kwargs, 'prefix_chars', container.prefix_chars) + setdefault(kwargs, 'argument_default', container.argument_default) + super(Object.assign({ description }, kwargs)) + + // group attributes + this.title = title + this._group_actions = [] + + // share most attributes with the container + this._registries = container._registries + this._actions = container._actions + this._option_string_actions = container._option_string_actions + this._defaults = container._defaults + this._has_negative_number_optionals = + container._has_negative_number_optionals + this._mutually_exclusive_groups = container._mutually_exclusive_groups + } + + _add_action(action) { + action = super._add_action(action) + this._group_actions.push(action) + return action + } + + _remove_action(action) { + super._remove_action(action) + _array_remove(this._group_actions, action) + } +}) + + +const _MutuallyExclusiveGroup = _callable(class _MutuallyExclusiveGroup extends _ArgumentGroup { + + constructor() { + let [ + container, + required + ] = _parse_opts(arguments, { + container: no_default, + required: false + }) + + super(container) + this.required = required + this._container = container + } + + _add_action(action) { + if (action.required) { + let msg = 'mutually exclusive arguments must be optional' + throw new TypeError(msg) + } + action = this._container._add_action(action) + this._group_actions.push(action) + return action + } + + _remove_action(action) { + this._container._remove_action(action) + _array_remove(this._group_actions, action) + } +}) + + +const ArgumentParser = _camelcase_alias(_callable(class ArgumentParser extends _AttributeHolder(_ActionsContainer) { + /* + * Object for parsing command line strings into Python objects. + * + * Keyword Arguments: + * - prog -- The name of the program (default: sys.argv[0]) + * - usage -- A usage message (default: auto-generated from arguments) + * - description -- A description of what the program does + * - epilog -- Text following the argument descriptions + * - parents -- Parsers whose arguments should be copied into this one + * - formatter_class -- HelpFormatter class for printing help messages + * - prefix_chars -- Characters that prefix optional arguments + * - fromfile_prefix_chars -- Characters that prefix files containing + * additional arguments + * - argument_default -- The default value for all arguments + * - conflict_handler -- String indicating how to handle conflicts + * - add_help -- Add a -h/-help option + * - allow_abbrev -- Allow long options to be abbreviated unambiguously + * - exit_on_error -- Determines whether or not ArgumentParser exits with + * error info when an error occurs + */ + + constructor() { + let [ + prog, + usage, + description, + epilog, + parents, + formatter_class, + prefix_chars, + fromfile_prefix_chars, + argument_default, + conflict_handler, + add_help, + allow_abbrev, + exit_on_error, + debug, // LEGACY (v1 compatibility), debug mode + version // LEGACY (v1 compatibility), version + ] = _parse_opts(arguments, { + prog: undefined, + usage: undefined, + description: undefined, + epilog: undefined, + parents: [], + formatter_class: HelpFormatter, + prefix_chars: '-', + fromfile_prefix_chars: undefined, + argument_default: undefined, + conflict_handler: 'error', + add_help: true, + allow_abbrev: true, + exit_on_error: true, + debug: undefined, // LEGACY (v1 compatibility), debug mode + version: undefined // LEGACY (v1 compatibility), version + }) + + // LEGACY (v1 compatibility) + if (debug !== undefined) { + deprecate('debug', + 'The "debug" argument to ArgumentParser is deprecated. Please ' + + 'override ArgumentParser.exit function instead.' + ) + } + + if (version !== undefined) { + deprecate('version', + 'The "version" argument to ArgumentParser is deprecated. Please use ' + + "add_argument(..., { action: 'version', version: 'N', ... }) instead." + ) + } + // end + + super({ + description, + prefix_chars, + argument_default, + conflict_handler + }) + + // default setting for prog + if (prog === undefined) { + prog = path.basename(get_argv()[0] || '') + } + + this.prog = prog + this.usage = usage + this.epilog = epilog + this.formatter_class = formatter_class + this.fromfile_prefix_chars = fromfile_prefix_chars + this.add_help = add_help + this.allow_abbrev = allow_abbrev + this.exit_on_error = exit_on_error + // LEGACY (v1 compatibility), debug mode + this.debug = debug + // end + + this._positionals = this.add_argument_group('positional arguments') + this._optionals = this.add_argument_group('optional arguments') + this._subparsers = undefined + + // register types + function identity(string) { + return string + } + this.register('type', undefined, identity) + this.register('type', null, identity) + this.register('type', 'auto', identity) + this.register('type', 'int', function (x) { + let result = Number(x) + if (!Number.isInteger(result)) { + throw new TypeError(sub('could not convert string to int: %r', x)) + } + return result + }) + this.register('type', 'float', function (x) { + let result = Number(x) + if (isNaN(result)) { + throw new TypeError(sub('could not convert string to float: %r', x)) + } + return result + }) + this.register('type', 'str', String) + // LEGACY (v1 compatibility): custom types + this.register('type', 'string', + util.deprecate(String, 'use {type:"str"} or {type:String} instead of {type:"string"}')) + // end + + // add help argument if necessary + // (using explicit default to override global argument_default) + let default_prefix = prefix_chars.includes('-') ? '-' : prefix_chars[0] + if (this.add_help) { + this.add_argument( + default_prefix + 'h', + default_prefix.repeat(2) + 'help', + { + action: 'help', + default: SUPPRESS, + help: 'show this help message and exit' + } + ) + } + // LEGACY (v1 compatibility), version + if (version) { + this.add_argument( + default_prefix + 'v', + default_prefix.repeat(2) + 'version', + { + action: 'version', + default: SUPPRESS, + version: this.version, + help: "show program's version number and exit" + } + ) + } + // end + + // add parent arguments and defaults + for (let parent of parents) { + this._add_container_actions(parent) + Object.assign(this._defaults, parent._defaults) + } + } + + // ======================= + // Pretty __repr__ methods + // ======================= + _get_kwargs() { + let names = [ + 'prog', + 'usage', + 'description', + 'formatter_class', + 'conflict_handler', + 'add_help' + ] + return names.map(name => [ name, getattr(this, name) ]) + } + + // ================================== + // Optional/Positional adding methods + // ================================== + add_subparsers() { + let [ + kwargs + ] = _parse_opts(arguments, { + '**kwargs': no_default + }) + + if (this._subparsers !== undefined) { + this.error('cannot have multiple subparser arguments') + } + + // add the parser class to the arguments if it's not present + setdefault(kwargs, 'parser_class', this.constructor) + + if ('title' in kwargs || 'description' in kwargs) { + let title = getattr(kwargs, 'title', 'subcommands') + let description = getattr(kwargs, 'description', undefined) + delete kwargs.title + delete kwargs.description + this._subparsers = this.add_argument_group(title, description) + } else { + this._subparsers = this._positionals + } + + // prog defaults to the usage message of this parser, skipping + // optional arguments and with no "usage:" prefix + if (kwargs.prog === undefined) { + let formatter = this._get_formatter() + let positionals = this._get_positional_actions() + let groups = this._mutually_exclusive_groups + formatter.add_usage(this.usage, positionals, groups, '') + kwargs.prog = formatter.format_help().trim() + } + + // create the parsers action and add it to the positionals list + let parsers_class = this._pop_action_class(kwargs, 'parsers') + // eslint-disable-next-line new-cap + let action = new parsers_class(Object.assign({ option_strings: [] }, kwargs)) + this._subparsers._add_action(action) + + // return the created parsers action + return action + } + + _add_action(action) { + if (action.option_strings.length) { + this._optionals._add_action(action) + } else { + this._positionals._add_action(action) + } + return action + } + + _get_optional_actions() { + return this._actions.filter(action => action.option_strings.length) + } + + _get_positional_actions() { + return this._actions.filter(action => !action.option_strings.length) + } + + // ===================================== + // Command line argument parsing methods + // ===================================== + parse_args(args = undefined, namespace = undefined) { + let argv + [ args, argv ] = this.parse_known_args(args, namespace) + if (argv && argv.length > 0) { + let msg = 'unrecognized arguments: %s' + this.error(sub(msg, argv.join(' '))) + } + return args + } + + parse_known_args(args = undefined, namespace = undefined) { + if (args === undefined) { + args = get_argv().slice(1) + } + + // default Namespace built from parser defaults + if (namespace === undefined) { + namespace = new Namespace() + } + + // add any action defaults that aren't present + for (let action of this._actions) { + if (action.dest !== SUPPRESS) { + if (!hasattr(namespace, action.dest)) { + if (action.default !== SUPPRESS) { + setattr(namespace, action.dest, action.default) + } + } + } + } + + // add any parser defaults that aren't present + for (let dest of Object.keys(this._defaults)) { + if (!hasattr(namespace, dest)) { + setattr(namespace, dest, this._defaults[dest]) + } + } + + // parse the arguments and exit if there are any errors + if (this.exit_on_error) { + try { + [ namespace, args ] = this._parse_known_args(args, namespace) + } catch (err) { + if (err instanceof ArgumentError) { + this.error(err.message) + } else { + throw err + } + } + } else { + [ namespace, args ] = this._parse_known_args(args, namespace) + } + + if (hasattr(namespace, _UNRECOGNIZED_ARGS_ATTR)) { + args = args.concat(getattr(namespace, _UNRECOGNIZED_ARGS_ATTR)) + delattr(namespace, _UNRECOGNIZED_ARGS_ATTR) + } + + return [ namespace, args ] + } + + _parse_known_args(arg_strings, namespace) { + // replace arg strings that are file references + if (this.fromfile_prefix_chars !== undefined) { + arg_strings = this._read_args_from_files(arg_strings) + } + + // map all mutually exclusive arguments to the other arguments + // they can't occur with + let action_conflicts = new Map() + for (let mutex_group of this._mutually_exclusive_groups) { + let group_actions = mutex_group._group_actions + for (let [ i, mutex_action ] of Object.entries(mutex_group._group_actions)) { + let conflicts = action_conflicts.get(mutex_action) || [] + conflicts = conflicts.concat(group_actions.slice(0, +i)) + conflicts = conflicts.concat(group_actions.slice(+i + 1)) + action_conflicts.set(mutex_action, conflicts) + } + } + + // find all option indices, and determine the arg_string_pattern + // which has an 'O' if there is an option at an index, + // an 'A' if there is an argument, or a '-' if there is a '--' + let option_string_indices = {} + let arg_string_pattern_parts = [] + let arg_strings_iter = Object.entries(arg_strings)[Symbol.iterator]() + for (let [ i, arg_string ] of arg_strings_iter) { + + // all args after -- are non-options + if (arg_string === '--') { + arg_string_pattern_parts.push('-') + for ([ i, arg_string ] of arg_strings_iter) { + arg_string_pattern_parts.push('A') + } + + // otherwise, add the arg to the arg strings + // and note the index if it was an option + } else { + let option_tuple = this._parse_optional(arg_string) + let pattern + if (option_tuple === undefined) { + pattern = 'A' + } else { + option_string_indices[i] = option_tuple + pattern = 'O' + } + arg_string_pattern_parts.push(pattern) + } + } + + // join the pieces together to form the pattern + let arg_strings_pattern = arg_string_pattern_parts.join('') + + // converts arg strings to the appropriate and then takes the action + let seen_actions = new Set() + let seen_non_default_actions = new Set() + let extras + + let take_action = (action, argument_strings, option_string = undefined) => { + seen_actions.add(action) + let argument_values = this._get_values(action, argument_strings) + + // error if this argument is not allowed with other previously + // seen arguments, assuming that actions that use the default + // value don't really count as "present" + if (argument_values !== action.default) { + seen_non_default_actions.add(action) + for (let conflict_action of action_conflicts.get(action) || []) { + if (seen_non_default_actions.has(conflict_action)) { + let msg = 'not allowed with argument %s' + let action_name = _get_action_name(conflict_action) + throw new ArgumentError(action, sub(msg, action_name)) + } + } + } + + // take the action if we didn't receive a SUPPRESS value + // (e.g. from a default) + if (argument_values !== SUPPRESS) { + action(this, namespace, argument_values, option_string) + } + } + + // function to convert arg_strings into an optional action + let consume_optional = start_index => { + + // get the optional identified at this index + let option_tuple = option_string_indices[start_index] + let [ action, option_string, explicit_arg ] = option_tuple + + // identify additional optionals in the same arg string + // (e.g. -xyz is the same as -x -y -z if no args are required) + let action_tuples = [] + let stop + for (;;) { + + // if we found no optional action, skip it + if (action === undefined) { + extras.push(arg_strings[start_index]) + return start_index + 1 + } + + // if there is an explicit argument, try to match the + // optional's string arguments to only this + if (explicit_arg !== undefined) { + let arg_count = this._match_argument(action, 'A') + + // if the action is a single-dash option and takes no + // arguments, try to parse more single-dash options out + // of the tail of the option string + let chars = this.prefix_chars + if (arg_count === 0 && !chars.includes(option_string[1])) { + action_tuples.push([ action, [], option_string ]) + let char = option_string[0] + option_string = char + explicit_arg[0] + let new_explicit_arg = explicit_arg.slice(1) || undefined + let optionals_map = this._option_string_actions + if (hasattr(optionals_map, option_string)) { + action = optionals_map[option_string] + explicit_arg = new_explicit_arg + } else { + let msg = 'ignored explicit argument %r' + throw new ArgumentError(action, sub(msg, explicit_arg)) + } + + // if the action expect exactly one argument, we've + // successfully matched the option; exit the loop + } else if (arg_count === 1) { + stop = start_index + 1 + let args = [ explicit_arg ] + action_tuples.push([ action, args, option_string ]) + break + + // error if a double-dash option did not use the + // explicit argument + } else { + let msg = 'ignored explicit argument %r' + throw new ArgumentError(action, sub(msg, explicit_arg)) + } + + // if there is no explicit argument, try to match the + // optional's string arguments with the following strings + // if successful, exit the loop + } else { + let start = start_index + 1 + let selected_patterns = arg_strings_pattern.slice(start) + let arg_count = this._match_argument(action, selected_patterns) + stop = start + arg_count + let args = arg_strings.slice(start, stop) + action_tuples.push([ action, args, option_string ]) + break + } + } + + // add the Optional to the list and return the index at which + // the Optional's string args stopped + assert(action_tuples.length) + for (let [ action, args, option_string ] of action_tuples) { + take_action(action, args, option_string) + } + return stop + } + + // the list of Positionals left to be parsed; this is modified + // by consume_positionals() + let positionals = this._get_positional_actions() + + // function to convert arg_strings into positional actions + let consume_positionals = start_index => { + // match as many Positionals as possible + let selected_pattern = arg_strings_pattern.slice(start_index) + let arg_counts = this._match_arguments_partial(positionals, selected_pattern) + + // slice off the appropriate arg strings for each Positional + // and add the Positional and its args to the list + for (let i = 0; i < positionals.length && i < arg_counts.length; i++) { + let action = positionals[i] + let arg_count = arg_counts[i] + let args = arg_strings.slice(start_index, start_index + arg_count) + start_index += arg_count + take_action(action, args) + } + + // slice off the Positionals that we just parsed and return the + // index at which the Positionals' string args stopped + positionals = positionals.slice(arg_counts.length) + return start_index + } + + // consume Positionals and Optionals alternately, until we have + // passed the last option string + extras = [] + let start_index = 0 + let max_option_string_index = Math.max(-1, ...Object.keys(option_string_indices).map(Number)) + while (start_index <= max_option_string_index) { + + // consume any Positionals preceding the next option + let next_option_string_index = Math.min( + // eslint-disable-next-line no-loop-func + ...Object.keys(option_string_indices).map(Number).filter(index => index >= start_index) + ) + if (start_index !== next_option_string_index) { + let positionals_end_index = consume_positionals(start_index) + + // only try to parse the next optional if we didn't consume + // the option string during the positionals parsing + if (positionals_end_index > start_index) { + start_index = positionals_end_index + continue + } else { + start_index = positionals_end_index + } + } + + // if we consumed all the positionals we could and we're not + // at the index of an option string, there were extra arguments + if (!(start_index in option_string_indices)) { + let strings = arg_strings.slice(start_index, next_option_string_index) + extras = extras.concat(strings) + start_index = next_option_string_index + } + + // consume the next optional and any arguments for it + start_index = consume_optional(start_index) + } + + // consume any positionals following the last Optional + let stop_index = consume_positionals(start_index) + + // if we didn't consume all the argument strings, there were extras + extras = extras.concat(arg_strings.slice(stop_index)) + + // make sure all required actions were present and also convert + // action defaults which were not given as arguments + let required_actions = [] + for (let action of this._actions) { + if (!seen_actions.has(action)) { + if (action.required) { + required_actions.push(_get_action_name(action)) + } else { + // Convert action default now instead of doing it before + // parsing arguments to avoid calling convert functions + // twice (which may fail) if the argument was given, but + // only if it was defined already in the namespace + if (action.default !== undefined && + typeof action.default === 'string' && + hasattr(namespace, action.dest) && + action.default === getattr(namespace, action.dest)) { + setattr(namespace, action.dest, + this._get_value(action, action.default)) + } + } + } + } + + if (required_actions.length) { + this.error(sub('the following arguments are required: %s', + required_actions.join(', '))) + } + + // make sure all required groups had one option present + for (let group of this._mutually_exclusive_groups) { + if (group.required) { + let no_actions_used = true + for (let action of group._group_actions) { + if (seen_non_default_actions.has(action)) { + no_actions_used = false + break + } + } + + // if no actions were used, report the error + if (no_actions_used) { + let names = group._group_actions + .filter(action => action.help !== SUPPRESS) + .map(action => _get_action_name(action)) + let msg = 'one of the arguments %s is required' + this.error(sub(msg, names.join(' '))) + } + } + } + + // return the updated namespace and the extra arguments + return [ namespace, extras ] + } + + _read_args_from_files(arg_strings) { + // expand arguments referencing files + let new_arg_strings = [] + for (let arg_string of arg_strings) { + + // for regular arguments, just add them back into the list + if (!arg_string || !this.fromfile_prefix_chars.includes(arg_string[0])) { + new_arg_strings.push(arg_string) + + // replace arguments referencing files with the file content + } else { + try { + let args_file = fs.readFileSync(arg_string.slice(1), 'utf8') + let arg_strings = [] + for (let arg_line of splitlines(args_file)) { + for (let arg of this.convert_arg_line_to_args(arg_line)) { + arg_strings.push(arg) + } + } + arg_strings = this._read_args_from_files(arg_strings) + new_arg_strings = new_arg_strings.concat(arg_strings) + } catch (err) { + this.error(err.message) + } + } + } + + // return the modified argument list + return new_arg_strings + } + + convert_arg_line_to_args(arg_line) { + return [arg_line] + } + + _match_argument(action, arg_strings_pattern) { + // match the pattern for this action to the arg strings + let nargs_pattern = this._get_nargs_pattern(action) + let match = arg_strings_pattern.match(new RegExp('^' + nargs_pattern)) + + // raise an exception if we weren't able to find a match + if (match === null) { + let nargs_errors = { + undefined: 'expected one argument', + [OPTIONAL]: 'expected at most one argument', + [ONE_OR_MORE]: 'expected at least one argument' + } + let msg = nargs_errors[action.nargs] + if (msg === undefined) { + msg = sub(action.nargs === 1 ? 'expected %s argument' : 'expected %s arguments', action.nargs) + } + throw new ArgumentError(action, msg) + } + + // return the number of arguments matched + return match[1].length + } + + _match_arguments_partial(actions, arg_strings_pattern) { + // progressively shorten the actions list by slicing off the + // final actions until we find a match + let result = [] + for (let i of range(actions.length, 0, -1)) { + let actions_slice = actions.slice(0, i) + let pattern = actions_slice.map(action => this._get_nargs_pattern(action)).join('') + let match = arg_strings_pattern.match(new RegExp('^' + pattern)) + if (match !== null) { + result = result.concat(match.slice(1).map(string => string.length)) + break + } + } + + // return the list of arg string counts + return result + } + + _parse_optional(arg_string) { + // if it's an empty string, it was meant to be a positional + if (!arg_string) { + return undefined + } + + // if it doesn't start with a prefix, it was meant to be positional + if (!this.prefix_chars.includes(arg_string[0])) { + return undefined + } + + // if the option string is present in the parser, return the action + if (arg_string in this._option_string_actions) { + let action = this._option_string_actions[arg_string] + return [ action, arg_string, undefined ] + } + + // if it's just a single character, it was meant to be positional + if (arg_string.length === 1) { + return undefined + } + + // if the option string before the "=" is present, return the action + if (arg_string.includes('=')) { + let [ option_string, explicit_arg ] = _string_split(arg_string, '=', 1) + if (option_string in this._option_string_actions) { + let action = this._option_string_actions[option_string] + return [ action, option_string, explicit_arg ] + } + } + + // search through all possible prefixes of the option string + // and all actions in the parser for possible interpretations + let option_tuples = this._get_option_tuples(arg_string) + + // if multiple actions match, the option string was ambiguous + if (option_tuples.length > 1) { + let options = option_tuples.map(([ /*action*/, option_string/*, explicit_arg*/ ]) => option_string).join(', ') + let args = {option: arg_string, matches: options} + let msg = 'ambiguous option: %(option)s could match %(matches)s' + this.error(sub(msg, args)) + + // if exactly one action matched, this segmentation is good, + // so return the parsed action + } else if (option_tuples.length === 1) { + let [ option_tuple ] = option_tuples + return option_tuple + } + + // if it was not found as an option, but it looks like a negative + // number, it was meant to be positional + // unless there are negative-number-like options + if (this._negative_number_matcher.test(arg_string)) { + if (!this._has_negative_number_optionals.length) { + return undefined + } + } + + // if it contains a space, it was meant to be a positional + if (arg_string.includes(' ')) { + return undefined + } + + // it was meant to be an optional but there is no such option + // in this parser (though it might be a valid option in a subparser) + return [ undefined, arg_string, undefined ] + } + + _get_option_tuples(option_string) { + let result = [] + + // option strings starting with two prefix characters are only + // split at the '=' + let chars = this.prefix_chars + if (chars.includes(option_string[0]) && chars.includes(option_string[1])) { + if (this.allow_abbrev) { + let option_prefix, explicit_arg + if (option_string.includes('=')) { + [ option_prefix, explicit_arg ] = _string_split(option_string, '=', 1) + } else { + option_prefix = option_string + explicit_arg = undefined + } + for (let option_string of Object.keys(this._option_string_actions)) { + if (option_string.startsWith(option_prefix)) { + let action = this._option_string_actions[option_string] + let tup = [ action, option_string, explicit_arg ] + result.push(tup) + } + } + } + + // single character options can be concatenated with their arguments + // but multiple character options always have to have their argument + // separate + } else if (chars.includes(option_string[0]) && !chars.includes(option_string[1])) { + let option_prefix = option_string + let explicit_arg = undefined + let short_option_prefix = option_string.slice(0, 2) + let short_explicit_arg = option_string.slice(2) + + for (let option_string of Object.keys(this._option_string_actions)) { + if (option_string === short_option_prefix) { + let action = this._option_string_actions[option_string] + let tup = [ action, option_string, short_explicit_arg ] + result.push(tup) + } else if (option_string.startsWith(option_prefix)) { + let action = this._option_string_actions[option_string] + let tup = [ action, option_string, explicit_arg ] + result.push(tup) + } + } + + // shouldn't ever get here + } else { + this.error(sub('unexpected option string: %s', option_string)) + } + + // return the collected option tuples + return result + } + + _get_nargs_pattern(action) { + // in all examples below, we have to allow for '--' args + // which are represented as '-' in the pattern + let nargs = action.nargs + let nargs_pattern + + // the default (None) is assumed to be a single argument + if (nargs === undefined) { + nargs_pattern = '(-*A-*)' + + // allow zero or one arguments + } else if (nargs === OPTIONAL) { + nargs_pattern = '(-*A?-*)' + + // allow zero or more arguments + } else if (nargs === ZERO_OR_MORE) { + nargs_pattern = '(-*[A-]*)' + + // allow one or more arguments + } else if (nargs === ONE_OR_MORE) { + nargs_pattern = '(-*A[A-]*)' + + // allow any number of options or arguments + } else if (nargs === REMAINDER) { + nargs_pattern = '([-AO]*)' + + // allow one argument followed by any number of options or arguments + } else if (nargs === PARSER) { + nargs_pattern = '(-*A[-AO]*)' + + // suppress action, like nargs=0 + } else if (nargs === SUPPRESS) { + nargs_pattern = '(-*-*)' + + // all others should be integers + } else { + nargs_pattern = sub('(-*%s-*)', 'A'.repeat(nargs).split('').join('-*')) + } + + // if this is an optional action, -- is not allowed + if (action.option_strings.length) { + nargs_pattern = nargs_pattern.replace(/-\*/g, '') + nargs_pattern = nargs_pattern.replace(/-/g, '') + } + + // return the pattern + return nargs_pattern + } + + // ======================== + // Alt command line argument parsing, allowing free intermix + // ======================== + + parse_intermixed_args(args = undefined, namespace = undefined) { + let argv + [ args, argv ] = this.parse_known_intermixed_args(args, namespace) + if (argv.length) { + let msg = 'unrecognized arguments: %s' + this.error(sub(msg, argv.join(' '))) + } + return args + } + + parse_known_intermixed_args(args = undefined, namespace = undefined) { + // returns a namespace and list of extras + // + // positional can be freely intermixed with optionals. optionals are + // first parsed with all positional arguments deactivated. The 'extras' + // are then parsed. If the parser definition is incompatible with the + // intermixed assumptions (e.g. use of REMAINDER, subparsers) a + // TypeError is raised. + // + // positionals are 'deactivated' by setting nargs and default to + // SUPPRESS. This blocks the addition of that positional to the + // namespace + + let extras + let positionals = this._get_positional_actions() + let a = positionals.filter(action => [ PARSER, REMAINDER ].includes(action.nargs)) + if (a.length) { + throw new TypeError(sub('parse_intermixed_args: positional arg' + + ' with nargs=%s', a[0].nargs)) + } + + for (let group of this._mutually_exclusive_groups) { + for (let action of group._group_actions) { + if (positionals.includes(action)) { + throw new TypeError('parse_intermixed_args: positional in' + + ' mutuallyExclusiveGroup') + } + } + } + + let save_usage + try { + save_usage = this.usage + let remaining_args + try { + if (this.usage === undefined) { + // capture the full usage for use in error messages + this.usage = this.format_usage().slice(7) + } + for (let action of positionals) { + // deactivate positionals + action.save_nargs = action.nargs + // action.nargs = 0 + action.nargs = SUPPRESS + action.save_default = action.default + action.default = SUPPRESS + } + [ namespace, remaining_args ] = this.parse_known_args(args, + namespace) + for (let action of positionals) { + // remove the empty positional values from namespace + let attr = getattr(namespace, action.dest) + if (Array.isArray(attr) && attr.length === 0) { + // eslint-disable-next-line no-console + console.warn(sub('Do not expect %s in %s', action.dest, namespace)) + delattr(namespace, action.dest) + } + } + } finally { + // restore nargs and usage before exiting + for (let action of positionals) { + action.nargs = action.save_nargs + action.default = action.save_default + } + } + let optionals = this._get_optional_actions() + try { + // parse positionals. optionals aren't normally required, but + // they could be, so make sure they aren't. + for (let action of optionals) { + action.save_required = action.required + action.required = false + } + for (let group of this._mutually_exclusive_groups) { + group.save_required = group.required + group.required = false + } + [ namespace, extras ] = this.parse_known_args(remaining_args, + namespace) + } finally { + // restore parser values before exiting + for (let action of optionals) { + action.required = action.save_required + } + for (let group of this._mutually_exclusive_groups) { + group.required = group.save_required + } + } + } finally { + this.usage = save_usage + } + return [ namespace, extras ] + } + + // ======================== + // Value conversion methods + // ======================== + _get_values(action, arg_strings) { + // for everything but PARSER, REMAINDER args, strip out first '--' + if (![PARSER, REMAINDER].includes(action.nargs)) { + try { + _array_remove(arg_strings, '--') + } catch (err) {} + } + + let value + // optional argument produces a default when not present + if (!arg_strings.length && action.nargs === OPTIONAL) { + if (action.option_strings.length) { + value = action.const + } else { + value = action.default + } + if (typeof value === 'string') { + value = this._get_value(action, value) + this._check_value(action, value) + } + + // when nargs='*' on a positional, if there were no command-line + // args, use the default if it is anything other than None + } else if (!arg_strings.length && action.nargs === ZERO_OR_MORE && + !action.option_strings.length) { + if (action.default !== undefined) { + value = action.default + } else { + value = arg_strings + } + this._check_value(action, value) + + // single argument or optional argument produces a single value + } else if (arg_strings.length === 1 && [undefined, OPTIONAL].includes(action.nargs)) { + let arg_string = arg_strings[0] + value = this._get_value(action, arg_string) + this._check_value(action, value) + + // REMAINDER arguments convert all values, checking none + } else if (action.nargs === REMAINDER) { + value = arg_strings.map(v => this._get_value(action, v)) + + // PARSER arguments convert all values, but check only the first + } else if (action.nargs === PARSER) { + value = arg_strings.map(v => this._get_value(action, v)) + this._check_value(action, value[0]) + + // SUPPRESS argument does not put anything in the namespace + } else if (action.nargs === SUPPRESS) { + value = SUPPRESS + + // all other types of nargs produce a list + } else { + value = arg_strings.map(v => this._get_value(action, v)) + for (let v of value) { + this._check_value(action, v) + } + } + + // return the converted value + return value + } + + _get_value(action, arg_string) { + let type_func = this._registry_get('type', action.type, action.type) + if (typeof type_func !== 'function') { + let msg = '%r is not callable' + throw new ArgumentError(action, sub(msg, type_func)) + } + + // convert the value to the appropriate type + let result + try { + try { + result = type_func(arg_string) + } catch (err) { + // Dear TC39, why would you ever consider making es6 classes not callable? + // We had one universal interface, [[Call]], which worked for anything + // (with familiar this-instanceof guard for classes). Now we have two. + if (err instanceof TypeError && + /Class constructor .* cannot be invoked without 'new'/.test(err.message)) { + // eslint-disable-next-line new-cap + result = new type_func(arg_string) + } else { + throw err + } + } + + } catch (err) { + // ArgumentTypeErrors indicate errors + if (err instanceof ArgumentTypeError) { + //let name = getattr(action.type, 'name', repr(action.type)) + let msg = err.message + throw new ArgumentError(action, msg) + + // TypeErrors or ValueErrors also indicate errors + } else if (err instanceof TypeError) { + let name = getattr(action.type, 'name', repr(action.type)) + let args = {type: name, value: arg_string} + let msg = 'invalid %(type)s value: %(value)r' + throw new ArgumentError(action, sub(msg, args)) + } else { + throw err + } + } + + // return the converted value + return result + } + + _check_value(action, value) { + // converted value must be one of the choices (if specified) + if (action.choices !== undefined && !_choices_to_array(action.choices).includes(value)) { + let args = {value, + choices: _choices_to_array(action.choices).map(repr).join(', ')} + let msg = 'invalid choice: %(value)r (choose from %(choices)s)' + throw new ArgumentError(action, sub(msg, args)) + } + } + + // ======================= + // Help-formatting methods + // ======================= + format_usage() { + let formatter = this._get_formatter() + formatter.add_usage(this.usage, this._actions, + this._mutually_exclusive_groups) + return formatter.format_help() + } + + format_help() { + let formatter = this._get_formatter() + + // usage + formatter.add_usage(this.usage, this._actions, + this._mutually_exclusive_groups) + + // description + formatter.add_text(this.description) + + // positionals, optionals and user-defined groups + for (let action_group of this._action_groups) { + formatter.start_section(action_group.title) + formatter.add_text(action_group.description) + formatter.add_arguments(action_group._group_actions) + formatter.end_section() + } + + // epilog + formatter.add_text(this.epilog) + + // determine help from format above + return formatter.format_help() + } + + _get_formatter() { + // eslint-disable-next-line new-cap + return new this.formatter_class({ prog: this.prog }) + } + + // ===================== + // Help-printing methods + // ===================== + print_usage(file = undefined) { + if (file === undefined) file = process.stdout + this._print_message(this.format_usage(), file) + } + + print_help(file = undefined) { + if (file === undefined) file = process.stdout + this._print_message(this.format_help(), file) + } + + _print_message(message, file = undefined) { + if (message) { + if (file === undefined) file = process.stderr + file.write(message) + } + } + + // =============== + // Exiting methods + // =============== + exit(status = 0, message = undefined) { + if (message) { + this._print_message(message, process.stderr) + } + process.exit(status) + } + + error(message) { + /* + * error(message: string) + * + * Prints a usage message incorporating the message to stderr and + * exits. + * + * If you override this in a subclass, it should not return -- it + * should either exit or raise an exception. + */ + + // LEGACY (v1 compatibility), debug mode + if (this.debug === true) throw new Error(message) + // end + this.print_usage(process.stderr) + let args = {prog: this.prog, message: message} + this.exit(2, sub('%(prog)s: error: %(message)s\n', args)) + } +})) + + +module.exports = { + ArgumentParser, + ArgumentError, + ArgumentTypeError, + BooleanOptionalAction, + FileType, + HelpFormatter, + ArgumentDefaultsHelpFormatter, + RawDescriptionHelpFormatter, + RawTextHelpFormatter, + MetavarTypeHelpFormatter, + Namespace, + Action, + ONE_OR_MORE, + OPTIONAL, + PARSER, + REMAINDER, + SUPPRESS, + ZERO_OR_MORE +} + +// LEGACY (v1 compatibility), Const alias +Object.defineProperty(module.exports, 'Const', { + get() { + let result = {} + Object.entries({ ONE_OR_MORE, OPTIONAL, PARSER, REMAINDER, SUPPRESS, ZERO_OR_MORE }).forEach(([ n, v ]) => { + Object.defineProperty(result, n, { + get() { + deprecate(n, sub('use argparse.%s instead of argparse.Const.%s', n, n)) + return v + } + }) + }) + Object.entries({ _UNRECOGNIZED_ARGS_ATTR }).forEach(([ n, v ]) => { + Object.defineProperty(result, n, { + get() { + deprecate(n, sub('argparse.Const.%s is an internal symbol and will no longer be available', n)) + return v + } + }) + }) + return result + }, + enumerable: false +}) +// end diff --git a/node_modules/argparse/lib/sub.js b/node_modules/argparse/lib/sub.js new file mode 100644 index 0000000..e3eb321 --- /dev/null +++ b/node_modules/argparse/lib/sub.js @@ -0,0 +1,67 @@ +// Limited implementation of python % string operator, supports only %s and %r for now +// (other formats are not used here, but may appear in custom templates) + +'use strict' + +const { inspect } = require('util') + + +module.exports = function sub(pattern, ...values) { + let regex = /%(?:(%)|(-)?(\*)?(?:\((\w+)\))?([A-Za-z]))/g + + let result = pattern.replace(regex, function (_, is_literal, is_left_align, is_padded, name, format) { + if (is_literal) return '%' + + let padded_count = 0 + if (is_padded) { + if (values.length === 0) throw new TypeError('not enough arguments for format string') + padded_count = values.shift() + if (!Number.isInteger(padded_count)) throw new TypeError('* wants int') + } + + let str + if (name !== undefined) { + let dict = values[0] + if (typeof dict !== 'object' || dict === null) throw new TypeError('format requires a mapping') + if (!(name in dict)) throw new TypeError(`no such key: '${name}'`) + str = dict[name] + } else { + if (values.length === 0) throw new TypeError('not enough arguments for format string') + str = values.shift() + } + + switch (format) { + case 's': + str = String(str) + break + case 'r': + str = inspect(str) + break + case 'd': + case 'i': + if (typeof str !== 'number') { + throw new TypeError(`%${format} format: a number is required, not ${typeof str}`) + } + str = String(str.toFixed(0)) + break + default: + throw new TypeError(`unsupported format character '${format}'`) + } + + if (padded_count > 0) { + return is_left_align ? str.padEnd(padded_count) : str.padStart(padded_count) + } else { + return str + } + }) + + if (values.length) { + if (values.length === 1 && typeof values[0] === 'object' && values[0] !== null) { + // mapping + } else { + throw new TypeError('not all arguments converted during string formatting') + } + } + + return result +} diff --git a/node_modules/argparse/lib/textwrap.js b/node_modules/argparse/lib/textwrap.js new file mode 100644 index 0000000..23d51cd --- /dev/null +++ b/node_modules/argparse/lib/textwrap.js @@ -0,0 +1,440 @@ +// Partial port of python's argparse module, version 3.9.0 (only wrap and fill functions): +// https://github.com/python/cpython/blob/v3.9.0b4/Lib/textwrap.py + +'use strict' + +/* + * Text wrapping and filling. + */ + +// Copyright (C) 1999-2001 Gregory P. Ward. +// Copyright (C) 2002, 2003 Python Software Foundation. +// Copyright (C) 2020 argparse.js authors +// Originally written by Greg Ward + +// Hardcode the recognized whitespace characters to the US-ASCII +// whitespace characters. The main reason for doing this is that +// some Unicode spaces (like \u00a0) are non-breaking whitespaces. +// +// This less funky little regex just split on recognized spaces. E.g. +// "Hello there -- you goof-ball, use the -b option!" +// splits into +// Hello/ /there/ /--/ /you/ /goof-ball,/ /use/ /the/ /-b/ /option!/ +const wordsep_simple_re = /([\t\n\x0b\x0c\r ]+)/ + +class TextWrapper { + /* + * Object for wrapping/filling text. The public interface consists of + * the wrap() and fill() methods; the other methods are just there for + * subclasses to override in order to tweak the default behaviour. + * If you want to completely replace the main wrapping algorithm, + * you'll probably have to override _wrap_chunks(). + * + * Several instance attributes control various aspects of wrapping: + * width (default: 70) + * the maximum width of wrapped lines (unless break_long_words + * is false) + * initial_indent (default: "") + * string that will be prepended to the first line of wrapped + * output. Counts towards the line's width. + * subsequent_indent (default: "") + * string that will be prepended to all lines save the first + * of wrapped output; also counts towards each line's width. + * expand_tabs (default: true) + * Expand tabs in input text to spaces before further processing. + * Each tab will become 0 .. 'tabsize' spaces, depending on its position + * in its line. If false, each tab is treated as a single character. + * tabsize (default: 8) + * Expand tabs in input text to 0 .. 'tabsize' spaces, unless + * 'expand_tabs' is false. + * replace_whitespace (default: true) + * Replace all whitespace characters in the input text by spaces + * after tab expansion. Note that if expand_tabs is false and + * replace_whitespace is true, every tab will be converted to a + * single space! + * fix_sentence_endings (default: false) + * Ensure that sentence-ending punctuation is always followed + * by two spaces. Off by default because the algorithm is + * (unavoidably) imperfect. + * break_long_words (default: true) + * Break words longer than 'width'. If false, those words will not + * be broken, and some lines might be longer than 'width'. + * break_on_hyphens (default: true) + * Allow breaking hyphenated words. If true, wrapping will occur + * preferably on whitespaces and right after hyphens part of + * compound words. + * drop_whitespace (default: true) + * Drop leading and trailing whitespace from lines. + * max_lines (default: None) + * Truncate wrapped lines. + * placeholder (default: ' [...]') + * Append to the last line of truncated text. + */ + + constructor(options = {}) { + let { + width = 70, + initial_indent = '', + subsequent_indent = '', + expand_tabs = true, + replace_whitespace = true, + fix_sentence_endings = false, + break_long_words = true, + drop_whitespace = true, + break_on_hyphens = true, + tabsize = 8, + max_lines = undefined, + placeholder=' [...]' + } = options + + this.width = width + this.initial_indent = initial_indent + this.subsequent_indent = subsequent_indent + this.expand_tabs = expand_tabs + this.replace_whitespace = replace_whitespace + this.fix_sentence_endings = fix_sentence_endings + this.break_long_words = break_long_words + this.drop_whitespace = drop_whitespace + this.break_on_hyphens = break_on_hyphens + this.tabsize = tabsize + this.max_lines = max_lines + this.placeholder = placeholder + } + + + // -- Private methods ----------------------------------------------- + // (possibly useful for subclasses to override) + + _munge_whitespace(text) { + /* + * _munge_whitespace(text : string) -> string + * + * Munge whitespace in text: expand tabs and convert all other + * whitespace characters to spaces. Eg. " foo\\tbar\\n\\nbaz" + * becomes " foo bar baz". + */ + if (this.expand_tabs) { + text = text.replace(/\t/g, ' '.repeat(this.tabsize)) // not strictly correct in js + } + if (this.replace_whitespace) { + text = text.replace(/[\t\n\x0b\x0c\r]/g, ' ') + } + return text + } + + _split(text) { + /* + * _split(text : string) -> [string] + * + * Split the text to wrap into indivisible chunks. Chunks are + * not quite the same as words; see _wrap_chunks() for full + * details. As an example, the text + * Look, goof-ball -- use the -b option! + * breaks into the following chunks: + * 'Look,', ' ', 'goof-', 'ball', ' ', '--', ' ', + * 'use', ' ', 'the', ' ', '-b', ' ', 'option!' + * if break_on_hyphens is True, or in: + * 'Look,', ' ', 'goof-ball', ' ', '--', ' ', + * 'use', ' ', 'the', ' ', '-b', ' ', option!' + * otherwise. + */ + let chunks = text.split(wordsep_simple_re) + chunks = chunks.filter(Boolean) + return chunks + } + + _handle_long_word(reversed_chunks, cur_line, cur_len, width) { + /* + * _handle_long_word(chunks : [string], + * cur_line : [string], + * cur_len : int, width : int) + * + * Handle a chunk of text (most likely a word, not whitespace) that + * is too long to fit in any line. + */ + // Figure out when indent is larger than the specified width, and make + // sure at least one character is stripped off on every pass + let space_left + if (width < 1) { + space_left = 1 + } else { + space_left = width - cur_len + } + + // If we're allowed to break long words, then do so: put as much + // of the next chunk onto the current line as will fit. + if (this.break_long_words) { + cur_line.push(reversed_chunks[reversed_chunks.length - 1].slice(0, space_left)) + reversed_chunks[reversed_chunks.length - 1] = reversed_chunks[reversed_chunks.length - 1].slice(space_left) + + // Otherwise, we have to preserve the long word intact. Only add + // it to the current line if there's nothing already there -- + // that minimizes how much we violate the width constraint. + } else if (!cur_line) { + cur_line.push(...reversed_chunks.pop()) + } + + // If we're not allowed to break long words, and there's already + // text on the current line, do nothing. Next time through the + // main loop of _wrap_chunks(), we'll wind up here again, but + // cur_len will be zero, so the next line will be entirely + // devoted to the long word that we can't handle right now. + } + + _wrap_chunks(chunks) { + /* + * _wrap_chunks(chunks : [string]) -> [string] + * + * Wrap a sequence of text chunks and return a list of lines of + * length 'self.width' or less. (If 'break_long_words' is false, + * some lines may be longer than this.) Chunks correspond roughly + * to words and the whitespace between them: each chunk is + * indivisible (modulo 'break_long_words'), but a line break can + * come between any two chunks. Chunks should not have internal + * whitespace; ie. a chunk is either all whitespace or a "word". + * Whitespace chunks will be removed from the beginning and end of + * lines, but apart from that whitespace is preserved. + */ + let lines = [] + let indent + if (this.width <= 0) { + throw Error(`invalid width ${this.width} (must be > 0)`) + } + if (this.max_lines !== undefined) { + if (this.max_lines > 1) { + indent = this.subsequent_indent + } else { + indent = this.initial_indent + } + if (indent.length + this.placeholder.trimStart().length > this.width) { + throw Error('placeholder too large for max width') + } + } + + // Arrange in reverse order so items can be efficiently popped + // from a stack of chucks. + chunks = chunks.reverse() + + while (chunks.length > 0) { + + // Start the list of chunks that will make up the current line. + // cur_len is just the length of all the chunks in cur_line. + let cur_line = [] + let cur_len = 0 + + // Figure out which static string will prefix this line. + let indent + if (lines) { + indent = this.subsequent_indent + } else { + indent = this.initial_indent + } + + // Maximum width for this line. + let width = this.width - indent.length + + // First chunk on line is whitespace -- drop it, unless this + // is the very beginning of the text (ie. no lines started yet). + if (this.drop_whitespace && chunks[chunks.length - 1].trim() === '' && lines.length > 0) { + chunks.pop() + } + + while (chunks.length > 0) { + let l = chunks[chunks.length - 1].length + + // Can at least squeeze this chunk onto the current line. + if (cur_len + l <= width) { + cur_line.push(chunks.pop()) + cur_len += l + + // Nope, this line is full. + } else { + break + } + } + + // The current line is full, and the next chunk is too big to + // fit on *any* line (not just this one). + if (chunks.length && chunks[chunks.length - 1].length > width) { + this._handle_long_word(chunks, cur_line, cur_len, width) + cur_len = cur_line.map(l => l.length).reduce((a, b) => a + b, 0) + } + + // If the last chunk on this line is all whitespace, drop it. + if (this.drop_whitespace && cur_line.length > 0 && cur_line[cur_line.length - 1].trim() === '') { + cur_len -= cur_line[cur_line.length - 1].length + cur_line.pop() + } + + if (cur_line) { + if (this.max_lines === undefined || + lines.length + 1 < this.max_lines || + (chunks.length === 0 || + this.drop_whitespace && + chunks.length === 1 && + !chunks[0].trim()) && cur_len <= width) { + // Convert current line back to a string and store it in + // list of all lines (return value). + lines.push(indent + cur_line.join('')) + } else { + let had_break = false + while (cur_line) { + if (cur_line[cur_line.length - 1].trim() && + cur_len + this.placeholder.length <= width) { + cur_line.push(this.placeholder) + lines.push(indent + cur_line.join('')) + had_break = true + break + } + cur_len -= cur_line[-1].length + cur_line.pop() + } + if (!had_break) { + if (lines) { + let prev_line = lines[lines.length - 1].trimEnd() + if (prev_line.length + this.placeholder.length <= + this.width) { + lines[lines.length - 1] = prev_line + this.placeholder + break + } + } + lines.push(indent + this.placeholder.lstrip()) + } + break + } + } + } + + return lines + } + + _split_chunks(text) { + text = this._munge_whitespace(text) + return this._split(text) + } + + // -- Public interface ---------------------------------------------- + + wrap(text) { + /* + * wrap(text : string) -> [string] + * + * Reformat the single paragraph in 'text' so it fits in lines of + * no more than 'self.width' columns, and return a list of wrapped + * lines. Tabs in 'text' are expanded with string.expandtabs(), + * and all other whitespace characters (including newline) are + * converted to space. + */ + let chunks = this._split_chunks(text) + // not implemented in js + //if (this.fix_sentence_endings) { + // this._fix_sentence_endings(chunks) + //} + return this._wrap_chunks(chunks) + } + + fill(text) { + /* + * fill(text : string) -> string + * + * Reformat the single paragraph in 'text' to fit in lines of no + * more than 'self.width' columns, and return a new string + * containing the entire wrapped paragraph. + */ + return this.wrap(text).join('\n') + } +} + + +// -- Convenience interface --------------------------------------------- + +function wrap(text, options = {}) { + /* + * Wrap a single paragraph of text, returning a list of wrapped lines. + * + * Reformat the single paragraph in 'text' so it fits in lines of no + * more than 'width' columns, and return a list of wrapped lines. By + * default, tabs in 'text' are expanded with string.expandtabs(), and + * all other whitespace characters (including newline) are converted to + * space. See TextWrapper class for available keyword args to customize + * wrapping behaviour. + */ + let { width = 70, ...kwargs } = options + let w = new TextWrapper(Object.assign({ width }, kwargs)) + return w.wrap(text) +} + +function fill(text, options = {}) { + /* + * Fill a single paragraph of text, returning a new string. + * + * Reformat the single paragraph in 'text' to fit in lines of no more + * than 'width' columns, and return a new string containing the entire + * wrapped paragraph. As with wrap(), tabs are expanded and other + * whitespace characters converted to space. See TextWrapper class for + * available keyword args to customize wrapping behaviour. + */ + let { width = 70, ...kwargs } = options + let w = new TextWrapper(Object.assign({ width }, kwargs)) + return w.fill(text) +} + +// -- Loosely related functionality ------------------------------------- + +let _whitespace_only_re = /^[ \t]+$/mg +let _leading_whitespace_re = /(^[ \t]*)(?:[^ \t\n])/mg + +function dedent(text) { + /* + * Remove any common leading whitespace from every line in `text`. + * + * This can be used to make triple-quoted strings line up with the left + * edge of the display, while still presenting them in the source code + * in indented form. + * + * Note that tabs and spaces are both treated as whitespace, but they + * are not equal: the lines " hello" and "\\thello" are + * considered to have no common leading whitespace. + * + * Entirely blank lines are normalized to a newline character. + */ + // Look for the longest leading string of spaces and tabs common to + // all lines. + let margin = undefined + text = text.replace(_whitespace_only_re, '') + let indents = text.match(_leading_whitespace_re) || [] + for (let indent of indents) { + indent = indent.slice(0, -1) + + if (margin === undefined) { + margin = indent + + // Current line more deeply indented than previous winner: + // no change (previous winner is still on top). + } else if (indent.startsWith(margin)) { + // pass + + // Current line consistent with and no deeper than previous winner: + // it's the new winner. + } else if (margin.startsWith(indent)) { + margin = indent + + // Find the largest common whitespace between current line and previous + // winner. + } else { + for (let i = 0; i < margin.length && i < indent.length; i++) { + if (margin[i] !== indent[i]) { + margin = margin.slice(0, i) + break + } + } + } + } + + if (margin) { + text = text.replace(new RegExp('^' + margin, 'mg'), '') + } + return text +} + +module.exports = { wrap, fill, dedent } diff --git a/node_modules/argparse/package.json b/node_modules/argparse/package.json new file mode 100644 index 0000000..647d2af --- /dev/null +++ b/node_modules/argparse/package.json @@ -0,0 +1,31 @@ +{ + "name": "argparse", + "description": "CLI arguments parser. Native port of python's argparse.", + "version": "2.0.1", + "keywords": [ + "cli", + "parser", + "argparse", + "option", + "args" + ], + "main": "argparse.js", + "files": [ + "argparse.js", + "lib/" + ], + "license": "Python-2.0", + "repository": "nodeca/argparse", + "scripts": { + "lint": "eslint .", + "test": "npm run lint && nyc mocha", + "coverage": "npm run test && nyc report --reporter html" + }, + "devDependencies": { + "@babel/eslint-parser": "^7.11.0", + "@babel/plugin-syntax-class-properties": "^7.10.4", + "eslint": "^7.5.0", + "mocha": "^8.0.1", + "nyc": "^15.1.0" + } +} diff --git a/node_modules/axios-retry/CHANGELOG.md b/node_modules/axios-retry/CHANGELOG.md new file mode 100644 index 0000000..26c1ef2 --- /dev/null +++ b/node_modules/axios-retry/CHANGELOG.md @@ -0,0 +1,152 @@ +# Change Log + +All notable changes to this project will be documented in this file. + +The format is based on [Keep a Changelog](http://keepachangelog.com/) +and this project adheres to [Semantic Versioning](http://semver.org/). + +## [3.2.3] - 2021-10-19 + +- fix: removed breaking requirements introduced in 3.2.1 +- fix: allow Typescript CommonJS default import + +## [3.2.2] - 2021-10-14 + +- fix: added missing @babel/runtime runtime dep + +## [3.2.1] - 2021-10-14 + +- updated all dependencies +- made the package hybrid (ES modules and CommonJS) +- BREAKING: axios >=0.21.2 is now required to work as a peer dep. +- BREAKING: NodeJS "^12.20.0 || ^14.13.1 || >=16.0.0" to work + +## [3.2.0] - 2021-09-28 + +### Added + +- Retry condition accepts a function that returns a Promise resolving to a boolean + +## [3.1.9] - 2020-09-18 + +### Fixed + +- TS: extended AxiosRequestConfig with optional "axios-retry" property + +## [3.1.8] - 2019-04-24 + +### Fixed + +- TS: export types for all functions + +## [3.1.7] - 2019-04-23 + +### Fixed + +- Fixed default export to resolve TS2309 +- Updated dependencies to fix build error +- Added missing CHANGELOG entries (versions 3.0.1 until today) + +## [3.1.6] - 2019-04-21 + +### Fixed + +- Fixed export of `IAxiosRetryConfig` + +## [3.1.5] - 2019-04-20 + +### Fixed + +- Fixed TS definitions + +## [3.1.4] - 2019-04-18 + +### Fixed + +- Fixed TS definitions + +### Added + +- Added note in README related to compatibility issue with `axios 0.19.0` +- Updated LICENSE + +## [3.1.2] - 2019-01-24 + +### Added + +- TravisCI build status badge in README +- Update `index.d.ts` with missing functions + +## [3.1.1] - 2018-06-13 + +### Fixed + +- Do not run `requestTransform` again after retry + +### Added + +- Explicit return type on `axiosRetry` +- Prettier + +## [3.1.0] - 2018-04-26 + +### Fixed + +- Export `isRetryableError` for CommonJS + +### Added + +- Added additional param `shouldResetTimeout` + +## [3.0.2] - 2018-02-09 + +### Added + +- Now `isRetryableError` method is accessible. +- Added `delayStrategy` option to be able to have exponential backoff for successive retries. + +## [3.0.1] - 2017-08-16 + +### Fixed + +- Fixed first request time not being taken into account in timeout across retries. +- Fixed negative timeouts being passed to XHR (browsers), causing that no timeout was applied. +- Fixed safe methods and idempotent errors not being retried on unknown network errors. + +## [3.0.0] - 2017-08-13 + +### Changed + +- Retried errors on idempotent requests (5xx with get, head, options, put and delete) by default, +along with safe network errors. +- Moved some hard-coded conditions to the default `retryCondition` function so users can define a +custom function that overwrites them. The conditions that verify that the error is not a timeout or +an unsafe network error have been moved to `isNetworkError`. + +### Added + +- Added additional pre-defined retry conditions: `isSafeRequestError`, `isIdempotentRequestError`. + +## [2.0.1] - 2017-06-19 + +### Fixed + +- Removed dependency from the `package.json` file. + +## [2.0.0] - 2017-06-15 + +### Changed + +- Now the configured timeout in Axios is not for each retry request but for the whole request lifecycle. + +## [1.3.1] - 2017-06-19 + +### Fixed + +- Removed dependency from the `package.json` file. + +## [1.3.0] - 2017-06-15 + +### Added + +- Allowed per-request configuration using the `axios-retry` namespace. diff --git a/node_modules/axios-retry/LICENSE b/node_modules/axios-retry/LICENSE new file mode 100644 index 0000000..ab87190 --- /dev/null +++ b/node_modules/axios-retry/LICENSE @@ -0,0 +1,13 @@ +Copyright 2019 Softonic International S.A. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. \ No newline at end of file diff --git a/node_modules/axios-retry/README.md b/node_modules/axios-retry/README.md new file mode 100644 index 0000000..91ddb4a --- /dev/null +++ b/node_modules/axios-retry/README.md @@ -0,0 +1,84 @@ +# axios-retry + +[![Node.js CI](https://github.com/softonic/axios-retry/actions/workflows/node.js.yml/badge.svg)](https://github.com/softonic/axios-retry/actions/workflows/node.js.yml) + +Axios plugin that intercepts failed requests and retries them whenever possible. + +## Installation + +```bash +npm install axios-retry +``` + +## Usage + +```js +// CommonJS +// const axiosRetry = require('axios-retry'); + +// ES6 +import axiosRetry from 'axios-retry'; + +axiosRetry(axios, { retries: 3 }); + +axios.get('http://example.com/test') // The first request fails and the second returns 'ok' + .then(result => { + result.data; // 'ok' + }); + +// Exponential back-off retry delay between requests +axiosRetry(axios, { retryDelay: axiosRetry.exponentialDelay}); + +// Custom retry delay +axiosRetry(axios, { retryDelay: (retryCount) => { + return retryCount * 1000; +}}); + +// Works with custom axios instances +const client = axios.create({ baseURL: 'http://example.com' }); +axiosRetry(client, { retries: 3 }); + +client.get('/test') // The first request fails and the second returns 'ok' + .then(result => { + result.data; // 'ok' + }); + +// Allows request-specific configuration +client + .get('/test', { + 'axios-retry': { + retries: 0 + } + }) + .catch(error => { // The first request fails + error !== undefined + }); +``` + +**Note:** Unless `shouldResetTimeout` is set, the plugin interprets the request timeout as a global value, so it is not used for each retry but for the whole request lifecycle. + +## Options + +| Name | Type | Default | Description | +| --- | --- | --- | --- | +| retries | `Number` | `3` | The number of times to retry before failing. | +| retryCondition | `Function` | `isNetworkOrIdempotentRequestError` | A callback to further control if a request should be retried. By default, it retries if it is a network error or a 5xx error on an idempotent request (GET, HEAD, OPTIONS, PUT or DELETE). | +| shouldResetTimeout | `Boolean` | false | Defines if the timeout should be reset between retries | +| retryDelay | `Function` | `function noDelay() { return 0; }` | A callback to further control the delay in milliseconds between retried requests. By default there is no delay between retries. Another option is exponentialDelay ([Exponential Backoff](https://developers.google.com/analytics/devguides/reporting/core/v3/errors#backoff)). The function is passed `retryCount` and `error`. | + +## Testing + +Clone the repository and execute: + +```bash +npm test +``` + +## Contribute + +1. Fork it: `git clone https://github.com/softonic/axios-retry.git` +2. Create your feature branch: `git checkout -b feature/my-new-feature` +3. Commit your changes: `git commit -am 'Added some feature'` +4. Check the build: `npm run build` +4. Push to the branch: `git push origin my-new-feature` +5. Submit a pull request :D diff --git a/node_modules/axios-retry/es/index.mjs b/node_modules/axios-retry/es/index.mjs new file mode 100644 index 0000000..555b67e --- /dev/null +++ b/node_modules/axios-retry/es/index.mjs @@ -0,0 +1,249 @@ +import isRetryAllowed from 'is-retry-allowed'; + +const namespace = 'axios-retry'; + +/** + * @param {Error} error + * @return {boolean} + */ +export function isNetworkError(error) { + return ( + !error.response && + Boolean(error.code) && // Prevents retrying cancelled requests + error.code !== 'ECONNABORTED' && // Prevents retrying timed out requests + isRetryAllowed(error) + ); // Prevents retrying unsafe errors +} + +const SAFE_HTTP_METHODS = ['get', 'head', 'options']; +const IDEMPOTENT_HTTP_METHODS = SAFE_HTTP_METHODS.concat(['put', 'delete']); + +/** + * @param {Error} error + * @return {boolean} + */ +export function isRetryableError(error) { + return ( + error.code !== 'ECONNABORTED' && + (!error.response || (error.response.status >= 500 && error.response.status <= 599)) + ); +} + +/** + * @param {Error} error + * @return {boolean} + */ +export function isSafeRequestError(error) { + if (!error.config) { + // Cannot determine if the request can be retried + return false; + } + + return isRetryableError(error) && SAFE_HTTP_METHODS.indexOf(error.config.method) !== -1; +} + +/** + * @param {Error} error + * @return {boolean} + */ +export function isIdempotentRequestError(error) { + if (!error.config) { + // Cannot determine if the request can be retried + return false; + } + + return isRetryableError(error) && IDEMPOTENT_HTTP_METHODS.indexOf(error.config.method) !== -1; +} + +/** + * @param {Error} error + * @return {boolean | Promise} + */ +export function isNetworkOrIdempotentRequestError(error) { + return isNetworkError(error) || isIdempotentRequestError(error); +} + +/** + * @return {number} - delay in milliseconds, always 0 + */ +function noDelay() { + return 0; +} + +/** + * @param {number} [retryNumber=0] + * @return {number} - delay in milliseconds + */ +export function exponentialDelay(retryNumber = 0) { + const delay = Math.pow(2, retryNumber) * 100; + const randomSum = delay * 0.2 * Math.random(); // 0-20% of the delay + return delay + randomSum; +} + +/** + * Initializes and returns the retry state for the given request/config + * @param {AxiosRequestConfig} config + * @return {Object} + */ +function getCurrentState(config) { + const currentState = config[namespace] || {}; + currentState.retryCount = currentState.retryCount || 0; + config[namespace] = currentState; + return currentState; +} + +/** + * Returns the axios-retry options for the current request + * @param {AxiosRequestConfig} config + * @param {AxiosRetryConfig} defaultOptions + * @return {AxiosRetryConfig} + */ +function getRequestOptions(config, defaultOptions) { + return { ...defaultOptions, ...config[namespace] }; +} + +/** + * @param {Axios} axios + * @param {AxiosRequestConfig} config + */ +function fixConfig(axios, config) { + if (axios.defaults.agent === config.agent) { + delete config.agent; + } + if (axios.defaults.httpAgent === config.httpAgent) { + delete config.httpAgent; + } + if (axios.defaults.httpsAgent === config.httpsAgent) { + delete config.httpsAgent; + } +} + +/** + * Checks retryCondition if request can be retried. Handles it's retruning value or Promise. + * @param {number} retries + * @param {Function} retryCondition + * @param {Object} currentState + * @param {Error} error + * @return {boolean} + */ +async function shouldRetry(retries, retryCondition, currentState, error) { + const shouldRetryOrPromise = currentState.retryCount < retries && retryCondition(error); + + // This could be a promise + if (typeof shouldRetryOrPromise === 'object') { + try { + await shouldRetryOrPromise; + return true; + } catch (_err) { + return false; + } + } + return shouldRetryOrPromise; +} + +/** + * Adds response interceptors to an axios instance to retry requests failed due to network issues + * + * @example + * + * import axios from 'axios'; + * + * axiosRetry(axios, { retries: 3 }); + * + * axios.get('http://example.com/test') // The first request fails and the second returns 'ok' + * .then(result => { + * result.data; // 'ok' + * }); + * + * // Exponential back-off retry delay between requests + * axiosRetry(axios, { retryDelay : axiosRetry.exponentialDelay}); + * + * // Custom retry delay + * axiosRetry(axios, { retryDelay : (retryCount) => { + * return retryCount * 1000; + * }}); + * + * // Also works with custom axios instances + * const client = axios.create({ baseURL: 'http://example.com' }); + * axiosRetry(client, { retries: 3 }); + * + * client.get('/test') // The first request fails and the second returns 'ok' + * .then(result => { + * result.data; // 'ok' + * }); + * + * // Allows request-specific configuration + * client + * .get('/test', { + * 'axios-retry': { + * retries: 0 + * } + * }) + * .catch(error => { // The first request fails + * error !== undefined + * }); + * + * @param {Axios} axios An axios instance (the axios object or one created from axios.create) + * @param {Object} [defaultOptions] + * @param {number} [defaultOptions.retries=3] Number of retries + * @param {boolean} [defaultOptions.shouldResetTimeout=false] + * Defines if the timeout should be reset between retries + * @param {Function} [defaultOptions.retryCondition=isNetworkOrIdempotentRequestError] + * A function to determine if the error can be retried + * @param {Function} [defaultOptions.retryDelay=noDelay] + * A function to determine the delay between retry requests + */ +export default function axiosRetry(axios, defaultOptions) { + axios.interceptors.request.use((config) => { + const currentState = getCurrentState(config); + currentState.lastRequestTime = Date.now(); + return config; + }); + + axios.interceptors.response.use(null, async (error) => { + const { config } = error; + + // If we have no information to retry the request + if (!config) { + return Promise.reject(error); + } + + const { + retries = 3, + retryCondition = isNetworkOrIdempotentRequestError, + retryDelay = noDelay, + shouldResetTimeout = false + } = getRequestOptions(config, defaultOptions); + + const currentState = getCurrentState(config); + + if (await shouldRetry(retries, retryCondition, currentState, error)) { + currentState.retryCount += 1; + const delay = retryDelay(currentState.retryCount, error); + + // Axios fails merging this configuration to the default configuration because it has an issue + // with circular structures: https://github.com/mzabriskie/axios/issues/370 + fixConfig(axios, config); + + if (!shouldResetTimeout && config.timeout && currentState.lastRequestTime) { + const lastRequestDuration = Date.now() - currentState.lastRequestTime; + // Minimum 1ms timeout (passing 0 or less to XHR means no timeout) + config.timeout = Math.max(config.timeout - lastRequestDuration - delay, 1); + } + + config.transformRequest = [(data) => data]; + + return new Promise((resolve) => setTimeout(() => resolve(axios(config)), delay)); + } + + return Promise.reject(error); + }); +} + +// Compatibility with CommonJS +axiosRetry.isNetworkError = isNetworkError; +axiosRetry.isSafeRequestError = isSafeRequestError; +axiosRetry.isIdempotentRequestError = isIdempotentRequestError; +axiosRetry.isNetworkOrIdempotentRequestError = isNetworkOrIdempotentRequestError; +axiosRetry.exponentialDelay = exponentialDelay; +axiosRetry.isRetryableError = isRetryableError; diff --git a/node_modules/axios-retry/index.d.ts b/node_modules/axios-retry/index.d.ts new file mode 100644 index 0000000..75a8855 --- /dev/null +++ b/node_modules/axios-retry/index.d.ts @@ -0,0 +1,66 @@ +import * as axios from 'axios' + +interface IAxiosRetry { + ( + axios: axios.AxiosStatic | axios.AxiosInstance, + axiosRetryConfig?: IAxiosRetry.IAxiosRetryConfig + ): void; + + isNetworkError(error: Error): boolean; + isRetryableError(error: Error): boolean; + isSafeRequestError(error: Error): boolean; + isIdempotentRequestError(error: Error): boolean; + isNetworkOrIdempotentRequestError(error: Error): boolean; + exponentialDelay(retryNumber: number): number; +} + +export function isNetworkError(error: Error): boolean; +export function isRetryableError(error: Error): boolean; +export function isSafeRequestError(error: Error): boolean; +export function isIdempotentRequestError(error: Error): boolean; +export function isNetworkOrIdempotentRequestError(error: Error): boolean; +export function exponentialDelay(retryNumber: number): number; + +declare namespace IAxiosRetry { + export interface IAxiosRetryConfig { + /** + * The number of times to retry before failing + * default: 3 + * + * @type {number} + */ + retries?: number, + /** + * Defines if the timeout should be reset between retries + * default: false + * + * @type {boolean} + */ + shouldResetTimeout?: boolean, + /** + * A callback to further control if a request should be retried. By default, it retries if the result did not have a response. + * default: error => !error.response + * + * @type {Function} + */ + retryCondition?: (error: axios.AxiosError) => boolean | Promise, + /** + * A callback to further control the delay between retry requests. By default there is no delay. + * + * @type {Function} + */ + retryDelay?: (retryCount: number, error: axios.AxiosError) => number + } +} + +declare const axiosRetry: IAxiosRetry; + +export type IAxiosRetryConfig = IAxiosRetry.IAxiosRetryConfig; + +export default axiosRetry; + +declare module 'axios' { + export interface AxiosRequestConfig { + 'axios-retry'?: IAxiosRetryConfig; + } +} diff --git a/node_modules/axios-retry/index.js b/node_modules/axios-retry/index.js new file mode 100644 index 0000000..4045d74 --- /dev/null +++ b/node_modules/axios-retry/index.js @@ -0,0 +1,4 @@ +const axiosRetry = require('./lib/cjs/index').default; + +module.exports = axiosRetry; +module.exports.default = axiosRetry; diff --git a/node_modules/axios-retry/lib/cjs/index.js b/node_modules/axios-retry/lib/cjs/index.js new file mode 100644 index 0000000..600b443 --- /dev/null +++ b/node_modules/axios-retry/lib/cjs/index.js @@ -0,0 +1,339 @@ +"use strict"; + +var _interopRequireDefault = require("@babel/runtime/helpers/interopRequireDefault"); + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.isNetworkError = isNetworkError; +exports.isRetryableError = isRetryableError; +exports.isSafeRequestError = isSafeRequestError; +exports.isIdempotentRequestError = isIdempotentRequestError; +exports.isNetworkOrIdempotentRequestError = isNetworkOrIdempotentRequestError; +exports.exponentialDelay = exponentialDelay; +exports.default = axiosRetry; + +var _regenerator = _interopRequireDefault(require("@babel/runtime/regenerator")); + +var _typeof2 = _interopRequireDefault(require("@babel/runtime/helpers/typeof")); + +var _asyncToGenerator2 = _interopRequireDefault(require("@babel/runtime/helpers/asyncToGenerator")); + +var _defineProperty2 = _interopRequireDefault(require("@babel/runtime/helpers/defineProperty")); + +var _isRetryAllowed = _interopRequireDefault(require("is-retry-allowed")); + +function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) { symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); } keys.push.apply(keys, symbols); } return keys; } + +function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { (0, _defineProperty2.default)(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; } + +var namespace = 'axios-retry'; +/** + * @param {Error} error + * @return {boolean} + */ + +function isNetworkError(error) { + return !error.response && Boolean(error.code) && // Prevents retrying cancelled requests + error.code !== 'ECONNABORTED' && // Prevents retrying timed out requests + (0, _isRetryAllowed.default)(error); // Prevents retrying unsafe errors +} + +var SAFE_HTTP_METHODS = ['get', 'head', 'options']; +var IDEMPOTENT_HTTP_METHODS = SAFE_HTTP_METHODS.concat(['put', 'delete']); +/** + * @param {Error} error + * @return {boolean} + */ + +function isRetryableError(error) { + return error.code !== 'ECONNABORTED' && (!error.response || error.response.status >= 500 && error.response.status <= 599); +} +/** + * @param {Error} error + * @return {boolean} + */ + + +function isSafeRequestError(error) { + if (!error.config) { + // Cannot determine if the request can be retried + return false; + } + + return isRetryableError(error) && SAFE_HTTP_METHODS.indexOf(error.config.method) !== -1; +} +/** + * @param {Error} error + * @return {boolean} + */ + + +function isIdempotentRequestError(error) { + if (!error.config) { + // Cannot determine if the request can be retried + return false; + } + + return isRetryableError(error) && IDEMPOTENT_HTTP_METHODS.indexOf(error.config.method) !== -1; +} +/** + * @param {Error} error + * @return {boolean | Promise} + */ + + +function isNetworkOrIdempotentRequestError(error) { + return isNetworkError(error) || isIdempotentRequestError(error); +} +/** + * @return {number} - delay in milliseconds, always 0 + */ + + +function noDelay() { + return 0; +} +/** + * @param {number} [retryNumber=0] + * @return {number} - delay in milliseconds + */ + + +function exponentialDelay() { + var retryNumber = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 0; + var delay = Math.pow(2, retryNumber) * 100; + var randomSum = delay * 0.2 * Math.random(); // 0-20% of the delay + + return delay + randomSum; +} +/** + * Initializes and returns the retry state for the given request/config + * @param {AxiosRequestConfig} config + * @return {Object} + */ + + +function getCurrentState(config) { + var currentState = config[namespace] || {}; + currentState.retryCount = currentState.retryCount || 0; + config[namespace] = currentState; + return currentState; +} +/** + * Returns the axios-retry options for the current request + * @param {AxiosRequestConfig} config + * @param {AxiosRetryConfig} defaultOptions + * @return {AxiosRetryConfig} + */ + + +function getRequestOptions(config, defaultOptions) { + return _objectSpread(_objectSpread({}, defaultOptions), config[namespace]); +} +/** + * @param {Axios} axios + * @param {AxiosRequestConfig} config + */ + + +function fixConfig(axios, config) { + if (axios.defaults.agent === config.agent) { + delete config.agent; + } + + if (axios.defaults.httpAgent === config.httpAgent) { + delete config.httpAgent; + } + + if (axios.defaults.httpsAgent === config.httpsAgent) { + delete config.httpsAgent; + } +} +/** + * Checks retryCondition if request can be retried. Handles it's retruning value or Promise. + * @param {number} retries + * @param {Function} retryCondition + * @param {Object} currentState + * @param {Error} error + * @return {boolean} + */ + + +function shouldRetry(_x, _x2, _x3, _x4) { + return _shouldRetry.apply(this, arguments); +} +/** + * Adds response interceptors to an axios instance to retry requests failed due to network issues + * + * @example + * + * import axios from 'axios'; + * + * axiosRetry(axios, { retries: 3 }); + * + * axios.get('http://example.com/test') // The first request fails and the second returns 'ok' + * .then(result => { + * result.data; // 'ok' + * }); + * + * // Exponential back-off retry delay between requests + * axiosRetry(axios, { retryDelay : axiosRetry.exponentialDelay}); + * + * // Custom retry delay + * axiosRetry(axios, { retryDelay : (retryCount) => { + * return retryCount * 1000; + * }}); + * + * // Also works with custom axios instances + * const client = axios.create({ baseURL: 'http://example.com' }); + * axiosRetry(client, { retries: 3 }); + * + * client.get('/test') // The first request fails and the second returns 'ok' + * .then(result => { + * result.data; // 'ok' + * }); + * + * // Allows request-specific configuration + * client + * .get('/test', { + * 'axios-retry': { + * retries: 0 + * } + * }) + * .catch(error => { // The first request fails + * error !== undefined + * }); + * + * @param {Axios} axios An axios instance (the axios object or one created from axios.create) + * @param {Object} [defaultOptions] + * @param {number} [defaultOptions.retries=3] Number of retries + * @param {boolean} [defaultOptions.shouldResetTimeout=false] + * Defines if the timeout should be reset between retries + * @param {Function} [defaultOptions.retryCondition=isNetworkOrIdempotentRequestError] + * A function to determine if the error can be retried + * @param {Function} [defaultOptions.retryDelay=noDelay] + * A function to determine the delay between retry requests + */ + + +function _shouldRetry() { + _shouldRetry = (0, _asyncToGenerator2.default)( /*#__PURE__*/_regenerator.default.mark(function _callee2(retries, retryCondition, currentState, error) { + var shouldRetryOrPromise; + return _regenerator.default.wrap(function _callee2$(_context2) { + while (1) { + switch (_context2.prev = _context2.next) { + case 0: + shouldRetryOrPromise = currentState.retryCount < retries && retryCondition(error); // This could be a promise + + if (!((0, _typeof2.default)(shouldRetryOrPromise) === 'object')) { + _context2.next = 11; + break; + } + + _context2.prev = 2; + _context2.next = 5; + return shouldRetryOrPromise; + + case 5: + return _context2.abrupt("return", true); + + case 8: + _context2.prev = 8; + _context2.t0 = _context2["catch"](2); + return _context2.abrupt("return", false); + + case 11: + return _context2.abrupt("return", shouldRetryOrPromise); + + case 12: + case "end": + return _context2.stop(); + } + } + }, _callee2, null, [[2, 8]]); + })); + return _shouldRetry.apply(this, arguments); +} + +function axiosRetry(axios, defaultOptions) { + axios.interceptors.request.use(function (config) { + var currentState = getCurrentState(config); + currentState.lastRequestTime = Date.now(); + return config; + }); + axios.interceptors.response.use(null, /*#__PURE__*/function () { + var _ref = (0, _asyncToGenerator2.default)( /*#__PURE__*/_regenerator.default.mark(function _callee(error) { + var config, _getRequestOptions, _getRequestOptions$re, retries, _getRequestOptions$re2, retryCondition, _getRequestOptions$re3, retryDelay, _getRequestOptions$sh, shouldResetTimeout, currentState, delay, lastRequestDuration; + + return _regenerator.default.wrap(function _callee$(_context) { + while (1) { + switch (_context.prev = _context.next) { + case 0: + config = error.config; // If we have no information to retry the request + + if (config) { + _context.next = 3; + break; + } + + return _context.abrupt("return", Promise.reject(error)); + + case 3: + _getRequestOptions = getRequestOptions(config, defaultOptions), _getRequestOptions$re = _getRequestOptions.retries, retries = _getRequestOptions$re === void 0 ? 3 : _getRequestOptions$re, _getRequestOptions$re2 = _getRequestOptions.retryCondition, retryCondition = _getRequestOptions$re2 === void 0 ? isNetworkOrIdempotentRequestError : _getRequestOptions$re2, _getRequestOptions$re3 = _getRequestOptions.retryDelay, retryDelay = _getRequestOptions$re3 === void 0 ? noDelay : _getRequestOptions$re3, _getRequestOptions$sh = _getRequestOptions.shouldResetTimeout, shouldResetTimeout = _getRequestOptions$sh === void 0 ? false : _getRequestOptions$sh; + currentState = getCurrentState(config); + _context.next = 7; + return shouldRetry(retries, retryCondition, currentState, error); + + case 7: + if (!_context.sent) { + _context.next = 14; + break; + } + + currentState.retryCount += 1; + delay = retryDelay(currentState.retryCount, error); // Axios fails merging this configuration to the default configuration because it has an issue + // with circular structures: https://github.com/mzabriskie/axios/issues/370 + + fixConfig(axios, config); + + if (!shouldResetTimeout && config.timeout && currentState.lastRequestTime) { + lastRequestDuration = Date.now() - currentState.lastRequestTime; // Minimum 1ms timeout (passing 0 or less to XHR means no timeout) + + config.timeout = Math.max(config.timeout - lastRequestDuration - delay, 1); + } + + config.transformRequest = [function (data) { + return data; + }]; + return _context.abrupt("return", new Promise(function (resolve) { + return setTimeout(function () { + return resolve(axios(config)); + }, delay); + })); + + case 14: + return _context.abrupt("return", Promise.reject(error)); + + case 15: + case "end": + return _context.stop(); + } + } + }, _callee); + })); + + return function (_x5) { + return _ref.apply(this, arguments); + }; + }()); +} // Compatibility with CommonJS + + +axiosRetry.isNetworkError = isNetworkError; +axiosRetry.isSafeRequestError = isSafeRequestError; +axiosRetry.isIdempotentRequestError = isIdempotentRequestError; +axiosRetry.isNetworkOrIdempotentRequestError = isNetworkOrIdempotentRequestError; +axiosRetry.exponentialDelay = exponentialDelay; +axiosRetry.isRetryableError = isRetryableError; +//# sourceMappingURL=index.js.map \ No newline at end of file diff --git a/node_modules/axios-retry/lib/cjs/index.js.map b/node_modules/axios-retry/lib/cjs/index.js.map new file mode 100644 index 0000000..eede669 --- /dev/null +++ b/node_modules/axios-retry/lib/cjs/index.js.map @@ -0,0 +1 @@ +{"version":3,"sources":["../../es/index.mjs"],"names":["namespace","isNetworkError","error","response","Boolean","code","SAFE_HTTP_METHODS","IDEMPOTENT_HTTP_METHODS","concat","isRetryableError","status","isSafeRequestError","config","indexOf","method","isIdempotentRequestError","isNetworkOrIdempotentRequestError","noDelay","exponentialDelay","retryNumber","delay","Math","pow","randomSum","random","getCurrentState","currentState","retryCount","getRequestOptions","defaultOptions","fixConfig","axios","defaults","agent","httpAgent","httpsAgent","shouldRetry","retries","retryCondition","shouldRetryOrPromise","axiosRetry","interceptors","request","use","lastRequestTime","Date","now","Promise","reject","retryDelay","shouldResetTimeout","timeout","lastRequestDuration","max","transformRequest","data","resolve","setTimeout"],"mappings":";;;;;;;;;;;;;;;;;;;;;;;AAAA;;;;;;AAEA,IAAMA,SAAS,GAAG,aAAlB;AAEA;AACA;AACA;AACA;;AACO,SAASC,cAAT,CAAwBC,KAAxB,EAA+B;AACpC,SACE,CAACA,KAAK,CAACC,QAAP,IACAC,OAAO,CAACF,KAAK,CAACG,IAAP,CADP,IACuB;AACvBH,EAAAA,KAAK,CAACG,IAAN,KAAe,cAFf,IAEiC;AACjC,+BAAeH,KAAf,CAJF,CADoC,CAMjC;AACJ;;AAED,IAAMI,iBAAiB,GAAG,CAAC,KAAD,EAAQ,MAAR,EAAgB,SAAhB,CAA1B;AACA,IAAMC,uBAAuB,GAAGD,iBAAiB,CAACE,MAAlB,CAAyB,CAAC,KAAD,EAAQ,QAAR,CAAzB,CAAhC;AAEA;AACA;AACA;AACA;;AACO,SAASC,gBAAT,CAA0BP,KAA1B,EAAiC;AACtC,SACEA,KAAK,CAACG,IAAN,KAAe,cAAf,KACC,CAACH,KAAK,CAACC,QAAP,IAAoBD,KAAK,CAACC,QAAN,CAAeO,MAAf,IAAyB,GAAzB,IAAgCR,KAAK,CAACC,QAAN,CAAeO,MAAf,IAAyB,GAD9E,CADF;AAID;AAED;AACA;AACA;AACA;;;AACO,SAASC,kBAAT,CAA4BT,KAA5B,EAAmC;AACxC,MAAI,CAACA,KAAK,CAACU,MAAX,EAAmB;AACjB;AACA,WAAO,KAAP;AACD;;AAED,SAAOH,gBAAgB,CAACP,KAAD,CAAhB,IAA2BI,iBAAiB,CAACO,OAAlB,CAA0BX,KAAK,CAACU,MAAN,CAAaE,MAAvC,MAAmD,CAAC,CAAtF;AACD;AAED;AACA;AACA;AACA;;;AACO,SAASC,wBAAT,CAAkCb,KAAlC,EAAyC;AAC9C,MAAI,CAACA,KAAK,CAACU,MAAX,EAAmB;AACjB;AACA,WAAO,KAAP;AACD;;AAED,SAAOH,gBAAgB,CAACP,KAAD,CAAhB,IAA2BK,uBAAuB,CAACM,OAAxB,CAAgCX,KAAK,CAACU,MAAN,CAAaE,MAA7C,MAAyD,CAAC,CAA5F;AACD;AAED;AACA;AACA;AACA;;;AACO,SAASE,iCAAT,CAA2Cd,KAA3C,EAAkD;AACvD,SAAOD,cAAc,CAACC,KAAD,CAAd,IAAyBa,wBAAwB,CAACb,KAAD,CAAxD;AACD;AAED;AACA;AACA;;;AACA,SAASe,OAAT,GAAmB;AACjB,SAAO,CAAP;AACD;AAED;AACA;AACA;AACA;;;AACO,SAASC,gBAAT,GAA2C;AAAA,MAAjBC,WAAiB,uEAAH,CAAG;AAChD,MAAMC,KAAK,GAAGC,IAAI,CAACC,GAAL,CAAS,CAAT,EAAYH,WAAZ,IAA2B,GAAzC;AACA,MAAMI,SAAS,GAAGH,KAAK,GAAG,GAAR,GAAcC,IAAI,CAACG,MAAL,EAAhC,CAFgD,CAED;;AAC/C,SAAOJ,KAAK,GAAGG,SAAf;AACD;AAED;AACA;AACA;AACA;AACA;;;AACA,SAASE,eAAT,CAAyBb,MAAzB,EAAiC;AAC/B,MAAMc,YAAY,GAAGd,MAAM,CAACZ,SAAD,CAAN,IAAqB,EAA1C;AACA0B,EAAAA,YAAY,CAACC,UAAb,GAA0BD,YAAY,CAACC,UAAb,IAA2B,CAArD;AACAf,EAAAA,MAAM,CAACZ,SAAD,CAAN,GAAoB0B,YAApB;AACA,SAAOA,YAAP;AACD;AAED;AACA;AACA;AACA;AACA;AACA;;;AACA,SAASE,iBAAT,CAA2BhB,MAA3B,EAAmCiB,cAAnC,EAAmD;AACjD,yCAAYA,cAAZ,GAA+BjB,MAAM,CAACZ,SAAD,CAArC;AACD;AAED;AACA;AACA;AACA;;;AACA,SAAS8B,SAAT,CAAmBC,KAAnB,EAA0BnB,MAA1B,EAAkC;AAChC,MAAImB,KAAK,CAACC,QAAN,CAAeC,KAAf,KAAyBrB,MAAM,CAACqB,KAApC,EAA2C;AACzC,WAAOrB,MAAM,CAACqB,KAAd;AACD;;AACD,MAAIF,KAAK,CAACC,QAAN,CAAeE,SAAf,KAA6BtB,MAAM,CAACsB,SAAxC,EAAmD;AACjD,WAAOtB,MAAM,CAACsB,SAAd;AACD;;AACD,MAAIH,KAAK,CAACC,QAAN,CAAeG,UAAf,KAA8BvB,MAAM,CAACuB,UAAzC,EAAqD;AACnD,WAAOvB,MAAM,CAACuB,UAAd;AACD;AACF;AAED;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;;SACeC,W;;;AAef;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;;;yFAlEA,kBAA2BC,OAA3B,EAAoCC,cAApC,EAAoDZ,YAApD,EAAkExB,KAAlE;AAAA;AAAA;AAAA;AAAA;AAAA;AACQqC,YAAAA,oBADR,GAC+Bb,YAAY,CAACC,UAAb,GAA0BU,OAA1B,IAAqCC,cAAc,CAACpC,KAAD,CADlF,EAGE;;AAHF,kBAIM,sBAAOqC,oBAAP,MAAgC,QAJtC;AAAA;AAAA;AAAA;;AAAA;AAAA;AAAA,mBAMYA,oBANZ;;AAAA;AAAA,8CAOa,IAPb;;AAAA;AAAA;AAAA;AAAA,8CASa,KATb;;AAAA;AAAA,8CAYSA,oBAZT;;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,G;;;;AAmEe,SAASC,UAAT,CAAoBT,KAApB,EAA2BF,cAA3B,EAA2C;AACxDE,EAAAA,KAAK,CAACU,YAAN,CAAmBC,OAAnB,CAA2BC,GAA3B,CAA+B,UAAC/B,MAAD,EAAY;AACzC,QAAMc,YAAY,GAAGD,eAAe,CAACb,MAAD,CAApC;AACAc,IAAAA,YAAY,CAACkB,eAAb,GAA+BC,IAAI,CAACC,GAAL,EAA/B;AACA,WAAOlC,MAAP;AACD,GAJD;AAMAmB,EAAAA,KAAK,CAACU,YAAN,CAAmBtC,QAAnB,CAA4BwC,GAA5B,CAAgC,IAAhC;AAAA,uFAAsC,iBAAOzC,KAAP;AAAA;;AAAA;AAAA;AAAA;AAAA;AAC5BU,cAAAA,MAD4B,GACjBV,KADiB,CAC5BU,MAD4B,EAGpC;;AAHoC,kBAI/BA,MAJ+B;AAAA;AAAA;AAAA;;AAAA,+CAK3BmC,OAAO,CAACC,MAAR,CAAe9C,KAAf,CAL2B;;AAAA;AAAA,mCAahC0B,iBAAiB,CAAChB,MAAD,EAASiB,cAAT,CAbe,6CASlCQ,OATkC,EASlCA,OATkC,sCASxB,CATwB,sEAUlCC,cAVkC,EAUlCA,cAVkC,uCAUjBtB,iCAViB,uEAWlCiC,UAXkC,EAWlCA,UAXkC,uCAWrBhC,OAXqB,sEAYlCiC,kBAZkC,EAYlCA,kBAZkC,sCAYb,KAZa;AAe9BxB,cAAAA,YAf8B,GAefD,eAAe,CAACb,MAAD,CAfA;AAAA;AAAA,qBAiB1BwB,WAAW,CAACC,OAAD,EAAUC,cAAV,EAA0BZ,YAA1B,EAAwCxB,KAAxC,CAjBe;;AAAA;AAAA;AAAA;AAAA;AAAA;;AAkBlCwB,cAAAA,YAAY,CAACC,UAAb,IAA2B,CAA3B;AACMP,cAAAA,KAnB4B,GAmBpB6B,UAAU,CAACvB,YAAY,CAACC,UAAd,EAA0BzB,KAA1B,CAnBU,EAqBlC;AACA;;AACA4B,cAAAA,SAAS,CAACC,KAAD,EAAQnB,MAAR,CAAT;;AAEA,kBAAI,CAACsC,kBAAD,IAAuBtC,MAAM,CAACuC,OAA9B,IAAyCzB,YAAY,CAACkB,eAA1D,EAA2E;AACnEQ,gBAAAA,mBADmE,GAC7CP,IAAI,CAACC,GAAL,KAAapB,YAAY,CAACkB,eADmB,EAEzE;;AACAhC,gBAAAA,MAAM,CAACuC,OAAP,GAAiB9B,IAAI,CAACgC,GAAL,CAASzC,MAAM,CAACuC,OAAP,GAAiBC,mBAAjB,GAAuChC,KAAhD,EAAuD,CAAvD,CAAjB;AACD;;AAEDR,cAAAA,MAAM,CAAC0C,gBAAP,GAA0B,CAAC,UAACC,IAAD;AAAA,uBAAUA,IAAV;AAAA,eAAD,CAA1B;AA/BkC,+CAiC3B,IAAIR,OAAJ,CAAY,UAACS,OAAD;AAAA,uBAAaC,UAAU,CAAC;AAAA,yBAAMD,OAAO,CAACzB,KAAK,CAACnB,MAAD,CAAN,CAAb;AAAA,iBAAD,EAA+BQ,KAA/B,CAAvB;AAAA,eAAZ,CAjC2B;;AAAA;AAAA,+CAoC7B2B,OAAO,CAACC,MAAR,CAAe9C,KAAf,CApC6B;;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,KAAtC;;AAAA;AAAA;AAAA;AAAA;AAsCD,C,CAED;;;AACAsC,UAAU,CAACvC,cAAX,GAA4BA,cAA5B;AACAuC,UAAU,CAAC7B,kBAAX,GAAgCA,kBAAhC;AACA6B,UAAU,CAACzB,wBAAX,GAAsCA,wBAAtC;AACAyB,UAAU,CAACxB,iCAAX,GAA+CA,iCAA/C;AACAwB,UAAU,CAACtB,gBAAX,GAA8BA,gBAA9B;AACAsB,UAAU,CAAC/B,gBAAX,GAA8BA,gBAA9B","sourcesContent":["import isRetryAllowed from 'is-retry-allowed';\n\nconst namespace = 'axios-retry';\n\n/**\n * @param {Error} error\n * @return {boolean}\n */\nexport function isNetworkError(error) {\n return (\n !error.response &&\n Boolean(error.code) && // Prevents retrying cancelled requests\n error.code !== 'ECONNABORTED' && // Prevents retrying timed out requests\n isRetryAllowed(error)\n ); // Prevents retrying unsafe errors\n}\n\nconst SAFE_HTTP_METHODS = ['get', 'head', 'options'];\nconst IDEMPOTENT_HTTP_METHODS = SAFE_HTTP_METHODS.concat(['put', 'delete']);\n\n/**\n * @param {Error} error\n * @return {boolean}\n */\nexport function isRetryableError(error) {\n return (\n error.code !== 'ECONNABORTED' &&\n (!error.response || (error.response.status >= 500 && error.response.status <= 599))\n );\n}\n\n/**\n * @param {Error} error\n * @return {boolean}\n */\nexport function isSafeRequestError(error) {\n if (!error.config) {\n // Cannot determine if the request can be retried\n return false;\n }\n\n return isRetryableError(error) && SAFE_HTTP_METHODS.indexOf(error.config.method) !== -1;\n}\n\n/**\n * @param {Error} error\n * @return {boolean}\n */\nexport function isIdempotentRequestError(error) {\n if (!error.config) {\n // Cannot determine if the request can be retried\n return false;\n }\n\n return isRetryableError(error) && IDEMPOTENT_HTTP_METHODS.indexOf(error.config.method) !== -1;\n}\n\n/**\n * @param {Error} error\n * @return {boolean | Promise}\n */\nexport function isNetworkOrIdempotentRequestError(error) {\n return isNetworkError(error) || isIdempotentRequestError(error);\n}\n\n/**\n * @return {number} - delay in milliseconds, always 0\n */\nfunction noDelay() {\n return 0;\n}\n\n/**\n * @param {number} [retryNumber=0]\n * @return {number} - delay in milliseconds\n */\nexport function exponentialDelay(retryNumber = 0) {\n const delay = Math.pow(2, retryNumber) * 100;\n const randomSum = delay * 0.2 * Math.random(); // 0-20% of the delay\n return delay + randomSum;\n}\n\n/**\n * Initializes and returns the retry state for the given request/config\n * @param {AxiosRequestConfig} config\n * @return {Object}\n */\nfunction getCurrentState(config) {\n const currentState = config[namespace] || {};\n currentState.retryCount = currentState.retryCount || 0;\n config[namespace] = currentState;\n return currentState;\n}\n\n/**\n * Returns the axios-retry options for the current request\n * @param {AxiosRequestConfig} config\n * @param {AxiosRetryConfig} defaultOptions\n * @return {AxiosRetryConfig}\n */\nfunction getRequestOptions(config, defaultOptions) {\n return { ...defaultOptions, ...config[namespace] };\n}\n\n/**\n * @param {Axios} axios\n * @param {AxiosRequestConfig} config\n */\nfunction fixConfig(axios, config) {\n if (axios.defaults.agent === config.agent) {\n delete config.agent;\n }\n if (axios.defaults.httpAgent === config.httpAgent) {\n delete config.httpAgent;\n }\n if (axios.defaults.httpsAgent === config.httpsAgent) {\n delete config.httpsAgent;\n }\n}\n\n/**\n * Checks retryCondition if request can be retried. Handles it's retruning value or Promise.\n * @param {number} retries\n * @param {Function} retryCondition\n * @param {Object} currentState\n * @param {Error} error\n * @return {boolean}\n */\nasync function shouldRetry(retries, retryCondition, currentState, error) {\n const shouldRetryOrPromise = currentState.retryCount < retries && retryCondition(error);\n\n // This could be a promise\n if (typeof shouldRetryOrPromise === 'object') {\n try {\n await shouldRetryOrPromise;\n return true;\n } catch (_err) {\n return false;\n }\n }\n return shouldRetryOrPromise;\n}\n\n/**\n * Adds response interceptors to an axios instance to retry requests failed due to network issues\n *\n * @example\n *\n * import axios from 'axios';\n *\n * axiosRetry(axios, { retries: 3 });\n *\n * axios.get('http://example.com/test') // The first request fails and the second returns 'ok'\n * .then(result => {\n * result.data; // 'ok'\n * });\n *\n * // Exponential back-off retry delay between requests\n * axiosRetry(axios, { retryDelay : axiosRetry.exponentialDelay});\n *\n * // Custom retry delay\n * axiosRetry(axios, { retryDelay : (retryCount) => {\n * return retryCount * 1000;\n * }});\n *\n * // Also works with custom axios instances\n * const client = axios.create({ baseURL: 'http://example.com' });\n * axiosRetry(client, { retries: 3 });\n *\n * client.get('/test') // The first request fails and the second returns 'ok'\n * .then(result => {\n * result.data; // 'ok'\n * });\n *\n * // Allows request-specific configuration\n * client\n * .get('/test', {\n * 'axios-retry': {\n * retries: 0\n * }\n * })\n * .catch(error => { // The first request fails\n * error !== undefined\n * });\n *\n * @param {Axios} axios An axios instance (the axios object or one created from axios.create)\n * @param {Object} [defaultOptions]\n * @param {number} [defaultOptions.retries=3] Number of retries\n * @param {boolean} [defaultOptions.shouldResetTimeout=false]\n * Defines if the timeout should be reset between retries\n * @param {Function} [defaultOptions.retryCondition=isNetworkOrIdempotentRequestError]\n * A function to determine if the error can be retried\n * @param {Function} [defaultOptions.retryDelay=noDelay]\n * A function to determine the delay between retry requests\n */\nexport default function axiosRetry(axios, defaultOptions) {\n axios.interceptors.request.use((config) => {\n const currentState = getCurrentState(config);\n currentState.lastRequestTime = Date.now();\n return config;\n });\n\n axios.interceptors.response.use(null, async (error) => {\n const { config } = error;\n\n // If we have no information to retry the request\n if (!config) {\n return Promise.reject(error);\n }\n\n const {\n retries = 3,\n retryCondition = isNetworkOrIdempotentRequestError,\n retryDelay = noDelay,\n shouldResetTimeout = false\n } = getRequestOptions(config, defaultOptions);\n\n const currentState = getCurrentState(config);\n\n if (await shouldRetry(retries, retryCondition, currentState, error)) {\n currentState.retryCount += 1;\n const delay = retryDelay(currentState.retryCount, error);\n\n // Axios fails merging this configuration to the default configuration because it has an issue\n // with circular structures: https://github.com/mzabriskie/axios/issues/370\n fixConfig(axios, config);\n\n if (!shouldResetTimeout && config.timeout && currentState.lastRequestTime) {\n const lastRequestDuration = Date.now() - currentState.lastRequestTime;\n // Minimum 1ms timeout (passing 0 or less to XHR means no timeout)\n config.timeout = Math.max(config.timeout - lastRequestDuration - delay, 1);\n }\n\n config.transformRequest = [(data) => data];\n\n return new Promise((resolve) => setTimeout(() => resolve(axios(config)), delay));\n }\n\n return Promise.reject(error);\n });\n}\n\n// Compatibility with CommonJS\naxiosRetry.isNetworkError = isNetworkError;\naxiosRetry.isSafeRequestError = isSafeRequestError;\naxiosRetry.isIdempotentRequestError = isIdempotentRequestError;\naxiosRetry.isNetworkOrIdempotentRequestError = isNetworkOrIdempotentRequestError;\naxiosRetry.exponentialDelay = exponentialDelay;\naxiosRetry.isRetryableError = isRetryableError;\n"],"file":"index.js"} \ No newline at end of file diff --git a/node_modules/axios-retry/lib/cjs/package.json b/node_modules/axios-retry/lib/cjs/package.json new file mode 100644 index 0000000..1cd945a --- /dev/null +++ b/node_modules/axios-retry/lib/cjs/package.json @@ -0,0 +1,3 @@ +{ + "type": "commonjs" +} diff --git a/node_modules/axios-retry/lib/esm/index.js b/node_modules/axios-retry/lib/esm/index.js new file mode 100644 index 0000000..cd2b8ea --- /dev/null +++ b/node_modules/axios-retry/lib/esm/index.js @@ -0,0 +1,270 @@ +function asyncGeneratorStep(gen, resolve, reject, _next, _throw, key, arg) { try { var info = gen[key](arg); var value = info.value; } catch (error) { reject(error); return; } if (info.done) { resolve(value); } else { Promise.resolve(value).then(_next, _throw); } } + +function _asyncToGenerator(fn) { return function () { var self = this, args = arguments; return new Promise(function (resolve, reject) { var gen = fn.apply(self, args); function _next(value) { asyncGeneratorStep(gen, resolve, reject, _next, _throw, "next", value); } function _throw(err) { asyncGeneratorStep(gen, resolve, reject, _next, _throw, "throw", err); } _next(undefined); }); }; } + +function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) { symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); } keys.push.apply(keys, symbols); } return keys; } + +function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; } + +function _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; } + +import isRetryAllowed from 'is-retry-allowed'; +var namespace = 'axios-retry'; +/** + * @param {Error} error + * @return {boolean} + */ + +export function isNetworkError(error) { + return !error.response && Boolean(error.code) && // Prevents retrying cancelled requests + error.code !== 'ECONNABORTED' && // Prevents retrying timed out requests + isRetryAllowed(error); // Prevents retrying unsafe errors +} +var SAFE_HTTP_METHODS = ['get', 'head', 'options']; +var IDEMPOTENT_HTTP_METHODS = SAFE_HTTP_METHODS.concat(['put', 'delete']); +/** + * @param {Error} error + * @return {boolean} + */ + +export function isRetryableError(error) { + return error.code !== 'ECONNABORTED' && (!error.response || error.response.status >= 500 && error.response.status <= 599); +} +/** + * @param {Error} error + * @return {boolean} + */ + +export function isSafeRequestError(error) { + if (!error.config) { + // Cannot determine if the request can be retried + return false; + } + + return isRetryableError(error) && SAFE_HTTP_METHODS.indexOf(error.config.method) !== -1; +} +/** + * @param {Error} error + * @return {boolean} + */ + +export function isIdempotentRequestError(error) { + if (!error.config) { + // Cannot determine if the request can be retried + return false; + } + + return isRetryableError(error) && IDEMPOTENT_HTTP_METHODS.indexOf(error.config.method) !== -1; +} +/** + * @param {Error} error + * @return {boolean | Promise} + */ + +export function isNetworkOrIdempotentRequestError(error) { + return isNetworkError(error) || isIdempotentRequestError(error); +} +/** + * @return {number} - delay in milliseconds, always 0 + */ + +function noDelay() { + return 0; +} +/** + * @param {number} [retryNumber=0] + * @return {number} - delay in milliseconds + */ + + +export function exponentialDelay() { + var retryNumber = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 0; + var delay = Math.pow(2, retryNumber) * 100; + var randomSum = delay * 0.2 * Math.random(); // 0-20% of the delay + + return delay + randomSum; +} +/** + * Initializes and returns the retry state for the given request/config + * @param {AxiosRequestConfig} config + * @return {Object} + */ + +function getCurrentState(config) { + var currentState = config[namespace] || {}; + currentState.retryCount = currentState.retryCount || 0; + config[namespace] = currentState; + return currentState; +} +/** + * Returns the axios-retry options for the current request + * @param {AxiosRequestConfig} config + * @param {AxiosRetryConfig} defaultOptions + * @return {AxiosRetryConfig} + */ + + +function getRequestOptions(config, defaultOptions) { + return _objectSpread(_objectSpread({}, defaultOptions), config[namespace]); +} +/** + * @param {Axios} axios + * @param {AxiosRequestConfig} config + */ + + +function fixConfig(axios, config) { + if (axios.defaults.agent === config.agent) { + delete config.agent; + } + + if (axios.defaults.httpAgent === config.httpAgent) { + delete config.httpAgent; + } + + if (axios.defaults.httpsAgent === config.httpsAgent) { + delete config.httpsAgent; + } +} +/** + * Checks retryCondition if request can be retried. Handles it's retruning value or Promise. + * @param {number} retries + * @param {Function} retryCondition + * @param {Object} currentState + * @param {Error} error + * @return {boolean} + */ + + +function shouldRetry(_x, _x2, _x3, _x4) { + return _shouldRetry.apply(this, arguments); +} +/** + * Adds response interceptors to an axios instance to retry requests failed due to network issues + * + * @example + * + * import axios from 'axios'; + * + * axiosRetry(axios, { retries: 3 }); + * + * axios.get('http://example.com/test') // The first request fails and the second returns 'ok' + * .then(result => { + * result.data; // 'ok' + * }); + * + * // Exponential back-off retry delay between requests + * axiosRetry(axios, { retryDelay : axiosRetry.exponentialDelay}); + * + * // Custom retry delay + * axiosRetry(axios, { retryDelay : (retryCount) => { + * return retryCount * 1000; + * }}); + * + * // Also works with custom axios instances + * const client = axios.create({ baseURL: 'http://example.com' }); + * axiosRetry(client, { retries: 3 }); + * + * client.get('/test') // The first request fails and the second returns 'ok' + * .then(result => { + * result.data; // 'ok' + * }); + * + * // Allows request-specific configuration + * client + * .get('/test', { + * 'axios-retry': { + * retries: 0 + * } + * }) + * .catch(error => { // The first request fails + * error !== undefined + * }); + * + * @param {Axios} axios An axios instance (the axios object or one created from axios.create) + * @param {Object} [defaultOptions] + * @param {number} [defaultOptions.retries=3] Number of retries + * @param {boolean} [defaultOptions.shouldResetTimeout=false] + * Defines if the timeout should be reset between retries + * @param {Function} [defaultOptions.retryCondition=isNetworkOrIdempotentRequestError] + * A function to determine if the error can be retried + * @param {Function} [defaultOptions.retryDelay=noDelay] + * A function to determine the delay between retry requests + */ + + +function _shouldRetry() { + _shouldRetry = _asyncToGenerator(function* (retries, retryCondition, currentState, error) { + var shouldRetryOrPromise = currentState.retryCount < retries && retryCondition(error); // This could be a promise + + if (typeof shouldRetryOrPromise === 'object') { + try { + yield shouldRetryOrPromise; + return true; + } catch (_err) { + return false; + } + } + + return shouldRetryOrPromise; + }); + return _shouldRetry.apply(this, arguments); +} + +export default function axiosRetry(axios, defaultOptions) { + axios.interceptors.request.use(config => { + var currentState = getCurrentState(config); + currentState.lastRequestTime = Date.now(); + return config; + }); + axios.interceptors.response.use(null, /*#__PURE__*/function () { + var _ref = _asyncToGenerator(function* (error) { + var { + config + } = error; // If we have no information to retry the request + + if (!config) { + return Promise.reject(error); + } + + var { + retries = 3, + retryCondition = isNetworkOrIdempotentRequestError, + retryDelay = noDelay, + shouldResetTimeout = false + } = getRequestOptions(config, defaultOptions); + var currentState = getCurrentState(config); + + if (yield shouldRetry(retries, retryCondition, currentState, error)) { + currentState.retryCount += 1; + var delay = retryDelay(currentState.retryCount, error); // Axios fails merging this configuration to the default configuration because it has an issue + // with circular structures: https://github.com/mzabriskie/axios/issues/370 + + fixConfig(axios, config); + + if (!shouldResetTimeout && config.timeout && currentState.lastRequestTime) { + var lastRequestDuration = Date.now() - currentState.lastRequestTime; // Minimum 1ms timeout (passing 0 or less to XHR means no timeout) + + config.timeout = Math.max(config.timeout - lastRequestDuration - delay, 1); + } + + config.transformRequest = [data => data]; + return new Promise(resolve => setTimeout(() => resolve(axios(config)), delay)); + } + + return Promise.reject(error); + }); + + return function (_x5) { + return _ref.apply(this, arguments); + }; + }()); +} // Compatibility with CommonJS + +axiosRetry.isNetworkError = isNetworkError; +axiosRetry.isSafeRequestError = isSafeRequestError; +axiosRetry.isIdempotentRequestError = isIdempotentRequestError; +axiosRetry.isNetworkOrIdempotentRequestError = isNetworkOrIdempotentRequestError; +axiosRetry.exponentialDelay = exponentialDelay; +axiosRetry.isRetryableError = isRetryableError; +//# sourceMappingURL=index.js.map \ No newline at end of file diff --git a/node_modules/axios-retry/lib/esm/index.js.map b/node_modules/axios-retry/lib/esm/index.js.map new file mode 100644 index 0000000..fbf81ac --- /dev/null +++ b/node_modules/axios-retry/lib/esm/index.js.map @@ -0,0 +1 @@ +{"version":3,"sources":["../../es/index.mjs"],"names":["isRetryAllowed","namespace","isNetworkError","error","response","Boolean","code","SAFE_HTTP_METHODS","IDEMPOTENT_HTTP_METHODS","concat","isRetryableError","status","isSafeRequestError","config","indexOf","method","isIdempotentRequestError","isNetworkOrIdempotentRequestError","noDelay","exponentialDelay","retryNumber","delay","Math","pow","randomSum","random","getCurrentState","currentState","retryCount","getRequestOptions","defaultOptions","fixConfig","axios","defaults","agent","httpAgent","httpsAgent","shouldRetry","retries","retryCondition","shouldRetryOrPromise","_err","axiosRetry","interceptors","request","use","lastRequestTime","Date","now","Promise","reject","retryDelay","shouldResetTimeout","timeout","lastRequestDuration","max","transformRequest","data","resolve","setTimeout"],"mappings":";;;;;;;;;;AAAA,OAAOA,cAAP,MAA2B,kBAA3B;AAEA,IAAMC,SAAS,GAAG,aAAlB;AAEA;AACA;AACA;AACA;;AACA,OAAO,SAASC,cAAT,CAAwBC,KAAxB,EAA+B;AACpC,SACE,CAACA,KAAK,CAACC,QAAP,IACAC,OAAO,CAACF,KAAK,CAACG,IAAP,CADP,IACuB;AACvBH,EAAAA,KAAK,CAACG,IAAN,KAAe,cAFf,IAEiC;AACjCN,EAAAA,cAAc,CAACG,KAAD,CAJhB,CADoC,CAMjC;AACJ;AAED,IAAMI,iBAAiB,GAAG,CAAC,KAAD,EAAQ,MAAR,EAAgB,SAAhB,CAA1B;AACA,IAAMC,uBAAuB,GAAGD,iBAAiB,CAACE,MAAlB,CAAyB,CAAC,KAAD,EAAQ,QAAR,CAAzB,CAAhC;AAEA;AACA;AACA;AACA;;AACA,OAAO,SAASC,gBAAT,CAA0BP,KAA1B,EAAiC;AACtC,SACEA,KAAK,CAACG,IAAN,KAAe,cAAf,KACC,CAACH,KAAK,CAACC,QAAP,IAAoBD,KAAK,CAACC,QAAN,CAAeO,MAAf,IAAyB,GAAzB,IAAgCR,KAAK,CAACC,QAAN,CAAeO,MAAf,IAAyB,GAD9E,CADF;AAID;AAED;AACA;AACA;AACA;;AACA,OAAO,SAASC,kBAAT,CAA4BT,KAA5B,EAAmC;AACxC,MAAI,CAACA,KAAK,CAACU,MAAX,EAAmB;AACjB;AACA,WAAO,KAAP;AACD;;AAED,SAAOH,gBAAgB,CAACP,KAAD,CAAhB,IAA2BI,iBAAiB,CAACO,OAAlB,CAA0BX,KAAK,CAACU,MAAN,CAAaE,MAAvC,MAAmD,CAAC,CAAtF;AACD;AAED;AACA;AACA;AACA;;AACA,OAAO,SAASC,wBAAT,CAAkCb,KAAlC,EAAyC;AAC9C,MAAI,CAACA,KAAK,CAACU,MAAX,EAAmB;AACjB;AACA,WAAO,KAAP;AACD;;AAED,SAAOH,gBAAgB,CAACP,KAAD,CAAhB,IAA2BK,uBAAuB,CAACM,OAAxB,CAAgCX,KAAK,CAACU,MAAN,CAAaE,MAA7C,MAAyD,CAAC,CAA5F;AACD;AAED;AACA;AACA;AACA;;AACA,OAAO,SAASE,iCAAT,CAA2Cd,KAA3C,EAAkD;AACvD,SAAOD,cAAc,CAACC,KAAD,CAAd,IAAyBa,wBAAwB,CAACb,KAAD,CAAxD;AACD;AAED;AACA;AACA;;AACA,SAASe,OAAT,GAAmB;AACjB,SAAO,CAAP;AACD;AAED;AACA;AACA;AACA;;;AACA,OAAO,SAASC,gBAAT,GAA2C;AAAA,MAAjBC,WAAiB,uEAAH,CAAG;AAChD,MAAMC,KAAK,GAAGC,IAAI,CAACC,GAAL,CAAS,CAAT,EAAYH,WAAZ,IAA2B,GAAzC;AACA,MAAMI,SAAS,GAAGH,KAAK,GAAG,GAAR,GAAcC,IAAI,CAACG,MAAL,EAAhC,CAFgD,CAED;;AAC/C,SAAOJ,KAAK,GAAGG,SAAf;AACD;AAED;AACA;AACA;AACA;AACA;;AACA,SAASE,eAAT,CAAyBb,MAAzB,EAAiC;AAC/B,MAAMc,YAAY,GAAGd,MAAM,CAACZ,SAAD,CAAN,IAAqB,EAA1C;AACA0B,EAAAA,YAAY,CAACC,UAAb,GAA0BD,YAAY,CAACC,UAAb,IAA2B,CAArD;AACAf,EAAAA,MAAM,CAACZ,SAAD,CAAN,GAAoB0B,YAApB;AACA,SAAOA,YAAP;AACD;AAED;AACA;AACA;AACA;AACA;AACA;;;AACA,SAASE,iBAAT,CAA2BhB,MAA3B,EAAmCiB,cAAnC,EAAmD;AACjD,yCAAYA,cAAZ,GAA+BjB,MAAM,CAACZ,SAAD,CAArC;AACD;AAED;AACA;AACA;AACA;;;AACA,SAAS8B,SAAT,CAAmBC,KAAnB,EAA0BnB,MAA1B,EAAkC;AAChC,MAAImB,KAAK,CAACC,QAAN,CAAeC,KAAf,KAAyBrB,MAAM,CAACqB,KAApC,EAA2C;AACzC,WAAOrB,MAAM,CAACqB,KAAd;AACD;;AACD,MAAIF,KAAK,CAACC,QAAN,CAAeE,SAAf,KAA6BtB,MAAM,CAACsB,SAAxC,EAAmD;AACjD,WAAOtB,MAAM,CAACsB,SAAd;AACD;;AACD,MAAIH,KAAK,CAACC,QAAN,CAAeG,UAAf,KAA8BvB,MAAM,CAACuB,UAAzC,EAAqD;AACnD,WAAOvB,MAAM,CAACuB,UAAd;AACD;AACF;AAED;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;;SACeC,W;;;AAef;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;;;mCAlEA,WAA2BC,OAA3B,EAAoCC,cAApC,EAAoDZ,YAApD,EAAkExB,KAAlE,EAAyE;AACvE,QAAMqC,oBAAoB,GAAGb,YAAY,CAACC,UAAb,GAA0BU,OAA1B,IAAqCC,cAAc,CAACpC,KAAD,CAAhF,CADuE,CAGvE;;AACA,QAAI,OAAOqC,oBAAP,KAAgC,QAApC,EAA8C;AAC5C,UAAI;AACF,cAAMA,oBAAN;AACA,eAAO,IAAP;AACD,OAHD,CAGE,OAAOC,IAAP,EAAa;AACb,eAAO,KAAP;AACD;AACF;;AACD,WAAOD,oBAAP;AACD,G;;;;AAsDD,eAAe,SAASE,UAAT,CAAoBV,KAApB,EAA2BF,cAA3B,EAA2C;AACxDE,EAAAA,KAAK,CAACW,YAAN,CAAmBC,OAAnB,CAA2BC,GAA3B,CAAgChC,MAAD,IAAY;AACzC,QAAMc,YAAY,GAAGD,eAAe,CAACb,MAAD,CAApC;AACAc,IAAAA,YAAY,CAACmB,eAAb,GAA+BC,IAAI,CAACC,GAAL,EAA/B;AACA,WAAOnC,MAAP;AACD,GAJD;AAMAmB,EAAAA,KAAK,CAACW,YAAN,CAAmBvC,QAAnB,CAA4ByC,GAA5B,CAAgC,IAAhC;AAAA,iCAAsC,WAAO1C,KAAP,EAAiB;AACrD,UAAM;AAAEU,QAAAA;AAAF,UAAaV,KAAnB,CADqD,CAGrD;;AACA,UAAI,CAACU,MAAL,EAAa;AACX,eAAOoC,OAAO,CAACC,MAAR,CAAe/C,KAAf,CAAP;AACD;;AAED,UAAM;AACJmC,QAAAA,OAAO,GAAG,CADN;AAEJC,QAAAA,cAAc,GAAGtB,iCAFb;AAGJkC,QAAAA,UAAU,GAAGjC,OAHT;AAIJkC,QAAAA,kBAAkB,GAAG;AAJjB,UAKFvB,iBAAiB,CAAChB,MAAD,EAASiB,cAAT,CALrB;AAOA,UAAMH,YAAY,GAAGD,eAAe,CAACb,MAAD,CAApC;;AAEA,gBAAUwB,WAAW,CAACC,OAAD,EAAUC,cAAV,EAA0BZ,YAA1B,EAAwCxB,KAAxC,CAArB,EAAqE;AACnEwB,QAAAA,YAAY,CAACC,UAAb,IAA2B,CAA3B;AACA,YAAMP,KAAK,GAAG8B,UAAU,CAACxB,YAAY,CAACC,UAAd,EAA0BzB,KAA1B,CAAxB,CAFmE,CAInE;AACA;;AACA4B,QAAAA,SAAS,CAACC,KAAD,EAAQnB,MAAR,CAAT;;AAEA,YAAI,CAACuC,kBAAD,IAAuBvC,MAAM,CAACwC,OAA9B,IAAyC1B,YAAY,CAACmB,eAA1D,EAA2E;AACzE,cAAMQ,mBAAmB,GAAGP,IAAI,CAACC,GAAL,KAAarB,YAAY,CAACmB,eAAtD,CADyE,CAEzE;;AACAjC,UAAAA,MAAM,CAACwC,OAAP,GAAiB/B,IAAI,CAACiC,GAAL,CAAS1C,MAAM,CAACwC,OAAP,GAAiBC,mBAAjB,GAAuCjC,KAAhD,EAAuD,CAAvD,CAAjB;AACD;;AAEDR,QAAAA,MAAM,CAAC2C,gBAAP,GAA0B,CAAEC,IAAD,IAAUA,IAAX,CAA1B;AAEA,eAAO,IAAIR,OAAJ,CAAaS,OAAD,IAAaC,UAAU,CAAC,MAAMD,OAAO,CAAC1B,KAAK,CAACnB,MAAD,CAAN,CAAd,EAA+BQ,KAA/B,CAAnC,CAAP;AACD;;AAED,aAAO4B,OAAO,CAACC,MAAR,CAAe/C,KAAf,CAAP;AACD,KArCD;;AAAA;AAAA;AAAA;AAAA;AAsCD,C,CAED;;AACAuC,UAAU,CAACxC,cAAX,GAA4BA,cAA5B;AACAwC,UAAU,CAAC9B,kBAAX,GAAgCA,kBAAhC;AACA8B,UAAU,CAAC1B,wBAAX,GAAsCA,wBAAtC;AACA0B,UAAU,CAACzB,iCAAX,GAA+CA,iCAA/C;AACAyB,UAAU,CAACvB,gBAAX,GAA8BA,gBAA9B;AACAuB,UAAU,CAAChC,gBAAX,GAA8BA,gBAA9B","sourcesContent":["import isRetryAllowed from 'is-retry-allowed';\n\nconst namespace = 'axios-retry';\n\n/**\n * @param {Error} error\n * @return {boolean}\n */\nexport function isNetworkError(error) {\n return (\n !error.response &&\n Boolean(error.code) && // Prevents retrying cancelled requests\n error.code !== 'ECONNABORTED' && // Prevents retrying timed out requests\n isRetryAllowed(error)\n ); // Prevents retrying unsafe errors\n}\n\nconst SAFE_HTTP_METHODS = ['get', 'head', 'options'];\nconst IDEMPOTENT_HTTP_METHODS = SAFE_HTTP_METHODS.concat(['put', 'delete']);\n\n/**\n * @param {Error} error\n * @return {boolean}\n */\nexport function isRetryableError(error) {\n return (\n error.code !== 'ECONNABORTED' &&\n (!error.response || (error.response.status >= 500 && error.response.status <= 599))\n );\n}\n\n/**\n * @param {Error} error\n * @return {boolean}\n */\nexport function isSafeRequestError(error) {\n if (!error.config) {\n // Cannot determine if the request can be retried\n return false;\n }\n\n return isRetryableError(error) && SAFE_HTTP_METHODS.indexOf(error.config.method) !== -1;\n}\n\n/**\n * @param {Error} error\n * @return {boolean}\n */\nexport function isIdempotentRequestError(error) {\n if (!error.config) {\n // Cannot determine if the request can be retried\n return false;\n }\n\n return isRetryableError(error) && IDEMPOTENT_HTTP_METHODS.indexOf(error.config.method) !== -1;\n}\n\n/**\n * @param {Error} error\n * @return {boolean | Promise}\n */\nexport function isNetworkOrIdempotentRequestError(error) {\n return isNetworkError(error) || isIdempotentRequestError(error);\n}\n\n/**\n * @return {number} - delay in milliseconds, always 0\n */\nfunction noDelay() {\n return 0;\n}\n\n/**\n * @param {number} [retryNumber=0]\n * @return {number} - delay in milliseconds\n */\nexport function exponentialDelay(retryNumber = 0) {\n const delay = Math.pow(2, retryNumber) * 100;\n const randomSum = delay * 0.2 * Math.random(); // 0-20% of the delay\n return delay + randomSum;\n}\n\n/**\n * Initializes and returns the retry state for the given request/config\n * @param {AxiosRequestConfig} config\n * @return {Object}\n */\nfunction getCurrentState(config) {\n const currentState = config[namespace] || {};\n currentState.retryCount = currentState.retryCount || 0;\n config[namespace] = currentState;\n return currentState;\n}\n\n/**\n * Returns the axios-retry options for the current request\n * @param {AxiosRequestConfig} config\n * @param {AxiosRetryConfig} defaultOptions\n * @return {AxiosRetryConfig}\n */\nfunction getRequestOptions(config, defaultOptions) {\n return { ...defaultOptions, ...config[namespace] };\n}\n\n/**\n * @param {Axios} axios\n * @param {AxiosRequestConfig} config\n */\nfunction fixConfig(axios, config) {\n if (axios.defaults.agent === config.agent) {\n delete config.agent;\n }\n if (axios.defaults.httpAgent === config.httpAgent) {\n delete config.httpAgent;\n }\n if (axios.defaults.httpsAgent === config.httpsAgent) {\n delete config.httpsAgent;\n }\n}\n\n/**\n * Checks retryCondition if request can be retried. Handles it's retruning value or Promise.\n * @param {number} retries\n * @param {Function} retryCondition\n * @param {Object} currentState\n * @param {Error} error\n * @return {boolean}\n */\nasync function shouldRetry(retries, retryCondition, currentState, error) {\n const shouldRetryOrPromise = currentState.retryCount < retries && retryCondition(error);\n\n // This could be a promise\n if (typeof shouldRetryOrPromise === 'object') {\n try {\n await shouldRetryOrPromise;\n return true;\n } catch (_err) {\n return false;\n }\n }\n return shouldRetryOrPromise;\n}\n\n/**\n * Adds response interceptors to an axios instance to retry requests failed due to network issues\n *\n * @example\n *\n * import axios from 'axios';\n *\n * axiosRetry(axios, { retries: 3 });\n *\n * axios.get('http://example.com/test') // The first request fails and the second returns 'ok'\n * .then(result => {\n * result.data; // 'ok'\n * });\n *\n * // Exponential back-off retry delay between requests\n * axiosRetry(axios, { retryDelay : axiosRetry.exponentialDelay});\n *\n * // Custom retry delay\n * axiosRetry(axios, { retryDelay : (retryCount) => {\n * return retryCount * 1000;\n * }});\n *\n * // Also works with custom axios instances\n * const client = axios.create({ baseURL: 'http://example.com' });\n * axiosRetry(client, { retries: 3 });\n *\n * client.get('/test') // The first request fails and the second returns 'ok'\n * .then(result => {\n * result.data; // 'ok'\n * });\n *\n * // Allows request-specific configuration\n * client\n * .get('/test', {\n * 'axios-retry': {\n * retries: 0\n * }\n * })\n * .catch(error => { // The first request fails\n * error !== undefined\n * });\n *\n * @param {Axios} axios An axios instance (the axios object or one created from axios.create)\n * @param {Object} [defaultOptions]\n * @param {number} [defaultOptions.retries=3] Number of retries\n * @param {boolean} [defaultOptions.shouldResetTimeout=false]\n * Defines if the timeout should be reset between retries\n * @param {Function} [defaultOptions.retryCondition=isNetworkOrIdempotentRequestError]\n * A function to determine if the error can be retried\n * @param {Function} [defaultOptions.retryDelay=noDelay]\n * A function to determine the delay between retry requests\n */\nexport default function axiosRetry(axios, defaultOptions) {\n axios.interceptors.request.use((config) => {\n const currentState = getCurrentState(config);\n currentState.lastRequestTime = Date.now();\n return config;\n });\n\n axios.interceptors.response.use(null, async (error) => {\n const { config } = error;\n\n // If we have no information to retry the request\n if (!config) {\n return Promise.reject(error);\n }\n\n const {\n retries = 3,\n retryCondition = isNetworkOrIdempotentRequestError,\n retryDelay = noDelay,\n shouldResetTimeout = false\n } = getRequestOptions(config, defaultOptions);\n\n const currentState = getCurrentState(config);\n\n if (await shouldRetry(retries, retryCondition, currentState, error)) {\n currentState.retryCount += 1;\n const delay = retryDelay(currentState.retryCount, error);\n\n // Axios fails merging this configuration to the default configuration because it has an issue\n // with circular structures: https://github.com/mzabriskie/axios/issues/370\n fixConfig(axios, config);\n\n if (!shouldResetTimeout && config.timeout && currentState.lastRequestTime) {\n const lastRequestDuration = Date.now() - currentState.lastRequestTime;\n // Minimum 1ms timeout (passing 0 or less to XHR means no timeout)\n config.timeout = Math.max(config.timeout - lastRequestDuration - delay, 1);\n }\n\n config.transformRequest = [(data) => data];\n\n return new Promise((resolve) => setTimeout(() => resolve(axios(config)), delay));\n }\n\n return Promise.reject(error);\n });\n}\n\n// Compatibility with CommonJS\naxiosRetry.isNetworkError = isNetworkError;\naxiosRetry.isSafeRequestError = isSafeRequestError;\naxiosRetry.isIdempotentRequestError = isIdempotentRequestError;\naxiosRetry.isNetworkOrIdempotentRequestError = isNetworkOrIdempotentRequestError;\naxiosRetry.exponentialDelay = exponentialDelay;\naxiosRetry.isRetryableError = isRetryableError;\n"],"file":"index.js"} \ No newline at end of file diff --git a/node_modules/axios-retry/lib/esm/package.json b/node_modules/axios-retry/lib/esm/package.json new file mode 100644 index 0000000..4720025 --- /dev/null +++ b/node_modules/axios-retry/lib/esm/package.json @@ -0,0 +1,3 @@ +{ + "type": "module" +} diff --git a/node_modules/axios-retry/package.json b/node_modules/axios-retry/package.json new file mode 100644 index 0000000..4a22391 --- /dev/null +++ b/node_modules/axios-retry/package.json @@ -0,0 +1,72 @@ +{ + "name": "axios-retry", + "version": "3.2.4", + "author": "Rubén Norte ", + "description": "Axios plugin that intercepts failed requests and retries them whenever posible.", + "license": "Apache-2.0", + "homepage": "https://github.com/softonic/axios-retry", + "files": [ + "es", + "lib", + "index.js", + "index.d.ts" + ], + "scripts": { + "lint": "eslint es/**/*.mjs spec/**/*.spec.mjs", + "pretest": "npm run lint", + "test": "NODE_OPTIONS=--es-module-specifier-resolution=node jasmine", + "prebuild": "npm run test", + "build": "rm -rf lib && babel es -d lib/esm --source-maps && babel es -d lib/cjs --config-file ./babel.config.cjs.json --source-maps && ./fixup", + "prerelease": "npm run build", + "release": "npm version -m \"New version: %s\"", + "postrelease": "npm run push && npm publish", + "push": "git push origin master && git push origin --tags", + "prepare": "husky install" + }, + "lint-staged": { + "*.+(js|mjs)": [ + "eslint --cache --fix", + "prettier --write" + ], + "*.js": "eslint --cache --fix" + }, + "dependencies": { + "@babel/runtime": "^7.15.4", + "is-retry-allowed": "^2.2.0" + }, + "devDependencies": { + "@babel/cli": "^7.15.7", + "@babel/core": "^7.15.5", + "@babel/plugin-transform-runtime": "^7.15.8", + "@babel/preset-env": "^7.15.6", + "axios": "^0.21.2", + "eslint": "^7.32.0", + "eslint-config-airbnb-base": "^14.2.1", + "eslint-config-prettier": "^8.3.0", + "eslint-plugin-import": "^2.24.2", + "eslint-plugin-jasmine": "^4.1.2", + "eslint-plugin-prettier": "^4.0.0", + "husky": "^7.0.2", + "jasmine": "^3.9.0", + "lint-staged": "^11.2.0", + "nock": "^13.1.3", + "prettier": "^2.4.1" + }, + "repository": { + "type": "git", + "url": "git+https://github.com/softonic/axios-retry.git" + }, + "bugs": { + "url": "https://github.com/softonic/axios-retry/issues" + }, + "typings": "./index.d.ts", + "main": "index.js", + "module": "lib/esm/index.js", + "exports": { + ".": { + "import": "./lib/esm/index.js", + "require": "./index.js" + }, + "./package.json": "./package.json" + } +} diff --git a/node_modules/axios/CHANGELOG.md b/node_modules/axios/CHANGELOG.md index 4affca5..d1204ff 100644 --- a/node_modules/axios/CHANGELOG.md +++ b/node_modules/axios/CHANGELOG.md @@ -1,5 +1,499 @@ # Changelog +### 0.26.1 (March 9, 2022) + +Fixes and Functionality: +- Refactored project file structure to avoid circular imports ([##4220](https://github.com/axios/axios/pull/#4220)) + +### 0.26.0 (February 13, 2022) + +Fixes and Functionality: +- Fixed The timeoutErrorMessage property in config not work with Node.js ([#3581](https://github.com/axios/axios/pull/3581)) +- Added errors to be displayed when the query parsing process itself fails ([#3961](https://github.com/axios/axios/pull/3961)) +- Fix/remove url required ([#4426](https://github.com/axios/axios/pull/4426)) +- Update follow-redirects dependency due to Vurnerbility ([#4462](https://github.com/axios/axios/pull/4462)) +- Bump karma from 6.3.11 to 6.3.14 ([#4461](https://github.com/axios/axios/pull/4461)) +- Bump follow-redirects from 1.14.7 to 1.14.8 ([#4473](https://github.com/axios/axios/pull/4473)) + +### 0.25.0 (January 18, 2022) + +Breaking changes: +- Fixing maxBodyLength enforcement ([#3786](https://github.com/axios/axios/pull/3786)) +- Don't rely on strict mode behaviour for arguments ([#3470](https://github.com/axios/axios/pull/3470)) +- Adding error handling when missing url ([#3791](https://github.com/axios/axios/pull/3791)) +- Update isAbsoluteURL.js removing escaping of non-special characters ([#3809](https://github.com/axios/axios/pull/3809)) +- Use native Array.isArray() in utils.js ([#3836](https://github.com/axios/axios/pull/3836)) +- Adding error handling inside stream end callback ([#3967](https://github.com/axios/axios/pull/3967)) + +Fixes and Functionality: +- Added aborted even handler ([#3916](https://github.com/axios/axios/pull/3916)) +- Header types expanded allowing `boolean` and `number` types ([#4144](https://github.com/axios/axios/pull/4144)) +- Fix cancel signature allowing cancel message to be `undefined` ([#3153](https://github.com/axios/axios/pull/3153)) +- Updated type checks to be formulated better ([#3342](https://github.com/axios/axios/pull/3342)) +- Avoid unnecessary buffer allocations ([#3321](https://github.com/axios/axios/pull/3321)) +- Adding a socket handler to keep TCP connection live when processing long living requests ([#3422](https://github.com/axios/axios/pull/3422)) +- Added toFormData helper function ([#3757](https://github.com/axios/axios/pull/3757)) +- Adding responseEncoding prop type in AxiosRequestConfig ([#3918](https://github.com/axios/axios/pull/3918)) + +Internal and Tests: +- Adding axios-test-instance to ecosystem ([#3786](https://github.com/axios/axios/pull/3786)) +- Optimize the logic of isAxiosError ([#3546](https://github.com/axios/axios/pull/3546)) +- Add tests and documentation to display how multiple inceptors work ([#3564](https://github.com/axios/axios/pull/3564)) +- Updating follow-redirects to version 1.14.7 ([#4379](https://github.com/axios/axios/pull/4379)) + + +Documentation: +- Fixing changelog to show corrext pull request ([#4219](https://github.com/axios/axios/pull/4219)) +- Update upgrade guide for https proxy setting ([#3604](https://github.com/axios/axios/pull/3604)) + +Huge thanks to everyone who contributed to this release via code (authors listed below) or via reviews and triaging on GitHub: + +- [Jay](mailto:jasonsaayman@gmail.com) +- [Rijk van Zanten](https://github.com/rijkvanzanten) +- [Kohta Ito](https://github.com/koh110) +- [Brandon Faulkner](https://github.com/bfaulk96) +- [Stefano Magni](https://github.com/NoriSte) +- [enofan](https://github.com/fanguangyi) +- [Andrey Pechkurov](https://github.com/puzpuzpuz) +- [Doowonee](https://github.com/doowonee) +- [Emil Broman](https://github.com/emilbroman-eqt) +- [Remco Haszing](https://github.com/remcohaszing) +- [Black-Hole](https://github.com/BlackHole1) +- [Wolfram Kriesing](https://github.com/wolframkriesing) +- [Andrew Ovens](https://github.com/repl-andrew-ovens) +- [Paulo Renato](https://github.com/PauloRSF) +- [Ben Carp](https://github.com/carpben) +- [Hirotaka Tagawa](https://github.com/wafuwafu13) +- [狼族小狈](https://github.com/lzxb) +- [C. Lewis](https://github.com/ctjlewis) +- [Felipe Carvalho](https://github.com/FCarvalhoVII) +- [Daniel](https://github.com/djs113) +- [Gustavo Sales](https://github.com/gussalesdev) + +### 0.24.0 (October 25, 2021) + +Breaking changes: +- Revert: change type of AxiosResponse to any, please read lengthy discussion here: ([#4141](https://github.com/axios/axios/issues/4141)) pull request: ([#4186](https://github.com/axios/axios/pull/4186)) + +Huge thanks to everyone who contributed to this release via code (authors listed below) or via reviews and triaging on GitHub: + +- [Jay](mailto:jasonsaayman@gmail.com) +- [Rodry](https://github.com/ImRodry) +- [Remco Haszing](https://github.com/remcohaszing) +- [Isaiah Thomason](https://github.com/ITenthusiasm) + +### 0.23.0 (October 12, 2021) + +Breaking changes: +- Distinguish request and response data types ([#4116](https://github.com/axios/axios/pull/4116)) +- Change never type to unknown ([#4142](https://github.com/axios/axios/pull/4142)) +- Fixed TransitionalOptions typings ([#4147](https://github.com/axios/axios/pull/4147)) + +Fixes and Functionality: +- Adding globalObject: 'this' to webpack config ([#3176](https://github.com/axios/axios/pull/3176)) +- Adding insecureHTTPParser type to AxiosRequestConfig ([#4066](https://github.com/axios/axios/pull/4066)) +- Fix missing semicolon in typings ([#4115](https://github.com/axios/axios/pull/4115)) +- Fix response headers types ([#4136](https://github.com/axios/axios/pull/4136)) + +Internal and Tests: +- Improve timeout error when timeout is browser default ([#3209](https://github.com/axios/axios/pull/3209)) +- Fix node version on CI ([#4069](https://github.com/axios/axios/pull/4069)) +- Added testing to TypeScript portion of project ([#4140](https://github.com/axios/axios/pull/4140)) + +Documentation: +- Rename Angular to AngularJS ([#4114](https://github.com/axios/axios/pull/4114)) + +Huge thanks to everyone who contributed to this release via code (authors listed below) or via reviews and triaging on GitHub: + +- [Jay](mailto:jasonsaayman@gmail.com) +- [Evan-Finkelstein](https://github.com/Evan-Finkelstein) +- [Paweł Szymański](https://github.com/Jezorko) +- [Dobes Vandermeer](https://github.com/dobesv) +- [Claas Augner](https://github.com/caugner) +- [Remco Haszing](https://github.com/remcohaszing) +- [Evgeniy](https://github.com/egmen) +- [Dmitriy Mozgovoy](https://github.com/DigitalBrainJS) + +### 0.22.0 (October 01, 2021) + +Fixes and Functionality: +- Caseless header comparing in HTTP adapter ([#2880](https://github.com/axios/axios/pull/2880)) +- Avoid package.json import fixing issues and warnings related to this ([#4041](https://github.com/axios/axios/pull/4041)), ([#4065](https://github.com/axios/axios/pull/4065)) +- Fixed cancelToken leakage and added AbortController support ([#3305](https://github.com/axios/axios/pull/3305)) +- Updating CI to run on release branches +- Bump follow redirects version +- Fixed default transitional config for custom Axios instance; ([#4052](https://github.com/axios/axios/pull/4052)) + +Huge thanks to everyone who contributed to this release via code (authors listed below) or via reviews and triaging on GitHub: + +- [Jay](mailto:jasonsaayman@gmail.com) +- [Matt R. Wilson](https://github.com/mastermatt) +- [Xianming Zhong](https://github.com/chinesedfan) +- [Dmitriy Mozgovoy](https://github.com/DigitalBrainJS) + +### 0.21.4 (September 6, 2021) + +Fixes and Functionality: +- Fixing JSON transform when data is stringified. Providing backward compatability and complying to the JSON RFC standard ([#4020](https://github.com/axios/axios/pull/4020)) + +Huge thanks to everyone who contributed to this release via code (authors listed below) or via reviews and triaging on GitHub: + +- [Jay](mailto:jasonsaayman@gmail.com) +- [Guillaume Fortaine](https://github.com/gfortaine) +- [Yusuke Kawasaki](https://github.com/kawanet) +- [Dmitriy Mozgovoy](https://github.com/DigitalBrainJS) + +### 0.21.3 (September 4, 2021) + +Fixes and Functionality: +- Fixing response interceptor not being called when request interceptor is attached ([#4013](https://github.com/axios/axios/pull/4013)) + +Huge thanks to everyone who contributed to this release via code (authors listed below) or via reviews and triaging on GitHub: + +- [Jay](mailto:jasonsaayman@gmail.com) +- [Julian Hollmann](https://github.com/nerdbeere) + +### 0.21.2 (September 4, 2021) + +Fixes and Functionality: + +- Updating axios requests to be delayed by pre-emptive promise creation ([#2702](https://github.com/axios/axios/pull/2702)) +- Adding "synchronous" and "runWhen" options to interceptors api ([#2702](https://github.com/axios/axios/pull/2702)) +- Updating of transformResponse ([#3377](https://github.com/axios/axios/pull/3377)) +- Adding ability to omit User-Agent header ([#3703](https://github.com/axios/axios/pull/3703)) +- Adding multiple JSON improvements ([#3688](https://github.com/axios/axios/pull/3688), [#3763](https://github.com/axios/axios/pull/3763)) +- Fixing quadratic runtime and extra memory usage when setting a maxContentLength ([#3738](https://github.com/axios/axios/pull/3738)) +- Adding parseInt to config.timeout ([#3781](https://github.com/axios/axios/pull/3781)) +- Adding custom return type support to interceptor ([#3783](https://github.com/axios/axios/pull/3783)) +- Adding security fix for ReDoS vulnerability ([#3980](https://github.com/axios/axios/pull/3980)) + +Internal and Tests: + +- Updating build dev dependancies ([#3401](https://github.com/axios/axios/pull/3401)) +- Fixing builds running on Travis CI ([#3538](https://github.com/axios/axios/pull/3538)) +- Updating follow rediect version ([#3694](https://github.com/axios/axios/pull/3694), [#3771](https://github.com/axios/axios/pull/3771)) +- Updating karma sauce launcher to fix failing sauce tests ([#3712](https://github.com/axios/axios/pull/3712), [#3717](https://github.com/axios/axios/pull/3717)) +- Updating content-type header for application/json to not contain charset field, according do RFC 8259 ([#2154](https://github.com/axios/axios/pull/2154)) +- Fixing tests by bumping karma-sauce-launcher version ([#3813](https://github.com/axios/axios/pull/3813)) +- Changing testing process from Travis CI to GitHub Actions ([#3938](https://github.com/axios/axios/pull/3938)) + +Documentation: + +- Updating documentation around the use of `AUTH_TOKEN` with multiple domain endpoints ([#3539](https://github.com/axios/axios/pull/3539)) +- Remove duplication of item in changelog ([#3523](https://github.com/axios/axios/pull/3523)) +- Fixing gramatical errors ([#2642](https://github.com/axios/axios/pull/2642)) +- Fixing spelling error ([#3567](https://github.com/axios/axios/pull/3567)) +- Moving gitpod metion ([#2637](https://github.com/axios/axios/pull/2637)) +- Adding new axios documentation website link ([#3681](https://github.com/axios/axios/pull/3681), [#3707](https://github.com/axios/axios/pull/3707)) +- Updating documentation around dispatching requests ([#3772](https://github.com/axios/axios/pull/3772)) +- Adding documentation for the type guard isAxiosError ([#3767](https://github.com/axios/axios/pull/3767)) +- Adding explanation of cancel token ([#3803](https://github.com/axios/axios/pull/3803)) +- Updating CI status badge ([#3953](https://github.com/axios/axios/pull/3953)) +- Fixing errors with JSON documentation ([#3936](https://github.com/axios/axios/pull/3936)) +- Fixing README typo under Request Config ([#3825](https://github.com/axios/axios/pull/3825)) +- Adding axios-multi-api to the ecosystem file ([#3817](https://github.com/axios/axios/pull/3817)) +- Adding SECURITY.md to properly disclose security vulnerabilities ([#3981](https://github.com/axios/axios/pull/3981)) + +Huge thanks to everyone who contributed to this release via code (authors listed below) or via reviews and triaging on GitHub: + +- [Jay](mailto:jasonsaayman@gmail.com) +- [Sasha Korotkov](https://github.com/SashaKoro) +- [Daniel Lopretto](https://github.com/timemachine3030) +- [Mike Bishop](https://github.com/MikeBishop) +- [Dmitriy Mozgovoy](https://github.com/DigitalBrainJS) +- [Mark](https://github.com/bimbiltu) +- [Philipe Gouveia Paixão](https://github.com/piiih) +- [hippo](https://github.com/hippo2cat) +- [ready-research](https://github.com/ready-research) +- [Xianming Zhong](https://github.com/chinesedfan) +- [Christopher Chrapka](https://github.com/OJezu) +- [Brian Anglin](https://github.com/anglinb) +- [Kohta Ito](https://github.com/koh110) +- [Ali Clark](https://github.com/aliclark) +- [caikan](https://github.com/caikan) +- [Elina Gorshkova](https://github.com/elinagorshkova) +- [Ryota Ikezawa](https://github.com/paveg) +- [Nisar Hassan Naqvi](https://github.com/nisarhassan12) +- [Jake](https://github.com/codemaster138) +- [TagawaHirotaka](https://github.com/wafuwafu13) +- [Johannes Jarbratt](https://github.com/johachi) +- [Mo Sattler](https://github.com/MoSattler) +- [Sam Carlton](https://github.com/ThatGuySam) +- [Matt Czapliński](https://github.com/MattCCC) +- [Ziding Zhang](https://github.com/zidingz) + +### 0.21.1 (December 21, 2020) + +Fixes and Functionality: + +- Hotfix: Prevent SSRF ([#3410](https://github.com/axios/axios/pull/3410)) +- Protocol not parsed when setting proxy config from env vars ([#3070](https://github.com/axios/axios/pull/3070)) +- Updating axios in types to be lower case ([#2797](https://github.com/axios/axios/pull/2797)) +- Adding a type guard for `AxiosError` ([#2949](https://github.com/axios/axios/pull/2949)) + +Internal and Tests: + +- Remove the skipping of the `socket` http test ([#3364](https://github.com/axios/axios/pull/3364)) +- Use different socket for Win32 test ([#3375](https://github.com/axios/axios/pull/3375)) + +Huge thanks to everyone who contributed to this release via code (authors listed below) or via reviews and triaging on GitHub: + +- Daniel Lopretto +- Jason Kwok +- Jay +- Jonathan Foster +- Remco Haszing +- Xianming Zhong + +### 0.21.0 (October 23, 2020) + +Fixes and Functionality: + +- Fixing requestHeaders.Authorization ([#3287](https://github.com/axios/axios/pull/3287)) +- Fixing node types ([#3237](https://github.com/axios/axios/pull/3237)) +- Fixing axios.delete ignores config.data ([#3282](https://github.com/axios/axios/pull/3282)) +- Revert "Fixing overwrite Blob/File type as Content-Type in browser. (#1773)" ([#3289](https://github.com/axios/axios/pull/3289)) +- Fixing an issue that type 'null' and 'undefined' is not assignable to validateStatus when typescript strict option is enabled ([#3200](https://github.com/axios/axios/pull/3200)) + +Internal and Tests: + +- Lock travis to not use node v15 ([#3361](https://github.com/axios/axios/pull/3361)) + +Documentation: + +- Fixing simple typo, existant -> existent ([#3252](https://github.com/axios/axios/pull/3252)) +- Fixing typos ([#3309](https://github.com/axios/axios/pull/3309)) + +Huge thanks to everyone who contributed to this release via code (authors listed below) or via reviews and triaging on GitHub: + +- Allan Cruz <57270969+Allanbcruz@users.noreply.github.com> +- George Cheng +- Jay +- Kevin Kirsche +- Remco Haszing +- Taemin Shin +- Tim Gates +- Xianming Zhong + +### 0.20.0 (August 20, 2020) + +Release of 0.20.0-pre as a full release with no other changes. + +### 0.20.0-pre (July 15, 2020) + +Fixes and Functionality: + +- Fixing response with utf-8 BOM can not parse to json ([#2419](https://github.com/axios/axios/pull/2419)) + - fix: remove byte order marker (UTF-8 BOM) when transform response + - fix: remove BOM only utf-8 + - test: utf-8 BOM + - fix: incorrect param name +- Refactor mergeConfig without utils.deepMerge ([#2844](https://github.com/axios/axios/pull/2844)) + - Adding failing test + - Fixing #2587 default custom config persisting + - Adding Concat keys and filter duplicates + - Fixed value from CPE + - update for review feedbacks + - no deepMerge + - only merge between plain objects + - fix rename + - always merge config by mergeConfig + - extract function mergeDeepProperties + - refactor mergeConfig with all keys, and add special logic for validateStatus + - add test for resetting headers + - add lots of tests and fix a bug + - should not inherit `data` + - use simple toString +- Fixing overwrite Blob/File type as Content-Type in browser. ([#1773](https://github.com/axios/axios/pull/1773)) +- Fixing an issue that type 'null' is not assignable to validateStatus ([#2773](https://github.com/axios/axios/pull/2773)) +- Fixing special char encoding ([#1671](https://github.com/axios/axios/pull/1671)) + - removing @ character from replacement list since it is a reserved character + - Updating buildURL test to not include the @ character + - Removing console logs +- Fixing password encoding with special characters in basic authentication ([#1492](https://github.com/axios/axios/pull/1492)) + - Fixing password encoding with special characters in basic authentication + - Adding test to check if password with non-Latin1 characters pass +- Fixing 'Network Error' in react native android ([#1487](https://github.com/axios/axios/pull/1487)) + There is a bug in react native Android platform when using get method. It will trigger a 'Network Error' when passing the requestData which is an empty string to request.send function. So if the requestData is an empty string we can set it to null as well to fix the bug. +- Fixing Cookie Helper with Async Components ([#1105](https://github.com/axios/axios/pull/1105)) ([#1107](https://github.com/axios/axios/pull/1107)) +- Fixing 'progressEvent' type ([#2851](https://github.com/axios/axios/pull/2851)) + - Fix 'progressEvent' type + - Update axios.ts +- Fixing getting local files (file://) failed ([#2470](https://github.com/axios/axios/pull/2470)) + - fix issue #2416, #2396 + - fix Eslint warn + - Modify judgment conditions + - add unit test + - update unit test + - update unit test +- Allow PURGE method in typings ([#2191](https://github.com/axios/axios/pull/2191)) +- Adding option to disable automatic decompression ([#2661](https://github.com/axios/axios/pull/2661)) + - Adding ability to disable auto decompression + - Updating decompress documentation in README + - Fixing test\unit\adapters\http.js lint errors + - Adding test for disabling auto decompression + - Removing changes that fixed lint errors in tests + - Removing formatting change to unit test +- Add independent `maxBodyLength` option ([#2781](https://github.com/axios/axios/pull/2781)) + - Add independent option to set the maximum size of the request body + - Remove maxBodyLength check + - Update README + - Assert for error code and message +- Adding responseEncoding to mergeConfig ([#1745](https://github.com/axios/axios/pull/1745)) +- Compatible with follow-redirect aborts the request ([#2689](https://github.com/axios/axios/pull/2689)) + - Compatible with follow-redirect aborts the request + - Use the error code +- Fix merging of params ([#2656](https://github.com/axios/axios/pull/2656)) + - Name function to avoid ESLint func-names warning + - Switch params config to merge list and update tests + - Restore testing of both false and null + - Restore test cases for keys without defaults + - Include test for non-object values that aren't false-y. +- Revert `finally` as `then` ([#2683](https://github.com/axios/axios/pull/2683)) + +Internal and Tests: + +- Fix stale bot config ([#3049](https://github.com/axios/axios/pull/3049)) + - fix stale bot config + - fix multiple lines +- Add days and change name to work ([#3035](https://github.com/axios/axios/pull/3035)) +- Update close-issues.yml ([#3031](https://github.com/axios/axios/pull/3031)) + - Update close-issues.yml + Update close message to read better 😄 + - Fix use of quotations + Use single quotes as per other .yml files + - Remove user name form message +- Add GitHub actions to close stale issues/prs ([#3029](https://github.com/axios/axios/pull/3029)) + - prepare stale actions + - update messages + - Add exempt labels and lighten up comments +- Add GitHub actions to close invalid issues ([#3022](https://github.com/axios/axios/pull/3022)) + - add close actions + - fix with checkout + - update issue templates + - add reminder + - update close message +- Add test with Node.js 12 ([#2860](https://github.com/axios/axios/pull/2860)) + - test with Node.js 12 + - test with latest +- Adding console log on sandbox server startup ([#2210](https://github.com/axios/axios/pull/2210)) + - Adding console log on sandbox server startup + - Update server.js + Add server error handling + - Update server.js + Better error message, remove retry. +- Adding tests for method `options` type definitions ([#1996](https://github.com/axios/axios/pull/1996)) + Update tests. +- Add test for redirecting with too large response ([#2695](https://github.com/axios/axios/pull/2695)) +- Fixing unit test failure in Windows OS ([#2601](https://github.com/axios/axios/pull/2601)) +- Fixing issue for HEAD method and gzipped response ([#2666](https://github.com/axios/axios/pull/2666)) +- Fix tests in browsers ([#2748](https://github.com/axios/axios/pull/2748)) +- chore: add `jsdelivr` and `unpkg` support ([#2443](https://github.com/axios/axios/pull/2443)) + +Documentation: + +- Adding support for URLSearchParams in node ([#1900](https://github.com/axios/axios/pull/1900)) + - Adding support for URLSearchParams in node + - Remove un-needed code + - Update utils.js + - Make changes as suggested +- Adding table of content (preview) ([#3050](https://github.com/axios/axios/pull/3050)) + - add toc (preview) + - remove toc in toc + Signed-off-by: Moni + - fix sublinks + - fix indentation + - remove redundant table links + - update caps and indent + - remove axios +- Replace 'blacklist' with 'blocklist' ([#3006](https://github.com/axios/axios/pull/3006)) +- docs(): Detailed config options environment. ([#2088](https://github.com/axios/axios/pull/2088)) + - docs(): Detailed config options environment. + - Update README.md +- Include axios-data-unpacker in ECOSYSTEM.md ([#2080](https://github.com/axios/axios/pull/2080)) +- Allow opening examples in Gitpod ([#1958](https://github.com/axios/axios/pull/1958)) +- Remove axios.all() and axios.spread() from Readme.md ([#2727](https://github.com/axios/axios/pull/2727)) + - remove axios.all(), axios.spread() + - replace example + - axios.all() -> Promise.all() + - axios.spread(function (acct, perms)) -> function (acct, perms) + - add deprecated mark +- Update README.md ([#2887](https://github.com/axios/axios/pull/2887)) + Small change to the data attribute doc of the config. A request body can also be set for DELETE methods but this wasn't mentioned in the documentation (it only mentioned POST, PUT and PATCH). Took my some 10-20 minutes until I realized that I don't need to manipulate the request body with transformRequest in the case of DELETE. +- Include swagger-taxos-codegen in ECOSYSTEM.md ([#2162](https://github.com/axios/axios/pull/2162)) +- Add CDNJS version badge in README.md ([#878](https://github.com/axios/axios/pull/878)) + This badge will show the version on CDNJS! +- Documentation update to clear up ambiguity in code examples ([#2928](https://github.com/axios/axios/pull/2928)) + - Made an adjustment to the documentation to clear up any ambiguity around the use of "fs". This should help clear up that the code examples with "fs" cannot be used on the client side. +- Update README.md about validateStatus ([#2912](https://github.com/axios/axios/pull/2912)) + Rewrote the comment from "Reject only if the status code is greater than or equal to 500" to "Resolve only if the status code is less than 500" +- Updating documentation for usage form-data ([#2805](https://github.com/axios/axios/pull/2805)) + Closes #2049 +- Fixing CHANGELOG.md issue link ([#2784](https://github.com/axios/axios/pull/2784)) +- Include axios-hooks in ECOSYSTEM.md ([#2003](https://github.com/axios/axios/pull/2003)) +- Added Response header access instructions ([#1901](https://github.com/axios/axios/pull/1901)) + - Added Response header access instructions + - Added note about using bracket notation +- Add `onUploadProgress` and `onDownloadProgress` are browser only ([#2763](https://github.com/axios/axios/pull/2763)) + Saw in #928 and #1966 that `onUploadProgress` and `onDownloadProgress` only work in the browser and was missing that from the README. +- Update ' sign to ` in proxy spec ([#2778](https://github.com/axios/axios/pull/2778)) +- Adding jsDelivr link in README ([#1110](https://github.com/axios/axios/pull/1110)) + - Adding jsDelivr link + - Add SRI + - Remove SRI + +Huge thanks to everyone who contributed to this release via code (authors listed +below) or via reviews and triaging on GitHub: + +- Alan Wang +- Alexandru Ungureanu +- Anubhav Srivastava +- Benny Neugebauer +- Cr <631807682@qq.com> +- David +- David Ko +- David Tanner +- Emily Morehouse +- Felipe Martins +- Fonger <5862369+Fonger@users.noreply.github.com> +- Frostack +- George Cheng +- grumblerchester +- Gustavo López +- hexaez <45806662+hexaez@users.noreply.github.com> +- huangzuizui +- Ian Wijma +- Jay +- jeffjing +- jennynju <46782518+jennynju@users.noreply.github.com> +- Jimmy Liao <52391190+jimmy-liao-gogoro@users.noreply.github.com> +- Jonathan Sharpe +- JounQin +- Justin Beckwith +- Kamil Posiadała <3dcreator.pl@gmail.com> +- Lukas Drgon +- marcinx +- Martti Laine +- Michał Zarach +- Moni +- Motonori Iwata <121048+iwata@users.noreply.github.com> +- Nikita Galkin +- Petr Mares +- Philippe Recto +- Remco Haszing +- rockcs1992 +- Ryan Bown +- Samina Fu +- Simone Busoli +- Spencer von der Ohe +- Sven Efftinge +- Taegyeoung Oh +- Taemin Shin +- Thibault Ehrhart <1208424+ehrhart@users.noreply.github.com> +- Xianming Zhong +- Yasu Flores +- Zac Delventhal + ### 0.19.2 (Jan 20, 2020) - Remove unnecessary XSS check ([#2679](https://github.com/axios/axios/pull/2679)) (see ([#2646](https://github.com/axios/axios/issues/2646)) for discussion) @@ -25,7 +519,7 @@ Fixes and Functionality: - Add error toJSON example ([#2466](https://github.com/axios/axios/pull/2466)) - Fixing Vulnerability A Fortify Scan finds a critical Cross-Site Scrip… ([#2451](https://github.com/axios/axios/pull/2451)) - Fixing subdomain handling on no_proxy ([#2442](https://github.com/axios/axios/pull/2442)) -- Make redirection from HTTP to HTTPS work ([#2426](https://github.com/axios/axios/pull/2426] and ([#2547](https://github.com/axios/axios/pull/2547)) +- Make redirection from HTTP to HTTPS work ([#2426](https://github.com/axios/axios/pull/2426)) and ([#2547](https://github.com/axios/axios/pull/2547)) - Add toJSON property to AxiosError type ([#2427](https://github.com/axios/axios/pull/2427)) - Fixing socket hang up error on node side for slow response. ([#1752](https://github.com/axios/axios/pull/1752)) - Alternative syntax to send data into the body ([#2317](https://github.com/axios/axios/pull/2317)) @@ -33,7 +527,6 @@ Fixes and Functionality: - Fixing set `config.method` after mergeConfig for Axios.prototype.request ([#2383](https://github.com/axios/axios/pull/2383)) - Axios create url bug ([#2290](https://github.com/axios/axios/pull/2290)) - Do not modify config.url when using a relative baseURL (resolves [#1628](https://github.com/axios/axios/issues/1098)) ([#2391](https://github.com/axios/axios/pull/2391)) -- Add typescript HTTP method definition for LINK and UNLINK ([#2444](https://github.com/axios/axios/pull/2444)) Internal: @@ -57,7 +550,7 @@ Documentation: - Update response interceptor docs ([#2399](https://github.com/axios/axios/pull/2399)) - Update README.md ([#2504](https://github.com/axios/axios/pull/2504)) - Fix word 'sintaxe' to 'syntax' in README.md ([#2432](https://github.com/axios/axios/pull/2432)) -- upadating README: notes on CommonJS autocomplete ([#2256](https://github.com/axios/axios/pull/2256)) +- updating README: notes on CommonJS autocomplete ([#2256](https://github.com/axios/axios/pull/2256)) - Fix grammar in README.md ([#2271](https://github.com/axios/axios/pull/2271)) - Doc fixes, minor examples cleanup ([#2198](https://github.com/axios/axios/pull/2198)) @@ -110,7 +603,7 @@ New Functionality: - Add getUri method ([#1712](https://github.com/axios/axios/issues/1712)) - Add support for no_proxy env variable ([#1693](https://github.com/axios/axios/issues/1693)) -- Add toJSON to decorated Axios errors to faciliate serialization ([#1625](https://github.com/axios/axios/issues/1625)) +- Add toJSON to decorated Axios errors to facilitate serialization ([#1625](https://github.com/axios/axios/issues/1625)) - Add second then on axios call ([#1623](https://github.com/axios/axios/issues/1623)) - Typings: allow custom return types - Add option to specify character set in responses (with http adapter) diff --git a/node_modules/axios/README.md b/node_modules/axios/README.md index 0b09254..d5ba7f9 100755 --- a/node_modules/axios/README.md +++ b/node_modules/axios/README.md @@ -1,15 +1,53 @@ # axios [![npm version](https://img.shields.io/npm/v/axios.svg?style=flat-square)](https://www.npmjs.org/package/axios) -[![build status](https://img.shields.io/travis/axios/axios/master.svg?style=flat-square)](https://travis-ci.org/axios/axios) +[![CDNJS](https://img.shields.io/cdnjs/v/axios.svg?style=flat-square)](https://cdnjs.com/libraries/axios) +![Build status](https://github.com/axios/axios/actions/workflows/ci.yml/badge.svg) +[![Gitpod Ready-to-Code](https://img.shields.io/badge/Gitpod-Ready--to--Code-blue?logo=gitpod)](https://gitpod.io/#https://github.com/axios/axios) [![code coverage](https://img.shields.io/coveralls/mzabriskie/axios.svg?style=flat-square)](https://coveralls.io/r/mzabriskie/axios) [![install size](https://packagephobia.now.sh/badge?p=axios)](https://packagephobia.now.sh/result?p=axios) [![npm downloads](https://img.shields.io/npm/dm/axios.svg?style=flat-square)](http://npm-stat.com/charts.html?package=axios) [![gitter chat](https://img.shields.io/gitter/room/mzabriskie/axios.svg?style=flat-square)](https://gitter.im/mzabriskie/axios) [![code helpers](https://www.codetriage.com/axios/axios/badges/users.svg)](https://www.codetriage.com/axios/axios) +[![Known Vulnerabilities](https://snyk.io/test/npm/axios/badge.svg)](https://snyk.io/test/npm/axios) Promise based HTTP client for the browser and node.js +> New axios docs website: [click here](https://axios-http.com/) + +## Table of Contents + + - [Features](#features) + - [Browser Support](#browser-support) + - [Installing](#installing) + - [Example](#example) + - [Axios API](#axios-api) + - [Request method aliases](#request-method-aliases) + - [Concurrency (Deprecated)](#concurrency-deprecated) + - [Creating an instance](#creating-an-instance) + - [Instance methods](#instance-methods) + - [Request Config](#request-config) + - [Response Schema](#response-schema) + - [Config Defaults](#config-defaults) + - [Global axios defaults](#global-axios-defaults) + - [Custom instance defaults](#custom-instance-defaults) + - [Config order of precedence](#config-order-of-precedence) + - [Interceptors](#interceptors) + - [Multiple Interceptors](#multiple-interceptors) + - [Handling Errors](#handling-errors) + - [Cancellation](#cancellation) + - [Using application/x-www-form-urlencoded format](#using-applicationx-www-form-urlencoded-format) + - [Browser](#browser) + - [Node.js](#nodejs) + - [Query string](#query-string) + - [Form data](#form-data) + - [Semver](#semver) + - [Promises](#promises) + - [TypeScript](#typescript) + - [Resources](#resources) + - [Credits](#credits) + - [License](#license) + ## Features - Make [XMLHttpRequests](https://developer.mozilla.org/en-US/docs/Web/API/XMLHttpRequest) from the browser @@ -49,7 +87,13 @@ Using yarn: $ yarn add axios ``` -Using cdn: +Using jsDelivr CDN: + +```html + +``` + +Using unpkg CDN: ```html @@ -81,7 +125,7 @@ axios.get('/user?ID=12345') // handle error console.log(error); }) - .finally(function () { + .then(function () { // always executed }); @@ -97,7 +141,7 @@ axios.get('/user', { .catch(function (error) { console.log(error); }) - .finally(function () { + .then(function () { // always executed }); @@ -141,10 +185,11 @@ function getUserPermissions() { return axios.get('/user/12345/permissions'); } -axios.all([getUserAccount(), getUserPermissions()]) - .then(axios.spread(function (acct, perms) { - // Both requests are now complete - })); +Promise.all([getUserAccount(), getUserPermissions()]) + .then(function (results) { + const acct = results[0]; + const perm = results[1]; + }); ``` ## axios API @@ -166,7 +211,7 @@ axios({ ``` ```js -// GET request for remote image +// GET request for remote image in node.js axios({ method: 'get', url: 'http://bit.ly/2mTM3nY', @@ -200,12 +245,13 @@ For convenience aliases have been provided for all supported request methods. ###### NOTE When using the alias methods `url`, `method`, and `data` properties don't need to be specified in config. -### Concurrency +### Concurrency (Deprecated) +Please use `Promise.all` to replace the below functions. Helper functions for dealing with concurrent requests. -##### axios.all(iterable) -##### axios.spread(callback) +axios.all(iterable) +axios.spread(callback) ### Creating an instance @@ -287,7 +333,7 @@ These are the available config options for making requests. Only the `url` is re }, // `data` is the data to be sent as the request body - // Only applicable for request methods 'PUT', 'POST', and 'PATCH' + // Only applicable for request methods 'PUT', 'POST', 'DELETE , and 'PATCH' // When no `transformRequest` is set, must be of one of the following types: // - string, plain object, ArrayBuffer, ArrayBufferView, URLSearchParams // - Browser only: FormData, File, Blob @@ -330,7 +376,7 @@ These are the available config options for making requests. Only the `url` is re // browser only: 'blob' responseType: 'json', // default - // `responseEncoding` indicates encoding to use for decoding responses + // `responseEncoding` indicates encoding to use for decoding responses (Node.js only) // Note: Ignored for `responseType` of 'stream' or client-side requests responseEncoding: 'utf8', // default @@ -341,18 +387,23 @@ These are the available config options for making requests. Only the `url` is re xsrfHeaderName: 'X-XSRF-TOKEN', // default // `onUploadProgress` allows handling of progress events for uploads + // browser only onUploadProgress: function (progressEvent) { // Do whatever you want with the native progress event }, // `onDownloadProgress` allows handling of progress events for downloads + // browser only onDownloadProgress: function (progressEvent) { // Do whatever you want with the native progress event }, - // `maxContentLength` defines the max size of the http response content in bytes allowed + // `maxContentLength` defines the max size of the http response content in bytes allowed in node.js maxContentLength: 2000, + // `maxBodyLength` (Node only option) defines the max size of the http request content in bytes allowed + maxBodyLength: 2000, + // `validateStatus` defines whether to resolve or reject the promise for a given // HTTP response status code. If `validateStatus` returns `true` (or is set to `null` // or `undefined`), the promise will be resolved; otherwise, the promise will be @@ -377,7 +428,7 @@ These are the available config options for making requests. Only the `url` is re httpAgent: new http.Agent({ keepAlive: true }), httpsAgent: new https.Agent({ keepAlive: true }), - // 'proxy' defines the hostname and port of the proxy server. + // `proxy` defines the hostname, port, and protocol of the proxy server. // You can also define your proxy using the conventional `http_proxy` and // `https_proxy` environment variables. If you are using environment variables // for your proxy configuration, you can also define a `no_proxy` environment @@ -387,7 +438,9 @@ These are the available config options for making requests. Only the `url` is re // supplies credentials. // This will set an `Proxy-Authorization` header, overwriting any existing // `Proxy-Authorization` custom headers you have set using `headers`. + // If the proxy server uses HTTPS, then you must set the protocol to `https`. proxy: { + protocol: 'https', host: '127.0.0.1', port: 9000, auth: { @@ -399,7 +452,38 @@ These are the available config options for making requests. Only the `url` is re // `cancelToken` specifies a cancel token that can be used to cancel the request // (see Cancellation section below for details) cancelToken: new CancelToken(function (cancel) { - }) + }), + + // an alternative way to cancel Axios requests using AbortController + signal: new AbortController().signal, + + // `decompress` indicates whether or not the response body should be decompressed + // automatically. If set to `true` will also remove the 'content-encoding' header + // from the responses objects of all decompressed responses + // - Node only (XHR cannot turn off decompression) + decompress: true // default + + // `insecureHTTPParser` boolean. + // Indicates where to use an insecure HTTP parser that accepts invalid HTTP headers. + // This may allow interoperability with non-conformant HTTP implementations. + // Using the insecure parser should be avoided. + // see options https://nodejs.org/dist/latest-v12.x/docs/api/http.html#http_http_request_url_options_callback + // see also https://nodejs.org/en/blog/vulnerability/february-2020-security-releases/#strict-http-header-parsing-none + insecureHTTPParser: undefined // default + + // transitional options for backward compatibility that may be removed in the newer versions + transitional: { + // silent JSON parsing mode + // `true` - ignore JSON parsing errors and set response.data to null if parsing failed (old behaviour) + // `false` - throw SyntaxError if JSON parsing failed (Note: responseType must be set to 'json') + silentJSONParsing: true, // default value for the current Axios version + + // try to parse the response string as JSON even if `responseType` is not 'json' + forcedJSONParsing: true, + + // throw ETIMEDOUT error instead of generic ECONNABORTED on request timeouts + clarifyTimeoutError: false, + } } ``` @@ -418,8 +502,9 @@ The response for a request contains the following information. // `statusText` is the HTTP status message from the server response statusText: 'OK', - // `headers` the headers that the server responded with - // All header names are lower cased + // `headers` the HTTP headers that the server responded with + // All header names are lower cased and can be accessed using the bracket notation. + // Example: `response.headers['content-type']` headers: {}, // `config` is the config that was provided to `axios` for the request @@ -455,7 +540,11 @@ You can specify config defaults that will be applied to every request. ```js axios.defaults.baseURL = 'https://api.example.com'; + +// Important: If axios is used with multiple domains, the AUTH_TOKEN will be sent to all of them. +// See below for an example using Custom instance defaults instead. axios.defaults.headers.common['Authorization'] = AUTH_TOKEN; + axios.defaults.headers.post['Content-Type'] = 'application/x-www-form-urlencoded'; ``` @@ -530,6 +619,49 @@ const instance = axios.create(); instance.interceptors.request.use(function () {/*...*/}); ``` +When you add request interceptors, they are presumed to be asynchronous by default. This can cause a delay +in the execution of your axios request when the main thread is blocked (a promise is created under the hood for +the interceptor and your request gets put on the bottom of the call stack). If your request interceptors are synchronous you can add a flag +to the options object that will tell axios to run the code synchronously and avoid any delays in request execution. + +```js +axios.interceptors.request.use(function (config) { + config.headers.test = 'I am only a header!'; + return config; +}, null, { synchronous: true }); +``` + +If you want to execute a particular interceptor based on a runtime check, +you can add a `runWhen` function to the options object. The interceptor will not be executed **if and only if** the return +of `runWhen` is `false`. The function will be called with the config +object (don't forget that you can bind your own arguments to it as well.) This can be handy when you have an +asynchronous request interceptor that only needs to run at certain times. + +```js +function onGetCall(config) { + return config.method === 'get'; +} +axios.interceptors.request.use(function (config) { + config.headers.test = 'special get headers'; + return config; +}, null, { runWhen: onGetCall }); +``` + +### Multiple Interceptors + +Given you add multiple response interceptors +and when the response was fulfilled +- then each interceptor is executed +- then they are executed in the order they were added +- then only the last interceptor's result is returned +- then every interceptor receives the result of it's predecessor +- and when the fulfillment-interceptor throws + - then the following fulfillment-interceptor is not called + - then the following rejection-interceptor is called + - once caught, another following fulfill-interceptor is called again (just like in a promise chain). + +Read [the interceptor tests](./test/specs/interceptors.spec.js) for seeing all this in code. + ## Handling Errors ```js @@ -559,7 +691,7 @@ Using the `validateStatus` config option, you can define HTTP code(s) that shoul ```js axios.get('/user/12345', { validateStatus: function (status) { - return status < 500; // Reject only if the status code is greater than or equal to 500 + return status < 500; // Resolve only if the status code is less than 500 } }) ``` @@ -622,7 +754,21 @@ axios.get('/user/12345', { cancel(); ``` -> Note: you can cancel several requests with the same cancel token. +Axios supports AbortController to abort requests in [`fetch API`](https://developer.mozilla.org/en-US/docs/Web/API/Fetch_API#aborting_a_fetch) way: +```js +const controller = new AbortController(); + +axios.get('/foo/bar', { + signal: controller.signal +}).then(function(response) { + //... +}); +// cancel the request +controller.abort() +``` + +> Note: you can cancel several requests with the same cancel token/abort controller. +> If a cancellation token is already cancelled at the moment of starting an Axios request, then the request is cancelled immediately, without any attempts to make real request. ## Using application/x-www-form-urlencoded format @@ -664,6 +810,8 @@ axios(options); ### Node.js +#### Query string + In node.js, you can use the [`querystring`](https://nodejs.org/api/querystring.html) module as follows: ```js @@ -671,11 +819,45 @@ const querystring = require('querystring'); axios.post('http://something.com/', querystring.stringify({ foo: 'bar' })); ``` +or ['URLSearchParams'](https://nodejs.org/api/url.html#url_class_urlsearchparams) from ['url module'](https://nodejs.org/api/url.html) as follows: + +```js +const url = require('url'); +const params = new url.URLSearchParams({ foo: 'bar' }); +axios.post('http://something.com/', params.toString()); +``` + You can also use the [`qs`](https://github.com/ljharb/qs) library. ###### NOTE The `qs` library is preferable if you need to stringify nested objects, as the `querystring` method has known issues with that use case (https://github.com/nodejs/node-v0.x-archive/issues/1665). +#### Form data + +In node.js, you can use the [`form-data`](https://github.com/form-data/form-data) library as follows: + +```js +const FormData = require('form-data'); + +const form = new FormData(); +form.append('my_field', 'my value'); +form.append('my_buffer', new Buffer(10)); +form.append('my_file', fs.createReadStream('/foo/bar.jpg')); + +axios.post('https://example.com', form, { headers: form.getHeaders() }) +``` + +Alternatively, use an interceptor: + +```js +axios.interceptors.request.use(config => { + if (config.data instanceof FormData) { + Object.assign(config.headers, config.data.getHeaders()); + } + return config; +}); +``` + ## Semver Until axios reaches a `1.0` release, breaking changes will be released with a new minor version. For example `0.5.1`, and `0.5.4` will have the same API, but `0.6.0` will have breaking changes. @@ -686,12 +868,30 @@ axios depends on a native ES6 Promise implementation to be [supported](http://ca If your environment doesn't support ES6 Promises, you can [polyfill](https://github.com/jakearchibald/es6-promise). ## TypeScript -axios includes [TypeScript](http://typescriptlang.org) definitions. + +axios includes [TypeScript](http://typescriptlang.org) definitions and a type guard for axios errors. + ```typescript -import axios from 'axios'; -axios.get('/user?ID=12345'); +let user: User = null; +try { + const { data } = await axios.get('/user?ID=12345'); + user = data.userDetails; +} catch (error) { + if (axios.isAxiosError(error)) { + handleAxiosError(error); + } else { + handleUnexpectedError(error); + } +} ``` +## Online one-click setup + +You can use Gitpod an online IDE(which is free for Open Source) for contributing or running the examples online. + +[![Open in Gitpod](https://gitpod.io/button/open-in-gitpod.svg)](https://gitpod.io/#https://github.com/axios/axios/blob/master/examples/server.js) + + ## Resources * [Changelog](https://github.com/axios/axios/blob/master/CHANGELOG.md) @@ -702,7 +902,7 @@ axios.get('/user?ID=12345'); ## Credits -axios is heavily inspired by the [$http service](https://docs.angularjs.org/api/ng/service/$http) provided in [Angular](https://angularjs.org/). Ultimately axios is an effort to provide a standalone `$http`-like service for use outside of Angular. +axios is heavily inspired by the [$http service](https://docs.angularjs.org/api/ng/service/$http) provided in [AngularJS](https://angularjs.org/). Ultimately axios is an effort to provide a standalone `$http`-like service for use outside of AngularJS. ## License diff --git a/node_modules/axios/SECURITY.md b/node_modules/axios/SECURITY.md new file mode 100644 index 0000000..353df9a --- /dev/null +++ b/node_modules/axios/SECURITY.md @@ -0,0 +1,5 @@ +# Security Policy + +## Reporting a Vulnerability + +Please report security issues to jasonsaayman@gmail.com diff --git a/node_modules/axios/UPGRADE_GUIDE.md b/node_modules/axios/UPGRADE_GUIDE.md index eedb049..fdcff1a 100644 --- a/node_modules/axios/UPGRADE_GUIDE.md +++ b/node_modules/axios/UPGRADE_GUIDE.md @@ -1,5 +1,11 @@ # Upgrade Guide +### 0.18.x -> 0.19.0 + +#### HTTPS Proxies + +Routing through an https proxy now requires setting the `protocol` attribute of the proxy configuration to `https` + ### 0.15.x -> 0.16.0 #### `Promise` Type Declarations @@ -135,7 +141,7 @@ This will polyfill the global environment, and only needs to be done once. #### `axios.success`/`axios.error` -The `success`, and `error` aliases were deprectated in [0.4.0](https://github.com/axios/axios/blob/master/CHANGELOG.md#040-oct-03-2014). As of this release they have been removed entirely. Instead please use `axios.then`, and `axios.catch` respectively. +The `success`, and `error` aliases were deprecated in [0.4.0](https://github.com/axios/axios/blob/master/CHANGELOG.md#040-oct-03-2014). As of this release they have been removed entirely. Instead please use `axios.then`, and `axios.catch` respectively. ```js axios.get('some/url') diff --git a/node_modules/axios/dist/axios.js b/node_modules/axios/dist/axios.js index d9c0c71..e78f7ca 100644 --- a/node_modules/axios/dist/axios.js +++ b/node_modules/axios/dist/axios.js @@ -1,4 +1,3 @@ -/* axios v0.19.2 | (c) 2020 by Matt Zabriskie */ (function webpackUniversalModuleDefinition(root, factory) { if(typeof exports === 'object' && typeof module === 'object') module.exports = factory(); @@ -17,21 +16,21 @@ return /******/ (function(modules) { // webpackBootstrap /******/ function __webpack_require__(moduleId) { /******/ /******/ // Check if module is in cache -/******/ if(installedModules[moduleId]) +/******/ if(installedModules[moduleId]) { /******/ return installedModules[moduleId].exports; -/******/ +/******/ } /******/ // Create a new module (and put it into the cache) /******/ var module = installedModules[moduleId] = { -/******/ exports: {}, -/******/ id: moduleId, -/******/ loaded: false +/******/ i: moduleId, +/******/ l: false, +/******/ exports: {} /******/ }; /******/ /******/ // Execute the module function /******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__); /******/ /******/ // Flag the module as loaded -/******/ module.loaded = true; +/******/ module.l = true; /******/ /******/ // Return the exports of the module /******/ return module.exports; @@ -44,1672 +43,2251 @@ return /******/ (function(modules) { // webpackBootstrap /******/ // expose the module cache /******/ __webpack_require__.c = installedModules; /******/ +/******/ // define getter function for harmony exports +/******/ __webpack_require__.d = function(exports, name, getter) { +/******/ if(!__webpack_require__.o(exports, name)) { +/******/ Object.defineProperty(exports, name, { enumerable: true, get: getter }); +/******/ } +/******/ }; +/******/ +/******/ // define __esModule on exports +/******/ __webpack_require__.r = function(exports) { +/******/ if(typeof Symbol !== 'undefined' && Symbol.toStringTag) { +/******/ Object.defineProperty(exports, Symbol.toStringTag, { value: 'Module' }); +/******/ } +/******/ Object.defineProperty(exports, '__esModule', { value: true }); +/******/ }; +/******/ +/******/ // create a fake namespace object +/******/ // mode & 1: value is a module id, require it +/******/ // mode & 2: merge all properties of value into the ns +/******/ // mode & 4: return value when already ns object +/******/ // mode & 8|1: behave like require +/******/ __webpack_require__.t = function(value, mode) { +/******/ if(mode & 1) value = __webpack_require__(value); +/******/ if(mode & 8) return value; +/******/ if((mode & 4) && typeof value === 'object' && value && value.__esModule) return value; +/******/ var ns = Object.create(null); +/******/ __webpack_require__.r(ns); +/******/ Object.defineProperty(ns, 'default', { enumerable: true, value: value }); +/******/ if(mode & 2 && typeof value != 'string') for(var key in value) __webpack_require__.d(ns, key, function(key) { return value[key]; }.bind(null, key)); +/******/ return ns; +/******/ }; +/******/ +/******/ // getDefaultExport function for compatibility with non-harmony modules +/******/ __webpack_require__.n = function(module) { +/******/ var getter = module && module.__esModule ? +/******/ function getDefault() { return module['default']; } : +/******/ function getModuleExports() { return module; }; +/******/ __webpack_require__.d(getter, 'a', getter); +/******/ return getter; +/******/ }; +/******/ +/******/ // Object.prototype.hasOwnProperty.call +/******/ __webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); }; +/******/ /******/ // __webpack_public_path__ /******/ __webpack_require__.p = ""; /******/ +/******/ /******/ // Load entry module and return exports -/******/ return __webpack_require__(0); +/******/ return __webpack_require__(__webpack_require__.s = "./index.js"); /******/ }) /************************************************************************/ -/******/ ([ -/* 0 */ +/******/ ({ + +/***/ "./index.js": +/*!******************!*\ + !*** ./index.js ***! + \******************/ +/*! no static exports found */ /***/ (function(module, exports, __webpack_require__) { - module.exports = __webpack_require__(1); +module.exports = __webpack_require__(/*! ./lib/axios */ "./lib/axios.js"); /***/ }), -/* 1 */ + +/***/ "./lib/adapters/xhr.js": +/*!*****************************!*\ + !*** ./lib/adapters/xhr.js ***! + \*****************************/ +/*! no static exports found */ /***/ (function(module, exports, __webpack_require__) { - 'use strict'; - - var utils = __webpack_require__(2); - var bind = __webpack_require__(3); - var Axios = __webpack_require__(4); - var mergeConfig = __webpack_require__(22); - var defaults = __webpack_require__(10); - - /** - * Create an instance of Axios - * - * @param {Object} defaultConfig The default config for the instance - * @return {Axios} A new instance of Axios - */ - function createInstance(defaultConfig) { - var context = new Axios(defaultConfig); - var instance = bind(Axios.prototype.request, context); - - // Copy axios.prototype to instance - utils.extend(instance, Axios.prototype, context); - - // Copy context to instance - utils.extend(instance, context); - - return instance; - } - - // Create the default instance to be exported - var axios = createInstance(defaults); - - // Expose Axios class to allow class inheritance - axios.Axios = Axios; - - // Factory for creating new instances - axios.create = function create(instanceConfig) { - return createInstance(mergeConfig(axios.defaults, instanceConfig)); - }; - - // Expose Cancel & CancelToken - axios.Cancel = __webpack_require__(23); - axios.CancelToken = __webpack_require__(24); - axios.isCancel = __webpack_require__(9); - - // Expose all/spread - axios.all = function all(promises) { - return Promise.all(promises); - }; - axios.spread = __webpack_require__(25); - - module.exports = axios; - - // Allow use of default import syntax in TypeScript - module.exports.default = axios; +"use strict"; + + +var utils = __webpack_require__(/*! ./../utils */ "./lib/utils.js"); +var settle = __webpack_require__(/*! ./../core/settle */ "./lib/core/settle.js"); +var cookies = __webpack_require__(/*! ./../helpers/cookies */ "./lib/helpers/cookies.js"); +var buildURL = __webpack_require__(/*! ./../helpers/buildURL */ "./lib/helpers/buildURL.js"); +var buildFullPath = __webpack_require__(/*! ../core/buildFullPath */ "./lib/core/buildFullPath.js"); +var parseHeaders = __webpack_require__(/*! ./../helpers/parseHeaders */ "./lib/helpers/parseHeaders.js"); +var isURLSameOrigin = __webpack_require__(/*! ./../helpers/isURLSameOrigin */ "./lib/helpers/isURLSameOrigin.js"); +var createError = __webpack_require__(/*! ../core/createError */ "./lib/core/createError.js"); +var transitionalDefaults = __webpack_require__(/*! ../defaults/transitional */ "./lib/defaults/transitional.js"); +var Cancel = __webpack_require__(/*! ../cancel/Cancel */ "./lib/cancel/Cancel.js"); + +module.exports = function xhrAdapter(config) { + return new Promise(function dispatchXhrRequest(resolve, reject) { + var requestData = config.data; + var requestHeaders = config.headers; + var responseType = config.responseType; + var onCanceled; + function done() { + if (config.cancelToken) { + config.cancelToken.unsubscribe(onCanceled); + } + + if (config.signal) { + config.signal.removeEventListener('abort', onCanceled); + } + } + + if (utils.isFormData(requestData)) { + delete requestHeaders['Content-Type']; // Let the browser set it + } + + var request = new XMLHttpRequest(); + + // HTTP basic authentication + if (config.auth) { + var username = config.auth.username || ''; + var password = config.auth.password ? unescape(encodeURIComponent(config.auth.password)) : ''; + requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password); + } + + var fullPath = buildFullPath(config.baseURL, config.url); + request.open(config.method.toUpperCase(), buildURL(fullPath, config.params, config.paramsSerializer), true); + + // Set the request timeout in MS + request.timeout = config.timeout; + + function onloadend() { + if (!request) { + return; + } + // Prepare the response + var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null; + var responseData = !responseType || responseType === 'text' || responseType === 'json' ? + request.responseText : request.response; + var response = { + data: responseData, + status: request.status, + statusText: request.statusText, + headers: responseHeaders, + config: config, + request: request + }; + + settle(function _resolve(value) { + resolve(value); + done(); + }, function _reject(err) { + reject(err); + done(); + }, response); + + // Clean up request + request = null; + } + + if ('onloadend' in request) { + // Use onloadend if available + request.onloadend = onloadend; + } else { + // Listen for ready state to emulate onloadend + request.onreadystatechange = function handleLoad() { + if (!request || request.readyState !== 4) { + return; + } + + // The request errored out and we didn't get a response, this will be + // handled by onerror instead + // With one exception: request that using file: protocol, most browsers + // will return status as 0 even though it's a successful request + if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) { + return; + } + // readystate handler is calling before onerror or ontimeout handlers, + // so we should call onloadend on the next 'tick' + setTimeout(onloadend); + }; + } + + // Handle browser request cancellation (as opposed to a manual cancellation) + request.onabort = function handleAbort() { + if (!request) { + return; + } + + reject(createError('Request aborted', config, 'ECONNABORTED', request)); + + // Clean up request + request = null; + }; + + // Handle low level network errors + request.onerror = function handleError() { + // Real errors are hidden from us by the browser + // onerror should only fire if it's a network error + reject(createError('Network Error', config, null, request)); + + // Clean up request + request = null; + }; + + // Handle timeout + request.ontimeout = function handleTimeout() { + var timeoutErrorMessage = config.timeout ? 'timeout of ' + config.timeout + 'ms exceeded' : 'timeout exceeded'; + var transitional = config.transitional || transitionalDefaults; + if (config.timeoutErrorMessage) { + timeoutErrorMessage = config.timeoutErrorMessage; + } + reject(createError( + timeoutErrorMessage, + config, + transitional.clarifyTimeoutError ? 'ETIMEDOUT' : 'ECONNABORTED', + request)); + + // Clean up request + request = null; + }; + + // Add xsrf header + // This is only done if running in a standard browser environment. + // Specifically not if we're in a web worker, or react-native. + if (utils.isStandardBrowserEnv()) { + // Add xsrf header + var xsrfValue = (config.withCredentials || isURLSameOrigin(fullPath)) && config.xsrfCookieName ? + cookies.read(config.xsrfCookieName) : + undefined; + + if (xsrfValue) { + requestHeaders[config.xsrfHeaderName] = xsrfValue; + } + } + + // Add headers to the request + if ('setRequestHeader' in request) { + utils.forEach(requestHeaders, function setRequestHeader(val, key) { + if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') { + // Remove Content-Type if data is undefined + delete requestHeaders[key]; + } else { + // Otherwise add header to the request + request.setRequestHeader(key, val); + } + }); + } + + // Add withCredentials to request if needed + if (!utils.isUndefined(config.withCredentials)) { + request.withCredentials = !!config.withCredentials; + } + + // Add responseType to request if needed + if (responseType && responseType !== 'json') { + request.responseType = config.responseType; + } + + // Handle progress if needed + if (typeof config.onDownloadProgress === 'function') { + request.addEventListener('progress', config.onDownloadProgress); + } + + // Not all browsers support upload events + if (typeof config.onUploadProgress === 'function' && request.upload) { + request.upload.addEventListener('progress', config.onUploadProgress); + } + + if (config.cancelToken || config.signal) { + // Handle cancellation + // eslint-disable-next-line func-names + onCanceled = function(cancel) { + if (!request) { + return; + } + reject(!cancel || (cancel && cancel.type) ? new Cancel('canceled') : cancel); + request.abort(); + request = null; + }; + + config.cancelToken && config.cancelToken.subscribe(onCanceled); + if (config.signal) { + config.signal.aborted ? onCanceled() : config.signal.addEventListener('abort', onCanceled); + } + } + + if (!requestData) { + requestData = null; + } + + // Send the request + request.send(requestData); + }); +}; /***/ }), -/* 2 */ + +/***/ "./lib/axios.js": +/*!**********************!*\ + !*** ./lib/axios.js ***! + \**********************/ +/*! no static exports found */ /***/ (function(module, exports, __webpack_require__) { - 'use strict'; - - var bind = __webpack_require__(3); - - /*global toString:true*/ - - // utils is a library of generic helper functions non-specific to axios - - var toString = Object.prototype.toString; - - /** - * Determine if a value is an Array - * - * @param {Object} val The value to test - * @returns {boolean} True if value is an Array, otherwise false - */ - function isArray(val) { - return toString.call(val) === '[object Array]'; - } - - /** - * Determine if a value is undefined - * - * @param {Object} val The value to test - * @returns {boolean} True if the value is undefined, otherwise false - */ - function isUndefined(val) { - return typeof val === 'undefined'; - } - - /** - * Determine if a value is a Buffer - * - * @param {Object} val The value to test - * @returns {boolean} True if value is a Buffer, otherwise false - */ - function isBuffer(val) { - return val !== null && !isUndefined(val) && val.constructor !== null && !isUndefined(val.constructor) - && typeof val.constructor.isBuffer === 'function' && val.constructor.isBuffer(val); - } - - /** - * Determine if a value is an ArrayBuffer - * - * @param {Object} val The value to test - * @returns {boolean} True if value is an ArrayBuffer, otherwise false - */ - function isArrayBuffer(val) { - return toString.call(val) === '[object ArrayBuffer]'; - } - - /** - * Determine if a value is a FormData - * - * @param {Object} val The value to test - * @returns {boolean} True if value is an FormData, otherwise false - */ - function isFormData(val) { - return (typeof FormData !== 'undefined') && (val instanceof FormData); - } - - /** - * Determine if a value is a view on an ArrayBuffer - * - * @param {Object} val The value to test - * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false - */ - function isArrayBufferView(val) { - var result; - if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) { - result = ArrayBuffer.isView(val); - } else { - result = (val) && (val.buffer) && (val.buffer instanceof ArrayBuffer); - } - return result; - } - - /** - * Determine if a value is a String - * - * @param {Object} val The value to test - * @returns {boolean} True if value is a String, otherwise false - */ - function isString(val) { - return typeof val === 'string'; - } - - /** - * Determine if a value is a Number - * - * @param {Object} val The value to test - * @returns {boolean} True if value is a Number, otherwise false - */ - function isNumber(val) { - return typeof val === 'number'; - } - - /** - * Determine if a value is an Object - * - * @param {Object} val The value to test - * @returns {boolean} True if value is an Object, otherwise false - */ - function isObject(val) { - return val !== null && typeof val === 'object'; - } - - /** - * Determine if a value is a Date - * - * @param {Object} val The value to test - * @returns {boolean} True if value is a Date, otherwise false - */ - function isDate(val) { - return toString.call(val) === '[object Date]'; - } - - /** - * Determine if a value is a File - * - * @param {Object} val The value to test - * @returns {boolean} True if value is a File, otherwise false - */ - function isFile(val) { - return toString.call(val) === '[object File]'; - } - - /** - * Determine if a value is a Blob - * - * @param {Object} val The value to test - * @returns {boolean} True if value is a Blob, otherwise false - */ - function isBlob(val) { - return toString.call(val) === '[object Blob]'; - } - - /** - * Determine if a value is a Function - * - * @param {Object} val The value to test - * @returns {boolean} True if value is a Function, otherwise false - */ - function isFunction(val) { - return toString.call(val) === '[object Function]'; - } - - /** - * Determine if a value is a Stream - * - * @param {Object} val The value to test - * @returns {boolean} True if value is a Stream, otherwise false - */ - function isStream(val) { - return isObject(val) && isFunction(val.pipe); - } - - /** - * Determine if a value is a URLSearchParams object - * - * @param {Object} val The value to test - * @returns {boolean} True if value is a URLSearchParams object, otherwise false - */ - function isURLSearchParams(val) { - return typeof URLSearchParams !== 'undefined' && val instanceof URLSearchParams; - } - - /** - * Trim excess whitespace off the beginning and end of a string - * - * @param {String} str The String to trim - * @returns {String} The String freed of excess whitespace - */ - function trim(str) { - return str.replace(/^\s*/, '').replace(/\s*$/, ''); - } - - /** - * Determine if we're running in a standard browser environment - * - * This allows axios to run in a web worker, and react-native. - * Both environments support XMLHttpRequest, but not fully standard globals. - * - * web workers: - * typeof window -> undefined - * typeof document -> undefined - * - * react-native: - * navigator.product -> 'ReactNative' - * nativescript - * navigator.product -> 'NativeScript' or 'NS' - */ - function isStandardBrowserEnv() { - if (typeof navigator !== 'undefined' && (navigator.product === 'ReactNative' || - navigator.product === 'NativeScript' || - navigator.product === 'NS')) { - return false; - } - return ( - typeof window !== 'undefined' && - typeof document !== 'undefined' - ); - } - - /** - * Iterate over an Array or an Object invoking a function for each item. - * - * If `obj` is an Array callback will be called passing - * the value, index, and complete array for each item. - * - * If 'obj' is an Object callback will be called passing - * the value, key, and complete object for each property. - * - * @param {Object|Array} obj The object to iterate - * @param {Function} fn The callback to invoke for each item - */ - function forEach(obj, fn) { - // Don't bother if no value provided - if (obj === null || typeof obj === 'undefined') { - return; - } - - // Force an array if not already something iterable - if (typeof obj !== 'object') { - /*eslint no-param-reassign:0*/ - obj = [obj]; - } - - if (isArray(obj)) { - // Iterate over array values - for (var i = 0, l = obj.length; i < l; i++) { - fn.call(null, obj[i], i, obj); - } - } else { - // Iterate over object keys - for (var key in obj) { - if (Object.prototype.hasOwnProperty.call(obj, key)) { - fn.call(null, obj[key], key, obj); - } - } - } - } - - /** - * Accepts varargs expecting each argument to be an object, then - * immutably merges the properties of each object and returns result. - * - * When multiple objects contain the same key the later object in - * the arguments list will take precedence. - * - * Example: - * - * ```js - * var result = merge({foo: 123}, {foo: 456}); - * console.log(result.foo); // outputs 456 - * ``` - * - * @param {Object} obj1 Object to merge - * @returns {Object} Result of all merge properties - */ - function merge(/* obj1, obj2, obj3, ... */) { - var result = {}; - function assignValue(val, key) { - if (typeof result[key] === 'object' && typeof val === 'object') { - result[key] = merge(result[key], val); - } else { - result[key] = val; - } - } - - for (var i = 0, l = arguments.length; i < l; i++) { - forEach(arguments[i], assignValue); - } - return result; - } - - /** - * Function equal to merge with the difference being that no reference - * to original objects is kept. - * - * @see merge - * @param {Object} obj1 Object to merge - * @returns {Object} Result of all merge properties - */ - function deepMerge(/* obj1, obj2, obj3, ... */) { - var result = {}; - function assignValue(val, key) { - if (typeof result[key] === 'object' && typeof val === 'object') { - result[key] = deepMerge(result[key], val); - } else if (typeof val === 'object') { - result[key] = deepMerge({}, val); - } else { - result[key] = val; - } - } - - for (var i = 0, l = arguments.length; i < l; i++) { - forEach(arguments[i], assignValue); - } - return result; - } - - /** - * Extends object a by mutably adding to it the properties of object b. - * - * @param {Object} a The object to be extended - * @param {Object} b The object to copy properties from - * @param {Object} thisArg The object to bind function to - * @return {Object} The resulting value of object a - */ - function extend(a, b, thisArg) { - forEach(b, function assignValue(val, key) { - if (thisArg && typeof val === 'function') { - a[key] = bind(val, thisArg); - } else { - a[key] = val; - } - }); - return a; - } - - module.exports = { - isArray: isArray, - isArrayBuffer: isArrayBuffer, - isBuffer: isBuffer, - isFormData: isFormData, - isArrayBufferView: isArrayBufferView, - isString: isString, - isNumber: isNumber, - isObject: isObject, - isUndefined: isUndefined, - isDate: isDate, - isFile: isFile, - isBlob: isBlob, - isFunction: isFunction, - isStream: isStream, - isURLSearchParams: isURLSearchParams, - isStandardBrowserEnv: isStandardBrowserEnv, - forEach: forEach, - merge: merge, - deepMerge: deepMerge, - extend: extend, - trim: trim - }; +"use strict"; + + +var utils = __webpack_require__(/*! ./utils */ "./lib/utils.js"); +var bind = __webpack_require__(/*! ./helpers/bind */ "./lib/helpers/bind.js"); +var Axios = __webpack_require__(/*! ./core/Axios */ "./lib/core/Axios.js"); +var mergeConfig = __webpack_require__(/*! ./core/mergeConfig */ "./lib/core/mergeConfig.js"); +var defaults = __webpack_require__(/*! ./defaults */ "./lib/defaults/index.js"); + +/** + * Create an instance of Axios + * + * @param {Object} defaultConfig The default config for the instance + * @return {Axios} A new instance of Axios + */ +function createInstance(defaultConfig) { + var context = new Axios(defaultConfig); + var instance = bind(Axios.prototype.request, context); + + // Copy axios.prototype to instance + utils.extend(instance, Axios.prototype, context); + + // Copy context to instance + utils.extend(instance, context); + + // Factory for creating new instances + instance.create = function create(instanceConfig) { + return createInstance(mergeConfig(defaultConfig, instanceConfig)); + }; + + return instance; +} + +// Create the default instance to be exported +var axios = createInstance(defaults); + +// Expose Axios class to allow class inheritance +axios.Axios = Axios; + +// Expose Cancel & CancelToken +axios.Cancel = __webpack_require__(/*! ./cancel/Cancel */ "./lib/cancel/Cancel.js"); +axios.CancelToken = __webpack_require__(/*! ./cancel/CancelToken */ "./lib/cancel/CancelToken.js"); +axios.isCancel = __webpack_require__(/*! ./cancel/isCancel */ "./lib/cancel/isCancel.js"); +axios.VERSION = __webpack_require__(/*! ./env/data */ "./lib/env/data.js").version; + +// Expose all/spread +axios.all = function all(promises) { + return Promise.all(promises); +}; +axios.spread = __webpack_require__(/*! ./helpers/spread */ "./lib/helpers/spread.js"); + +// Expose isAxiosError +axios.isAxiosError = __webpack_require__(/*! ./helpers/isAxiosError */ "./lib/helpers/isAxiosError.js"); + +module.exports = axios; + +// Allow use of default import syntax in TypeScript +module.exports.default = axios; /***/ }), -/* 3 */ + +/***/ "./lib/cancel/Cancel.js": +/*!******************************!*\ + !*** ./lib/cancel/Cancel.js ***! + \******************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +/** + * A `Cancel` is an object that is thrown when an operation is canceled. + * + * @class + * @param {string=} message The message. + */ +function Cancel(message) { + this.message = message; +} + +Cancel.prototype.toString = function toString() { + return 'Cancel' + (this.message ? ': ' + this.message : ''); +}; + +Cancel.prototype.__CANCEL__ = true; + +module.exports = Cancel; + + +/***/ }), + +/***/ "./lib/cancel/CancelToken.js": +/*!***********************************!*\ + !*** ./lib/cancel/CancelToken.js ***! + \***********************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var Cancel = __webpack_require__(/*! ./Cancel */ "./lib/cancel/Cancel.js"); + +/** + * A `CancelToken` is an object that can be used to request cancellation of an operation. + * + * @class + * @param {Function} executor The executor function. + */ +function CancelToken(executor) { + if (typeof executor !== 'function') { + throw new TypeError('executor must be a function.'); + } + + var resolvePromise; + + this.promise = new Promise(function promiseExecutor(resolve) { + resolvePromise = resolve; + }); + + var token = this; + + // eslint-disable-next-line func-names + this.promise.then(function(cancel) { + if (!token._listeners) return; + + var i; + var l = token._listeners.length; + + for (i = 0; i < l; i++) { + token._listeners[i](cancel); + } + token._listeners = null; + }); + + // eslint-disable-next-line func-names + this.promise.then = function(onfulfilled) { + var _resolve; + // eslint-disable-next-line func-names + var promise = new Promise(function(resolve) { + token.subscribe(resolve); + _resolve = resolve; + }).then(onfulfilled); + + promise.cancel = function reject() { + token.unsubscribe(_resolve); + }; + + return promise; + }; + + executor(function cancel(message) { + if (token.reason) { + // Cancellation has already been requested + return; + } + + token.reason = new Cancel(message); + resolvePromise(token.reason); + }); +} + +/** + * Throws a `Cancel` if cancellation has been requested. + */ +CancelToken.prototype.throwIfRequested = function throwIfRequested() { + if (this.reason) { + throw this.reason; + } +}; + +/** + * Subscribe to the cancel signal + */ + +CancelToken.prototype.subscribe = function subscribe(listener) { + if (this.reason) { + listener(this.reason); + return; + } + + if (this._listeners) { + this._listeners.push(listener); + } else { + this._listeners = [listener]; + } +}; + +/** + * Unsubscribe from the cancel signal + */ + +CancelToken.prototype.unsubscribe = function unsubscribe(listener) { + if (!this._listeners) { + return; + } + var index = this._listeners.indexOf(listener); + if (index !== -1) { + this._listeners.splice(index, 1); + } +}; + +/** + * Returns an object that contains a new `CancelToken` and a function that, when called, + * cancels the `CancelToken`. + */ +CancelToken.source = function source() { + var cancel; + var token = new CancelToken(function executor(c) { + cancel = c; + }); + return { + token: token, + cancel: cancel + }; +}; + +module.exports = CancelToken; + + +/***/ }), + +/***/ "./lib/cancel/isCancel.js": +/*!********************************!*\ + !*** ./lib/cancel/isCancel.js ***! + \********************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +module.exports = function isCancel(value) { + return !!(value && value.__CANCEL__); +}; + + +/***/ }), + +/***/ "./lib/core/Axios.js": +/*!***************************!*\ + !*** ./lib/core/Axios.js ***! + \***************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var utils = __webpack_require__(/*! ./../utils */ "./lib/utils.js"); +var buildURL = __webpack_require__(/*! ../helpers/buildURL */ "./lib/helpers/buildURL.js"); +var InterceptorManager = __webpack_require__(/*! ./InterceptorManager */ "./lib/core/InterceptorManager.js"); +var dispatchRequest = __webpack_require__(/*! ./dispatchRequest */ "./lib/core/dispatchRequest.js"); +var mergeConfig = __webpack_require__(/*! ./mergeConfig */ "./lib/core/mergeConfig.js"); +var validator = __webpack_require__(/*! ../helpers/validator */ "./lib/helpers/validator.js"); + +var validators = validator.validators; +/** + * Create a new instance of Axios + * + * @param {Object} instanceConfig The default config for the instance + */ +function Axios(instanceConfig) { + this.defaults = instanceConfig; + this.interceptors = { + request: new InterceptorManager(), + response: new InterceptorManager() + }; +} + +/** + * Dispatch a request + * + * @param {Object} config The config specific for this request (merged with this.defaults) + */ +Axios.prototype.request = function request(configOrUrl, config) { + /*eslint no-param-reassign:0*/ + // Allow for axios('example/url'[, config]) a la fetch API + if (typeof configOrUrl === 'string') { + config = config || {}; + config.url = configOrUrl; + } else { + config = configOrUrl || {}; + } + + config = mergeConfig(this.defaults, config); + + // Set config.method + if (config.method) { + config.method = config.method.toLowerCase(); + } else if (this.defaults.method) { + config.method = this.defaults.method.toLowerCase(); + } else { + config.method = 'get'; + } + + var transitional = config.transitional; + + if (transitional !== undefined) { + validator.assertOptions(transitional, { + silentJSONParsing: validators.transitional(validators.boolean), + forcedJSONParsing: validators.transitional(validators.boolean), + clarifyTimeoutError: validators.transitional(validators.boolean) + }, false); + } + + // filter out skipped interceptors + var requestInterceptorChain = []; + var synchronousRequestInterceptors = true; + this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) { + if (typeof interceptor.runWhen === 'function' && interceptor.runWhen(config) === false) { + return; + } + + synchronousRequestInterceptors = synchronousRequestInterceptors && interceptor.synchronous; + + requestInterceptorChain.unshift(interceptor.fulfilled, interceptor.rejected); + }); + + var responseInterceptorChain = []; + this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) { + responseInterceptorChain.push(interceptor.fulfilled, interceptor.rejected); + }); + + var promise; + + if (!synchronousRequestInterceptors) { + var chain = [dispatchRequest, undefined]; + + Array.prototype.unshift.apply(chain, requestInterceptorChain); + chain = chain.concat(responseInterceptorChain); + + promise = Promise.resolve(config); + while (chain.length) { + promise = promise.then(chain.shift(), chain.shift()); + } + + return promise; + } + + + var newConfig = config; + while (requestInterceptorChain.length) { + var onFulfilled = requestInterceptorChain.shift(); + var onRejected = requestInterceptorChain.shift(); + try { + newConfig = onFulfilled(newConfig); + } catch (error) { + onRejected(error); + break; + } + } + + try { + promise = dispatchRequest(newConfig); + } catch (error) { + return Promise.reject(error); + } + + while (responseInterceptorChain.length) { + promise = promise.then(responseInterceptorChain.shift(), responseInterceptorChain.shift()); + } + + return promise; +}; + +Axios.prototype.getUri = function getUri(config) { + config = mergeConfig(this.defaults, config); + return buildURL(config.url, config.params, config.paramsSerializer).replace(/^\?/, ''); +}; + +// Provide aliases for supported request methods +utils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) { + /*eslint func-names:0*/ + Axios.prototype[method] = function(url, config) { + return this.request(mergeConfig(config || {}, { + method: method, + url: url, + data: (config || {}).data + })); + }; +}); + +utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) { + /*eslint func-names:0*/ + Axios.prototype[method] = function(url, data, config) { + return this.request(mergeConfig(config || {}, { + method: method, + url: url, + data: data + })); + }; +}); + +module.exports = Axios; + + +/***/ }), + +/***/ "./lib/core/InterceptorManager.js": +/*!****************************************!*\ + !*** ./lib/core/InterceptorManager.js ***! + \****************************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var utils = __webpack_require__(/*! ./../utils */ "./lib/utils.js"); + +function InterceptorManager() { + this.handlers = []; +} + +/** + * Add a new interceptor to the stack + * + * @param {Function} fulfilled The function to handle `then` for a `Promise` + * @param {Function} rejected The function to handle `reject` for a `Promise` + * + * @return {Number} An ID used to remove interceptor later + */ +InterceptorManager.prototype.use = function use(fulfilled, rejected, options) { + this.handlers.push({ + fulfilled: fulfilled, + rejected: rejected, + synchronous: options ? options.synchronous : false, + runWhen: options ? options.runWhen : null + }); + return this.handlers.length - 1; +}; + +/** + * Remove an interceptor from the stack + * + * @param {Number} id The ID that was returned by `use` + */ +InterceptorManager.prototype.eject = function eject(id) { + if (this.handlers[id]) { + this.handlers[id] = null; + } +}; + +/** + * Iterate over all the registered interceptors + * + * This method is particularly useful for skipping over any + * interceptors that may have become `null` calling `eject`. + * + * @param {Function} fn The function to call for each interceptor + */ +InterceptorManager.prototype.forEach = function forEach(fn) { + utils.forEach(this.handlers, function forEachHandler(h) { + if (h !== null) { + fn(h); + } + }); +}; + +module.exports = InterceptorManager; + + +/***/ }), + +/***/ "./lib/core/buildFullPath.js": +/*!***********************************!*\ + !*** ./lib/core/buildFullPath.js ***! + \***********************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var isAbsoluteURL = __webpack_require__(/*! ../helpers/isAbsoluteURL */ "./lib/helpers/isAbsoluteURL.js"); +var combineURLs = __webpack_require__(/*! ../helpers/combineURLs */ "./lib/helpers/combineURLs.js"); + +/** + * Creates a new URL by combining the baseURL with the requestedURL, + * only when the requestedURL is not already an absolute URL. + * If the requestURL is absolute, this function returns the requestedURL untouched. + * + * @param {string} baseURL The base URL + * @param {string} requestedURL Absolute or relative URL to combine + * @returns {string} The combined full path + */ +module.exports = function buildFullPath(baseURL, requestedURL) { + if (baseURL && !isAbsoluteURL(requestedURL)) { + return combineURLs(baseURL, requestedURL); + } + return requestedURL; +}; + + +/***/ }), + +/***/ "./lib/core/createError.js": +/*!*********************************!*\ + !*** ./lib/core/createError.js ***! + \*********************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var enhanceError = __webpack_require__(/*! ./enhanceError */ "./lib/core/enhanceError.js"); + +/** + * Create an Error with the specified message, config, error code, request and response. + * + * @param {string} message The error message. + * @param {Object} config The config. + * @param {string} [code] The error code (for example, 'ECONNABORTED'). + * @param {Object} [request] The request. + * @param {Object} [response] The response. + * @returns {Error} The created error. + */ +module.exports = function createError(message, config, code, request, response) { + var error = new Error(message); + return enhanceError(error, config, code, request, response); +}; + + +/***/ }), + +/***/ "./lib/core/dispatchRequest.js": +/*!*************************************!*\ + !*** ./lib/core/dispatchRequest.js ***! + \*************************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var utils = __webpack_require__(/*! ./../utils */ "./lib/utils.js"); +var transformData = __webpack_require__(/*! ./transformData */ "./lib/core/transformData.js"); +var isCancel = __webpack_require__(/*! ../cancel/isCancel */ "./lib/cancel/isCancel.js"); +var defaults = __webpack_require__(/*! ../defaults */ "./lib/defaults/index.js"); +var Cancel = __webpack_require__(/*! ../cancel/Cancel */ "./lib/cancel/Cancel.js"); + +/** + * Throws a `Cancel` if cancellation has been requested. + */ +function throwIfCancellationRequested(config) { + if (config.cancelToken) { + config.cancelToken.throwIfRequested(); + } + + if (config.signal && config.signal.aborted) { + throw new Cancel('canceled'); + } +} + +/** + * Dispatch a request to the server using the configured adapter. + * + * @param {object} config The config that is to be used for the request + * @returns {Promise} The Promise to be fulfilled + */ +module.exports = function dispatchRequest(config) { + throwIfCancellationRequested(config); + + // Ensure headers exist + config.headers = config.headers || {}; + + // Transform request data + config.data = transformData.call( + config, + config.data, + config.headers, + config.transformRequest + ); + + // Flatten headers + config.headers = utils.merge( + config.headers.common || {}, + config.headers[config.method] || {}, + config.headers + ); + + utils.forEach( + ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'], + function cleanHeaderConfig(method) { + delete config.headers[method]; + } + ); + + var adapter = config.adapter || defaults.adapter; + + return adapter(config).then(function onAdapterResolution(response) { + throwIfCancellationRequested(config); + + // Transform response data + response.data = transformData.call( + config, + response.data, + response.headers, + config.transformResponse + ); + + return response; + }, function onAdapterRejection(reason) { + if (!isCancel(reason)) { + throwIfCancellationRequested(config); + + // Transform response data + if (reason && reason.response) { + reason.response.data = transformData.call( + config, + reason.response.data, + reason.response.headers, + config.transformResponse + ); + } + } + + return Promise.reject(reason); + }); +}; + + +/***/ }), + +/***/ "./lib/core/enhanceError.js": +/*!**********************************!*\ + !*** ./lib/core/enhanceError.js ***! + \**********************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +/** + * Update an Error with the specified config, error code, and response. + * + * @param {Error} error The error to update. + * @param {Object} config The config. + * @param {string} [code] The error code (for example, 'ECONNABORTED'). + * @param {Object} [request] The request. + * @param {Object} [response] The response. + * @returns {Error} The error. + */ +module.exports = function enhanceError(error, config, code, request, response) { + error.config = config; + if (code) { + error.code = code; + } + + error.request = request; + error.response = response; + error.isAxiosError = true; + + error.toJSON = function toJSON() { + return { + // Standard + message: this.message, + name: this.name, + // Microsoft + description: this.description, + number: this.number, + // Mozilla + fileName: this.fileName, + lineNumber: this.lineNumber, + columnNumber: this.columnNumber, + stack: this.stack, + // Axios + config: this.config, + code: this.code, + status: this.response && this.response.status ? this.response.status : null + }; + }; + return error; +}; + + +/***/ }), + +/***/ "./lib/core/mergeConfig.js": +/*!*********************************!*\ + !*** ./lib/core/mergeConfig.js ***! + \*********************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var utils = __webpack_require__(/*! ../utils */ "./lib/utils.js"); + +/** + * Config-specific merge-function which creates a new config-object + * by merging two configuration objects together. + * + * @param {Object} config1 + * @param {Object} config2 + * @returns {Object} New object resulting from merging config2 to config1 + */ +module.exports = function mergeConfig(config1, config2) { + // eslint-disable-next-line no-param-reassign + config2 = config2 || {}; + var config = {}; + + function getMergedValue(target, source) { + if (utils.isPlainObject(target) && utils.isPlainObject(source)) { + return utils.merge(target, source); + } else if (utils.isPlainObject(source)) { + return utils.merge({}, source); + } else if (utils.isArray(source)) { + return source.slice(); + } + return source; + } + + // eslint-disable-next-line consistent-return + function mergeDeepProperties(prop) { + if (!utils.isUndefined(config2[prop])) { + return getMergedValue(config1[prop], config2[prop]); + } else if (!utils.isUndefined(config1[prop])) { + return getMergedValue(undefined, config1[prop]); + } + } + + // eslint-disable-next-line consistent-return + function valueFromConfig2(prop) { + if (!utils.isUndefined(config2[prop])) { + return getMergedValue(undefined, config2[prop]); + } + } + + // eslint-disable-next-line consistent-return + function defaultToConfig2(prop) { + if (!utils.isUndefined(config2[prop])) { + return getMergedValue(undefined, config2[prop]); + } else if (!utils.isUndefined(config1[prop])) { + return getMergedValue(undefined, config1[prop]); + } + } + + // eslint-disable-next-line consistent-return + function mergeDirectKeys(prop) { + if (prop in config2) { + return getMergedValue(config1[prop], config2[prop]); + } else if (prop in config1) { + return getMergedValue(undefined, config1[prop]); + } + } + + var mergeMap = { + 'url': valueFromConfig2, + 'method': valueFromConfig2, + 'data': valueFromConfig2, + 'baseURL': defaultToConfig2, + 'transformRequest': defaultToConfig2, + 'transformResponse': defaultToConfig2, + 'paramsSerializer': defaultToConfig2, + 'timeout': defaultToConfig2, + 'timeoutMessage': defaultToConfig2, + 'withCredentials': defaultToConfig2, + 'adapter': defaultToConfig2, + 'responseType': defaultToConfig2, + 'xsrfCookieName': defaultToConfig2, + 'xsrfHeaderName': defaultToConfig2, + 'onUploadProgress': defaultToConfig2, + 'onDownloadProgress': defaultToConfig2, + 'decompress': defaultToConfig2, + 'maxContentLength': defaultToConfig2, + 'maxBodyLength': defaultToConfig2, + 'transport': defaultToConfig2, + 'httpAgent': defaultToConfig2, + 'httpsAgent': defaultToConfig2, + 'cancelToken': defaultToConfig2, + 'socketPath': defaultToConfig2, + 'responseEncoding': defaultToConfig2, + 'validateStatus': mergeDirectKeys + }; + + utils.forEach(Object.keys(config1).concat(Object.keys(config2)), function computeConfigValue(prop) { + var merge = mergeMap[prop] || mergeDeepProperties; + var configValue = merge(prop); + (utils.isUndefined(configValue) && merge !== mergeDirectKeys) || (config[prop] = configValue); + }); + + return config; +}; + + +/***/ }), + +/***/ "./lib/core/settle.js": +/*!****************************!*\ + !*** ./lib/core/settle.js ***! + \****************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var createError = __webpack_require__(/*! ./createError */ "./lib/core/createError.js"); + +/** + * Resolve or reject a Promise based on response status. + * + * @param {Function} resolve A function that resolves the promise. + * @param {Function} reject A function that rejects the promise. + * @param {object} response The response. + */ +module.exports = function settle(resolve, reject, response) { + var validateStatus = response.config.validateStatus; + if (!response.status || !validateStatus || validateStatus(response.status)) { + resolve(response); + } else { + reject(createError( + 'Request failed with status code ' + response.status, + response.config, + null, + response.request, + response + )); + } +}; + + +/***/ }), + +/***/ "./lib/core/transformData.js": +/*!***********************************!*\ + !*** ./lib/core/transformData.js ***! + \***********************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var utils = __webpack_require__(/*! ./../utils */ "./lib/utils.js"); +var defaults = __webpack_require__(/*! ../defaults */ "./lib/defaults/index.js"); + +/** + * Transform the data for a request or a response + * + * @param {Object|String} data The data to be transformed + * @param {Array} headers The headers for the request or response + * @param {Array|Function} fns A single function or Array of functions + * @returns {*} The resulting transformed data + */ +module.exports = function transformData(data, headers, fns) { + var context = this || defaults; + /*eslint no-param-reassign:0*/ + utils.forEach(fns, function transform(fn) { + data = fn.call(context, data, headers); + }); + + return data; +}; + + +/***/ }), + +/***/ "./lib/defaults/index.js": +/*!*******************************!*\ + !*** ./lib/defaults/index.js ***! + \*******************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var utils = __webpack_require__(/*! ../utils */ "./lib/utils.js"); +var normalizeHeaderName = __webpack_require__(/*! ../helpers/normalizeHeaderName */ "./lib/helpers/normalizeHeaderName.js"); +var enhanceError = __webpack_require__(/*! ../core/enhanceError */ "./lib/core/enhanceError.js"); +var transitionalDefaults = __webpack_require__(/*! ./transitional */ "./lib/defaults/transitional.js"); + +var DEFAULT_CONTENT_TYPE = { + 'Content-Type': 'application/x-www-form-urlencoded' +}; + +function setContentTypeIfUnset(headers, value) { + if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) { + headers['Content-Type'] = value; + } +} + +function getDefaultAdapter() { + var adapter; + if (typeof XMLHttpRequest !== 'undefined') { + // For browsers use XHR adapter + adapter = __webpack_require__(/*! ../adapters/xhr */ "./lib/adapters/xhr.js"); + } else if (typeof process !== 'undefined' && Object.prototype.toString.call(process) === '[object process]') { + // For node use HTTP adapter + adapter = __webpack_require__(/*! ../adapters/http */ "./lib/adapters/xhr.js"); + } + return adapter; +} + +function stringifySafely(rawValue, parser, encoder) { + if (utils.isString(rawValue)) { + try { + (parser || JSON.parse)(rawValue); + return utils.trim(rawValue); + } catch (e) { + if (e.name !== 'SyntaxError') { + throw e; + } + } + } + + return (encoder || JSON.stringify)(rawValue); +} + +var defaults = { + + transitional: transitionalDefaults, + + adapter: getDefaultAdapter(), + + transformRequest: [function transformRequest(data, headers) { + normalizeHeaderName(headers, 'Accept'); + normalizeHeaderName(headers, 'Content-Type'); + + if (utils.isFormData(data) || + utils.isArrayBuffer(data) || + utils.isBuffer(data) || + utils.isStream(data) || + utils.isFile(data) || + utils.isBlob(data) + ) { + return data; + } + if (utils.isArrayBufferView(data)) { + return data.buffer; + } + if (utils.isURLSearchParams(data)) { + setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8'); + return data.toString(); + } + if (utils.isObject(data) || (headers && headers['Content-Type'] === 'application/json')) { + setContentTypeIfUnset(headers, 'application/json'); + return stringifySafely(data); + } + return data; + }], + + transformResponse: [function transformResponse(data) { + var transitional = this.transitional || defaults.transitional; + var silentJSONParsing = transitional && transitional.silentJSONParsing; + var forcedJSONParsing = transitional && transitional.forcedJSONParsing; + var strictJSONParsing = !silentJSONParsing && this.responseType === 'json'; + + if (strictJSONParsing || (forcedJSONParsing && utils.isString(data) && data.length)) { + try { + return JSON.parse(data); + } catch (e) { + if (strictJSONParsing) { + if (e.name === 'SyntaxError') { + throw enhanceError(e, this, 'E_JSON_PARSE'); + } + throw e; + } + } + } + + return data; + }], + + /** + * A timeout in milliseconds to abort a request. If set to 0 (default) a + * timeout is not created. + */ + timeout: 0, + + xsrfCookieName: 'XSRF-TOKEN', + xsrfHeaderName: 'X-XSRF-TOKEN', + + maxContentLength: -1, + maxBodyLength: -1, + + validateStatus: function validateStatus(status) { + return status >= 200 && status < 300; + }, + + headers: { + common: { + 'Accept': 'application/json, text/plain, */*' + } + } +}; + +utils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) { + defaults.headers[method] = {}; +}); + +utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) { + defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE); +}); + +module.exports = defaults; + + +/***/ }), + +/***/ "./lib/defaults/transitional.js": +/*!**************************************!*\ + !*** ./lib/defaults/transitional.js ***! + \**************************************/ +/*! no static exports found */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +module.exports = { + silentJSONParsing: true, + forcedJSONParsing: true, + clarifyTimeoutError: false +}; + + +/***/ }), + +/***/ "./lib/env/data.js": +/*!*************************!*\ + !*** ./lib/env/data.js ***! + \*************************/ +/*! no static exports found */ /***/ (function(module, exports) { - 'use strict'; - - module.exports = function bind(fn, thisArg) { - return function wrap() { - var args = new Array(arguments.length); - for (var i = 0; i < args.length; i++) { - args[i] = arguments[i]; - } - return fn.apply(thisArg, args); - }; - }; - +module.exports = { + "version": "0.26.1" +}; /***/ }), -/* 4 */ + +/***/ "./lib/helpers/bind.js": +/*!*****************************!*\ + !*** ./lib/helpers/bind.js ***! + \*****************************/ +/*! no static exports found */ /***/ (function(module, exports, __webpack_require__) { - 'use strict'; - - var utils = __webpack_require__(2); - var buildURL = __webpack_require__(5); - var InterceptorManager = __webpack_require__(6); - var dispatchRequest = __webpack_require__(7); - var mergeConfig = __webpack_require__(22); - - /** - * Create a new instance of Axios - * - * @param {Object} instanceConfig The default config for the instance - */ - function Axios(instanceConfig) { - this.defaults = instanceConfig; - this.interceptors = { - request: new InterceptorManager(), - response: new InterceptorManager() - }; - } - - /** - * Dispatch a request - * - * @param {Object} config The config specific for this request (merged with this.defaults) - */ - Axios.prototype.request = function request(config) { - /*eslint no-param-reassign:0*/ - // Allow for axios('example/url'[, config]) a la fetch API - if (typeof config === 'string') { - config = arguments[1] || {}; - config.url = arguments[0]; - } else { - config = config || {}; - } - - config = mergeConfig(this.defaults, config); - - // Set config.method - if (config.method) { - config.method = config.method.toLowerCase(); - } else if (this.defaults.method) { - config.method = this.defaults.method.toLowerCase(); - } else { - config.method = 'get'; - } - - // Hook up interceptors middleware - var chain = [dispatchRequest, undefined]; - var promise = Promise.resolve(config); - - this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) { - chain.unshift(interceptor.fulfilled, interceptor.rejected); - }); - - this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) { - chain.push(interceptor.fulfilled, interceptor.rejected); - }); - - while (chain.length) { - promise = promise.then(chain.shift(), chain.shift()); - } - - return promise; - }; - - Axios.prototype.getUri = function getUri(config) { - config = mergeConfig(this.defaults, config); - return buildURL(config.url, config.params, config.paramsSerializer).replace(/^\?/, ''); - }; - - // Provide aliases for supported request methods - utils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) { - /*eslint func-names:0*/ - Axios.prototype[method] = function(url, config) { - return this.request(utils.merge(config || {}, { - method: method, - url: url - })); - }; - }); - - utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) { - /*eslint func-names:0*/ - Axios.prototype[method] = function(url, data, config) { - return this.request(utils.merge(config || {}, { - method: method, - url: url, - data: data - })); - }; - }); - - module.exports = Axios; +"use strict"; + + +module.exports = function bind(fn, thisArg) { + return function wrap() { + var args = new Array(arguments.length); + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i]; + } + return fn.apply(thisArg, args); + }; +}; /***/ }), -/* 5 */ + +/***/ "./lib/helpers/buildURL.js": +/*!*********************************!*\ + !*** ./lib/helpers/buildURL.js ***! + \*********************************/ +/*! no static exports found */ /***/ (function(module, exports, __webpack_require__) { - 'use strict'; - - var utils = __webpack_require__(2); - - function encode(val) { - return encodeURIComponent(val). - replace(/%40/gi, '@'). - replace(/%3A/gi, ':'). - replace(/%24/g, '$'). - replace(/%2C/gi, ','). - replace(/%20/g, '+'). - replace(/%5B/gi, '['). - replace(/%5D/gi, ']'); - } - - /** - * Build a URL by appending params to the end - * - * @param {string} url The base of the url (e.g., http://www.google.com) - * @param {object} [params] The params to be appended - * @returns {string} The formatted url - */ - module.exports = function buildURL(url, params, paramsSerializer) { - /*eslint no-param-reassign:0*/ - if (!params) { - return url; - } - - var serializedParams; - if (paramsSerializer) { - serializedParams = paramsSerializer(params); - } else if (utils.isURLSearchParams(params)) { - serializedParams = params.toString(); - } else { - var parts = []; - - utils.forEach(params, function serialize(val, key) { - if (val === null || typeof val === 'undefined') { - return; - } - - if (utils.isArray(val)) { - key = key + '[]'; - } else { - val = [val]; - } - - utils.forEach(val, function parseValue(v) { - if (utils.isDate(v)) { - v = v.toISOString(); - } else if (utils.isObject(v)) { - v = JSON.stringify(v); - } - parts.push(encode(key) + '=' + encode(v)); - }); - }); - - serializedParams = parts.join('&'); - } - - if (serializedParams) { - var hashmarkIndex = url.indexOf('#'); - if (hashmarkIndex !== -1) { - url = url.slice(0, hashmarkIndex); - } - - url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams; - } - - return url; - }; +"use strict"; + + +var utils = __webpack_require__(/*! ./../utils */ "./lib/utils.js"); + +function encode(val) { + return encodeURIComponent(val). + replace(/%3A/gi, ':'). + replace(/%24/g, '$'). + replace(/%2C/gi, ','). + replace(/%20/g, '+'). + replace(/%5B/gi, '['). + replace(/%5D/gi, ']'); +} + +/** + * Build a URL by appending params to the end + * + * @param {string} url The base of the url (e.g., http://www.google.com) + * @param {object} [params] The params to be appended + * @returns {string} The formatted url + */ +module.exports = function buildURL(url, params, paramsSerializer) { + /*eslint no-param-reassign:0*/ + if (!params) { + return url; + } + + var serializedParams; + if (paramsSerializer) { + serializedParams = paramsSerializer(params); + } else if (utils.isURLSearchParams(params)) { + serializedParams = params.toString(); + } else { + var parts = []; + + utils.forEach(params, function serialize(val, key) { + if (val === null || typeof val === 'undefined') { + return; + } + + if (utils.isArray(val)) { + key = key + '[]'; + } else { + val = [val]; + } + + utils.forEach(val, function parseValue(v) { + if (utils.isDate(v)) { + v = v.toISOString(); + } else if (utils.isObject(v)) { + v = JSON.stringify(v); + } + parts.push(encode(key) + '=' + encode(v)); + }); + }); + + serializedParams = parts.join('&'); + } + + if (serializedParams) { + var hashmarkIndex = url.indexOf('#'); + if (hashmarkIndex !== -1) { + url = url.slice(0, hashmarkIndex); + } + + url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams; + } + + return url; +}; /***/ }), -/* 6 */ + +/***/ "./lib/helpers/combineURLs.js": +/*!************************************!*\ + !*** ./lib/helpers/combineURLs.js ***! + \************************************/ +/*! no static exports found */ /***/ (function(module, exports, __webpack_require__) { - 'use strict'; - - var utils = __webpack_require__(2); - - function InterceptorManager() { - this.handlers = []; - } - - /** - * Add a new interceptor to the stack - * - * @param {Function} fulfilled The function to handle `then` for a `Promise` - * @param {Function} rejected The function to handle `reject` for a `Promise` - * - * @return {Number} An ID used to remove interceptor later - */ - InterceptorManager.prototype.use = function use(fulfilled, rejected) { - this.handlers.push({ - fulfilled: fulfilled, - rejected: rejected - }); - return this.handlers.length - 1; - }; - - /** - * Remove an interceptor from the stack - * - * @param {Number} id The ID that was returned by `use` - */ - InterceptorManager.prototype.eject = function eject(id) { - if (this.handlers[id]) { - this.handlers[id] = null; - } - }; - - /** - * Iterate over all the registered interceptors - * - * This method is particularly useful for skipping over any - * interceptors that may have become `null` calling `eject`. - * - * @param {Function} fn The function to call for each interceptor - */ - InterceptorManager.prototype.forEach = function forEach(fn) { - utils.forEach(this.handlers, function forEachHandler(h) { - if (h !== null) { - fn(h); - } - }); - }; - - module.exports = InterceptorManager; +"use strict"; + + +/** + * Creates a new URL by combining the specified URLs + * + * @param {string} baseURL The base URL + * @param {string} relativeURL The relative URL + * @returns {string} The combined URL + */ +module.exports = function combineURLs(baseURL, relativeURL) { + return relativeURL + ? baseURL.replace(/\/+$/, '') + '/' + relativeURL.replace(/^\/+/, '') + : baseURL; +}; /***/ }), -/* 7 */ + +/***/ "./lib/helpers/cookies.js": +/*!********************************!*\ + !*** ./lib/helpers/cookies.js ***! + \********************************/ +/*! no static exports found */ /***/ (function(module, exports, __webpack_require__) { - 'use strict'; - - var utils = __webpack_require__(2); - var transformData = __webpack_require__(8); - var isCancel = __webpack_require__(9); - var defaults = __webpack_require__(10); - - /** - * Throws a `Cancel` if cancellation has been requested. - */ - function throwIfCancellationRequested(config) { - if (config.cancelToken) { - config.cancelToken.throwIfRequested(); - } - } - - /** - * Dispatch a request to the server using the configured adapter. - * - * @param {object} config The config that is to be used for the request - * @returns {Promise} The Promise to be fulfilled - */ - module.exports = function dispatchRequest(config) { - throwIfCancellationRequested(config); - - // Ensure headers exist - config.headers = config.headers || {}; - - // Transform request data - config.data = transformData( - config.data, - config.headers, - config.transformRequest - ); - - // Flatten headers - config.headers = utils.merge( - config.headers.common || {}, - config.headers[config.method] || {}, - config.headers - ); - - utils.forEach( - ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'], - function cleanHeaderConfig(method) { - delete config.headers[method]; - } - ); - - var adapter = config.adapter || defaults.adapter; - - return adapter(config).then(function onAdapterResolution(response) { - throwIfCancellationRequested(config); - - // Transform response data - response.data = transformData( - response.data, - response.headers, - config.transformResponse - ); - - return response; - }, function onAdapterRejection(reason) { - if (!isCancel(reason)) { - throwIfCancellationRequested(config); - - // Transform response data - if (reason && reason.response) { - reason.response.data = transformData( - reason.response.data, - reason.response.headers, - config.transformResponse - ); - } - } - - return Promise.reject(reason); - }); - }; +"use strict"; + + +var utils = __webpack_require__(/*! ./../utils */ "./lib/utils.js"); + +module.exports = ( + utils.isStandardBrowserEnv() ? + + // Standard browser envs support document.cookie + (function standardBrowserEnv() { + return { + write: function write(name, value, expires, path, domain, secure) { + var cookie = []; + cookie.push(name + '=' + encodeURIComponent(value)); + + if (utils.isNumber(expires)) { + cookie.push('expires=' + new Date(expires).toGMTString()); + } + + if (utils.isString(path)) { + cookie.push('path=' + path); + } + + if (utils.isString(domain)) { + cookie.push('domain=' + domain); + } + + if (secure === true) { + cookie.push('secure'); + } + + document.cookie = cookie.join('; '); + }, + + read: function read(name) { + var match = document.cookie.match(new RegExp('(^|;\\s*)(' + name + ')=([^;]*)')); + return (match ? decodeURIComponent(match[3]) : null); + }, + + remove: function remove(name) { + this.write(name, '', Date.now() - 86400000); + } + }; + })() : + + // Non standard browser env (web workers, react-native) lack needed support. + (function nonStandardBrowserEnv() { + return { + write: function write() {}, + read: function read() { return null; }, + remove: function remove() {} + }; + })() +); /***/ }), -/* 8 */ + +/***/ "./lib/helpers/isAbsoluteURL.js": +/*!**************************************!*\ + !*** ./lib/helpers/isAbsoluteURL.js ***! + \**************************************/ +/*! no static exports found */ /***/ (function(module, exports, __webpack_require__) { - 'use strict'; - - var utils = __webpack_require__(2); - - /** - * Transform the data for a request or a response - * - * @param {Object|String} data The data to be transformed - * @param {Array} headers The headers for the request or response - * @param {Array|Function} fns A single function or Array of functions - * @returns {*} The resulting transformed data - */ - module.exports = function transformData(data, headers, fns) { - /*eslint no-param-reassign:0*/ - utils.forEach(fns, function transform(fn) { - data = fn(data, headers); - }); - - return data; - }; +"use strict"; + + +/** + * Determines whether the specified URL is absolute + * + * @param {string} url The URL to test + * @returns {boolean} True if the specified URL is absolute, otherwise false + */ +module.exports = function isAbsoluteURL(url) { + // A URL is considered absolute if it begins with "://" or "//" (protocol-relative URL). + // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed + // by any combination of letters, digits, plus, period, or hyphen. + return /^([a-z][a-z\d+\-.]*:)?\/\//i.test(url); +}; /***/ }), -/* 9 */ -/***/ (function(module, exports) { - 'use strict'; - - module.exports = function isCancel(value) { - return !!(value && value.__CANCEL__); - }; - - -/***/ }), -/* 10 */ +/***/ "./lib/helpers/isAxiosError.js": +/*!*************************************!*\ + !*** ./lib/helpers/isAxiosError.js ***! + \*************************************/ +/*! no static exports found */ /***/ (function(module, exports, __webpack_require__) { - 'use strict'; - - var utils = __webpack_require__(2); - var normalizeHeaderName = __webpack_require__(11); - - var DEFAULT_CONTENT_TYPE = { - 'Content-Type': 'application/x-www-form-urlencoded' - }; - - function setContentTypeIfUnset(headers, value) { - if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) { - headers['Content-Type'] = value; - } - } - - function getDefaultAdapter() { - var adapter; - if (typeof XMLHttpRequest !== 'undefined') { - // For browsers use XHR adapter - adapter = __webpack_require__(12); - } else if (typeof process !== 'undefined' && Object.prototype.toString.call(process) === '[object process]') { - // For node use HTTP adapter - adapter = __webpack_require__(12); - } - return adapter; - } - - var defaults = { - adapter: getDefaultAdapter(), - - transformRequest: [function transformRequest(data, headers) { - normalizeHeaderName(headers, 'Accept'); - normalizeHeaderName(headers, 'Content-Type'); - if (utils.isFormData(data) || - utils.isArrayBuffer(data) || - utils.isBuffer(data) || - utils.isStream(data) || - utils.isFile(data) || - utils.isBlob(data) - ) { - return data; - } - if (utils.isArrayBufferView(data)) { - return data.buffer; - } - if (utils.isURLSearchParams(data)) { - setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8'); - return data.toString(); - } - if (utils.isObject(data)) { - setContentTypeIfUnset(headers, 'application/json;charset=utf-8'); - return JSON.stringify(data); - } - return data; - }], - - transformResponse: [function transformResponse(data) { - /*eslint no-param-reassign:0*/ - if (typeof data === 'string') { - try { - data = JSON.parse(data); - } catch (e) { /* Ignore */ } - } - return data; - }], - - /** - * A timeout in milliseconds to abort a request. If set to 0 (default) a - * timeout is not created. - */ - timeout: 0, - - xsrfCookieName: 'XSRF-TOKEN', - xsrfHeaderName: 'X-XSRF-TOKEN', - - maxContentLength: -1, - - validateStatus: function validateStatus(status) { - return status >= 200 && status < 300; - } - }; - - defaults.headers = { - common: { - 'Accept': 'application/json, text/plain, */*' - } - }; - - utils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) { - defaults.headers[method] = {}; - }); - - utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) { - defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE); - }); - - module.exports = defaults; +"use strict"; + + +var utils = __webpack_require__(/*! ./../utils */ "./lib/utils.js"); + +/** + * Determines whether the payload is an error thrown by Axios + * + * @param {*} payload The value to test + * @returns {boolean} True if the payload is an error thrown by Axios, otherwise false + */ +module.exports = function isAxiosError(payload) { + return utils.isObject(payload) && (payload.isAxiosError === true); +}; /***/ }), -/* 11 */ + +/***/ "./lib/helpers/isURLSameOrigin.js": +/*!****************************************!*\ + !*** ./lib/helpers/isURLSameOrigin.js ***! + \****************************************/ +/*! no static exports found */ /***/ (function(module, exports, __webpack_require__) { - 'use strict'; - - var utils = __webpack_require__(2); - - module.exports = function normalizeHeaderName(headers, normalizedName) { - utils.forEach(headers, function processHeader(value, name) { - if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) { - headers[normalizedName] = value; - delete headers[name]; - } - }); - }; +"use strict"; + + +var utils = __webpack_require__(/*! ./../utils */ "./lib/utils.js"); + +module.exports = ( + utils.isStandardBrowserEnv() ? + + // Standard browser envs have full support of the APIs needed to test + // whether the request URL is of the same origin as current location. + (function standardBrowserEnv() { + var msie = /(msie|trident)/i.test(navigator.userAgent); + var urlParsingNode = document.createElement('a'); + var originURL; + + /** + * Parse a URL to discover it's components + * + * @param {String} url The URL to be parsed + * @returns {Object} + */ + function resolveURL(url) { + var href = url; + + if (msie) { + // IE needs attribute set twice to normalize properties + urlParsingNode.setAttribute('href', href); + href = urlParsingNode.href; + } + + urlParsingNode.setAttribute('href', href); + + // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils + return { + href: urlParsingNode.href, + protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '', + host: urlParsingNode.host, + search: urlParsingNode.search ? urlParsingNode.search.replace(/^\?/, '') : '', + hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '', + hostname: urlParsingNode.hostname, + port: urlParsingNode.port, + pathname: (urlParsingNode.pathname.charAt(0) === '/') ? + urlParsingNode.pathname : + '/' + urlParsingNode.pathname + }; + } + + originURL = resolveURL(window.location.href); + + /** + * Determine if a URL shares the same origin as the current location + * + * @param {String} requestURL The URL to test + * @returns {boolean} True if URL shares the same origin, otherwise false + */ + return function isURLSameOrigin(requestURL) { + var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL; + return (parsed.protocol === originURL.protocol && + parsed.host === originURL.host); + }; + })() : + + // Non standard browser envs (web workers, react-native) lack needed support. + (function nonStandardBrowserEnv() { + return function isURLSameOrigin() { + return true; + }; + })() +); /***/ }), -/* 12 */ + +/***/ "./lib/helpers/normalizeHeaderName.js": +/*!********************************************!*\ + !*** ./lib/helpers/normalizeHeaderName.js ***! + \********************************************/ +/*! no static exports found */ /***/ (function(module, exports, __webpack_require__) { - 'use strict'; - - var utils = __webpack_require__(2); - var settle = __webpack_require__(13); - var buildURL = __webpack_require__(5); - var buildFullPath = __webpack_require__(16); - var parseHeaders = __webpack_require__(19); - var isURLSameOrigin = __webpack_require__(20); - var createError = __webpack_require__(14); - - module.exports = function xhrAdapter(config) { - return new Promise(function dispatchXhrRequest(resolve, reject) { - var requestData = config.data; - var requestHeaders = config.headers; - - if (utils.isFormData(requestData)) { - delete requestHeaders['Content-Type']; // Let the browser set it - } - - var request = new XMLHttpRequest(); - - // HTTP basic authentication - if (config.auth) { - var username = config.auth.username || ''; - var password = config.auth.password || ''; - requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password); - } - - var fullPath = buildFullPath(config.baseURL, config.url); - request.open(config.method.toUpperCase(), buildURL(fullPath, config.params, config.paramsSerializer), true); - - // Set the request timeout in MS - request.timeout = config.timeout; - - // Listen for ready state - request.onreadystatechange = function handleLoad() { - if (!request || request.readyState !== 4) { - return; - } - - // The request errored out and we didn't get a response, this will be - // handled by onerror instead - // With one exception: request that using file: protocol, most browsers - // will return status as 0 even though it's a successful request - if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) { - return; - } - - // Prepare the response - var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null; - var responseData = !config.responseType || config.responseType === 'text' ? request.responseText : request.response; - var response = { - data: responseData, - status: request.status, - statusText: request.statusText, - headers: responseHeaders, - config: config, - request: request - }; - - settle(resolve, reject, response); - - // Clean up request - request = null; - }; - - // Handle browser request cancellation (as opposed to a manual cancellation) - request.onabort = function handleAbort() { - if (!request) { - return; - } - - reject(createError('Request aborted', config, 'ECONNABORTED', request)); - - // Clean up request - request = null; - }; - - // Handle low level network errors - request.onerror = function handleError() { - // Real errors are hidden from us by the browser - // onerror should only fire if it's a network error - reject(createError('Network Error', config, null, request)); - - // Clean up request - request = null; - }; - - // Handle timeout - request.ontimeout = function handleTimeout() { - var timeoutErrorMessage = 'timeout of ' + config.timeout + 'ms exceeded'; - if (config.timeoutErrorMessage) { - timeoutErrorMessage = config.timeoutErrorMessage; - } - reject(createError(timeoutErrorMessage, config, 'ECONNABORTED', - request)); - - // Clean up request - request = null; - }; - - // Add xsrf header - // This is only done if running in a standard browser environment. - // Specifically not if we're in a web worker, or react-native. - if (utils.isStandardBrowserEnv()) { - var cookies = __webpack_require__(21); - - // Add xsrf header - var xsrfValue = (config.withCredentials || isURLSameOrigin(fullPath)) && config.xsrfCookieName ? - cookies.read(config.xsrfCookieName) : - undefined; - - if (xsrfValue) { - requestHeaders[config.xsrfHeaderName] = xsrfValue; - } - } - - // Add headers to the request - if ('setRequestHeader' in request) { - utils.forEach(requestHeaders, function setRequestHeader(val, key) { - if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') { - // Remove Content-Type if data is undefined - delete requestHeaders[key]; - } else { - // Otherwise add header to the request - request.setRequestHeader(key, val); - } - }); - } - - // Add withCredentials to request if needed - if (!utils.isUndefined(config.withCredentials)) { - request.withCredentials = !!config.withCredentials; - } - - // Add responseType to request if needed - if (config.responseType) { - try { - request.responseType = config.responseType; - } catch (e) { - // Expected DOMException thrown by browsers not compatible XMLHttpRequest Level 2. - // But, this can be suppressed for 'json' type as it can be parsed by default 'transformResponse' function. - if (config.responseType !== 'json') { - throw e; - } - } - } - - // Handle progress if needed - if (typeof config.onDownloadProgress === 'function') { - request.addEventListener('progress', config.onDownloadProgress); - } - - // Not all browsers support upload events - if (typeof config.onUploadProgress === 'function' && request.upload) { - request.upload.addEventListener('progress', config.onUploadProgress); - } - - if (config.cancelToken) { - // Handle cancellation - config.cancelToken.promise.then(function onCanceled(cancel) { - if (!request) { - return; - } - - request.abort(); - reject(cancel); - // Clean up request - request = null; - }); - } - - if (requestData === undefined) { - requestData = null; - } - - // Send the request - request.send(requestData); - }); - }; +"use strict"; + + +var utils = __webpack_require__(/*! ../utils */ "./lib/utils.js"); + +module.exports = function normalizeHeaderName(headers, normalizedName) { + utils.forEach(headers, function processHeader(value, name) { + if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) { + headers[normalizedName] = value; + delete headers[name]; + } + }); +}; /***/ }), -/* 13 */ + +/***/ "./lib/helpers/parseHeaders.js": +/*!*************************************!*\ + !*** ./lib/helpers/parseHeaders.js ***! + \*************************************/ +/*! no static exports found */ /***/ (function(module, exports, __webpack_require__) { - 'use strict'; - - var createError = __webpack_require__(14); - - /** - * Resolve or reject a Promise based on response status. - * - * @param {Function} resolve A function that resolves the promise. - * @param {Function} reject A function that rejects the promise. - * @param {object} response The response. - */ - module.exports = function settle(resolve, reject, response) { - var validateStatus = response.config.validateStatus; - if (!validateStatus || validateStatus(response.status)) { - resolve(response); - } else { - reject(createError( - 'Request failed with status code ' + response.status, - response.config, - null, - response.request, - response - )); - } - }; +"use strict"; + + +var utils = __webpack_require__(/*! ./../utils */ "./lib/utils.js"); + +// Headers whose duplicates are ignored by node +// c.f. https://nodejs.org/api/http.html#http_message_headers +var ignoreDuplicateOf = [ + 'age', 'authorization', 'content-length', 'content-type', 'etag', + 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since', + 'last-modified', 'location', 'max-forwards', 'proxy-authorization', + 'referer', 'retry-after', 'user-agent' +]; + +/** + * Parse headers into an object + * + * ``` + * Date: Wed, 27 Aug 2014 08:58:49 GMT + * Content-Type: application/json + * Connection: keep-alive + * Transfer-Encoding: chunked + * ``` + * + * @param {String} headers Headers needing to be parsed + * @returns {Object} Headers parsed into an object + */ +module.exports = function parseHeaders(headers) { + var parsed = {}; + var key; + var val; + var i; + + if (!headers) { return parsed; } + + utils.forEach(headers.split('\n'), function parser(line) { + i = line.indexOf(':'); + key = utils.trim(line.substr(0, i)).toLowerCase(); + val = utils.trim(line.substr(i + 1)); + + if (key) { + if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) { + return; + } + if (key === 'set-cookie') { + parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]); + } else { + parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val; + } + } + }); + + return parsed; +}; /***/ }), -/* 14 */ + +/***/ "./lib/helpers/spread.js": +/*!*******************************!*\ + !*** ./lib/helpers/spread.js ***! + \*******************************/ +/*! no static exports found */ /***/ (function(module, exports, __webpack_require__) { - 'use strict'; - - var enhanceError = __webpack_require__(15); - - /** - * Create an Error with the specified message, config, error code, request and response. - * - * @param {string} message The error message. - * @param {Object} config The config. - * @param {string} [code] The error code (for example, 'ECONNABORTED'). - * @param {Object} [request] The request. - * @param {Object} [response] The response. - * @returns {Error} The created error. - */ - module.exports = function createError(message, config, code, request, response) { - var error = new Error(message); - return enhanceError(error, config, code, request, response); - }; +"use strict"; + + +/** + * Syntactic sugar for invoking a function and expanding an array for arguments. + * + * Common use case would be to use `Function.prototype.apply`. + * + * ```js + * function f(x, y, z) {} + * var args = [1, 2, 3]; + * f.apply(null, args); + * ``` + * + * With `spread` this example can be re-written. + * + * ```js + * spread(function(x, y, z) {})([1, 2, 3]); + * ``` + * + * @param {Function} callback + * @returns {Function} + */ +module.exports = function spread(callback) { + return function wrap(arr) { + return callback.apply(null, arr); + }; +}; /***/ }), -/* 15 */ -/***/ (function(module, exports) { - 'use strict'; - - /** - * Update an Error with the specified config, error code, and response. - * - * @param {Error} error The error to update. - * @param {Object} config The config. - * @param {string} [code] The error code (for example, 'ECONNABORTED'). - * @param {Object} [request] The request. - * @param {Object} [response] The response. - * @returns {Error} The error. - */ - module.exports = function enhanceError(error, config, code, request, response) { - error.config = config; - if (code) { - error.code = code; - } - - error.request = request; - error.response = response; - error.isAxiosError = true; - - error.toJSON = function() { - return { - // Standard - message: this.message, - name: this.name, - // Microsoft - description: this.description, - number: this.number, - // Mozilla - fileName: this.fileName, - lineNumber: this.lineNumber, - columnNumber: this.columnNumber, - stack: this.stack, - // Axios - config: this.config, - code: this.code - }; - }; - return error; - }; - - -/***/ }), -/* 16 */ +/***/ "./lib/helpers/validator.js": +/*!**********************************!*\ + !*** ./lib/helpers/validator.js ***! + \**********************************/ +/*! no static exports found */ /***/ (function(module, exports, __webpack_require__) { - 'use strict'; - - var isAbsoluteURL = __webpack_require__(17); - var combineURLs = __webpack_require__(18); - - /** - * Creates a new URL by combining the baseURL with the requestedURL, - * only when the requestedURL is not already an absolute URL. - * If the requestURL is absolute, this function returns the requestedURL untouched. - * - * @param {string} baseURL The base URL - * @param {string} requestedURL Absolute or relative URL to combine - * @returns {string} The combined full path - */ - module.exports = function buildFullPath(baseURL, requestedURL) { - if (baseURL && !isAbsoluteURL(requestedURL)) { - return combineURLs(baseURL, requestedURL); - } - return requestedURL; - }; +"use strict"; + + +var VERSION = __webpack_require__(/*! ../env/data */ "./lib/env/data.js").version; + +var validators = {}; + +// eslint-disable-next-line func-names +['object', 'boolean', 'number', 'function', 'string', 'symbol'].forEach(function(type, i) { + validators[type] = function validator(thing) { + return typeof thing === type || 'a' + (i < 1 ? 'n ' : ' ') + type; + }; +}); + +var deprecatedWarnings = {}; + +/** + * Transitional option validator + * @param {function|boolean?} validator - set to false if the transitional option has been removed + * @param {string?} version - deprecated version / removed since version + * @param {string?} message - some message with additional info + * @returns {function} + */ +validators.transitional = function transitional(validator, version, message) { + function formatMessage(opt, desc) { + return '[Axios v' + VERSION + '] Transitional option \'' + opt + '\'' + desc + (message ? '. ' + message : ''); + } + + // eslint-disable-next-line func-names + return function(value, opt, opts) { + if (validator === false) { + throw new Error(formatMessage(opt, ' has been removed' + (version ? ' in ' + version : ''))); + } + + if (version && !deprecatedWarnings[opt]) { + deprecatedWarnings[opt] = true; + // eslint-disable-next-line no-console + console.warn( + formatMessage( + opt, + ' has been deprecated since v' + version + ' and will be removed in the near future' + ) + ); + } + + return validator ? validator(value, opt, opts) : true; + }; +}; + +/** + * Assert object's properties type + * @param {object} options + * @param {object} schema + * @param {boolean?} allowUnknown + */ + +function assertOptions(options, schema, allowUnknown) { + if (typeof options !== 'object') { + throw new TypeError('options must be an object'); + } + var keys = Object.keys(options); + var i = keys.length; + while (i-- > 0) { + var opt = keys[i]; + var validator = schema[opt]; + if (validator) { + var value = options[opt]; + var result = value === undefined || validator(value, opt, options); + if (result !== true) { + throw new TypeError('option ' + opt + ' must be ' + result); + } + continue; + } + if (allowUnknown !== true) { + throw Error('Unknown option ' + opt); + } + } +} + +module.exports = { + assertOptions: assertOptions, + validators: validators +}; /***/ }), -/* 17 */ -/***/ (function(module, exports) { - 'use strict'; - - /** - * Determines whether the specified URL is absolute - * - * @param {string} url The URL to test - * @returns {boolean} True if the specified URL is absolute, otherwise false - */ - module.exports = function isAbsoluteURL(url) { - // A URL is considered absolute if it begins with "://" or "//" (protocol-relative URL). - // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed - // by any combination of letters, digits, plus, period, or hyphen. - return /^([a-z][a-z\d\+\-\.]*:)?\/\//i.test(url); - }; - - -/***/ }), -/* 18 */ -/***/ (function(module, exports) { - - 'use strict'; - - /** - * Creates a new URL by combining the specified URLs - * - * @param {string} baseURL The base URL - * @param {string} relativeURL The relative URL - * @returns {string} The combined URL - */ - module.exports = function combineURLs(baseURL, relativeURL) { - return relativeURL - ? baseURL.replace(/\/+$/, '') + '/' + relativeURL.replace(/^\/+/, '') - : baseURL; - }; - - -/***/ }), -/* 19 */ +/***/ "./lib/utils.js": +/*!**********************!*\ + !*** ./lib/utils.js ***! + \**********************/ +/*! no static exports found */ /***/ (function(module, exports, __webpack_require__) { - 'use strict'; - - var utils = __webpack_require__(2); - - // Headers whose duplicates are ignored by node - // c.f. https://nodejs.org/api/http.html#http_message_headers - var ignoreDuplicateOf = [ - 'age', 'authorization', 'content-length', 'content-type', 'etag', - 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since', - 'last-modified', 'location', 'max-forwards', 'proxy-authorization', - 'referer', 'retry-after', 'user-agent' - ]; - - /** - * Parse headers into an object - * - * ``` - * Date: Wed, 27 Aug 2014 08:58:49 GMT - * Content-Type: application/json - * Connection: keep-alive - * Transfer-Encoding: chunked - * ``` - * - * @param {String} headers Headers needing to be parsed - * @returns {Object} Headers parsed into an object - */ - module.exports = function parseHeaders(headers) { - var parsed = {}; - var key; - var val; - var i; - - if (!headers) { return parsed; } - - utils.forEach(headers.split('\n'), function parser(line) { - i = line.indexOf(':'); - key = utils.trim(line.substr(0, i)).toLowerCase(); - val = utils.trim(line.substr(i + 1)); - - if (key) { - if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) { - return; - } - if (key === 'set-cookie') { - parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]); - } else { - parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val; - } - } - }); - - return parsed; - }; +"use strict"; -/***/ }), -/* 20 */ -/***/ (function(module, exports, __webpack_require__) { +var bind = __webpack_require__(/*! ./helpers/bind */ "./lib/helpers/bind.js"); - 'use strict'; - - var utils = __webpack_require__(2); - - module.exports = ( - utils.isStandardBrowserEnv() ? - - // Standard browser envs have full support of the APIs needed to test - // whether the request URL is of the same origin as current location. - (function standardBrowserEnv() { - var msie = /(msie|trident)/i.test(navigator.userAgent); - var urlParsingNode = document.createElement('a'); - var originURL; - - /** - * Parse a URL to discover it's components - * - * @param {String} url The URL to be parsed - * @returns {Object} - */ - function resolveURL(url) { - var href = url; - - if (msie) { - // IE needs attribute set twice to normalize properties - urlParsingNode.setAttribute('href', href); - href = urlParsingNode.href; - } - - urlParsingNode.setAttribute('href', href); - - // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils - return { - href: urlParsingNode.href, - protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '', - host: urlParsingNode.host, - search: urlParsingNode.search ? urlParsingNode.search.replace(/^\?/, '') : '', - hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '', - hostname: urlParsingNode.hostname, - port: urlParsingNode.port, - pathname: (urlParsingNode.pathname.charAt(0) === '/') ? - urlParsingNode.pathname : - '/' + urlParsingNode.pathname - }; - } - - originURL = resolveURL(window.location.href); - - /** - * Determine if a URL shares the same origin as the current location - * - * @param {String} requestURL The URL to test - * @returns {boolean} True if URL shares the same origin, otherwise false - */ - return function isURLSameOrigin(requestURL) { - var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL; - return (parsed.protocol === originURL.protocol && - parsed.host === originURL.host); - }; - })() : - - // Non standard browser envs (web workers, react-native) lack needed support. - (function nonStandardBrowserEnv() { - return function isURLSameOrigin() { - return true; - }; - })() - ); +// utils is a library of generic helper functions non-specific to axios +var toString = Object.prototype.toString; -/***/ }), -/* 21 */ -/***/ (function(module, exports, __webpack_require__) { +/** + * Determine if a value is an Array + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an Array, otherwise false + */ +function isArray(val) { + return Array.isArray(val); +} - 'use strict'; - - var utils = __webpack_require__(2); - - module.exports = ( - utils.isStandardBrowserEnv() ? - - // Standard browser envs support document.cookie - (function standardBrowserEnv() { - return { - write: function write(name, value, expires, path, domain, secure) { - var cookie = []; - cookie.push(name + '=' + encodeURIComponent(value)); - - if (utils.isNumber(expires)) { - cookie.push('expires=' + new Date(expires).toGMTString()); - } - - if (utils.isString(path)) { - cookie.push('path=' + path); - } - - if (utils.isString(domain)) { - cookie.push('domain=' + domain); - } - - if (secure === true) { - cookie.push('secure'); - } - - document.cookie = cookie.join('; '); - }, - - read: function read(name) { - var match = document.cookie.match(new RegExp('(^|;\\s*)(' + name + ')=([^;]*)')); - return (match ? decodeURIComponent(match[3]) : null); - }, - - remove: function remove(name) { - this.write(name, '', Date.now() - 86400000); - } - }; - })() : - - // Non standard browser env (web workers, react-native) lack needed support. - (function nonStandardBrowserEnv() { - return { - write: function write() {}, - read: function read() { return null; }, - remove: function remove() {} - }; - })() - ); +/** + * Determine if a value is undefined + * + * @param {Object} val The value to test + * @returns {boolean} True if the value is undefined, otherwise false + */ +function isUndefined(val) { + return typeof val === 'undefined'; +} +/** + * Determine if a value is a Buffer + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Buffer, otherwise false + */ +function isBuffer(val) { + return val !== null && !isUndefined(val) && val.constructor !== null && !isUndefined(val.constructor) + && typeof val.constructor.isBuffer === 'function' && val.constructor.isBuffer(val); +} -/***/ }), -/* 22 */ -/***/ (function(module, exports, __webpack_require__) { +/** + * Determine if a value is an ArrayBuffer + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an ArrayBuffer, otherwise false + */ +function isArrayBuffer(val) { + return toString.call(val) === '[object ArrayBuffer]'; +} - 'use strict'; - - var utils = __webpack_require__(2); - - /** - * Config-specific merge-function which creates a new config-object - * by merging two configuration objects together. - * - * @param {Object} config1 - * @param {Object} config2 - * @returns {Object} New object resulting from merging config2 to config1 - */ - module.exports = function mergeConfig(config1, config2) { - // eslint-disable-next-line no-param-reassign - config2 = config2 || {}; - var config = {}; - - var valueFromConfig2Keys = ['url', 'method', 'params', 'data']; - var mergeDeepPropertiesKeys = ['headers', 'auth', 'proxy']; - var defaultToConfig2Keys = [ - 'baseURL', 'url', 'transformRequest', 'transformResponse', 'paramsSerializer', - 'timeout', 'withCredentials', 'adapter', 'responseType', 'xsrfCookieName', - 'xsrfHeaderName', 'onUploadProgress', 'onDownloadProgress', - 'maxContentLength', 'validateStatus', 'maxRedirects', 'httpAgent', - 'httpsAgent', 'cancelToken', 'socketPath' - ]; - - utils.forEach(valueFromConfig2Keys, function valueFromConfig2(prop) { - if (typeof config2[prop] !== 'undefined') { - config[prop] = config2[prop]; - } - }); - - utils.forEach(mergeDeepPropertiesKeys, function mergeDeepProperties(prop) { - if (utils.isObject(config2[prop])) { - config[prop] = utils.deepMerge(config1[prop], config2[prop]); - } else if (typeof config2[prop] !== 'undefined') { - config[prop] = config2[prop]; - } else if (utils.isObject(config1[prop])) { - config[prop] = utils.deepMerge(config1[prop]); - } else if (typeof config1[prop] !== 'undefined') { - config[prop] = config1[prop]; - } - }); - - utils.forEach(defaultToConfig2Keys, function defaultToConfig2(prop) { - if (typeof config2[prop] !== 'undefined') { - config[prop] = config2[prop]; - } else if (typeof config1[prop] !== 'undefined') { - config[prop] = config1[prop]; - } - }); - - var axiosKeys = valueFromConfig2Keys - .concat(mergeDeepPropertiesKeys) - .concat(defaultToConfig2Keys); - - var otherKeys = Object - .keys(config2) - .filter(function filterAxiosKeys(key) { - return axiosKeys.indexOf(key) === -1; - }); - - utils.forEach(otherKeys, function otherKeysDefaultToConfig2(prop) { - if (typeof config2[prop] !== 'undefined') { - config[prop] = config2[prop]; - } else if (typeof config1[prop] !== 'undefined') { - config[prop] = config1[prop]; - } - }); - - return config; - }; +/** + * Determine if a value is a FormData + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an FormData, otherwise false + */ +function isFormData(val) { + return toString.call(val) === '[object FormData]'; +} +/** + * Determine if a value is a view on an ArrayBuffer + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false + */ +function isArrayBufferView(val) { + var result; + if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) { + result = ArrayBuffer.isView(val); + } else { + result = (val) && (val.buffer) && (isArrayBuffer(val.buffer)); + } + return result; +} -/***/ }), -/* 23 */ -/***/ (function(module, exports) { +/** + * Determine if a value is a String + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a String, otherwise false + */ +function isString(val) { + return typeof val === 'string'; +} - 'use strict'; - - /** - * A `Cancel` is an object that is thrown when an operation is canceled. - * - * @class - * @param {string=} message The message. - */ - function Cancel(message) { - this.message = message; - } - - Cancel.prototype.toString = function toString() { - return 'Cancel' + (this.message ? ': ' + this.message : ''); - }; - - Cancel.prototype.__CANCEL__ = true; - - module.exports = Cancel; +/** + * Determine if a value is a Number + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Number, otherwise false + */ +function isNumber(val) { + return typeof val === 'number'; +} +/** + * Determine if a value is an Object + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an Object, otherwise false + */ +function isObject(val) { + return val !== null && typeof val === 'object'; +} -/***/ }), -/* 24 */ -/***/ (function(module, exports, __webpack_require__) { +/** + * Determine if a value is a plain Object + * + * @param {Object} val The value to test + * @return {boolean} True if value is a plain Object, otherwise false + */ +function isPlainObject(val) { + if (toString.call(val) !== '[object Object]') { + return false; + } - 'use strict'; - - var Cancel = __webpack_require__(23); - - /** - * A `CancelToken` is an object that can be used to request cancellation of an operation. - * - * @class - * @param {Function} executor The executor function. - */ - function CancelToken(executor) { - if (typeof executor !== 'function') { - throw new TypeError('executor must be a function.'); - } - - var resolvePromise; - this.promise = new Promise(function promiseExecutor(resolve) { - resolvePromise = resolve; - }); - - var token = this; - executor(function cancel(message) { - if (token.reason) { - // Cancellation has already been requested - return; - } - - token.reason = new Cancel(message); - resolvePromise(token.reason); - }); - } - - /** - * Throws a `Cancel` if cancellation has been requested. - */ - CancelToken.prototype.throwIfRequested = function throwIfRequested() { - if (this.reason) { - throw this.reason; - } - }; - - /** - * Returns an object that contains a new `CancelToken` and a function that, when called, - * cancels the `CancelToken`. - */ - CancelToken.source = function source() { - var cancel; - var token = new CancelToken(function executor(c) { - cancel = c; - }); - return { - token: token, - cancel: cancel - }; - }; - - module.exports = CancelToken; + var prototype = Object.getPrototypeOf(val); + return prototype === null || prototype === Object.prototype; +} +/** + * Determine if a value is a Date + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Date, otherwise false + */ +function isDate(val) { + return toString.call(val) === '[object Date]'; +} -/***/ }), -/* 25 */ -/***/ (function(module, exports) { +/** + * Determine if a value is a File + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a File, otherwise false + */ +function isFile(val) { + return toString.call(val) === '[object File]'; +} - 'use strict'; - - /** - * Syntactic sugar for invoking a function and expanding an array for arguments. - * - * Common use case would be to use `Function.prototype.apply`. - * - * ```js - * function f(x, y, z) {} - * var args = [1, 2, 3]; - * f.apply(null, args); - * ``` - * - * With `spread` this example can be re-written. - * - * ```js - * spread(function(x, y, z) {})([1, 2, 3]); - * ``` - * - * @param {Function} callback - * @returns {Function} - */ - module.exports = function spread(callback) { - return function wrap(arr) { - return callback.apply(null, arr); - }; - }; +/** + * Determine if a value is a Blob + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Blob, otherwise false + */ +function isBlob(val) { + return toString.call(val) === '[object Blob]'; +} + +/** + * Determine if a value is a Function + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Function, otherwise false + */ +function isFunction(val) { + return toString.call(val) === '[object Function]'; +} + +/** + * Determine if a value is a Stream + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Stream, otherwise false + */ +function isStream(val) { + return isObject(val) && isFunction(val.pipe); +} + +/** + * Determine if a value is a URLSearchParams object + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a URLSearchParams object, otherwise false + */ +function isURLSearchParams(val) { + return toString.call(val) === '[object URLSearchParams]'; +} + +/** + * Trim excess whitespace off the beginning and end of a string + * + * @param {String} str The String to trim + * @returns {String} The String freed of excess whitespace + */ +function trim(str) { + return str.trim ? str.trim() : str.replace(/^\s+|\s+$/g, ''); +} + +/** + * Determine if we're running in a standard browser environment + * + * This allows axios to run in a web worker, and react-native. + * Both environments support XMLHttpRequest, but not fully standard globals. + * + * web workers: + * typeof window -> undefined + * typeof document -> undefined + * + * react-native: + * navigator.product -> 'ReactNative' + * nativescript + * navigator.product -> 'NativeScript' or 'NS' + */ +function isStandardBrowserEnv() { + if (typeof navigator !== 'undefined' && (navigator.product === 'ReactNative' || + navigator.product === 'NativeScript' || + navigator.product === 'NS')) { + return false; + } + return ( + typeof window !== 'undefined' && + typeof document !== 'undefined' + ); +} + +/** + * Iterate over an Array or an Object invoking a function for each item. + * + * If `obj` is an Array callback will be called passing + * the value, index, and complete array for each item. + * + * If 'obj' is an Object callback will be called passing + * the value, key, and complete object for each property. + * + * @param {Object|Array} obj The object to iterate + * @param {Function} fn The callback to invoke for each item + */ +function forEach(obj, fn) { + // Don't bother if no value provided + if (obj === null || typeof obj === 'undefined') { + return; + } + + // Force an array if not already something iterable + if (typeof obj !== 'object') { + /*eslint no-param-reassign:0*/ + obj = [obj]; + } + + if (isArray(obj)) { + // Iterate over array values + for (var i = 0, l = obj.length; i < l; i++) { + fn.call(null, obj[i], i, obj); + } + } else { + // Iterate over object keys + for (var key in obj) { + if (Object.prototype.hasOwnProperty.call(obj, key)) { + fn.call(null, obj[key], key, obj); + } + } + } +} + +/** + * Accepts varargs expecting each argument to be an object, then + * immutably merges the properties of each object and returns result. + * + * When multiple objects contain the same key the later object in + * the arguments list will take precedence. + * + * Example: + * + * ```js + * var result = merge({foo: 123}, {foo: 456}); + * console.log(result.foo); // outputs 456 + * ``` + * + * @param {Object} obj1 Object to merge + * @returns {Object} Result of all merge properties + */ +function merge(/* obj1, obj2, obj3, ... */) { + var result = {}; + function assignValue(val, key) { + if (isPlainObject(result[key]) && isPlainObject(val)) { + result[key] = merge(result[key], val); + } else if (isPlainObject(val)) { + result[key] = merge({}, val); + } else if (isArray(val)) { + result[key] = val.slice(); + } else { + result[key] = val; + } + } + + for (var i = 0, l = arguments.length; i < l; i++) { + forEach(arguments[i], assignValue); + } + return result; +} + +/** + * Extends object a by mutably adding to it the properties of object b. + * + * @param {Object} a The object to be extended + * @param {Object} b The object to copy properties from + * @param {Object} thisArg The object to bind function to + * @return {Object} The resulting value of object a + */ +function extend(a, b, thisArg) { + forEach(b, function assignValue(val, key) { + if (thisArg && typeof val === 'function') { + a[key] = bind(val, thisArg); + } else { + a[key] = val; + } + }); + return a; +} + +/** + * Remove byte order marker. This catches EF BB BF (the UTF-8 BOM) + * + * @param {string} content with BOM + * @return {string} content value without BOM + */ +function stripBOM(content) { + if (content.charCodeAt(0) === 0xFEFF) { + content = content.slice(1); + } + return content; +} + +module.exports = { + isArray: isArray, + isArrayBuffer: isArrayBuffer, + isBuffer: isBuffer, + isFormData: isFormData, + isArrayBufferView: isArrayBufferView, + isString: isString, + isNumber: isNumber, + isObject: isObject, + isPlainObject: isPlainObject, + isUndefined: isUndefined, + isDate: isDate, + isFile: isFile, + isBlob: isBlob, + isFunction: isFunction, + isStream: isStream, + isURLSearchParams: isURLSearchParams, + isStandardBrowserEnv: isStandardBrowserEnv, + forEach: forEach, + merge: merge, + extend: extend, + trim: trim, + stripBOM: stripBOM +}; /***/ }) -/******/ ]) + +/******/ }); }); -; //# sourceMappingURL=axios.map \ No newline at end of file diff --git a/node_modules/axios/dist/axios.map b/node_modules/axios/dist/axios.map index 4370129..f0beb46 100644 --- a/node_modules/axios/dist/axios.map +++ b/node_modules/axios/dist/axios.map @@ -1 +1 @@ -{"version":3,"sources":["webpack:///webpack/universalModuleDefinition","webpack:///webpack/bootstrap 18e5718d1c92e108675b","webpack:///./index.js","webpack:///./lib/axios.js","webpack:///./lib/utils.js","webpack:///./lib/helpers/bind.js","webpack:///./lib/core/Axios.js","webpack:///./lib/helpers/buildURL.js","webpack:///./lib/core/InterceptorManager.js","webpack:///./lib/core/dispatchRequest.js","webpack:///./lib/core/transformData.js","webpack:///./lib/cancel/isCancel.js","webpack:///./lib/defaults.js","webpack:///./lib/helpers/normalizeHeaderName.js","webpack:///./lib/adapters/xhr.js","webpack:///./lib/core/settle.js","webpack:///./lib/core/createError.js","webpack:///./lib/core/enhanceError.js","webpack:///./lib/core/buildFullPath.js","webpack:///./lib/helpers/isAbsoluteURL.js","webpack:///./lib/helpers/combineURLs.js","webpack:///./lib/helpers/parseHeaders.js","webpack:///./lib/helpers/isURLSameOrigin.js","webpack:///./lib/helpers/cookies.js","webpack:///./lib/core/mergeConfig.js","webpack:///./lib/cancel/Cancel.js","webpack:///./lib/cancel/CancelToken.js","webpack:///./lib/helpers/spread.js"],"names":[],"mappings":"AAAA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC;AACD,O;ACVA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA,uBAAe;AACf;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;;;AAGA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;;;;;;;ACtCA,yC;;;;;;ACAA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,aAAY,MAAM;AAClB;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;;;;;;;ACpDA;;AAEA;;AAEA;;AAEA;;AAEA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,OAAO;AACpB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW,aAAa;AACxB,YAAW,SAAS;AACpB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,oCAAmC,OAAO;AAC1C;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAuB,SAAS,GAAG,SAAS;AAC5C,4BAA2B;AAC3B;AACA;AACA,YAAW,OAAO;AAClB,cAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;;AAEA,wCAAuC,OAAO;AAC9C;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL,iCAAgC;AAChC,MAAK;AACL;AACA;AACA;;AAEA,wCAAuC,OAAO;AAC9C;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,aAAY,OAAO;AACnB;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,IAAG;AACH;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;;;;;;ACvVA;;AAEA;AACA;AACA;AACA,oBAAmB,iBAAiB;AACpC;AACA;AACA;AACA;AACA;;;;;;;ACVA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;;AAEA;;AAEA;AACA;AACA;AACA,IAAG;AACH;AACA,IAAG;AACH;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA,IAAG;;AAEH;AACA;AACA,IAAG;;AAEH;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,iDAAgD;AAChD;AACA;AACA,MAAK;AACL;AACA,EAAC;;AAED;AACA;AACA;AACA,iDAAgD;AAChD;AACA;AACA;AACA,MAAK;AACL;AACA,EAAC;;AAED;;;;;;;AC7FA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,cAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,IAAG;AACH;AACA,IAAG;AACH;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA,QAAO;AACP;AACA;;AAEA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP,MAAK;;AAEL;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;;;;;;ACtEA;;AAEA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,SAAS;AACpB,YAAW,SAAS;AACpB;AACA,aAAY,OAAO;AACnB;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW,SAAS;AACpB;AACA;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;;AAEA;;;;;;;ACnDA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,gCAA+B;AAC/B,wCAAuC;AACvC;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,IAAG;AACH;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,IAAG;AACH;;;;;;;AC9EA;;AAEA;;AAEA;AACA;AACA;AACA,YAAW,cAAc;AACzB,YAAW,MAAM;AACjB,YAAW,eAAe;AAC1B,cAAa,EAAE;AACf;AACA;AACA;AACA;AACA;AACA,IAAG;;AAEH;AACA;;;;;;;ACnBA;;AAEA;AACA;AACA;;;;;;;ACJA;;AAEA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yEAAwE;AACxE;AACA;AACA;AACA,wDAAuD;AACvD;AACA;AACA;AACA,IAAG;;AAEH;AACA;AACA;AACA;AACA;AACA,QAAO,YAAY;AACnB;AACA;AACA,IAAG;;AAEH;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,EAAC;;AAED;AACA;AACA,EAAC;;AAED;;;;;;;AChGA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;;;;;;;ACXA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA,6CAA4C;AAC5C;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;;AAEA;AACA;AACA;;AAEA;AACA;AACA,IAAG;AACH;;;;;;;ACnLA;;AAEA;;AAEA;AACA;AACA;AACA,YAAW,SAAS;AACpB,YAAW,SAAS;AACpB,YAAW,OAAO;AAClB;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;;;;;;ACxBA;;AAEA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,cAAa,MAAM;AACnB;AACA;AACA;AACA;AACA;;;;;;;ACjBA;;AAEA;AACA;AACA;AACA,YAAW,MAAM;AACjB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,cAAa,MAAM;AACnB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;;;;;;ACzCA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,cAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;AACA;;;;;;;ACnBA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;;;;;;;ACbA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,cAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;;;;;;;ACbA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;;AAEA,kBAAiB,eAAe;;AAEhC;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA,IAAG;;AAEH;AACA;;;;;;;ACpDA;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,eAAc,OAAO;AACrB,iBAAgB;AAChB;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA,eAAc,OAAO;AACrB,iBAAgB,QAAQ;AACxB;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;;;;;;;ACnEA;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA,2CAA0C;AAC1C,UAAS;;AAET;AACA,6DAA4D,wBAAwB;AACpF;AACA,UAAS;;AAET;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA,mCAAkC;AAClC,gCAA+B,aAAa,EAAE;AAC9C;AACA;AACA,MAAK;AACL;;;;;;;ACpDA;;AAEA;;AAEA;AACA;AACA;AACA;AACA,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,cAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,IAAG;;AAEH;AACA;AACA;AACA,MAAK;AACL;AACA,MAAK;AACL;AACA,MAAK;AACL;AACA;AACA,IAAG;;AAEH;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,IAAG;;AAEH;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,IAAG;;AAEH;AACA;;;;;;;ACxEA;;AAEA;AACA;AACA;AACA;AACA,YAAW,QAAQ;AACnB;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;;AAEA;;;;;;;AClBA;;AAEA;;AAEA;AACA;AACA;AACA;AACA,YAAW,SAAS;AACpB;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,IAAG;;AAEH;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,IAAG;AACH;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;AACA;;AAEA;;;;;;;ACxDA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAA+B;AAC/B;AACA;AACA,YAAW,SAAS;AACpB,cAAa;AACb;AACA;AACA;AACA;AACA;AACA","file":"axios.js","sourcesContent":["(function webpackUniversalModuleDefinition(root, factory) {\n\tif(typeof exports === 'object' && typeof module === 'object')\n\t\tmodule.exports = factory();\n\telse if(typeof define === 'function' && define.amd)\n\t\tdefine([], factory);\n\telse if(typeof exports === 'object')\n\t\texports[\"axios\"] = factory();\n\telse\n\t\troot[\"axios\"] = factory();\n})(this, function() {\nreturn \n\n\n// WEBPACK FOOTER //\n// webpack/universalModuleDefinition"," \t// The module cache\n \tvar installedModules = {};\n\n \t// The require function\n \tfunction __webpack_require__(moduleId) {\n\n \t\t// Check if module is in cache\n \t\tif(installedModules[moduleId])\n \t\t\treturn installedModules[moduleId].exports;\n\n \t\t// Create a new module (and put it into the cache)\n \t\tvar module = installedModules[moduleId] = {\n \t\t\texports: {},\n \t\t\tid: moduleId,\n \t\t\tloaded: false\n \t\t};\n\n \t\t// Execute the module function\n \t\tmodules[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n\n \t\t// Flag the module as loaded\n \t\tmodule.loaded = true;\n\n \t\t// Return the exports of the module\n \t\treturn module.exports;\n \t}\n\n\n \t// expose the modules object (__webpack_modules__)\n \t__webpack_require__.m = modules;\n\n \t// expose the module cache\n \t__webpack_require__.c = installedModules;\n\n \t// __webpack_public_path__\n \t__webpack_require__.p = \"\";\n\n \t// Load entry module and return exports\n \treturn __webpack_require__(0);\n\n\n\n// WEBPACK FOOTER //\n// webpack/bootstrap 18e5718d1c92e108675b","module.exports = require('./lib/axios');\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./index.js\n// module id = 0\n// module chunks = 0","'use strict';\n\nvar utils = require('./utils');\nvar bind = require('./helpers/bind');\nvar Axios = require('./core/Axios');\nvar mergeConfig = require('./core/mergeConfig');\nvar defaults = require('./defaults');\n\n/**\n * Create an instance of Axios\n *\n * @param {Object} defaultConfig The default config for the instance\n * @return {Axios} A new instance of Axios\n */\nfunction createInstance(defaultConfig) {\n var context = new Axios(defaultConfig);\n var instance = bind(Axios.prototype.request, context);\n\n // Copy axios.prototype to instance\n utils.extend(instance, Axios.prototype, context);\n\n // Copy context to instance\n utils.extend(instance, context);\n\n return instance;\n}\n\n// Create the default instance to be exported\nvar axios = createInstance(defaults);\n\n// Expose Axios class to allow class inheritance\naxios.Axios = Axios;\n\n// Factory for creating new instances\naxios.create = function create(instanceConfig) {\n return createInstance(mergeConfig(axios.defaults, instanceConfig));\n};\n\n// Expose Cancel & CancelToken\naxios.Cancel = require('./cancel/Cancel');\naxios.CancelToken = require('./cancel/CancelToken');\naxios.isCancel = require('./cancel/isCancel');\n\n// Expose all/spread\naxios.all = function all(promises) {\n return Promise.all(promises);\n};\naxios.spread = require('./helpers/spread');\n\nmodule.exports = axios;\n\n// Allow use of default import syntax in TypeScript\nmodule.exports.default = axios;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/axios.js\n// module id = 1\n// module chunks = 0","'use strict';\n\nvar bind = require('./helpers/bind');\n\n/*global toString:true*/\n\n// utils is a library of generic helper functions non-specific to axios\n\nvar toString = Object.prototype.toString;\n\n/**\n * Determine if a value is an Array\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an Array, otherwise false\n */\nfunction isArray(val) {\n return toString.call(val) === '[object Array]';\n}\n\n/**\n * Determine if a value is undefined\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if the value is undefined, otherwise false\n */\nfunction isUndefined(val) {\n return typeof val === 'undefined';\n}\n\n/**\n * Determine if a value is a Buffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Buffer, otherwise false\n */\nfunction isBuffer(val) {\n return val !== null && !isUndefined(val) && val.constructor !== null && !isUndefined(val.constructor)\n && typeof val.constructor.isBuffer === 'function' && val.constructor.isBuffer(val);\n}\n\n/**\n * Determine if a value is an ArrayBuffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an ArrayBuffer, otherwise false\n */\nfunction isArrayBuffer(val) {\n return toString.call(val) === '[object ArrayBuffer]';\n}\n\n/**\n * Determine if a value is a FormData\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an FormData, otherwise false\n */\nfunction isFormData(val) {\n return (typeof FormData !== 'undefined') && (val instanceof FormData);\n}\n\n/**\n * Determine if a value is a view on an ArrayBuffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false\n */\nfunction isArrayBufferView(val) {\n var result;\n if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) {\n result = ArrayBuffer.isView(val);\n } else {\n result = (val) && (val.buffer) && (val.buffer instanceof ArrayBuffer);\n }\n return result;\n}\n\n/**\n * Determine if a value is a String\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a String, otherwise false\n */\nfunction isString(val) {\n return typeof val === 'string';\n}\n\n/**\n * Determine if a value is a Number\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Number, otherwise false\n */\nfunction isNumber(val) {\n return typeof val === 'number';\n}\n\n/**\n * Determine if a value is an Object\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an Object, otherwise false\n */\nfunction isObject(val) {\n return val !== null && typeof val === 'object';\n}\n\n/**\n * Determine if a value is a Date\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Date, otherwise false\n */\nfunction isDate(val) {\n return toString.call(val) === '[object Date]';\n}\n\n/**\n * Determine if a value is a File\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a File, otherwise false\n */\nfunction isFile(val) {\n return toString.call(val) === '[object File]';\n}\n\n/**\n * Determine if a value is a Blob\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Blob, otherwise false\n */\nfunction isBlob(val) {\n return toString.call(val) === '[object Blob]';\n}\n\n/**\n * Determine if a value is a Function\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Function, otherwise false\n */\nfunction isFunction(val) {\n return toString.call(val) === '[object Function]';\n}\n\n/**\n * Determine if a value is a Stream\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Stream, otherwise false\n */\nfunction isStream(val) {\n return isObject(val) && isFunction(val.pipe);\n}\n\n/**\n * Determine if a value is a URLSearchParams object\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a URLSearchParams object, otherwise false\n */\nfunction isURLSearchParams(val) {\n return typeof URLSearchParams !== 'undefined' && val instanceof URLSearchParams;\n}\n\n/**\n * Trim excess whitespace off the beginning and end of a string\n *\n * @param {String} str The String to trim\n * @returns {String} The String freed of excess whitespace\n */\nfunction trim(str) {\n return str.replace(/^\\s*/, '').replace(/\\s*$/, '');\n}\n\n/**\n * Determine if we're running in a standard browser environment\n *\n * This allows axios to run in a web worker, and react-native.\n * Both environments support XMLHttpRequest, but not fully standard globals.\n *\n * web workers:\n * typeof window -> undefined\n * typeof document -> undefined\n *\n * react-native:\n * navigator.product -> 'ReactNative'\n * nativescript\n * navigator.product -> 'NativeScript' or 'NS'\n */\nfunction isStandardBrowserEnv() {\n if (typeof navigator !== 'undefined' && (navigator.product === 'ReactNative' ||\n navigator.product === 'NativeScript' ||\n navigator.product === 'NS')) {\n return false;\n }\n return (\n typeof window !== 'undefined' &&\n typeof document !== 'undefined'\n );\n}\n\n/**\n * Iterate over an Array or an Object invoking a function for each item.\n *\n * If `obj` is an Array callback will be called passing\n * the value, index, and complete array for each item.\n *\n * If 'obj' is an Object callback will be called passing\n * the value, key, and complete object for each property.\n *\n * @param {Object|Array} obj The object to iterate\n * @param {Function} fn The callback to invoke for each item\n */\nfunction forEach(obj, fn) {\n // Don't bother if no value provided\n if (obj === null || typeof obj === 'undefined') {\n return;\n }\n\n // Force an array if not already something iterable\n if (typeof obj !== 'object') {\n /*eslint no-param-reassign:0*/\n obj = [obj];\n }\n\n if (isArray(obj)) {\n // Iterate over array values\n for (var i = 0, l = obj.length; i < l; i++) {\n fn.call(null, obj[i], i, obj);\n }\n } else {\n // Iterate over object keys\n for (var key in obj) {\n if (Object.prototype.hasOwnProperty.call(obj, key)) {\n fn.call(null, obj[key], key, obj);\n }\n }\n }\n}\n\n/**\n * Accepts varargs expecting each argument to be an object, then\n * immutably merges the properties of each object and returns result.\n *\n * When multiple objects contain the same key the later object in\n * the arguments list will take precedence.\n *\n * Example:\n *\n * ```js\n * var result = merge({foo: 123}, {foo: 456});\n * console.log(result.foo); // outputs 456\n * ```\n *\n * @param {Object} obj1 Object to merge\n * @returns {Object} Result of all merge properties\n */\nfunction merge(/* obj1, obj2, obj3, ... */) {\n var result = {};\n function assignValue(val, key) {\n if (typeof result[key] === 'object' && typeof val === 'object') {\n result[key] = merge(result[key], val);\n } else {\n result[key] = val;\n }\n }\n\n for (var i = 0, l = arguments.length; i < l; i++) {\n forEach(arguments[i], assignValue);\n }\n return result;\n}\n\n/**\n * Function equal to merge with the difference being that no reference\n * to original objects is kept.\n *\n * @see merge\n * @param {Object} obj1 Object to merge\n * @returns {Object} Result of all merge properties\n */\nfunction deepMerge(/* obj1, obj2, obj3, ... */) {\n var result = {};\n function assignValue(val, key) {\n if (typeof result[key] === 'object' && typeof val === 'object') {\n result[key] = deepMerge(result[key], val);\n } else if (typeof val === 'object') {\n result[key] = deepMerge({}, val);\n } else {\n result[key] = val;\n }\n }\n\n for (var i = 0, l = arguments.length; i < l; i++) {\n forEach(arguments[i], assignValue);\n }\n return result;\n}\n\n/**\n * Extends object a by mutably adding to it the properties of object b.\n *\n * @param {Object} a The object to be extended\n * @param {Object} b The object to copy properties from\n * @param {Object} thisArg The object to bind function to\n * @return {Object} The resulting value of object a\n */\nfunction extend(a, b, thisArg) {\n forEach(b, function assignValue(val, key) {\n if (thisArg && typeof val === 'function') {\n a[key] = bind(val, thisArg);\n } else {\n a[key] = val;\n }\n });\n return a;\n}\n\nmodule.exports = {\n isArray: isArray,\n isArrayBuffer: isArrayBuffer,\n isBuffer: isBuffer,\n isFormData: isFormData,\n isArrayBufferView: isArrayBufferView,\n isString: isString,\n isNumber: isNumber,\n isObject: isObject,\n isUndefined: isUndefined,\n isDate: isDate,\n isFile: isFile,\n isBlob: isBlob,\n isFunction: isFunction,\n isStream: isStream,\n isURLSearchParams: isURLSearchParams,\n isStandardBrowserEnv: isStandardBrowserEnv,\n forEach: forEach,\n merge: merge,\n deepMerge: deepMerge,\n extend: extend,\n trim: trim\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/utils.js\n// module id = 2\n// module chunks = 0","'use strict';\n\nmodule.exports = function bind(fn, thisArg) {\n return function wrap() {\n var args = new Array(arguments.length);\n for (var i = 0; i < args.length; i++) {\n args[i] = arguments[i];\n }\n return fn.apply(thisArg, args);\n };\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/bind.js\n// module id = 3\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\nvar buildURL = require('../helpers/buildURL');\nvar InterceptorManager = require('./InterceptorManager');\nvar dispatchRequest = require('./dispatchRequest');\nvar mergeConfig = require('./mergeConfig');\n\n/**\n * Create a new instance of Axios\n *\n * @param {Object} instanceConfig The default config for the instance\n */\nfunction Axios(instanceConfig) {\n this.defaults = instanceConfig;\n this.interceptors = {\n request: new InterceptorManager(),\n response: new InterceptorManager()\n };\n}\n\n/**\n * Dispatch a request\n *\n * @param {Object} config The config specific for this request (merged with this.defaults)\n */\nAxios.prototype.request = function request(config) {\n /*eslint no-param-reassign:0*/\n // Allow for axios('example/url'[, config]) a la fetch API\n if (typeof config === 'string') {\n config = arguments[1] || {};\n config.url = arguments[0];\n } else {\n config = config || {};\n }\n\n config = mergeConfig(this.defaults, config);\n\n // Set config.method\n if (config.method) {\n config.method = config.method.toLowerCase();\n } else if (this.defaults.method) {\n config.method = this.defaults.method.toLowerCase();\n } else {\n config.method = 'get';\n }\n\n // Hook up interceptors middleware\n var chain = [dispatchRequest, undefined];\n var promise = Promise.resolve(config);\n\n this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) {\n chain.unshift(interceptor.fulfilled, interceptor.rejected);\n });\n\n this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) {\n chain.push(interceptor.fulfilled, interceptor.rejected);\n });\n\n while (chain.length) {\n promise = promise.then(chain.shift(), chain.shift());\n }\n\n return promise;\n};\n\nAxios.prototype.getUri = function getUri(config) {\n config = mergeConfig(this.defaults, config);\n return buildURL(config.url, config.params, config.paramsSerializer).replace(/^\\?/, '');\n};\n\n// Provide aliases for supported request methods\nutils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) {\n /*eslint func-names:0*/\n Axios.prototype[method] = function(url, config) {\n return this.request(utils.merge(config || {}, {\n method: method,\n url: url\n }));\n };\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n /*eslint func-names:0*/\n Axios.prototype[method] = function(url, data, config) {\n return this.request(utils.merge(config || {}, {\n method: method,\n url: url,\n data: data\n }));\n };\n});\n\nmodule.exports = Axios;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/Axios.js\n// module id = 4\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nfunction encode(val) {\n return encodeURIComponent(val).\n replace(/%40/gi, '@').\n replace(/%3A/gi, ':').\n replace(/%24/g, '$').\n replace(/%2C/gi, ',').\n replace(/%20/g, '+').\n replace(/%5B/gi, '[').\n replace(/%5D/gi, ']');\n}\n\n/**\n * Build a URL by appending params to the end\n *\n * @param {string} url The base of the url (e.g., http://www.google.com)\n * @param {object} [params] The params to be appended\n * @returns {string} The formatted url\n */\nmodule.exports = function buildURL(url, params, paramsSerializer) {\n /*eslint no-param-reassign:0*/\n if (!params) {\n return url;\n }\n\n var serializedParams;\n if (paramsSerializer) {\n serializedParams = paramsSerializer(params);\n } else if (utils.isURLSearchParams(params)) {\n serializedParams = params.toString();\n } else {\n var parts = [];\n\n utils.forEach(params, function serialize(val, key) {\n if (val === null || typeof val === 'undefined') {\n return;\n }\n\n if (utils.isArray(val)) {\n key = key + '[]';\n } else {\n val = [val];\n }\n\n utils.forEach(val, function parseValue(v) {\n if (utils.isDate(v)) {\n v = v.toISOString();\n } else if (utils.isObject(v)) {\n v = JSON.stringify(v);\n }\n parts.push(encode(key) + '=' + encode(v));\n });\n });\n\n serializedParams = parts.join('&');\n }\n\n if (serializedParams) {\n var hashmarkIndex = url.indexOf('#');\n if (hashmarkIndex !== -1) {\n url = url.slice(0, hashmarkIndex);\n }\n\n url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams;\n }\n\n return url;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/buildURL.js\n// module id = 5\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nfunction InterceptorManager() {\n this.handlers = [];\n}\n\n/**\n * Add a new interceptor to the stack\n *\n * @param {Function} fulfilled The function to handle `then` for a `Promise`\n * @param {Function} rejected The function to handle `reject` for a `Promise`\n *\n * @return {Number} An ID used to remove interceptor later\n */\nInterceptorManager.prototype.use = function use(fulfilled, rejected) {\n this.handlers.push({\n fulfilled: fulfilled,\n rejected: rejected\n });\n return this.handlers.length - 1;\n};\n\n/**\n * Remove an interceptor from the stack\n *\n * @param {Number} id The ID that was returned by `use`\n */\nInterceptorManager.prototype.eject = function eject(id) {\n if (this.handlers[id]) {\n this.handlers[id] = null;\n }\n};\n\n/**\n * Iterate over all the registered interceptors\n *\n * This method is particularly useful for skipping over any\n * interceptors that may have become `null` calling `eject`.\n *\n * @param {Function} fn The function to call for each interceptor\n */\nInterceptorManager.prototype.forEach = function forEach(fn) {\n utils.forEach(this.handlers, function forEachHandler(h) {\n if (h !== null) {\n fn(h);\n }\n });\n};\n\nmodule.exports = InterceptorManager;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/InterceptorManager.js\n// module id = 6\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\nvar transformData = require('./transformData');\nvar isCancel = require('../cancel/isCancel');\nvar defaults = require('../defaults');\n\n/**\n * Throws a `Cancel` if cancellation has been requested.\n */\nfunction throwIfCancellationRequested(config) {\n if (config.cancelToken) {\n config.cancelToken.throwIfRequested();\n }\n}\n\n/**\n * Dispatch a request to the server using the configured adapter.\n *\n * @param {object} config The config that is to be used for the request\n * @returns {Promise} The Promise to be fulfilled\n */\nmodule.exports = function dispatchRequest(config) {\n throwIfCancellationRequested(config);\n\n // Ensure headers exist\n config.headers = config.headers || {};\n\n // Transform request data\n config.data = transformData(\n config.data,\n config.headers,\n config.transformRequest\n );\n\n // Flatten headers\n config.headers = utils.merge(\n config.headers.common || {},\n config.headers[config.method] || {},\n config.headers\n );\n\n utils.forEach(\n ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'],\n function cleanHeaderConfig(method) {\n delete config.headers[method];\n }\n );\n\n var adapter = config.adapter || defaults.adapter;\n\n return adapter(config).then(function onAdapterResolution(response) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n response.data = transformData(\n response.data,\n response.headers,\n config.transformResponse\n );\n\n return response;\n }, function onAdapterRejection(reason) {\n if (!isCancel(reason)) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n if (reason && reason.response) {\n reason.response.data = transformData(\n reason.response.data,\n reason.response.headers,\n config.transformResponse\n );\n }\n }\n\n return Promise.reject(reason);\n });\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/dispatchRequest.js\n// module id = 7\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\n/**\n * Transform the data for a request or a response\n *\n * @param {Object|String} data The data to be transformed\n * @param {Array} headers The headers for the request or response\n * @param {Array|Function} fns A single function or Array of functions\n * @returns {*} The resulting transformed data\n */\nmodule.exports = function transformData(data, headers, fns) {\n /*eslint no-param-reassign:0*/\n utils.forEach(fns, function transform(fn) {\n data = fn(data, headers);\n });\n\n return data;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/transformData.js\n// module id = 8\n// module chunks = 0","'use strict';\n\nmodule.exports = function isCancel(value) {\n return !!(value && value.__CANCEL__);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/cancel/isCancel.js\n// module id = 9\n// module chunks = 0","'use strict';\n\nvar utils = require('./utils');\nvar normalizeHeaderName = require('./helpers/normalizeHeaderName');\n\nvar DEFAULT_CONTENT_TYPE = {\n 'Content-Type': 'application/x-www-form-urlencoded'\n};\n\nfunction setContentTypeIfUnset(headers, value) {\n if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) {\n headers['Content-Type'] = value;\n }\n}\n\nfunction getDefaultAdapter() {\n var adapter;\n if (typeof XMLHttpRequest !== 'undefined') {\n // For browsers use XHR adapter\n adapter = require('./adapters/xhr');\n } else if (typeof process !== 'undefined' && Object.prototype.toString.call(process) === '[object process]') {\n // For node use HTTP adapter\n adapter = require('./adapters/http');\n }\n return adapter;\n}\n\nvar defaults = {\n adapter: getDefaultAdapter(),\n\n transformRequest: [function transformRequest(data, headers) {\n normalizeHeaderName(headers, 'Accept');\n normalizeHeaderName(headers, 'Content-Type');\n if (utils.isFormData(data) ||\n utils.isArrayBuffer(data) ||\n utils.isBuffer(data) ||\n utils.isStream(data) ||\n utils.isFile(data) ||\n utils.isBlob(data)\n ) {\n return data;\n }\n if (utils.isArrayBufferView(data)) {\n return data.buffer;\n }\n if (utils.isURLSearchParams(data)) {\n setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8');\n return data.toString();\n }\n if (utils.isObject(data)) {\n setContentTypeIfUnset(headers, 'application/json;charset=utf-8');\n return JSON.stringify(data);\n }\n return data;\n }],\n\n transformResponse: [function transformResponse(data) {\n /*eslint no-param-reassign:0*/\n if (typeof data === 'string') {\n try {\n data = JSON.parse(data);\n } catch (e) { /* Ignore */ }\n }\n return data;\n }],\n\n /**\n * A timeout in milliseconds to abort a request. If set to 0 (default) a\n * timeout is not created.\n */\n timeout: 0,\n\n xsrfCookieName: 'XSRF-TOKEN',\n xsrfHeaderName: 'X-XSRF-TOKEN',\n\n maxContentLength: -1,\n\n validateStatus: function validateStatus(status) {\n return status >= 200 && status < 300;\n }\n};\n\ndefaults.headers = {\n common: {\n 'Accept': 'application/json, text/plain, */*'\n }\n};\n\nutils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) {\n defaults.headers[method] = {};\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE);\n});\n\nmodule.exports = defaults;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/defaults.js\n// module id = 10\n// module chunks = 0","'use strict';\n\nvar utils = require('../utils');\n\nmodule.exports = function normalizeHeaderName(headers, normalizedName) {\n utils.forEach(headers, function processHeader(value, name) {\n if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) {\n headers[normalizedName] = value;\n delete headers[name];\n }\n });\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/normalizeHeaderName.js\n// module id = 11\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\nvar settle = require('./../core/settle');\nvar buildURL = require('./../helpers/buildURL');\nvar buildFullPath = require('../core/buildFullPath');\nvar parseHeaders = require('./../helpers/parseHeaders');\nvar isURLSameOrigin = require('./../helpers/isURLSameOrigin');\nvar createError = require('../core/createError');\n\nmodule.exports = function xhrAdapter(config) {\n return new Promise(function dispatchXhrRequest(resolve, reject) {\n var requestData = config.data;\n var requestHeaders = config.headers;\n\n if (utils.isFormData(requestData)) {\n delete requestHeaders['Content-Type']; // Let the browser set it\n }\n\n var request = new XMLHttpRequest();\n\n // HTTP basic authentication\n if (config.auth) {\n var username = config.auth.username || '';\n var password = config.auth.password || '';\n requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password);\n }\n\n var fullPath = buildFullPath(config.baseURL, config.url);\n request.open(config.method.toUpperCase(), buildURL(fullPath, config.params, config.paramsSerializer), true);\n\n // Set the request timeout in MS\n request.timeout = config.timeout;\n\n // Listen for ready state\n request.onreadystatechange = function handleLoad() {\n if (!request || request.readyState !== 4) {\n return;\n }\n\n // The request errored out and we didn't get a response, this will be\n // handled by onerror instead\n // With one exception: request that using file: protocol, most browsers\n // will return status as 0 even though it's a successful request\n if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) {\n return;\n }\n\n // Prepare the response\n var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null;\n var responseData = !config.responseType || config.responseType === 'text' ? request.responseText : request.response;\n var response = {\n data: responseData,\n status: request.status,\n statusText: request.statusText,\n headers: responseHeaders,\n config: config,\n request: request\n };\n\n settle(resolve, reject, response);\n\n // Clean up request\n request = null;\n };\n\n // Handle browser request cancellation (as opposed to a manual cancellation)\n request.onabort = function handleAbort() {\n if (!request) {\n return;\n }\n\n reject(createError('Request aborted', config, 'ECONNABORTED', request));\n\n // Clean up request\n request = null;\n };\n\n // Handle low level network errors\n request.onerror = function handleError() {\n // Real errors are hidden from us by the browser\n // onerror should only fire if it's a network error\n reject(createError('Network Error', config, null, request));\n\n // Clean up request\n request = null;\n };\n\n // Handle timeout\n request.ontimeout = function handleTimeout() {\n var timeoutErrorMessage = 'timeout of ' + config.timeout + 'ms exceeded';\n if (config.timeoutErrorMessage) {\n timeoutErrorMessage = config.timeoutErrorMessage;\n }\n reject(createError(timeoutErrorMessage, config, 'ECONNABORTED',\n request));\n\n // Clean up request\n request = null;\n };\n\n // Add xsrf header\n // This is only done if running in a standard browser environment.\n // Specifically not if we're in a web worker, or react-native.\n if (utils.isStandardBrowserEnv()) {\n var cookies = require('./../helpers/cookies');\n\n // Add xsrf header\n var xsrfValue = (config.withCredentials || isURLSameOrigin(fullPath)) && config.xsrfCookieName ?\n cookies.read(config.xsrfCookieName) :\n undefined;\n\n if (xsrfValue) {\n requestHeaders[config.xsrfHeaderName] = xsrfValue;\n }\n }\n\n // Add headers to the request\n if ('setRequestHeader' in request) {\n utils.forEach(requestHeaders, function setRequestHeader(val, key) {\n if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') {\n // Remove Content-Type if data is undefined\n delete requestHeaders[key];\n } else {\n // Otherwise add header to the request\n request.setRequestHeader(key, val);\n }\n });\n }\n\n // Add withCredentials to request if needed\n if (!utils.isUndefined(config.withCredentials)) {\n request.withCredentials = !!config.withCredentials;\n }\n\n // Add responseType to request if needed\n if (config.responseType) {\n try {\n request.responseType = config.responseType;\n } catch (e) {\n // Expected DOMException thrown by browsers not compatible XMLHttpRequest Level 2.\n // But, this can be suppressed for 'json' type as it can be parsed by default 'transformResponse' function.\n if (config.responseType !== 'json') {\n throw e;\n }\n }\n }\n\n // Handle progress if needed\n if (typeof config.onDownloadProgress === 'function') {\n request.addEventListener('progress', config.onDownloadProgress);\n }\n\n // Not all browsers support upload events\n if (typeof config.onUploadProgress === 'function' && request.upload) {\n request.upload.addEventListener('progress', config.onUploadProgress);\n }\n\n if (config.cancelToken) {\n // Handle cancellation\n config.cancelToken.promise.then(function onCanceled(cancel) {\n if (!request) {\n return;\n }\n\n request.abort();\n reject(cancel);\n // Clean up request\n request = null;\n });\n }\n\n if (requestData === undefined) {\n requestData = null;\n }\n\n // Send the request\n request.send(requestData);\n });\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/adapters/xhr.js\n// module id = 12\n// module chunks = 0","'use strict';\n\nvar createError = require('./createError');\n\n/**\n * Resolve or reject a Promise based on response status.\n *\n * @param {Function} resolve A function that resolves the promise.\n * @param {Function} reject A function that rejects the promise.\n * @param {object} response The response.\n */\nmodule.exports = function settle(resolve, reject, response) {\n var validateStatus = response.config.validateStatus;\n if (!validateStatus || validateStatus(response.status)) {\n resolve(response);\n } else {\n reject(createError(\n 'Request failed with status code ' + response.status,\n response.config,\n null,\n response.request,\n response\n ));\n }\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/settle.js\n// module id = 13\n// module chunks = 0","'use strict';\n\nvar enhanceError = require('./enhanceError');\n\n/**\n * Create an Error with the specified message, config, error code, request and response.\n *\n * @param {string} message The error message.\n * @param {Object} config The config.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n * @returns {Error} The created error.\n */\nmodule.exports = function createError(message, config, code, request, response) {\n var error = new Error(message);\n return enhanceError(error, config, code, request, response);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/createError.js\n// module id = 14\n// module chunks = 0","'use strict';\n\n/**\n * Update an Error with the specified config, error code, and response.\n *\n * @param {Error} error The error to update.\n * @param {Object} config The config.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n * @returns {Error} The error.\n */\nmodule.exports = function enhanceError(error, config, code, request, response) {\n error.config = config;\n if (code) {\n error.code = code;\n }\n\n error.request = request;\n error.response = response;\n error.isAxiosError = true;\n\n error.toJSON = function() {\n return {\n // Standard\n message: this.message,\n name: this.name,\n // Microsoft\n description: this.description,\n number: this.number,\n // Mozilla\n fileName: this.fileName,\n lineNumber: this.lineNumber,\n columnNumber: this.columnNumber,\n stack: this.stack,\n // Axios\n config: this.config,\n code: this.code\n };\n };\n return error;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/enhanceError.js\n// module id = 15\n// module chunks = 0","'use strict';\n\nvar isAbsoluteURL = require('../helpers/isAbsoluteURL');\nvar combineURLs = require('../helpers/combineURLs');\n\n/**\n * Creates a new URL by combining the baseURL with the requestedURL,\n * only when the requestedURL is not already an absolute URL.\n * If the requestURL is absolute, this function returns the requestedURL untouched.\n *\n * @param {string} baseURL The base URL\n * @param {string} requestedURL Absolute or relative URL to combine\n * @returns {string} The combined full path\n */\nmodule.exports = function buildFullPath(baseURL, requestedURL) {\n if (baseURL && !isAbsoluteURL(requestedURL)) {\n return combineURLs(baseURL, requestedURL);\n }\n return requestedURL;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/buildFullPath.js\n// module id = 16\n// module chunks = 0","'use strict';\n\n/**\n * Determines whether the specified URL is absolute\n *\n * @param {string} url The URL to test\n * @returns {boolean} True if the specified URL is absolute, otherwise false\n */\nmodule.exports = function isAbsoluteURL(url) {\n // A URL is considered absolute if it begins with \"://\" or \"//\" (protocol-relative URL).\n // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed\n // by any combination of letters, digits, plus, period, or hyphen.\n return /^([a-z][a-z\\d\\+\\-\\.]*:)?\\/\\//i.test(url);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/isAbsoluteURL.js\n// module id = 17\n// module chunks = 0","'use strict';\n\n/**\n * Creates a new URL by combining the specified URLs\n *\n * @param {string} baseURL The base URL\n * @param {string} relativeURL The relative URL\n * @returns {string} The combined URL\n */\nmodule.exports = function combineURLs(baseURL, relativeURL) {\n return relativeURL\n ? baseURL.replace(/\\/+$/, '') + '/' + relativeURL.replace(/^\\/+/, '')\n : baseURL;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/combineURLs.js\n// module id = 18\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\n// Headers whose duplicates are ignored by node\n// c.f. https://nodejs.org/api/http.html#http_message_headers\nvar ignoreDuplicateOf = [\n 'age', 'authorization', 'content-length', 'content-type', 'etag',\n 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since',\n 'last-modified', 'location', 'max-forwards', 'proxy-authorization',\n 'referer', 'retry-after', 'user-agent'\n];\n\n/**\n * Parse headers into an object\n *\n * ```\n * Date: Wed, 27 Aug 2014 08:58:49 GMT\n * Content-Type: application/json\n * Connection: keep-alive\n * Transfer-Encoding: chunked\n * ```\n *\n * @param {String} headers Headers needing to be parsed\n * @returns {Object} Headers parsed into an object\n */\nmodule.exports = function parseHeaders(headers) {\n var parsed = {};\n var key;\n var val;\n var i;\n\n if (!headers) { return parsed; }\n\n utils.forEach(headers.split('\\n'), function parser(line) {\n i = line.indexOf(':');\n key = utils.trim(line.substr(0, i)).toLowerCase();\n val = utils.trim(line.substr(i + 1));\n\n if (key) {\n if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) {\n return;\n }\n if (key === 'set-cookie') {\n parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]);\n } else {\n parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val;\n }\n }\n });\n\n return parsed;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/parseHeaders.js\n// module id = 19\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs have full support of the APIs needed to test\n // whether the request URL is of the same origin as current location.\n (function standardBrowserEnv() {\n var msie = /(msie|trident)/i.test(navigator.userAgent);\n var urlParsingNode = document.createElement('a');\n var originURL;\n\n /**\n * Parse a URL to discover it's components\n *\n * @param {String} url The URL to be parsed\n * @returns {Object}\n */\n function resolveURL(url) {\n var href = url;\n\n if (msie) {\n // IE needs attribute set twice to normalize properties\n urlParsingNode.setAttribute('href', href);\n href = urlParsingNode.href;\n }\n\n urlParsingNode.setAttribute('href', href);\n\n // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils\n return {\n href: urlParsingNode.href,\n protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '',\n host: urlParsingNode.host,\n search: urlParsingNode.search ? urlParsingNode.search.replace(/^\\?/, '') : '',\n hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '',\n hostname: urlParsingNode.hostname,\n port: urlParsingNode.port,\n pathname: (urlParsingNode.pathname.charAt(0) === '/') ?\n urlParsingNode.pathname :\n '/' + urlParsingNode.pathname\n };\n }\n\n originURL = resolveURL(window.location.href);\n\n /**\n * Determine if a URL shares the same origin as the current location\n *\n * @param {String} requestURL The URL to test\n * @returns {boolean} True if URL shares the same origin, otherwise false\n */\n return function isURLSameOrigin(requestURL) {\n var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL;\n return (parsed.protocol === originURL.protocol &&\n parsed.host === originURL.host);\n };\n })() :\n\n // Non standard browser envs (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return function isURLSameOrigin() {\n return true;\n };\n })()\n);\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/isURLSameOrigin.js\n// module id = 20\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs support document.cookie\n (function standardBrowserEnv() {\n return {\n write: function write(name, value, expires, path, domain, secure) {\n var cookie = [];\n cookie.push(name + '=' + encodeURIComponent(value));\n\n if (utils.isNumber(expires)) {\n cookie.push('expires=' + new Date(expires).toGMTString());\n }\n\n if (utils.isString(path)) {\n cookie.push('path=' + path);\n }\n\n if (utils.isString(domain)) {\n cookie.push('domain=' + domain);\n }\n\n if (secure === true) {\n cookie.push('secure');\n }\n\n document.cookie = cookie.join('; ');\n },\n\n read: function read(name) {\n var match = document.cookie.match(new RegExp('(^|;\\\\s*)(' + name + ')=([^;]*)'));\n return (match ? decodeURIComponent(match[3]) : null);\n },\n\n remove: function remove(name) {\n this.write(name, '', Date.now() - 86400000);\n }\n };\n })() :\n\n // Non standard browser env (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return {\n write: function write() {},\n read: function read() { return null; },\n remove: function remove() {}\n };\n })()\n);\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/cookies.js\n// module id = 21\n// module chunks = 0","'use strict';\n\nvar utils = require('../utils');\n\n/**\n * Config-specific merge-function which creates a new config-object\n * by merging two configuration objects together.\n *\n * @param {Object} config1\n * @param {Object} config2\n * @returns {Object} New object resulting from merging config2 to config1\n */\nmodule.exports = function mergeConfig(config1, config2) {\n // eslint-disable-next-line no-param-reassign\n config2 = config2 || {};\n var config = {};\n\n var valueFromConfig2Keys = ['url', 'method', 'params', 'data'];\n var mergeDeepPropertiesKeys = ['headers', 'auth', 'proxy'];\n var defaultToConfig2Keys = [\n 'baseURL', 'url', 'transformRequest', 'transformResponse', 'paramsSerializer',\n 'timeout', 'withCredentials', 'adapter', 'responseType', 'xsrfCookieName',\n 'xsrfHeaderName', 'onUploadProgress', 'onDownloadProgress',\n 'maxContentLength', 'validateStatus', 'maxRedirects', 'httpAgent',\n 'httpsAgent', 'cancelToken', 'socketPath'\n ];\n\n utils.forEach(valueFromConfig2Keys, function valueFromConfig2(prop) {\n if (typeof config2[prop] !== 'undefined') {\n config[prop] = config2[prop];\n }\n });\n\n utils.forEach(mergeDeepPropertiesKeys, function mergeDeepProperties(prop) {\n if (utils.isObject(config2[prop])) {\n config[prop] = utils.deepMerge(config1[prop], config2[prop]);\n } else if (typeof config2[prop] !== 'undefined') {\n config[prop] = config2[prop];\n } else if (utils.isObject(config1[prop])) {\n config[prop] = utils.deepMerge(config1[prop]);\n } else if (typeof config1[prop] !== 'undefined') {\n config[prop] = config1[prop];\n }\n });\n\n utils.forEach(defaultToConfig2Keys, function defaultToConfig2(prop) {\n if (typeof config2[prop] !== 'undefined') {\n config[prop] = config2[prop];\n } else if (typeof config1[prop] !== 'undefined') {\n config[prop] = config1[prop];\n }\n });\n\n var axiosKeys = valueFromConfig2Keys\n .concat(mergeDeepPropertiesKeys)\n .concat(defaultToConfig2Keys);\n\n var otherKeys = Object\n .keys(config2)\n .filter(function filterAxiosKeys(key) {\n return axiosKeys.indexOf(key) === -1;\n });\n\n utils.forEach(otherKeys, function otherKeysDefaultToConfig2(prop) {\n if (typeof config2[prop] !== 'undefined') {\n config[prop] = config2[prop];\n } else if (typeof config1[prop] !== 'undefined') {\n config[prop] = config1[prop];\n }\n });\n\n return config;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/mergeConfig.js\n// module id = 22\n// module chunks = 0","'use strict';\n\n/**\n * A `Cancel` is an object that is thrown when an operation is canceled.\n *\n * @class\n * @param {string=} message The message.\n */\nfunction Cancel(message) {\n this.message = message;\n}\n\nCancel.prototype.toString = function toString() {\n return 'Cancel' + (this.message ? ': ' + this.message : '');\n};\n\nCancel.prototype.__CANCEL__ = true;\n\nmodule.exports = Cancel;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/cancel/Cancel.js\n// module id = 23\n// module chunks = 0","'use strict';\n\nvar Cancel = require('./Cancel');\n\n/**\n * A `CancelToken` is an object that can be used to request cancellation of an operation.\n *\n * @class\n * @param {Function} executor The executor function.\n */\nfunction CancelToken(executor) {\n if (typeof executor !== 'function') {\n throw new TypeError('executor must be a function.');\n }\n\n var resolvePromise;\n this.promise = new Promise(function promiseExecutor(resolve) {\n resolvePromise = resolve;\n });\n\n var token = this;\n executor(function cancel(message) {\n if (token.reason) {\n // Cancellation has already been requested\n return;\n }\n\n token.reason = new Cancel(message);\n resolvePromise(token.reason);\n });\n}\n\n/**\n * Throws a `Cancel` if cancellation has been requested.\n */\nCancelToken.prototype.throwIfRequested = function throwIfRequested() {\n if (this.reason) {\n throw this.reason;\n }\n};\n\n/**\n * Returns an object that contains a new `CancelToken` and a function that, when called,\n * cancels the `CancelToken`.\n */\nCancelToken.source = function source() {\n var cancel;\n var token = new CancelToken(function executor(c) {\n cancel = c;\n });\n return {\n token: token,\n cancel: cancel\n };\n};\n\nmodule.exports = CancelToken;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/cancel/CancelToken.js\n// module id = 24\n// module chunks = 0","'use strict';\n\n/**\n * Syntactic sugar for invoking a function and expanding an array for arguments.\n *\n * Common use case would be to use `Function.prototype.apply`.\n *\n * ```js\n * function f(x, y, z) {}\n * var args = [1, 2, 3];\n * f.apply(null, args);\n * ```\n *\n * With `spread` this example can be re-written.\n *\n * ```js\n * spread(function(x, y, z) {})([1, 2, 3]);\n * ```\n *\n * @param {Function} callback\n * @returns {Function}\n */\nmodule.exports = function spread(callback) {\n return function wrap(arr) {\n return callback.apply(null, arr);\n };\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/spread.js\n// module id = 25\n// module chunks = 0"],"sourceRoot":""} \ No newline at end of file +{"version":3,"sources":["webpack://axios/webpack/universalModuleDefinition","webpack://axios/webpack/bootstrap","webpack://axios/./index.js","webpack://axios/./lib/adapters/xhr.js","webpack://axios/./lib/axios.js","webpack://axios/./lib/cancel/Cancel.js","webpack://axios/./lib/cancel/CancelToken.js","webpack://axios/./lib/cancel/isCancel.js","webpack://axios/./lib/core/Axios.js","webpack://axios/./lib/core/InterceptorManager.js","webpack://axios/./lib/core/buildFullPath.js","webpack://axios/./lib/core/createError.js","webpack://axios/./lib/core/dispatchRequest.js","webpack://axios/./lib/core/enhanceError.js","webpack://axios/./lib/core/mergeConfig.js","webpack://axios/./lib/core/settle.js","webpack://axios/./lib/core/transformData.js","webpack://axios/./lib/defaults/index.js","webpack://axios/./lib/defaults/transitional.js","webpack://axios/./lib/env/data.js","webpack://axios/./lib/helpers/bind.js","webpack://axios/./lib/helpers/buildURL.js","webpack://axios/./lib/helpers/combineURLs.js","webpack://axios/./lib/helpers/cookies.js","webpack://axios/./lib/helpers/isAbsoluteURL.js","webpack://axios/./lib/helpers/isAxiosError.js","webpack://axios/./lib/helpers/isURLSameOrigin.js","webpack://axios/./lib/helpers/normalizeHeaderName.js","webpack://axios/./lib/helpers/parseHeaders.js","webpack://axios/./lib/helpers/spread.js","webpack://axios/./lib/helpers/validator.js","webpack://axios/./lib/utils.js"],"names":[],"mappings":"AAAA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC;AACD,O;QCVA;QACA;;QAEA;QACA;;QAEA;QACA;QACA;QACA;QACA;QACA;QACA;QACA;QACA;QACA;;QAEA;QACA;;QAEA;QACA;;QAEA;QACA;QACA;;;QAGA;QACA;;QAEA;QACA;;QAEA;QACA;QACA;QACA,0CAA0C,gCAAgC;QAC1E;QACA;;QAEA;QACA;QACA;QACA,wDAAwD,kBAAkB;QAC1E;QACA,iDAAiD,cAAc;QAC/D;;QAEA;QACA;QACA;QACA;QACA;QACA;QACA;QACA;QACA;QACA;QACA;QACA,yCAAyC,iCAAiC;QAC1E,gHAAgH,mBAAmB,EAAE;QACrI;QACA;;QAEA;QACA;QACA;QACA,2BAA2B,0BAA0B,EAAE;QACvD,iCAAiC,eAAe;QAChD;QACA;QACA;;QAEA;QACA,sDAAsD,+DAA+D;;QAErH;QACA;;;QAGA;QACA;;;;;;;;;;;;AClFA,iBAAiB,mBAAO,CAAC,mCAAa,E;;;;;;;;;;;;ACAzB;;AAEb,YAAY,mBAAO,CAAC,kCAAY;AAChC,aAAa,mBAAO,CAAC,8CAAkB;AACvC,cAAc,mBAAO,CAAC,sDAAsB;AAC5C,eAAe,mBAAO,CAAC,wDAAuB;AAC9C,oBAAoB,mBAAO,CAAC,0DAAuB;AACnD,mBAAmB,mBAAO,CAAC,gEAA2B;AACtD,sBAAsB,mBAAO,CAAC,sEAA8B;AAC5D,kBAAkB,mBAAO,CAAC,sDAAqB;AAC/C,2BAA2B,mBAAO,CAAC,gEAA0B;AAC7D,aAAa,mBAAO,CAAC,gDAAkB;;AAEvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA,4CAA4C;AAC5C;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,OAAO;AACP;AACA;AACA,OAAO;;AAEP;AACA;AACA;;AAEA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA,OAAO;AACP;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA,GAAG;AACH;;;;;;;;;;;;;ACnNa;;AAEb,YAAY,mBAAO,CAAC,+BAAS;AAC7B,WAAW,mBAAO,CAAC,6CAAgB;AACnC,YAAY,mBAAO,CAAC,yCAAc;AAClC,kBAAkB,mBAAO,CAAC,qDAAoB;AAC9C,eAAe,mBAAO,CAAC,2CAAY;;AAEnC;AACA;AACA;AACA,WAAW,OAAO;AAClB,YAAY,MAAM;AAClB;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA,eAAe,mBAAO,CAAC,+CAAiB;AACxC,oBAAoB,mBAAO,CAAC,yDAAsB;AAClD,iBAAiB,mBAAO,CAAC,mDAAmB;AAC5C,gBAAgB,mBAAO,CAAC,qCAAY;;AAEpC;AACA;AACA;AACA;AACA,eAAe,mBAAO,CAAC,iDAAkB;;AAEzC;AACA,qBAAqB,mBAAO,CAAC,6DAAwB;;AAErD;;AAEA;AACA;;;;;;;;;;;;;ACxDa;;AAEb;AACA;AACA;AACA;AACA,WAAW,QAAQ;AACnB;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;;AAEA;;;;;;;;;;;;;AClBa;;AAEb,aAAa,mBAAO,CAAC,wCAAU;;AAE/B;AACA;AACA;AACA;AACA,WAAW,SAAS;AACpB;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA,GAAG;;AAEH;;AAEA;AACA;AACA;;AAEA;AACA;;AAEA,eAAe,OAAO;AACtB;AACA;AACA;AACA,GAAG;;AAEH;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;;AAEL;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,GAAG;AACH;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,GAAG;AACH;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,GAAG;AACH;AACA;AACA;AACA;AACA;;AAEA;;;;;;;;;;;;;ACtHa;;AAEb;AACA;AACA;;;;;;;;;;;;;ACJa;;AAEb,YAAY,mBAAO,CAAC,kCAAY;AAChC,eAAe,mBAAO,CAAC,sDAAqB;AAC5C,yBAAyB,mBAAO,CAAC,8DAAsB;AACvD,sBAAsB,mBAAO,CAAC,wDAAmB;AACjD,kBAAkB,mBAAO,CAAC,gDAAe;AACzC,gBAAgB,mBAAO,CAAC,wDAAsB;;AAE9C;AACA;AACA;AACA;AACA,WAAW,OAAO;AAClB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,GAAG;AACH;AACA;;AAEA;;AAEA;AACA;AACA;AACA,GAAG;AACH;AACA,GAAG;AACH;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA,GAAG;;AAEH;AACA;AACA;AACA,GAAG;;AAEH;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;;;AAGA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;;AAEA;AACA;AACA,GAAG;AACH;AACA;;AAEA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,gDAAgD;AAChD;AACA;AACA,yBAAyB;AACzB,KAAK;AACL;AACA,CAAC;;AAED;AACA;AACA;AACA,gDAAgD;AAChD;AACA;AACA;AACA,KAAK;AACL;AACA,CAAC;;AAED;;;;;;;;;;;;;ACnJa;;AAEb,YAAY,mBAAO,CAAC,kCAAY;;AAEhC;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,SAAS;AACpB,WAAW,SAAS;AACpB;AACA,YAAY,OAAO;AACnB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,GAAG;AACH;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,SAAS;AACpB;AACA;AACA;AACA;AACA;AACA;AACA,GAAG;AACH;;AAEA;;;;;;;;;;;;;ACrDa;;AAEb,oBAAoB,mBAAO,CAAC,gEAA0B;AACtD,kBAAkB,mBAAO,CAAC,4DAAwB;;AAElD;AACA;AACA;AACA;AACA;AACA,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,aAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;AACA;;;;;;;;;;;;;ACnBa;;AAEb,mBAAmB,mBAAO,CAAC,kDAAgB;;AAE3C;AACA;AACA;AACA,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,aAAa,MAAM;AACnB;AACA;AACA;AACA;AACA;;;;;;;;;;;;;ACjBa;;AAEb,YAAY,mBAAO,CAAC,kCAAY;AAChC,oBAAoB,mBAAO,CAAC,oDAAiB;AAC7C,eAAe,mBAAO,CAAC,oDAAoB;AAC3C,eAAe,mBAAO,CAAC,4CAAa;AACpC,aAAa,mBAAO,CAAC,gDAAkB;;AAEvC;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,+BAA+B;AAC/B,uCAAuC;AACvC;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,GAAG;AACH;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,GAAG;AACH;;;;;;;;;;;;;ACtFa;;AAEb;AACA;AACA;AACA,WAAW,MAAM;AACjB,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,aAAa,MAAM;AACnB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;;;;;;;;;;;;AC1Ca;;AAEb,YAAY,mBAAO,CAAC,gCAAU;;AAE9B;AACA;AACA;AACA;AACA,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,aAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,KAAK;AACL,2BAA2B;AAC3B,KAAK;AACL;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,GAAG;;AAEH;AACA;;;;;;;;;;;;;AClGa;;AAEb,kBAAkB,mBAAO,CAAC,gDAAe;;AAEzC;AACA;AACA;AACA,WAAW,SAAS;AACpB,WAAW,SAAS;AACpB,WAAW,OAAO;AAClB;AACA;AACA;AACA;AACA;AACA,GAAG;AACH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;;;;;;;;;;;;ACxBa;;AAEb,YAAY,mBAAO,CAAC,kCAAY;AAChC,eAAe,mBAAO,CAAC,4CAAa;;AAEpC;AACA;AACA;AACA,WAAW,cAAc;AACzB,WAAW,MAAM;AACjB,WAAW,eAAe;AAC1B,aAAa,EAAE;AACf;AACA;AACA;AACA;AACA;AACA;AACA,GAAG;;AAEH;AACA;;;;;;;;;;;;;ACrBa;;AAEb,YAAY,mBAAO,CAAC,gCAAU;AAC9B,0BAA0B,mBAAO,CAAC,4EAAgC;AAClE,mBAAmB,mBAAO,CAAC,wDAAsB;AACjD,2BAA2B,mBAAO,CAAC,sDAAgB;;AAEnD;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,cAAc,mBAAO,CAAC,8CAAiB;AACvC,GAAG;AACH;AACA,cAAc,mBAAO,CAAC,+CAAkB;AACxC;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;;AAEA;;AAEA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wEAAwE;AACxE;AACA;AACA;AACA;AACA;AACA;AACA;AACA,GAAG;;AAEH;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,OAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,GAAG;;AAEH;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA,GAAG;;AAEH;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,CAAC;;AAED;AACA;AACA,CAAC;;AAED;;;;;;;;;;;;;AClIa;;AAEb;AACA;AACA;AACA;AACA;;;;;;;;;;;;ACNA;AACA;AACA,E;;;;;;;;;;;;ACFa;;AAEb;AACA;AACA;AACA,mBAAmB,iBAAiB;AACpC;AACA;AACA;AACA;AACA;;;;;;;;;;;;;ACVa;;AAEb,YAAY,mBAAO,CAAC,kCAAY;;AAEhC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,aAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,GAAG;AACH;AACA,GAAG;AACH;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA,OAAO;AACP;AACA;;AAEA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA,OAAO;AACP,KAAK;;AAEL;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;;;;;;;;;;;;ACrEa;;AAEb;AACA;AACA;AACA,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,aAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;;;;;;;;;;;;;ACba;;AAEb,YAAY,mBAAO,CAAC,kCAAY;;AAEhC;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA,0CAA0C;AAC1C,SAAS;;AAET;AACA,4DAA4D,wBAAwB;AACpF;AACA,SAAS;;AAET;AACA;AACA;AACA;AACA,KAAK;;AAEL;AACA;AACA;AACA,kCAAkC;AAClC,+BAA+B,aAAa,EAAE;AAC9C;AACA;AACA,KAAK;AACL;;;;;;;;;;;;;ACpDa;;AAEb;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;;;;;;;;;;;;;ACba;;AAEb,YAAY,mBAAO,CAAC,kCAAY;;AAEhC;AACA;AACA;AACA,WAAW,EAAE;AACb,aAAa,QAAQ;AACrB;AACA;AACA;AACA;;;;;;;;;;;;;ACZa;;AAEb,YAAY,mBAAO,CAAC,kCAAY;;AAEhC;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,cAAc,OAAO;AACrB,gBAAgB;AAChB;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA,cAAc,OAAO;AACrB,gBAAgB,QAAQ;AACxB;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;;AAEL;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;;;;;;;;;;;;;ACnEa;;AAEb,YAAY,mBAAO,CAAC,gCAAU;;AAE9B;AACA;AACA;AACA;AACA;AACA;AACA,GAAG;AACH;;;;;;;;;;;;;ACXa;;AAEb,YAAY,mBAAO,CAAC,kCAAY;;AAEhC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;;AAEA,iBAAiB,eAAe;;AAEhC;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,OAAO;AACP;AACA;AACA;AACA,GAAG;;AAEH;AACA;;;;;;;;;;;;;ACpDa;;AAEb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B;AAC/B;AACA;AACA,WAAW,SAAS;AACpB,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;;;;;;;;;;;;;AC1Ba;;AAEb,cAAc,mBAAO,CAAC,sCAAa;;AAEnC;;AAEA;AACA;AACA;AACA;AACA;AACA,CAAC;;AAED;;AAEA;AACA;AACA,WAAW,kBAAkB;AAC7B,WAAW,QAAQ;AACnB,WAAW,QAAQ;AACnB,aAAa;AACb;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,WAAW,SAAS;AACpB;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;;;;;;;;;;;;ACjFa;;AAEb,WAAW,mBAAO,CAAC,6CAAgB;;AAEnC;;AAEA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;AACA;AACA,GAAG;AACH;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,YAAY,QAAQ;AACpB;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,aAAa,OAAO;AACpB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,aAAa;AACxB,WAAW,SAAS;AACpB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,mCAAmC,OAAO;AAC1C;AACA;AACA,GAAG;AACH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,SAAS,GAAG,SAAS;AAC5C,2BAA2B;AAC3B;AACA;AACA,WAAW,OAAO;AAClB,aAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL,4BAA4B;AAC5B,KAAK;AACL;AACA,KAAK;AACL;AACA;AACA;;AAEA,uCAAuC,OAAO;AAC9C;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,WAAW,OAAO;AAClB,YAAY,OAAO;AACnB;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA,GAAG;AACH;AACA;;AAEA;AACA;AACA;AACA,WAAW,OAAO;AAClB,YAAY,OAAO;AACnB;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA","file":"axios.js","sourcesContent":["(function webpackUniversalModuleDefinition(root, factory) {\n\tif(typeof exports === 'object' && typeof module === 'object')\n\t\tmodule.exports = factory();\n\telse if(typeof define === 'function' && define.amd)\n\t\tdefine([], factory);\n\telse if(typeof exports === 'object')\n\t\texports[\"axios\"] = factory();\n\telse\n\t\troot[\"axios\"] = factory();\n})(this, function() {\nreturn "," \t// The module cache\n \tvar installedModules = {};\n\n \t// The require function\n \tfunction __webpack_require__(moduleId) {\n\n \t\t// Check if module is in cache\n \t\tif(installedModules[moduleId]) {\n \t\t\treturn installedModules[moduleId].exports;\n \t\t}\n \t\t// Create a new module (and put it into the cache)\n \t\tvar module = installedModules[moduleId] = {\n \t\t\ti: moduleId,\n \t\t\tl: false,\n \t\t\texports: {}\n \t\t};\n\n \t\t// Execute the module function\n \t\tmodules[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n\n \t\t// Flag the module as loaded\n \t\tmodule.l = true;\n\n \t\t// Return the exports of the module\n \t\treturn module.exports;\n \t}\n\n\n \t// expose the modules object (__webpack_modules__)\n \t__webpack_require__.m = modules;\n\n \t// expose the module cache\n \t__webpack_require__.c = installedModules;\n\n \t// define getter function for harmony exports\n \t__webpack_require__.d = function(exports, name, getter) {\n \t\tif(!__webpack_require__.o(exports, name)) {\n \t\t\tObject.defineProperty(exports, name, { enumerable: true, get: getter });\n \t\t}\n \t};\n\n \t// define __esModule on exports\n \t__webpack_require__.r = function(exports) {\n \t\tif(typeof Symbol !== 'undefined' && Symbol.toStringTag) {\n \t\t\tObject.defineProperty(exports, Symbol.toStringTag, { value: 'Module' });\n \t\t}\n \t\tObject.defineProperty(exports, '__esModule', { value: true });\n \t};\n\n \t// create a fake namespace object\n \t// mode & 1: value is a module id, require it\n \t// mode & 2: merge all properties of value into the ns\n \t// mode & 4: return value when already ns object\n \t// mode & 8|1: behave like require\n \t__webpack_require__.t = function(value, mode) {\n \t\tif(mode & 1) value = __webpack_require__(value);\n \t\tif(mode & 8) return value;\n \t\tif((mode & 4) && typeof value === 'object' && value && value.__esModule) return value;\n \t\tvar ns = Object.create(null);\n \t\t__webpack_require__.r(ns);\n \t\tObject.defineProperty(ns, 'default', { enumerable: true, value: value });\n \t\tif(mode & 2 && typeof value != 'string') for(var key in value) __webpack_require__.d(ns, key, function(key) { return value[key]; }.bind(null, key));\n \t\treturn ns;\n \t};\n\n \t// getDefaultExport function for compatibility with non-harmony modules\n \t__webpack_require__.n = function(module) {\n \t\tvar getter = module && module.__esModule ?\n \t\t\tfunction getDefault() { return module['default']; } :\n \t\t\tfunction getModuleExports() { return module; };\n \t\t__webpack_require__.d(getter, 'a', getter);\n \t\treturn getter;\n \t};\n\n \t// Object.prototype.hasOwnProperty.call\n \t__webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); };\n\n \t// __webpack_public_path__\n \t__webpack_require__.p = \"\";\n\n\n \t// Load entry module and return exports\n \treturn __webpack_require__(__webpack_require__.s = \"./index.js\");\n","module.exports = require('./lib/axios');","'use strict';\n\nvar utils = require('./../utils');\nvar settle = require('./../core/settle');\nvar cookies = require('./../helpers/cookies');\nvar buildURL = require('./../helpers/buildURL');\nvar buildFullPath = require('../core/buildFullPath');\nvar parseHeaders = require('./../helpers/parseHeaders');\nvar isURLSameOrigin = require('./../helpers/isURLSameOrigin');\nvar createError = require('../core/createError');\nvar transitionalDefaults = require('../defaults/transitional');\nvar Cancel = require('../cancel/Cancel');\n\nmodule.exports = function xhrAdapter(config) {\n return new Promise(function dispatchXhrRequest(resolve, reject) {\n var requestData = config.data;\n var requestHeaders = config.headers;\n var responseType = config.responseType;\n var onCanceled;\n function done() {\n if (config.cancelToken) {\n config.cancelToken.unsubscribe(onCanceled);\n }\n\n if (config.signal) {\n config.signal.removeEventListener('abort', onCanceled);\n }\n }\n\n if (utils.isFormData(requestData)) {\n delete requestHeaders['Content-Type']; // Let the browser set it\n }\n\n var request = new XMLHttpRequest();\n\n // HTTP basic authentication\n if (config.auth) {\n var username = config.auth.username || '';\n var password = config.auth.password ? unescape(encodeURIComponent(config.auth.password)) : '';\n requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password);\n }\n\n var fullPath = buildFullPath(config.baseURL, config.url);\n request.open(config.method.toUpperCase(), buildURL(fullPath, config.params, config.paramsSerializer), true);\n\n // Set the request timeout in MS\n request.timeout = config.timeout;\n\n function onloadend() {\n if (!request) {\n return;\n }\n // Prepare the response\n var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null;\n var responseData = !responseType || responseType === 'text' || responseType === 'json' ?\n request.responseText : request.response;\n var response = {\n data: responseData,\n status: request.status,\n statusText: request.statusText,\n headers: responseHeaders,\n config: config,\n request: request\n };\n\n settle(function _resolve(value) {\n resolve(value);\n done();\n }, function _reject(err) {\n reject(err);\n done();\n }, response);\n\n // Clean up request\n request = null;\n }\n\n if ('onloadend' in request) {\n // Use onloadend if available\n request.onloadend = onloadend;\n } else {\n // Listen for ready state to emulate onloadend\n request.onreadystatechange = function handleLoad() {\n if (!request || request.readyState !== 4) {\n return;\n }\n\n // The request errored out and we didn't get a response, this will be\n // handled by onerror instead\n // With one exception: request that using file: protocol, most browsers\n // will return status as 0 even though it's a successful request\n if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) {\n return;\n }\n // readystate handler is calling before onerror or ontimeout handlers,\n // so we should call onloadend on the next 'tick'\n setTimeout(onloadend);\n };\n }\n\n // Handle browser request cancellation (as opposed to a manual cancellation)\n request.onabort = function handleAbort() {\n if (!request) {\n return;\n }\n\n reject(createError('Request aborted', config, 'ECONNABORTED', request));\n\n // Clean up request\n request = null;\n };\n\n // Handle low level network errors\n request.onerror = function handleError() {\n // Real errors are hidden from us by the browser\n // onerror should only fire if it's a network error\n reject(createError('Network Error', config, null, request));\n\n // Clean up request\n request = null;\n };\n\n // Handle timeout\n request.ontimeout = function handleTimeout() {\n var timeoutErrorMessage = config.timeout ? 'timeout of ' + config.timeout + 'ms exceeded' : 'timeout exceeded';\n var transitional = config.transitional || transitionalDefaults;\n if (config.timeoutErrorMessage) {\n timeoutErrorMessage = config.timeoutErrorMessage;\n }\n reject(createError(\n timeoutErrorMessage,\n config,\n transitional.clarifyTimeoutError ? 'ETIMEDOUT' : 'ECONNABORTED',\n request));\n\n // Clean up request\n request = null;\n };\n\n // Add xsrf header\n // This is only done if running in a standard browser environment.\n // Specifically not if we're in a web worker, or react-native.\n if (utils.isStandardBrowserEnv()) {\n // Add xsrf header\n var xsrfValue = (config.withCredentials || isURLSameOrigin(fullPath)) && config.xsrfCookieName ?\n cookies.read(config.xsrfCookieName) :\n undefined;\n\n if (xsrfValue) {\n requestHeaders[config.xsrfHeaderName] = xsrfValue;\n }\n }\n\n // Add headers to the request\n if ('setRequestHeader' in request) {\n utils.forEach(requestHeaders, function setRequestHeader(val, key) {\n if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') {\n // Remove Content-Type if data is undefined\n delete requestHeaders[key];\n } else {\n // Otherwise add header to the request\n request.setRequestHeader(key, val);\n }\n });\n }\n\n // Add withCredentials to request if needed\n if (!utils.isUndefined(config.withCredentials)) {\n request.withCredentials = !!config.withCredentials;\n }\n\n // Add responseType to request if needed\n if (responseType && responseType !== 'json') {\n request.responseType = config.responseType;\n }\n\n // Handle progress if needed\n if (typeof config.onDownloadProgress === 'function') {\n request.addEventListener('progress', config.onDownloadProgress);\n }\n\n // Not all browsers support upload events\n if (typeof config.onUploadProgress === 'function' && request.upload) {\n request.upload.addEventListener('progress', config.onUploadProgress);\n }\n\n if (config.cancelToken || config.signal) {\n // Handle cancellation\n // eslint-disable-next-line func-names\n onCanceled = function(cancel) {\n if (!request) {\n return;\n }\n reject(!cancel || (cancel && cancel.type) ? new Cancel('canceled') : cancel);\n request.abort();\n request = null;\n };\n\n config.cancelToken && config.cancelToken.subscribe(onCanceled);\n if (config.signal) {\n config.signal.aborted ? onCanceled() : config.signal.addEventListener('abort', onCanceled);\n }\n }\n\n if (!requestData) {\n requestData = null;\n }\n\n // Send the request\n request.send(requestData);\n });\n};\n","'use strict';\n\nvar utils = require('./utils');\nvar bind = require('./helpers/bind');\nvar Axios = require('./core/Axios');\nvar mergeConfig = require('./core/mergeConfig');\nvar defaults = require('./defaults');\n\n/**\n * Create an instance of Axios\n *\n * @param {Object} defaultConfig The default config for the instance\n * @return {Axios} A new instance of Axios\n */\nfunction createInstance(defaultConfig) {\n var context = new Axios(defaultConfig);\n var instance = bind(Axios.prototype.request, context);\n\n // Copy axios.prototype to instance\n utils.extend(instance, Axios.prototype, context);\n\n // Copy context to instance\n utils.extend(instance, context);\n\n // Factory for creating new instances\n instance.create = function create(instanceConfig) {\n return createInstance(mergeConfig(defaultConfig, instanceConfig));\n };\n\n return instance;\n}\n\n// Create the default instance to be exported\nvar axios = createInstance(defaults);\n\n// Expose Axios class to allow class inheritance\naxios.Axios = Axios;\n\n// Expose Cancel & CancelToken\naxios.Cancel = require('./cancel/Cancel');\naxios.CancelToken = require('./cancel/CancelToken');\naxios.isCancel = require('./cancel/isCancel');\naxios.VERSION = require('./env/data').version;\n\n// Expose all/spread\naxios.all = function all(promises) {\n return Promise.all(promises);\n};\naxios.spread = require('./helpers/spread');\n\n// Expose isAxiosError\naxios.isAxiosError = require('./helpers/isAxiosError');\n\nmodule.exports = axios;\n\n// Allow use of default import syntax in TypeScript\nmodule.exports.default = axios;\n","'use strict';\n\n/**\n * A `Cancel` is an object that is thrown when an operation is canceled.\n *\n * @class\n * @param {string=} message The message.\n */\nfunction Cancel(message) {\n this.message = message;\n}\n\nCancel.prototype.toString = function toString() {\n return 'Cancel' + (this.message ? ': ' + this.message : '');\n};\n\nCancel.prototype.__CANCEL__ = true;\n\nmodule.exports = Cancel;\n","'use strict';\n\nvar Cancel = require('./Cancel');\n\n/**\n * A `CancelToken` is an object that can be used to request cancellation of an operation.\n *\n * @class\n * @param {Function} executor The executor function.\n */\nfunction CancelToken(executor) {\n if (typeof executor !== 'function') {\n throw new TypeError('executor must be a function.');\n }\n\n var resolvePromise;\n\n this.promise = new Promise(function promiseExecutor(resolve) {\n resolvePromise = resolve;\n });\n\n var token = this;\n\n // eslint-disable-next-line func-names\n this.promise.then(function(cancel) {\n if (!token._listeners) return;\n\n var i;\n var l = token._listeners.length;\n\n for (i = 0; i < l; i++) {\n token._listeners[i](cancel);\n }\n token._listeners = null;\n });\n\n // eslint-disable-next-line func-names\n this.promise.then = function(onfulfilled) {\n var _resolve;\n // eslint-disable-next-line func-names\n var promise = new Promise(function(resolve) {\n token.subscribe(resolve);\n _resolve = resolve;\n }).then(onfulfilled);\n\n promise.cancel = function reject() {\n token.unsubscribe(_resolve);\n };\n\n return promise;\n };\n\n executor(function cancel(message) {\n if (token.reason) {\n // Cancellation has already been requested\n return;\n }\n\n token.reason = new Cancel(message);\n resolvePromise(token.reason);\n });\n}\n\n/**\n * Throws a `Cancel` if cancellation has been requested.\n */\nCancelToken.prototype.throwIfRequested = function throwIfRequested() {\n if (this.reason) {\n throw this.reason;\n }\n};\n\n/**\n * Subscribe to the cancel signal\n */\n\nCancelToken.prototype.subscribe = function subscribe(listener) {\n if (this.reason) {\n listener(this.reason);\n return;\n }\n\n if (this._listeners) {\n this._listeners.push(listener);\n } else {\n this._listeners = [listener];\n }\n};\n\n/**\n * Unsubscribe from the cancel signal\n */\n\nCancelToken.prototype.unsubscribe = function unsubscribe(listener) {\n if (!this._listeners) {\n return;\n }\n var index = this._listeners.indexOf(listener);\n if (index !== -1) {\n this._listeners.splice(index, 1);\n }\n};\n\n/**\n * Returns an object that contains a new `CancelToken` and a function that, when called,\n * cancels the `CancelToken`.\n */\nCancelToken.source = function source() {\n var cancel;\n var token = new CancelToken(function executor(c) {\n cancel = c;\n });\n return {\n token: token,\n cancel: cancel\n };\n};\n\nmodule.exports = CancelToken;\n","'use strict';\n\nmodule.exports = function isCancel(value) {\n return !!(value && value.__CANCEL__);\n};\n","'use strict';\n\nvar utils = require('./../utils');\nvar buildURL = require('../helpers/buildURL');\nvar InterceptorManager = require('./InterceptorManager');\nvar dispatchRequest = require('./dispatchRequest');\nvar mergeConfig = require('./mergeConfig');\nvar validator = require('../helpers/validator');\n\nvar validators = validator.validators;\n/**\n * Create a new instance of Axios\n *\n * @param {Object} instanceConfig The default config for the instance\n */\nfunction Axios(instanceConfig) {\n this.defaults = instanceConfig;\n this.interceptors = {\n request: new InterceptorManager(),\n response: new InterceptorManager()\n };\n}\n\n/**\n * Dispatch a request\n *\n * @param {Object} config The config specific for this request (merged with this.defaults)\n */\nAxios.prototype.request = function request(configOrUrl, config) {\n /*eslint no-param-reassign:0*/\n // Allow for axios('example/url'[, config]) a la fetch API\n if (typeof configOrUrl === 'string') {\n config = config || {};\n config.url = configOrUrl;\n } else {\n config = configOrUrl || {};\n }\n\n config = mergeConfig(this.defaults, config);\n\n // Set config.method\n if (config.method) {\n config.method = config.method.toLowerCase();\n } else if (this.defaults.method) {\n config.method = this.defaults.method.toLowerCase();\n } else {\n config.method = 'get';\n }\n\n var transitional = config.transitional;\n\n if (transitional !== undefined) {\n validator.assertOptions(transitional, {\n silentJSONParsing: validators.transitional(validators.boolean),\n forcedJSONParsing: validators.transitional(validators.boolean),\n clarifyTimeoutError: validators.transitional(validators.boolean)\n }, false);\n }\n\n // filter out skipped interceptors\n var requestInterceptorChain = [];\n var synchronousRequestInterceptors = true;\n this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) {\n if (typeof interceptor.runWhen === 'function' && interceptor.runWhen(config) === false) {\n return;\n }\n\n synchronousRequestInterceptors = synchronousRequestInterceptors && interceptor.synchronous;\n\n requestInterceptorChain.unshift(interceptor.fulfilled, interceptor.rejected);\n });\n\n var responseInterceptorChain = [];\n this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) {\n responseInterceptorChain.push(interceptor.fulfilled, interceptor.rejected);\n });\n\n var promise;\n\n if (!synchronousRequestInterceptors) {\n var chain = [dispatchRequest, undefined];\n\n Array.prototype.unshift.apply(chain, requestInterceptorChain);\n chain = chain.concat(responseInterceptorChain);\n\n promise = Promise.resolve(config);\n while (chain.length) {\n promise = promise.then(chain.shift(), chain.shift());\n }\n\n return promise;\n }\n\n\n var newConfig = config;\n while (requestInterceptorChain.length) {\n var onFulfilled = requestInterceptorChain.shift();\n var onRejected = requestInterceptorChain.shift();\n try {\n newConfig = onFulfilled(newConfig);\n } catch (error) {\n onRejected(error);\n break;\n }\n }\n\n try {\n promise = dispatchRequest(newConfig);\n } catch (error) {\n return Promise.reject(error);\n }\n\n while (responseInterceptorChain.length) {\n promise = promise.then(responseInterceptorChain.shift(), responseInterceptorChain.shift());\n }\n\n return promise;\n};\n\nAxios.prototype.getUri = function getUri(config) {\n config = mergeConfig(this.defaults, config);\n return buildURL(config.url, config.params, config.paramsSerializer).replace(/^\\?/, '');\n};\n\n// Provide aliases for supported request methods\nutils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) {\n /*eslint func-names:0*/\n Axios.prototype[method] = function(url, config) {\n return this.request(mergeConfig(config || {}, {\n method: method,\n url: url,\n data: (config || {}).data\n }));\n };\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n /*eslint func-names:0*/\n Axios.prototype[method] = function(url, data, config) {\n return this.request(mergeConfig(config || {}, {\n method: method,\n url: url,\n data: data\n }));\n };\n});\n\nmodule.exports = Axios;\n","'use strict';\n\nvar utils = require('./../utils');\n\nfunction InterceptorManager() {\n this.handlers = [];\n}\n\n/**\n * Add a new interceptor to the stack\n *\n * @param {Function} fulfilled The function to handle `then` for a `Promise`\n * @param {Function} rejected The function to handle `reject` for a `Promise`\n *\n * @return {Number} An ID used to remove interceptor later\n */\nInterceptorManager.prototype.use = function use(fulfilled, rejected, options) {\n this.handlers.push({\n fulfilled: fulfilled,\n rejected: rejected,\n synchronous: options ? options.synchronous : false,\n runWhen: options ? options.runWhen : null\n });\n return this.handlers.length - 1;\n};\n\n/**\n * Remove an interceptor from the stack\n *\n * @param {Number} id The ID that was returned by `use`\n */\nInterceptorManager.prototype.eject = function eject(id) {\n if (this.handlers[id]) {\n this.handlers[id] = null;\n }\n};\n\n/**\n * Iterate over all the registered interceptors\n *\n * This method is particularly useful for skipping over any\n * interceptors that may have become `null` calling `eject`.\n *\n * @param {Function} fn The function to call for each interceptor\n */\nInterceptorManager.prototype.forEach = function forEach(fn) {\n utils.forEach(this.handlers, function forEachHandler(h) {\n if (h !== null) {\n fn(h);\n }\n });\n};\n\nmodule.exports = InterceptorManager;\n","'use strict';\n\nvar isAbsoluteURL = require('../helpers/isAbsoluteURL');\nvar combineURLs = require('../helpers/combineURLs');\n\n/**\n * Creates a new URL by combining the baseURL with the requestedURL,\n * only when the requestedURL is not already an absolute URL.\n * If the requestURL is absolute, this function returns the requestedURL untouched.\n *\n * @param {string} baseURL The base URL\n * @param {string} requestedURL Absolute or relative URL to combine\n * @returns {string} The combined full path\n */\nmodule.exports = function buildFullPath(baseURL, requestedURL) {\n if (baseURL && !isAbsoluteURL(requestedURL)) {\n return combineURLs(baseURL, requestedURL);\n }\n return requestedURL;\n};\n","'use strict';\n\nvar enhanceError = require('./enhanceError');\n\n/**\n * Create an Error with the specified message, config, error code, request and response.\n *\n * @param {string} message The error message.\n * @param {Object} config The config.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n * @returns {Error} The created error.\n */\nmodule.exports = function createError(message, config, code, request, response) {\n var error = new Error(message);\n return enhanceError(error, config, code, request, response);\n};\n","'use strict';\n\nvar utils = require('./../utils');\nvar transformData = require('./transformData');\nvar isCancel = require('../cancel/isCancel');\nvar defaults = require('../defaults');\nvar Cancel = require('../cancel/Cancel');\n\n/**\n * Throws a `Cancel` if cancellation has been requested.\n */\nfunction throwIfCancellationRequested(config) {\n if (config.cancelToken) {\n config.cancelToken.throwIfRequested();\n }\n\n if (config.signal && config.signal.aborted) {\n throw new Cancel('canceled');\n }\n}\n\n/**\n * Dispatch a request to the server using the configured adapter.\n *\n * @param {object} config The config that is to be used for the request\n * @returns {Promise} The Promise to be fulfilled\n */\nmodule.exports = function dispatchRequest(config) {\n throwIfCancellationRequested(config);\n\n // Ensure headers exist\n config.headers = config.headers || {};\n\n // Transform request data\n config.data = transformData.call(\n config,\n config.data,\n config.headers,\n config.transformRequest\n );\n\n // Flatten headers\n config.headers = utils.merge(\n config.headers.common || {},\n config.headers[config.method] || {},\n config.headers\n );\n\n utils.forEach(\n ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'],\n function cleanHeaderConfig(method) {\n delete config.headers[method];\n }\n );\n\n var adapter = config.adapter || defaults.adapter;\n\n return adapter(config).then(function onAdapterResolution(response) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n response.data = transformData.call(\n config,\n response.data,\n response.headers,\n config.transformResponse\n );\n\n return response;\n }, function onAdapterRejection(reason) {\n if (!isCancel(reason)) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n if (reason && reason.response) {\n reason.response.data = transformData.call(\n config,\n reason.response.data,\n reason.response.headers,\n config.transformResponse\n );\n }\n }\n\n return Promise.reject(reason);\n });\n};\n","'use strict';\n\n/**\n * Update an Error with the specified config, error code, and response.\n *\n * @param {Error} error The error to update.\n * @param {Object} config The config.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n * @returns {Error} The error.\n */\nmodule.exports = function enhanceError(error, config, code, request, response) {\n error.config = config;\n if (code) {\n error.code = code;\n }\n\n error.request = request;\n error.response = response;\n error.isAxiosError = true;\n\n error.toJSON = function toJSON() {\n return {\n // Standard\n message: this.message,\n name: this.name,\n // Microsoft\n description: this.description,\n number: this.number,\n // Mozilla\n fileName: this.fileName,\n lineNumber: this.lineNumber,\n columnNumber: this.columnNumber,\n stack: this.stack,\n // Axios\n config: this.config,\n code: this.code,\n status: this.response && this.response.status ? this.response.status : null\n };\n };\n return error;\n};\n","'use strict';\n\nvar utils = require('../utils');\n\n/**\n * Config-specific merge-function which creates a new config-object\n * by merging two configuration objects together.\n *\n * @param {Object} config1\n * @param {Object} config2\n * @returns {Object} New object resulting from merging config2 to config1\n */\nmodule.exports = function mergeConfig(config1, config2) {\n // eslint-disable-next-line no-param-reassign\n config2 = config2 || {};\n var config = {};\n\n function getMergedValue(target, source) {\n if (utils.isPlainObject(target) && utils.isPlainObject(source)) {\n return utils.merge(target, source);\n } else if (utils.isPlainObject(source)) {\n return utils.merge({}, source);\n } else if (utils.isArray(source)) {\n return source.slice();\n }\n return source;\n }\n\n // eslint-disable-next-line consistent-return\n function mergeDeepProperties(prop) {\n if (!utils.isUndefined(config2[prop])) {\n return getMergedValue(config1[prop], config2[prop]);\n } else if (!utils.isUndefined(config1[prop])) {\n return getMergedValue(undefined, config1[prop]);\n }\n }\n\n // eslint-disable-next-line consistent-return\n function valueFromConfig2(prop) {\n if (!utils.isUndefined(config2[prop])) {\n return getMergedValue(undefined, config2[prop]);\n }\n }\n\n // eslint-disable-next-line consistent-return\n function defaultToConfig2(prop) {\n if (!utils.isUndefined(config2[prop])) {\n return getMergedValue(undefined, config2[prop]);\n } else if (!utils.isUndefined(config1[prop])) {\n return getMergedValue(undefined, config1[prop]);\n }\n }\n\n // eslint-disable-next-line consistent-return\n function mergeDirectKeys(prop) {\n if (prop in config2) {\n return getMergedValue(config1[prop], config2[prop]);\n } else if (prop in config1) {\n return getMergedValue(undefined, config1[prop]);\n }\n }\n\n var mergeMap = {\n 'url': valueFromConfig2,\n 'method': valueFromConfig2,\n 'data': valueFromConfig2,\n 'baseURL': defaultToConfig2,\n 'transformRequest': defaultToConfig2,\n 'transformResponse': defaultToConfig2,\n 'paramsSerializer': defaultToConfig2,\n 'timeout': defaultToConfig2,\n 'timeoutMessage': defaultToConfig2,\n 'withCredentials': defaultToConfig2,\n 'adapter': defaultToConfig2,\n 'responseType': defaultToConfig2,\n 'xsrfCookieName': defaultToConfig2,\n 'xsrfHeaderName': defaultToConfig2,\n 'onUploadProgress': defaultToConfig2,\n 'onDownloadProgress': defaultToConfig2,\n 'decompress': defaultToConfig2,\n 'maxContentLength': defaultToConfig2,\n 'maxBodyLength': defaultToConfig2,\n 'transport': defaultToConfig2,\n 'httpAgent': defaultToConfig2,\n 'httpsAgent': defaultToConfig2,\n 'cancelToken': defaultToConfig2,\n 'socketPath': defaultToConfig2,\n 'responseEncoding': defaultToConfig2,\n 'validateStatus': mergeDirectKeys\n };\n\n utils.forEach(Object.keys(config1).concat(Object.keys(config2)), function computeConfigValue(prop) {\n var merge = mergeMap[prop] || mergeDeepProperties;\n var configValue = merge(prop);\n (utils.isUndefined(configValue) && merge !== mergeDirectKeys) || (config[prop] = configValue);\n });\n\n return config;\n};\n","'use strict';\n\nvar createError = require('./createError');\n\n/**\n * Resolve or reject a Promise based on response status.\n *\n * @param {Function} resolve A function that resolves the promise.\n * @param {Function} reject A function that rejects the promise.\n * @param {object} response The response.\n */\nmodule.exports = function settle(resolve, reject, response) {\n var validateStatus = response.config.validateStatus;\n if (!response.status || !validateStatus || validateStatus(response.status)) {\n resolve(response);\n } else {\n reject(createError(\n 'Request failed with status code ' + response.status,\n response.config,\n null,\n response.request,\n response\n ));\n }\n};\n","'use strict';\n\nvar utils = require('./../utils');\nvar defaults = require('../defaults');\n\n/**\n * Transform the data for a request or a response\n *\n * @param {Object|String} data The data to be transformed\n * @param {Array} headers The headers for the request or response\n * @param {Array|Function} fns A single function or Array of functions\n * @returns {*} The resulting transformed data\n */\nmodule.exports = function transformData(data, headers, fns) {\n var context = this || defaults;\n /*eslint no-param-reassign:0*/\n utils.forEach(fns, function transform(fn) {\n data = fn.call(context, data, headers);\n });\n\n return data;\n};\n","'use strict';\n\nvar utils = require('../utils');\nvar normalizeHeaderName = require('../helpers/normalizeHeaderName');\nvar enhanceError = require('../core/enhanceError');\nvar transitionalDefaults = require('./transitional');\n\nvar DEFAULT_CONTENT_TYPE = {\n 'Content-Type': 'application/x-www-form-urlencoded'\n};\n\nfunction setContentTypeIfUnset(headers, value) {\n if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) {\n headers['Content-Type'] = value;\n }\n}\n\nfunction getDefaultAdapter() {\n var adapter;\n if (typeof XMLHttpRequest !== 'undefined') {\n // For browsers use XHR adapter\n adapter = require('../adapters/xhr');\n } else if (typeof process !== 'undefined' && Object.prototype.toString.call(process) === '[object process]') {\n // For node use HTTP adapter\n adapter = require('../adapters/http');\n }\n return adapter;\n}\n\nfunction stringifySafely(rawValue, parser, encoder) {\n if (utils.isString(rawValue)) {\n try {\n (parser || JSON.parse)(rawValue);\n return utils.trim(rawValue);\n } catch (e) {\n if (e.name !== 'SyntaxError') {\n throw e;\n }\n }\n }\n\n return (encoder || JSON.stringify)(rawValue);\n}\n\nvar defaults = {\n\n transitional: transitionalDefaults,\n\n adapter: getDefaultAdapter(),\n\n transformRequest: [function transformRequest(data, headers) {\n normalizeHeaderName(headers, 'Accept');\n normalizeHeaderName(headers, 'Content-Type');\n\n if (utils.isFormData(data) ||\n utils.isArrayBuffer(data) ||\n utils.isBuffer(data) ||\n utils.isStream(data) ||\n utils.isFile(data) ||\n utils.isBlob(data)\n ) {\n return data;\n }\n if (utils.isArrayBufferView(data)) {\n return data.buffer;\n }\n if (utils.isURLSearchParams(data)) {\n setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8');\n return data.toString();\n }\n if (utils.isObject(data) || (headers && headers['Content-Type'] === 'application/json')) {\n setContentTypeIfUnset(headers, 'application/json');\n return stringifySafely(data);\n }\n return data;\n }],\n\n transformResponse: [function transformResponse(data) {\n var transitional = this.transitional || defaults.transitional;\n var silentJSONParsing = transitional && transitional.silentJSONParsing;\n var forcedJSONParsing = transitional && transitional.forcedJSONParsing;\n var strictJSONParsing = !silentJSONParsing && this.responseType === 'json';\n\n if (strictJSONParsing || (forcedJSONParsing && utils.isString(data) && data.length)) {\n try {\n return JSON.parse(data);\n } catch (e) {\n if (strictJSONParsing) {\n if (e.name === 'SyntaxError') {\n throw enhanceError(e, this, 'E_JSON_PARSE');\n }\n throw e;\n }\n }\n }\n\n return data;\n }],\n\n /**\n * A timeout in milliseconds to abort a request. If set to 0 (default) a\n * timeout is not created.\n */\n timeout: 0,\n\n xsrfCookieName: 'XSRF-TOKEN',\n xsrfHeaderName: 'X-XSRF-TOKEN',\n\n maxContentLength: -1,\n maxBodyLength: -1,\n\n validateStatus: function validateStatus(status) {\n return status >= 200 && status < 300;\n },\n\n headers: {\n common: {\n 'Accept': 'application/json, text/plain, */*'\n }\n }\n};\n\nutils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) {\n defaults.headers[method] = {};\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE);\n});\n\nmodule.exports = defaults;\n","'use strict';\n\nmodule.exports = {\n silentJSONParsing: true,\n forcedJSONParsing: true,\n clarifyTimeoutError: false\n};\n","module.exports = {\n \"version\": \"0.26.1\"\n};","'use strict';\n\nmodule.exports = function bind(fn, thisArg) {\n return function wrap() {\n var args = new Array(arguments.length);\n for (var i = 0; i < args.length; i++) {\n args[i] = arguments[i];\n }\n return fn.apply(thisArg, args);\n };\n};\n","'use strict';\n\nvar utils = require('./../utils');\n\nfunction encode(val) {\n return encodeURIComponent(val).\n replace(/%3A/gi, ':').\n replace(/%24/g, '$').\n replace(/%2C/gi, ',').\n replace(/%20/g, '+').\n replace(/%5B/gi, '[').\n replace(/%5D/gi, ']');\n}\n\n/**\n * Build a URL by appending params to the end\n *\n * @param {string} url The base of the url (e.g., http://www.google.com)\n * @param {object} [params] The params to be appended\n * @returns {string} The formatted url\n */\nmodule.exports = function buildURL(url, params, paramsSerializer) {\n /*eslint no-param-reassign:0*/\n if (!params) {\n return url;\n }\n\n var serializedParams;\n if (paramsSerializer) {\n serializedParams = paramsSerializer(params);\n } else if (utils.isURLSearchParams(params)) {\n serializedParams = params.toString();\n } else {\n var parts = [];\n\n utils.forEach(params, function serialize(val, key) {\n if (val === null || typeof val === 'undefined') {\n return;\n }\n\n if (utils.isArray(val)) {\n key = key + '[]';\n } else {\n val = [val];\n }\n\n utils.forEach(val, function parseValue(v) {\n if (utils.isDate(v)) {\n v = v.toISOString();\n } else if (utils.isObject(v)) {\n v = JSON.stringify(v);\n }\n parts.push(encode(key) + '=' + encode(v));\n });\n });\n\n serializedParams = parts.join('&');\n }\n\n if (serializedParams) {\n var hashmarkIndex = url.indexOf('#');\n if (hashmarkIndex !== -1) {\n url = url.slice(0, hashmarkIndex);\n }\n\n url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams;\n }\n\n return url;\n};\n","'use strict';\n\n/**\n * Creates a new URL by combining the specified URLs\n *\n * @param {string} baseURL The base URL\n * @param {string} relativeURL The relative URL\n * @returns {string} The combined URL\n */\nmodule.exports = function combineURLs(baseURL, relativeURL) {\n return relativeURL\n ? baseURL.replace(/\\/+$/, '') + '/' + relativeURL.replace(/^\\/+/, '')\n : baseURL;\n};\n","'use strict';\n\nvar utils = require('./../utils');\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs support document.cookie\n (function standardBrowserEnv() {\n return {\n write: function write(name, value, expires, path, domain, secure) {\n var cookie = [];\n cookie.push(name + '=' + encodeURIComponent(value));\n\n if (utils.isNumber(expires)) {\n cookie.push('expires=' + new Date(expires).toGMTString());\n }\n\n if (utils.isString(path)) {\n cookie.push('path=' + path);\n }\n\n if (utils.isString(domain)) {\n cookie.push('domain=' + domain);\n }\n\n if (secure === true) {\n cookie.push('secure');\n }\n\n document.cookie = cookie.join('; ');\n },\n\n read: function read(name) {\n var match = document.cookie.match(new RegExp('(^|;\\\\s*)(' + name + ')=([^;]*)'));\n return (match ? decodeURIComponent(match[3]) : null);\n },\n\n remove: function remove(name) {\n this.write(name, '', Date.now() - 86400000);\n }\n };\n })() :\n\n // Non standard browser env (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return {\n write: function write() {},\n read: function read() { return null; },\n remove: function remove() {}\n };\n })()\n);\n","'use strict';\n\n/**\n * Determines whether the specified URL is absolute\n *\n * @param {string} url The URL to test\n * @returns {boolean} True if the specified URL is absolute, otherwise false\n */\nmodule.exports = function isAbsoluteURL(url) {\n // A URL is considered absolute if it begins with \"://\" or \"//\" (protocol-relative URL).\n // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed\n // by any combination of letters, digits, plus, period, or hyphen.\n return /^([a-z][a-z\\d+\\-.]*:)?\\/\\//i.test(url);\n};\n","'use strict';\n\nvar utils = require('./../utils');\n\n/**\n * Determines whether the payload is an error thrown by Axios\n *\n * @param {*} payload The value to test\n * @returns {boolean} True if the payload is an error thrown by Axios, otherwise false\n */\nmodule.exports = function isAxiosError(payload) {\n return utils.isObject(payload) && (payload.isAxiosError === true);\n};\n","'use strict';\n\nvar utils = require('./../utils');\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs have full support of the APIs needed to test\n // whether the request URL is of the same origin as current location.\n (function standardBrowserEnv() {\n var msie = /(msie|trident)/i.test(navigator.userAgent);\n var urlParsingNode = document.createElement('a');\n var originURL;\n\n /**\n * Parse a URL to discover it's components\n *\n * @param {String} url The URL to be parsed\n * @returns {Object}\n */\n function resolveURL(url) {\n var href = url;\n\n if (msie) {\n // IE needs attribute set twice to normalize properties\n urlParsingNode.setAttribute('href', href);\n href = urlParsingNode.href;\n }\n\n urlParsingNode.setAttribute('href', href);\n\n // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils\n return {\n href: urlParsingNode.href,\n protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '',\n host: urlParsingNode.host,\n search: urlParsingNode.search ? urlParsingNode.search.replace(/^\\?/, '') : '',\n hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '',\n hostname: urlParsingNode.hostname,\n port: urlParsingNode.port,\n pathname: (urlParsingNode.pathname.charAt(0) === '/') ?\n urlParsingNode.pathname :\n '/' + urlParsingNode.pathname\n };\n }\n\n originURL = resolveURL(window.location.href);\n\n /**\n * Determine if a URL shares the same origin as the current location\n *\n * @param {String} requestURL The URL to test\n * @returns {boolean} True if URL shares the same origin, otherwise false\n */\n return function isURLSameOrigin(requestURL) {\n var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL;\n return (parsed.protocol === originURL.protocol &&\n parsed.host === originURL.host);\n };\n })() :\n\n // Non standard browser envs (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return function isURLSameOrigin() {\n return true;\n };\n })()\n);\n","'use strict';\n\nvar utils = require('../utils');\n\nmodule.exports = function normalizeHeaderName(headers, normalizedName) {\n utils.forEach(headers, function processHeader(value, name) {\n if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) {\n headers[normalizedName] = value;\n delete headers[name];\n }\n });\n};\n","'use strict';\n\nvar utils = require('./../utils');\n\n// Headers whose duplicates are ignored by node\n// c.f. https://nodejs.org/api/http.html#http_message_headers\nvar ignoreDuplicateOf = [\n 'age', 'authorization', 'content-length', 'content-type', 'etag',\n 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since',\n 'last-modified', 'location', 'max-forwards', 'proxy-authorization',\n 'referer', 'retry-after', 'user-agent'\n];\n\n/**\n * Parse headers into an object\n *\n * ```\n * Date: Wed, 27 Aug 2014 08:58:49 GMT\n * Content-Type: application/json\n * Connection: keep-alive\n * Transfer-Encoding: chunked\n * ```\n *\n * @param {String} headers Headers needing to be parsed\n * @returns {Object} Headers parsed into an object\n */\nmodule.exports = function parseHeaders(headers) {\n var parsed = {};\n var key;\n var val;\n var i;\n\n if (!headers) { return parsed; }\n\n utils.forEach(headers.split('\\n'), function parser(line) {\n i = line.indexOf(':');\n key = utils.trim(line.substr(0, i)).toLowerCase();\n val = utils.trim(line.substr(i + 1));\n\n if (key) {\n if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) {\n return;\n }\n if (key === 'set-cookie') {\n parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]);\n } else {\n parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val;\n }\n }\n });\n\n return parsed;\n};\n","'use strict';\n\n/**\n * Syntactic sugar for invoking a function and expanding an array for arguments.\n *\n * Common use case would be to use `Function.prototype.apply`.\n *\n * ```js\n * function f(x, y, z) {}\n * var args = [1, 2, 3];\n * f.apply(null, args);\n * ```\n *\n * With `spread` this example can be re-written.\n *\n * ```js\n * spread(function(x, y, z) {})([1, 2, 3]);\n * ```\n *\n * @param {Function} callback\n * @returns {Function}\n */\nmodule.exports = function spread(callback) {\n return function wrap(arr) {\n return callback.apply(null, arr);\n };\n};\n","'use strict';\n\nvar VERSION = require('../env/data').version;\n\nvar validators = {};\n\n// eslint-disable-next-line func-names\n['object', 'boolean', 'number', 'function', 'string', 'symbol'].forEach(function(type, i) {\n validators[type] = function validator(thing) {\n return typeof thing === type || 'a' + (i < 1 ? 'n ' : ' ') + type;\n };\n});\n\nvar deprecatedWarnings = {};\n\n/**\n * Transitional option validator\n * @param {function|boolean?} validator - set to false if the transitional option has been removed\n * @param {string?} version - deprecated version / removed since version\n * @param {string?} message - some message with additional info\n * @returns {function}\n */\nvalidators.transitional = function transitional(validator, version, message) {\n function formatMessage(opt, desc) {\n return '[Axios v' + VERSION + '] Transitional option \\'' + opt + '\\'' + desc + (message ? '. ' + message : '');\n }\n\n // eslint-disable-next-line func-names\n return function(value, opt, opts) {\n if (validator === false) {\n throw new Error(formatMessage(opt, ' has been removed' + (version ? ' in ' + version : '')));\n }\n\n if (version && !deprecatedWarnings[opt]) {\n deprecatedWarnings[opt] = true;\n // eslint-disable-next-line no-console\n console.warn(\n formatMessage(\n opt,\n ' has been deprecated since v' + version + ' and will be removed in the near future'\n )\n );\n }\n\n return validator ? validator(value, opt, opts) : true;\n };\n};\n\n/**\n * Assert object's properties type\n * @param {object} options\n * @param {object} schema\n * @param {boolean?} allowUnknown\n */\n\nfunction assertOptions(options, schema, allowUnknown) {\n if (typeof options !== 'object') {\n throw new TypeError('options must be an object');\n }\n var keys = Object.keys(options);\n var i = keys.length;\n while (i-- > 0) {\n var opt = keys[i];\n var validator = schema[opt];\n if (validator) {\n var value = options[opt];\n var result = value === undefined || validator(value, opt, options);\n if (result !== true) {\n throw new TypeError('option ' + opt + ' must be ' + result);\n }\n continue;\n }\n if (allowUnknown !== true) {\n throw Error('Unknown option ' + opt);\n }\n }\n}\n\nmodule.exports = {\n assertOptions: assertOptions,\n validators: validators\n};\n","'use strict';\n\nvar bind = require('./helpers/bind');\n\n// utils is a library of generic helper functions non-specific to axios\n\nvar toString = Object.prototype.toString;\n\n/**\n * Determine if a value is an Array\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an Array, otherwise false\n */\nfunction isArray(val) {\n return Array.isArray(val);\n}\n\n/**\n * Determine if a value is undefined\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if the value is undefined, otherwise false\n */\nfunction isUndefined(val) {\n return typeof val === 'undefined';\n}\n\n/**\n * Determine if a value is a Buffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Buffer, otherwise false\n */\nfunction isBuffer(val) {\n return val !== null && !isUndefined(val) && val.constructor !== null && !isUndefined(val.constructor)\n && typeof val.constructor.isBuffer === 'function' && val.constructor.isBuffer(val);\n}\n\n/**\n * Determine if a value is an ArrayBuffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an ArrayBuffer, otherwise false\n */\nfunction isArrayBuffer(val) {\n return toString.call(val) === '[object ArrayBuffer]';\n}\n\n/**\n * Determine if a value is a FormData\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an FormData, otherwise false\n */\nfunction isFormData(val) {\n return toString.call(val) === '[object FormData]';\n}\n\n/**\n * Determine if a value is a view on an ArrayBuffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false\n */\nfunction isArrayBufferView(val) {\n var result;\n if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) {\n result = ArrayBuffer.isView(val);\n } else {\n result = (val) && (val.buffer) && (isArrayBuffer(val.buffer));\n }\n return result;\n}\n\n/**\n * Determine if a value is a String\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a String, otherwise false\n */\nfunction isString(val) {\n return typeof val === 'string';\n}\n\n/**\n * Determine if a value is a Number\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Number, otherwise false\n */\nfunction isNumber(val) {\n return typeof val === 'number';\n}\n\n/**\n * Determine if a value is an Object\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an Object, otherwise false\n */\nfunction isObject(val) {\n return val !== null && typeof val === 'object';\n}\n\n/**\n * Determine if a value is a plain Object\n *\n * @param {Object} val The value to test\n * @return {boolean} True if value is a plain Object, otherwise false\n */\nfunction isPlainObject(val) {\n if (toString.call(val) !== '[object Object]') {\n return false;\n }\n\n var prototype = Object.getPrototypeOf(val);\n return prototype === null || prototype === Object.prototype;\n}\n\n/**\n * Determine if a value is a Date\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Date, otherwise false\n */\nfunction isDate(val) {\n return toString.call(val) === '[object Date]';\n}\n\n/**\n * Determine if a value is a File\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a File, otherwise false\n */\nfunction isFile(val) {\n return toString.call(val) === '[object File]';\n}\n\n/**\n * Determine if a value is a Blob\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Blob, otherwise false\n */\nfunction isBlob(val) {\n return toString.call(val) === '[object Blob]';\n}\n\n/**\n * Determine if a value is a Function\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Function, otherwise false\n */\nfunction isFunction(val) {\n return toString.call(val) === '[object Function]';\n}\n\n/**\n * Determine if a value is a Stream\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Stream, otherwise false\n */\nfunction isStream(val) {\n return isObject(val) && isFunction(val.pipe);\n}\n\n/**\n * Determine if a value is a URLSearchParams object\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a URLSearchParams object, otherwise false\n */\nfunction isURLSearchParams(val) {\n return toString.call(val) === '[object URLSearchParams]';\n}\n\n/**\n * Trim excess whitespace off the beginning and end of a string\n *\n * @param {String} str The String to trim\n * @returns {String} The String freed of excess whitespace\n */\nfunction trim(str) {\n return str.trim ? str.trim() : str.replace(/^\\s+|\\s+$/g, '');\n}\n\n/**\n * Determine if we're running in a standard browser environment\n *\n * This allows axios to run in a web worker, and react-native.\n * Both environments support XMLHttpRequest, but not fully standard globals.\n *\n * web workers:\n * typeof window -> undefined\n * typeof document -> undefined\n *\n * react-native:\n * navigator.product -> 'ReactNative'\n * nativescript\n * navigator.product -> 'NativeScript' or 'NS'\n */\nfunction isStandardBrowserEnv() {\n if (typeof navigator !== 'undefined' && (navigator.product === 'ReactNative' ||\n navigator.product === 'NativeScript' ||\n navigator.product === 'NS')) {\n return false;\n }\n return (\n typeof window !== 'undefined' &&\n typeof document !== 'undefined'\n );\n}\n\n/**\n * Iterate over an Array or an Object invoking a function for each item.\n *\n * If `obj` is an Array callback will be called passing\n * the value, index, and complete array for each item.\n *\n * If 'obj' is an Object callback will be called passing\n * the value, key, and complete object for each property.\n *\n * @param {Object|Array} obj The object to iterate\n * @param {Function} fn The callback to invoke for each item\n */\nfunction forEach(obj, fn) {\n // Don't bother if no value provided\n if (obj === null || typeof obj === 'undefined') {\n return;\n }\n\n // Force an array if not already something iterable\n if (typeof obj !== 'object') {\n /*eslint no-param-reassign:0*/\n obj = [obj];\n }\n\n if (isArray(obj)) {\n // Iterate over array values\n for (var i = 0, l = obj.length; i < l; i++) {\n fn.call(null, obj[i], i, obj);\n }\n } else {\n // Iterate over object keys\n for (var key in obj) {\n if (Object.prototype.hasOwnProperty.call(obj, key)) {\n fn.call(null, obj[key], key, obj);\n }\n }\n }\n}\n\n/**\n * Accepts varargs expecting each argument to be an object, then\n * immutably merges the properties of each object and returns result.\n *\n * When multiple objects contain the same key the later object in\n * the arguments list will take precedence.\n *\n * Example:\n *\n * ```js\n * var result = merge({foo: 123}, {foo: 456});\n * console.log(result.foo); // outputs 456\n * ```\n *\n * @param {Object} obj1 Object to merge\n * @returns {Object} Result of all merge properties\n */\nfunction merge(/* obj1, obj2, obj3, ... */) {\n var result = {};\n function assignValue(val, key) {\n if (isPlainObject(result[key]) && isPlainObject(val)) {\n result[key] = merge(result[key], val);\n } else if (isPlainObject(val)) {\n result[key] = merge({}, val);\n } else if (isArray(val)) {\n result[key] = val.slice();\n } else {\n result[key] = val;\n }\n }\n\n for (var i = 0, l = arguments.length; i < l; i++) {\n forEach(arguments[i], assignValue);\n }\n return result;\n}\n\n/**\n * Extends object a by mutably adding to it the properties of object b.\n *\n * @param {Object} a The object to be extended\n * @param {Object} b The object to copy properties from\n * @param {Object} thisArg The object to bind function to\n * @return {Object} The resulting value of object a\n */\nfunction extend(a, b, thisArg) {\n forEach(b, function assignValue(val, key) {\n if (thisArg && typeof val === 'function') {\n a[key] = bind(val, thisArg);\n } else {\n a[key] = val;\n }\n });\n return a;\n}\n\n/**\n * Remove byte order marker. This catches EF BB BF (the UTF-8 BOM)\n *\n * @param {string} content with BOM\n * @return {string} content value without BOM\n */\nfunction stripBOM(content) {\n if (content.charCodeAt(0) === 0xFEFF) {\n content = content.slice(1);\n }\n return content;\n}\n\nmodule.exports = {\n isArray: isArray,\n isArrayBuffer: isArrayBuffer,\n isBuffer: isBuffer,\n isFormData: isFormData,\n isArrayBufferView: isArrayBufferView,\n isString: isString,\n isNumber: isNumber,\n isObject: isObject,\n isPlainObject: isPlainObject,\n isUndefined: isUndefined,\n isDate: isDate,\n isFile: isFile,\n isBlob: isBlob,\n isFunction: isFunction,\n isStream: isStream,\n isURLSearchParams: isURLSearchParams,\n isStandardBrowserEnv: isStandardBrowserEnv,\n forEach: forEach,\n merge: merge,\n extend: extend,\n trim: trim,\n stripBOM: stripBOM\n};\n"],"sourceRoot":""} \ No newline at end of file diff --git a/node_modules/axios/dist/axios.min.js b/node_modules/axios/dist/axios.min.js index b87c0e3..1ed7cf3 100644 --- a/node_modules/axios/dist/axios.min.js +++ b/node_modules/axios/dist/axios.min.js @@ -1,3 +1,2 @@ -/* axios v0.19.2 | (c) 2020 by Matt Zabriskie */ -!function(e,t){"object"==typeof exports&&"object"==typeof module?module.exports=t():"function"==typeof define&&define.amd?define([],t):"object"==typeof exports?exports.axios=t():e.axios=t()}(this,function(){return function(e){function t(r){if(n[r])return n[r].exports;var o=n[r]={exports:{},id:r,loaded:!1};return e[r].call(o.exports,o,o.exports,t),o.loaded=!0,o.exports}var n={};return t.m=e,t.c=n,t.p="",t(0)}([function(e,t,n){e.exports=n(1)},function(e,t,n){"use strict";function r(e){var t=new s(e),n=i(s.prototype.request,t);return o.extend(n,s.prototype,t),o.extend(n,t),n}var o=n(2),i=n(3),s=n(4),a=n(22),u=n(10),c=r(u);c.Axios=s,c.create=function(e){return r(a(c.defaults,e))},c.Cancel=n(23),c.CancelToken=n(24),c.isCancel=n(9),c.all=function(e){return Promise.all(e)},c.spread=n(25),e.exports=c,e.exports.default=c},function(e,t,n){"use strict";function r(e){return"[object Array]"===j.call(e)}function o(e){return"undefined"==typeof e}function i(e){return null!==e&&!o(e)&&null!==e.constructor&&!o(e.constructor)&&"function"==typeof e.constructor.isBuffer&&e.constructor.isBuffer(e)}function s(e){return"[object ArrayBuffer]"===j.call(e)}function a(e){return"undefined"!=typeof FormData&&e instanceof FormData}function u(e){var t;return t="undefined"!=typeof ArrayBuffer&&ArrayBuffer.isView?ArrayBuffer.isView(e):e&&e.buffer&&e.buffer instanceof ArrayBuffer}function c(e){return"string"==typeof e}function f(e){return"number"==typeof e}function p(e){return null!==e&&"object"==typeof e}function d(e){return"[object Date]"===j.call(e)}function l(e){return"[object File]"===j.call(e)}function h(e){return"[object Blob]"===j.call(e)}function m(e){return"[object Function]"===j.call(e)}function y(e){return p(e)&&m(e.pipe)}function g(e){return"undefined"!=typeof URLSearchParams&&e instanceof URLSearchParams}function v(e){return e.replace(/^\s*/,"").replace(/\s*$/,"")}function x(){return("undefined"==typeof navigator||"ReactNative"!==navigator.product&&"NativeScript"!==navigator.product&&"NS"!==navigator.product)&&("undefined"!=typeof window&&"undefined"!=typeof document)}function w(e,t){if(null!==e&&"undefined"!=typeof e)if("object"!=typeof e&&(e=[e]),r(e))for(var n=0,o=e.length;n=200&&e<300}};u.headers={common:{Accept:"application/json, text/plain, */*"}},i.forEach(["delete","get","head"],function(e){u.headers[e]={}}),i.forEach(["post","put","patch"],function(e){u.headers[e]=i.merge(a)}),e.exports=u},function(e,t,n){"use strict";var r=n(2);e.exports=function(e,t){r.forEach(e,function(n,r){r!==t&&r.toUpperCase()===t.toUpperCase()&&(e[t]=n,delete e[r])})}},function(e,t,n){"use strict";var r=n(2),o=n(13),i=n(5),s=n(16),a=n(19),u=n(20),c=n(14);e.exports=function(e){return new Promise(function(t,f){var p=e.data,d=e.headers;r.isFormData(p)&&delete d["Content-Type"];var l=new XMLHttpRequest;if(e.auth){var h=e.auth.username||"",m=e.auth.password||"";d.Authorization="Basic "+btoa(h+":"+m)}var y=s(e.baseURL,e.url);if(l.open(e.method.toUpperCase(),i(y,e.params,e.paramsSerializer),!0),l.timeout=e.timeout,l.onreadystatechange=function(){if(l&&4===l.readyState&&(0!==l.status||l.responseURL&&0===l.responseURL.indexOf("file:"))){var n="getAllResponseHeaders"in l?a(l.getAllResponseHeaders()):null,r=e.responseType&&"text"!==e.responseType?l.response:l.responseText,i={data:r,status:l.status,statusText:l.statusText,headers:n,config:e,request:l};o(t,f,i),l=null}},l.onabort=function(){l&&(f(c("Request aborted",e,"ECONNABORTED",l)),l=null)},l.onerror=function(){f(c("Network Error",e,null,l)),l=null},l.ontimeout=function(){var t="timeout of "+e.timeout+"ms exceeded";e.timeoutErrorMessage&&(t=e.timeoutErrorMessage),f(c(t,e,"ECONNABORTED",l)),l=null},r.isStandardBrowserEnv()){var g=n(21),v=(e.withCredentials||u(y))&&e.xsrfCookieName?g.read(e.xsrfCookieName):void 0;v&&(d[e.xsrfHeaderName]=v)}if("setRequestHeader"in l&&r.forEach(d,function(e,t){"undefined"==typeof p&&"content-type"===t.toLowerCase()?delete d[t]:l.setRequestHeader(t,e)}),r.isUndefined(e.withCredentials)||(l.withCredentials=!!e.withCredentials),e.responseType)try{l.responseType=e.responseType}catch(t){if("json"!==e.responseType)throw t}"function"==typeof e.onDownloadProgress&&l.addEventListener("progress",e.onDownloadProgress),"function"==typeof e.onUploadProgress&&l.upload&&l.upload.addEventListener("progress",e.onUploadProgress),e.cancelToken&&e.cancelToken.promise.then(function(e){l&&(l.abort(),f(e),l=null)}),void 0===p&&(p=null),l.send(p)})}},function(e,t,n){"use strict";var r=n(14);e.exports=function(e,t,n){var o=n.config.validateStatus;!o||o(n.status)?e(n):t(r("Request failed with status code "+n.status,n.config,null,n.request,n))}},function(e,t,n){"use strict";var r=n(15);e.exports=function(e,t,n,o,i){var s=new Error(e);return r(s,t,n,o,i)}},function(e,t){"use strict";e.exports=function(e,t,n,r,o){return e.config=t,n&&(e.code=n),e.request=r,e.response=o,e.isAxiosError=!0,e.toJSON=function(){return{message:this.message,name:this.name,description:this.description,number:this.number,fileName:this.fileName,lineNumber:this.lineNumber,columnNumber:this.columnNumber,stack:this.stack,config:this.config,code:this.code}},e}},function(e,t,n){"use strict";var r=n(17),o=n(18);e.exports=function(e,t){return e&&!r(t)?o(e,t):t}},function(e,t){"use strict";e.exports=function(e){return/^([a-z][a-z\d\+\-\.]*:)?\/\//i.test(e)}},function(e,t){"use strict";e.exports=function(e,t){return t?e.replace(/\/+$/,"")+"/"+t.replace(/^\/+/,""):e}},function(e,t,n){"use strict";var r=n(2),o=["age","authorization","content-length","content-type","etag","expires","from","host","if-modified-since","if-unmodified-since","last-modified","location","max-forwards","proxy-authorization","referer","retry-after","user-agent"];e.exports=function(e){var t,n,i,s={};return e?(r.forEach(e.split("\n"),function(e){if(i=e.indexOf(":"),t=r.trim(e.substr(0,i)).toLowerCase(),n=r.trim(e.substr(i+1)),t){if(s[t]&&o.indexOf(t)>=0)return;"set-cookie"===t?s[t]=(s[t]?s[t]:[]).concat([n]):s[t]=s[t]?s[t]+", "+n:n}}),s):s}},function(e,t,n){"use strict";var r=n(2);e.exports=r.isStandardBrowserEnv()?function(){function e(e){var t=e;return n&&(o.setAttribute("href",t),t=o.href),o.setAttribute("href",t),{href:o.href,protocol:o.protocol?o.protocol.replace(/:$/,""):"",host:o.host,search:o.search?o.search.replace(/^\?/,""):"",hash:o.hash?o.hash.replace(/^#/,""):"",hostname:o.hostname,port:o.port,pathname:"/"===o.pathname.charAt(0)?o.pathname:"/"+o.pathname}}var t,n=/(msie|trident)/i.test(navigator.userAgent),o=document.createElement("a");return t=e(window.location.href),function(n){var o=r.isString(n)?e(n):n;return o.protocol===t.protocol&&o.host===t.host}}():function(){return function(){return!0}}()},function(e,t,n){"use strict";var r=n(2);e.exports=r.isStandardBrowserEnv()?function(){return{write:function(e,t,n,o,i,s){var a=[];a.push(e+"="+encodeURIComponent(t)),r.isNumber(n)&&a.push("expires="+new Date(n).toGMTString()),r.isString(o)&&a.push("path="+o),r.isString(i)&&a.push("domain="+i),s===!0&&a.push("secure"),document.cookie=a.join("; ")},read:function(e){var t=document.cookie.match(new RegExp("(^|;\\s*)("+e+")=([^;]*)"));return t?decodeURIComponent(t[3]):null},remove:function(e){this.write(e,"",Date.now()-864e5)}}}():function(){return{write:function(){},read:function(){return null},remove:function(){}}}()},function(e,t,n){"use strict";var r=n(2);e.exports=function(e,t){t=t||{};var n={},o=["url","method","params","data"],i=["headers","auth","proxy"],s=["baseURL","url","transformRequest","transformResponse","paramsSerializer","timeout","withCredentials","adapter","responseType","xsrfCookieName","xsrfHeaderName","onUploadProgress","onDownloadProgress","maxContentLength","validateStatus","maxRedirects","httpAgent","httpsAgent","cancelToken","socketPath"];r.forEach(o,function(e){"undefined"!=typeof t[e]&&(n[e]=t[e])}),r.forEach(i,function(o){r.isObject(t[o])?n[o]=r.deepMerge(e[o],t[o]):"undefined"!=typeof t[o]?n[o]=t[o]:r.isObject(e[o])?n[o]=r.deepMerge(e[o]):"undefined"!=typeof e[o]&&(n[o]=e[o])}),r.forEach(s,function(r){"undefined"!=typeof t[r]?n[r]=t[r]:"undefined"!=typeof e[r]&&(n[r]=e[r])});var a=o.concat(i).concat(s),u=Object.keys(t).filter(function(e){return a.indexOf(e)===-1});return r.forEach(u,function(r){"undefined"!=typeof t[r]?n[r]=t[r]:"undefined"!=typeof e[r]&&(n[r]=e[r])}),n}},function(e,t){"use strict";function n(e){this.message=e}n.prototype.toString=function(){return"Cancel"+(this.message?": "+this.message:"")},n.prototype.__CANCEL__=!0,e.exports=n},function(e,t,n){"use strict";function r(e){if("function"!=typeof e)throw new TypeError("executor must be a function.");var t;this.promise=new Promise(function(e){t=e});var n=this;e(function(e){n.reason||(n.reason=new o(e),t(n.reason))})}var o=n(23);r.prototype.throwIfRequested=function(){if(this.reason)throw this.reason},r.source=function(){var e,t=new r(function(t){e=t});return{token:t,cancel:e}},e.exports=r},function(e,t){"use strict";e.exports=function(e){return function(t){return e.apply(null,t)}}}])}); +!function(e,t){"object"==typeof exports&&"object"==typeof module?module.exports=t():"function"==typeof define&&define.amd?define([],t):"object"==typeof exports?exports.axios=t():e.axios=t()}(this,(function(){return function(e){var t={};function n(r){if(t[r])return t[r].exports;var o=t[r]={i:r,l:!1,exports:{}};return e[r].call(o.exports,o,o.exports,n),o.l=!0,o.exports}return n.m=e,n.c=t,n.d=function(e,t,r){n.o(e,t)||Object.defineProperty(e,t,{enumerable:!0,get:r})},n.r=function(e){"undefined"!=typeof Symbol&&Symbol.toStringTag&&Object.defineProperty(e,Symbol.toStringTag,{value:"Module"}),Object.defineProperty(e,"__esModule",{value:!0})},n.t=function(e,t){if(1&t&&(e=n(e)),8&t)return e;if(4&t&&"object"==typeof e&&e&&e.__esModule)return e;var r=Object.create(null);if(n.r(r),Object.defineProperty(r,"default",{enumerable:!0,value:e}),2&t&&"string"!=typeof e)for(var o in e)n.d(r,o,function(t){return e[t]}.bind(null,o));return r},n.n=function(e){var t=e&&e.__esModule?function(){return e.default}:function(){return e};return n.d(t,"a",t),t},n.o=function(e,t){return Object.prototype.hasOwnProperty.call(e,t)},n.p="",n(n.s=12)}([function(e,t,n){"use strict";var r=n(3),o=Object.prototype.toString;function i(e){return Array.isArray(e)}function s(e){return void 0===e}function a(e){return"[object ArrayBuffer]"===o.call(e)}function u(e){return null!==e&&"object"==typeof e}function c(e){if("[object Object]"!==o.call(e))return!1;var t=Object.getPrototypeOf(e);return null===t||t===Object.prototype}function f(e){return"[object Function]"===o.call(e)}function l(e,t){if(null!=e)if("object"!=typeof e&&(e=[e]),i(e))for(var n=0,r=e.length;n=200&&e<300},headers:{common:{Accept:"application/json, text/plain, */*"}}};r.forEach(["delete","get","head"],(function(e){f.headers[e]={}})),r.forEach(["post","put","patch"],(function(e){f.headers[e]=r.merge(a)})),e.exports=f},function(e,t,n){"use strict";e.exports=function(e,t){return function(){for(var n=new Array(arguments.length),r=0;r=0)return;s[t]="set-cookie"===t?(s[t]?s[t]:[]).concat([n]):s[t]?s[t]+", "+n:n}})),s):s}},function(e,t,n){"use strict";var r=n(0);e.exports=r.isStandardBrowserEnv()?function(){var e,t=/(msie|trident)/i.test(navigator.userAgent),n=document.createElement("a");function o(e){var r=e;return t&&(n.setAttribute("href",r),r=n.href),n.setAttribute("href",r),{href:n.href,protocol:n.protocol?n.protocol.replace(/:$/,""):"",host:n.host,search:n.search?n.search.replace(/^\?/,""):"",hash:n.hash?n.hash.replace(/^#/,""):"",hostname:n.hostname,port:n.port,pathname:"/"===n.pathname.charAt(0)?n.pathname:"/"+n.pathname}}return e=o(window.location.href),function(t){var n=r.isString(t)?o(t):t;return n.protocol===e.protocol&&n.host===e.host}}():function(){return!0}},function(e,t,n){"use strict";var r=n(11).version,o={};["object","boolean","number","function","string","symbol"].forEach((function(e,t){o[e]=function(n){return typeof n===e||"a"+(t<1?"n ":" ")+e}}));var i={};o.transitional=function(e,t,n){function o(e,t){return"[Axios v"+r+"] Transitional option '"+e+"'"+t+(n?". "+n:"")}return function(n,r,s){if(!1===e)throw new Error(o(r," has been removed"+(t?" in "+t:"")));return t&&!i[r]&&(i[r]=!0,console.warn(o(r," has been deprecated since v"+t+" and will be removed in the near future"))),!e||e(n,r,s)}},e.exports={assertOptions:function(e,t,n){if("object"!=typeof e)throw new TypeError("options must be an object");for(var r=Object.keys(e),o=r.length;o-- >0;){var i=r[o],s=t[i];if(s){var a=e[i],u=void 0===a||s(a,i,e);if(!0!==u)throw new TypeError("option "+i+" must be "+u)}else if(!0!==n)throw Error("Unknown option "+i)}},validators:o}},function(e,t,n){"use strict";var r=n(1);function o(e){if("function"!=typeof e)throw new TypeError("executor must be a function.");var t;this.promise=new Promise((function(e){t=e}));var n=this;this.promise.then((function(e){if(n._listeners){var t,r=n._listeners.length;for(t=0;t undefined\n\t * typeof document -> undefined\n\t *\n\t * react-native:\n\t * navigator.product -> 'ReactNative'\n\t * nativescript\n\t * navigator.product -> 'NativeScript' or 'NS'\n\t */\n\tfunction isStandardBrowserEnv() {\n\t if (typeof navigator !== 'undefined' && (navigator.product === 'ReactNative' ||\n\t navigator.product === 'NativeScript' ||\n\t navigator.product === 'NS')) {\n\t return false;\n\t }\n\t return (\n\t typeof window !== 'undefined' &&\n\t typeof document !== 'undefined'\n\t );\n\t}\n\t\n\t/**\n\t * Iterate over an Array or an Object invoking a function for each item.\n\t *\n\t * If `obj` is an Array callback will be called passing\n\t * the value, index, and complete array for each item.\n\t *\n\t * If 'obj' is an Object callback will be called passing\n\t * the value, key, and complete object for each property.\n\t *\n\t * @param {Object|Array} obj The object to iterate\n\t * @param {Function} fn The callback to invoke for each item\n\t */\n\tfunction forEach(obj, fn) {\n\t // Don't bother if no value provided\n\t if (obj === null || typeof obj === 'undefined') {\n\t return;\n\t }\n\t\n\t // Force an array if not already something iterable\n\t if (typeof obj !== 'object') {\n\t /*eslint no-param-reassign:0*/\n\t obj = [obj];\n\t }\n\t\n\t if (isArray(obj)) {\n\t // Iterate over array values\n\t for (var i = 0, l = obj.length; i < l; i++) {\n\t fn.call(null, obj[i], i, obj);\n\t }\n\t } else {\n\t // Iterate over object keys\n\t for (var key in obj) {\n\t if (Object.prototype.hasOwnProperty.call(obj, key)) {\n\t fn.call(null, obj[key], key, obj);\n\t }\n\t }\n\t }\n\t}\n\t\n\t/**\n\t * Accepts varargs expecting each argument to be an object, then\n\t * immutably merges the properties of each object and returns result.\n\t *\n\t * When multiple objects contain the same key the later object in\n\t * the arguments list will take precedence.\n\t *\n\t * Example:\n\t *\n\t * ```js\n\t * var result = merge({foo: 123}, {foo: 456});\n\t * console.log(result.foo); // outputs 456\n\t * ```\n\t *\n\t * @param {Object} obj1 Object to merge\n\t * @returns {Object} Result of all merge properties\n\t */\n\tfunction merge(/* obj1, obj2, obj3, ... */) {\n\t var result = {};\n\t function assignValue(val, key) {\n\t if (typeof result[key] === 'object' && typeof val === 'object') {\n\t result[key] = merge(result[key], val);\n\t } else {\n\t result[key] = val;\n\t }\n\t }\n\t\n\t for (var i = 0, l = arguments.length; i < l; i++) {\n\t forEach(arguments[i], assignValue);\n\t }\n\t return result;\n\t}\n\t\n\t/**\n\t * Function equal to merge with the difference being that no reference\n\t * to original objects is kept.\n\t *\n\t * @see merge\n\t * @param {Object} obj1 Object to merge\n\t * @returns {Object} Result of all merge properties\n\t */\n\tfunction deepMerge(/* obj1, obj2, obj3, ... */) {\n\t var result = {};\n\t function assignValue(val, key) {\n\t if (typeof result[key] === 'object' && typeof val === 'object') {\n\t result[key] = deepMerge(result[key], val);\n\t } else if (typeof val === 'object') {\n\t result[key] = deepMerge({}, val);\n\t } else {\n\t result[key] = val;\n\t }\n\t }\n\t\n\t for (var i = 0, l = arguments.length; i < l; i++) {\n\t forEach(arguments[i], assignValue);\n\t }\n\t return result;\n\t}\n\t\n\t/**\n\t * Extends object a by mutably adding to it the properties of object b.\n\t *\n\t * @param {Object} a The object to be extended\n\t * @param {Object} b The object to copy properties from\n\t * @param {Object} thisArg The object to bind function to\n\t * @return {Object} The resulting value of object a\n\t */\n\tfunction extend(a, b, thisArg) {\n\t forEach(b, function assignValue(val, key) {\n\t if (thisArg && typeof val === 'function') {\n\t a[key] = bind(val, thisArg);\n\t } else {\n\t a[key] = val;\n\t }\n\t });\n\t return a;\n\t}\n\t\n\tmodule.exports = {\n\t isArray: isArray,\n\t isArrayBuffer: isArrayBuffer,\n\t isBuffer: isBuffer,\n\t isFormData: isFormData,\n\t isArrayBufferView: isArrayBufferView,\n\t isString: isString,\n\t isNumber: isNumber,\n\t isObject: isObject,\n\t isUndefined: isUndefined,\n\t isDate: isDate,\n\t isFile: isFile,\n\t isBlob: isBlob,\n\t isFunction: isFunction,\n\t isStream: isStream,\n\t isURLSearchParams: isURLSearchParams,\n\t isStandardBrowserEnv: isStandardBrowserEnv,\n\t forEach: forEach,\n\t merge: merge,\n\t deepMerge: deepMerge,\n\t extend: extend,\n\t trim: trim\n\t};\n\n\n/***/ }),\n/* 3 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\tmodule.exports = function bind(fn, thisArg) {\n\t return function wrap() {\n\t var args = new Array(arguments.length);\n\t for (var i = 0; i < args.length; i++) {\n\t args[i] = arguments[i];\n\t }\n\t return fn.apply(thisArg, args);\n\t };\n\t};\n\n\n/***/ }),\n/* 4 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\tvar buildURL = __webpack_require__(5);\n\tvar InterceptorManager = __webpack_require__(6);\n\tvar dispatchRequest = __webpack_require__(7);\n\tvar mergeConfig = __webpack_require__(22);\n\t\n\t/**\n\t * Create a new instance of Axios\n\t *\n\t * @param {Object} instanceConfig The default config for the instance\n\t */\n\tfunction Axios(instanceConfig) {\n\t this.defaults = instanceConfig;\n\t this.interceptors = {\n\t request: new InterceptorManager(),\n\t response: new InterceptorManager()\n\t };\n\t}\n\t\n\t/**\n\t * Dispatch a request\n\t *\n\t * @param {Object} config The config specific for this request (merged with this.defaults)\n\t */\n\tAxios.prototype.request = function request(config) {\n\t /*eslint no-param-reassign:0*/\n\t // Allow for axios('example/url'[, config]) a la fetch API\n\t if (typeof config === 'string') {\n\t config = arguments[1] || {};\n\t config.url = arguments[0];\n\t } else {\n\t config = config || {};\n\t }\n\t\n\t config = mergeConfig(this.defaults, config);\n\t\n\t // Set config.method\n\t if (config.method) {\n\t config.method = config.method.toLowerCase();\n\t } else if (this.defaults.method) {\n\t config.method = this.defaults.method.toLowerCase();\n\t } else {\n\t config.method = 'get';\n\t }\n\t\n\t // Hook up interceptors middleware\n\t var chain = [dispatchRequest, undefined];\n\t var promise = Promise.resolve(config);\n\t\n\t this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) {\n\t chain.unshift(interceptor.fulfilled, interceptor.rejected);\n\t });\n\t\n\t this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) {\n\t chain.push(interceptor.fulfilled, interceptor.rejected);\n\t });\n\t\n\t while (chain.length) {\n\t promise = promise.then(chain.shift(), chain.shift());\n\t }\n\t\n\t return promise;\n\t};\n\t\n\tAxios.prototype.getUri = function getUri(config) {\n\t config = mergeConfig(this.defaults, config);\n\t return buildURL(config.url, config.params, config.paramsSerializer).replace(/^\\?/, '');\n\t};\n\t\n\t// Provide aliases for supported request methods\n\tutils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) {\n\t /*eslint func-names:0*/\n\t Axios.prototype[method] = function(url, config) {\n\t return this.request(utils.merge(config || {}, {\n\t method: method,\n\t url: url\n\t }));\n\t };\n\t});\n\t\n\tutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n\t /*eslint func-names:0*/\n\t Axios.prototype[method] = function(url, data, config) {\n\t return this.request(utils.merge(config || {}, {\n\t method: method,\n\t url: url,\n\t data: data\n\t }));\n\t };\n\t});\n\t\n\tmodule.exports = Axios;\n\n\n/***/ }),\n/* 5 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\tfunction encode(val) {\n\t return encodeURIComponent(val).\n\t replace(/%40/gi, '@').\n\t replace(/%3A/gi, ':').\n\t replace(/%24/g, '$').\n\t replace(/%2C/gi, ',').\n\t replace(/%20/g, '+').\n\t replace(/%5B/gi, '[').\n\t replace(/%5D/gi, ']');\n\t}\n\t\n\t/**\n\t * Build a URL by appending params to the end\n\t *\n\t * @param {string} url The base of the url (e.g., http://www.google.com)\n\t * @param {object} [params] The params to be appended\n\t * @returns {string} The formatted url\n\t */\n\tmodule.exports = function buildURL(url, params, paramsSerializer) {\n\t /*eslint no-param-reassign:0*/\n\t if (!params) {\n\t return url;\n\t }\n\t\n\t var serializedParams;\n\t if (paramsSerializer) {\n\t serializedParams = paramsSerializer(params);\n\t } else if (utils.isURLSearchParams(params)) {\n\t serializedParams = params.toString();\n\t } else {\n\t var parts = [];\n\t\n\t utils.forEach(params, function serialize(val, key) {\n\t if (val === null || typeof val === 'undefined') {\n\t return;\n\t }\n\t\n\t if (utils.isArray(val)) {\n\t key = key + '[]';\n\t } else {\n\t val = [val];\n\t }\n\t\n\t utils.forEach(val, function parseValue(v) {\n\t if (utils.isDate(v)) {\n\t v = v.toISOString();\n\t } else if (utils.isObject(v)) {\n\t v = JSON.stringify(v);\n\t }\n\t parts.push(encode(key) + '=' + encode(v));\n\t });\n\t });\n\t\n\t serializedParams = parts.join('&');\n\t }\n\t\n\t if (serializedParams) {\n\t var hashmarkIndex = url.indexOf('#');\n\t if (hashmarkIndex !== -1) {\n\t url = url.slice(0, hashmarkIndex);\n\t }\n\t\n\t url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams;\n\t }\n\t\n\t return url;\n\t};\n\n\n/***/ }),\n/* 6 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\tfunction InterceptorManager() {\n\t this.handlers = [];\n\t}\n\t\n\t/**\n\t * Add a new interceptor to the stack\n\t *\n\t * @param {Function} fulfilled The function to handle `then` for a `Promise`\n\t * @param {Function} rejected The function to handle `reject` for a `Promise`\n\t *\n\t * @return {Number} An ID used to remove interceptor later\n\t */\n\tInterceptorManager.prototype.use = function use(fulfilled, rejected) {\n\t this.handlers.push({\n\t fulfilled: fulfilled,\n\t rejected: rejected\n\t });\n\t return this.handlers.length - 1;\n\t};\n\t\n\t/**\n\t * Remove an interceptor from the stack\n\t *\n\t * @param {Number} id The ID that was returned by `use`\n\t */\n\tInterceptorManager.prototype.eject = function eject(id) {\n\t if (this.handlers[id]) {\n\t this.handlers[id] = null;\n\t }\n\t};\n\t\n\t/**\n\t * Iterate over all the registered interceptors\n\t *\n\t * This method is particularly useful for skipping over any\n\t * interceptors that may have become `null` calling `eject`.\n\t *\n\t * @param {Function} fn The function to call for each interceptor\n\t */\n\tInterceptorManager.prototype.forEach = function forEach(fn) {\n\t utils.forEach(this.handlers, function forEachHandler(h) {\n\t if (h !== null) {\n\t fn(h);\n\t }\n\t });\n\t};\n\t\n\tmodule.exports = InterceptorManager;\n\n\n/***/ }),\n/* 7 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\tvar transformData = __webpack_require__(8);\n\tvar isCancel = __webpack_require__(9);\n\tvar defaults = __webpack_require__(10);\n\t\n\t/**\n\t * Throws a `Cancel` if cancellation has been requested.\n\t */\n\tfunction throwIfCancellationRequested(config) {\n\t if (config.cancelToken) {\n\t config.cancelToken.throwIfRequested();\n\t }\n\t}\n\t\n\t/**\n\t * Dispatch a request to the server using the configured adapter.\n\t *\n\t * @param {object} config The config that is to be used for the request\n\t * @returns {Promise} The Promise to be fulfilled\n\t */\n\tmodule.exports = function dispatchRequest(config) {\n\t throwIfCancellationRequested(config);\n\t\n\t // Ensure headers exist\n\t config.headers = config.headers || {};\n\t\n\t // Transform request data\n\t config.data = transformData(\n\t config.data,\n\t config.headers,\n\t config.transformRequest\n\t );\n\t\n\t // Flatten headers\n\t config.headers = utils.merge(\n\t config.headers.common || {},\n\t config.headers[config.method] || {},\n\t config.headers\n\t );\n\t\n\t utils.forEach(\n\t ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'],\n\t function cleanHeaderConfig(method) {\n\t delete config.headers[method];\n\t }\n\t );\n\t\n\t var adapter = config.adapter || defaults.adapter;\n\t\n\t return adapter(config).then(function onAdapterResolution(response) {\n\t throwIfCancellationRequested(config);\n\t\n\t // Transform response data\n\t response.data = transformData(\n\t response.data,\n\t response.headers,\n\t config.transformResponse\n\t );\n\t\n\t return response;\n\t }, function onAdapterRejection(reason) {\n\t if (!isCancel(reason)) {\n\t throwIfCancellationRequested(config);\n\t\n\t // Transform response data\n\t if (reason && reason.response) {\n\t reason.response.data = transformData(\n\t reason.response.data,\n\t reason.response.headers,\n\t config.transformResponse\n\t );\n\t }\n\t }\n\t\n\t return Promise.reject(reason);\n\t });\n\t};\n\n\n/***/ }),\n/* 8 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\t/**\n\t * Transform the data for a request or a response\n\t *\n\t * @param {Object|String} data The data to be transformed\n\t * @param {Array} headers The headers for the request or response\n\t * @param {Array|Function} fns A single function or Array of functions\n\t * @returns {*} The resulting transformed data\n\t */\n\tmodule.exports = function transformData(data, headers, fns) {\n\t /*eslint no-param-reassign:0*/\n\t utils.forEach(fns, function transform(fn) {\n\t data = fn(data, headers);\n\t });\n\t\n\t return data;\n\t};\n\n\n/***/ }),\n/* 9 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\tmodule.exports = function isCancel(value) {\n\t return !!(value && value.__CANCEL__);\n\t};\n\n\n/***/ }),\n/* 10 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\tvar normalizeHeaderName = __webpack_require__(11);\n\t\n\tvar DEFAULT_CONTENT_TYPE = {\n\t 'Content-Type': 'application/x-www-form-urlencoded'\n\t};\n\t\n\tfunction setContentTypeIfUnset(headers, value) {\n\t if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) {\n\t headers['Content-Type'] = value;\n\t }\n\t}\n\t\n\tfunction getDefaultAdapter() {\n\t var adapter;\n\t if (typeof XMLHttpRequest !== 'undefined') {\n\t // For browsers use XHR adapter\n\t adapter = __webpack_require__(12);\n\t } else if (typeof process !== 'undefined' && Object.prototype.toString.call(process) === '[object process]') {\n\t // For node use HTTP adapter\n\t adapter = __webpack_require__(12);\n\t }\n\t return adapter;\n\t}\n\t\n\tvar defaults = {\n\t adapter: getDefaultAdapter(),\n\t\n\t transformRequest: [function transformRequest(data, headers) {\n\t normalizeHeaderName(headers, 'Accept');\n\t normalizeHeaderName(headers, 'Content-Type');\n\t if (utils.isFormData(data) ||\n\t utils.isArrayBuffer(data) ||\n\t utils.isBuffer(data) ||\n\t utils.isStream(data) ||\n\t utils.isFile(data) ||\n\t utils.isBlob(data)\n\t ) {\n\t return data;\n\t }\n\t if (utils.isArrayBufferView(data)) {\n\t return data.buffer;\n\t }\n\t if (utils.isURLSearchParams(data)) {\n\t setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8');\n\t return data.toString();\n\t }\n\t if (utils.isObject(data)) {\n\t setContentTypeIfUnset(headers, 'application/json;charset=utf-8');\n\t return JSON.stringify(data);\n\t }\n\t return data;\n\t }],\n\t\n\t transformResponse: [function transformResponse(data) {\n\t /*eslint no-param-reassign:0*/\n\t if (typeof data === 'string') {\n\t try {\n\t data = JSON.parse(data);\n\t } catch (e) { /* Ignore */ }\n\t }\n\t return data;\n\t }],\n\t\n\t /**\n\t * A timeout in milliseconds to abort a request. If set to 0 (default) a\n\t * timeout is not created.\n\t */\n\t timeout: 0,\n\t\n\t xsrfCookieName: 'XSRF-TOKEN',\n\t xsrfHeaderName: 'X-XSRF-TOKEN',\n\t\n\t maxContentLength: -1,\n\t\n\t validateStatus: function validateStatus(status) {\n\t return status >= 200 && status < 300;\n\t }\n\t};\n\t\n\tdefaults.headers = {\n\t common: {\n\t 'Accept': 'application/json, text/plain, */*'\n\t }\n\t};\n\t\n\tutils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) {\n\t defaults.headers[method] = {};\n\t});\n\t\n\tutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n\t defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE);\n\t});\n\t\n\tmodule.exports = defaults;\n\n\n/***/ }),\n/* 11 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\tmodule.exports = function normalizeHeaderName(headers, normalizedName) {\n\t utils.forEach(headers, function processHeader(value, name) {\n\t if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) {\n\t headers[normalizedName] = value;\n\t delete headers[name];\n\t }\n\t });\n\t};\n\n\n/***/ }),\n/* 12 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\tvar settle = __webpack_require__(13);\n\tvar buildURL = __webpack_require__(5);\n\tvar buildFullPath = __webpack_require__(16);\n\tvar parseHeaders = __webpack_require__(19);\n\tvar isURLSameOrigin = __webpack_require__(20);\n\tvar createError = __webpack_require__(14);\n\t\n\tmodule.exports = function xhrAdapter(config) {\n\t return new Promise(function dispatchXhrRequest(resolve, reject) {\n\t var requestData = config.data;\n\t var requestHeaders = config.headers;\n\t\n\t if (utils.isFormData(requestData)) {\n\t delete requestHeaders['Content-Type']; // Let the browser set it\n\t }\n\t\n\t var request = new XMLHttpRequest();\n\t\n\t // HTTP basic authentication\n\t if (config.auth) {\n\t var username = config.auth.username || '';\n\t var password = config.auth.password || '';\n\t requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password);\n\t }\n\t\n\t var fullPath = buildFullPath(config.baseURL, config.url);\n\t request.open(config.method.toUpperCase(), buildURL(fullPath, config.params, config.paramsSerializer), true);\n\t\n\t // Set the request timeout in MS\n\t request.timeout = config.timeout;\n\t\n\t // Listen for ready state\n\t request.onreadystatechange = function handleLoad() {\n\t if (!request || request.readyState !== 4) {\n\t return;\n\t }\n\t\n\t // The request errored out and we didn't get a response, this will be\n\t // handled by onerror instead\n\t // With one exception: request that using file: protocol, most browsers\n\t // will return status as 0 even though it's a successful request\n\t if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) {\n\t return;\n\t }\n\t\n\t // Prepare the response\n\t var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null;\n\t var responseData = !config.responseType || config.responseType === 'text' ? request.responseText : request.response;\n\t var response = {\n\t data: responseData,\n\t status: request.status,\n\t statusText: request.statusText,\n\t headers: responseHeaders,\n\t config: config,\n\t request: request\n\t };\n\t\n\t settle(resolve, reject, response);\n\t\n\t // Clean up request\n\t request = null;\n\t };\n\t\n\t // Handle browser request cancellation (as opposed to a manual cancellation)\n\t request.onabort = function handleAbort() {\n\t if (!request) {\n\t return;\n\t }\n\t\n\t reject(createError('Request aborted', config, 'ECONNABORTED', request));\n\t\n\t // Clean up request\n\t request = null;\n\t };\n\t\n\t // Handle low level network errors\n\t request.onerror = function handleError() {\n\t // Real errors are hidden from us by the browser\n\t // onerror should only fire if it's a network error\n\t reject(createError('Network Error', config, null, request));\n\t\n\t // Clean up request\n\t request = null;\n\t };\n\t\n\t // Handle timeout\n\t request.ontimeout = function handleTimeout() {\n\t var timeoutErrorMessage = 'timeout of ' + config.timeout + 'ms exceeded';\n\t if (config.timeoutErrorMessage) {\n\t timeoutErrorMessage = config.timeoutErrorMessage;\n\t }\n\t reject(createError(timeoutErrorMessage, config, 'ECONNABORTED',\n\t request));\n\t\n\t // Clean up request\n\t request = null;\n\t };\n\t\n\t // Add xsrf header\n\t // This is only done if running in a standard browser environment.\n\t // Specifically not if we're in a web worker, or react-native.\n\t if (utils.isStandardBrowserEnv()) {\n\t var cookies = __webpack_require__(21);\n\t\n\t // Add xsrf header\n\t var xsrfValue = (config.withCredentials || isURLSameOrigin(fullPath)) && config.xsrfCookieName ?\n\t cookies.read(config.xsrfCookieName) :\n\t undefined;\n\t\n\t if (xsrfValue) {\n\t requestHeaders[config.xsrfHeaderName] = xsrfValue;\n\t }\n\t }\n\t\n\t // Add headers to the request\n\t if ('setRequestHeader' in request) {\n\t utils.forEach(requestHeaders, function setRequestHeader(val, key) {\n\t if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') {\n\t // Remove Content-Type if data is undefined\n\t delete requestHeaders[key];\n\t } else {\n\t // Otherwise add header to the request\n\t request.setRequestHeader(key, val);\n\t }\n\t });\n\t }\n\t\n\t // Add withCredentials to request if needed\n\t if (!utils.isUndefined(config.withCredentials)) {\n\t request.withCredentials = !!config.withCredentials;\n\t }\n\t\n\t // Add responseType to request if needed\n\t if (config.responseType) {\n\t try {\n\t request.responseType = config.responseType;\n\t } catch (e) {\n\t // Expected DOMException thrown by browsers not compatible XMLHttpRequest Level 2.\n\t // But, this can be suppressed for 'json' type as it can be parsed by default 'transformResponse' function.\n\t if (config.responseType !== 'json') {\n\t throw e;\n\t }\n\t }\n\t }\n\t\n\t // Handle progress if needed\n\t if (typeof config.onDownloadProgress === 'function') {\n\t request.addEventListener('progress', config.onDownloadProgress);\n\t }\n\t\n\t // Not all browsers support upload events\n\t if (typeof config.onUploadProgress === 'function' && request.upload) {\n\t request.upload.addEventListener('progress', config.onUploadProgress);\n\t }\n\t\n\t if (config.cancelToken) {\n\t // Handle cancellation\n\t config.cancelToken.promise.then(function onCanceled(cancel) {\n\t if (!request) {\n\t return;\n\t }\n\t\n\t request.abort();\n\t reject(cancel);\n\t // Clean up request\n\t request = null;\n\t });\n\t }\n\t\n\t if (requestData === undefined) {\n\t requestData = null;\n\t }\n\t\n\t // Send the request\n\t request.send(requestData);\n\t });\n\t};\n\n\n/***/ }),\n/* 13 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar createError = __webpack_require__(14);\n\t\n\t/**\n\t * Resolve or reject a Promise based on response status.\n\t *\n\t * @param {Function} resolve A function that resolves the promise.\n\t * @param {Function} reject A function that rejects the promise.\n\t * @param {object} response The response.\n\t */\n\tmodule.exports = function settle(resolve, reject, response) {\n\t var validateStatus = response.config.validateStatus;\n\t if (!validateStatus || validateStatus(response.status)) {\n\t resolve(response);\n\t } else {\n\t reject(createError(\n\t 'Request failed with status code ' + response.status,\n\t response.config,\n\t null,\n\t response.request,\n\t response\n\t ));\n\t }\n\t};\n\n\n/***/ }),\n/* 14 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar enhanceError = __webpack_require__(15);\n\t\n\t/**\n\t * Create an Error with the specified message, config, error code, request and response.\n\t *\n\t * @param {string} message The error message.\n\t * @param {Object} config The config.\n\t * @param {string} [code] The error code (for example, 'ECONNABORTED').\n\t * @param {Object} [request] The request.\n\t * @param {Object} [response] The response.\n\t * @returns {Error} The created error.\n\t */\n\tmodule.exports = function createError(message, config, code, request, response) {\n\t var error = new Error(message);\n\t return enhanceError(error, config, code, request, response);\n\t};\n\n\n/***/ }),\n/* 15 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\t/**\n\t * Update an Error with the specified config, error code, and response.\n\t *\n\t * @param {Error} error The error to update.\n\t * @param {Object} config The config.\n\t * @param {string} [code] The error code (for example, 'ECONNABORTED').\n\t * @param {Object} [request] The request.\n\t * @param {Object} [response] The response.\n\t * @returns {Error} The error.\n\t */\n\tmodule.exports = function enhanceError(error, config, code, request, response) {\n\t error.config = config;\n\t if (code) {\n\t error.code = code;\n\t }\n\t\n\t error.request = request;\n\t error.response = response;\n\t error.isAxiosError = true;\n\t\n\t error.toJSON = function() {\n\t return {\n\t // Standard\n\t message: this.message,\n\t name: this.name,\n\t // Microsoft\n\t description: this.description,\n\t number: this.number,\n\t // Mozilla\n\t fileName: this.fileName,\n\t lineNumber: this.lineNumber,\n\t columnNumber: this.columnNumber,\n\t stack: this.stack,\n\t // Axios\n\t config: this.config,\n\t code: this.code\n\t };\n\t };\n\t return error;\n\t};\n\n\n/***/ }),\n/* 16 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar isAbsoluteURL = __webpack_require__(17);\n\tvar combineURLs = __webpack_require__(18);\n\t\n\t/**\n\t * Creates a new URL by combining the baseURL with the requestedURL,\n\t * only when the requestedURL is not already an absolute URL.\n\t * If the requestURL is absolute, this function returns the requestedURL untouched.\n\t *\n\t * @param {string} baseURL The base URL\n\t * @param {string} requestedURL Absolute or relative URL to combine\n\t * @returns {string} The combined full path\n\t */\n\tmodule.exports = function buildFullPath(baseURL, requestedURL) {\n\t if (baseURL && !isAbsoluteURL(requestedURL)) {\n\t return combineURLs(baseURL, requestedURL);\n\t }\n\t return requestedURL;\n\t};\n\n\n/***/ }),\n/* 17 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\t/**\n\t * Determines whether the specified URL is absolute\n\t *\n\t * @param {string} url The URL to test\n\t * @returns {boolean} True if the specified URL is absolute, otherwise false\n\t */\n\tmodule.exports = function isAbsoluteURL(url) {\n\t // A URL is considered absolute if it begins with \"://\" or \"//\" (protocol-relative URL).\n\t // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed\n\t // by any combination of letters, digits, plus, period, or hyphen.\n\t return /^([a-z][a-z\\d\\+\\-\\.]*:)?\\/\\//i.test(url);\n\t};\n\n\n/***/ }),\n/* 18 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\t/**\n\t * Creates a new URL by combining the specified URLs\n\t *\n\t * @param {string} baseURL The base URL\n\t * @param {string} relativeURL The relative URL\n\t * @returns {string} The combined URL\n\t */\n\tmodule.exports = function combineURLs(baseURL, relativeURL) {\n\t return relativeURL\n\t ? baseURL.replace(/\\/+$/, '') + '/' + relativeURL.replace(/^\\/+/, '')\n\t : baseURL;\n\t};\n\n\n/***/ }),\n/* 19 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\t// Headers whose duplicates are ignored by node\n\t// c.f. https://nodejs.org/api/http.html#http_message_headers\n\tvar ignoreDuplicateOf = [\n\t 'age', 'authorization', 'content-length', 'content-type', 'etag',\n\t 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since',\n\t 'last-modified', 'location', 'max-forwards', 'proxy-authorization',\n\t 'referer', 'retry-after', 'user-agent'\n\t];\n\t\n\t/**\n\t * Parse headers into an object\n\t *\n\t * ```\n\t * Date: Wed, 27 Aug 2014 08:58:49 GMT\n\t * Content-Type: application/json\n\t * Connection: keep-alive\n\t * Transfer-Encoding: chunked\n\t * ```\n\t *\n\t * @param {String} headers Headers needing to be parsed\n\t * @returns {Object} Headers parsed into an object\n\t */\n\tmodule.exports = function parseHeaders(headers) {\n\t var parsed = {};\n\t var key;\n\t var val;\n\t var i;\n\t\n\t if (!headers) { return parsed; }\n\t\n\t utils.forEach(headers.split('\\n'), function parser(line) {\n\t i = line.indexOf(':');\n\t key = utils.trim(line.substr(0, i)).toLowerCase();\n\t val = utils.trim(line.substr(i + 1));\n\t\n\t if (key) {\n\t if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) {\n\t return;\n\t }\n\t if (key === 'set-cookie') {\n\t parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]);\n\t } else {\n\t parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val;\n\t }\n\t }\n\t });\n\t\n\t return parsed;\n\t};\n\n\n/***/ }),\n/* 20 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\tmodule.exports = (\n\t utils.isStandardBrowserEnv() ?\n\t\n\t // Standard browser envs have full support of the APIs needed to test\n\t // whether the request URL is of the same origin as current location.\n\t (function standardBrowserEnv() {\n\t var msie = /(msie|trident)/i.test(navigator.userAgent);\n\t var urlParsingNode = document.createElement('a');\n\t var originURL;\n\t\n\t /**\n\t * Parse a URL to discover it's components\n\t *\n\t * @param {String} url The URL to be parsed\n\t * @returns {Object}\n\t */\n\t function resolveURL(url) {\n\t var href = url;\n\t\n\t if (msie) {\n\t // IE needs attribute set twice to normalize properties\n\t urlParsingNode.setAttribute('href', href);\n\t href = urlParsingNode.href;\n\t }\n\t\n\t urlParsingNode.setAttribute('href', href);\n\t\n\t // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils\n\t return {\n\t href: urlParsingNode.href,\n\t protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '',\n\t host: urlParsingNode.host,\n\t search: urlParsingNode.search ? urlParsingNode.search.replace(/^\\?/, '') : '',\n\t hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '',\n\t hostname: urlParsingNode.hostname,\n\t port: urlParsingNode.port,\n\t pathname: (urlParsingNode.pathname.charAt(0) === '/') ?\n\t urlParsingNode.pathname :\n\t '/' + urlParsingNode.pathname\n\t };\n\t }\n\t\n\t originURL = resolveURL(window.location.href);\n\t\n\t /**\n\t * Determine if a URL shares the same origin as the current location\n\t *\n\t * @param {String} requestURL The URL to test\n\t * @returns {boolean} True if URL shares the same origin, otherwise false\n\t */\n\t return function isURLSameOrigin(requestURL) {\n\t var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL;\n\t return (parsed.protocol === originURL.protocol &&\n\t parsed.host === originURL.host);\n\t };\n\t })() :\n\t\n\t // Non standard browser envs (web workers, react-native) lack needed support.\n\t (function nonStandardBrowserEnv() {\n\t return function isURLSameOrigin() {\n\t return true;\n\t };\n\t })()\n\t);\n\n\n/***/ }),\n/* 21 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\tmodule.exports = (\n\t utils.isStandardBrowserEnv() ?\n\t\n\t // Standard browser envs support document.cookie\n\t (function standardBrowserEnv() {\n\t return {\n\t write: function write(name, value, expires, path, domain, secure) {\n\t var cookie = [];\n\t cookie.push(name + '=' + encodeURIComponent(value));\n\t\n\t if (utils.isNumber(expires)) {\n\t cookie.push('expires=' + new Date(expires).toGMTString());\n\t }\n\t\n\t if (utils.isString(path)) {\n\t cookie.push('path=' + path);\n\t }\n\t\n\t if (utils.isString(domain)) {\n\t cookie.push('domain=' + domain);\n\t }\n\t\n\t if (secure === true) {\n\t cookie.push('secure');\n\t }\n\t\n\t document.cookie = cookie.join('; ');\n\t },\n\t\n\t read: function read(name) {\n\t var match = document.cookie.match(new RegExp('(^|;\\\\s*)(' + name + ')=([^;]*)'));\n\t return (match ? decodeURIComponent(match[3]) : null);\n\t },\n\t\n\t remove: function remove(name) {\n\t this.write(name, '', Date.now() - 86400000);\n\t }\n\t };\n\t })() :\n\t\n\t // Non standard browser env (web workers, react-native) lack needed support.\n\t (function nonStandardBrowserEnv() {\n\t return {\n\t write: function write() {},\n\t read: function read() { return null; },\n\t remove: function remove() {}\n\t };\n\t })()\n\t);\n\n\n/***/ }),\n/* 22 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\t/**\n\t * Config-specific merge-function which creates a new config-object\n\t * by merging two configuration objects together.\n\t *\n\t * @param {Object} config1\n\t * @param {Object} config2\n\t * @returns {Object} New object resulting from merging config2 to config1\n\t */\n\tmodule.exports = function mergeConfig(config1, config2) {\n\t // eslint-disable-next-line no-param-reassign\n\t config2 = config2 || {};\n\t var config = {};\n\t\n\t var valueFromConfig2Keys = ['url', 'method', 'params', 'data'];\n\t var mergeDeepPropertiesKeys = ['headers', 'auth', 'proxy'];\n\t var defaultToConfig2Keys = [\n\t 'baseURL', 'url', 'transformRequest', 'transformResponse', 'paramsSerializer',\n\t 'timeout', 'withCredentials', 'adapter', 'responseType', 'xsrfCookieName',\n\t 'xsrfHeaderName', 'onUploadProgress', 'onDownloadProgress',\n\t 'maxContentLength', 'validateStatus', 'maxRedirects', 'httpAgent',\n\t 'httpsAgent', 'cancelToken', 'socketPath'\n\t ];\n\t\n\t utils.forEach(valueFromConfig2Keys, function valueFromConfig2(prop) {\n\t if (typeof config2[prop] !== 'undefined') {\n\t config[prop] = config2[prop];\n\t }\n\t });\n\t\n\t utils.forEach(mergeDeepPropertiesKeys, function mergeDeepProperties(prop) {\n\t if (utils.isObject(config2[prop])) {\n\t config[prop] = utils.deepMerge(config1[prop], config2[prop]);\n\t } else if (typeof config2[prop] !== 'undefined') {\n\t config[prop] = config2[prop];\n\t } else if (utils.isObject(config1[prop])) {\n\t config[prop] = utils.deepMerge(config1[prop]);\n\t } else if (typeof config1[prop] !== 'undefined') {\n\t config[prop] = config1[prop];\n\t }\n\t });\n\t\n\t utils.forEach(defaultToConfig2Keys, function defaultToConfig2(prop) {\n\t if (typeof config2[prop] !== 'undefined') {\n\t config[prop] = config2[prop];\n\t } else if (typeof config1[prop] !== 'undefined') {\n\t config[prop] = config1[prop];\n\t }\n\t });\n\t\n\t var axiosKeys = valueFromConfig2Keys\n\t .concat(mergeDeepPropertiesKeys)\n\t .concat(defaultToConfig2Keys);\n\t\n\t var otherKeys = Object\n\t .keys(config2)\n\t .filter(function filterAxiosKeys(key) {\n\t return axiosKeys.indexOf(key) === -1;\n\t });\n\t\n\t utils.forEach(otherKeys, function otherKeysDefaultToConfig2(prop) {\n\t if (typeof config2[prop] !== 'undefined') {\n\t config[prop] = config2[prop];\n\t } else if (typeof config1[prop] !== 'undefined') {\n\t config[prop] = config1[prop];\n\t }\n\t });\n\t\n\t return config;\n\t};\n\n\n/***/ }),\n/* 23 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\t/**\n\t * A `Cancel` is an object that is thrown when an operation is canceled.\n\t *\n\t * @class\n\t * @param {string=} message The message.\n\t */\n\tfunction Cancel(message) {\n\t this.message = message;\n\t}\n\t\n\tCancel.prototype.toString = function toString() {\n\t return 'Cancel' + (this.message ? ': ' + this.message : '');\n\t};\n\t\n\tCancel.prototype.__CANCEL__ = true;\n\t\n\tmodule.exports = Cancel;\n\n\n/***/ }),\n/* 24 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar Cancel = __webpack_require__(23);\n\t\n\t/**\n\t * A `CancelToken` is an object that can be used to request cancellation of an operation.\n\t *\n\t * @class\n\t * @param {Function} executor The executor function.\n\t */\n\tfunction CancelToken(executor) {\n\t if (typeof executor !== 'function') {\n\t throw new TypeError('executor must be a function.');\n\t }\n\t\n\t var resolvePromise;\n\t this.promise = new Promise(function promiseExecutor(resolve) {\n\t resolvePromise = resolve;\n\t });\n\t\n\t var token = this;\n\t executor(function cancel(message) {\n\t if (token.reason) {\n\t // Cancellation has already been requested\n\t return;\n\t }\n\t\n\t token.reason = new Cancel(message);\n\t resolvePromise(token.reason);\n\t });\n\t}\n\t\n\t/**\n\t * Throws a `Cancel` if cancellation has been requested.\n\t */\n\tCancelToken.prototype.throwIfRequested = function throwIfRequested() {\n\t if (this.reason) {\n\t throw this.reason;\n\t }\n\t};\n\t\n\t/**\n\t * Returns an object that contains a new `CancelToken` and a function that, when called,\n\t * cancels the `CancelToken`.\n\t */\n\tCancelToken.source = function source() {\n\t var cancel;\n\t var token = new CancelToken(function executor(c) {\n\t cancel = c;\n\t });\n\t return {\n\t token: token,\n\t cancel: cancel\n\t };\n\t};\n\t\n\tmodule.exports = CancelToken;\n\n\n/***/ }),\n/* 25 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\t/**\n\t * Syntactic sugar for invoking a function and expanding an array for arguments.\n\t *\n\t * Common use case would be to use `Function.prototype.apply`.\n\t *\n\t * ```js\n\t * function f(x, y, z) {}\n\t * var args = [1, 2, 3];\n\t * f.apply(null, args);\n\t * ```\n\t *\n\t * With `spread` this example can be re-written.\n\t *\n\t * ```js\n\t * spread(function(x, y, z) {})([1, 2, 3]);\n\t * ```\n\t *\n\t * @param {Function} callback\n\t * @returns {Function}\n\t */\n\tmodule.exports = function spread(callback) {\n\t return function wrap(arr) {\n\t return callback.apply(null, arr);\n\t };\n\t};\n\n\n/***/ })\n/******/ ])\n});\n;\n\n\n// WEBPACK FOOTER //\n// axios.min.js"," \t// The module cache\n \tvar installedModules = {};\n\n \t// The require function\n \tfunction __webpack_require__(moduleId) {\n\n \t\t// Check if module is in cache\n \t\tif(installedModules[moduleId])\n \t\t\treturn installedModules[moduleId].exports;\n\n \t\t// Create a new module (and put it into the cache)\n \t\tvar module = installedModules[moduleId] = {\n \t\t\texports: {},\n \t\t\tid: moduleId,\n \t\t\tloaded: false\n \t\t};\n\n \t\t// Execute the module function\n \t\tmodules[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n\n \t\t// Flag the module as loaded\n \t\tmodule.loaded = true;\n\n \t\t// Return the exports of the module\n \t\treturn module.exports;\n \t}\n\n\n \t// expose the modules object (__webpack_modules__)\n \t__webpack_require__.m = modules;\n\n \t// expose the module cache\n \t__webpack_require__.c = installedModules;\n\n \t// __webpack_public_path__\n \t__webpack_require__.p = \"\";\n\n \t// Load entry module and return exports\n \treturn __webpack_require__(0);\n\n\n\n// WEBPACK FOOTER //\n// webpack/bootstrap be8c45a40d7c235b46c5","module.exports = require('./lib/axios');\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./index.js\n// module id = 0\n// module chunks = 0","'use strict';\n\nvar utils = require('./utils');\nvar bind = require('./helpers/bind');\nvar Axios = require('./core/Axios');\nvar mergeConfig = require('./core/mergeConfig');\nvar defaults = require('./defaults');\n\n/**\n * Create an instance of Axios\n *\n * @param {Object} defaultConfig The default config for the instance\n * @return {Axios} A new instance of Axios\n */\nfunction createInstance(defaultConfig) {\n var context = new Axios(defaultConfig);\n var instance = bind(Axios.prototype.request, context);\n\n // Copy axios.prototype to instance\n utils.extend(instance, Axios.prototype, context);\n\n // Copy context to instance\n utils.extend(instance, context);\n\n return instance;\n}\n\n// Create the default instance to be exported\nvar axios = createInstance(defaults);\n\n// Expose Axios class to allow class inheritance\naxios.Axios = Axios;\n\n// Factory for creating new instances\naxios.create = function create(instanceConfig) {\n return createInstance(mergeConfig(axios.defaults, instanceConfig));\n};\n\n// Expose Cancel & CancelToken\naxios.Cancel = require('./cancel/Cancel');\naxios.CancelToken = require('./cancel/CancelToken');\naxios.isCancel = require('./cancel/isCancel');\n\n// Expose all/spread\naxios.all = function all(promises) {\n return Promise.all(promises);\n};\naxios.spread = require('./helpers/spread');\n\nmodule.exports = axios;\n\n// Allow use of default import syntax in TypeScript\nmodule.exports.default = axios;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/axios.js\n// module id = 1\n// module chunks = 0","'use strict';\n\nvar bind = require('./helpers/bind');\n\n/*global toString:true*/\n\n// utils is a library of generic helper functions non-specific to axios\n\nvar toString = Object.prototype.toString;\n\n/**\n * Determine if a value is an Array\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an Array, otherwise false\n */\nfunction isArray(val) {\n return toString.call(val) === '[object Array]';\n}\n\n/**\n * Determine if a value is undefined\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if the value is undefined, otherwise false\n */\nfunction isUndefined(val) {\n return typeof val === 'undefined';\n}\n\n/**\n * Determine if a value is a Buffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Buffer, otherwise false\n */\nfunction isBuffer(val) {\n return val !== null && !isUndefined(val) && val.constructor !== null && !isUndefined(val.constructor)\n && typeof val.constructor.isBuffer === 'function' && val.constructor.isBuffer(val);\n}\n\n/**\n * Determine if a value is an ArrayBuffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an ArrayBuffer, otherwise false\n */\nfunction isArrayBuffer(val) {\n return toString.call(val) === '[object ArrayBuffer]';\n}\n\n/**\n * Determine if a value is a FormData\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an FormData, otherwise false\n */\nfunction isFormData(val) {\n return (typeof FormData !== 'undefined') && (val instanceof FormData);\n}\n\n/**\n * Determine if a value is a view on an ArrayBuffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false\n */\nfunction isArrayBufferView(val) {\n var result;\n if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) {\n result = ArrayBuffer.isView(val);\n } else {\n result = (val) && (val.buffer) && (val.buffer instanceof ArrayBuffer);\n }\n return result;\n}\n\n/**\n * Determine if a value is a String\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a String, otherwise false\n */\nfunction isString(val) {\n return typeof val === 'string';\n}\n\n/**\n * Determine if a value is a Number\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Number, otherwise false\n */\nfunction isNumber(val) {\n return typeof val === 'number';\n}\n\n/**\n * Determine if a value is an Object\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an Object, otherwise false\n */\nfunction isObject(val) {\n return val !== null && typeof val === 'object';\n}\n\n/**\n * Determine if a value is a Date\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Date, otherwise false\n */\nfunction isDate(val) {\n return toString.call(val) === '[object Date]';\n}\n\n/**\n * Determine if a value is a File\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a File, otherwise false\n */\nfunction isFile(val) {\n return toString.call(val) === '[object File]';\n}\n\n/**\n * Determine if a value is a Blob\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Blob, otherwise false\n */\nfunction isBlob(val) {\n return toString.call(val) === '[object Blob]';\n}\n\n/**\n * Determine if a value is a Function\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Function, otherwise false\n */\nfunction isFunction(val) {\n return toString.call(val) === '[object Function]';\n}\n\n/**\n * Determine if a value is a Stream\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Stream, otherwise false\n */\nfunction isStream(val) {\n return isObject(val) && isFunction(val.pipe);\n}\n\n/**\n * Determine if a value is a URLSearchParams object\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a URLSearchParams object, otherwise false\n */\nfunction isURLSearchParams(val) {\n return typeof URLSearchParams !== 'undefined' && val instanceof URLSearchParams;\n}\n\n/**\n * Trim excess whitespace off the beginning and end of a string\n *\n * @param {String} str The String to trim\n * @returns {String} The String freed of excess whitespace\n */\nfunction trim(str) {\n return str.replace(/^\\s*/, '').replace(/\\s*$/, '');\n}\n\n/**\n * Determine if we're running in a standard browser environment\n *\n * This allows axios to run in a web worker, and react-native.\n * Both environments support XMLHttpRequest, but not fully standard globals.\n *\n * web workers:\n * typeof window -> undefined\n * typeof document -> undefined\n *\n * react-native:\n * navigator.product -> 'ReactNative'\n * nativescript\n * navigator.product -> 'NativeScript' or 'NS'\n */\nfunction isStandardBrowserEnv() {\n if (typeof navigator !== 'undefined' && (navigator.product === 'ReactNative' ||\n navigator.product === 'NativeScript' ||\n navigator.product === 'NS')) {\n return false;\n }\n return (\n typeof window !== 'undefined' &&\n typeof document !== 'undefined'\n );\n}\n\n/**\n * Iterate over an Array or an Object invoking a function for each item.\n *\n * If `obj` is an Array callback will be called passing\n * the value, index, and complete array for each item.\n *\n * If 'obj' is an Object callback will be called passing\n * the value, key, and complete object for each property.\n *\n * @param {Object|Array} obj The object to iterate\n * @param {Function} fn The callback to invoke for each item\n */\nfunction forEach(obj, fn) {\n // Don't bother if no value provided\n if (obj === null || typeof obj === 'undefined') {\n return;\n }\n\n // Force an array if not already something iterable\n if (typeof obj !== 'object') {\n /*eslint no-param-reassign:0*/\n obj = [obj];\n }\n\n if (isArray(obj)) {\n // Iterate over array values\n for (var i = 0, l = obj.length; i < l; i++) {\n fn.call(null, obj[i], i, obj);\n }\n } else {\n // Iterate over object keys\n for (var key in obj) {\n if (Object.prototype.hasOwnProperty.call(obj, key)) {\n fn.call(null, obj[key], key, obj);\n }\n }\n }\n}\n\n/**\n * Accepts varargs expecting each argument to be an object, then\n * immutably merges the properties of each object and returns result.\n *\n * When multiple objects contain the same key the later object in\n * the arguments list will take precedence.\n *\n * Example:\n *\n * ```js\n * var result = merge({foo: 123}, {foo: 456});\n * console.log(result.foo); // outputs 456\n * ```\n *\n * @param {Object} obj1 Object to merge\n * @returns {Object} Result of all merge properties\n */\nfunction merge(/* obj1, obj2, obj3, ... */) {\n var result = {};\n function assignValue(val, key) {\n if (typeof result[key] === 'object' && typeof val === 'object') {\n result[key] = merge(result[key], val);\n } else {\n result[key] = val;\n }\n }\n\n for (var i = 0, l = arguments.length; i < l; i++) {\n forEach(arguments[i], assignValue);\n }\n return result;\n}\n\n/**\n * Function equal to merge with the difference being that no reference\n * to original objects is kept.\n *\n * @see merge\n * @param {Object} obj1 Object to merge\n * @returns {Object} Result of all merge properties\n */\nfunction deepMerge(/* obj1, obj2, obj3, ... */) {\n var result = {};\n function assignValue(val, key) {\n if (typeof result[key] === 'object' && typeof val === 'object') {\n result[key] = deepMerge(result[key], val);\n } else if (typeof val === 'object') {\n result[key] = deepMerge({}, val);\n } else {\n result[key] = val;\n }\n }\n\n for (var i = 0, l = arguments.length; i < l; i++) {\n forEach(arguments[i], assignValue);\n }\n return result;\n}\n\n/**\n * Extends object a by mutably adding to it the properties of object b.\n *\n * @param {Object} a The object to be extended\n * @param {Object} b The object to copy properties from\n * @param {Object} thisArg The object to bind function to\n * @return {Object} The resulting value of object a\n */\nfunction extend(a, b, thisArg) {\n forEach(b, function assignValue(val, key) {\n if (thisArg && typeof val === 'function') {\n a[key] = bind(val, thisArg);\n } else {\n a[key] = val;\n }\n });\n return a;\n}\n\nmodule.exports = {\n isArray: isArray,\n isArrayBuffer: isArrayBuffer,\n isBuffer: isBuffer,\n isFormData: isFormData,\n isArrayBufferView: isArrayBufferView,\n isString: isString,\n isNumber: isNumber,\n isObject: isObject,\n isUndefined: isUndefined,\n isDate: isDate,\n isFile: isFile,\n isBlob: isBlob,\n isFunction: isFunction,\n isStream: isStream,\n isURLSearchParams: isURLSearchParams,\n isStandardBrowserEnv: isStandardBrowserEnv,\n forEach: forEach,\n merge: merge,\n deepMerge: deepMerge,\n extend: extend,\n trim: trim\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/utils.js\n// module id = 2\n// module chunks = 0","'use strict';\n\nmodule.exports = function bind(fn, thisArg) {\n return function wrap() {\n var args = new Array(arguments.length);\n for (var i = 0; i < args.length; i++) {\n args[i] = arguments[i];\n }\n return fn.apply(thisArg, args);\n };\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/bind.js\n// module id = 3\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\nvar buildURL = require('../helpers/buildURL');\nvar InterceptorManager = require('./InterceptorManager');\nvar dispatchRequest = require('./dispatchRequest');\nvar mergeConfig = require('./mergeConfig');\n\n/**\n * Create a new instance of Axios\n *\n * @param {Object} instanceConfig The default config for the instance\n */\nfunction Axios(instanceConfig) {\n this.defaults = instanceConfig;\n this.interceptors = {\n request: new InterceptorManager(),\n response: new InterceptorManager()\n };\n}\n\n/**\n * Dispatch a request\n *\n * @param {Object} config The config specific for this request (merged with this.defaults)\n */\nAxios.prototype.request = function request(config) {\n /*eslint no-param-reassign:0*/\n // Allow for axios('example/url'[, config]) a la fetch API\n if (typeof config === 'string') {\n config = arguments[1] || {};\n config.url = arguments[0];\n } else {\n config = config || {};\n }\n\n config = mergeConfig(this.defaults, config);\n\n // Set config.method\n if (config.method) {\n config.method = config.method.toLowerCase();\n } else if (this.defaults.method) {\n config.method = this.defaults.method.toLowerCase();\n } else {\n config.method = 'get';\n }\n\n // Hook up interceptors middleware\n var chain = [dispatchRequest, undefined];\n var promise = Promise.resolve(config);\n\n this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) {\n chain.unshift(interceptor.fulfilled, interceptor.rejected);\n });\n\n this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) {\n chain.push(interceptor.fulfilled, interceptor.rejected);\n });\n\n while (chain.length) {\n promise = promise.then(chain.shift(), chain.shift());\n }\n\n return promise;\n};\n\nAxios.prototype.getUri = function getUri(config) {\n config = mergeConfig(this.defaults, config);\n return buildURL(config.url, config.params, config.paramsSerializer).replace(/^\\?/, '');\n};\n\n// Provide aliases for supported request methods\nutils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) {\n /*eslint func-names:0*/\n Axios.prototype[method] = function(url, config) {\n return this.request(utils.merge(config || {}, {\n method: method,\n url: url\n }));\n };\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n /*eslint func-names:0*/\n Axios.prototype[method] = function(url, data, config) {\n return this.request(utils.merge(config || {}, {\n method: method,\n url: url,\n data: data\n }));\n };\n});\n\nmodule.exports = Axios;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/Axios.js\n// module id = 4\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nfunction encode(val) {\n return encodeURIComponent(val).\n replace(/%40/gi, '@').\n replace(/%3A/gi, ':').\n replace(/%24/g, '$').\n replace(/%2C/gi, ',').\n replace(/%20/g, '+').\n replace(/%5B/gi, '[').\n replace(/%5D/gi, ']');\n}\n\n/**\n * Build a URL by appending params to the end\n *\n * @param {string} url The base of the url (e.g., http://www.google.com)\n * @param {object} [params] The params to be appended\n * @returns {string} The formatted url\n */\nmodule.exports = function buildURL(url, params, paramsSerializer) {\n /*eslint no-param-reassign:0*/\n if (!params) {\n return url;\n }\n\n var serializedParams;\n if (paramsSerializer) {\n serializedParams = paramsSerializer(params);\n } else if (utils.isURLSearchParams(params)) {\n serializedParams = params.toString();\n } else {\n var parts = [];\n\n utils.forEach(params, function serialize(val, key) {\n if (val === null || typeof val === 'undefined') {\n return;\n }\n\n if (utils.isArray(val)) {\n key = key + '[]';\n } else {\n val = [val];\n }\n\n utils.forEach(val, function parseValue(v) {\n if (utils.isDate(v)) {\n v = v.toISOString();\n } else if (utils.isObject(v)) {\n v = JSON.stringify(v);\n }\n parts.push(encode(key) + '=' + encode(v));\n });\n });\n\n serializedParams = parts.join('&');\n }\n\n if (serializedParams) {\n var hashmarkIndex = url.indexOf('#');\n if (hashmarkIndex !== -1) {\n url = url.slice(0, hashmarkIndex);\n }\n\n url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams;\n }\n\n return url;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/buildURL.js\n// module id = 5\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nfunction InterceptorManager() {\n this.handlers = [];\n}\n\n/**\n * Add a new interceptor to the stack\n *\n * @param {Function} fulfilled The function to handle `then` for a `Promise`\n * @param {Function} rejected The function to handle `reject` for a `Promise`\n *\n * @return {Number} An ID used to remove interceptor later\n */\nInterceptorManager.prototype.use = function use(fulfilled, rejected) {\n this.handlers.push({\n fulfilled: fulfilled,\n rejected: rejected\n });\n return this.handlers.length - 1;\n};\n\n/**\n * Remove an interceptor from the stack\n *\n * @param {Number} id The ID that was returned by `use`\n */\nInterceptorManager.prototype.eject = function eject(id) {\n if (this.handlers[id]) {\n this.handlers[id] = null;\n }\n};\n\n/**\n * Iterate over all the registered interceptors\n *\n * This method is particularly useful for skipping over any\n * interceptors that may have become `null` calling `eject`.\n *\n * @param {Function} fn The function to call for each interceptor\n */\nInterceptorManager.prototype.forEach = function forEach(fn) {\n utils.forEach(this.handlers, function forEachHandler(h) {\n if (h !== null) {\n fn(h);\n }\n });\n};\n\nmodule.exports = InterceptorManager;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/InterceptorManager.js\n// module id = 6\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\nvar transformData = require('./transformData');\nvar isCancel = require('../cancel/isCancel');\nvar defaults = require('../defaults');\n\n/**\n * Throws a `Cancel` if cancellation has been requested.\n */\nfunction throwIfCancellationRequested(config) {\n if (config.cancelToken) {\n config.cancelToken.throwIfRequested();\n }\n}\n\n/**\n * Dispatch a request to the server using the configured adapter.\n *\n * @param {object} config The config that is to be used for the request\n * @returns {Promise} The Promise to be fulfilled\n */\nmodule.exports = function dispatchRequest(config) {\n throwIfCancellationRequested(config);\n\n // Ensure headers exist\n config.headers = config.headers || {};\n\n // Transform request data\n config.data = transformData(\n config.data,\n config.headers,\n config.transformRequest\n );\n\n // Flatten headers\n config.headers = utils.merge(\n config.headers.common || {},\n config.headers[config.method] || {},\n config.headers\n );\n\n utils.forEach(\n ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'],\n function cleanHeaderConfig(method) {\n delete config.headers[method];\n }\n );\n\n var adapter = config.adapter || defaults.adapter;\n\n return adapter(config).then(function onAdapterResolution(response) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n response.data = transformData(\n response.data,\n response.headers,\n config.transformResponse\n );\n\n return response;\n }, function onAdapterRejection(reason) {\n if (!isCancel(reason)) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n if (reason && reason.response) {\n reason.response.data = transformData(\n reason.response.data,\n reason.response.headers,\n config.transformResponse\n );\n }\n }\n\n return Promise.reject(reason);\n });\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/dispatchRequest.js\n// module id = 7\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\n/**\n * Transform the data for a request or a response\n *\n * @param {Object|String} data The data to be transformed\n * @param {Array} headers The headers for the request or response\n * @param {Array|Function} fns A single function or Array of functions\n * @returns {*} The resulting transformed data\n */\nmodule.exports = function transformData(data, headers, fns) {\n /*eslint no-param-reassign:0*/\n utils.forEach(fns, function transform(fn) {\n data = fn(data, headers);\n });\n\n return data;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/transformData.js\n// module id = 8\n// module chunks = 0","'use strict';\n\nmodule.exports = function isCancel(value) {\n return !!(value && value.__CANCEL__);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/cancel/isCancel.js\n// module id = 9\n// module chunks = 0","'use strict';\n\nvar utils = require('./utils');\nvar normalizeHeaderName = require('./helpers/normalizeHeaderName');\n\nvar DEFAULT_CONTENT_TYPE = {\n 'Content-Type': 'application/x-www-form-urlencoded'\n};\n\nfunction setContentTypeIfUnset(headers, value) {\n if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) {\n headers['Content-Type'] = value;\n }\n}\n\nfunction getDefaultAdapter() {\n var adapter;\n if (typeof XMLHttpRequest !== 'undefined') {\n // For browsers use XHR adapter\n adapter = require('./adapters/xhr');\n } else if (typeof process !== 'undefined' && Object.prototype.toString.call(process) === '[object process]') {\n // For node use HTTP adapter\n adapter = require('./adapters/http');\n }\n return adapter;\n}\n\nvar defaults = {\n adapter: getDefaultAdapter(),\n\n transformRequest: [function transformRequest(data, headers) {\n normalizeHeaderName(headers, 'Accept');\n normalizeHeaderName(headers, 'Content-Type');\n if (utils.isFormData(data) ||\n utils.isArrayBuffer(data) ||\n utils.isBuffer(data) ||\n utils.isStream(data) ||\n utils.isFile(data) ||\n utils.isBlob(data)\n ) {\n return data;\n }\n if (utils.isArrayBufferView(data)) {\n return data.buffer;\n }\n if (utils.isURLSearchParams(data)) {\n setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8');\n return data.toString();\n }\n if (utils.isObject(data)) {\n setContentTypeIfUnset(headers, 'application/json;charset=utf-8');\n return JSON.stringify(data);\n }\n return data;\n }],\n\n transformResponse: [function transformResponse(data) {\n /*eslint no-param-reassign:0*/\n if (typeof data === 'string') {\n try {\n data = JSON.parse(data);\n } catch (e) { /* Ignore */ }\n }\n return data;\n }],\n\n /**\n * A timeout in milliseconds to abort a request. If set to 0 (default) a\n * timeout is not created.\n */\n timeout: 0,\n\n xsrfCookieName: 'XSRF-TOKEN',\n xsrfHeaderName: 'X-XSRF-TOKEN',\n\n maxContentLength: -1,\n\n validateStatus: function validateStatus(status) {\n return status >= 200 && status < 300;\n }\n};\n\ndefaults.headers = {\n common: {\n 'Accept': 'application/json, text/plain, */*'\n }\n};\n\nutils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) {\n defaults.headers[method] = {};\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE);\n});\n\nmodule.exports = defaults;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/defaults.js\n// module id = 10\n// module chunks = 0","'use strict';\n\nvar utils = require('../utils');\n\nmodule.exports = function normalizeHeaderName(headers, normalizedName) {\n utils.forEach(headers, function processHeader(value, name) {\n if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) {\n headers[normalizedName] = value;\n delete headers[name];\n }\n });\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/normalizeHeaderName.js\n// module id = 11\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\nvar settle = require('./../core/settle');\nvar buildURL = require('./../helpers/buildURL');\nvar buildFullPath = require('../core/buildFullPath');\nvar parseHeaders = require('./../helpers/parseHeaders');\nvar isURLSameOrigin = require('./../helpers/isURLSameOrigin');\nvar createError = require('../core/createError');\n\nmodule.exports = function xhrAdapter(config) {\n return new Promise(function dispatchXhrRequest(resolve, reject) {\n var requestData = config.data;\n var requestHeaders = config.headers;\n\n if (utils.isFormData(requestData)) {\n delete requestHeaders['Content-Type']; // Let the browser set it\n }\n\n var request = new XMLHttpRequest();\n\n // HTTP basic authentication\n if (config.auth) {\n var username = config.auth.username || '';\n var password = config.auth.password || '';\n requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password);\n }\n\n var fullPath = buildFullPath(config.baseURL, config.url);\n request.open(config.method.toUpperCase(), buildURL(fullPath, config.params, config.paramsSerializer), true);\n\n // Set the request timeout in MS\n request.timeout = config.timeout;\n\n // Listen for ready state\n request.onreadystatechange = function handleLoad() {\n if (!request || request.readyState !== 4) {\n return;\n }\n\n // The request errored out and we didn't get a response, this will be\n // handled by onerror instead\n // With one exception: request that using file: protocol, most browsers\n // will return status as 0 even though it's a successful request\n if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) {\n return;\n }\n\n // Prepare the response\n var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null;\n var responseData = !config.responseType || config.responseType === 'text' ? request.responseText : request.response;\n var response = {\n data: responseData,\n status: request.status,\n statusText: request.statusText,\n headers: responseHeaders,\n config: config,\n request: request\n };\n\n settle(resolve, reject, response);\n\n // Clean up request\n request = null;\n };\n\n // Handle browser request cancellation (as opposed to a manual cancellation)\n request.onabort = function handleAbort() {\n if (!request) {\n return;\n }\n\n reject(createError('Request aborted', config, 'ECONNABORTED', request));\n\n // Clean up request\n request = null;\n };\n\n // Handle low level network errors\n request.onerror = function handleError() {\n // Real errors are hidden from us by the browser\n // onerror should only fire if it's a network error\n reject(createError('Network Error', config, null, request));\n\n // Clean up request\n request = null;\n };\n\n // Handle timeout\n request.ontimeout = function handleTimeout() {\n var timeoutErrorMessage = 'timeout of ' + config.timeout + 'ms exceeded';\n if (config.timeoutErrorMessage) {\n timeoutErrorMessage = config.timeoutErrorMessage;\n }\n reject(createError(timeoutErrorMessage, config, 'ECONNABORTED',\n request));\n\n // Clean up request\n request = null;\n };\n\n // Add xsrf header\n // This is only done if running in a standard browser environment.\n // Specifically not if we're in a web worker, or react-native.\n if (utils.isStandardBrowserEnv()) {\n var cookies = require('./../helpers/cookies');\n\n // Add xsrf header\n var xsrfValue = (config.withCredentials || isURLSameOrigin(fullPath)) && config.xsrfCookieName ?\n cookies.read(config.xsrfCookieName) :\n undefined;\n\n if (xsrfValue) {\n requestHeaders[config.xsrfHeaderName] = xsrfValue;\n }\n }\n\n // Add headers to the request\n if ('setRequestHeader' in request) {\n utils.forEach(requestHeaders, function setRequestHeader(val, key) {\n if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') {\n // Remove Content-Type if data is undefined\n delete requestHeaders[key];\n } else {\n // Otherwise add header to the request\n request.setRequestHeader(key, val);\n }\n });\n }\n\n // Add withCredentials to request if needed\n if (!utils.isUndefined(config.withCredentials)) {\n request.withCredentials = !!config.withCredentials;\n }\n\n // Add responseType to request if needed\n if (config.responseType) {\n try {\n request.responseType = config.responseType;\n } catch (e) {\n // Expected DOMException thrown by browsers not compatible XMLHttpRequest Level 2.\n // But, this can be suppressed for 'json' type as it can be parsed by default 'transformResponse' function.\n if (config.responseType !== 'json') {\n throw e;\n }\n }\n }\n\n // Handle progress if needed\n if (typeof config.onDownloadProgress === 'function') {\n request.addEventListener('progress', config.onDownloadProgress);\n }\n\n // Not all browsers support upload events\n if (typeof config.onUploadProgress === 'function' && request.upload) {\n request.upload.addEventListener('progress', config.onUploadProgress);\n }\n\n if (config.cancelToken) {\n // Handle cancellation\n config.cancelToken.promise.then(function onCanceled(cancel) {\n if (!request) {\n return;\n }\n\n request.abort();\n reject(cancel);\n // Clean up request\n request = null;\n });\n }\n\n if (requestData === undefined) {\n requestData = null;\n }\n\n // Send the request\n request.send(requestData);\n });\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/adapters/xhr.js\n// module id = 12\n// module chunks = 0","'use strict';\n\nvar createError = require('./createError');\n\n/**\n * Resolve or reject a Promise based on response status.\n *\n * @param {Function} resolve A function that resolves the promise.\n * @param {Function} reject A function that rejects the promise.\n * @param {object} response The response.\n */\nmodule.exports = function settle(resolve, reject, response) {\n var validateStatus = response.config.validateStatus;\n if (!validateStatus || validateStatus(response.status)) {\n resolve(response);\n } else {\n reject(createError(\n 'Request failed with status code ' + response.status,\n response.config,\n null,\n response.request,\n response\n ));\n }\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/settle.js\n// module id = 13\n// module chunks = 0","'use strict';\n\nvar enhanceError = require('./enhanceError');\n\n/**\n * Create an Error with the specified message, config, error code, request and response.\n *\n * @param {string} message The error message.\n * @param {Object} config The config.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n * @returns {Error} The created error.\n */\nmodule.exports = function createError(message, config, code, request, response) {\n var error = new Error(message);\n return enhanceError(error, config, code, request, response);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/createError.js\n// module id = 14\n// module chunks = 0","'use strict';\n\n/**\n * Update an Error with the specified config, error code, and response.\n *\n * @param {Error} error The error to update.\n * @param {Object} config The config.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n * @returns {Error} The error.\n */\nmodule.exports = function enhanceError(error, config, code, request, response) {\n error.config = config;\n if (code) {\n error.code = code;\n }\n\n error.request = request;\n error.response = response;\n error.isAxiosError = true;\n\n error.toJSON = function() {\n return {\n // Standard\n message: this.message,\n name: this.name,\n // Microsoft\n description: this.description,\n number: this.number,\n // Mozilla\n fileName: this.fileName,\n lineNumber: this.lineNumber,\n columnNumber: this.columnNumber,\n stack: this.stack,\n // Axios\n config: this.config,\n code: this.code\n };\n };\n return error;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/enhanceError.js\n// module id = 15\n// module chunks = 0","'use strict';\n\nvar isAbsoluteURL = require('../helpers/isAbsoluteURL');\nvar combineURLs = require('../helpers/combineURLs');\n\n/**\n * Creates a new URL by combining the baseURL with the requestedURL,\n * only when the requestedURL is not already an absolute URL.\n * If the requestURL is absolute, this function returns the requestedURL untouched.\n *\n * @param {string} baseURL The base URL\n * @param {string} requestedURL Absolute or relative URL to combine\n * @returns {string} The combined full path\n */\nmodule.exports = function buildFullPath(baseURL, requestedURL) {\n if (baseURL && !isAbsoluteURL(requestedURL)) {\n return combineURLs(baseURL, requestedURL);\n }\n return requestedURL;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/buildFullPath.js\n// module id = 16\n// module chunks = 0","'use strict';\n\n/**\n * Determines whether the specified URL is absolute\n *\n * @param {string} url The URL to test\n * @returns {boolean} True if the specified URL is absolute, otherwise false\n */\nmodule.exports = function isAbsoluteURL(url) {\n // A URL is considered absolute if it begins with \"://\" or \"//\" (protocol-relative URL).\n // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed\n // by any combination of letters, digits, plus, period, or hyphen.\n return /^([a-z][a-z\\d\\+\\-\\.]*:)?\\/\\//i.test(url);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/isAbsoluteURL.js\n// module id = 17\n// module chunks = 0","'use strict';\n\n/**\n * Creates a new URL by combining the specified URLs\n *\n * @param {string} baseURL The base URL\n * @param {string} relativeURL The relative URL\n * @returns {string} The combined URL\n */\nmodule.exports = function combineURLs(baseURL, relativeURL) {\n return relativeURL\n ? baseURL.replace(/\\/+$/, '') + '/' + relativeURL.replace(/^\\/+/, '')\n : baseURL;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/combineURLs.js\n// module id = 18\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\n// Headers whose duplicates are ignored by node\n// c.f. https://nodejs.org/api/http.html#http_message_headers\nvar ignoreDuplicateOf = [\n 'age', 'authorization', 'content-length', 'content-type', 'etag',\n 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since',\n 'last-modified', 'location', 'max-forwards', 'proxy-authorization',\n 'referer', 'retry-after', 'user-agent'\n];\n\n/**\n * Parse headers into an object\n *\n * ```\n * Date: Wed, 27 Aug 2014 08:58:49 GMT\n * Content-Type: application/json\n * Connection: keep-alive\n * Transfer-Encoding: chunked\n * ```\n *\n * @param {String} headers Headers needing to be parsed\n * @returns {Object} Headers parsed into an object\n */\nmodule.exports = function parseHeaders(headers) {\n var parsed = {};\n var key;\n var val;\n var i;\n\n if (!headers) { return parsed; }\n\n utils.forEach(headers.split('\\n'), function parser(line) {\n i = line.indexOf(':');\n key = utils.trim(line.substr(0, i)).toLowerCase();\n val = utils.trim(line.substr(i + 1));\n\n if (key) {\n if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) {\n return;\n }\n if (key === 'set-cookie') {\n parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]);\n } else {\n parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val;\n }\n }\n });\n\n return parsed;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/parseHeaders.js\n// module id = 19\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs have full support of the APIs needed to test\n // whether the request URL is of the same origin as current location.\n (function standardBrowserEnv() {\n var msie = /(msie|trident)/i.test(navigator.userAgent);\n var urlParsingNode = document.createElement('a');\n var originURL;\n\n /**\n * Parse a URL to discover it's components\n *\n * @param {String} url The URL to be parsed\n * @returns {Object}\n */\n function resolveURL(url) {\n var href = url;\n\n if (msie) {\n // IE needs attribute set twice to normalize properties\n urlParsingNode.setAttribute('href', href);\n href = urlParsingNode.href;\n }\n\n urlParsingNode.setAttribute('href', href);\n\n // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils\n return {\n href: urlParsingNode.href,\n protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '',\n host: urlParsingNode.host,\n search: urlParsingNode.search ? urlParsingNode.search.replace(/^\\?/, '') : '',\n hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '',\n hostname: urlParsingNode.hostname,\n port: urlParsingNode.port,\n pathname: (urlParsingNode.pathname.charAt(0) === '/') ?\n urlParsingNode.pathname :\n '/' + urlParsingNode.pathname\n };\n }\n\n originURL = resolveURL(window.location.href);\n\n /**\n * Determine if a URL shares the same origin as the current location\n *\n * @param {String} requestURL The URL to test\n * @returns {boolean} True if URL shares the same origin, otherwise false\n */\n return function isURLSameOrigin(requestURL) {\n var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL;\n return (parsed.protocol === originURL.protocol &&\n parsed.host === originURL.host);\n };\n })() :\n\n // Non standard browser envs (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return function isURLSameOrigin() {\n return true;\n };\n })()\n);\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/isURLSameOrigin.js\n// module id = 20\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs support document.cookie\n (function standardBrowserEnv() {\n return {\n write: function write(name, value, expires, path, domain, secure) {\n var cookie = [];\n cookie.push(name + '=' + encodeURIComponent(value));\n\n if (utils.isNumber(expires)) {\n cookie.push('expires=' + new Date(expires).toGMTString());\n }\n\n if (utils.isString(path)) {\n cookie.push('path=' + path);\n }\n\n if (utils.isString(domain)) {\n cookie.push('domain=' + domain);\n }\n\n if (secure === true) {\n cookie.push('secure');\n }\n\n document.cookie = cookie.join('; ');\n },\n\n read: function read(name) {\n var match = document.cookie.match(new RegExp('(^|;\\\\s*)(' + name + ')=([^;]*)'));\n return (match ? decodeURIComponent(match[3]) : null);\n },\n\n remove: function remove(name) {\n this.write(name, '', Date.now() - 86400000);\n }\n };\n })() :\n\n // Non standard browser env (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return {\n write: function write() {},\n read: function read() { return null; },\n remove: function remove() {}\n };\n })()\n);\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/cookies.js\n// module id = 21\n// module chunks = 0","'use strict';\n\nvar utils = require('../utils');\n\n/**\n * Config-specific merge-function which creates a new config-object\n * by merging two configuration objects together.\n *\n * @param {Object} config1\n * @param {Object} config2\n * @returns {Object} New object resulting from merging config2 to config1\n */\nmodule.exports = function mergeConfig(config1, config2) {\n // eslint-disable-next-line no-param-reassign\n config2 = config2 || {};\n var config = {};\n\n var valueFromConfig2Keys = ['url', 'method', 'params', 'data'];\n var mergeDeepPropertiesKeys = ['headers', 'auth', 'proxy'];\n var defaultToConfig2Keys = [\n 'baseURL', 'url', 'transformRequest', 'transformResponse', 'paramsSerializer',\n 'timeout', 'withCredentials', 'adapter', 'responseType', 'xsrfCookieName',\n 'xsrfHeaderName', 'onUploadProgress', 'onDownloadProgress',\n 'maxContentLength', 'validateStatus', 'maxRedirects', 'httpAgent',\n 'httpsAgent', 'cancelToken', 'socketPath'\n ];\n\n utils.forEach(valueFromConfig2Keys, function valueFromConfig2(prop) {\n if (typeof config2[prop] !== 'undefined') {\n config[prop] = config2[prop];\n }\n });\n\n utils.forEach(mergeDeepPropertiesKeys, function mergeDeepProperties(prop) {\n if (utils.isObject(config2[prop])) {\n config[prop] = utils.deepMerge(config1[prop], config2[prop]);\n } else if (typeof config2[prop] !== 'undefined') {\n config[prop] = config2[prop];\n } else if (utils.isObject(config1[prop])) {\n config[prop] = utils.deepMerge(config1[prop]);\n } else if (typeof config1[prop] !== 'undefined') {\n config[prop] = config1[prop];\n }\n });\n\n utils.forEach(defaultToConfig2Keys, function defaultToConfig2(prop) {\n if (typeof config2[prop] !== 'undefined') {\n config[prop] = config2[prop];\n } else if (typeof config1[prop] !== 'undefined') {\n config[prop] = config1[prop];\n }\n });\n\n var axiosKeys = valueFromConfig2Keys\n .concat(mergeDeepPropertiesKeys)\n .concat(defaultToConfig2Keys);\n\n var otherKeys = Object\n .keys(config2)\n .filter(function filterAxiosKeys(key) {\n return axiosKeys.indexOf(key) === -1;\n });\n\n utils.forEach(otherKeys, function otherKeysDefaultToConfig2(prop) {\n if (typeof config2[prop] !== 'undefined') {\n config[prop] = config2[prop];\n } else if (typeof config1[prop] !== 'undefined') {\n config[prop] = config1[prop];\n }\n });\n\n return config;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/mergeConfig.js\n// module id = 22\n// module chunks = 0","'use strict';\n\n/**\n * A `Cancel` is an object that is thrown when an operation is canceled.\n *\n * @class\n * @param {string=} message The message.\n */\nfunction Cancel(message) {\n this.message = message;\n}\n\nCancel.prototype.toString = function toString() {\n return 'Cancel' + (this.message ? ': ' + this.message : '');\n};\n\nCancel.prototype.__CANCEL__ = true;\n\nmodule.exports = Cancel;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/cancel/Cancel.js\n// module id = 23\n// module chunks = 0","'use strict';\n\nvar Cancel = require('./Cancel');\n\n/**\n * A `CancelToken` is an object that can be used to request cancellation of an operation.\n *\n * @class\n * @param {Function} executor The executor function.\n */\nfunction CancelToken(executor) {\n if (typeof executor !== 'function') {\n throw new TypeError('executor must be a function.');\n }\n\n var resolvePromise;\n this.promise = new Promise(function promiseExecutor(resolve) {\n resolvePromise = resolve;\n });\n\n var token = this;\n executor(function cancel(message) {\n if (token.reason) {\n // Cancellation has already been requested\n return;\n }\n\n token.reason = new Cancel(message);\n resolvePromise(token.reason);\n });\n}\n\n/**\n * Throws a `Cancel` if cancellation has been requested.\n */\nCancelToken.prototype.throwIfRequested = function throwIfRequested() {\n if (this.reason) {\n throw this.reason;\n }\n};\n\n/**\n * Returns an object that contains a new `CancelToken` and a function that, when called,\n * cancels the `CancelToken`.\n */\nCancelToken.source = function source() {\n var cancel;\n var token = new CancelToken(function executor(c) {\n cancel = c;\n });\n return {\n token: token,\n cancel: cancel\n };\n};\n\nmodule.exports = CancelToken;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/cancel/CancelToken.js\n// module id = 24\n// module chunks = 0","'use strict';\n\n/**\n * Syntactic sugar for invoking a function and expanding an array for arguments.\n *\n * Common use case would be to use `Function.prototype.apply`.\n *\n * ```js\n * function f(x, y, z) {}\n * var args = [1, 2, 3];\n * f.apply(null, args);\n * ```\n *\n * With `spread` this example can be re-written.\n *\n * ```js\n * spread(function(x, y, z) {})([1, 2, 3]);\n * ```\n *\n * @param {Function} callback\n * @returns {Function}\n */\nmodule.exports = function spread(callback) {\n return function wrap(arr) {\n return callback.apply(null, arr);\n };\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/spread.js\n// module id = 25\n// module chunks = 0"],"sourceRoot":""} \ No newline at end of file +{"version":3,"sources":["webpack://axios/webpack/universalModuleDefinition","webpack://axios/webpack/bootstrap","webpack://axios/./lib/utils.js","webpack://axios/./lib/cancel/Cancel.js","webpack://axios/./lib/defaults/index.js","webpack://axios/./lib/helpers/bind.js","webpack://axios/./lib/helpers/buildURL.js","webpack://axios/./lib/core/enhanceError.js","webpack://axios/./lib/defaults/transitional.js","webpack://axios/./lib/adapters/xhr.js","webpack://axios/./lib/core/createError.js","webpack://axios/./lib/cancel/isCancel.js","webpack://axios/./lib/core/mergeConfig.js","webpack://axios/./lib/env/data.js","webpack://axios/./index.js","webpack://axios/./lib/axios.js","webpack://axios/./lib/core/Axios.js","webpack://axios/./lib/core/InterceptorManager.js","webpack://axios/./lib/core/dispatchRequest.js","webpack://axios/./lib/core/transformData.js","webpack://axios/./lib/helpers/normalizeHeaderName.js","webpack://axios/./lib/core/settle.js","webpack://axios/./lib/helpers/cookies.js","webpack://axios/./lib/core/buildFullPath.js","webpack://axios/./lib/helpers/isAbsoluteURL.js","webpack://axios/./lib/helpers/combineURLs.js","webpack://axios/./lib/helpers/parseHeaders.js","webpack://axios/./lib/helpers/isURLSameOrigin.js","webpack://axios/./lib/helpers/validator.js","webpack://axios/./lib/cancel/CancelToken.js","webpack://axios/./lib/helpers/spread.js","webpack://axios/./lib/helpers/isAxiosError.js"],"names":["root","factory","exports","module","define","amd","this","installedModules","__webpack_require__","moduleId","i","l","modules","call","m","c","d","name","getter","o","Object","defineProperty","enumerable","get","r","Symbol","toStringTag","value","t","mode","__esModule","ns","create","key","bind","n","object","property","prototype","hasOwnProperty","p","s","toString","isArray","val","Array","isUndefined","isArrayBuffer","isObject","isPlainObject","getPrototypeOf","isFunction","forEach","obj","fn","length","isBuffer","constructor","isFormData","isArrayBufferView","ArrayBuffer","isView","buffer","isString","isNumber","isDate","isFile","isBlob","isStream","pipe","isURLSearchParams","isStandardBrowserEnv","navigator","product","window","document","merge","result","assignValue","slice","arguments","extend","a","b","thisArg","trim","str","replace","stripBOM","content","charCodeAt","Cancel","message","__CANCEL__","utils","normalizeHeaderName","enhanceError","transitionalDefaults","DEFAULT_CONTENT_TYPE","setContentTypeIfUnset","headers","adapter","defaults","transitional","XMLHttpRequest","process","transformRequest","data","rawValue","parser","encoder","JSON","parse","e","stringify","stringifySafely","transformResponse","silentJSONParsing","forcedJSONParsing","strictJSONParsing","responseType","timeout","xsrfCookieName","xsrfHeaderName","maxContentLength","maxBodyLength","validateStatus","status","common","method","args","apply","encode","encodeURIComponent","url","params","paramsSerializer","serializedParams","parts","v","toISOString","push","join","hashmarkIndex","indexOf","error","config","code","request","response","isAxiosError","toJSON","description","number","fileName","lineNumber","columnNumber","stack","clarifyTimeoutError","settle","cookies","buildURL","buildFullPath","parseHeaders","isURLSameOrigin","createError","Promise","resolve","reject","onCanceled","requestData","requestHeaders","done","cancelToken","unsubscribe","signal","removeEventListener","auth","username","password","unescape","Authorization","btoa","fullPath","baseURL","onloadend","responseHeaders","getAllResponseHeaders","responseText","statusText","err","open","toUpperCase","onreadystatechange","readyState","responseURL","setTimeout","onabort","onerror","ontimeout","timeoutErrorMessage","xsrfValue","withCredentials","read","undefined","toLowerCase","setRequestHeader","onDownloadProgress","addEventListener","onUploadProgress","upload","cancel","type","abort","subscribe","aborted","send","Error","config1","config2","getMergedValue","target","source","mergeDeepProperties","prop","valueFromConfig2","defaultToConfig2","mergeDirectKeys","mergeMap","keys","concat","configValue","Axios","mergeConfig","axios","createInstance","defaultConfig","context","instance","instanceConfig","CancelToken","isCancel","VERSION","version","all","promises","spread","default","InterceptorManager","dispatchRequest","validator","validators","interceptors","configOrUrl","assertOptions","boolean","requestInterceptorChain","synchronousRequestInterceptors","interceptor","runWhen","synchronous","unshift","fulfilled","rejected","promise","responseInterceptorChain","chain","then","shift","newConfig","onFulfilled","onRejected","getUri","handlers","use","options","eject","id","h","transformData","throwIfCancellationRequested","throwIfRequested","reason","fns","normalizedName","write","expires","path","domain","secure","cookie","Date","toGMTString","match","RegExp","decodeURIComponent","remove","now","isAbsoluteURL","combineURLs","requestedURL","test","relativeURL","ignoreDuplicateOf","parsed","split","line","substr","originURL","msie","userAgent","urlParsingNode","createElement","resolveURL","href","setAttribute","protocol","host","search","hash","hostname","port","pathname","charAt","location","requestURL","thing","deprecatedWarnings","formatMessage","opt","desc","opts","console","warn","schema","allowUnknown","TypeError","executor","resolvePromise","token","_listeners","onfulfilled","_resolve","listener","index","splice","callback","arr","payload"],"mappings":"CAAA,SAA2CA,EAAMC,GAC1B,iBAAZC,SAA0C,iBAAXC,OACxCA,OAAOD,QAAUD,IACQ,mBAAXG,QAAyBA,OAAOC,IAC9CD,OAAO,GAAIH,GACe,iBAAZC,QACdA,QAAe,MAAID,IAEnBD,EAAY,MAAIC,IARlB,CASGK,MAAM,WACT,O,YCTE,IAAIC,EAAmB,GAGvB,SAASC,EAAoBC,GAG5B,GAAGF,EAAiBE,GACnB,OAAOF,EAAiBE,GAAUP,QAGnC,IAAIC,EAASI,EAAiBE,GAAY,CACzCC,EAAGD,EACHE,GAAG,EACHT,QAAS,IAUV,OANAU,EAAQH,GAAUI,KAAKV,EAAOD,QAASC,EAAQA,EAAOD,QAASM,GAG/DL,EAAOQ,GAAI,EAGJR,EAAOD,QA0Df,OArDAM,EAAoBM,EAAIF,EAGxBJ,EAAoBO,EAAIR,EAGxBC,EAAoBQ,EAAI,SAASd,EAASe,EAAMC,GAC3CV,EAAoBW,EAAEjB,EAASe,IAClCG,OAAOC,eAAenB,EAASe,EAAM,CAAEK,YAAY,EAAMC,IAAKL,KAKhEV,EAAoBgB,EAAI,SAAStB,GACX,oBAAXuB,QAA0BA,OAAOC,aAC1CN,OAAOC,eAAenB,EAASuB,OAAOC,YAAa,CAAEC,MAAO,WAE7DP,OAAOC,eAAenB,EAAS,aAAc,CAAEyB,OAAO,KAQvDnB,EAAoBoB,EAAI,SAASD,EAAOE,GAEvC,GADU,EAAPA,IAAUF,EAAQnB,EAAoBmB,IAC/B,EAAPE,EAAU,OAAOF,EACpB,GAAW,EAAPE,GAA8B,iBAAVF,GAAsBA,GAASA,EAAMG,WAAY,OAAOH,EAChF,IAAII,EAAKX,OAAOY,OAAO,MAGvB,GAFAxB,EAAoBgB,EAAEO,GACtBX,OAAOC,eAAeU,EAAI,UAAW,CAAET,YAAY,EAAMK,MAAOA,IACtD,EAAPE,GAA4B,iBAATF,EAAmB,IAAI,IAAIM,KAAON,EAAOnB,EAAoBQ,EAAEe,EAAIE,EAAK,SAASA,GAAO,OAAON,EAAMM,IAAQC,KAAK,KAAMD,IAC9I,OAAOF,GAIRvB,EAAoB2B,EAAI,SAAShC,GAChC,IAAIe,EAASf,GAAUA,EAAO2B,WAC7B,WAAwB,OAAO3B,EAAgB,SAC/C,WAA8B,OAAOA,GAEtC,OADAK,EAAoBQ,EAAEE,EAAQ,IAAKA,GAC5BA,GAIRV,EAAoBW,EAAI,SAASiB,EAAQC,GAAY,OAAOjB,OAAOkB,UAAUC,eAAe1B,KAAKuB,EAAQC,IAGzG7B,EAAoBgC,EAAI,GAIjBhC,EAAoBA,EAAoBiC,EAAI,I,+BChFrD,IAAIP,EAAO,EAAQ,GAIfQ,EAAWtB,OAAOkB,UAAUI,SAQhC,SAASC,EAAQC,GACf,OAAOC,MAAMF,QAAQC,GASvB,SAASE,EAAYF,GACnB,YAAsB,IAARA,EAoBhB,SAASG,EAAcH,GACrB,MAA8B,yBAAvBF,EAAS7B,KAAK+B,GAuDvB,SAASI,EAASJ,GAChB,OAAe,OAARA,GAA+B,iBAARA,EAShC,SAASK,EAAcL,GACrB,GAA2B,oBAAvBF,EAAS7B,KAAK+B,GAChB,OAAO,EAGT,IAAIN,EAAYlB,OAAO8B,eAAeN,GACtC,OAAqB,OAAdN,GAAsBA,IAAclB,OAAOkB,UAuCpD,SAASa,EAAWP,GAClB,MAA8B,sBAAvBF,EAAS7B,KAAK+B,GAwEvB,SAASQ,EAAQC,EAAKC,GAEpB,GAAID,QAUJ,GALmB,iBAARA,IAETA,EAAM,CAACA,IAGLV,EAAQU,GAEV,IAAK,IAAI3C,EAAI,EAAGC,EAAI0C,EAAIE,OAAQ7C,EAAIC,EAAGD,IACrC4C,EAAGzC,KAAK,KAAMwC,EAAI3C,GAAIA,EAAG2C,QAI3B,IAAK,IAAIpB,KAAOoB,EACVjC,OAAOkB,UAAUC,eAAe1B,KAAKwC,EAAKpB,IAC5CqB,EAAGzC,KAAK,KAAMwC,EAAIpB,GAAMA,EAAKoB,GA2ErClD,EAAOD,QAAU,CACfyC,QAASA,EACTI,cAAeA,EACfS,SAtSF,SAAkBZ,GAChB,OAAe,OAARA,IAAiBE,EAAYF,IAA4B,OAApBA,EAAIa,cAAyBX,EAAYF,EAAIa,cAChD,mBAA7Bb,EAAIa,YAAYD,UAA2BZ,EAAIa,YAAYD,SAASZ,IAqShFc,WAlRF,SAAoBd,GAClB,MAA8B,sBAAvBF,EAAS7B,KAAK+B,IAkRrBe,kBAzQF,SAA2Bf,GAOzB,MAL4B,oBAAhBgB,aAAiCA,YAAkB,OACpDA,YAAYC,OAAOjB,GAEnB,GAAUA,EAAU,QAAMG,EAAcH,EAAIkB,SAqQvDC,SA1PF,SAAkBnB,GAChB,MAAsB,iBAARA,GA0PdoB,SAjPF,SAAkBpB,GAChB,MAAsB,iBAARA,GAiPdI,SAAUA,EACVC,cAAeA,EACfH,YAAaA,EACbmB,OAlNF,SAAgBrB,GACd,MAA8B,kBAAvBF,EAAS7B,KAAK+B,IAkNrBsB,OAzMF,SAAgBtB,GACd,MAA8B,kBAAvBF,EAAS7B,KAAK+B,IAyMrBuB,OAhMF,SAAgBvB,GACd,MAA8B,kBAAvBF,EAAS7B,KAAK+B,IAgMrBO,WAAYA,EACZiB,SA9KF,SAAkBxB,GAChB,OAAOI,EAASJ,IAAQO,EAAWP,EAAIyB,OA8KvCC,kBArKF,SAA2B1B,GACzB,MAA8B,6BAAvBF,EAAS7B,KAAK+B,IAqKrB2B,qBAzIF,WACE,OAAyB,oBAAdC,WAAoD,gBAAtBA,UAAUC,SACY,iBAAtBD,UAAUC,SACY,OAAtBD,UAAUC,WAI/B,oBAAXC,QACa,oBAAbC,WAkITvB,QAASA,EACTwB,MAvEF,SAASA,IACP,IAAIC,EAAS,GACb,SAASC,EAAYlC,EAAKX,GACpBgB,EAAc4B,EAAO5C,KAASgB,EAAcL,GAC9CiC,EAAO5C,GAAO2C,EAAMC,EAAO5C,GAAMW,GACxBK,EAAcL,GACvBiC,EAAO5C,GAAO2C,EAAM,GAAIhC,GACfD,EAAQC,GACjBiC,EAAO5C,GAAOW,EAAImC,QAElBF,EAAO5C,GAAOW,EAIlB,IAAK,IAAIlC,EAAI,EAAGC,EAAIqE,UAAUzB,OAAQ7C,EAAIC,EAAGD,IAC3C0C,EAAQ4B,UAAUtE,GAAIoE,GAExB,OAAOD,GAuDPI,OA5CF,SAAgBC,EAAGC,EAAGC,GAQpB,OAPAhC,EAAQ+B,GAAG,SAAqBvC,EAAKX,GAEjCiD,EAAEjD,GADAmD,GAA0B,mBAARxC,EACXV,EAAKU,EAAKwC,GAEVxC,KAGNsC,GAqCPG,KAhKF,SAAcC,GACZ,OAAOA,EAAID,KAAOC,EAAID,OAASC,EAAIC,QAAQ,aAAc,KAgKzDC,SA7BF,SAAkBC,GAIhB,OAH8B,QAA1BA,EAAQC,WAAW,KACrBD,EAAUA,EAAQV,MAAM,IAEnBU,K,6BC1TT,SAASE,EAAOC,GACdtF,KAAKsF,QAAUA,EAGjBD,EAAOrD,UAAUI,SAAW,WAC1B,MAAO,UAAYpC,KAAKsF,QAAU,KAAOtF,KAAKsF,QAAU,KAG1DD,EAAOrD,UAAUuD,YAAa,EAE9B1F,EAAOD,QAAUyF,G,6BChBjB,IAAIG,EAAQ,EAAQ,GAChBC,EAAsB,EAAQ,IAC9BC,EAAe,EAAQ,GACvBC,EAAuB,EAAQ,GAE/BC,EAAuB,CACzB,eAAgB,qCAGlB,SAASC,EAAsBC,EAASzE,IACjCmE,EAAMhD,YAAYsD,IAAYN,EAAMhD,YAAYsD,EAAQ,mBAC3DA,EAAQ,gBAAkBzE,GA+B9B,IA1BM0E,EA0BFC,EAAW,CAEbC,aAAcN,EAEdI,UA7B8B,oBAAnBG,gBAGmB,oBAAZC,SAAuE,qBAA5CrF,OAAOkB,UAAUI,SAAS7B,KAAK4F,YAD1EJ,EAAU,EAAQ,IAKbA,GAwBPK,iBAAkB,CAAC,SAA0BC,EAAMP,GAIjD,OAHAL,EAAoBK,EAAS,UAC7BL,EAAoBK,EAAS,gBAEzBN,EAAMpC,WAAWiD,IACnBb,EAAM/C,cAAc4D,IACpBb,EAAMtC,SAASmD,IACfb,EAAM1B,SAASuC,IACfb,EAAM5B,OAAOyC,IACbb,EAAM3B,OAAOwC,GAENA,EAELb,EAAMnC,kBAAkBgD,GACnBA,EAAK7C,OAEVgC,EAAMxB,kBAAkBqC,IAC1BR,EAAsBC,EAAS,mDACxBO,EAAKjE,YAEVoD,EAAM9C,SAAS2D,IAAUP,GAAuC,qBAA5BA,EAAQ,iBAC9CD,EAAsBC,EAAS,oBA1CrC,SAAyBQ,EAAUC,EAAQC,GACzC,GAAIhB,EAAM/B,SAAS6C,GACjB,IAEE,OADCC,GAAUE,KAAKC,OAAOJ,GAChBd,EAAMT,KAAKuB,GAClB,MAAOK,GACP,GAAe,gBAAXA,EAAEhG,KACJ,MAAMgG,EAKZ,OAAQH,GAAWC,KAAKG,WAAWN,GA+BxBO,CAAgBR,IAElBA,IAGTS,kBAAmB,CAAC,SAA2BT,GAC7C,IAAIJ,EAAejG,KAAKiG,cAAgBD,EAASC,aAC7Cc,EAAoBd,GAAgBA,EAAac,kBACjDC,EAAoBf,GAAgBA,EAAae,kBACjDC,GAAqBF,GAA2C,SAAtB/G,KAAKkH,aAEnD,GAAID,GAAsBD,GAAqBxB,EAAM/B,SAAS4C,IAASA,EAAKpD,OAC1E,IACE,OAAOwD,KAAKC,MAAML,GAClB,MAAOM,GACP,GAAIM,EAAmB,CACrB,GAAe,gBAAXN,EAAEhG,KACJ,MAAM+E,EAAaiB,EAAG3G,KAAM,gBAE9B,MAAM2G,GAKZ,OAAON,IAOTc,QAAS,EAETC,eAAgB,aAChBC,eAAgB,eAEhBC,kBAAmB,EACnBC,eAAgB,EAEhBC,eAAgB,SAAwBC,GACtC,OAAOA,GAAU,KAAOA,EAAS,KAGnC3B,QAAS,CACP4B,OAAQ,CACN,OAAU,uCAKhBlC,EAAM1C,QAAQ,CAAC,SAAU,MAAO,SAAS,SAA6B6E,GACpE3B,EAASF,QAAQ6B,GAAU,MAG7BnC,EAAM1C,QAAQ,CAAC,OAAQ,MAAO,UAAU,SAA+B6E,GACrE3B,EAASF,QAAQ6B,GAAUnC,EAAMlB,MAAMsB,MAGzC/F,EAAOD,QAAUoG,G,6BChIjBnG,EAAOD,QAAU,SAAcoD,EAAI8B,GACjC,OAAO,WAEL,IADA,IAAI8C,EAAO,IAAIrF,MAAMmC,UAAUzB,QACtB7C,EAAI,EAAGA,EAAIwH,EAAK3E,OAAQ7C,IAC/BwH,EAAKxH,GAAKsE,UAAUtE,GAEtB,OAAO4C,EAAG6E,MAAM/C,EAAS8C,M,6BCN7B,IAAIpC,EAAQ,EAAQ,GAEpB,SAASsC,EAAOxF,GACd,OAAOyF,mBAAmBzF,GACxB2C,QAAQ,QAAS,KACjBA,QAAQ,OAAQ,KAChBA,QAAQ,QAAS,KACjBA,QAAQ,OAAQ,KAChBA,QAAQ,QAAS,KACjBA,QAAQ,QAAS,KAUrBpF,EAAOD,QAAU,SAAkBoI,EAAKC,EAAQC,GAE9C,IAAKD,EACH,OAAOD,EAGT,IAAIG,EACJ,GAAID,EACFC,EAAmBD,EAAiBD,QAC/B,GAAIzC,EAAMxB,kBAAkBiE,GACjCE,EAAmBF,EAAO7F,eACrB,CACL,IAAIgG,EAAQ,GAEZ5C,EAAM1C,QAAQmF,GAAQ,SAAmB3F,EAAKX,GACxCW,UAIAkD,EAAMnD,QAAQC,GAChBX,GAAY,KAEZW,EAAM,CAACA,GAGTkD,EAAM1C,QAAQR,GAAK,SAAoB+F,GACjC7C,EAAM7B,OAAO0E,GACfA,EAAIA,EAAEC,cACG9C,EAAM9C,SAAS2F,KACxBA,EAAI5B,KAAKG,UAAUyB,IAErBD,EAAMG,KAAKT,EAAOnG,GAAO,IAAMmG,EAAOO,WAI1CF,EAAmBC,EAAMI,KAAK,KAGhC,GAAIL,EAAkB,CACpB,IAAIM,EAAgBT,EAAIU,QAAQ,MACT,IAAnBD,IACFT,EAAMA,EAAIvD,MAAM,EAAGgE,IAGrBT,KAA8B,IAAtBA,EAAIU,QAAQ,KAAc,IAAM,KAAOP,EAGjD,OAAOH,I,6BCxDTnI,EAAOD,QAAU,SAAsB+I,EAAOC,EAAQC,EAAMC,EAASC,GA6BnE,OA5BAJ,EAAMC,OAASA,EACXC,IACFF,EAAME,KAAOA,GAGfF,EAAMG,QAAUA,EAChBH,EAAMI,SAAWA,EACjBJ,EAAMK,cAAe,EAErBL,EAAMM,OAAS,WACb,MAAO,CAEL3D,QAAStF,KAAKsF,QACd3E,KAAMX,KAAKW,KAEXuI,YAAalJ,KAAKkJ,YAClBC,OAAQnJ,KAAKmJ,OAEbC,SAAUpJ,KAAKoJ,SACfC,WAAYrJ,KAAKqJ,WACjBC,aAActJ,KAAKsJ,aACnBC,MAAOvJ,KAAKuJ,MAEZX,OAAQ5I,KAAK4I,OACbC,KAAM7I,KAAK6I,KACXpB,OAAQzH,KAAK+I,UAAY/I,KAAK+I,SAAStB,OAASzH,KAAK+I,SAAStB,OAAS,OAGpEkB,I,6BCvCT9I,EAAOD,QAAU,CACfmH,mBAAmB,EACnBC,mBAAmB,EACnBwC,qBAAqB,I,6BCHvB,IAAIhE,EAAQ,EAAQ,GAChBiE,EAAS,EAAQ,IACjBC,EAAU,EAAQ,IAClBC,EAAW,EAAQ,GACnBC,EAAgB,EAAQ,IACxBC,EAAe,EAAQ,IACvBC,EAAkB,EAAQ,IAC1BC,EAAc,EAAQ,GACtBpE,EAAuB,EAAQ,GAC/BN,EAAS,EAAQ,GAErBxF,EAAOD,QAAU,SAAoBgJ,GACnC,OAAO,IAAIoB,SAAQ,SAA4BC,EAASC,GACtD,IAGIC,EAHAC,EAAcxB,EAAOvC,KACrBgE,EAAiBzB,EAAO9C,QACxBoB,EAAe0B,EAAO1B,aAE1B,SAASoD,IACH1B,EAAO2B,aACT3B,EAAO2B,YAAYC,YAAYL,GAG7BvB,EAAO6B,QACT7B,EAAO6B,OAAOC,oBAAoB,QAASP,GAI3C3E,EAAMpC,WAAWgH,WACZC,EAAe,gBAGxB,IAAIvB,EAAU,IAAI5C,eAGlB,GAAI0C,EAAO+B,KAAM,CACf,IAAIC,EAAWhC,EAAO+B,KAAKC,UAAY,GACnCC,EAAWjC,EAAO+B,KAAKE,SAAWC,SAAS/C,mBAAmBa,EAAO+B,KAAKE,WAAa,GAC3FR,EAAeU,cAAgB,SAAWC,KAAKJ,EAAW,IAAMC,GAGlE,IAAII,EAAWrB,EAAchB,EAAOsC,QAAStC,EAAOZ,KAMpD,SAASmD,IACP,GAAKrC,EAAL,CAIA,IAAIsC,EAAkB,0BAA2BtC,EAAUe,EAAaf,EAAQuC,yBAA2B,KAGvGtC,EAAW,CACb1C,KAHkBa,GAAiC,SAAjBA,GAA6C,SAAjBA,EACvC4B,EAAQC,SAA/BD,EAAQwC,aAGR7D,OAAQqB,EAAQrB,OAChB8D,WAAYzC,EAAQyC,WACpBzF,QAASsF,EACTxC,OAAQA,EACRE,QAASA,GAGXW,GAAO,SAAkBpI,GACvB4I,EAAQ5I,GACRiJ,OACC,SAAiBkB,GAClBtB,EAAOsB,GACPlB,MACCvB,GAGHD,EAAU,MAoEZ,GAnGAA,EAAQ2C,KAAK7C,EAAOjB,OAAO+D,cAAe/B,EAASsB,EAAUrC,EAAOX,OAAQW,EAAOV,mBAAmB,GAGtGY,EAAQ3B,QAAUyB,EAAOzB,QA+BrB,cAAe2B,EAEjBA,EAAQqC,UAAYA,EAGpBrC,EAAQ6C,mBAAqB,WACtB7C,GAAkC,IAAvBA,EAAQ8C,aAQD,IAAnB9C,EAAQrB,QAAkBqB,EAAQ+C,aAAwD,IAAzC/C,EAAQ+C,YAAYnD,QAAQ,WAKjFoD,WAAWX,IAKfrC,EAAQiD,QAAU,WACXjD,IAILoB,EAAOH,EAAY,kBAAmBnB,EAAQ,eAAgBE,IAG9DA,EAAU,OAIZA,EAAQkD,QAAU,WAGhB9B,EAAOH,EAAY,gBAAiBnB,EAAQ,KAAME,IAGlDA,EAAU,MAIZA,EAAQmD,UAAY,WAClB,IAAIC,EAAsBtD,EAAOzB,QAAU,cAAgByB,EAAOzB,QAAU,cAAgB,mBACxFlB,EAAe2C,EAAO3C,cAAgBN,EACtCiD,EAAOsD,sBACTA,EAAsBtD,EAAOsD,qBAE/BhC,EAAOH,EACLmC,EACAtD,EACA3C,EAAauD,oBAAsB,YAAc,eACjDV,IAGFA,EAAU,MAMRtD,EAAMvB,uBAAwB,CAEhC,IAAIkI,GAAavD,EAAOwD,iBAAmBtC,EAAgBmB,KAAcrC,EAAOxB,eAC9EsC,EAAQ2C,KAAKzD,EAAOxB,qBACpBkF,EAEEH,IACF9B,EAAezB,EAAOvB,gBAAkB8E,GAKxC,qBAAsBrD,GACxBtD,EAAM1C,QAAQuH,GAAgB,SAA0B/H,EAAKX,QAChC,IAAhByI,GAAqD,iBAAtBzI,EAAI4K,qBAErClC,EAAe1I,GAGtBmH,EAAQ0D,iBAAiB7K,EAAKW,MAM/BkD,EAAMhD,YAAYoG,EAAOwD,mBAC5BtD,EAAQsD,kBAAoBxD,EAAOwD,iBAIjClF,GAAiC,SAAjBA,IAClB4B,EAAQ5B,aAAe0B,EAAO1B,cAIS,mBAA9B0B,EAAO6D,oBAChB3D,EAAQ4D,iBAAiB,WAAY9D,EAAO6D,oBAIP,mBAA5B7D,EAAO+D,kBAAmC7D,EAAQ8D,QAC3D9D,EAAQ8D,OAAOF,iBAAiB,WAAY9D,EAAO+D,mBAGjD/D,EAAO2B,aAAe3B,EAAO6B,UAG/BN,EAAa,SAAS0C,GACf/D,IAGLoB,GAAQ2C,GAAWA,GAAUA,EAAOC,KAAQ,IAAIzH,EAAO,YAAcwH,GACrE/D,EAAQiE,QACRjE,EAAU,OAGZF,EAAO2B,aAAe3B,EAAO2B,YAAYyC,UAAU7C,GAC/CvB,EAAO6B,SACT7B,EAAO6B,OAAOwC,QAAU9C,IAAevB,EAAO6B,OAAOiC,iBAAiB,QAASvC,KAI9EC,IACHA,EAAc,MAIhBtB,EAAQoE,KAAK9C,Q,6BC/MjB,IAAI1E,EAAe,EAAQ,GAY3B7F,EAAOD,QAAU,SAAqB0F,EAASsD,EAAQC,EAAMC,EAASC,GACpE,IAAIJ,EAAQ,IAAIwE,MAAM7H,GACtB,OAAOI,EAAaiD,EAAOC,EAAQC,EAAMC,EAASC,K,6BCdpDlJ,EAAOD,QAAU,SAAkByB,GACjC,SAAUA,IAASA,EAAMkE,c,6BCD3B,IAAIC,EAAQ,EAAQ,GAUpB3F,EAAOD,QAAU,SAAqBwN,EAASC,GAE7CA,EAAUA,GAAW,GACrB,IAAIzE,EAAS,GAEb,SAAS0E,EAAeC,EAAQC,GAC9B,OAAIhI,EAAM7C,cAAc4K,IAAW/H,EAAM7C,cAAc6K,GAC9ChI,EAAMlB,MAAMiJ,EAAQC,GAClBhI,EAAM7C,cAAc6K,GACtBhI,EAAMlB,MAAM,GAAIkJ,GACdhI,EAAMnD,QAAQmL,GAChBA,EAAO/I,QAET+I,EAIT,SAASC,EAAoBC,GAC3B,OAAKlI,EAAMhD,YAAY6K,EAAQK,IAEnBlI,EAAMhD,YAAY4K,EAAQM,SAA/B,EACEJ,OAAehB,EAAWc,EAAQM,IAFlCJ,EAAeF,EAAQM,GAAOL,EAAQK,IAOjD,SAASC,EAAiBD,GACxB,IAAKlI,EAAMhD,YAAY6K,EAAQK,IAC7B,OAAOJ,OAAehB,EAAWe,EAAQK,IAK7C,SAASE,EAAiBF,GACxB,OAAKlI,EAAMhD,YAAY6K,EAAQK,IAEnBlI,EAAMhD,YAAY4K,EAAQM,SAA/B,EACEJ,OAAehB,EAAWc,EAAQM,IAFlCJ,OAAehB,EAAWe,EAAQK,IAO7C,SAASG,EAAgBH,GACvB,OAAIA,KAAQL,EACHC,EAAeF,EAAQM,GAAOL,EAAQK,IACpCA,KAAQN,EACVE,OAAehB,EAAWc,EAAQM,SADpC,EAKT,IAAII,EAAW,CACb,IAAOH,EACP,OAAUA,EACV,KAAQA,EACR,QAAWC,EACX,iBAAoBA,EACpB,kBAAqBA,EACrB,iBAAoBA,EACpB,QAAWA,EACX,eAAkBA,EAClB,gBAAmBA,EACnB,QAAWA,EACX,aAAgBA,EAChB,eAAkBA,EAClB,eAAkBA,EAClB,iBAAoBA,EACpB,mBAAsBA,EACtB,WAAcA,EACd,iBAAoBA,EACpB,cAAiBA,EACjB,UAAaA,EACb,UAAaA,EACb,WAAcA,EACd,YAAeA,EACf,WAAcA,EACd,iBAAoBA,EACpB,eAAkBC,GASpB,OANArI,EAAM1C,QAAQhC,OAAOiN,KAAKX,GAASY,OAAOlN,OAAOiN,KAAKV,KAAW,SAA4BK,GAC3F,IAAIpJ,EAAQwJ,EAASJ,IAASD,EAC1BQ,EAAc3J,EAAMoJ,GACvBlI,EAAMhD,YAAYyL,IAAgB3J,IAAUuJ,IAAqBjF,EAAO8E,GAAQO,MAG5ErF,I,cCjGT/I,EAAOD,QAAU,CACf,QAAW,W,gBCDbC,EAAOD,QAAU,EAAQ,K,6BCEzB,IAAI4F,EAAQ,EAAQ,GAChB5D,EAAO,EAAQ,GACfsM,EAAQ,EAAQ,IAChBC,EAAc,EAAQ,IA4B1B,IAAIC,EAnBJ,SAASC,EAAeC,GACtB,IAAIC,EAAU,IAAIL,EAAMI,GACpBE,EAAW5M,EAAKsM,EAAMlM,UAAU8G,QAASyF,GAa7C,OAVA/I,EAAMb,OAAO6J,EAAUN,EAAMlM,UAAWuM,GAGxC/I,EAAMb,OAAO6J,EAAUD,GAGvBC,EAAS9M,OAAS,SAAgB+M,GAChC,OAAOJ,EAAeF,EAAYG,EAAeG,KAG5CD,EAIGH,CA3BG,EAAQ,IA8BvBD,EAAMF,MAAQA,EAGdE,EAAM/I,OAAS,EAAQ,GACvB+I,EAAMM,YAAc,EAAQ,IAC5BN,EAAMO,SAAW,EAAQ,GACzBP,EAAMQ,QAAU,EAAQ,IAAcC,QAGtCT,EAAMU,IAAM,SAAaC,GACvB,OAAO/E,QAAQ8E,IAAIC,IAErBX,EAAMY,OAAS,EAAQ,IAGvBZ,EAAMpF,aAAe,EAAQ,IAE7BnJ,EAAOD,QAAUwO,EAGjBvO,EAAOD,QAAQqP,QAAUb,G,6BCtDzB,IAAI5I,EAAQ,EAAQ,GAChBmE,EAAW,EAAQ,GACnBuF,EAAqB,EAAQ,IAC7BC,EAAkB,EAAQ,IAC1BhB,EAAc,EAAQ,IACtBiB,EAAY,EAAQ,IAEpBC,EAAaD,EAAUC,WAM3B,SAASnB,EAAMO,GACbzO,KAAKgG,SAAWyI,EAChBzO,KAAKsP,aAAe,CAClBxG,QAAS,IAAIoG,EACbnG,SAAU,IAAImG,GASlBhB,EAAMlM,UAAU8G,QAAU,SAAiByG,EAAa3G,GAG3B,iBAAhB2G,GACT3G,EAASA,GAAU,IACZZ,IAAMuH,EAEb3G,EAAS2G,GAAe,IAG1B3G,EAASuF,EAAYnO,KAAKgG,SAAU4C,IAGzBjB,OACTiB,EAAOjB,OAASiB,EAAOjB,OAAO4E,cACrBvM,KAAKgG,SAAS2B,OACvBiB,EAAOjB,OAAS3H,KAAKgG,SAAS2B,OAAO4E,cAErC3D,EAAOjB,OAAS,MAGlB,IAAI1B,EAAe2C,EAAO3C,kBAELqG,IAAjBrG,GACFmJ,EAAUI,cAAcvJ,EAAc,CACpCc,kBAAmBsI,EAAWpJ,aAAaoJ,EAAWI,SACtDzI,kBAAmBqI,EAAWpJ,aAAaoJ,EAAWI,SACtDjG,oBAAqB6F,EAAWpJ,aAAaoJ,EAAWI,WACvD,GAIL,IAAIC,EAA0B,GAC1BC,GAAiC,EACrC3P,KAAKsP,aAAaxG,QAAQhG,SAAQ,SAAoC8M,GACjC,mBAAxBA,EAAYC,UAA0D,IAAhCD,EAAYC,QAAQjH,KAIrE+G,EAAiCA,GAAkCC,EAAYE,YAE/EJ,EAAwBK,QAAQH,EAAYI,UAAWJ,EAAYK,cAGrE,IAKIC,EALAC,EAA2B,GAO/B,GANAnQ,KAAKsP,aAAavG,SAASjG,SAAQ,SAAkC8M,GACnEO,EAAyB5H,KAAKqH,EAAYI,UAAWJ,EAAYK,cAK9DN,EAAgC,CACnC,IAAIS,EAAQ,CAACjB,OAAiB7C,GAM9B,IAJA/J,MAAMP,UAAU+N,QAAQlI,MAAMuI,EAAOV,GACrCU,EAAQA,EAAMpC,OAAOmC,GAErBD,EAAUlG,QAAQC,QAAQrB,GACnBwH,EAAMnN,QACXiN,EAAUA,EAAQG,KAAKD,EAAME,QAASF,EAAME,SAG9C,OAAOJ,EAKT,IADA,IAAIK,EAAY3H,EACT8G,EAAwBzM,QAAQ,CACrC,IAAIuN,EAAcd,EAAwBY,QACtCG,EAAaf,EAAwBY,QACzC,IACEC,EAAYC,EAAYD,GACxB,MAAO5H,GACP8H,EAAW9H,GACX,OAIJ,IACEuH,EAAUf,EAAgBoB,GAC1B,MAAO5H,GACP,OAAOqB,QAAQE,OAAOvB,GAGxB,KAAOwH,EAAyBlN,QAC9BiN,EAAUA,EAAQG,KAAKF,EAAyBG,QAASH,EAAyBG,SAGpF,OAAOJ,GAGThC,EAAMlM,UAAU0O,OAAS,SAAgB9H,GAEvC,OADAA,EAASuF,EAAYnO,KAAKgG,SAAU4C,GAC7Be,EAASf,EAAOZ,IAAKY,EAAOX,OAAQW,EAAOV,kBAAkBjD,QAAQ,MAAO,KAIrFO,EAAM1C,QAAQ,CAAC,SAAU,MAAO,OAAQ,YAAY,SAA6B6E,GAE/EuG,EAAMlM,UAAU2F,GAAU,SAASK,EAAKY,GACtC,OAAO5I,KAAK8I,QAAQqF,EAAYvF,GAAU,GAAI,CAC5CjB,OAAQA,EACRK,IAAKA,EACL3B,MAAOuC,GAAU,IAAIvC,YAK3Bb,EAAM1C,QAAQ,CAAC,OAAQ,MAAO,UAAU,SAA+B6E,GAErEuG,EAAMlM,UAAU2F,GAAU,SAASK,EAAK3B,EAAMuC,GAC5C,OAAO5I,KAAK8I,QAAQqF,EAAYvF,GAAU,GAAI,CAC5CjB,OAAQA,EACRK,IAAKA,EACL3B,KAAMA,SAKZxG,EAAOD,QAAUsO,G,6BCjJjB,IAAI1I,EAAQ,EAAQ,GAEpB,SAAS0J,IACPlP,KAAK2Q,SAAW,GAWlBzB,EAAmBlN,UAAU4O,IAAM,SAAaZ,EAAWC,EAAUY,GAOnE,OANA7Q,KAAK2Q,SAASpI,KAAK,CACjByH,UAAWA,EACXC,SAAUA,EACVH,cAAae,GAAUA,EAAQf,YAC/BD,QAASgB,EAAUA,EAAQhB,QAAU,OAEhC7P,KAAK2Q,SAAS1N,OAAS,GAQhCiM,EAAmBlN,UAAU8O,MAAQ,SAAeC,GAC9C/Q,KAAK2Q,SAASI,KAChB/Q,KAAK2Q,SAASI,GAAM,OAYxB7B,EAAmBlN,UAAUc,QAAU,SAAiBE,GACtDwC,EAAM1C,QAAQ9C,KAAK2Q,UAAU,SAAwBK,GACzC,OAANA,GACFhO,EAAGgO,OAKTnR,EAAOD,QAAUsP,G,6BCnDjB,IAAI1J,EAAQ,EAAQ,GAChByL,EAAgB,EAAQ,IACxBtC,EAAW,EAAQ,GACnB3I,EAAW,EAAQ,GACnBX,EAAS,EAAQ,GAKrB,SAAS6L,EAA6BtI,GAKpC,GAJIA,EAAO2B,aACT3B,EAAO2B,YAAY4G,mBAGjBvI,EAAO6B,QAAU7B,EAAO6B,OAAOwC,QACjC,MAAM,IAAI5H,EAAO,YAUrBxF,EAAOD,QAAU,SAAyBgJ,GA8BxC,OA7BAsI,EAA6BtI,GAG7BA,EAAO9C,QAAU8C,EAAO9C,SAAW,GAGnC8C,EAAOvC,KAAO4K,EAAc1Q,KAC1BqI,EACAA,EAAOvC,KACPuC,EAAO9C,QACP8C,EAAOxC,kBAITwC,EAAO9C,QAAUN,EAAMlB,MACrBsE,EAAO9C,QAAQ4B,QAAU,GACzBkB,EAAO9C,QAAQ8C,EAAOjB,SAAW,GACjCiB,EAAO9C,SAGTN,EAAM1C,QACJ,CAAC,SAAU,MAAO,OAAQ,OAAQ,MAAO,QAAS,WAClD,SAA2B6E,UAClBiB,EAAO9C,QAAQ6B,OAIZiB,EAAO7C,SAAWC,EAASD,SAE1B6C,GAAQyH,MAAK,SAA6BtH,GAWvD,OAVAmI,EAA6BtI,GAG7BG,EAAS1C,KAAO4K,EAAc1Q,KAC5BqI,EACAG,EAAS1C,KACT0C,EAASjD,QACT8C,EAAO9B,mBAGFiC,KACN,SAA4BqI,GAe7B,OAdKzC,EAASyC,KACZF,EAA6BtI,GAGzBwI,GAAUA,EAAOrI,WACnBqI,EAAOrI,SAAS1C,KAAO4K,EAAc1Q,KACnCqI,EACAwI,EAAOrI,SAAS1C,KAChB+K,EAAOrI,SAASjD,QAChB8C,EAAO9B,qBAKNkD,QAAQE,OAAOkH,Q,6BClF1B,IAAI5L,EAAQ,EAAQ,GAChBQ,EAAW,EAAQ,GAUvBnG,EAAOD,QAAU,SAAuByG,EAAMP,EAASuL,GACrD,IAAI9C,EAAUvO,MAAQgG,EAMtB,OAJAR,EAAM1C,QAAQuO,GAAK,SAAmBrO,GACpCqD,EAAOrD,EAAGzC,KAAKgO,EAASlI,EAAMP,MAGzBO,I,6BClBT,IAAIb,EAAQ,EAAQ,GAEpB3F,EAAOD,QAAU,SAA6BkG,EAASwL,GACrD9L,EAAM1C,QAAQgD,GAAS,SAAuBzE,EAAOV,GAC/CA,IAAS2Q,GAAkB3Q,EAAK+K,gBAAkB4F,EAAe5F,gBACnE5F,EAAQwL,GAAkBjQ,SACnByE,EAAQnF,S,6BCNrB,IAAIoJ,EAAc,EAAQ,GAS1BlK,EAAOD,QAAU,SAAgBqK,EAASC,EAAQnB,GAChD,IAAIvB,EAAiBuB,EAASH,OAAOpB,eAChCuB,EAAStB,QAAWD,IAAkBA,EAAeuB,EAAStB,QAGjEyC,EAAOH,EACL,mCAAqChB,EAAStB,OAC9CsB,EAASH,OACT,KACAG,EAASD,QACTC,IAPFkB,EAAQlB,K,6BCZZ,IAAIvD,EAAQ,EAAQ,GAEpB3F,EAAOD,QACL4F,EAAMvB,uBAIK,CACLsN,MAAO,SAAe5Q,EAAMU,EAAOmQ,EAASC,EAAMC,EAAQC,GACxD,IAAIC,EAAS,GACbA,EAAOrJ,KAAK5H,EAAO,IAAMoH,mBAAmB1G,IAExCmE,EAAM9B,SAAS8N,IACjBI,EAAOrJ,KAAK,WAAa,IAAIsJ,KAAKL,GAASM,eAGzCtM,EAAM/B,SAASgO,IACjBG,EAAOrJ,KAAK,QAAUkJ,GAGpBjM,EAAM/B,SAASiO,IACjBE,EAAOrJ,KAAK,UAAYmJ,IAGX,IAAXC,GACFC,EAAOrJ,KAAK,UAGdlE,SAASuN,OAASA,EAAOpJ,KAAK,OAGhC6D,KAAM,SAAc1L,GAClB,IAAIoR,EAAQ1N,SAASuN,OAAOG,MAAM,IAAIC,OAAO,aAAerR,EAAO,cACnE,OAAQoR,EAAQE,mBAAmBF,EAAM,IAAM,MAGjDG,OAAQ,SAAgBvR,GACtBX,KAAKuR,MAAM5Q,EAAM,GAAIkR,KAAKM,MAAQ,SAO/B,CACLZ,MAAO,aACPlF,KAAM,WAAkB,OAAO,MAC/B6F,OAAQ,e,6BC/ChB,IAAIE,EAAgB,EAAQ,IACxBC,EAAc,EAAQ,IAW1BxS,EAAOD,QAAU,SAAuBsL,EAASoH,GAC/C,OAAIpH,IAAYkH,EAAcE,GACrBD,EAAYnH,EAASoH,GAEvBA,I,6BCVTzS,EAAOD,QAAU,SAAuBoI,GAItC,MAAO,8BAA8BuK,KAAKvK,K,6BCH5CnI,EAAOD,QAAU,SAAqBsL,EAASsH,GAC7C,OAAOA,EACHtH,EAAQjG,QAAQ,OAAQ,IAAM,IAAMuN,EAAYvN,QAAQ,OAAQ,IAChEiG,I,6BCVN,IAAI1F,EAAQ,EAAQ,GAIhBiN,EAAoB,CACtB,MAAO,gBAAiB,iBAAkB,eAAgB,OAC1D,UAAW,OAAQ,OAAQ,oBAAqB,sBAChD,gBAAiB,WAAY,eAAgB,sBAC7C,UAAW,cAAe,cAgB5B5S,EAAOD,QAAU,SAAsBkG,GACrC,IACInE,EACAW,EACAlC,EAHAsS,EAAS,GAKb,OAAK5M,GAELN,EAAM1C,QAAQgD,EAAQ6M,MAAM,OAAO,SAAgBC,GAKjD,GAJAxS,EAAIwS,EAAKlK,QAAQ,KACjB/G,EAAM6D,EAAMT,KAAK6N,EAAKC,OAAO,EAAGzS,IAAImM,cACpCjK,EAAMkD,EAAMT,KAAK6N,EAAKC,OAAOzS,EAAI,IAE7BuB,EAAK,CACP,GAAI+Q,EAAO/Q,IAAQ8Q,EAAkB/J,QAAQ/G,IAAQ,EACnD,OAGA+Q,EAAO/Q,GADG,eAARA,GACa+Q,EAAO/Q,GAAO+Q,EAAO/Q,GAAO,IAAIqM,OAAO,CAAC1L,IAEzCoQ,EAAO/Q,GAAO+Q,EAAO/Q,GAAO,KAAOW,EAAMA,MAKtDoQ,GAnBgBA,I,6BC9BzB,IAAIlN,EAAQ,EAAQ,GAEpB3F,EAAOD,QACL4F,EAAMvB,uBAIJ,WACE,IAEI6O,EAFAC,EAAO,kBAAkBR,KAAKrO,UAAU8O,WACxCC,EAAiB5O,SAAS6O,cAAc,KAS5C,SAASC,EAAWnL,GAClB,IAAIoL,EAAOpL,EAWX,OATI+K,IAEFE,EAAeI,aAAa,OAAQD,GACpCA,EAAOH,EAAeG,MAGxBH,EAAeI,aAAa,OAAQD,GAG7B,CACLA,KAAMH,EAAeG,KACrBE,SAAUL,EAAeK,SAAWL,EAAeK,SAASrO,QAAQ,KAAM,IAAM,GAChFsO,KAAMN,EAAeM,KACrBC,OAAQP,EAAeO,OAASP,EAAeO,OAAOvO,QAAQ,MAAO,IAAM,GAC3EwO,KAAMR,EAAeQ,KAAOR,EAAeQ,KAAKxO,QAAQ,KAAM,IAAM,GACpEyO,SAAUT,EAAeS,SACzBC,KAAMV,EAAeU,KACrBC,SAAiD,MAAtCX,EAAeW,SAASC,OAAO,GACxCZ,EAAeW,SACf,IAAMX,EAAeW,UAY3B,OARAd,EAAYK,EAAW/O,OAAO0P,SAASV,MAQhC,SAAyBW,GAC9B,IAAIrB,EAAUlN,EAAM/B,SAASsQ,GAAeZ,EAAWY,GAAcA,EACrE,OAAQrB,EAAOY,WAAaR,EAAUQ,UAClCZ,EAAOa,OAAST,EAAUS,MAhDlC,GAsDS,WACL,OAAO,I,6BC9Df,IAAI3E,EAAU,EAAQ,IAAeC,QAEjCQ,EAAa,GAGjB,CAAC,SAAU,UAAW,SAAU,WAAY,SAAU,UAAUvM,SAAQ,SAASgK,EAAM1M,GACrFiP,EAAWvC,GAAQ,SAAmBkH,GACpC,cAAcA,IAAUlH,GAAQ,KAAO1M,EAAI,EAAI,KAAO,KAAO0M,MAIjE,IAAImH,EAAqB,GASzB5E,EAAWpJ,aAAe,SAAsBmJ,EAAWP,EAASvJ,GAClE,SAAS4O,EAAcC,EAAKC,GAC1B,MAAO,WAAaxF,EAAU,0BAA6BuF,EAAM,IAAOC,GAAQ9O,EAAU,KAAOA,EAAU,IAI7G,OAAO,SAASjE,EAAO8S,EAAKE,GAC1B,IAAkB,IAAdjF,EACF,MAAM,IAAIjC,MAAM+G,EAAcC,EAAK,qBAAuBtF,EAAU,OAASA,EAAU,MAczF,OAXIA,IAAYoF,EAAmBE,KACjCF,EAAmBE,IAAO,EAE1BG,QAAQC,KACNL,EACEC,EACA,+BAAiCtF,EAAU,8CAK1CO,GAAYA,EAAU/N,EAAO8S,EAAKE,KAkC7CxU,EAAOD,QAAU,CACf4P,cAxBF,SAAuBqB,EAAS2D,EAAQC,GACtC,GAAuB,iBAAZ5D,EACT,MAAM,IAAI6D,UAAU,6BAItB,IAFA,IAAI3G,EAAOjN,OAAOiN,KAAK8C,GACnBzQ,EAAI2N,EAAK9K,OACN7C,KAAM,GAAG,CACd,IAAI+T,EAAMpG,EAAK3N,GACXgP,EAAYoF,EAAOL,GACvB,GAAI/E,EAAJ,CACE,IAAI/N,EAAQwP,EAAQsD,GAChB5P,OAAmB+H,IAAVjL,GAAuB+N,EAAU/N,EAAO8S,EAAKtD,GAC1D,IAAe,IAAXtM,EACF,MAAM,IAAImQ,UAAU,UAAYP,EAAM,YAAc5P,QAIxD,IAAqB,IAAjBkQ,EACF,MAAMtH,MAAM,kBAAoBgH,KAOpC9E,WAAYA,I,6BC9Ed,IAAIhK,EAAS,EAAQ,GAQrB,SAASqJ,EAAYiG,GACnB,GAAwB,mBAAbA,EACT,MAAM,IAAID,UAAU,gCAGtB,IAAIE,EAEJ5U,KAAKkQ,QAAU,IAAIlG,SAAQ,SAAyBC,GAClD2K,EAAiB3K,KAGnB,IAAI4K,EAAQ7U,KAGZA,KAAKkQ,QAAQG,MAAK,SAASxD,GACzB,GAAKgI,EAAMC,WAAX,CAEA,IAAI1U,EACAC,EAAIwU,EAAMC,WAAW7R,OAEzB,IAAK7C,EAAI,EAAGA,EAAIC,EAAGD,IACjByU,EAAMC,WAAW1U,GAAGyM,GAEtBgI,EAAMC,WAAa,SAIrB9U,KAAKkQ,QAAQG,KAAO,SAAS0E,GAC3B,IAAIC,EAEA9E,EAAU,IAAIlG,SAAQ,SAASC,GACjC4K,EAAM7H,UAAU/C,GAChB+K,EAAW/K,KACVoG,KAAK0E,GAMR,OAJA7E,EAAQrD,OAAS,WACfgI,EAAMrK,YAAYwK,IAGb9E,GAGTyE,GAAS,SAAgBrP,GACnBuP,EAAMzD,SAKVyD,EAAMzD,OAAS,IAAI/L,EAAOC,GAC1BsP,EAAeC,EAAMzD,YAOzB1C,EAAY1M,UAAUmP,iBAAmB,WACvC,GAAInR,KAAKoR,OACP,MAAMpR,KAAKoR,QAQf1C,EAAY1M,UAAUgL,UAAY,SAAmBiI,GAC/CjV,KAAKoR,OACP6D,EAASjV,KAAKoR,QAIZpR,KAAK8U,WACP9U,KAAK8U,WAAWvM,KAAK0M,GAErBjV,KAAK8U,WAAa,CAACG,IAQvBvG,EAAY1M,UAAUwI,YAAc,SAAqByK,GACvD,GAAKjV,KAAK8U,WAAV,CAGA,IAAII,EAAQlV,KAAK8U,WAAWpM,QAAQuM,IACrB,IAAXC,GACFlV,KAAK8U,WAAWK,OAAOD,EAAO,KAQlCxG,EAAYlB,OAAS,WACnB,IAAIX,EAIJ,MAAO,CACLgI,MAJU,IAAInG,GAAY,SAAkBjO,GAC5CoM,EAASpM,KAIToM,OAAQA,IAIZhN,EAAOD,QAAU8O,G,6BChGjB7O,EAAOD,QAAU,SAAgBwV,GAC/B,OAAO,SAAcC,GACnB,OAAOD,EAASvN,MAAM,KAAMwN,M,6BCtBhC,IAAI7P,EAAQ,EAAQ,GAQpB3F,EAAOD,QAAU,SAAsB0V,GACrC,OAAO9P,EAAM9C,SAAS4S,KAAsC,IAAzBA,EAAQtM","file":"axios.min.js","sourcesContent":["(function webpackUniversalModuleDefinition(root, factory) {\n\tif(typeof exports === 'object' && typeof module === 'object')\n\t\tmodule.exports = factory();\n\telse if(typeof define === 'function' && define.amd)\n\t\tdefine([], factory);\n\telse if(typeof exports === 'object')\n\t\texports[\"axios\"] = factory();\n\telse\n\t\troot[\"axios\"] = factory();\n})(this, function() {\nreturn "," \t// The module cache\n \tvar installedModules = {};\n\n \t// The require function\n \tfunction __webpack_require__(moduleId) {\n\n \t\t// Check if module is in cache\n \t\tif(installedModules[moduleId]) {\n \t\t\treturn installedModules[moduleId].exports;\n \t\t}\n \t\t// Create a new module (and put it into the cache)\n \t\tvar module = installedModules[moduleId] = {\n \t\t\ti: moduleId,\n \t\t\tl: false,\n \t\t\texports: {}\n \t\t};\n\n \t\t// Execute the module function\n \t\tmodules[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n\n \t\t// Flag the module as loaded\n \t\tmodule.l = true;\n\n \t\t// Return the exports of the module\n \t\treturn module.exports;\n \t}\n\n\n \t// expose the modules object (__webpack_modules__)\n \t__webpack_require__.m = modules;\n\n \t// expose the module cache\n \t__webpack_require__.c = installedModules;\n\n \t// define getter function for harmony exports\n \t__webpack_require__.d = function(exports, name, getter) {\n \t\tif(!__webpack_require__.o(exports, name)) {\n \t\t\tObject.defineProperty(exports, name, { enumerable: true, get: getter });\n \t\t}\n \t};\n\n \t// define __esModule on exports\n \t__webpack_require__.r = function(exports) {\n \t\tif(typeof Symbol !== 'undefined' && Symbol.toStringTag) {\n \t\t\tObject.defineProperty(exports, Symbol.toStringTag, { value: 'Module' });\n \t\t}\n \t\tObject.defineProperty(exports, '__esModule', { value: true });\n \t};\n\n \t// create a fake namespace object\n \t// mode & 1: value is a module id, require it\n \t// mode & 2: merge all properties of value into the ns\n \t// mode & 4: return value when already ns object\n \t// mode & 8|1: behave like require\n \t__webpack_require__.t = function(value, mode) {\n \t\tif(mode & 1) value = __webpack_require__(value);\n \t\tif(mode & 8) return value;\n \t\tif((mode & 4) && typeof value === 'object' && value && value.__esModule) return value;\n \t\tvar ns = Object.create(null);\n \t\t__webpack_require__.r(ns);\n \t\tObject.defineProperty(ns, 'default', { enumerable: true, value: value });\n \t\tif(mode & 2 && typeof value != 'string') for(var key in value) __webpack_require__.d(ns, key, function(key) { return value[key]; }.bind(null, key));\n \t\treturn ns;\n \t};\n\n \t// getDefaultExport function for compatibility with non-harmony modules\n \t__webpack_require__.n = function(module) {\n \t\tvar getter = module && module.__esModule ?\n \t\t\tfunction getDefault() { return module['default']; } :\n \t\t\tfunction getModuleExports() { return module; };\n \t\t__webpack_require__.d(getter, 'a', getter);\n \t\treturn getter;\n \t};\n\n \t// Object.prototype.hasOwnProperty.call\n \t__webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); };\n\n \t// __webpack_public_path__\n \t__webpack_require__.p = \"\";\n\n\n \t// Load entry module and return exports\n \treturn __webpack_require__(__webpack_require__.s = 12);\n","'use strict';\n\nvar bind = require('./helpers/bind');\n\n// utils is a library of generic helper functions non-specific to axios\n\nvar toString = Object.prototype.toString;\n\n/**\n * Determine if a value is an Array\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an Array, otherwise false\n */\nfunction isArray(val) {\n return Array.isArray(val);\n}\n\n/**\n * Determine if a value is undefined\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if the value is undefined, otherwise false\n */\nfunction isUndefined(val) {\n return typeof val === 'undefined';\n}\n\n/**\n * Determine if a value is a Buffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Buffer, otherwise false\n */\nfunction isBuffer(val) {\n return val !== null && !isUndefined(val) && val.constructor !== null && !isUndefined(val.constructor)\n && typeof val.constructor.isBuffer === 'function' && val.constructor.isBuffer(val);\n}\n\n/**\n * Determine if a value is an ArrayBuffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an ArrayBuffer, otherwise false\n */\nfunction isArrayBuffer(val) {\n return toString.call(val) === '[object ArrayBuffer]';\n}\n\n/**\n * Determine if a value is a FormData\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an FormData, otherwise false\n */\nfunction isFormData(val) {\n return toString.call(val) === '[object FormData]';\n}\n\n/**\n * Determine if a value is a view on an ArrayBuffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false\n */\nfunction isArrayBufferView(val) {\n var result;\n if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) {\n result = ArrayBuffer.isView(val);\n } else {\n result = (val) && (val.buffer) && (isArrayBuffer(val.buffer));\n }\n return result;\n}\n\n/**\n * Determine if a value is a String\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a String, otherwise false\n */\nfunction isString(val) {\n return typeof val === 'string';\n}\n\n/**\n * Determine if a value is a Number\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Number, otherwise false\n */\nfunction isNumber(val) {\n return typeof val === 'number';\n}\n\n/**\n * Determine if a value is an Object\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an Object, otherwise false\n */\nfunction isObject(val) {\n return val !== null && typeof val === 'object';\n}\n\n/**\n * Determine if a value is a plain Object\n *\n * @param {Object} val The value to test\n * @return {boolean} True if value is a plain Object, otherwise false\n */\nfunction isPlainObject(val) {\n if (toString.call(val) !== '[object Object]') {\n return false;\n }\n\n var prototype = Object.getPrototypeOf(val);\n return prototype === null || prototype === Object.prototype;\n}\n\n/**\n * Determine if a value is a Date\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Date, otherwise false\n */\nfunction isDate(val) {\n return toString.call(val) === '[object Date]';\n}\n\n/**\n * Determine if a value is a File\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a File, otherwise false\n */\nfunction isFile(val) {\n return toString.call(val) === '[object File]';\n}\n\n/**\n * Determine if a value is a Blob\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Blob, otherwise false\n */\nfunction isBlob(val) {\n return toString.call(val) === '[object Blob]';\n}\n\n/**\n * Determine if a value is a Function\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Function, otherwise false\n */\nfunction isFunction(val) {\n return toString.call(val) === '[object Function]';\n}\n\n/**\n * Determine if a value is a Stream\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Stream, otherwise false\n */\nfunction isStream(val) {\n return isObject(val) && isFunction(val.pipe);\n}\n\n/**\n * Determine if a value is a URLSearchParams object\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a URLSearchParams object, otherwise false\n */\nfunction isURLSearchParams(val) {\n return toString.call(val) === '[object URLSearchParams]';\n}\n\n/**\n * Trim excess whitespace off the beginning and end of a string\n *\n * @param {String} str The String to trim\n * @returns {String} The String freed of excess whitespace\n */\nfunction trim(str) {\n return str.trim ? str.trim() : str.replace(/^\\s+|\\s+$/g, '');\n}\n\n/**\n * Determine if we're running in a standard browser environment\n *\n * This allows axios to run in a web worker, and react-native.\n * Both environments support XMLHttpRequest, but not fully standard globals.\n *\n * web workers:\n * typeof window -> undefined\n * typeof document -> undefined\n *\n * react-native:\n * navigator.product -> 'ReactNative'\n * nativescript\n * navigator.product -> 'NativeScript' or 'NS'\n */\nfunction isStandardBrowserEnv() {\n if (typeof navigator !== 'undefined' && (navigator.product === 'ReactNative' ||\n navigator.product === 'NativeScript' ||\n navigator.product === 'NS')) {\n return false;\n }\n return (\n typeof window !== 'undefined' &&\n typeof document !== 'undefined'\n );\n}\n\n/**\n * Iterate over an Array or an Object invoking a function for each item.\n *\n * If `obj` is an Array callback will be called passing\n * the value, index, and complete array for each item.\n *\n * If 'obj' is an Object callback will be called passing\n * the value, key, and complete object for each property.\n *\n * @param {Object|Array} obj The object to iterate\n * @param {Function} fn The callback to invoke for each item\n */\nfunction forEach(obj, fn) {\n // Don't bother if no value provided\n if (obj === null || typeof obj === 'undefined') {\n return;\n }\n\n // Force an array if not already something iterable\n if (typeof obj !== 'object') {\n /*eslint no-param-reassign:0*/\n obj = [obj];\n }\n\n if (isArray(obj)) {\n // Iterate over array values\n for (var i = 0, l = obj.length; i < l; i++) {\n fn.call(null, obj[i], i, obj);\n }\n } else {\n // Iterate over object keys\n for (var key in obj) {\n if (Object.prototype.hasOwnProperty.call(obj, key)) {\n fn.call(null, obj[key], key, obj);\n }\n }\n }\n}\n\n/**\n * Accepts varargs expecting each argument to be an object, then\n * immutably merges the properties of each object and returns result.\n *\n * When multiple objects contain the same key the later object in\n * the arguments list will take precedence.\n *\n * Example:\n *\n * ```js\n * var result = merge({foo: 123}, {foo: 456});\n * console.log(result.foo); // outputs 456\n * ```\n *\n * @param {Object} obj1 Object to merge\n * @returns {Object} Result of all merge properties\n */\nfunction merge(/* obj1, obj2, obj3, ... */) {\n var result = {};\n function assignValue(val, key) {\n if (isPlainObject(result[key]) && isPlainObject(val)) {\n result[key] = merge(result[key], val);\n } else if (isPlainObject(val)) {\n result[key] = merge({}, val);\n } else if (isArray(val)) {\n result[key] = val.slice();\n } else {\n result[key] = val;\n }\n }\n\n for (var i = 0, l = arguments.length; i < l; i++) {\n forEach(arguments[i], assignValue);\n }\n return result;\n}\n\n/**\n * Extends object a by mutably adding to it the properties of object b.\n *\n * @param {Object} a The object to be extended\n * @param {Object} b The object to copy properties from\n * @param {Object} thisArg The object to bind function to\n * @return {Object} The resulting value of object a\n */\nfunction extend(a, b, thisArg) {\n forEach(b, function assignValue(val, key) {\n if (thisArg && typeof val === 'function') {\n a[key] = bind(val, thisArg);\n } else {\n a[key] = val;\n }\n });\n return a;\n}\n\n/**\n * Remove byte order marker. This catches EF BB BF (the UTF-8 BOM)\n *\n * @param {string} content with BOM\n * @return {string} content value without BOM\n */\nfunction stripBOM(content) {\n if (content.charCodeAt(0) === 0xFEFF) {\n content = content.slice(1);\n }\n return content;\n}\n\nmodule.exports = {\n isArray: isArray,\n isArrayBuffer: isArrayBuffer,\n isBuffer: isBuffer,\n isFormData: isFormData,\n isArrayBufferView: isArrayBufferView,\n isString: isString,\n isNumber: isNumber,\n isObject: isObject,\n isPlainObject: isPlainObject,\n isUndefined: isUndefined,\n isDate: isDate,\n isFile: isFile,\n isBlob: isBlob,\n isFunction: isFunction,\n isStream: isStream,\n isURLSearchParams: isURLSearchParams,\n isStandardBrowserEnv: isStandardBrowserEnv,\n forEach: forEach,\n merge: merge,\n extend: extend,\n trim: trim,\n stripBOM: stripBOM\n};\n","'use strict';\n\n/**\n * A `Cancel` is an object that is thrown when an operation is canceled.\n *\n * @class\n * @param {string=} message The message.\n */\nfunction Cancel(message) {\n this.message = message;\n}\n\nCancel.prototype.toString = function toString() {\n return 'Cancel' + (this.message ? ': ' + this.message : '');\n};\n\nCancel.prototype.__CANCEL__ = true;\n\nmodule.exports = Cancel;\n","'use strict';\n\nvar utils = require('../utils');\nvar normalizeHeaderName = require('../helpers/normalizeHeaderName');\nvar enhanceError = require('../core/enhanceError');\nvar transitionalDefaults = require('./transitional');\n\nvar DEFAULT_CONTENT_TYPE = {\n 'Content-Type': 'application/x-www-form-urlencoded'\n};\n\nfunction setContentTypeIfUnset(headers, value) {\n if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) {\n headers['Content-Type'] = value;\n }\n}\n\nfunction getDefaultAdapter() {\n var adapter;\n if (typeof XMLHttpRequest !== 'undefined') {\n // For browsers use XHR adapter\n adapter = require('../adapters/xhr');\n } else if (typeof process !== 'undefined' && Object.prototype.toString.call(process) === '[object process]') {\n // For node use HTTP adapter\n adapter = require('../adapters/http');\n }\n return adapter;\n}\n\nfunction stringifySafely(rawValue, parser, encoder) {\n if (utils.isString(rawValue)) {\n try {\n (parser || JSON.parse)(rawValue);\n return utils.trim(rawValue);\n } catch (e) {\n if (e.name !== 'SyntaxError') {\n throw e;\n }\n }\n }\n\n return (encoder || JSON.stringify)(rawValue);\n}\n\nvar defaults = {\n\n transitional: transitionalDefaults,\n\n adapter: getDefaultAdapter(),\n\n transformRequest: [function transformRequest(data, headers) {\n normalizeHeaderName(headers, 'Accept');\n normalizeHeaderName(headers, 'Content-Type');\n\n if (utils.isFormData(data) ||\n utils.isArrayBuffer(data) ||\n utils.isBuffer(data) ||\n utils.isStream(data) ||\n utils.isFile(data) ||\n utils.isBlob(data)\n ) {\n return data;\n }\n if (utils.isArrayBufferView(data)) {\n return data.buffer;\n }\n if (utils.isURLSearchParams(data)) {\n setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8');\n return data.toString();\n }\n if (utils.isObject(data) || (headers && headers['Content-Type'] === 'application/json')) {\n setContentTypeIfUnset(headers, 'application/json');\n return stringifySafely(data);\n }\n return data;\n }],\n\n transformResponse: [function transformResponse(data) {\n var transitional = this.transitional || defaults.transitional;\n var silentJSONParsing = transitional && transitional.silentJSONParsing;\n var forcedJSONParsing = transitional && transitional.forcedJSONParsing;\n var strictJSONParsing = !silentJSONParsing && this.responseType === 'json';\n\n if (strictJSONParsing || (forcedJSONParsing && utils.isString(data) && data.length)) {\n try {\n return JSON.parse(data);\n } catch (e) {\n if (strictJSONParsing) {\n if (e.name === 'SyntaxError') {\n throw enhanceError(e, this, 'E_JSON_PARSE');\n }\n throw e;\n }\n }\n }\n\n return data;\n }],\n\n /**\n * A timeout in milliseconds to abort a request. If set to 0 (default) a\n * timeout is not created.\n */\n timeout: 0,\n\n xsrfCookieName: 'XSRF-TOKEN',\n xsrfHeaderName: 'X-XSRF-TOKEN',\n\n maxContentLength: -1,\n maxBodyLength: -1,\n\n validateStatus: function validateStatus(status) {\n return status >= 200 && status < 300;\n },\n\n headers: {\n common: {\n 'Accept': 'application/json, text/plain, */*'\n }\n }\n};\n\nutils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) {\n defaults.headers[method] = {};\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE);\n});\n\nmodule.exports = defaults;\n","'use strict';\n\nmodule.exports = function bind(fn, thisArg) {\n return function wrap() {\n var args = new Array(arguments.length);\n for (var i = 0; i < args.length; i++) {\n args[i] = arguments[i];\n }\n return fn.apply(thisArg, args);\n };\n};\n","'use strict';\n\nvar utils = require('./../utils');\n\nfunction encode(val) {\n return encodeURIComponent(val).\n replace(/%3A/gi, ':').\n replace(/%24/g, '$').\n replace(/%2C/gi, ',').\n replace(/%20/g, '+').\n replace(/%5B/gi, '[').\n replace(/%5D/gi, ']');\n}\n\n/**\n * Build a URL by appending params to the end\n *\n * @param {string} url The base of the url (e.g., http://www.google.com)\n * @param {object} [params] The params to be appended\n * @returns {string} The formatted url\n */\nmodule.exports = function buildURL(url, params, paramsSerializer) {\n /*eslint no-param-reassign:0*/\n if (!params) {\n return url;\n }\n\n var serializedParams;\n if (paramsSerializer) {\n serializedParams = paramsSerializer(params);\n } else if (utils.isURLSearchParams(params)) {\n serializedParams = params.toString();\n } else {\n var parts = [];\n\n utils.forEach(params, function serialize(val, key) {\n if (val === null || typeof val === 'undefined') {\n return;\n }\n\n if (utils.isArray(val)) {\n key = key + '[]';\n } else {\n val = [val];\n }\n\n utils.forEach(val, function parseValue(v) {\n if (utils.isDate(v)) {\n v = v.toISOString();\n } else if (utils.isObject(v)) {\n v = JSON.stringify(v);\n }\n parts.push(encode(key) + '=' + encode(v));\n });\n });\n\n serializedParams = parts.join('&');\n }\n\n if (serializedParams) {\n var hashmarkIndex = url.indexOf('#');\n if (hashmarkIndex !== -1) {\n url = url.slice(0, hashmarkIndex);\n }\n\n url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams;\n }\n\n return url;\n};\n","'use strict';\n\n/**\n * Update an Error with the specified config, error code, and response.\n *\n * @param {Error} error The error to update.\n * @param {Object} config The config.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n * @returns {Error} The error.\n */\nmodule.exports = function enhanceError(error, config, code, request, response) {\n error.config = config;\n if (code) {\n error.code = code;\n }\n\n error.request = request;\n error.response = response;\n error.isAxiosError = true;\n\n error.toJSON = function toJSON() {\n return {\n // Standard\n message: this.message,\n name: this.name,\n // Microsoft\n description: this.description,\n number: this.number,\n // Mozilla\n fileName: this.fileName,\n lineNumber: this.lineNumber,\n columnNumber: this.columnNumber,\n stack: this.stack,\n // Axios\n config: this.config,\n code: this.code,\n status: this.response && this.response.status ? this.response.status : null\n };\n };\n return error;\n};\n","'use strict';\n\nmodule.exports = {\n silentJSONParsing: true,\n forcedJSONParsing: true,\n clarifyTimeoutError: false\n};\n","'use strict';\n\nvar utils = require('./../utils');\nvar settle = require('./../core/settle');\nvar cookies = require('./../helpers/cookies');\nvar buildURL = require('./../helpers/buildURL');\nvar buildFullPath = require('../core/buildFullPath');\nvar parseHeaders = require('./../helpers/parseHeaders');\nvar isURLSameOrigin = require('./../helpers/isURLSameOrigin');\nvar createError = require('../core/createError');\nvar transitionalDefaults = require('../defaults/transitional');\nvar Cancel = require('../cancel/Cancel');\n\nmodule.exports = function xhrAdapter(config) {\n return new Promise(function dispatchXhrRequest(resolve, reject) {\n var requestData = config.data;\n var requestHeaders = config.headers;\n var responseType = config.responseType;\n var onCanceled;\n function done() {\n if (config.cancelToken) {\n config.cancelToken.unsubscribe(onCanceled);\n }\n\n if (config.signal) {\n config.signal.removeEventListener('abort', onCanceled);\n }\n }\n\n if (utils.isFormData(requestData)) {\n delete requestHeaders['Content-Type']; // Let the browser set it\n }\n\n var request = new XMLHttpRequest();\n\n // HTTP basic authentication\n if (config.auth) {\n var username = config.auth.username || '';\n var password = config.auth.password ? unescape(encodeURIComponent(config.auth.password)) : '';\n requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password);\n }\n\n var fullPath = buildFullPath(config.baseURL, config.url);\n request.open(config.method.toUpperCase(), buildURL(fullPath, config.params, config.paramsSerializer), true);\n\n // Set the request timeout in MS\n request.timeout = config.timeout;\n\n function onloadend() {\n if (!request) {\n return;\n }\n // Prepare the response\n var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null;\n var responseData = !responseType || responseType === 'text' || responseType === 'json' ?\n request.responseText : request.response;\n var response = {\n data: responseData,\n status: request.status,\n statusText: request.statusText,\n headers: responseHeaders,\n config: config,\n request: request\n };\n\n settle(function _resolve(value) {\n resolve(value);\n done();\n }, function _reject(err) {\n reject(err);\n done();\n }, response);\n\n // Clean up request\n request = null;\n }\n\n if ('onloadend' in request) {\n // Use onloadend if available\n request.onloadend = onloadend;\n } else {\n // Listen for ready state to emulate onloadend\n request.onreadystatechange = function handleLoad() {\n if (!request || request.readyState !== 4) {\n return;\n }\n\n // The request errored out and we didn't get a response, this will be\n // handled by onerror instead\n // With one exception: request that using file: protocol, most browsers\n // will return status as 0 even though it's a successful request\n if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) {\n return;\n }\n // readystate handler is calling before onerror or ontimeout handlers,\n // so we should call onloadend on the next 'tick'\n setTimeout(onloadend);\n };\n }\n\n // Handle browser request cancellation (as opposed to a manual cancellation)\n request.onabort = function handleAbort() {\n if (!request) {\n return;\n }\n\n reject(createError('Request aborted', config, 'ECONNABORTED', request));\n\n // Clean up request\n request = null;\n };\n\n // Handle low level network errors\n request.onerror = function handleError() {\n // Real errors are hidden from us by the browser\n // onerror should only fire if it's a network error\n reject(createError('Network Error', config, null, request));\n\n // Clean up request\n request = null;\n };\n\n // Handle timeout\n request.ontimeout = function handleTimeout() {\n var timeoutErrorMessage = config.timeout ? 'timeout of ' + config.timeout + 'ms exceeded' : 'timeout exceeded';\n var transitional = config.transitional || transitionalDefaults;\n if (config.timeoutErrorMessage) {\n timeoutErrorMessage = config.timeoutErrorMessage;\n }\n reject(createError(\n timeoutErrorMessage,\n config,\n transitional.clarifyTimeoutError ? 'ETIMEDOUT' : 'ECONNABORTED',\n request));\n\n // Clean up request\n request = null;\n };\n\n // Add xsrf header\n // This is only done if running in a standard browser environment.\n // Specifically not if we're in a web worker, or react-native.\n if (utils.isStandardBrowserEnv()) {\n // Add xsrf header\n var xsrfValue = (config.withCredentials || isURLSameOrigin(fullPath)) && config.xsrfCookieName ?\n cookies.read(config.xsrfCookieName) :\n undefined;\n\n if (xsrfValue) {\n requestHeaders[config.xsrfHeaderName] = xsrfValue;\n }\n }\n\n // Add headers to the request\n if ('setRequestHeader' in request) {\n utils.forEach(requestHeaders, function setRequestHeader(val, key) {\n if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') {\n // Remove Content-Type if data is undefined\n delete requestHeaders[key];\n } else {\n // Otherwise add header to the request\n request.setRequestHeader(key, val);\n }\n });\n }\n\n // Add withCredentials to request if needed\n if (!utils.isUndefined(config.withCredentials)) {\n request.withCredentials = !!config.withCredentials;\n }\n\n // Add responseType to request if needed\n if (responseType && responseType !== 'json') {\n request.responseType = config.responseType;\n }\n\n // Handle progress if needed\n if (typeof config.onDownloadProgress === 'function') {\n request.addEventListener('progress', config.onDownloadProgress);\n }\n\n // Not all browsers support upload events\n if (typeof config.onUploadProgress === 'function' && request.upload) {\n request.upload.addEventListener('progress', config.onUploadProgress);\n }\n\n if (config.cancelToken || config.signal) {\n // Handle cancellation\n // eslint-disable-next-line func-names\n onCanceled = function(cancel) {\n if (!request) {\n return;\n }\n reject(!cancel || (cancel && cancel.type) ? new Cancel('canceled') : cancel);\n request.abort();\n request = null;\n };\n\n config.cancelToken && config.cancelToken.subscribe(onCanceled);\n if (config.signal) {\n config.signal.aborted ? onCanceled() : config.signal.addEventListener('abort', onCanceled);\n }\n }\n\n if (!requestData) {\n requestData = null;\n }\n\n // Send the request\n request.send(requestData);\n });\n};\n","'use strict';\n\nvar enhanceError = require('./enhanceError');\n\n/**\n * Create an Error with the specified message, config, error code, request and response.\n *\n * @param {string} message The error message.\n * @param {Object} config The config.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n * @returns {Error} The created error.\n */\nmodule.exports = function createError(message, config, code, request, response) {\n var error = new Error(message);\n return enhanceError(error, config, code, request, response);\n};\n","'use strict';\n\nmodule.exports = function isCancel(value) {\n return !!(value && value.__CANCEL__);\n};\n","'use strict';\n\nvar utils = require('../utils');\n\n/**\n * Config-specific merge-function which creates a new config-object\n * by merging two configuration objects together.\n *\n * @param {Object} config1\n * @param {Object} config2\n * @returns {Object} New object resulting from merging config2 to config1\n */\nmodule.exports = function mergeConfig(config1, config2) {\n // eslint-disable-next-line no-param-reassign\n config2 = config2 || {};\n var config = {};\n\n function getMergedValue(target, source) {\n if (utils.isPlainObject(target) && utils.isPlainObject(source)) {\n return utils.merge(target, source);\n } else if (utils.isPlainObject(source)) {\n return utils.merge({}, source);\n } else if (utils.isArray(source)) {\n return source.slice();\n }\n return source;\n }\n\n // eslint-disable-next-line consistent-return\n function mergeDeepProperties(prop) {\n if (!utils.isUndefined(config2[prop])) {\n return getMergedValue(config1[prop], config2[prop]);\n } else if (!utils.isUndefined(config1[prop])) {\n return getMergedValue(undefined, config1[prop]);\n }\n }\n\n // eslint-disable-next-line consistent-return\n function valueFromConfig2(prop) {\n if (!utils.isUndefined(config2[prop])) {\n return getMergedValue(undefined, config2[prop]);\n }\n }\n\n // eslint-disable-next-line consistent-return\n function defaultToConfig2(prop) {\n if (!utils.isUndefined(config2[prop])) {\n return getMergedValue(undefined, config2[prop]);\n } else if (!utils.isUndefined(config1[prop])) {\n return getMergedValue(undefined, config1[prop]);\n }\n }\n\n // eslint-disable-next-line consistent-return\n function mergeDirectKeys(prop) {\n if (prop in config2) {\n return getMergedValue(config1[prop], config2[prop]);\n } else if (prop in config1) {\n return getMergedValue(undefined, config1[prop]);\n }\n }\n\n var mergeMap = {\n 'url': valueFromConfig2,\n 'method': valueFromConfig2,\n 'data': valueFromConfig2,\n 'baseURL': defaultToConfig2,\n 'transformRequest': defaultToConfig2,\n 'transformResponse': defaultToConfig2,\n 'paramsSerializer': defaultToConfig2,\n 'timeout': defaultToConfig2,\n 'timeoutMessage': defaultToConfig2,\n 'withCredentials': defaultToConfig2,\n 'adapter': defaultToConfig2,\n 'responseType': defaultToConfig2,\n 'xsrfCookieName': defaultToConfig2,\n 'xsrfHeaderName': defaultToConfig2,\n 'onUploadProgress': defaultToConfig2,\n 'onDownloadProgress': defaultToConfig2,\n 'decompress': defaultToConfig2,\n 'maxContentLength': defaultToConfig2,\n 'maxBodyLength': defaultToConfig2,\n 'transport': defaultToConfig2,\n 'httpAgent': defaultToConfig2,\n 'httpsAgent': defaultToConfig2,\n 'cancelToken': defaultToConfig2,\n 'socketPath': defaultToConfig2,\n 'responseEncoding': defaultToConfig2,\n 'validateStatus': mergeDirectKeys\n };\n\n utils.forEach(Object.keys(config1).concat(Object.keys(config2)), function computeConfigValue(prop) {\n var merge = mergeMap[prop] || mergeDeepProperties;\n var configValue = merge(prop);\n (utils.isUndefined(configValue) && merge !== mergeDirectKeys) || (config[prop] = configValue);\n });\n\n return config;\n};\n","module.exports = {\n \"version\": \"0.26.1\"\n};","module.exports = require('./lib/axios');","'use strict';\n\nvar utils = require('./utils');\nvar bind = require('./helpers/bind');\nvar Axios = require('./core/Axios');\nvar mergeConfig = require('./core/mergeConfig');\nvar defaults = require('./defaults');\n\n/**\n * Create an instance of Axios\n *\n * @param {Object} defaultConfig The default config for the instance\n * @return {Axios} A new instance of Axios\n */\nfunction createInstance(defaultConfig) {\n var context = new Axios(defaultConfig);\n var instance = bind(Axios.prototype.request, context);\n\n // Copy axios.prototype to instance\n utils.extend(instance, Axios.prototype, context);\n\n // Copy context to instance\n utils.extend(instance, context);\n\n // Factory for creating new instances\n instance.create = function create(instanceConfig) {\n return createInstance(mergeConfig(defaultConfig, instanceConfig));\n };\n\n return instance;\n}\n\n// Create the default instance to be exported\nvar axios = createInstance(defaults);\n\n// Expose Axios class to allow class inheritance\naxios.Axios = Axios;\n\n// Expose Cancel & CancelToken\naxios.Cancel = require('./cancel/Cancel');\naxios.CancelToken = require('./cancel/CancelToken');\naxios.isCancel = require('./cancel/isCancel');\naxios.VERSION = require('./env/data').version;\n\n// Expose all/spread\naxios.all = function all(promises) {\n return Promise.all(promises);\n};\naxios.spread = require('./helpers/spread');\n\n// Expose isAxiosError\naxios.isAxiosError = require('./helpers/isAxiosError');\n\nmodule.exports = axios;\n\n// Allow use of default import syntax in TypeScript\nmodule.exports.default = axios;\n","'use strict';\n\nvar utils = require('./../utils');\nvar buildURL = require('../helpers/buildURL');\nvar InterceptorManager = require('./InterceptorManager');\nvar dispatchRequest = require('./dispatchRequest');\nvar mergeConfig = require('./mergeConfig');\nvar validator = require('../helpers/validator');\n\nvar validators = validator.validators;\n/**\n * Create a new instance of Axios\n *\n * @param {Object} instanceConfig The default config for the instance\n */\nfunction Axios(instanceConfig) {\n this.defaults = instanceConfig;\n this.interceptors = {\n request: new InterceptorManager(),\n response: new InterceptorManager()\n };\n}\n\n/**\n * Dispatch a request\n *\n * @param {Object} config The config specific for this request (merged with this.defaults)\n */\nAxios.prototype.request = function request(configOrUrl, config) {\n /*eslint no-param-reassign:0*/\n // Allow for axios('example/url'[, config]) a la fetch API\n if (typeof configOrUrl === 'string') {\n config = config || {};\n config.url = configOrUrl;\n } else {\n config = configOrUrl || {};\n }\n\n config = mergeConfig(this.defaults, config);\n\n // Set config.method\n if (config.method) {\n config.method = config.method.toLowerCase();\n } else if (this.defaults.method) {\n config.method = this.defaults.method.toLowerCase();\n } else {\n config.method = 'get';\n }\n\n var transitional = config.transitional;\n\n if (transitional !== undefined) {\n validator.assertOptions(transitional, {\n silentJSONParsing: validators.transitional(validators.boolean),\n forcedJSONParsing: validators.transitional(validators.boolean),\n clarifyTimeoutError: validators.transitional(validators.boolean)\n }, false);\n }\n\n // filter out skipped interceptors\n var requestInterceptorChain = [];\n var synchronousRequestInterceptors = true;\n this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) {\n if (typeof interceptor.runWhen === 'function' && interceptor.runWhen(config) === false) {\n return;\n }\n\n synchronousRequestInterceptors = synchronousRequestInterceptors && interceptor.synchronous;\n\n requestInterceptorChain.unshift(interceptor.fulfilled, interceptor.rejected);\n });\n\n var responseInterceptorChain = [];\n this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) {\n responseInterceptorChain.push(interceptor.fulfilled, interceptor.rejected);\n });\n\n var promise;\n\n if (!synchronousRequestInterceptors) {\n var chain = [dispatchRequest, undefined];\n\n Array.prototype.unshift.apply(chain, requestInterceptorChain);\n chain = chain.concat(responseInterceptorChain);\n\n promise = Promise.resolve(config);\n while (chain.length) {\n promise = promise.then(chain.shift(), chain.shift());\n }\n\n return promise;\n }\n\n\n var newConfig = config;\n while (requestInterceptorChain.length) {\n var onFulfilled = requestInterceptorChain.shift();\n var onRejected = requestInterceptorChain.shift();\n try {\n newConfig = onFulfilled(newConfig);\n } catch (error) {\n onRejected(error);\n break;\n }\n }\n\n try {\n promise = dispatchRequest(newConfig);\n } catch (error) {\n return Promise.reject(error);\n }\n\n while (responseInterceptorChain.length) {\n promise = promise.then(responseInterceptorChain.shift(), responseInterceptorChain.shift());\n }\n\n return promise;\n};\n\nAxios.prototype.getUri = function getUri(config) {\n config = mergeConfig(this.defaults, config);\n return buildURL(config.url, config.params, config.paramsSerializer).replace(/^\\?/, '');\n};\n\n// Provide aliases for supported request methods\nutils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) {\n /*eslint func-names:0*/\n Axios.prototype[method] = function(url, config) {\n return this.request(mergeConfig(config || {}, {\n method: method,\n url: url,\n data: (config || {}).data\n }));\n };\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n /*eslint func-names:0*/\n Axios.prototype[method] = function(url, data, config) {\n return this.request(mergeConfig(config || {}, {\n method: method,\n url: url,\n data: data\n }));\n };\n});\n\nmodule.exports = Axios;\n","'use strict';\n\nvar utils = require('./../utils');\n\nfunction InterceptorManager() {\n this.handlers = [];\n}\n\n/**\n * Add a new interceptor to the stack\n *\n * @param {Function} fulfilled The function to handle `then` for a `Promise`\n * @param {Function} rejected The function to handle `reject` for a `Promise`\n *\n * @return {Number} An ID used to remove interceptor later\n */\nInterceptorManager.prototype.use = function use(fulfilled, rejected, options) {\n this.handlers.push({\n fulfilled: fulfilled,\n rejected: rejected,\n synchronous: options ? options.synchronous : false,\n runWhen: options ? options.runWhen : null\n });\n return this.handlers.length - 1;\n};\n\n/**\n * Remove an interceptor from the stack\n *\n * @param {Number} id The ID that was returned by `use`\n */\nInterceptorManager.prototype.eject = function eject(id) {\n if (this.handlers[id]) {\n this.handlers[id] = null;\n }\n};\n\n/**\n * Iterate over all the registered interceptors\n *\n * This method is particularly useful for skipping over any\n * interceptors that may have become `null` calling `eject`.\n *\n * @param {Function} fn The function to call for each interceptor\n */\nInterceptorManager.prototype.forEach = function forEach(fn) {\n utils.forEach(this.handlers, function forEachHandler(h) {\n if (h !== null) {\n fn(h);\n }\n });\n};\n\nmodule.exports = InterceptorManager;\n","'use strict';\n\nvar utils = require('./../utils');\nvar transformData = require('./transformData');\nvar isCancel = require('../cancel/isCancel');\nvar defaults = require('../defaults');\nvar Cancel = require('../cancel/Cancel');\n\n/**\n * Throws a `Cancel` if cancellation has been requested.\n */\nfunction throwIfCancellationRequested(config) {\n if (config.cancelToken) {\n config.cancelToken.throwIfRequested();\n }\n\n if (config.signal && config.signal.aborted) {\n throw new Cancel('canceled');\n }\n}\n\n/**\n * Dispatch a request to the server using the configured adapter.\n *\n * @param {object} config The config that is to be used for the request\n * @returns {Promise} The Promise to be fulfilled\n */\nmodule.exports = function dispatchRequest(config) {\n throwIfCancellationRequested(config);\n\n // Ensure headers exist\n config.headers = config.headers || {};\n\n // Transform request data\n config.data = transformData.call(\n config,\n config.data,\n config.headers,\n config.transformRequest\n );\n\n // Flatten headers\n config.headers = utils.merge(\n config.headers.common || {},\n config.headers[config.method] || {},\n config.headers\n );\n\n utils.forEach(\n ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'],\n function cleanHeaderConfig(method) {\n delete config.headers[method];\n }\n );\n\n var adapter = config.adapter || defaults.adapter;\n\n return adapter(config).then(function onAdapterResolution(response) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n response.data = transformData.call(\n config,\n response.data,\n response.headers,\n config.transformResponse\n );\n\n return response;\n }, function onAdapterRejection(reason) {\n if (!isCancel(reason)) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n if (reason && reason.response) {\n reason.response.data = transformData.call(\n config,\n reason.response.data,\n reason.response.headers,\n config.transformResponse\n );\n }\n }\n\n return Promise.reject(reason);\n });\n};\n","'use strict';\n\nvar utils = require('./../utils');\nvar defaults = require('../defaults');\n\n/**\n * Transform the data for a request or a response\n *\n * @param {Object|String} data The data to be transformed\n * @param {Array} headers The headers for the request or response\n * @param {Array|Function} fns A single function or Array of functions\n * @returns {*} The resulting transformed data\n */\nmodule.exports = function transformData(data, headers, fns) {\n var context = this || defaults;\n /*eslint no-param-reassign:0*/\n utils.forEach(fns, function transform(fn) {\n data = fn.call(context, data, headers);\n });\n\n return data;\n};\n","'use strict';\n\nvar utils = require('../utils');\n\nmodule.exports = function normalizeHeaderName(headers, normalizedName) {\n utils.forEach(headers, function processHeader(value, name) {\n if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) {\n headers[normalizedName] = value;\n delete headers[name];\n }\n });\n};\n","'use strict';\n\nvar createError = require('./createError');\n\n/**\n * Resolve or reject a Promise based on response status.\n *\n * @param {Function} resolve A function that resolves the promise.\n * @param {Function} reject A function that rejects the promise.\n * @param {object} response The response.\n */\nmodule.exports = function settle(resolve, reject, response) {\n var validateStatus = response.config.validateStatus;\n if (!response.status || !validateStatus || validateStatus(response.status)) {\n resolve(response);\n } else {\n reject(createError(\n 'Request failed with status code ' + response.status,\n response.config,\n null,\n response.request,\n response\n ));\n }\n};\n","'use strict';\n\nvar utils = require('./../utils');\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs support document.cookie\n (function standardBrowserEnv() {\n return {\n write: function write(name, value, expires, path, domain, secure) {\n var cookie = [];\n cookie.push(name + '=' + encodeURIComponent(value));\n\n if (utils.isNumber(expires)) {\n cookie.push('expires=' + new Date(expires).toGMTString());\n }\n\n if (utils.isString(path)) {\n cookie.push('path=' + path);\n }\n\n if (utils.isString(domain)) {\n cookie.push('domain=' + domain);\n }\n\n if (secure === true) {\n cookie.push('secure');\n }\n\n document.cookie = cookie.join('; ');\n },\n\n read: function read(name) {\n var match = document.cookie.match(new RegExp('(^|;\\\\s*)(' + name + ')=([^;]*)'));\n return (match ? decodeURIComponent(match[3]) : null);\n },\n\n remove: function remove(name) {\n this.write(name, '', Date.now() - 86400000);\n }\n };\n })() :\n\n // Non standard browser env (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return {\n write: function write() {},\n read: function read() { return null; },\n remove: function remove() {}\n };\n })()\n);\n","'use strict';\n\nvar isAbsoluteURL = require('../helpers/isAbsoluteURL');\nvar combineURLs = require('../helpers/combineURLs');\n\n/**\n * Creates a new URL by combining the baseURL with the requestedURL,\n * only when the requestedURL is not already an absolute URL.\n * If the requestURL is absolute, this function returns the requestedURL untouched.\n *\n * @param {string} baseURL The base URL\n * @param {string} requestedURL Absolute or relative URL to combine\n * @returns {string} The combined full path\n */\nmodule.exports = function buildFullPath(baseURL, requestedURL) {\n if (baseURL && !isAbsoluteURL(requestedURL)) {\n return combineURLs(baseURL, requestedURL);\n }\n return requestedURL;\n};\n","'use strict';\n\n/**\n * Determines whether the specified URL is absolute\n *\n * @param {string} url The URL to test\n * @returns {boolean} True if the specified URL is absolute, otherwise false\n */\nmodule.exports = function isAbsoluteURL(url) {\n // A URL is considered absolute if it begins with \"://\" or \"//\" (protocol-relative URL).\n // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed\n // by any combination of letters, digits, plus, period, or hyphen.\n return /^([a-z][a-z\\d+\\-.]*:)?\\/\\//i.test(url);\n};\n","'use strict';\n\n/**\n * Creates a new URL by combining the specified URLs\n *\n * @param {string} baseURL The base URL\n * @param {string} relativeURL The relative URL\n * @returns {string} The combined URL\n */\nmodule.exports = function combineURLs(baseURL, relativeURL) {\n return relativeURL\n ? baseURL.replace(/\\/+$/, '') + '/' + relativeURL.replace(/^\\/+/, '')\n : baseURL;\n};\n","'use strict';\n\nvar utils = require('./../utils');\n\n// Headers whose duplicates are ignored by node\n// c.f. https://nodejs.org/api/http.html#http_message_headers\nvar ignoreDuplicateOf = [\n 'age', 'authorization', 'content-length', 'content-type', 'etag',\n 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since',\n 'last-modified', 'location', 'max-forwards', 'proxy-authorization',\n 'referer', 'retry-after', 'user-agent'\n];\n\n/**\n * Parse headers into an object\n *\n * ```\n * Date: Wed, 27 Aug 2014 08:58:49 GMT\n * Content-Type: application/json\n * Connection: keep-alive\n * Transfer-Encoding: chunked\n * ```\n *\n * @param {String} headers Headers needing to be parsed\n * @returns {Object} Headers parsed into an object\n */\nmodule.exports = function parseHeaders(headers) {\n var parsed = {};\n var key;\n var val;\n var i;\n\n if (!headers) { return parsed; }\n\n utils.forEach(headers.split('\\n'), function parser(line) {\n i = line.indexOf(':');\n key = utils.trim(line.substr(0, i)).toLowerCase();\n val = utils.trim(line.substr(i + 1));\n\n if (key) {\n if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) {\n return;\n }\n if (key === 'set-cookie') {\n parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]);\n } else {\n parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val;\n }\n }\n });\n\n return parsed;\n};\n","'use strict';\n\nvar utils = require('./../utils');\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs have full support of the APIs needed to test\n // whether the request URL is of the same origin as current location.\n (function standardBrowserEnv() {\n var msie = /(msie|trident)/i.test(navigator.userAgent);\n var urlParsingNode = document.createElement('a');\n var originURL;\n\n /**\n * Parse a URL to discover it's components\n *\n * @param {String} url The URL to be parsed\n * @returns {Object}\n */\n function resolveURL(url) {\n var href = url;\n\n if (msie) {\n // IE needs attribute set twice to normalize properties\n urlParsingNode.setAttribute('href', href);\n href = urlParsingNode.href;\n }\n\n urlParsingNode.setAttribute('href', href);\n\n // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils\n return {\n href: urlParsingNode.href,\n protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '',\n host: urlParsingNode.host,\n search: urlParsingNode.search ? urlParsingNode.search.replace(/^\\?/, '') : '',\n hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '',\n hostname: urlParsingNode.hostname,\n port: urlParsingNode.port,\n pathname: (urlParsingNode.pathname.charAt(0) === '/') ?\n urlParsingNode.pathname :\n '/' + urlParsingNode.pathname\n };\n }\n\n originURL = resolveURL(window.location.href);\n\n /**\n * Determine if a URL shares the same origin as the current location\n *\n * @param {String} requestURL The URL to test\n * @returns {boolean} True if URL shares the same origin, otherwise false\n */\n return function isURLSameOrigin(requestURL) {\n var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL;\n return (parsed.protocol === originURL.protocol &&\n parsed.host === originURL.host);\n };\n })() :\n\n // Non standard browser envs (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return function isURLSameOrigin() {\n return true;\n };\n })()\n);\n","'use strict';\n\nvar VERSION = require('../env/data').version;\n\nvar validators = {};\n\n// eslint-disable-next-line func-names\n['object', 'boolean', 'number', 'function', 'string', 'symbol'].forEach(function(type, i) {\n validators[type] = function validator(thing) {\n return typeof thing === type || 'a' + (i < 1 ? 'n ' : ' ') + type;\n };\n});\n\nvar deprecatedWarnings = {};\n\n/**\n * Transitional option validator\n * @param {function|boolean?} validator - set to false if the transitional option has been removed\n * @param {string?} version - deprecated version / removed since version\n * @param {string?} message - some message with additional info\n * @returns {function}\n */\nvalidators.transitional = function transitional(validator, version, message) {\n function formatMessage(opt, desc) {\n return '[Axios v' + VERSION + '] Transitional option \\'' + opt + '\\'' + desc + (message ? '. ' + message : '');\n }\n\n // eslint-disable-next-line func-names\n return function(value, opt, opts) {\n if (validator === false) {\n throw new Error(formatMessage(opt, ' has been removed' + (version ? ' in ' + version : '')));\n }\n\n if (version && !deprecatedWarnings[opt]) {\n deprecatedWarnings[opt] = true;\n // eslint-disable-next-line no-console\n console.warn(\n formatMessage(\n opt,\n ' has been deprecated since v' + version + ' and will be removed in the near future'\n )\n );\n }\n\n return validator ? validator(value, opt, opts) : true;\n };\n};\n\n/**\n * Assert object's properties type\n * @param {object} options\n * @param {object} schema\n * @param {boolean?} allowUnknown\n */\n\nfunction assertOptions(options, schema, allowUnknown) {\n if (typeof options !== 'object') {\n throw new TypeError('options must be an object');\n }\n var keys = Object.keys(options);\n var i = keys.length;\n while (i-- > 0) {\n var opt = keys[i];\n var validator = schema[opt];\n if (validator) {\n var value = options[opt];\n var result = value === undefined || validator(value, opt, options);\n if (result !== true) {\n throw new TypeError('option ' + opt + ' must be ' + result);\n }\n continue;\n }\n if (allowUnknown !== true) {\n throw Error('Unknown option ' + opt);\n }\n }\n}\n\nmodule.exports = {\n assertOptions: assertOptions,\n validators: validators\n};\n","'use strict';\n\nvar Cancel = require('./Cancel');\n\n/**\n * A `CancelToken` is an object that can be used to request cancellation of an operation.\n *\n * @class\n * @param {Function} executor The executor function.\n */\nfunction CancelToken(executor) {\n if (typeof executor !== 'function') {\n throw new TypeError('executor must be a function.');\n }\n\n var resolvePromise;\n\n this.promise = new Promise(function promiseExecutor(resolve) {\n resolvePromise = resolve;\n });\n\n var token = this;\n\n // eslint-disable-next-line func-names\n this.promise.then(function(cancel) {\n if (!token._listeners) return;\n\n var i;\n var l = token._listeners.length;\n\n for (i = 0; i < l; i++) {\n token._listeners[i](cancel);\n }\n token._listeners = null;\n });\n\n // eslint-disable-next-line func-names\n this.promise.then = function(onfulfilled) {\n var _resolve;\n // eslint-disable-next-line func-names\n var promise = new Promise(function(resolve) {\n token.subscribe(resolve);\n _resolve = resolve;\n }).then(onfulfilled);\n\n promise.cancel = function reject() {\n token.unsubscribe(_resolve);\n };\n\n return promise;\n };\n\n executor(function cancel(message) {\n if (token.reason) {\n // Cancellation has already been requested\n return;\n }\n\n token.reason = new Cancel(message);\n resolvePromise(token.reason);\n });\n}\n\n/**\n * Throws a `Cancel` if cancellation has been requested.\n */\nCancelToken.prototype.throwIfRequested = function throwIfRequested() {\n if (this.reason) {\n throw this.reason;\n }\n};\n\n/**\n * Subscribe to the cancel signal\n */\n\nCancelToken.prototype.subscribe = function subscribe(listener) {\n if (this.reason) {\n listener(this.reason);\n return;\n }\n\n if (this._listeners) {\n this._listeners.push(listener);\n } else {\n this._listeners = [listener];\n }\n};\n\n/**\n * Unsubscribe from the cancel signal\n */\n\nCancelToken.prototype.unsubscribe = function unsubscribe(listener) {\n if (!this._listeners) {\n return;\n }\n var index = this._listeners.indexOf(listener);\n if (index !== -1) {\n this._listeners.splice(index, 1);\n }\n};\n\n/**\n * Returns an object that contains a new `CancelToken` and a function that, when called,\n * cancels the `CancelToken`.\n */\nCancelToken.source = function source() {\n var cancel;\n var token = new CancelToken(function executor(c) {\n cancel = c;\n });\n return {\n token: token,\n cancel: cancel\n };\n};\n\nmodule.exports = CancelToken;\n","'use strict';\n\n/**\n * Syntactic sugar for invoking a function and expanding an array for arguments.\n *\n * Common use case would be to use `Function.prototype.apply`.\n *\n * ```js\n * function f(x, y, z) {}\n * var args = [1, 2, 3];\n * f.apply(null, args);\n * ```\n *\n * With `spread` this example can be re-written.\n *\n * ```js\n * spread(function(x, y, z) {})([1, 2, 3]);\n * ```\n *\n * @param {Function} callback\n * @returns {Function}\n */\nmodule.exports = function spread(callback) {\n return function wrap(arr) {\n return callback.apply(null, arr);\n };\n};\n","'use strict';\n\nvar utils = require('./../utils');\n\n/**\n * Determines whether the payload is an error thrown by Axios\n *\n * @param {*} payload The value to test\n * @returns {boolean} True if the payload is an error thrown by Axios, otherwise false\n */\nmodule.exports = function isAxiosError(payload) {\n return utils.isObject(payload) && (payload.isAxiosError === true);\n};\n"],"sourceRoot":""} \ No newline at end of file diff --git a/node_modules/axios/index.d.ts b/node_modules/axios/index.d.ts index fc1fd18..b681915 100644 --- a/node_modules/axios/index.d.ts +++ b/node_modules/axios/index.d.ts @@ -1,9 +1,21 @@ -export interface AxiosTransformer { - (data: any, headers?: any): any; +// TypeScript Version: 3.0 + +export type AxiosRequestHeaders = Record; + +export type AxiosResponseHeaders = Record & { + "set-cookie"?: string[] +}; + +export interface AxiosRequestTransformer { + (data: any, headers?: AxiosRequestHeaders): any; +} + +export interface AxiosResponseTransformer { + (data: any, headers?: AxiosResponseHeaders): any; } export interface AxiosAdapter { - (config: AxiosRequestConfig): AxiosPromise; + (config: AxiosRequestConfig): AxiosPromise; } export interface AxiosBasicCredentials { @@ -16,7 +28,7 @@ export interface AxiosProxyConfig { port: number; auth?: { username: string; - password:string; + password: string; }; protocol?: string; } @@ -29,61 +41,106 @@ export type Method = | 'post' | 'POST' | 'put' | 'PUT' | 'patch' | 'PATCH' + | 'purge' | 'PURGE' | 'link' | 'LINK' - | 'unlink' | 'UNLINK' + | 'unlink' | 'UNLINK'; -export type ResponseType = - | 'arraybuffer' - | 'blob' - | 'document' - | 'json' - | 'text' - | 'stream' +export type ResponseType = + | 'arraybuffer' + | 'blob' + | 'document' + | 'json' + | 'text' + | 'stream'; -export interface AxiosRequestConfig { + export type responseEncoding = + | 'ascii' | 'ASCII' + | 'ansi' | 'ANSI' + | 'binary' | 'BINARY' + | 'base64' | 'BASE64' + | 'base64url' | 'BASE64URL' + | 'hex' | 'HEX' + | 'latin1' | 'LATIN1' + | 'ucs-2' | 'UCS-2' + | 'ucs2' | 'UCS2' + | 'utf-8' | 'UTF-8' + | 'utf8' | 'UTF8' + | 'utf16le' | 'UTF16LE'; + +export interface TransitionalOptions { + silentJSONParsing?: boolean; + forcedJSONParsing?: boolean; + clarifyTimeoutError?: boolean; +} + +export interface AxiosRequestConfig { url?: string; method?: Method; baseURL?: string; - transformRequest?: AxiosTransformer | AxiosTransformer[]; - transformResponse?: AxiosTransformer | AxiosTransformer[]; - headers?: any; + transformRequest?: AxiosRequestTransformer | AxiosRequestTransformer[]; + transformResponse?: AxiosResponseTransformer | AxiosResponseTransformer[]; + headers?: AxiosRequestHeaders; params?: any; paramsSerializer?: (params: any) => string; - data?: any; + data?: D; timeout?: number; timeoutErrorMessage?: string; withCredentials?: boolean; adapter?: AxiosAdapter; auth?: AxiosBasicCredentials; responseType?: ResponseType; + responseEncoding?: responseEncoding | string; xsrfCookieName?: string; xsrfHeaderName?: string; onUploadProgress?: (progressEvent: any) => void; onDownloadProgress?: (progressEvent: any) => void; maxContentLength?: number; - validateStatus?: (status: number) => boolean; + validateStatus?: ((status: number) => boolean) | null; + maxBodyLength?: number; maxRedirects?: number; socketPath?: string | null; httpAgent?: any; httpsAgent?: any; proxy?: AxiosProxyConfig | false; cancelToken?: CancelToken; + decompress?: boolean; + transitional?: TransitionalOptions; + signal?: AbortSignal; + insecureHTTPParser?: boolean; } -export interface AxiosResponse { +export interface HeadersDefaults { + common: AxiosRequestHeaders; + delete: AxiosRequestHeaders; + get: AxiosRequestHeaders; + head: AxiosRequestHeaders; + post: AxiosRequestHeaders; + put: AxiosRequestHeaders; + patch: AxiosRequestHeaders; + options?: AxiosRequestHeaders; + purge?: AxiosRequestHeaders; + link?: AxiosRequestHeaders; + unlink?: AxiosRequestHeaders; +} + +export interface AxiosDefaults extends Omit, 'headers'> { + headers: HeadersDefaults; +} + +export interface AxiosResponse { data: T; status: number; statusText: string; - headers: any; - config: AxiosRequestConfig; + headers: AxiosResponseHeaders; + config: AxiosRequestConfig; request?: any; } -export interface AxiosError extends Error { - config: AxiosRequestConfig; +export interface AxiosError extends Error { + config: AxiosRequestConfig; code?: string; request?: any; - response?: AxiosResponse; + response?: AxiosResponse; isAxiosError: boolean; toJSON: () => object; } @@ -96,7 +153,7 @@ export interface CancelStatic { } export interface Cancel { - message: string; + message: string | undefined; } export interface Canceler { @@ -120,38 +177,45 @@ export interface CancelTokenSource { } export interface AxiosInterceptorManager { - use(onFulfilled?: (value: V) => V | Promise, onRejected?: (error: any) => any): number; + use(onFulfilled?: (value: V) => T | Promise, onRejected?: (error: any) => any): number; eject(id: number): void; } -export interface AxiosInstance { - (config: AxiosRequestConfig): AxiosPromise; - (url: string, config?: AxiosRequestConfig): AxiosPromise; - defaults: AxiosRequestConfig; +export class Axios { + constructor(config?: AxiosRequestConfig); + defaults: AxiosDefaults; interceptors: { request: AxiosInterceptorManager; response: AxiosInterceptorManager; }; getUri(config?: AxiosRequestConfig): string; - request> (config: AxiosRequestConfig): Promise; - get>(url: string, config?: AxiosRequestConfig): Promise; - delete>(url: string, config?: AxiosRequestConfig): Promise; - head>(url: string, config?: AxiosRequestConfig): Promise; - options>(url: string, config?: AxiosRequestConfig): Promise; - post>(url: string, data?: any, config?: AxiosRequestConfig): Promise; - put>(url: string, data?: any, config?: AxiosRequestConfig): Promise; - patch>(url: string, data?: any, config?: AxiosRequestConfig): Promise; + request, D = any>(config: AxiosRequestConfig): Promise; + get, D = any>(url: string, config?: AxiosRequestConfig): Promise; + delete, D = any>(url: string, config?: AxiosRequestConfig): Promise; + head, D = any>(url: string, config?: AxiosRequestConfig): Promise; + options, D = any>(url: string, config?: AxiosRequestConfig): Promise; + post, D = any>(url: string, data?: D, config?: AxiosRequestConfig): Promise; + put, D = any>(url: string, data?: D, config?: AxiosRequestConfig): Promise; + patch, D = any>(url: string, data?: D, config?: AxiosRequestConfig): Promise; +} + +export interface AxiosInstance extends Axios { + (config: AxiosRequestConfig): AxiosPromise; + (url: string, config?: AxiosRequestConfig): AxiosPromise; } export interface AxiosStatic extends AxiosInstance { create(config?: AxiosRequestConfig): AxiosInstance; Cancel: CancelStatic; CancelToken: CancelTokenStatic; + Axios: typeof Axios; + readonly VERSION: string; isCancel(value: any): boolean; - all(values: (T | Promise)[]): Promise; + all(values: Array>): Promise; spread(callback: (...args: T[]) => R): (array: T[]) => R; + isAxiosError(payload: any): payload is AxiosError; } -declare const Axios: AxiosStatic; +declare const axios: AxiosStatic; -export default Axios; +export default axios; diff --git a/node_modules/axios/lib/adapters/http.js b/node_modules/axios/lib/adapters/http.js index 16dad12..28317c1 100755 --- a/node_modules/axios/lib/adapters/http.js +++ b/node_modules/axios/lib/adapters/http.js @@ -10,29 +10,81 @@ var httpFollow = require('follow-redirects').http; var httpsFollow = require('follow-redirects').https; var url = require('url'); var zlib = require('zlib'); -var pkg = require('./../../package.json'); +var VERSION = require('./../env/data').version; var createError = require('../core/createError'); var enhanceError = require('../core/enhanceError'); +var transitionalDefaults = require('../defaults/transitional'); +var Cancel = require('../cancel/Cancel'); var isHttps = /https:?/; +/** + * + * @param {http.ClientRequestArgs} options + * @param {AxiosProxyConfig} proxy + * @param {string} location + */ +function setProxy(options, proxy, location) { + options.hostname = proxy.host; + options.host = proxy.host; + options.port = proxy.port; + options.path = location; + + // Basic proxy authorization + if (proxy.auth) { + var base64 = Buffer.from(proxy.auth.username + ':' + proxy.auth.password, 'utf8').toString('base64'); + options.headers['Proxy-Authorization'] = 'Basic ' + base64; + } + + // If a proxy is used, any redirects must also pass through the proxy + options.beforeRedirect = function beforeRedirect(redirection) { + redirection.headers.host = redirection.host; + setProxy(redirection, proxy, redirection.href); + }; +} + /*eslint consistent-return:0*/ module.exports = function httpAdapter(config) { return new Promise(function dispatchHttpRequest(resolvePromise, rejectPromise) { + var onCanceled; + function done() { + if (config.cancelToken) { + config.cancelToken.unsubscribe(onCanceled); + } + + if (config.signal) { + config.signal.removeEventListener('abort', onCanceled); + } + } var resolve = function resolve(value) { + done(); resolvePromise(value); }; + var rejected = false; var reject = function reject(value) { + done(); + rejected = true; rejectPromise(value); }; var data = config.data; var headers = config.headers; + var headerNames = {}; + + Object.keys(headers).forEach(function storeLowerName(name) { + headerNames[name.toLowerCase()] = name; + }); // Set User-Agent (required by some servers) - // Only set header if it hasn't been set in config // See https://github.com/axios/axios/issues/69 - if (!headers['User-Agent'] && !headers['user-agent']) { - headers['User-Agent'] = 'axios/' + pkg.version; + if ('user-agent' in headerNames) { + // User-Agent is specified; handle case where no UA header is desired + if (!headers[headerNames['user-agent']]) { + delete headers[headerNames['user-agent']]; + } + // Otherwise, use specified value + } else { + // Only set header if it hasn't been set in config + headers['User-Agent'] = 'axios/' + VERSION; } if (data && !utils.isStream(data)) { @@ -49,8 +101,14 @@ module.exports = function httpAdapter(config) { )); } + if (config.maxBodyLength > -1 && data.length > config.maxBodyLength) { + return reject(createError('Request body larger than maxBodyLength limit', config)); + } + // Add Content-Length header if data exists - headers['Content-Length'] = data.length; + if (!headerNames['content-length']) { + headers['Content-Length'] = data.length; + } } // HTTP basic authentication @@ -73,13 +131,23 @@ module.exports = function httpAdapter(config) { auth = urlUsername + ':' + urlPassword; } - if (auth) { - delete headers.Authorization; + if (auth && headerNames.authorization) { + delete headers[headerNames.authorization]; } var isHttpsRequest = isHttps.test(protocol); var agent = isHttpsRequest ? config.httpsAgent : config.httpAgent; + try { + buildURL(parsed.path, config.params, config.paramsSerializer).replace(/^\?/, ''); + } catch (err) { + var customErr = new Error(err.message); + customErr.config = config; + customErr.url = config.url; + customErr.exists = true; + reject(customErr); + } + var options = { path: buildURL(parsed.path, config.params, config.paramsSerializer).replace(/^\?/, ''), method: config.method.toUpperCase(), @@ -126,11 +194,11 @@ module.exports = function httpAdapter(config) { }); } - if (shouldProxy) { proxy = { host: parsedProxyUrl.hostname, - port: parsedProxyUrl.port + port: parsedProxyUrl.port, + protocol: parsedProxyUrl.protocol }; if (parsedProxyUrl.auth) { @@ -145,17 +213,8 @@ module.exports = function httpAdapter(config) { } if (proxy) { - options.hostname = proxy.host; - options.host = proxy.host; options.headers.host = parsed.hostname + (parsed.port ? ':' + parsed.port : ''); - options.port = proxy.port; - options.path = protocol + '//' + parsed.hostname + (parsed.port ? ':' + parsed.port : '') + options.path; - - // Basic proxy authorization - if (proxy.auth) { - var base64 = Buffer.from(proxy.auth.username + ':' + proxy.auth.password, 'utf8').toString('base64'); - options.headers['Proxy-Authorization'] = 'Basic ' + base64; - } + setProxy(options, proxy, protocol + '//' + parsed.hostname + (parsed.port ? ':' + parsed.port : '') + options.path); } var transport; @@ -171,8 +230,12 @@ module.exports = function httpAdapter(config) { transport = isHttpsProxy ? httpsFollow : httpFollow; } - if (config.maxContentLength && config.maxContentLength > -1) { - options.maxBodyLength = config.maxContentLength; + if (config.maxBodyLength > -1) { + options.maxBodyLength = config.maxBodyLength; + } + + if (config.insecureHTTPParser) { + options.insecureHTTPParser = config.insecureHTTPParser; } // Create the request @@ -181,22 +244,27 @@ module.exports = function httpAdapter(config) { // uncompress the response body transparently if required var stream = res; - switch (res.headers['content-encoding']) { - /*eslint default-case:0*/ - case 'gzip': - case 'compress': - case 'deflate': - // add the unzipper to the body stream processing pipeline - stream = (res.statusCode === 204) ? stream : stream.pipe(zlib.createUnzip()); - - // remove the content-encoding in order to not confuse downstream operations - delete res.headers['content-encoding']; - break; - } // return the last request in case of redirects var lastRequest = res.req || req; + + // if no content, is HEAD request or decompress disabled we should not decompress + if (res.statusCode !== 204 && lastRequest.method !== 'HEAD' && config.decompress !== false) { + switch (res.headers['content-encoding']) { + /*eslint default-case:0*/ + case 'gzip': + case 'compress': + case 'deflate': + // add the unzipper to the body stream processing pipeline + stream = stream.pipe(zlib.createUnzip()); + + // remove the content-encoding in order to not confuse downstream operations + delete res.headers['content-encoding']; + break; + } + } + var response = { status: res.statusCode, statusText: res.statusMessage, @@ -210,29 +278,47 @@ module.exports = function httpAdapter(config) { settle(resolve, reject, response); } else { var responseBuffer = []; + var totalResponseBytes = 0; stream.on('data', function handleStreamData(chunk) { responseBuffer.push(chunk); + totalResponseBytes += chunk.length; // make sure the content length is not over the maxContentLength if specified - if (config.maxContentLength > -1 && Buffer.concat(responseBuffer).length > config.maxContentLength) { + if (config.maxContentLength > -1 && totalResponseBytes > config.maxContentLength) { + // stream.destoy() emit aborted event before calling reject() on Node.js v16 + rejected = true; stream.destroy(); reject(createError('maxContentLength size of ' + config.maxContentLength + ' exceeded', config, null, lastRequest)); } }); + stream.on('aborted', function handlerStreamAborted() { + if (rejected) { + return; + } + stream.destroy(); + reject(createError('error request aborted', config, 'ERR_REQUEST_ABORTED', lastRequest)); + }); + stream.on('error', function handleStreamError(err) { if (req.aborted) return; reject(enhanceError(err, config, null, lastRequest)); }); stream.on('end', function handleStreamEnd() { - var responseData = Buffer.concat(responseBuffer); - if (config.responseType !== 'arraybuffer') { - responseData = responseData.toString(config.responseEncoding); + try { + var responseData = responseBuffer.length === 1 ? responseBuffer[0] : Buffer.concat(responseBuffer); + if (config.responseType !== 'arraybuffer') { + responseData = responseData.toString(config.responseEncoding); + if (!config.responseEncoding || config.responseEncoding === 'utf8') { + responseData = utils.stripBOM(responseData); + } + } + response.data = responseData; + } catch (err) { + reject(enhanceError(err, config, err.code, response.request, response)); } - - response.data = responseData; settle(resolve, reject, response); }); } @@ -240,33 +326,72 @@ module.exports = function httpAdapter(config) { // Handle errors req.on('error', function handleRequestError(err) { - if (req.aborted) return; + if (req.aborted && err.code !== 'ERR_FR_TOO_MANY_REDIRECTS') return; reject(enhanceError(err, config, null, req)); }); + // set tcp keep alive to prevent drop connection by peer + req.on('socket', function handleRequestSocket(socket) { + // default interval of sending ack packet is 1 minute + socket.setKeepAlive(true, 1000 * 60); + }); + // Handle request timeout if (config.timeout) { + // This is forcing a int timeout to avoid problems if the `req` interface doesn't handle other types. + var timeout = parseInt(config.timeout, 10); + + if (isNaN(timeout)) { + reject(createError( + 'error trying to parse `config.timeout` to int', + config, + 'ERR_PARSE_TIMEOUT', + req + )); + + return; + } + // Sometime, the response will be very slow, and does not respond, the connect event will be block by event loop system. // And timer callback will be fired, and abort() will be invoked before connection, then get "socket hang up" and code ECONNRESET. // At this time, if we have a large number of request, nodejs will hang up some socket on background. and the number will up and up. // And then these socket which be hang up will devoring CPU little by little. // ClientRequest.setTimeout will be fired on the specify milliseconds, and can make sure that abort() will be fired after connect. - req.setTimeout(config.timeout, function handleRequestTimeout() { + req.setTimeout(timeout, function handleRequestTimeout() { req.abort(); - reject(createError('timeout of ' + config.timeout + 'ms exceeded', config, 'ECONNABORTED', req)); + var timeoutErrorMessage = ''; + if (config.timeoutErrorMessage) { + timeoutErrorMessage = config.timeoutErrorMessage; + } else { + timeoutErrorMessage = 'timeout of ' + config.timeout + 'ms exceeded'; + } + var transitional = config.transitional || transitionalDefaults; + reject(createError( + timeoutErrorMessage, + config, + transitional.clarifyTimeoutError ? 'ETIMEDOUT' : 'ECONNABORTED', + req + )); }); } - if (config.cancelToken) { + if (config.cancelToken || config.signal) { // Handle cancellation - config.cancelToken.promise.then(function onCanceled(cancel) { + // eslint-disable-next-line func-names + onCanceled = function(cancel) { if (req.aborted) return; req.abort(); - reject(cancel); - }); + reject(!cancel || (cancel && cancel.type) ? new Cancel('canceled') : cancel); + }; + + config.cancelToken && config.cancelToken.subscribe(onCanceled); + if (config.signal) { + config.signal.aborted ? onCanceled() : config.signal.addEventListener('abort', onCanceled); + } } + // Send the request if (utils.isStream(data)) { data.on('error', function handleStreamError(err) { diff --git a/node_modules/axios/lib/adapters/xhr.js b/node_modules/axios/lib/adapters/xhr.js index 377e3e9..e58625a 100644 --- a/node_modules/axios/lib/adapters/xhr.js +++ b/node_modules/axios/lib/adapters/xhr.js @@ -2,16 +2,30 @@ var utils = require('./../utils'); var settle = require('./../core/settle'); +var cookies = require('./../helpers/cookies'); var buildURL = require('./../helpers/buildURL'); var buildFullPath = require('../core/buildFullPath'); var parseHeaders = require('./../helpers/parseHeaders'); var isURLSameOrigin = require('./../helpers/isURLSameOrigin'); var createError = require('../core/createError'); +var transitionalDefaults = require('../defaults/transitional'); +var Cancel = require('../cancel/Cancel'); module.exports = function xhrAdapter(config) { return new Promise(function dispatchXhrRequest(resolve, reject) { var requestData = config.data; var requestHeaders = config.headers; + var responseType = config.responseType; + var onCanceled; + function done() { + if (config.cancelToken) { + config.cancelToken.unsubscribe(onCanceled); + } + + if (config.signal) { + config.signal.removeEventListener('abort', onCanceled); + } + } if (utils.isFormData(requestData)) { delete requestHeaders['Content-Type']; // Let the browser set it @@ -22,7 +36,7 @@ module.exports = function xhrAdapter(config) { // HTTP basic authentication if (config.auth) { var username = config.auth.username || ''; - var password = config.auth.password || ''; + var password = config.auth.password ? unescape(encodeURIComponent(config.auth.password)) : ''; requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password); } @@ -32,23 +46,14 @@ module.exports = function xhrAdapter(config) { // Set the request timeout in MS request.timeout = config.timeout; - // Listen for ready state - request.onreadystatechange = function handleLoad() { - if (!request || request.readyState !== 4) { + function onloadend() { + if (!request) { return; } - - // The request errored out and we didn't get a response, this will be - // handled by onerror instead - // With one exception: request that using file: protocol, most browsers - // will return status as 0 even though it's a successful request - if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) { - return; - } - // Prepare the response var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null; - var responseData = !config.responseType || config.responseType === 'text' ? request.responseText : request.response; + var responseData = !responseType || responseType === 'text' || responseType === 'json' ? + request.responseText : request.response; var response = { data: responseData, status: request.status, @@ -58,11 +63,40 @@ module.exports = function xhrAdapter(config) { request: request }; - settle(resolve, reject, response); + settle(function _resolve(value) { + resolve(value); + done(); + }, function _reject(err) { + reject(err); + done(); + }, response); // Clean up request request = null; - }; + } + + if ('onloadend' in request) { + // Use onloadend if available + request.onloadend = onloadend; + } else { + // Listen for ready state to emulate onloadend + request.onreadystatechange = function handleLoad() { + if (!request || request.readyState !== 4) { + return; + } + + // The request errored out and we didn't get a response, this will be + // handled by onerror instead + // With one exception: request that using file: protocol, most browsers + // will return status as 0 even though it's a successful request + if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) { + return; + } + // readystate handler is calling before onerror or ontimeout handlers, + // so we should call onloadend on the next 'tick' + setTimeout(onloadend); + }; + } // Handle browser request cancellation (as opposed to a manual cancellation) request.onabort = function handleAbort() { @@ -88,11 +122,15 @@ module.exports = function xhrAdapter(config) { // Handle timeout request.ontimeout = function handleTimeout() { - var timeoutErrorMessage = 'timeout of ' + config.timeout + 'ms exceeded'; + var timeoutErrorMessage = config.timeout ? 'timeout of ' + config.timeout + 'ms exceeded' : 'timeout exceeded'; + var transitional = config.transitional || transitionalDefaults; if (config.timeoutErrorMessage) { timeoutErrorMessage = config.timeoutErrorMessage; } - reject(createError(timeoutErrorMessage, config, 'ECONNABORTED', + reject(createError( + timeoutErrorMessage, + config, + transitional.clarifyTimeoutError ? 'ETIMEDOUT' : 'ECONNABORTED', request)); // Clean up request @@ -103,8 +141,6 @@ module.exports = function xhrAdapter(config) { // This is only done if running in a standard browser environment. // Specifically not if we're in a web worker, or react-native. if (utils.isStandardBrowserEnv()) { - var cookies = require('./../helpers/cookies'); - // Add xsrf header var xsrfValue = (config.withCredentials || isURLSameOrigin(fullPath)) && config.xsrfCookieName ? cookies.read(config.xsrfCookieName) : @@ -134,16 +170,8 @@ module.exports = function xhrAdapter(config) { } // Add responseType to request if needed - if (config.responseType) { - try { - request.responseType = config.responseType; - } catch (e) { - // Expected DOMException thrown by browsers not compatible XMLHttpRequest Level 2. - // But, this can be suppressed for 'json' type as it can be parsed by default 'transformResponse' function. - if (config.responseType !== 'json') { - throw e; - } - } + if (responseType && responseType !== 'json') { + request.responseType = config.responseType; } // Handle progress if needed @@ -156,21 +184,25 @@ module.exports = function xhrAdapter(config) { request.upload.addEventListener('progress', config.onUploadProgress); } - if (config.cancelToken) { + if (config.cancelToken || config.signal) { // Handle cancellation - config.cancelToken.promise.then(function onCanceled(cancel) { + // eslint-disable-next-line func-names + onCanceled = function(cancel) { if (!request) { return; } - + reject(!cancel || (cancel && cancel.type) ? new Cancel('canceled') : cancel); request.abort(); - reject(cancel); - // Clean up request request = null; - }); + }; + + config.cancelToken && config.cancelToken.subscribe(onCanceled); + if (config.signal) { + config.signal.aborted ? onCanceled() : config.signal.addEventListener('abort', onCanceled); + } } - if (requestData === undefined) { + if (!requestData) { requestData = null; } diff --git a/node_modules/axios/lib/axios.js b/node_modules/axios/lib/axios.js index 8142437..c032327 100644 --- a/node_modules/axios/lib/axios.js +++ b/node_modules/axios/lib/axios.js @@ -22,6 +22,11 @@ function createInstance(defaultConfig) { // Copy context to instance utils.extend(instance, context); + // Factory for creating new instances + instance.create = function create(instanceConfig) { + return createInstance(mergeConfig(defaultConfig, instanceConfig)); + }; + return instance; } @@ -31,15 +36,11 @@ var axios = createInstance(defaults); // Expose Axios class to allow class inheritance axios.Axios = Axios; -// Factory for creating new instances -axios.create = function create(instanceConfig) { - return createInstance(mergeConfig(axios.defaults, instanceConfig)); -}; - // Expose Cancel & CancelToken axios.Cancel = require('./cancel/Cancel'); axios.CancelToken = require('./cancel/CancelToken'); axios.isCancel = require('./cancel/isCancel'); +axios.VERSION = require('./env/data').version; // Expose all/spread axios.all = function all(promises) { @@ -47,6 +48,9 @@ axios.all = function all(promises) { }; axios.spread = require('./helpers/spread'); +// Expose isAxiosError +axios.isAxiosError = require('./helpers/isAxiosError'); + module.exports = axios; // Allow use of default import syntax in TypeScript diff --git a/node_modules/axios/lib/cancel/CancelToken.js b/node_modules/axios/lib/cancel/CancelToken.js index 6b46e66..089d6b9 100644 --- a/node_modules/axios/lib/cancel/CancelToken.js +++ b/node_modules/axios/lib/cancel/CancelToken.js @@ -14,11 +14,42 @@ function CancelToken(executor) { } var resolvePromise; + this.promise = new Promise(function promiseExecutor(resolve) { resolvePromise = resolve; }); var token = this; + + // eslint-disable-next-line func-names + this.promise.then(function(cancel) { + if (!token._listeners) return; + + var i; + var l = token._listeners.length; + + for (i = 0; i < l; i++) { + token._listeners[i](cancel); + } + token._listeners = null; + }); + + // eslint-disable-next-line func-names + this.promise.then = function(onfulfilled) { + var _resolve; + // eslint-disable-next-line func-names + var promise = new Promise(function(resolve) { + token.subscribe(resolve); + _resolve = resolve; + }).then(onfulfilled); + + promise.cancel = function reject() { + token.unsubscribe(_resolve); + }; + + return promise; + }; + executor(function cancel(message) { if (token.reason) { // Cancellation has already been requested @@ -39,6 +70,37 @@ CancelToken.prototype.throwIfRequested = function throwIfRequested() { } }; +/** + * Subscribe to the cancel signal + */ + +CancelToken.prototype.subscribe = function subscribe(listener) { + if (this.reason) { + listener(this.reason); + return; + } + + if (this._listeners) { + this._listeners.push(listener); + } else { + this._listeners = [listener]; + } +}; + +/** + * Unsubscribe from the cancel signal + */ + +CancelToken.prototype.unsubscribe = function unsubscribe(listener) { + if (!this._listeners) { + return; + } + var index = this._listeners.indexOf(listener); + if (index !== -1) { + this._listeners.splice(index, 1); + } +}; + /** * Returns an object that contains a new `CancelToken` and a function that, when called, * cancels the `CancelToken`. diff --git a/node_modules/axios/lib/core/Axios.js b/node_modules/axios/lib/core/Axios.js index fb34ace..a1be08a 100644 --- a/node_modules/axios/lib/core/Axios.js +++ b/node_modules/axios/lib/core/Axios.js @@ -5,7 +5,9 @@ var buildURL = require('../helpers/buildURL'); var InterceptorManager = require('./InterceptorManager'); var dispatchRequest = require('./dispatchRequest'); var mergeConfig = require('./mergeConfig'); +var validator = require('../helpers/validator'); +var validators = validator.validators; /** * Create a new instance of Axios * @@ -24,14 +26,14 @@ function Axios(instanceConfig) { * * @param {Object} config The config specific for this request (merged with this.defaults) */ -Axios.prototype.request = function request(config) { +Axios.prototype.request = function request(configOrUrl, config) { /*eslint no-param-reassign:0*/ // Allow for axios('example/url'[, config]) a la fetch API - if (typeof config === 'string') { - config = arguments[1] || {}; - config.url = arguments[0]; - } else { + if (typeof configOrUrl === 'string') { config = config || {}; + config.url = configOrUrl; + } else { + config = configOrUrl || {}; } config = mergeConfig(this.defaults, config); @@ -45,20 +47,71 @@ Axios.prototype.request = function request(config) { config.method = 'get'; } - // Hook up interceptors middleware - var chain = [dispatchRequest, undefined]; - var promise = Promise.resolve(config); + var transitional = config.transitional; + if (transitional !== undefined) { + validator.assertOptions(transitional, { + silentJSONParsing: validators.transitional(validators.boolean), + forcedJSONParsing: validators.transitional(validators.boolean), + clarifyTimeoutError: validators.transitional(validators.boolean) + }, false); + } + + // filter out skipped interceptors + var requestInterceptorChain = []; + var synchronousRequestInterceptors = true; this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) { - chain.unshift(interceptor.fulfilled, interceptor.rejected); + if (typeof interceptor.runWhen === 'function' && interceptor.runWhen(config) === false) { + return; + } + + synchronousRequestInterceptors = synchronousRequestInterceptors && interceptor.synchronous; + + requestInterceptorChain.unshift(interceptor.fulfilled, interceptor.rejected); }); + var responseInterceptorChain = []; this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) { - chain.push(interceptor.fulfilled, interceptor.rejected); + responseInterceptorChain.push(interceptor.fulfilled, interceptor.rejected); }); - while (chain.length) { - promise = promise.then(chain.shift(), chain.shift()); + var promise; + + if (!synchronousRequestInterceptors) { + var chain = [dispatchRequest, undefined]; + + Array.prototype.unshift.apply(chain, requestInterceptorChain); + chain = chain.concat(responseInterceptorChain); + + promise = Promise.resolve(config); + while (chain.length) { + promise = promise.then(chain.shift(), chain.shift()); + } + + return promise; + } + + + var newConfig = config; + while (requestInterceptorChain.length) { + var onFulfilled = requestInterceptorChain.shift(); + var onRejected = requestInterceptorChain.shift(); + try { + newConfig = onFulfilled(newConfig); + } catch (error) { + onRejected(error); + break; + } + } + + try { + promise = dispatchRequest(newConfig); + } catch (error) { + return Promise.reject(error); + } + + while (responseInterceptorChain.length) { + promise = promise.then(responseInterceptorChain.shift(), responseInterceptorChain.shift()); } return promise; @@ -73,9 +126,10 @@ Axios.prototype.getUri = function getUri(config) { utils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) { /*eslint func-names:0*/ Axios.prototype[method] = function(url, config) { - return this.request(utils.merge(config || {}, { + return this.request(mergeConfig(config || {}, { method: method, - url: url + url: url, + data: (config || {}).data })); }; }); @@ -83,7 +137,7 @@ utils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) { /*eslint func-names:0*/ Axios.prototype[method] = function(url, data, config) { - return this.request(utils.merge(config || {}, { + return this.request(mergeConfig(config || {}, { method: method, url: url, data: data diff --git a/node_modules/axios/lib/core/InterceptorManager.js b/node_modules/axios/lib/core/InterceptorManager.js index 50d667b..900f448 100644 --- a/node_modules/axios/lib/core/InterceptorManager.js +++ b/node_modules/axios/lib/core/InterceptorManager.js @@ -14,10 +14,12 @@ function InterceptorManager() { * * @return {Number} An ID used to remove interceptor later */ -InterceptorManager.prototype.use = function use(fulfilled, rejected) { +InterceptorManager.prototype.use = function use(fulfilled, rejected, options) { this.handlers.push({ fulfilled: fulfilled, - rejected: rejected + rejected: rejected, + synchronous: options ? options.synchronous : false, + runWhen: options ? options.runWhen : null }); return this.handlers.length - 1; }; diff --git a/node_modules/axios/lib/core/README.md b/node_modules/axios/lib/core/README.md index 253bc48..84559ce 100644 --- a/node_modules/axios/lib/core/README.md +++ b/node_modules/axios/lib/core/README.md @@ -3,5 +3,6 @@ The modules found in `core/` should be modules that are specific to the domain logic of axios. These modules would most likely not make sense to be consumed outside of the axios module, as their logic is too specific. Some examples of core modules are: - Dispatching requests + - Requests sent via `adapters/` (see lib/adapters/README.md) - Managing interceptors - Handling config diff --git a/node_modules/axios/lib/core/dispatchRequest.js b/node_modules/axios/lib/core/dispatchRequest.js index c8267ad..36da48b 100644 --- a/node_modules/axios/lib/core/dispatchRequest.js +++ b/node_modules/axios/lib/core/dispatchRequest.js @@ -4,6 +4,7 @@ var utils = require('./../utils'); var transformData = require('./transformData'); var isCancel = require('../cancel/isCancel'); var defaults = require('../defaults'); +var Cancel = require('../cancel/Cancel'); /** * Throws a `Cancel` if cancellation has been requested. @@ -12,6 +13,10 @@ function throwIfCancellationRequested(config) { if (config.cancelToken) { config.cancelToken.throwIfRequested(); } + + if (config.signal && config.signal.aborted) { + throw new Cancel('canceled'); + } } /** @@ -27,7 +32,8 @@ module.exports = function dispatchRequest(config) { config.headers = config.headers || {}; // Transform request data - config.data = transformData( + config.data = transformData.call( + config, config.data, config.headers, config.transformRequest @@ -53,7 +59,8 @@ module.exports = function dispatchRequest(config) { throwIfCancellationRequested(config); // Transform response data - response.data = transformData( + response.data = transformData.call( + config, response.data, response.headers, config.transformResponse @@ -66,7 +73,8 @@ module.exports = function dispatchRequest(config) { // Transform response data if (reason && reason.response) { - reason.response.data = transformData( + reason.response.data = transformData.call( + config, reason.response.data, reason.response.headers, config.transformResponse diff --git a/node_modules/axios/lib/core/enhanceError.js b/node_modules/axios/lib/core/enhanceError.js index 02fbbd6..db04ec8 100644 --- a/node_modules/axios/lib/core/enhanceError.js +++ b/node_modules/axios/lib/core/enhanceError.js @@ -20,7 +20,7 @@ module.exports = function enhanceError(error, config, code, request, response) { error.response = response; error.isAxiosError = true; - error.toJSON = function() { + error.toJSON = function toJSON() { return { // Standard message: this.message, @@ -35,7 +35,8 @@ module.exports = function enhanceError(error, config, code, request, response) { stack: this.stack, // Axios config: this.config, - code: this.code + code: this.code, + status: this.response && this.response.status ? this.response.status : null }; }; return error; diff --git a/node_modules/axios/lib/core/mergeConfig.js b/node_modules/axios/lib/core/mergeConfig.js index 8e1ce61..05d1438 100644 --- a/node_modules/axios/lib/core/mergeConfig.js +++ b/node_modules/axios/lib/core/mergeConfig.js @@ -15,58 +15,84 @@ module.exports = function mergeConfig(config1, config2) { config2 = config2 || {}; var config = {}; - var valueFromConfig2Keys = ['url', 'method', 'params', 'data']; - var mergeDeepPropertiesKeys = ['headers', 'auth', 'proxy']; - var defaultToConfig2Keys = [ - 'baseURL', 'url', 'transformRequest', 'transformResponse', 'paramsSerializer', - 'timeout', 'withCredentials', 'adapter', 'responseType', 'xsrfCookieName', - 'xsrfHeaderName', 'onUploadProgress', 'onDownloadProgress', - 'maxContentLength', 'validateStatus', 'maxRedirects', 'httpAgent', - 'httpsAgent', 'cancelToken', 'socketPath' - ]; - - utils.forEach(valueFromConfig2Keys, function valueFromConfig2(prop) { - if (typeof config2[prop] !== 'undefined') { - config[prop] = config2[prop]; + function getMergedValue(target, source) { + if (utils.isPlainObject(target) && utils.isPlainObject(source)) { + return utils.merge(target, source); + } else if (utils.isPlainObject(source)) { + return utils.merge({}, source); + } else if (utils.isArray(source)) { + return source.slice(); } - }); + return source; + } - utils.forEach(mergeDeepPropertiesKeys, function mergeDeepProperties(prop) { - if (utils.isObject(config2[prop])) { - config[prop] = utils.deepMerge(config1[prop], config2[prop]); - } else if (typeof config2[prop] !== 'undefined') { - config[prop] = config2[prop]; - } else if (utils.isObject(config1[prop])) { - config[prop] = utils.deepMerge(config1[prop]); - } else if (typeof config1[prop] !== 'undefined') { - config[prop] = config1[prop]; + // eslint-disable-next-line consistent-return + function mergeDeepProperties(prop) { + if (!utils.isUndefined(config2[prop])) { + return getMergedValue(config1[prop], config2[prop]); + } else if (!utils.isUndefined(config1[prop])) { + return getMergedValue(undefined, config1[prop]); } - }); + } - utils.forEach(defaultToConfig2Keys, function defaultToConfig2(prop) { - if (typeof config2[prop] !== 'undefined') { - config[prop] = config2[prop]; - } else if (typeof config1[prop] !== 'undefined') { - config[prop] = config1[prop]; + // eslint-disable-next-line consistent-return + function valueFromConfig2(prop) { + if (!utils.isUndefined(config2[prop])) { + return getMergedValue(undefined, config2[prop]); } - }); + } - var axiosKeys = valueFromConfig2Keys - .concat(mergeDeepPropertiesKeys) - .concat(defaultToConfig2Keys); - - var otherKeys = Object - .keys(config2) - .filter(function filterAxiosKeys(key) { - return axiosKeys.indexOf(key) === -1; - }); - - utils.forEach(otherKeys, function otherKeysDefaultToConfig2(prop) { - if (typeof config2[prop] !== 'undefined') { - config[prop] = config2[prop]; - } else if (typeof config1[prop] !== 'undefined') { - config[prop] = config1[prop]; + // eslint-disable-next-line consistent-return + function defaultToConfig2(prop) { + if (!utils.isUndefined(config2[prop])) { + return getMergedValue(undefined, config2[prop]); + } else if (!utils.isUndefined(config1[prop])) { + return getMergedValue(undefined, config1[prop]); } + } + + // eslint-disable-next-line consistent-return + function mergeDirectKeys(prop) { + if (prop in config2) { + return getMergedValue(config1[prop], config2[prop]); + } else if (prop in config1) { + return getMergedValue(undefined, config1[prop]); + } + } + + var mergeMap = { + 'url': valueFromConfig2, + 'method': valueFromConfig2, + 'data': valueFromConfig2, + 'baseURL': defaultToConfig2, + 'transformRequest': defaultToConfig2, + 'transformResponse': defaultToConfig2, + 'paramsSerializer': defaultToConfig2, + 'timeout': defaultToConfig2, + 'timeoutMessage': defaultToConfig2, + 'withCredentials': defaultToConfig2, + 'adapter': defaultToConfig2, + 'responseType': defaultToConfig2, + 'xsrfCookieName': defaultToConfig2, + 'xsrfHeaderName': defaultToConfig2, + 'onUploadProgress': defaultToConfig2, + 'onDownloadProgress': defaultToConfig2, + 'decompress': defaultToConfig2, + 'maxContentLength': defaultToConfig2, + 'maxBodyLength': defaultToConfig2, + 'transport': defaultToConfig2, + 'httpAgent': defaultToConfig2, + 'httpsAgent': defaultToConfig2, + 'cancelToken': defaultToConfig2, + 'socketPath': defaultToConfig2, + 'responseEncoding': defaultToConfig2, + 'validateStatus': mergeDirectKeys + }; + + utils.forEach(Object.keys(config1).concat(Object.keys(config2)), function computeConfigValue(prop) { + var merge = mergeMap[prop] || mergeDeepProperties; + var configValue = merge(prop); + (utils.isUndefined(configValue) && merge !== mergeDirectKeys) || (config[prop] = configValue); }); return config; diff --git a/node_modules/axios/lib/core/settle.js b/node_modules/axios/lib/core/settle.js index 071d9e3..886adb0 100644 --- a/node_modules/axios/lib/core/settle.js +++ b/node_modules/axios/lib/core/settle.js @@ -11,7 +11,7 @@ var createError = require('./createError'); */ module.exports = function settle(resolve, reject, response) { var validateStatus = response.config.validateStatus; - if (!validateStatus || validateStatus(response.status)) { + if (!response.status || !validateStatus || validateStatus(response.status)) { resolve(response); } else { reject(createError( diff --git a/node_modules/axios/lib/core/transformData.js b/node_modules/axios/lib/core/transformData.js index e065362..82ee7dd 100644 --- a/node_modules/axios/lib/core/transformData.js +++ b/node_modules/axios/lib/core/transformData.js @@ -1,6 +1,7 @@ 'use strict'; var utils = require('./../utils'); +var defaults = require('../defaults'); /** * Transform the data for a request or a response @@ -11,9 +12,10 @@ var utils = require('./../utils'); * @returns {*} The resulting transformed data */ module.exports = function transformData(data, headers, fns) { + var context = this || defaults; /*eslint no-param-reassign:0*/ utils.forEach(fns, function transform(fn) { - data = fn(data, headers); + data = fn.call(context, data, headers); }); return data; diff --git a/node_modules/axios/lib/defaults.js b/node_modules/axios/lib/defaults/index.js similarity index 55% rename from node_modules/axios/lib/defaults.js rename to node_modules/axios/lib/defaults/index.js index 23e1cbd..8b57b88 100644 --- a/node_modules/axios/lib/defaults.js +++ b/node_modules/axios/lib/defaults/index.js @@ -1,7 +1,9 @@ 'use strict'; -var utils = require('./utils'); -var normalizeHeaderName = require('./helpers/normalizeHeaderName'); +var utils = require('../utils'); +var normalizeHeaderName = require('../helpers/normalizeHeaderName'); +var enhanceError = require('../core/enhanceError'); +var transitionalDefaults = require('./transitional'); var DEFAULT_CONTENT_TYPE = { 'Content-Type': 'application/x-www-form-urlencoded' @@ -17,20 +19,39 @@ function getDefaultAdapter() { var adapter; if (typeof XMLHttpRequest !== 'undefined') { // For browsers use XHR adapter - adapter = require('./adapters/xhr'); + adapter = require('../adapters/xhr'); } else if (typeof process !== 'undefined' && Object.prototype.toString.call(process) === '[object process]') { // For node use HTTP adapter - adapter = require('./adapters/http'); + adapter = require('../adapters/http'); } return adapter; } +function stringifySafely(rawValue, parser, encoder) { + if (utils.isString(rawValue)) { + try { + (parser || JSON.parse)(rawValue); + return utils.trim(rawValue); + } catch (e) { + if (e.name !== 'SyntaxError') { + throw e; + } + } + } + + return (encoder || JSON.stringify)(rawValue); +} + var defaults = { + + transitional: transitionalDefaults, + adapter: getDefaultAdapter(), transformRequest: [function transformRequest(data, headers) { normalizeHeaderName(headers, 'Accept'); normalizeHeaderName(headers, 'Content-Type'); + if (utils.isFormData(data) || utils.isArrayBuffer(data) || utils.isBuffer(data) || @@ -47,20 +68,32 @@ var defaults = { setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8'); return data.toString(); } - if (utils.isObject(data)) { - setContentTypeIfUnset(headers, 'application/json;charset=utf-8'); - return JSON.stringify(data); + if (utils.isObject(data) || (headers && headers['Content-Type'] === 'application/json')) { + setContentTypeIfUnset(headers, 'application/json'); + return stringifySafely(data); } return data; }], transformResponse: [function transformResponse(data) { - /*eslint no-param-reassign:0*/ - if (typeof data === 'string') { + var transitional = this.transitional || defaults.transitional; + var silentJSONParsing = transitional && transitional.silentJSONParsing; + var forcedJSONParsing = transitional && transitional.forcedJSONParsing; + var strictJSONParsing = !silentJSONParsing && this.responseType === 'json'; + + if (strictJSONParsing || (forcedJSONParsing && utils.isString(data) && data.length)) { try { - data = JSON.parse(data); - } catch (e) { /* Ignore */ } + return JSON.parse(data); + } catch (e) { + if (strictJSONParsing) { + if (e.name === 'SyntaxError') { + throw enhanceError(e, this, 'E_JSON_PARSE'); + } + throw e; + } + } } + return data; }], @@ -74,15 +107,16 @@ var defaults = { xsrfHeaderName: 'X-XSRF-TOKEN', maxContentLength: -1, + maxBodyLength: -1, validateStatus: function validateStatus(status) { return status >= 200 && status < 300; - } -}; + }, -defaults.headers = { - common: { - 'Accept': 'application/json, text/plain, */*' + headers: { + common: { + 'Accept': 'application/json, text/plain, */*' + } } }; diff --git a/node_modules/axios/lib/defaults/transitional.js b/node_modules/axios/lib/defaults/transitional.js new file mode 100644 index 0000000..601dd7e --- /dev/null +++ b/node_modules/axios/lib/defaults/transitional.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = { + silentJSONParsing: true, + forcedJSONParsing: true, + clarifyTimeoutError: false +}; diff --git a/node_modules/axios/lib/env/README.md b/node_modules/axios/lib/env/README.md new file mode 100644 index 0000000..b41baff --- /dev/null +++ b/node_modules/axios/lib/env/README.md @@ -0,0 +1,3 @@ +# axios // env + +The `data.js` file is updated automatically when the package version is upgrading. Please do not edit it manually. diff --git a/node_modules/axios/lib/env/data.js b/node_modules/axios/lib/env/data.js new file mode 100644 index 0000000..9fd3106 --- /dev/null +++ b/node_modules/axios/lib/env/data.js @@ -0,0 +1,3 @@ +module.exports = { + "version": "0.26.1" +}; \ No newline at end of file diff --git a/node_modules/axios/lib/helpers/buildURL.js b/node_modules/axios/lib/helpers/buildURL.js index 8c40e40..31595c3 100644 --- a/node_modules/axios/lib/helpers/buildURL.js +++ b/node_modules/axios/lib/helpers/buildURL.js @@ -4,7 +4,6 @@ var utils = require('./../utils'); function encode(val) { return encodeURIComponent(val). - replace(/%40/gi, '@'). replace(/%3A/gi, ':'). replace(/%24/g, '$'). replace(/%2C/gi, ','). diff --git a/node_modules/axios/lib/helpers/isAbsoluteURL.js b/node_modules/axios/lib/helpers/isAbsoluteURL.js index d33e992..43fea78 100644 --- a/node_modules/axios/lib/helpers/isAbsoluteURL.js +++ b/node_modules/axios/lib/helpers/isAbsoluteURL.js @@ -10,5 +10,5 @@ module.exports = function isAbsoluteURL(url) { // A URL is considered absolute if it begins with "://" or "//" (protocol-relative URL). // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed // by any combination of letters, digits, plus, period, or hyphen. - return /^([a-z][a-z\d\+\-\.]*:)?\/\//i.test(url); + return /^([a-z][a-z\d+\-.]*:)?\/\//i.test(url); }; diff --git a/node_modules/axios/lib/helpers/isAxiosError.js b/node_modules/axios/lib/helpers/isAxiosError.js new file mode 100644 index 0000000..a037bec --- /dev/null +++ b/node_modules/axios/lib/helpers/isAxiosError.js @@ -0,0 +1,13 @@ +'use strict'; + +var utils = require('./../utils'); + +/** + * Determines whether the payload is an error thrown by Axios + * + * @param {*} payload The value to test + * @returns {boolean} True if the payload is an error thrown by Axios, otherwise false + */ +module.exports = function isAxiosError(payload) { + return utils.isObject(payload) && (payload.isAxiosError === true); +}; diff --git a/node_modules/axios/lib/helpers/toFormData.js b/node_modules/axios/lib/helpers/toFormData.js new file mode 100644 index 0000000..e21d0a7 --- /dev/null +++ b/node_modules/axios/lib/helpers/toFormData.js @@ -0,0 +1,55 @@ +'use strict'; + +function combinedKey(parentKey, elKey) { + return parentKey + '.' + elKey; +} + +function buildFormData(formData, data, parentKey) { + if (Array.isArray(data)) { + data.forEach(function buildArray(el, i) { + buildFormData(formData, el, combinedKey(parentKey, i)); + }); + } else if ( + typeof data === 'object' && + !(data instanceof File || data === null) + ) { + Object.keys(data).forEach(function buildObject(key) { + buildFormData( + formData, + data[key], + parentKey ? combinedKey(parentKey, key) : key + ); + }); + } else { + if (data === undefined) { + return; + } + + var value = + typeof data === 'boolean' || typeof data === 'number' + ? data.toString() + : data; + formData.append(parentKey, value); + } +} + +/** + * convert a data object to FormData + * + * type FormDataPrimitive = string | Blob | number | boolean + * interface FormDataNest { + * [x: string]: FormVal + * } + * + * type FormVal = FormDataNest | FormDataPrimitive + * + * @param {FormVal} data + */ + +module.exports = function getFormData(data) { + var formData = new FormData(); + + buildFormData(formData, data); + + return formData; +}; diff --git a/node_modules/axios/lib/helpers/validator.js b/node_modules/axios/lib/helpers/validator.js new file mode 100644 index 0000000..a4ec413 --- /dev/null +++ b/node_modules/axios/lib/helpers/validator.js @@ -0,0 +1,82 @@ +'use strict'; + +var VERSION = require('../env/data').version; + +var validators = {}; + +// eslint-disable-next-line func-names +['object', 'boolean', 'number', 'function', 'string', 'symbol'].forEach(function(type, i) { + validators[type] = function validator(thing) { + return typeof thing === type || 'a' + (i < 1 ? 'n ' : ' ') + type; + }; +}); + +var deprecatedWarnings = {}; + +/** + * Transitional option validator + * @param {function|boolean?} validator - set to false if the transitional option has been removed + * @param {string?} version - deprecated version / removed since version + * @param {string?} message - some message with additional info + * @returns {function} + */ +validators.transitional = function transitional(validator, version, message) { + function formatMessage(opt, desc) { + return '[Axios v' + VERSION + '] Transitional option \'' + opt + '\'' + desc + (message ? '. ' + message : ''); + } + + // eslint-disable-next-line func-names + return function(value, opt, opts) { + if (validator === false) { + throw new Error(formatMessage(opt, ' has been removed' + (version ? ' in ' + version : ''))); + } + + if (version && !deprecatedWarnings[opt]) { + deprecatedWarnings[opt] = true; + // eslint-disable-next-line no-console + console.warn( + formatMessage( + opt, + ' has been deprecated since v' + version + ' and will be removed in the near future' + ) + ); + } + + return validator ? validator(value, opt, opts) : true; + }; +}; + +/** + * Assert object's properties type + * @param {object} options + * @param {object} schema + * @param {boolean?} allowUnknown + */ + +function assertOptions(options, schema, allowUnknown) { + if (typeof options !== 'object') { + throw new TypeError('options must be an object'); + } + var keys = Object.keys(options); + var i = keys.length; + while (i-- > 0) { + var opt = keys[i]; + var validator = schema[opt]; + if (validator) { + var value = options[opt]; + var result = value === undefined || validator(value, opt, options); + if (result !== true) { + throw new TypeError('option ' + opt + ' must be ' + result); + } + continue; + } + if (allowUnknown !== true) { + throw Error('Unknown option ' + opt); + } + } +} + +module.exports = { + assertOptions: assertOptions, + validators: validators +}; diff --git a/node_modules/axios/lib/utils.js b/node_modules/axios/lib/utils.js index e028c67..f0f9043 100644 --- a/node_modules/axios/lib/utils.js +++ b/node_modules/axios/lib/utils.js @@ -2,8 +2,6 @@ var bind = require('./helpers/bind'); -/*global toString:true*/ - // utils is a library of generic helper functions non-specific to axios var toString = Object.prototype.toString; @@ -15,7 +13,7 @@ var toString = Object.prototype.toString; * @returns {boolean} True if value is an Array, otherwise false */ function isArray(val) { - return toString.call(val) === '[object Array]'; + return Array.isArray(val); } /** @@ -56,7 +54,7 @@ function isArrayBuffer(val) { * @returns {boolean} True if value is an FormData, otherwise false */ function isFormData(val) { - return (typeof FormData !== 'undefined') && (val instanceof FormData); + return toString.call(val) === '[object FormData]'; } /** @@ -70,7 +68,7 @@ function isArrayBufferView(val) { if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) { result = ArrayBuffer.isView(val); } else { - result = (val) && (val.buffer) && (val.buffer instanceof ArrayBuffer); + result = (val) && (val.buffer) && (isArrayBuffer(val.buffer)); } return result; } @@ -105,6 +103,21 @@ function isObject(val) { return val !== null && typeof val === 'object'; } +/** + * Determine if a value is a plain Object + * + * @param {Object} val The value to test + * @return {boolean} True if value is a plain Object, otherwise false + */ +function isPlainObject(val) { + if (toString.call(val) !== '[object Object]') { + return false; + } + + var prototype = Object.getPrototypeOf(val); + return prototype === null || prototype === Object.prototype; +} + /** * Determine if a value is a Date * @@ -162,7 +175,7 @@ function isStream(val) { * @returns {boolean} True if value is a URLSearchParams object, otherwise false */ function isURLSearchParams(val) { - return typeof URLSearchParams !== 'undefined' && val instanceof URLSearchParams; + return toString.call(val) === '[object URLSearchParams]'; } /** @@ -172,7 +185,7 @@ function isURLSearchParams(val) { * @returns {String} The String freed of excess whitespace */ function trim(str) { - return str.replace(/^\s*/, '').replace(/\s*$/, ''); + return str.trim ? str.trim() : str.replace(/^\s+|\s+$/g, ''); } /** @@ -261,34 +274,12 @@ function forEach(obj, fn) { function merge(/* obj1, obj2, obj3, ... */) { var result = {}; function assignValue(val, key) { - if (typeof result[key] === 'object' && typeof val === 'object') { + if (isPlainObject(result[key]) && isPlainObject(val)) { result[key] = merge(result[key], val); - } else { - result[key] = val; - } - } - - for (var i = 0, l = arguments.length; i < l; i++) { - forEach(arguments[i], assignValue); - } - return result; -} - -/** - * Function equal to merge with the difference being that no reference - * to original objects is kept. - * - * @see merge - * @param {Object} obj1 Object to merge - * @returns {Object} Result of all merge properties - */ -function deepMerge(/* obj1, obj2, obj3, ... */) { - var result = {}; - function assignValue(val, key) { - if (typeof result[key] === 'object' && typeof val === 'object') { - result[key] = deepMerge(result[key], val); - } else if (typeof val === 'object') { - result[key] = deepMerge({}, val); + } else if (isPlainObject(val)) { + result[key] = merge({}, val); + } else if (isArray(val)) { + result[key] = val.slice(); } else { result[key] = val; } @@ -319,6 +310,19 @@ function extend(a, b, thisArg) { return a; } +/** + * Remove byte order marker. This catches EF BB BF (the UTF-8 BOM) + * + * @param {string} content with BOM + * @return {string} content value without BOM + */ +function stripBOM(content) { + if (content.charCodeAt(0) === 0xFEFF) { + content = content.slice(1); + } + return content; +} + module.exports = { isArray: isArray, isArrayBuffer: isArrayBuffer, @@ -328,6 +332,7 @@ module.exports = { isString: isString, isNumber: isNumber, isObject: isObject, + isPlainObject: isPlainObject, isUndefined: isUndefined, isDate: isDate, isFile: isFile, @@ -338,7 +343,7 @@ module.exports = { isStandardBrowserEnv: isStandardBrowserEnv, forEach: forEach, merge: merge, - deepMerge: deepMerge, extend: extend, - trim: trim + trim: trim, + stripBOM: stripBOM }; diff --git a/node_modules/axios/package.json b/node_modules/axios/package.json index a96eebe..32c275c 100644 --- a/node_modules/axios/package.json +++ b/node_modules/axios/package.json @@ -1,89 +1,24 @@ { - "_args": [ - [ - "axios@0.19.2", - "/Users/wphromma/workspace/actions-curl" - ] - ], - "_from": "axios@0.19.2", - "_id": "axios@0.19.2", - "_inBundle": false, - "_integrity": "sha512-fjgm5MvRHLhx+osE2xoekY70AhARk3a6hkN+3Io1jc00jtquGvxYlKlsFUhmUET0V5te6CcZI7lcv2Ym61mjHA==", - "_location": "/axios", - "_phantomChildren": {}, - "_requested": { - "type": "version", - "registry": true, - "raw": "axios@0.19.2", - "name": "axios", - "escapedName": "axios", - "rawSpec": "0.19.2", - "saveSpec": null, - "fetchSpec": "0.19.2" - }, - "_requiredBy": [ - "/" - ], - "_resolved": "https://registry.npmjs.org/axios/-/axios-0.19.2.tgz", - "_spec": "0.19.2", - "_where": "/Users/wphromma/workspace/actions-curl", - "author": { - "name": "Matt Zabriskie" - }, - "browser": { - "./lib/adapters/http.js": "./lib/adapters/xhr.js" - }, - "bugs": { - "url": "https://github.com/axios/axios/issues" - }, - "bundlesize": [ - { - "path": "./dist/axios.min.js", - "threshold": "5kB" - } - ], - "dependencies": { - "follow-redirects": "1.5.10" - }, + "name": "axios", + "version": "0.26.1", "description": "Promise based HTTP client for the browser and node.js", - "devDependencies": { - "bundlesize": "^0.17.0", - "coveralls": "^3.0.0", - "es6-promise": "^4.2.4", - "grunt": "^1.0.2", - "grunt-banner": "^0.6.0", - "grunt-cli": "^1.2.0", - "grunt-contrib-clean": "^1.1.0", - "grunt-contrib-watch": "^1.0.0", - "grunt-eslint": "^20.1.0", - "grunt-karma": "^2.0.0", - "grunt-mocha-test": "^0.13.3", - "grunt-ts": "^6.0.0-beta.19", - "grunt-webpack": "^1.0.18", - "istanbul-instrumenter-loader": "^1.0.0", - "jasmine-core": "^2.4.1", - "karma": "^1.3.0", - "karma-chrome-launcher": "^2.2.0", - "karma-coverage": "^1.1.1", - "karma-firefox-launcher": "^1.1.0", - "karma-jasmine": "^1.1.1", - "karma-jasmine-ajax": "^0.1.13", - "karma-opera-launcher": "^1.0.0", - "karma-safari-launcher": "^1.0.0", - "karma-sauce-launcher": "^1.2.0", - "karma-sinon": "^1.0.5", - "karma-sourcemap-loader": "^0.3.7", - "karma-webpack": "^1.7.0", - "load-grunt-tasks": "^3.5.2", - "minimist": "^1.2.0", - "mocha": "^5.2.0", - "sinon": "^4.5.0", - "typescript": "^2.8.1", - "url-search-params": "^0.10.0", - "webpack": "^1.13.1", - "webpack-dev-server": "^1.14.1" + "main": "index.js", + "types": "index.d.ts", + "scripts": { + "test": "grunt test && dtslint", + "start": "node ./sandbox/server.js", + "build": "NODE_ENV=production grunt build", + "preversion": "grunt version && npm test", + "version": "npm run build && git add -A dist && git add CHANGELOG.md bower.json package.json", + "postversion": "git push && git push --tags", + "examples": "node ./examples/server.js", + "coveralls": "cat coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js", + "fix": "eslint --fix lib/**/*.js" + }, + "repository": { + "type": "git", + "url": "https://github.com/axios/axios.git" }, - "homepage": "https://github.com/axios/axios", "keywords": [ "xhr", "http", @@ -91,24 +26,61 @@ "promise", "node" ], + "author": "Matt Zabriskie", "license": "MIT", - "main": "index.js", - "name": "axios", - "repository": { - "type": "git", - "url": "git+https://github.com/axios/axios.git" + "bugs": { + "url": "https://github.com/axios/axios/issues" }, - "scripts": { - "build": "NODE_ENV=production grunt build", - "coveralls": "cat coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js", - "examples": "node ./examples/server.js", - "fix": "eslint --fix lib/**/*.js", - "postversion": "git push && git push --tags", - "preversion": "npm test", - "start": "node ./sandbox/server.js", - "test": "grunt test && bundlesize", - "version": "npm run build && grunt version && git add -A dist && git add CHANGELOG.md bower.json package.json" + "homepage": "https://axios-http.com", + "devDependencies": { + "abortcontroller-polyfill": "^1.5.0", + "coveralls": "^3.0.0", + "dtslint": "^4.1.6", + "es6-promise": "^4.2.4", + "grunt": "^1.3.0", + "grunt-banner": "^0.6.0", + "grunt-cli": "^1.2.0", + "grunt-contrib-clean": "^1.1.0", + "grunt-contrib-watch": "^1.0.0", + "grunt-eslint": "^23.0.0", + "grunt-karma": "^4.0.0", + "grunt-mocha-test": "^0.13.3", + "grunt-webpack": "^4.0.2", + "istanbul-instrumenter-loader": "^1.0.0", + "jasmine-core": "^2.4.1", + "karma": "^6.3.2", + "karma-chrome-launcher": "^3.1.0", + "karma-firefox-launcher": "^2.1.0", + "karma-jasmine": "^1.1.1", + "karma-jasmine-ajax": "^0.1.13", + "karma-safari-launcher": "^1.0.0", + "karma-sauce-launcher": "^4.3.6", + "karma-sinon": "^1.0.5", + "karma-sourcemap-loader": "^0.3.8", + "karma-webpack": "^4.0.2", + "load-grunt-tasks": "^3.5.2", + "minimist": "^1.2.0", + "mocha": "^8.2.1", + "sinon": "^4.5.0", + "terser-webpack-plugin": "^4.2.3", + "typescript": "^4.0.5", + "url-search-params": "^0.10.0", + "webpack": "^4.44.2", + "webpack-dev-server": "^3.11.0" }, + "browser": { + "./lib/adapters/http.js": "./lib/adapters/xhr.js" + }, + "jsdelivr": "dist/axios.min.js", + "unpkg": "dist/axios.min.js", "typings": "./index.d.ts", - "version": "0.19.2" + "dependencies": { + "follow-redirects": "^1.14.8" + }, + "bundlesize": [ + { + "path": "./dist/axios.min.js", + "threshold": "5kB" + } + ] } diff --git a/node_modules/axios/tsconfig.json b/node_modules/axios/tsconfig.json new file mode 100644 index 0000000..6665188 --- /dev/null +++ b/node_modules/axios/tsconfig.json @@ -0,0 +1,14 @@ +{ + "compilerOptions": { + "module": "es2015", + "lib": ["dom", "es2015"], + "types": [], + "moduleResolution": "node", + "strict": true, + "noEmit": true, + "baseUrl": ".", + "paths": { + "axios": ["."] + } + } +} diff --git a/node_modules/axios/tslint.json b/node_modules/axios/tslint.json new file mode 100644 index 0000000..3ec44a7 --- /dev/null +++ b/node_modules/axios/tslint.json @@ -0,0 +1,6 @@ +{ + "extends": "dtslint/dtslint.json", + "rules": { + "no-unnecessary-generics": false + } +} diff --git a/node_modules/debug/.coveralls.yml b/node_modules/debug/.coveralls.yml deleted file mode 100644 index 20a7068..0000000 --- a/node_modules/debug/.coveralls.yml +++ /dev/null @@ -1 +0,0 @@ -repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve diff --git a/node_modules/debug/.eslintrc b/node_modules/debug/.eslintrc deleted file mode 100644 index 146371e..0000000 --- a/node_modules/debug/.eslintrc +++ /dev/null @@ -1,14 +0,0 @@ -{ - "env": { - "browser": true, - "node": true - }, - "globals": { - "chrome": true - }, - "rules": { - "no-console": 0, - "no-empty": [1, { "allowEmptyCatch": true }] - }, - "extends": "eslint:recommended" -} diff --git a/node_modules/debug/.npmignore b/node_modules/debug/.npmignore deleted file mode 100644 index 5f60eec..0000000 --- a/node_modules/debug/.npmignore +++ /dev/null @@ -1,9 +0,0 @@ -support -test -examples -example -*.sock -dist -yarn.lock -coverage -bower.json diff --git a/node_modules/debug/.travis.yml b/node_modules/debug/.travis.yml deleted file mode 100644 index a764300..0000000 --- a/node_modules/debug/.travis.yml +++ /dev/null @@ -1,20 +0,0 @@ -sudo: false - -language: node_js - -node_js: - - "4" - - "6" - - "8" - -install: - - make install - -script: - - make lint - - make test - -matrix: - include: - - node_js: '8' - env: BROWSER=1 diff --git a/node_modules/debug/CHANGELOG.md b/node_modules/debug/CHANGELOG.md deleted file mode 100644 index 820d21e..0000000 --- a/node_modules/debug/CHANGELOG.md +++ /dev/null @@ -1,395 +0,0 @@ - -3.1.0 / 2017-09-26 -================== - - * Add `DEBUG_HIDE_DATE` env var (#486) - * Remove ReDoS regexp in %o formatter (#504) - * Remove "component" from package.json - * Remove `component.json` - * Ignore package-lock.json - * Examples: fix colors printout - * Fix: browser detection - * Fix: spelling mistake (#496, @EdwardBetts) - -3.0.1 / 2017-08-24 -================== - - * Fix: Disable colors in Edge and Internet Explorer (#489) - -3.0.0 / 2017-08-08 -================== - - * Breaking: Remove DEBUG_FD (#406) - * Breaking: Use `Date#toISOString()` instead to `Date#toUTCString()` when output is not a TTY (#418) - * Breaking: Make millisecond timer namespace specific and allow 'always enabled' output (#408) - * Addition: document `enabled` flag (#465) - * Addition: add 256 colors mode (#481) - * Addition: `enabled()` updates existing debug instances, add `destroy()` function (#440) - * Update: component: update "ms" to v2.0.0 - * Update: separate the Node and Browser tests in Travis-CI - * Update: refactor Readme, fixed documentation, added "Namespace Colors" section, redid screenshots - * Update: separate Node.js and web browser examples for organization - * Update: update "browserify" to v14.4.0 - * Fix: fix Readme typo (#473) - -2.6.9 / 2017-09-22 -================== - - * remove ReDoS regexp in %o formatter (#504) - -2.6.8 / 2017-05-18 -================== - - * Fix: Check for undefined on browser globals (#462, @marbemac) - -2.6.7 / 2017-05-16 -================== - - * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom) - * Fix: Inline extend function in node implementation (#452, @dougwilson) - * Docs: Fix typo (#455, @msasad) - -2.6.5 / 2017-04-27 -================== - - * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek) - * Misc: clean up browser reference checks (#447, @thebigredgeek) - * Misc: add npm-debug.log to .gitignore (@thebigredgeek) - - -2.6.4 / 2017-04-20 -================== - - * Fix: bug that would occur if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo) - * Chore: ignore bower.json in npm installations. (#437, @joaovieira) - * Misc: update "ms" to v0.7.3 (@tootallnate) - -2.6.3 / 2017-03-13 -================== - - * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts) - * Docs: Changelog fix (@thebigredgeek) - -2.6.2 / 2017-03-10 -================== - - * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin) - * Docs: Add backers and sponsors from Open Collective (#422, @piamancini) - * Docs: Add Slackin invite badge (@tootallnate) - -2.6.1 / 2017-02-10 -================== - - * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error - * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0) - * Fix: IE8 "Expected identifier" error (#414, @vgoma) - * Fix: Namespaces would not disable once enabled (#409, @musikov) - -2.6.0 / 2016-12-28 -================== - - * Fix: added better null pointer checks for browser useColors (@thebigredgeek) - * Improvement: removed explicit `window.debug` export (#404, @tootallnate) - * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate) - -2.5.2 / 2016-12-25 -================== - - * Fix: reference error on window within webworkers (#393, @KlausTrainer) - * Docs: fixed README typo (#391, @lurch) - * Docs: added notice about v3 api discussion (@thebigredgeek) - -2.5.1 / 2016-12-20 -================== - - * Fix: babel-core compatibility - -2.5.0 / 2016-12-20 -================== - - * Fix: wrong reference in bower file (@thebigredgeek) - * Fix: webworker compatibility (@thebigredgeek) - * Fix: output formatting issue (#388, @kribblo) - * Fix: babel-loader compatibility (#383, @escwald) - * Misc: removed built asset from repo and publications (@thebigredgeek) - * Misc: moved source files to /src (#378, @yamikuronue) - * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue) - * Test: coveralls integration (#378, @yamikuronue) - * Docs: simplified language in the opening paragraph (#373, @yamikuronue) - -2.4.5 / 2016-12-17 -================== - - * Fix: `navigator` undefined in Rhino (#376, @jochenberger) - * Fix: custom log function (#379, @hsiliev) - * Improvement: bit of cleanup + linting fixes (@thebigredgeek) - * Improvement: rm non-maintainted `dist/` dir (#375, @freewil) - * Docs: simplified language in the opening paragraph. (#373, @yamikuronue) - -2.4.4 / 2016-12-14 -================== - - * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts) - -2.4.3 / 2016-12-14 -================== - - * Fix: navigation.userAgent error for react native (#364, @escwald) - -2.4.2 / 2016-12-14 -================== - - * Fix: browser colors (#367, @tootallnate) - * Misc: travis ci integration (@thebigredgeek) - * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek) - -2.4.1 / 2016-12-13 -================== - - * Fix: typo that broke the package (#356) - -2.4.0 / 2016-12-13 -================== - - * Fix: bower.json references unbuilt src entry point (#342, @justmatt) - * Fix: revert "handle regex special characters" (@tootallnate) - * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate) - * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate) - * Improvement: allow colors in workers (#335, @botverse) - * Improvement: use same color for same namespace. (#338, @lchenay) - -2.3.3 / 2016-11-09 -================== - - * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne) - * Fix: Returning `localStorage` saved values (#331, Levi Thomason) - * Improvement: Don't create an empty object when no `process` (Nathan Rajlich) - -2.3.2 / 2016-11-09 -================== - - * Fix: be super-safe in index.js as well (@TooTallNate) - * Fix: should check whether process exists (Tom Newby) - -2.3.1 / 2016-11-09 -================== - - * Fix: Added electron compatibility (#324, @paulcbetts) - * Improvement: Added performance optimizations (@tootallnate) - * Readme: Corrected PowerShell environment variable example (#252, @gimre) - * Misc: Removed yarn lock file from source control (#321, @fengmk2) - -2.3.0 / 2016-11-07 -================== - - * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic) - * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos) - * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15) - * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran) - * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom) - * Package: Update "ms" to 0.7.2 (#315, @DevSide) - * Package: removed superfluous version property from bower.json (#207 @kkirsche) - * Readme: fix USE_COLORS to DEBUG_COLORS - * Readme: Doc fixes for format string sugar (#269, @mlucool) - * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0) - * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable) - * Readme: better docs for browser support (#224, @matthewmueller) - * Tooling: Added yarn integration for development (#317, @thebigredgeek) - * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek) - * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman) - * Misc: Updated contributors (@thebigredgeek) - -2.2.0 / 2015-05-09 -================== - - * package: update "ms" to v0.7.1 (#202, @dougwilson) - * README: add logging to file example (#193, @DanielOchoa) - * README: fixed a typo (#191, @amir-s) - * browser: expose `storage` (#190, @stephenmathieson) - * Makefile: add a `distclean` target (#189, @stephenmathieson) - -2.1.3 / 2015-03-13 -================== - - * Updated stdout/stderr example (#186) - * Updated example/stdout.js to match debug current behaviour - * Renamed example/stderr.js to stdout.js - * Update Readme.md (#184) - * replace high intensity foreground color for bold (#182, #183) - -2.1.2 / 2015-03-01 -================== - - * dist: recompile - * update "ms" to v0.7.0 - * package: update "browserify" to v9.0.3 - * component: fix "ms.js" repo location - * changed bower package name - * updated documentation about using debug in a browser - * fix: security error on safari (#167, #168, @yields) - -2.1.1 / 2014-12-29 -================== - - * browser: use `typeof` to check for `console` existence - * browser: check for `console.log` truthiness (fix IE 8/9) - * browser: add support for Chrome apps - * Readme: added Windows usage remarks - * Add `bower.json` to properly support bower install - -2.1.0 / 2014-10-15 -================== - - * node: implement `DEBUG_FD` env variable support - * package: update "browserify" to v6.1.0 - * package: add "license" field to package.json (#135, @panuhorsmalahti) - -2.0.0 / 2014-09-01 -================== - - * package: update "browserify" to v5.11.0 - * node: use stderr rather than stdout for logging (#29, @stephenmathieson) - -1.0.4 / 2014-07-15 -================== - - * dist: recompile - * example: remove `console.info()` log usage - * example: add "Content-Type" UTF-8 header to browser example - * browser: place %c marker after the space character - * browser: reset the "content" color via `color: inherit` - * browser: add colors support for Firefox >= v31 - * debug: prefer an instance `log()` function over the global one (#119) - * Readme: update documentation about styled console logs for FF v31 (#116, @wryk) - -1.0.3 / 2014-07-09 -================== - - * Add support for multiple wildcards in namespaces (#122, @seegno) - * browser: fix lint - -1.0.2 / 2014-06-10 -================== - - * browser: update color palette (#113, @gscottolson) - * common: make console logging function configurable (#108, @timoxley) - * node: fix %o colors on old node <= 0.8.x - * Makefile: find node path using shell/which (#109, @timoxley) - -1.0.1 / 2014-06-06 -================== - - * browser: use `removeItem()` to clear localStorage - * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777) - * package: add "contributors" section - * node: fix comment typo - * README: list authors - -1.0.0 / 2014-06-04 -================== - - * make ms diff be global, not be scope - * debug: ignore empty strings in enable() - * node: make DEBUG_COLORS able to disable coloring - * *: export the `colors` array - * npmignore: don't publish the `dist` dir - * Makefile: refactor to use browserify - * package: add "browserify" as a dev dependency - * Readme: add Web Inspector Colors section - * node: reset terminal color for the debug content - * node: map "%o" to `util.inspect()` - * browser: map "%j" to `JSON.stringify()` - * debug: add custom "formatters" - * debug: use "ms" module for humanizing the diff - * Readme: add "bash" syntax highlighting - * browser: add Firebug color support - * browser: add colors for WebKit browsers - * node: apply log to `console` - * rewrite: abstract common logic for Node & browsers - * add .jshintrc file - -0.8.1 / 2014-04-14 -================== - - * package: re-add the "component" section - -0.8.0 / 2014-03-30 -================== - - * add `enable()` method for nodejs. Closes #27 - * change from stderr to stdout - * remove unnecessary index.js file - -0.7.4 / 2013-11-13 -================== - - * remove "browserify" key from package.json (fixes something in browserify) - -0.7.3 / 2013-10-30 -================== - - * fix: catch localStorage security error when cookies are blocked (Chrome) - * add debug(err) support. Closes #46 - * add .browser prop to package.json. Closes #42 - -0.7.2 / 2013-02-06 -================== - - * fix package.json - * fix: Mobile Safari (private mode) is broken with debug - * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript - -0.7.1 / 2013-02-05 -================== - - * add repository URL to package.json - * add DEBUG_COLORED to force colored output - * add browserify support - * fix component. Closes #24 - -0.7.0 / 2012-05-04 -================== - - * Added .component to package.json - * Added debug.component.js build - -0.6.0 / 2012-03-16 -================== - - * Added support for "-" prefix in DEBUG [Vinay Pulim] - * Added `.enabled` flag to the node version [TooTallNate] - -0.5.0 / 2012-02-02 -================== - - * Added: humanize diffs. Closes #8 - * Added `debug.disable()` to the CS variant - * Removed padding. Closes #10 - * Fixed: persist client-side variant again. Closes #9 - -0.4.0 / 2012-02-01 -================== - - * Added browser variant support for older browsers [TooTallNate] - * Added `debug.enable('project:*')` to browser variant [TooTallNate] - * Added padding to diff (moved it to the right) - -0.3.0 / 2012-01-26 -================== - - * Added millisecond diff when isatty, otherwise UTC string - -0.2.0 / 2012-01-22 -================== - - * Added wildcard support - -0.1.0 / 2011-12-02 -================== - - * Added: remove colors unless stderr isatty [TooTallNate] - -0.0.1 / 2010-01-03 -================== - - * Initial release diff --git a/node_modules/debug/LICENSE b/node_modules/debug/LICENSE deleted file mode 100644 index 658c933..0000000 --- a/node_modules/debug/LICENSE +++ /dev/null @@ -1,19 +0,0 @@ -(The MIT License) - -Copyright (c) 2014 TJ Holowaychuk - -Permission is hereby granted, free of charge, to any person obtaining a copy of this software -and associated documentation files (the 'Software'), to deal in the Software without restriction, -including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, -and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, -subject to the following conditions: - -The above copyright notice and this permission notice shall be included in all copies or substantial -portions of the Software. - -THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT -LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. -IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, -WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE -SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. - diff --git a/node_modules/debug/Makefile b/node_modules/debug/Makefile deleted file mode 100644 index 3ddd136..0000000 --- a/node_modules/debug/Makefile +++ /dev/null @@ -1,58 +0,0 @@ -# get Makefile directory name: http://stackoverflow.com/a/5982798/376773 -THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST)) -THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd) - -# BIN directory -BIN := $(THIS_DIR)/node_modules/.bin - -# Path -PATH := node_modules/.bin:$(PATH) -SHELL := /bin/bash - -# applications -NODE ?= $(shell which node) -YARN ?= $(shell which yarn) -PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm)) -BROWSERIFY ?= $(NODE) $(BIN)/browserify - -install: node_modules - -browser: dist/debug.js - -node_modules: package.json - @NODE_ENV= $(PKG) install - @touch node_modules - -dist/debug.js: src/*.js node_modules - @mkdir -p dist - @$(BROWSERIFY) \ - --standalone debug \ - . > dist/debug.js - -lint: - @eslint *.js src/*.js - -test-node: - @istanbul cover node_modules/mocha/bin/_mocha -- test/**.js - @cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js - -test-browser: - @$(MAKE) browser - @karma start --single-run - -test-all: - @concurrently \ - "make test-node" \ - "make test-browser" - -test: - @if [ "x$(BROWSER)" = "x" ]; then \ - $(MAKE) test-node; \ - else \ - $(MAKE) test-browser; \ - fi - -clean: - rimraf dist coverage - -.PHONY: browser install clean lint test test-all test-node test-browser diff --git a/node_modules/debug/README.md b/node_modules/debug/README.md deleted file mode 100644 index 8e754d1..0000000 --- a/node_modules/debug/README.md +++ /dev/null @@ -1,368 +0,0 @@ -# debug -[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug) [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master) [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) -[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors) - - - -A tiny JavaScript debugging utility modelled after Node.js core's debugging -technique. Works in Node.js and web browsers. - -## Installation - -```bash -$ npm install debug -``` - -## Usage - -`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole. - -Example [_app.js_](./examples/node/app.js): - -```js -var debug = require('debug')('http') - , http = require('http') - , name = 'My App'; - -// fake app - -debug('booting %o', name); - -http.createServer(function(req, res){ - debug(req.method + ' ' + req.url); - res.end('hello\n'); -}).listen(3000, function(){ - debug('listening'); -}); - -// fake worker of some kind - -require('./worker'); -``` - -Example [_worker.js_](./examples/node/worker.js): - -```js -var a = require('debug')('worker:a') - , b = require('debug')('worker:b'); - -function work() { - a('doing lots of uninteresting work'); - setTimeout(work, Math.random() * 1000); -} - -work(); - -function workb() { - b('doing some work'); - setTimeout(workb, Math.random() * 2000); -} - -workb(); -``` - -The `DEBUG` environment variable is then used to enable these based on space or -comma-delimited names. - -Here are some examples: - -screen shot 2017-08-08 at 12 53 04 pm -screen shot 2017-08-08 at 12 53 38 pm -screen shot 2017-08-08 at 12 53 25 pm - -#### Windows note - -On Windows the environment variable is set using the `set` command. - -```cmd -set DEBUG=*,-not_this -``` - -Note that PowerShell uses different syntax to set environment variables. - -```cmd -$env:DEBUG = "*,-not_this" -``` - -Then, run the program to be debugged as usual. - - -## Namespace Colors - -Every debug instance has a color generated for it based on its namespace name. -This helps when visually parsing the debug output to identify which debug instance -a debug line belongs to. - -#### Node.js - -In Node.js, colors are enabled when stderr is a TTY. You also _should_ install -the [`supports-color`](https://npmjs.org/supports-color) module alongside debug, -otherwise debug will only use a small handful of basic colors. - - - -#### Web Browser - -Colors are also enabled on "Web Inspectors" that understand the `%c` formatting -option. These are WebKit web inspectors, Firefox ([since version -31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) -and the Firebug plugin for Firefox (any version). - - - - -## Millisecond diff - -When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. - - - -When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below: - - - - -## Conventions - -If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable. You can then use it for normal output as well as debug output. - -## Wildcards - -The `*` character may be used as a wildcard. Suppose for example your library has -debuggers named "connect:bodyParser", "connect:compress", "connect:session", -instead of listing all three with -`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do -`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. - -You can also exclude specific debuggers by prefixing them with a "-" character. -For example, `DEBUG=*,-connect:*` would include all debuggers except those -starting with "connect:". - -## Environment Variables - -When running through Node.js, you can set a few environment variables that will -change the behavior of the debug logging: - -| Name | Purpose | -|-----------|-------------------------------------------------| -| `DEBUG` | Enables/disables specific debugging namespaces. | -| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY). | -| `DEBUG_COLORS`| Whether or not to use colors in the debug output. | -| `DEBUG_DEPTH` | Object inspection depth. | -| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. | - - -__Note:__ The environment variables beginning with `DEBUG_` end up being -converted into an Options object that gets used with `%o`/`%O` formatters. -See the Node.js documentation for -[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options) -for the complete list. - -## Formatters - -Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. -Below are the officially supported formatters: - -| Formatter | Representation | -|-----------|----------------| -| `%O` | Pretty-print an Object on multiple lines. | -| `%o` | Pretty-print an Object all on a single line. | -| `%s` | String. | -| `%d` | Number (both integer and float). | -| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. | -| `%%` | Single percent sign ('%'). This does not consume an argument. | - - -### Custom formatters - -You can add custom formatters by extending the `debug.formatters` object. -For example, if you wanted to add support for rendering a Buffer as hex with -`%h`, you could do something like: - -```js -const createDebug = require('debug') -createDebug.formatters.h = (v) => { - return v.toString('hex') -} - -// …elsewhere -const debug = createDebug('foo') -debug('this is hex: %h', new Buffer('hello world')) -// foo this is hex: 68656c6c6f20776f726c6421 +0ms -``` - - -## Browser Support - -You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify), -or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest), -if you don't want to build it yourself. - -Debug's enable state is currently persisted by `localStorage`. -Consider the situation shown below where you have `worker:a` and `worker:b`, -and wish to debug both. You can enable this using `localStorage.debug`: - -```js -localStorage.debug = 'worker:*' -``` - -And then refresh the page. - -```js -a = debug('worker:a'); -b = debug('worker:b'); - -setInterval(function(){ - a('doing some work'); -}, 1000); - -setInterval(function(){ - b('doing some work'); -}, 1200); -``` - - -## Output streams - - By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method: - -Example [_stdout.js_](./examples/node/stdout.js): - -```js -var debug = require('debug'); -var error = debug('app:error'); - -// by default stderr is used -error('goes to stderr!'); - -var log = debug('app:log'); -// set this namespace to log via console.log -log.log = console.log.bind(console); // don't forget to bind to console! -log('goes to stdout'); -error('still goes to stderr!'); - -// set all output to go via console.info -// overrides all per-namespace log settings -debug.log = console.info.bind(console); -error('now goes to stdout via console.info'); -log('still goes to stdout, but via console.info now'); -``` - -## Checking whether a debug target is enabled - -After you've created a debug instance, you can determine whether or not it is -enabled by checking the `enabled` property: - -```javascript -const debug = require('debug')('http'); - -if (debug.enabled) { - // do stuff... -} -``` - -You can also manually toggle this property to force the debug instance to be -enabled or disabled. - - -## Authors - - - TJ Holowaychuk - - Nathan Rajlich - - Andrew Rhyne - -## Backers - -Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)] - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -## Sponsors - -Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)] - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -## License - -(The MIT License) - -Copyright (c) 2014-2017 TJ Holowaychuk <tj@vision-media.ca> - -Permission is hereby granted, free of charge, to any person obtaining -a copy of this software and associated documentation files (the -'Software'), to deal in the Software without restriction, including -without limitation the rights to use, copy, modify, merge, publish, -distribute, sublicense, and/or sell copies of the Software, and to -permit persons to whom the Software is furnished to do so, subject to -the following conditions: - -The above copyright notice and this permission notice shall be -included in all copies or substantial portions of the Software. - -THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, -EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF -MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. -IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY -CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, -TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE -SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/debug/karma.conf.js b/node_modules/debug/karma.conf.js deleted file mode 100644 index 103a82d..0000000 --- a/node_modules/debug/karma.conf.js +++ /dev/null @@ -1,70 +0,0 @@ -// Karma configuration -// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC) - -module.exports = function(config) { - config.set({ - - // base path that will be used to resolve all patterns (eg. files, exclude) - basePath: '', - - - // frameworks to use - // available frameworks: https://npmjs.org/browse/keyword/karma-adapter - frameworks: ['mocha', 'chai', 'sinon'], - - - // list of files / patterns to load in the browser - files: [ - 'dist/debug.js', - 'test/*spec.js' - ], - - - // list of files to exclude - exclude: [ - 'src/node.js' - ], - - - // preprocess matching files before serving them to the browser - // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor - preprocessors: { - }, - - // test results reporter to use - // possible values: 'dots', 'progress' - // available reporters: https://npmjs.org/browse/keyword/karma-reporter - reporters: ['progress'], - - - // web server port - port: 9876, - - - // enable / disable colors in the output (reporters and logs) - colors: true, - - - // level of logging - // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG - logLevel: config.LOG_INFO, - - - // enable / disable watching file and executing tests whenever any file changes - autoWatch: true, - - - // start these browsers - // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher - browsers: ['PhantomJS'], - - - // Continuous Integration mode - // if true, Karma captures browsers, runs the tests and exits - singleRun: false, - - // Concurrency level - // how many browser should be started simultaneous - concurrency: Infinity - }) -} diff --git a/node_modules/debug/node.js b/node_modules/debug/node.js deleted file mode 100644 index 7fc36fe..0000000 --- a/node_modules/debug/node.js +++ /dev/null @@ -1 +0,0 @@ -module.exports = require('./src/node'); diff --git a/node_modules/debug/package.json b/node_modules/debug/package.json deleted file mode 100644 index 69d89d0..0000000 --- a/node_modules/debug/package.json +++ /dev/null @@ -1,85 +0,0 @@ -{ - "_args": [ - [ - "debug@3.1.0", - "/Users/wphromma/workspace/actions-curl" - ] - ], - "_from": "debug@3.1.0", - "_id": "debug@3.1.0", - "_inBundle": false, - "_integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==", - "_location": "/debug", - "_phantomChildren": {}, - "_requested": { - "type": "version", - "registry": true, - "raw": "debug@3.1.0", - "name": "debug", - "escapedName": "debug", - "rawSpec": "3.1.0", - "saveSpec": null, - "fetchSpec": "3.1.0" - }, - "_requiredBy": [ - "/follow-redirects" - ], - "_resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz", - "_spec": "3.1.0", - "_where": "/Users/wphromma/workspace/actions-curl", - "author": { - "name": "TJ Holowaychuk", - "email": "tj@vision-media.ca" - }, - "browser": "./src/browser.js", - "bugs": { - "url": "https://github.com/visionmedia/debug/issues" - }, - "contributors": [ - { - "name": "Nathan Rajlich", - "email": "nathan@tootallnate.net", - "url": "http://n8.io" - }, - { - "name": "Andrew Rhyne", - "email": "rhyneandrew@gmail.com" - } - ], - "dependencies": { - "ms": "2.0.0" - }, - "description": "small debugging utility", - "devDependencies": { - "browserify": "14.4.0", - "chai": "^3.5.0", - "concurrently": "^3.1.0", - "coveralls": "^2.11.15", - "eslint": "^3.12.1", - "istanbul": "^0.4.5", - "karma": "^1.3.0", - "karma-chai": "^0.1.0", - "karma-mocha": "^1.3.0", - "karma-phantomjs-launcher": "^1.0.2", - "karma-sinon": "^1.0.5", - "mocha": "^3.2.0", - "mocha-lcov-reporter": "^1.2.0", - "rimraf": "^2.5.4", - "sinon": "^1.17.6", - "sinon-chai": "^2.8.0" - }, - "homepage": "https://github.com/visionmedia/debug#readme", - "keywords": [ - "debug", - "log", - "debugger" - ], - "license": "MIT", - "main": "./src/index.js", - "name": "debug", - "repository": { - "type": "git", - "url": "git://github.com/visionmedia/debug.git" - }, - "version": "3.1.0" -} diff --git a/node_modules/debug/src/browser.js b/node_modules/debug/src/browser.js deleted file mode 100644 index f5149ff..0000000 --- a/node_modules/debug/src/browser.js +++ /dev/null @@ -1,195 +0,0 @@ -/** - * This is the web browser implementation of `debug()`. - * - * Expose `debug()` as the module. - */ - -exports = module.exports = require('./debug'); -exports.log = log; -exports.formatArgs = formatArgs; -exports.save = save; -exports.load = load; -exports.useColors = useColors; -exports.storage = 'undefined' != typeof chrome - && 'undefined' != typeof chrome.storage - ? chrome.storage.local - : localstorage(); - -/** - * Colors. - */ - -exports.colors = [ - '#0000CC', '#0000FF', '#0033CC', '#0033FF', '#0066CC', '#0066FF', '#0099CC', - '#0099FF', '#00CC00', '#00CC33', '#00CC66', '#00CC99', '#00CCCC', '#00CCFF', - '#3300CC', '#3300FF', '#3333CC', '#3333FF', '#3366CC', '#3366FF', '#3399CC', - '#3399FF', '#33CC00', '#33CC33', '#33CC66', '#33CC99', '#33CCCC', '#33CCFF', - '#6600CC', '#6600FF', '#6633CC', '#6633FF', '#66CC00', '#66CC33', '#9900CC', - '#9900FF', '#9933CC', '#9933FF', '#99CC00', '#99CC33', '#CC0000', '#CC0033', - '#CC0066', '#CC0099', '#CC00CC', '#CC00FF', '#CC3300', '#CC3333', '#CC3366', - '#CC3399', '#CC33CC', '#CC33FF', '#CC6600', '#CC6633', '#CC9900', '#CC9933', - '#CCCC00', '#CCCC33', '#FF0000', '#FF0033', '#FF0066', '#FF0099', '#FF00CC', - '#FF00FF', '#FF3300', '#FF3333', '#FF3366', '#FF3399', '#FF33CC', '#FF33FF', - '#FF6600', '#FF6633', '#FF9900', '#FF9933', '#FFCC00', '#FFCC33' -]; - -/** - * Currently only WebKit-based Web Inspectors, Firefox >= v31, - * and the Firebug extension (any Firefox version) are known - * to support "%c" CSS customizations. - * - * TODO: add a `localStorage` variable to explicitly enable/disable colors - */ - -function useColors() { - // NB: In an Electron preload script, document will be defined but not fully - // initialized. Since we know we're in Chrome, we'll just detect this case - // explicitly - if (typeof window !== 'undefined' && window.process && window.process.type === 'renderer') { - return true; - } - - // Internet Explorer and Edge do not support colors. - if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) { - return false; - } - - // is webkit? http://stackoverflow.com/a/16459606/376773 - // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 - return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || - // is firebug? http://stackoverflow.com/a/398120/376773 - (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || - // is firefox >= v31? - // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages - (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) || - // double check webkit in userAgent just in case we are in a worker - (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); -} - -/** - * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. - */ - -exports.formatters.j = function(v) { - try { - return JSON.stringify(v); - } catch (err) { - return '[UnexpectedJSONParseError]: ' + err.message; - } -}; - - -/** - * Colorize log arguments if enabled. - * - * @api public - */ - -function formatArgs(args) { - var useColors = this.useColors; - - args[0] = (useColors ? '%c' : '') - + this.namespace - + (useColors ? ' %c' : ' ') - + args[0] - + (useColors ? '%c ' : ' ') - + '+' + exports.humanize(this.diff); - - if (!useColors) return; - - var c = 'color: ' + this.color; - args.splice(1, 0, c, 'color: inherit') - - // the final "%c" is somewhat tricky, because there could be other - // arguments passed either before or after the %c, so we need to - // figure out the correct index to insert the CSS into - var index = 0; - var lastC = 0; - args[0].replace(/%[a-zA-Z%]/g, function(match) { - if ('%%' === match) return; - index++; - if ('%c' === match) { - // we only are interested in the *last* %c - // (the user may have provided their own) - lastC = index; - } - }); - - args.splice(lastC, 0, c); -} - -/** - * Invokes `console.log()` when available. - * No-op when `console.log` is not a "function". - * - * @api public - */ - -function log() { - // this hackery is required for IE8/9, where - // the `console.log` function doesn't have 'apply' - return 'object' === typeof console - && console.log - && Function.prototype.apply.call(console.log, console, arguments); -} - -/** - * Save `namespaces`. - * - * @param {String} namespaces - * @api private - */ - -function save(namespaces) { - try { - if (null == namespaces) { - exports.storage.removeItem('debug'); - } else { - exports.storage.debug = namespaces; - } - } catch(e) {} -} - -/** - * Load `namespaces`. - * - * @return {String} returns the previously persisted debug modes - * @api private - */ - -function load() { - var r; - try { - r = exports.storage.debug; - } catch(e) {} - - // If debug isn't set in LS, and we're in Electron, try to load $DEBUG - if (!r && typeof process !== 'undefined' && 'env' in process) { - r = process.env.DEBUG; - } - - return r; -} - -/** - * Enable namespaces listed in `localStorage.debug` initially. - */ - -exports.enable(load()); - -/** - * Localstorage attempts to return the localstorage. - * - * This is necessary because safari throws - * when a user disables cookies/localstorage - * and you attempt to access it. - * - * @return {LocalStorage} - * @api private - */ - -function localstorage() { - try { - return window.localStorage; - } catch (e) {} -} diff --git a/node_modules/debug/src/debug.js b/node_modules/debug/src/debug.js deleted file mode 100644 index 77e6384..0000000 --- a/node_modules/debug/src/debug.js +++ /dev/null @@ -1,225 +0,0 @@ - -/** - * This is the common logic for both the Node.js and web browser - * implementations of `debug()`. - * - * Expose `debug()` as the module. - */ - -exports = module.exports = createDebug.debug = createDebug['default'] = createDebug; -exports.coerce = coerce; -exports.disable = disable; -exports.enable = enable; -exports.enabled = enabled; -exports.humanize = require('ms'); - -/** - * Active `debug` instances. - */ -exports.instances = []; - -/** - * The currently active debug mode names, and names to skip. - */ - -exports.names = []; -exports.skips = []; - -/** - * Map of special "%n" handling functions, for the debug "format" argument. - * - * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". - */ - -exports.formatters = {}; - -/** - * Select a color. - * @param {String} namespace - * @return {Number} - * @api private - */ - -function selectColor(namespace) { - var hash = 0, i; - - for (i in namespace) { - hash = ((hash << 5) - hash) + namespace.charCodeAt(i); - hash |= 0; // Convert to 32bit integer - } - - return exports.colors[Math.abs(hash) % exports.colors.length]; -} - -/** - * Create a debugger with the given `namespace`. - * - * @param {String} namespace - * @return {Function} - * @api public - */ - -function createDebug(namespace) { - - var prevTime; - - function debug() { - // disabled? - if (!debug.enabled) return; - - var self = debug; - - // set `diff` timestamp - var curr = +new Date(); - var ms = curr - (prevTime || curr); - self.diff = ms; - self.prev = prevTime; - self.curr = curr; - prevTime = curr; - - // turn the `arguments` into a proper Array - var args = new Array(arguments.length); - for (var i = 0; i < args.length; i++) { - args[i] = arguments[i]; - } - - args[0] = exports.coerce(args[0]); - - if ('string' !== typeof args[0]) { - // anything else let's inspect with %O - args.unshift('%O'); - } - - // apply any `formatters` transformations - var index = 0; - args[0] = args[0].replace(/%([a-zA-Z%])/g, function(match, format) { - // if we encounter an escaped % then don't increase the array index - if (match === '%%') return match; - index++; - var formatter = exports.formatters[format]; - if ('function' === typeof formatter) { - var val = args[index]; - match = formatter.call(self, val); - - // now we need to remove `args[index]` since it's inlined in the `format` - args.splice(index, 1); - index--; - } - return match; - }); - - // apply env-specific formatting (colors, etc.) - exports.formatArgs.call(self, args); - - var logFn = debug.log || exports.log || console.log.bind(console); - logFn.apply(self, args); - } - - debug.namespace = namespace; - debug.enabled = exports.enabled(namespace); - debug.useColors = exports.useColors(); - debug.color = selectColor(namespace); - debug.destroy = destroy; - - // env-specific initialization logic for debug instances - if ('function' === typeof exports.init) { - exports.init(debug); - } - - exports.instances.push(debug); - - return debug; -} - -function destroy () { - var index = exports.instances.indexOf(this); - if (index !== -1) { - exports.instances.splice(index, 1); - return true; - } else { - return false; - } -} - -/** - * Enables a debug mode by namespaces. This can include modes - * separated by a colon and wildcards. - * - * @param {String} namespaces - * @api public - */ - -function enable(namespaces) { - exports.save(namespaces); - - exports.names = []; - exports.skips = []; - - var i; - var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/); - var len = split.length; - - for (i = 0; i < len; i++) { - if (!split[i]) continue; // ignore empty strings - namespaces = split[i].replace(/\*/g, '.*?'); - if (namespaces[0] === '-') { - exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$')); - } else { - exports.names.push(new RegExp('^' + namespaces + '$')); - } - } - - for (i = 0; i < exports.instances.length; i++) { - var instance = exports.instances[i]; - instance.enabled = exports.enabled(instance.namespace); - } -} - -/** - * Disable debug output. - * - * @api public - */ - -function disable() { - exports.enable(''); -} - -/** - * Returns true if the given mode name is enabled, false otherwise. - * - * @param {String} name - * @return {Boolean} - * @api public - */ - -function enabled(name) { - if (name[name.length - 1] === '*') { - return true; - } - var i, len; - for (i = 0, len = exports.skips.length; i < len; i++) { - if (exports.skips[i].test(name)) { - return false; - } - } - for (i = 0, len = exports.names.length; i < len; i++) { - if (exports.names[i].test(name)) { - return true; - } - } - return false; -} - -/** - * Coerce `val`. - * - * @param {Mixed} val - * @return {Mixed} - * @api private - */ - -function coerce(val) { - if (val instanceof Error) return val.stack || val.message; - return val; -} diff --git a/node_modules/debug/src/index.js b/node_modules/debug/src/index.js deleted file mode 100644 index cabcbcd..0000000 --- a/node_modules/debug/src/index.js +++ /dev/null @@ -1,10 +0,0 @@ -/** - * Detect Electron renderer process, which is node, but we should - * treat as a browser. - */ - -if (typeof process === 'undefined' || process.type === 'renderer') { - module.exports = require('./browser.js'); -} else { - module.exports = require('./node.js'); -} diff --git a/node_modules/debug/src/node.js b/node_modules/debug/src/node.js deleted file mode 100644 index d666fb9..0000000 --- a/node_modules/debug/src/node.js +++ /dev/null @@ -1,186 +0,0 @@ -/** - * Module dependencies. - */ - -var tty = require('tty'); -var util = require('util'); - -/** - * This is the Node.js implementation of `debug()`. - * - * Expose `debug()` as the module. - */ - -exports = module.exports = require('./debug'); -exports.init = init; -exports.log = log; -exports.formatArgs = formatArgs; -exports.save = save; -exports.load = load; -exports.useColors = useColors; - -/** - * Colors. - */ - -exports.colors = [ 6, 2, 3, 4, 5, 1 ]; - -try { - var supportsColor = require('supports-color'); - if (supportsColor && supportsColor.level >= 2) { - exports.colors = [ - 20, 21, 26, 27, 32, 33, 38, 39, 40, 41, 42, 43, 44, 45, 56, 57, 62, 63, 68, - 69, 74, 75, 76, 77, 78, 79, 80, 81, 92, 93, 98, 99, 112, 113, 128, 129, 134, - 135, 148, 149, 160, 161, 162, 163, 164, 165, 166, 167, 168, 169, 170, 171, - 172, 173, 178, 179, 184, 185, 196, 197, 198, 199, 200, 201, 202, 203, 204, - 205, 206, 207, 208, 209, 214, 215, 220, 221 - ]; - } -} catch (err) { - // swallow - we only care if `supports-color` is available; it doesn't have to be. -} - -/** - * Build up the default `inspectOpts` object from the environment variables. - * - * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js - */ - -exports.inspectOpts = Object.keys(process.env).filter(function (key) { - return /^debug_/i.test(key); -}).reduce(function (obj, key) { - // camel-case - var prop = key - .substring(6) - .toLowerCase() - .replace(/_([a-z])/g, function (_, k) { return k.toUpperCase() }); - - // coerce string value into JS value - var val = process.env[key]; - if (/^(yes|on|true|enabled)$/i.test(val)) val = true; - else if (/^(no|off|false|disabled)$/i.test(val)) val = false; - else if (val === 'null') val = null; - else val = Number(val); - - obj[prop] = val; - return obj; -}, {}); - -/** - * Is stdout a TTY? Colored output is enabled when `true`. - */ - -function useColors() { - return 'colors' in exports.inspectOpts - ? Boolean(exports.inspectOpts.colors) - : tty.isatty(process.stderr.fd); -} - -/** - * Map %o to `util.inspect()`, all on a single line. - */ - -exports.formatters.o = function(v) { - this.inspectOpts.colors = this.useColors; - return util.inspect(v, this.inspectOpts) - .split('\n').map(function(str) { - return str.trim() - }).join(' '); -}; - -/** - * Map %o to `util.inspect()`, allowing multiple lines if needed. - */ - -exports.formatters.O = function(v) { - this.inspectOpts.colors = this.useColors; - return util.inspect(v, this.inspectOpts); -}; - -/** - * Adds ANSI color escape codes if enabled. - * - * @api public - */ - -function formatArgs(args) { - var name = this.namespace; - var useColors = this.useColors; - - if (useColors) { - var c = this.color; - var colorCode = '\u001b[3' + (c < 8 ? c : '8;5;' + c); - var prefix = ' ' + colorCode + ';1m' + name + ' ' + '\u001b[0m'; - - args[0] = prefix + args[0].split('\n').join('\n' + prefix); - args.push(colorCode + 'm+' + exports.humanize(this.diff) + '\u001b[0m'); - } else { - args[0] = getDate() + name + ' ' + args[0]; - } -} - -function getDate() { - if (exports.inspectOpts.hideDate) { - return ''; - } else { - return new Date().toISOString() + ' '; - } -} - -/** - * Invokes `util.format()` with the specified arguments and writes to stderr. - */ - -function log() { - return process.stderr.write(util.format.apply(util, arguments) + '\n'); -} - -/** - * Save `namespaces`. - * - * @param {String} namespaces - * @api private - */ - -function save(namespaces) { - if (null == namespaces) { - // If you set a process.env field to null or undefined, it gets cast to the - // string 'null' or 'undefined'. Just delete instead. - delete process.env.DEBUG; - } else { - process.env.DEBUG = namespaces; - } -} - -/** - * Load `namespaces`. - * - * @return {String} returns the previously persisted debug modes - * @api private - */ - -function load() { - return process.env.DEBUG; -} - -/** - * Init logic for `debug` instances. - * - * Create a new `inspectOpts` object in case `useColors` is set - * differently for a particular `debug` instance. - */ - -function init (debug) { - debug.inspectOpts = {}; - - var keys = Object.keys(exports.inspectOpts); - for (var i = 0; i < keys.length; i++) { - debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]]; - } -} - -/** - * Enable namespaces listed in `process.env.DEBUG` initially. - */ - -exports.enable(load()); diff --git a/node_modules/follow-redirects/README.md b/node_modules/follow-redirects/README.md index 6d41337..ea618ab 100644 --- a/node_modules/follow-redirects/README.md +++ b/node_modules/follow-redirects/README.md @@ -1,26 +1,25 @@ ## Follow Redirects -Drop-in replacement for Nodes `http` and `https` that automatically follows redirects. +Drop-in replacement for Node's `http` and `https` modules that automatically follows redirects. [![npm version](https://img.shields.io/npm/v/follow-redirects.svg)](https://www.npmjs.com/package/follow-redirects) -[![Build Status](https://travis-ci.org/follow-redirects/follow-redirects.svg?branch=master)](https://travis-ci.org/follow-redirects/follow-redirects) +[![Build Status](https://github.com/follow-redirects/follow-redirects/workflows/CI/badge.svg)](https://github.com/follow-redirects/follow-redirects/actions) [![Coverage Status](https://coveralls.io/repos/follow-redirects/follow-redirects/badge.svg?branch=master)](https://coveralls.io/r/follow-redirects/follow-redirects?branch=master) -[![Dependency Status](https://david-dm.org/follow-redirects/follow-redirects.svg)](https://david-dm.org/follow-redirects/follow-redirects) [![npm downloads](https://img.shields.io/npm/dm/follow-redirects.svg)](https://www.npmjs.com/package/follow-redirects) +[![Sponsor on GitHub](https://img.shields.io/static/v1?label=Sponsor&message=%F0%9F%92%96&logo=GitHub)](https://github.com/sponsors/RubenVerborgh) `follow-redirects` provides [request](https://nodejs.org/api/http.html#http_http_request_options_callback) and [get](https://nodejs.org/api/http.html#http_http_get_options_callback) methods that behave identically to those found on the native [http](https://nodejs.org/api/http.html#http_http_request_options_callback) and [https](https://nodejs.org/api/https.html#https_https_request_options_callback) modules, with the exception that they will seamlessly follow redirects. ```javascript -var http = require('follow-redirects').http; -var https = require('follow-redirects').https; +const { http, https } = require('follow-redirects'); -http.get('http://bit.ly/900913', function (response) { - response.on('data', function (chunk) { +http.get('http://bit.ly/900913', response => { + response.on('data', chunk => { console.log(chunk); }); -}).on('error', function (err) { +}).on('error', err => { console.error(err); }); ``` @@ -29,13 +28,14 @@ You can inspect the final redirected URL through the `responseUrl` property on t If no redirection happened, `responseUrl` is the original request URL. ```javascript -https.request({ +const request = https.request({ host: 'bitly.com', path: '/UHfDGO', -}, function (response) { +}, response => { console.log(response.responseUrl); // 'http://duckduckgo.com/robots.txt' }); +request.end(); ``` ## Options @@ -43,7 +43,7 @@ https.request({ Global options are set directly on the `follow-redirects` module: ```javascript -var followRedirects = require('follow-redirects'); +const followRedirects = require('follow-redirects'); followRedirects.maxRedirects = 10; followRedirects.maxBodyLength = 20 * 1024 * 1024; // 20 MB ``` @@ -54,16 +54,23 @@ The following global options are supported: - `maxBodyLength` (default: 10MB) – sets the maximum size of the request body; if exceeded, an error will be emitted. - ### Per-request options Per-request options are set by passing an `options` object: ```javascript -var url = require('url'); -var followRedirects = require('follow-redirects'); +const url = require('url'); +const { http, https } = require('follow-redirects'); -var options = url.parse('http://bit.ly/900913'); +const options = url.parse('http://bit.ly/900913'); options.maxRedirects = 10; +options.beforeRedirect = (options, { headers }) => { + // Use this to adjust the request options upon redirecting, + // to inspect the latest response headers, + // or to cancel the request by throwing an error + if (options.hostname === "example.com") { + options.auth = "user:password"; + } +}; http.request(options); ``` @@ -75,6 +82,8 @@ the following per-request options are supported: - `maxBodyLength` (default: 10MB) – sets the maximum size of the request body; if exceeded, an error will be emitted. +- `beforeRedirect` (default: `undefined`) – optionally change the request `options` on redirects, or abort the request by throwing an error. + - `agents` (default: `undefined`) – sets the `agent` option per protocol, since HTTP and HTTPS use different agents. Example value: `{ http: new http.Agent(), https: new https.Agent() }` - `trackRedirects` (default: `false`) – whether to store the redirected response details into the `redirects` array on the response object. @@ -88,7 +97,7 @@ To enable features such as caching and/or intermediate request tracking, you might instead want to wrap `follow-redirects` around custom protocol implementations: ```javascript -var followRedirects = require('follow-redirects').wrap({ +const { http, https } = require('follow-redirects').wrap({ http: require('your-custom-http'), https: require('your-custom-https'), }); @@ -96,42 +105,26 @@ var followRedirects = require('follow-redirects').wrap({ Such custom protocols only need an implementation of the `request` method. -## Browserify Usage +## Browser Usage -Due to the way `XMLHttpRequest` works, the `browserify` versions of `http` and `https` already follow redirects. - If you are *only* targeting the browser, then this library has little value for you. If you want to write cross - platform code for node and the browser, `follow-redirects` provides a great solution for making the native node - modules behave the same as they do in browserified builds in the browser. To avoid bundling unnecessary code - you should tell browserify to swap out `follow-redirects` with the standard modules when bundling. - To make this easier, you need to change how you require the modules: +Due to the way the browser works, +the `http` and `https` browser equivalents perform redirects by default. +By requiring `follow-redirects` this way: ```javascript -var http = require('follow-redirects/http'); -var https = require('follow-redirects/https'); +const http = require('follow-redirects/http'); +const https = require('follow-redirects/https'); ``` +you can easily tell webpack and friends to replace +`follow-redirect` by the built-in versions: -You can then replace `follow-redirects` in your browserify configuration like so: - -```javascript -"browser": { +```json +{ "follow-redirects/http" : "http", "follow-redirects/https" : "https" } ``` -The `browserify-http` module has not kept pace with node development, and no long behaves identically to the native - module when running in the browser. If you are experiencing problems, you may want to check out - [browserify-http-2](https://www.npmjs.com/package/http-browserify-2). It is more actively maintained and - attempts to address a few of the shortcomings of `browserify-http`. In that case, your browserify config should - look something like this: - -```javascript -"browser": { - "follow-redirects/http" : "browserify-http-2/http", - "follow-redirects/https" : "browserify-http-2/https" -} -``` - ## Contributing Pull Requests are always welcome. Please [file an issue](https://github.com/follow-redirects/follow-redirects/issues) @@ -146,10 +139,10 @@ Pull Requests are always welcome. Please [file an issue](https://github.com/foll ## Authors -- Olivier Lalonde (olalonde@gmail.com) -- James Talmage (james@talmage.io) - [Ruben Verborgh](https://ruben.verborgh.org/) +- [Olivier Lalonde](mailto:olalonde@gmail.com) +- [James Talmage](mailto:james@talmage.io) ## License -[https://github.com/follow-redirects/follow-redirects/blob/master/LICENSE](MIT License) +[MIT License](https://github.com/follow-redirects/follow-redirects/blob/master/LICENSE) diff --git a/node_modules/follow-redirects/debug.js b/node_modules/follow-redirects/debug.js new file mode 100644 index 0000000..decb77d --- /dev/null +++ b/node_modules/follow-redirects/debug.js @@ -0,0 +1,15 @@ +var debug; + +module.exports = function () { + if (!debug) { + try { + /* eslint global-require: off */ + debug = require("debug")("follow-redirects"); + } + catch (error) { /* */ } + if (typeof debug !== "function") { + debug = function () { /* */ }; + } + } + debug.apply(null, arguments); +}; diff --git a/node_modules/follow-redirects/index.js b/node_modules/follow-redirects/index.js index 4d7297a..3f819d1 100644 --- a/node_modules/follow-redirects/index.js +++ b/node_modules/follow-redirects/index.js @@ -1,44 +1,51 @@ var url = require("url"); +var URL = url.URL; var http = require("http"); var https = require("https"); -var assert = require("assert"); var Writable = require("stream").Writable; -var debug = require("debug")("follow-redirects"); - -// RFC7231§4.2.1: Of the request methods defined by this specification, -// the GET, HEAD, OPTIONS, and TRACE methods are defined to be safe. -var SAFE_METHODS = { GET: true, HEAD: true, OPTIONS: true, TRACE: true }; +var assert = require("assert"); +var debug = require("./debug"); // Create handlers that pass events from native requests +var events = ["abort", "aborted", "connect", "error", "socket", "timeout"]; var eventHandlers = Object.create(null); -["abort", "aborted", "error", "socket", "timeout"].forEach(function (event) { - eventHandlers[event] = function (arg) { - this._redirectable.emit(event, arg); +events.forEach(function (event) { + eventHandlers[event] = function (arg1, arg2, arg3) { + this._redirectable.emit(event, arg1, arg2, arg3); }; }); +// Error types with codes +var RedirectionError = createErrorType( + "ERR_FR_REDIRECTION_FAILURE", + "Redirected request failed" +); +var TooManyRedirectsError = createErrorType( + "ERR_FR_TOO_MANY_REDIRECTS", + "Maximum number of redirects exceeded" +); +var MaxBodyLengthExceededError = createErrorType( + "ERR_FR_MAX_BODY_LENGTH_EXCEEDED", + "Request body larger than maxBodyLength limit" +); +var WriteAfterEndError = createErrorType( + "ERR_STREAM_WRITE_AFTER_END", + "write after end" +); + // An HTTP(S) request that can be redirected function RedirectableRequest(options, responseCallback) { // Initialize the request Writable.call(this); - options.headers = options.headers || {}; + this._sanitizeOptions(options); this._options = options; + this._ended = false; + this._ending = false; this._redirectCount = 0; this._redirects = []; this._requestBodyLength = 0; this._requestBodyBuffers = []; - // Since http.request treats host as an alias of hostname, - // but the url module interprets host as hostname plus port, - // eliminate the host property to avoid confusion. - if (options.host) { - // Use hostname if set, because it has precedence - if (!options.hostname) { - options.hostname = options.host; - } - delete options.host; - } - // Attach a callback if passed if (responseCallback) { this.on("response", responseCallback); @@ -50,28 +57,26 @@ function RedirectableRequest(options, responseCallback) { self._processResponse(response); }; - // Complete the URL object when necessary - if (!options.pathname && options.path) { - var searchPos = options.path.indexOf("?"); - if (searchPos < 0) { - options.pathname = options.path; - } - else { - options.pathname = options.path.substring(0, searchPos); - options.search = options.path.substring(searchPos); - } - } - // Perform the first request this._performRequest(); } RedirectableRequest.prototype = Object.create(Writable.prototype); +RedirectableRequest.prototype.abort = function () { + abortRequest(this._currentRequest); + this.emit("abort"); +}; + // Writes buffered data to the current native request RedirectableRequest.prototype.write = function (data, encoding, callback) { + // Writing is not allowed if end has been called + if (this._ending) { + throw new WriteAfterEndError(); + } + // Validate input and shift parameters if necessary if (!(typeof data === "string" || typeof data === "object" && ("length" in data))) { - throw new Error("data should be a string, Buffer or Uint8Array"); + throw new TypeError("data should be a string, Buffer or Uint8Array"); } if (typeof encoding === "function") { callback = encoding; @@ -94,7 +99,7 @@ RedirectableRequest.prototype.write = function (data, encoding, callback) { } // Error when we exceed the maximum body length else { - this.emit("error", new Error("Request body larger than maxBodyLength limit")); + this.emit("error", new MaxBodyLengthExceededError()); this.abort(); } }; @@ -111,11 +116,20 @@ RedirectableRequest.prototype.end = function (data, encoding, callback) { encoding = null; } - // Write data and end - var currentRequest = this._currentRequest; - this.write(data || "", encoding, function () { - currentRequest.end(null, null, callback); - }); + // Write data if needed and end + if (!data) { + this._ended = this._ending = true; + this._currentRequest.end(null, null, callback); + } + else { + var self = this; + var currentRequest = this._currentRequest; + this.write(data, encoding, function () { + self._ended = true; + currentRequest.end(null, null, callback); + }); + this._ending = true; + } }; // Sets a header value on the current native request @@ -130,10 +144,75 @@ RedirectableRequest.prototype.removeHeader = function (name) { this._currentRequest.removeHeader(name); }; +// Global timeout for all underlying requests +RedirectableRequest.prototype.setTimeout = function (msecs, callback) { + var self = this; + + // Destroys the socket on timeout + function destroyOnTimeout(socket) { + socket.setTimeout(msecs); + socket.removeListener("timeout", socket.destroy); + socket.addListener("timeout", socket.destroy); + } + + // Sets up a timer to trigger a timeout event + function startTimer(socket) { + if (self._timeout) { + clearTimeout(self._timeout); + } + self._timeout = setTimeout(function () { + self.emit("timeout"); + clearTimer(); + }, msecs); + destroyOnTimeout(socket); + } + + // Stops a timeout from triggering + function clearTimer() { + // Clear the timeout + if (self._timeout) { + clearTimeout(self._timeout); + self._timeout = null; + } + + // Clean up all attached listeners + self.removeListener("abort", clearTimer); + self.removeListener("error", clearTimer); + self.removeListener("response", clearTimer); + if (callback) { + self.removeListener("timeout", callback); + } + if (!self.socket) { + self._currentRequest.removeListener("socket", startTimer); + } + } + + // Attach callback if passed + if (callback) { + this.on("timeout", callback); + } + + // Start the timer if or when the socket is opened + if (this.socket) { + startTimer(this.socket); + } + else { + this._currentRequest.once("socket", startTimer); + } + + // Clean up on events + this.on("socket", destroyOnTimeout); + this.on("abort", clearTimer); + this.on("error", clearTimer); + this.on("response", clearTimer); + + return this; +}; + // Proxy all other public ClientRequest methods [ - "abort", "flushHeaders", "getHeader", - "setNoDelay", "setSocketKeepAlive", "setTimeout", + "flushHeaders", "getHeader", + "setNoDelay", "setSocketKeepAlive", ].forEach(function (method) { RedirectableRequest.prototype[method] = function (a, b) { return this._currentRequest[method](a, b); @@ -147,13 +226,44 @@ RedirectableRequest.prototype.removeHeader = function (name) { }); }); +RedirectableRequest.prototype._sanitizeOptions = function (options) { + // Ensure headers are always present + if (!options.headers) { + options.headers = {}; + } + + // Since http.request treats host as an alias of hostname, + // but the url module interprets host as hostname plus port, + // eliminate the host property to avoid confusion. + if (options.host) { + // Use hostname if set, because it has precedence + if (!options.hostname) { + options.hostname = options.host; + } + delete options.host; + } + + // Complete the URL object when necessary + if (!options.pathname && options.path) { + var searchPos = options.path.indexOf("?"); + if (searchPos < 0) { + options.pathname = options.path; + } + else { + options.pathname = options.path.substring(0, searchPos); + options.search = options.path.substring(searchPos); + } + } +}; + + // Executes the next native request (initial or redirect) RedirectableRequest.prototype._performRequest = function () { // Load the native protocol var protocol = this._options.protocol; var nativeProtocol = this._options.nativeProtocols[protocol]; if (!nativeProtocol) { - this.emit("error", new Error("Unsupported protocol " + protocol)); + this.emit("error", new TypeError("Unsupported protocol " + protocol)); return; } @@ -171,11 +281,8 @@ RedirectableRequest.prototype._performRequest = function () { // Set up event handlers request._redirectable = this; - for (var event in eventHandlers) { - /* istanbul ignore else */ - if (event) { - request.on(event, eventHandlers[event]); - } + for (var e = 0; e < events.length; e++) { + request.on(events[e], eventHandlers[events[e]]); } // End a redirected request @@ -183,14 +290,29 @@ RedirectableRequest.prototype._performRequest = function () { if (this._isRedirect) { // Write the request entity and end. var i = 0; + var self = this; var buffers = this._requestBodyBuffers; - (function writeNext() { - if (i < buffers.length) { - var buffer = buffers[i++]; - request.write(buffer.data, buffer.encoding, writeNext); - } - else { - request.end(); + (function writeNext(error) { + // Only write if this request has not been redirected yet + /* istanbul ignore else */ + if (request === self._currentRequest) { + // Report any write errors + /* istanbul ignore if */ + if (error) { + self.emit("error", error); + } + // Write the next buffer if there are still left + else if (i < buffers.length) { + var buffer = buffers[i++]; + /* istanbul ignore else */ + if (!request.finished) { + request.write(buffer.data, buffer.encoding, writeNext); + } + } + // End the request if `end` has been called on us + else if (self._ended) { + request.end(); + } } }()); } @@ -199,11 +321,12 @@ RedirectableRequest.prototype._performRequest = function () { // Processes a response from the current native request RedirectableRequest.prototype._processResponse = function (response) { // Store the redirected response + var statusCode = response.statusCode; if (this._options.trackRedirects) { this._redirects.push({ url: this._currentUrl, headers: response.headers, - statusCode: response.statusCode, + statusCode: statusCode, }); } @@ -213,63 +336,101 @@ RedirectableRequest.prototype._processResponse = function (response) { // the user agent MAY automatically redirect its request to the URI // referenced by the Location field value, // even if the specific status code is not understood. + + // If the response is not a redirect; return it as-is var location = response.headers.location; - if (location && this._options.followRedirects !== false && - response.statusCode >= 300 && response.statusCode < 400) { - // RFC7231§6.4: A client SHOULD detect and intervene - // in cyclical redirections (i.e., "infinite" redirection loops). - if (++this._redirectCount > this._options.maxRedirects) { - this.emit("error", new Error("Max redirects exceeded.")); - return; - } - - // RFC7231§6.4: Automatic redirection needs to done with - // care for methods not known to be safe […], - // since the user might not wish to redirect an unsafe request. - // RFC7231§6.4.7: The 307 (Temporary Redirect) status code indicates - // that the target resource resides temporarily under a different URI - // and the user agent MUST NOT change the request method - // if it performs an automatic redirection to that URI. - var header; - var headers = this._options.headers; - if (response.statusCode !== 307 && !(this._options.method in SAFE_METHODS)) { - this._options.method = "GET"; - // Drop a possible entity and headers related to it - this._requestBodyBuffers = []; - for (header in headers) { - if (/^content-/i.test(header)) { - delete headers[header]; - } - } - } - - // Drop the Host header, as the redirect might lead to a different host - if (!this._isRedirect) { - for (header in headers) { - if (/^host$/i.test(header)) { - delete headers[header]; - } - } - } - - // Perform the redirected request - var redirectUrl = url.resolve(this._currentUrl, location); - debug("redirecting to", redirectUrl); - Object.assign(this._options, url.parse(redirectUrl)); - this._isRedirect = true; - this._performRequest(); - - // Discard the remainder of the response to avoid waiting for data - response.destroy(); - } - else { - // The response is not a redirect; return it as-is + if (!location || this._options.followRedirects === false || + statusCode < 300 || statusCode >= 400) { response.responseUrl = this._currentUrl; response.redirects = this._redirects; this.emit("response", response); // Clean up this._requestBodyBuffers = []; + return; + } + + // The response is a redirect, so abort the current request + abortRequest(this._currentRequest); + // Discard the remainder of the response to avoid waiting for data + response.destroy(); + + // RFC7231§6.4: A client SHOULD detect and intervene + // in cyclical redirections (i.e., "infinite" redirection loops). + if (++this._redirectCount > this._options.maxRedirects) { + this.emit("error", new TooManyRedirectsError()); + return; + } + + // RFC7231§6.4: Automatic redirection needs to done with + // care for methods not known to be safe, […] + // RFC7231§6.4.2–3: For historical reasons, a user agent MAY change + // the request method from POST to GET for the subsequent request. + if ((statusCode === 301 || statusCode === 302) && this._options.method === "POST" || + // RFC7231§6.4.4: The 303 (See Other) status code indicates that + // the server is redirecting the user agent to a different resource […] + // A user agent can perform a retrieval request targeting that URI + // (a GET or HEAD request if using HTTP) […] + (statusCode === 303) && !/^(?:GET|HEAD)$/.test(this._options.method)) { + this._options.method = "GET"; + // Drop a possible entity and headers related to it + this._requestBodyBuffers = []; + removeMatchingHeaders(/^content-/i, this._options.headers); + } + + // Drop the Host header, as the redirect might lead to a different host + var currentHostHeader = removeMatchingHeaders(/^host$/i, this._options.headers); + + // If the redirect is relative, carry over the host of the last request + var currentUrlParts = url.parse(this._currentUrl); + var currentHost = currentHostHeader || currentUrlParts.host; + var currentUrl = /^\w+:/.test(location) ? this._currentUrl : + url.format(Object.assign(currentUrlParts, { host: currentHost })); + + // Determine the URL of the redirection + var redirectUrl; + try { + redirectUrl = url.resolve(currentUrl, location); + } + catch (cause) { + this.emit("error", new RedirectionError(cause)); + return; + } + + // Create the redirected request + debug("redirecting to", redirectUrl); + this._isRedirect = true; + var redirectUrlParts = url.parse(redirectUrl); + Object.assign(this._options, redirectUrlParts); + + // Drop confidential headers when redirecting to a less secure protocol + // or to a different domain that is not a superdomain + if (redirectUrlParts.protocol !== currentUrlParts.protocol && + redirectUrlParts.protocol !== "https:" || + redirectUrlParts.host !== currentHost && + !isSubdomain(redirectUrlParts.host, currentHost)) { + removeMatchingHeaders(/^(?:authorization|cookie)$/i, this._options.headers); + } + + // Evaluate the beforeRedirect callback + if (typeof this._options.beforeRedirect === "function") { + var responseDetails = { headers: response.headers }; + try { + this._options.beforeRedirect.call(null, this._options, responseDetails); + } + catch (err) { + this.emit("error", err); + return; + } + this._sanitizeOptions(this._options); + } + + // Perform the redirected request + try { + this._performRequest(); + } + catch (cause) { + this.emit("error", new RedirectionError(cause)); } }; @@ -289,34 +450,125 @@ function wrap(protocols) { var wrappedProtocol = exports[scheme] = Object.create(nativeProtocol); // Executes a request, following redirects - wrappedProtocol.request = function (options, callback) { - if (typeof options === "string") { - options = url.parse(options); - options.maxRedirects = exports.maxRedirects; + function request(input, options, callback) { + // Parse parameters + if (typeof input === "string") { + var urlStr = input; + try { + input = urlToOptions(new URL(urlStr)); + } + catch (err) { + /* istanbul ignore next */ + input = url.parse(urlStr); + } + } + else if (URL && (input instanceof URL)) { + input = urlToOptions(input); } else { - options = Object.assign({ - protocol: protocol, - maxRedirects: exports.maxRedirects, - maxBodyLength: exports.maxBodyLength, - }, options); + callback = options; + options = input; + input = { protocol: protocol }; } + if (typeof options === "function") { + callback = options; + options = null; + } + + // Set defaults + options = Object.assign({ + maxRedirects: exports.maxRedirects, + maxBodyLength: exports.maxBodyLength, + }, input, options); options.nativeProtocols = nativeProtocols; + assert.equal(options.protocol, protocol, "protocol mismatch"); debug("options", options); return new RedirectableRequest(options, callback); - }; + } // Executes a GET request, following redirects - wrappedProtocol.get = function (options, callback) { - var request = wrappedProtocol.request(options, callback); - request.end(); - return request; - }; + function get(input, options, callback) { + var wrappedRequest = wrappedProtocol.request(input, options, callback); + wrappedRequest.end(); + return wrappedRequest; + } + + // Expose the properties on the wrapped protocol + Object.defineProperties(wrappedProtocol, { + request: { value: request, configurable: true, enumerable: true, writable: true }, + get: { value: get, configurable: true, enumerable: true, writable: true }, + }); }); return exports; } +/* istanbul ignore next */ +function noop() { /* empty */ } + +// from https://github.com/nodejs/node/blob/master/lib/internal/url.js +function urlToOptions(urlObject) { + var options = { + protocol: urlObject.protocol, + hostname: urlObject.hostname.startsWith("[") ? + /* istanbul ignore next */ + urlObject.hostname.slice(1, -1) : + urlObject.hostname, + hash: urlObject.hash, + search: urlObject.search, + pathname: urlObject.pathname, + path: urlObject.pathname + urlObject.search, + href: urlObject.href, + }; + if (urlObject.port !== "") { + options.port = Number(urlObject.port); + } + return options; +} + +function removeMatchingHeaders(regex, headers) { + var lastValue; + for (var header in headers) { + if (regex.test(header)) { + lastValue = headers[header]; + delete headers[header]; + } + } + return (lastValue === null || typeof lastValue === "undefined") ? + undefined : String(lastValue).trim(); +} + +function createErrorType(code, defaultMessage) { + function CustomError(cause) { + Error.captureStackTrace(this, this.constructor); + if (!cause) { + this.message = defaultMessage; + } + else { + this.message = defaultMessage + ": " + cause.message; + this.cause = cause; + } + } + CustomError.prototype = new Error(); + CustomError.prototype.constructor = CustomError; + CustomError.prototype.name = "Error [" + code + "]"; + CustomError.prototype.code = code; + return CustomError; +} + +function abortRequest(request) { + for (var e = 0; e < events.length; e++) { + request.removeListener(events[e], eventHandlers[events[e]]); + } + request.on("error", noop); + request.abort(); +} + +function isSubdomain(subdomain, domain) { + const dot = subdomain.length - domain.length - 1; + return dot > 0 && subdomain[dot] === "." && subdomain.endsWith(domain); +} + // Exports module.exports = wrap({ http: http, https: https }); module.exports.wrap = wrap; diff --git a/node_modules/follow-redirects/package.json b/node_modules/follow-redirects/package.json index c1db735..742fb44 100644 --- a/node_modules/follow-redirects/package.json +++ b/node_modules/follow-redirects/package.json @@ -1,73 +1,28 @@ { - "_args": [ - [ - "follow-redirects@1.5.10", - "/Users/wphromma/workspace/actions-curl" - ] - ], - "_from": "follow-redirects@1.5.10", - "_id": "follow-redirects@1.5.10", - "_inBundle": false, - "_integrity": "sha512-0V5l4Cizzvqt5D44aTXbFZz+FtyXV1vrDN6qrelxtfYQKW0KO0W2T/hkE8xvGa/540LkZlkaUjO4ailYTFtHVQ==", - "_location": "/follow-redirects", - "_phantomChildren": {}, - "_requested": { - "type": "version", - "registry": true, - "raw": "follow-redirects@1.5.10", - "name": "follow-redirects", - "escapedName": "follow-redirects", - "rawSpec": "1.5.10", - "saveSpec": null, - "fetchSpec": "1.5.10" - }, - "_requiredBy": [ - "/axios" - ], - "_resolved": "https://registry.npmjs.org/follow-redirects/-/follow-redirects-1.5.10.tgz", - "_spec": "1.5.10", - "_where": "/Users/wphromma/workspace/actions-curl", - "author": { - "name": "Ruben Verborgh", - "email": "ruben@verborgh.org", - "url": "https://ruben.verborgh.org/" - }, - "bugs": { - "url": "https://github.com/follow-redirects/follow-redirects/issues" - }, - "contributors": [ - { - "name": "Olivier Lalonde", - "email": "olalonde@gmail.com", - "url": "http://www.syskall.com" - }, - { - "name": "James Talmage", - "email": "james@talmage.io" - } - ], - "dependencies": { - "debug": "=3.1.0" - }, + "name": "follow-redirects", + "version": "1.14.9", "description": "HTTP and HTTPS modules that follow redirects.", - "devDependencies": { - "concat-stream": "^1.6.0", - "coveralls": "^3.0.2", - "eslint": "^4.19.1", - "express": "^4.16.2", - "mocha": "^5.0.0", - "nyc": "^11.8.0" - }, + "license": "MIT", + "main": "index.js", + "files": [ + "*.js" + ], "engines": { "node": ">=4.0" }, - "files": [ - "index.js", - "create.js", - "http.js", - "https.js" - ], + "scripts": { + "test": "npm run lint && npm run mocha", + "lint": "eslint *.js test", + "mocha": "nyc mocha" + }, + "repository": { + "type": "git", + "url": "git@github.com:follow-redirects/follow-redirects.git" + }, "homepage": "https://github.com/follow-redirects/follow-redirects", + "bugs": { + "url": "https://github.com/follow-redirects/follow-redirects/issues" + }, "keywords": [ "http", "https", @@ -77,23 +32,28 @@ "location", "utility" ], - "license": "MIT", - "main": "index.js", - "name": "follow-redirects", - "nyc": { - "reporter": [ - "lcov", - "text" - ] + "author": "Ruben Verborgh (https://ruben.verborgh.org/)", + "contributors": [ + "Olivier Lalonde (http://www.syskall.com)", + "James Talmage " + ], + "funding": [ + { + "type": "individual", + "url": "https://github.com/sponsors/RubenVerborgh" + } + ], + "peerDependenciesMeta": { + "debug": { + "optional": true + } }, - "repository": { - "type": "git", - "url": "git+ssh://git@github.com/follow-redirects/follow-redirects.git" - }, - "scripts": { - "lint": "eslint *.js test", - "mocha": "nyc mocha", - "test": "npm run lint && npm run mocha" - }, - "version": "1.5.10" + "devDependencies": { + "concat-stream": "^2.0.0", + "eslint": "^5.16.0", + "express": "^4.16.4", + "lolex": "^3.1.0", + "mocha": "^6.0.2", + "nyc": "^14.1.1" + } } diff --git a/node_modules/is-retry-allowed/index.d.ts b/node_modules/is-retry-allowed/index.d.ts new file mode 100644 index 0000000..7ebe5ba --- /dev/null +++ b/node_modules/is-retry-allowed/index.d.ts @@ -0,0 +1,22 @@ +/** +Check whether a request can be retried based on the `error.code`. + +@param error - The `.code` property, if it exists, will be used to determine whether retry is allowed. + +@example +``` +import isRetryAllowed = require('is-retry-allowed'); + +isRetryAllowed({code: 'ETIMEDOUT'}); +//=> true + +isRetryAllowed({code: 'ENOTFOUND'}); +//=> false + +isRetryAllowed({}); +//=> true +``` +*/ +declare function isRetryAllowed(error?: Error | Record): boolean; + +export = isRetryAllowed; diff --git a/node_modules/is-retry-allowed/index.js b/node_modules/is-retry-allowed/index.js new file mode 100644 index 0000000..6ba708a --- /dev/null +++ b/node_modules/is-retry-allowed/index.js @@ -0,0 +1,39 @@ +'use strict'; + +const denyList = new Set([ + 'ENOTFOUND', + 'ENETUNREACH', + + // SSL errors from https://github.com/nodejs/node/blob/fc8e3e2cdc521978351de257030db0076d79e0ab/src/crypto/crypto_common.cc#L301-L328 + 'UNABLE_TO_GET_ISSUER_CERT', + 'UNABLE_TO_GET_CRL', + 'UNABLE_TO_DECRYPT_CERT_SIGNATURE', + 'UNABLE_TO_DECRYPT_CRL_SIGNATURE', + 'UNABLE_TO_DECODE_ISSUER_PUBLIC_KEY', + 'CERT_SIGNATURE_FAILURE', + 'CRL_SIGNATURE_FAILURE', + 'CERT_NOT_YET_VALID', + 'CERT_HAS_EXPIRED', + 'CRL_NOT_YET_VALID', + 'CRL_HAS_EXPIRED', + 'ERROR_IN_CERT_NOT_BEFORE_FIELD', + 'ERROR_IN_CERT_NOT_AFTER_FIELD', + 'ERROR_IN_CRL_LAST_UPDATE_FIELD', + 'ERROR_IN_CRL_NEXT_UPDATE_FIELD', + 'OUT_OF_MEM', + 'DEPTH_ZERO_SELF_SIGNED_CERT', + 'SELF_SIGNED_CERT_IN_CHAIN', + 'UNABLE_TO_GET_ISSUER_CERT_LOCALLY', + 'UNABLE_TO_VERIFY_LEAF_SIGNATURE', + 'CERT_CHAIN_TOO_LONG', + 'CERT_REVOKED', + 'INVALID_CA', + 'PATH_LENGTH_EXCEEDED', + 'INVALID_PURPOSE', + 'CERT_UNTRUSTED', + 'CERT_REJECTED', + 'HOSTNAME_MISMATCH' +]); + +// TODO: Use `error?.code` when targeting Node.js 14 +module.exports = error => !denyList.has(error && error.code); diff --git a/node_modules/is-retry-allowed/license b/node_modules/is-retry-allowed/license new file mode 100644 index 0000000..a69bb59 --- /dev/null +++ b/node_modules/is-retry-allowed/license @@ -0,0 +1,10 @@ +MIT License + +Copyright (c) Vsevolod Strukchinsky (github.com/floatdrop) +Copyright (c) Sindre Sorhus (https://sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/is-retry-allowed/package.json b/node_modules/is-retry-allowed/package.json new file mode 100644 index 0000000..d48a72e --- /dev/null +++ b/node_modules/is-retry-allowed/package.json @@ -0,0 +1,40 @@ +{ + "name": "is-retry-allowed", + "version": "2.2.0", + "description": "Check whether a request can be retried based on the `error.code`", + "license": "MIT", + "repository": "sindresorhus/is-retry-allowed", + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + }, + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "engines": { + "node": ">=10" + }, + "scripts": { + "test": "xo && ava && tsd" + }, + "files": [ + "index.js", + "index.d.ts" + ], + "keywords": [ + "retry", + "retries", + "allowed", + "check", + "http", + "https", + "request", + "fetch" + ], + "devDependencies": { + "ava": "^3.14.0", + "tsd": "^0.14.0", + "xo": "^0.36.1" + } +} diff --git a/node_modules/is-retry-allowed/readme.md b/node_modules/is-retry-allowed/readme.md new file mode 100644 index 0000000..9a6ef5f --- /dev/null +++ b/node_modules/is-retry-allowed/readme.md @@ -0,0 +1,46 @@ +# is-retry-allowed + +> Check whether a request can be retried based on the `error.code` + +## Install + +``` +$ npm install --save is-retry-allowed +``` + +## Usage + +```js +const isRetryAllowed = require('is-retry-allowed'); + +isRetryAllowed({code: 'ETIMEDOUT'}); +//=> true + +isRetryAllowed({code: 'ENOTFOUND'}); +//=> false + +isRetryAllowed({}); +//=> true +``` + +## API + +### isRetryAllowed(error) + +#### error + +Type: `Error | object` + +The `.code` property, if it exists, will be used to determine whether retry is allowed. + +--- + +
+ + Get professional support for this package with a Tidelift subscription + +
+ + Tidelift helps make open source sustainable for maintainers while giving companies
assurances about security, maintenance, and licensing for their dependencies. +
+
diff --git a/node_modules/js-yaml/CHANGELOG.md b/node_modules/js-yaml/CHANGELOG.md new file mode 100644 index 0000000..ff2375e --- /dev/null +++ b/node_modules/js-yaml/CHANGELOG.md @@ -0,0 +1,616 @@ +# Changelog + +All notable changes to this project will be documented in this file. + +The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/), +and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html). + + +## [4.1.0] - 2021-04-15 +### Added +- Types are now exported as `yaml.types.XXX`. +- Every type now has `options` property with original arguments kept as they were + (see `yaml.types.int.options` as an example). + +### Changed +- `Schema.extend()` now keeps old type order in case of conflicts + (e.g. Schema.extend([ a, b, c ]).extend([ b, a, d ]) is now ordered as `abcd` instead of `cbad`). + + +## [4.0.0] - 2021-01-03 +### Changed +- Check [migration guide](migrate_v3_to_v4.md) to see details for all breaking changes. +- Breaking: "unsafe" tags `!!js/function`, `!!js/regexp`, `!!js/undefined` are + moved to [js-yaml-js-types](https://github.com/nodeca/js-yaml-js-types) package. +- Breaking: removed `safe*` functions. Use `load`, `loadAll`, `dump` + instead which are all now safe by default. +- `yaml.DEFAULT_SAFE_SCHEMA` and `yaml.DEFAULT_FULL_SCHEMA` are removed, use + `yaml.DEFAULT_SCHEMA` instead. +- `yaml.Schema.create(schema, tags)` is removed, use `schema.extend(tags)` instead. +- `!!binary` now always mapped to `Uint8Array` on load. +- Reduced nesting of `/lib` folder. +- Parse numbers according to YAML 1.2 instead of YAML 1.1 (`01234` is now decimal, + `0o1234` is octal, `1:23` is parsed as string instead of base60). +- `dump()` no longer quotes `:`, `[`, `]`, `(`, `)` except when necessary, #470, #557. +- Line and column in exceptions are now formatted as `(X:Y)` instead of + `at line X, column Y` (also present in compact format), #332. +- Code snippet created in exceptions now contains multiple lines with line numbers. +- `dump()` now serializes `undefined` as `null` in collections and removes keys with + `undefined` in mappings, #571. +- `dump()` with `skipInvalid=true` now serializes invalid items in collections as null. +- Custom tags starting with `!` are now dumped as `!tag` instead of `!`, #576. +- Custom tags starting with `tag:yaml.org,2002:` are now shorthanded using `!!`, #258. + +### Added +- Added `.mjs` (es modules) support. +- Added `quotingType` and `forceQuotes` options for dumper to configure + string literal style, #290, #529. +- Added `styles: { '!!null': 'empty' }` option for dumper + (serializes `{ foo: null }` as "`foo: `"), #570. +- Added `replacer` option (similar to option in JSON.stringify), #339. +- Custom `Tag` can now handle all tags or multiple tags with the same prefix, #385. + +### Fixed +- Astral characters are no longer encoded by `dump()`, #587. +- "duplicate mapping key" exception now points at the correct column, #452. +- Extra commas in flow collections (e.g. `[foo,,bar]`) now throw an exception + instead of producing null, #321. +- `__proto__` key no longer overrides object prototype, #164. +- Removed `bower.json`. +- Tags are now url-decoded in `load()` and url-encoded in `dump()` + (previously usage of custom non-ascii tags may have led to invalid YAML that can't be parsed). +- Anchors now work correctly with empty nodes, #301. +- Fix incorrect parsing of invalid block mapping syntax, #418. +- Throw an error if block sequence/mapping indent contains a tab, #80. + + +## [3.14.1] - 2020-12-07 +### Security +- Fix possible code execution in (already unsafe) `.load()` (in &anchor). + + +## [3.14.0] - 2020-05-22 +### Changed +- Support `safe/loadAll(input, options)` variant of call. +- CI: drop outdated nodejs versions. +- Dev deps bump. + +### Fixed +- Quote `=` in plain scalars #519. +- Check the node type for `!` tag in case user manually specifies it. +- Verify that there are no null-bytes in input. +- Fix wrong quote position when writing condensed flow, #526. + + +## [3.13.1] - 2019-04-05 +### Security +- Fix possible code execution in (already unsafe) `.load()`, #480. + + +## [3.13.0] - 2019-03-20 +### Security +- Security fix: `safeLoad()` can hang when arrays with nested refs + used as key. Now throws exception for nested arrays. #475. + + +## [3.12.2] - 2019-02-26 +### Fixed +- Fix `noArrayIndent` option for root level, #468. + + +## [3.12.1] - 2019-01-05 +### Added +- Added `noArrayIndent` option, #432. + + +## [3.12.0] - 2018-06-02 +### Changed +- Support arrow functions without a block statement, #421. + + +## [3.11.0] - 2018-03-05 +### Added +- Add arrow functions suport for `!!js/function`. + +### Fixed +- Fix dump in bin/octal/hex formats for negative integers, #399. + + +## [3.10.0] - 2017-09-10 +### Fixed +- Fix `condenseFlow` output (quote keys for sure, instead of spaces), #371, #370. +- Dump astrals as codepoints instead of surrogate pair, #368. + + +## [3.9.1] - 2017-07-08 +### Fixed +- Ensure stack is present for custom errors in node 7.+, #351. + + +## [3.9.0] - 2017-07-08 +### Added +- Add `condenseFlow` option (to create pretty URL query params), #346. + +### Fixed +- Support array return from safeLoadAll/loadAll, #350. + + +## [3.8.4] - 2017-05-08 +### Fixed +- Dumper: prevent space after dash for arrays that wrap, #343. + + +## [3.8.3] - 2017-04-05 +### Fixed +- Should not allow numbers to begin and end with underscore, #335. + + +## [3.8.2] - 2017-03-02 +### Fixed +- Fix `!!float 123` (integers) parse, #333. +- Don't allow leading zeros in floats (except 0, 0.xxx). +- Allow positive exponent without sign in floats. + + +## [3.8.1] - 2017-02-07 +### Changed +- Maintenance: update browserified build. + + +## [3.8.0] - 2017-02-07 +### Fixed +- Fix reported position for `duplicated mapping key` errors. + Now points to block start instead of block end. + (#243, thanks to @shockey). + + +## [3.7.0] - 2016-11-12 +### Added +- Support polymorphism for tags (#300, thanks to @monken). + +### Fixed +- Fix parsing of quotes followed by newlines (#304, thanks to @dplepage). + + +## [3.6.1] - 2016-05-11 +### Fixed +- Fix output cut on a pipe, #286. + + +## [3.6.0] - 2016-04-16 +### Fixed +- Dumper rewrite, fix multiple bugs with trailing `\n`. + Big thanks to @aepsilon! +- Loader: fix leading/trailing newlines in block scalars, @aepsilon. + + +## [3.5.5] - 2016-03-17 +### Fixed +- Date parse fix: don't allow dates with on digit in month and day, #268. + + +## [3.5.4] - 2016-03-09 +### Added +- `noCompatMode` for dumper, to disable quoting YAML 1.1 values. + + +## [3.5.3] - 2016-02-11 +### Changed +- Maintenance release. + + +## [3.5.2] - 2016-01-11 +### Changed +- Maintenance: missed comma in bower config. + + +## [3.5.1] - 2016-01-11 +### Changed +- Removed `inherit` dependency, #239. +- Better browserify workaround for esprima load. +- Demo rewrite. + + +## [3.5.0] - 2016-01-10 +### Fixed +- Dumper. Fold strings only, #217. +- Dumper. `norefs` option, to clone linked objects, #229. +- Loader. Throw a warning for duplicate keys, #166. +- Improved browserify support (mark `esprima` & `Buffer` excluded). + + +## [3.4.6] - 2015-11-26 +### Changed +- Use standalone `inherit` to keep browserified files clear. + + +## [3.4.5] - 2015-11-23 +### Added +- Added `lineWidth` option to dumper. + + +## [3.4.4] - 2015-11-21 +### Fixed +- Fixed floats dump (missed dot for scientific format), #220. +- Allow non-printable characters inside quoted scalars, #192. + + +## [3.4.3] - 2015-10-10 +### Changed +- Maintenance release - deps bump (esprima, argparse). + + +## [3.4.2] - 2015-09-09 +### Fixed +- Fixed serialization of duplicated entries in sequences, #205. + Thanks to @vogelsgesang. + + +## [3.4.1] - 2015-09-05 +### Fixed +- Fixed stacktrace handling in generated errors, for browsers (FF/IE). + + +## [3.4.0] - 2015-08-23 +### Changed +- Don't throw on warnings anymore. Use `onWarning` option to catch. +- Throw error on unknown tags (was warning before). +- Reworked internals of error class. + +### Fixed +- Fixed multiline keys dump, #197. Thanks to @tcr. +- Fixed heading line breaks in some scalars (regression). + + +## [3.3.1] - 2015-05-13 +### Added +- Added `.sortKeys` dumper option, thanks to @rjmunro. + +### Fixed +- Fixed astral characters support, #191. + + +## [3.3.0] - 2015-04-26 +### Changed +- Significantly improved long strings formatting in dumper, thanks to @isaacs. +- Strip BOM if exists. + + +## [3.2.7] - 2015-02-19 +### Changed +- Maintenance release. +- Updated dependencies. +- HISTORY.md -> CHANGELOG.md + + +## [3.2.6] - 2015-02-07 +### Fixed +- Fixed encoding of UTF-16 surrogate pairs. (e.g. "\U0001F431" CAT FACE). +- Fixed demo dates dump (#113, thanks to @Hypercubed). + + +## [3.2.5] - 2014-12-28 +### Fixed +- Fixed resolving of all built-in types on empty nodes. +- Fixed invalid warning on empty lines within quoted scalars and flow collections. +- Fixed bug: Tag on an empty node didn't resolve in some cases. + + +## [3.2.4] - 2014-12-19 +### Fixed +- Fixed resolving of !!null tag on an empty node. + + +## [3.2.3] - 2014-11-08 +### Fixed +- Implemented dumping of objects with circular and cross references. +- Partially fixed aliasing of constructed objects. (see issue #141 for details) + + +## [3.2.2] - 2014-09-07 +### Fixed +- Fixed infinite loop on unindented block scalars. +- Rewritten base64 encode/decode in binary type, to keep code licence clear. + + +## [3.2.1] - 2014-08-24 +### Fixed +- Nothig new. Just fix npm publish error. + + +## [3.2.0] - 2014-08-24 +### Added +- Added input piping support to CLI. + +### Fixed +- Fixed typo, that could cause hand on initial indent (#139). + + +## [3.1.0] - 2014-07-07 +### Changed +- 1.5x-2x speed boost. +- Removed deprecated `require('xxx.yml')` support. +- Significant code cleanup and refactoring. +- Internal API changed. If you used custom types - see updated examples. + Others are not affected. +- Even if the input string has no trailing line break character, + it will be parsed as if it has one. +- Added benchmark scripts. +- Moved bower files to /dist folder +- Bugfixes. + + +## [3.0.2] - 2014-02-27 +### Fixed +- Fixed bug: "constructor" string parsed as `null`. + + +## [3.0.1] - 2013-12-22 +### Fixed +- Fixed parsing of literal scalars. (issue #108) +- Prevented adding unnecessary spaces in object dumps. (issue #68) +- Fixed dumping of objects with very long (> 1024 in length) keys. + + +## [3.0.0] - 2013-12-16 +### Changed +- Refactored code. Changed API for custom types. +- Removed output colors in CLI, dump json by default. +- Removed big dependencies from browser version (esprima, buffer). Load `esprima` manually, if `!!js/function` needed. `!!bin` now returns Array in browser +- AMD support. +- Don't quote dumped strings because of `-` & `?` (if not first char). +- __Deprecated__ loading yaml files via `require()`, as not recommended + behaviour for node. + + +## [2.1.3] - 2013-10-16 +### Fixed +- Fix wrong loading of empty block scalars. + + +## [2.1.2] - 2013-10-07 +### Fixed +- Fix unwanted line breaks in folded scalars. + + +## [2.1.1] - 2013-10-02 +### Fixed +- Dumper now respects deprecated booleans syntax from YAML 1.0/1.1 +- Fixed reader bug in JSON-like sequences/mappings. + + +## [2.1.0] - 2013-06-05 +### Added +- Add standard YAML schemas: Failsafe (`FAILSAFE_SCHEMA`), + JSON (`JSON_SCHEMA`) and Core (`CORE_SCHEMA`). +- Add `skipInvalid` dumper option. + +### Changed +- Rename `DEFAULT_SCHEMA` to `DEFAULT_FULL_SCHEMA` + and `SAFE_SCHEMA` to `DEFAULT_SAFE_SCHEMA`. +- Use `safeLoad` for `require` extension. + +### Fixed +- Bug fix: export `NIL` constant from the public interface. + + +## [2.0.5] - 2013-04-26 +### Security +- Close security issue in !!js/function constructor. + Big thanks to @nealpoole for security audit. + + +## [2.0.4] - 2013-04-08 +### Changed +- Updated .npmignore to reduce package size + + +## [2.0.3] - 2013-02-26 +### Fixed +- Fixed dumping of empty arrays ans objects. ([] and {} instead of null) + + +## [2.0.2] - 2013-02-15 +### Fixed +- Fixed input validation: tabs are printable characters. + + +## [2.0.1] - 2013-02-09 +### Fixed +- Fixed error, when options not passed to function cass + + +## [2.0.0] - 2013-02-09 +### Changed +- Full rewrite. New architecture. Fast one-stage parsing. +- Changed custom types API. +- Added YAML dumper. + + +## [1.0.3] - 2012-11-05 +### Fixed +- Fixed utf-8 files loading. + + +## [1.0.2] - 2012-08-02 +### Fixed +- Pull out hand-written shims. Use ES5-Shims for old browsers support. See #44. +- Fix timstamps incorectly parsed in local time when no time part specified. + + +## [1.0.1] - 2012-07-07 +### Fixed +- Fixes `TypeError: 'undefined' is not an object` under Safari. Thanks Phuong. +- Fix timestamps incorrectly parsed in local time. Thanks @caolan. Closes #46. + + +## [1.0.0] - 2012-07-01 +### Changed +- `y`, `yes`, `n`, `no`, `on`, `off` are not converted to Booleans anymore. + Fixes #42. +- `require(filename)` now returns a single document and throws an Error if + file contains more than one document. +- CLI was merged back from js-yaml.bin + + +## [0.3.7] - 2012-02-28 +### Fixed +- Fix export of `addConstructor()`. Closes #39. + + +## [0.3.6] - 2012-02-22 +### Changed +- Removed AMD parts - too buggy to use. Need help to rewrite from scratch + +### Fixed +- Removed YUI compressor warning (renamed `double` variable). Closes #40. + + +## [0.3.5] - 2012-01-10 +### Fixed +- Workagound for .npmignore fuckup under windows. Thanks to airportyh. + + +## [0.3.4] - 2011-12-24 +### Fixed +- Fixes str[] for oldIEs support. +- Adds better has change support for browserified demo. +- improves compact output of Error. Closes #33. + + +## [0.3.3] - 2011-12-20 +### Added +- adds `compact` stringification of Errors. + +### Changed +- jsyaml executable moved to separate module. + + +## [0.3.2] - 2011-12-16 +### Added +- Added jsyaml executable. +- Added !!js/function support. Closes #12. + +### Fixed +- Fixes ug with block style scalars. Closes #26. +- All sources are passing JSLint now. +- Fixes bug in Safari. Closes #28. +- Fixes bug in Opers. Closes #29. +- Improves browser support. Closes #20. + + +## [0.3.1] - 2011-11-18 +### Added +- Added AMD support for browserified version. +- Added permalinks for online demo YAML snippets. Now we have YPaste service, lol. +- Added !!js/regexp and !!js/undefined types. Partially solves #12. + +### Changed +- Wrapped browserified js-yaml into closure. + +### Fixed +- Fixed the resolvement of non-specific tags. Closes #17. +- Fixed !!set mapping. +- Fixed month parse in dates. Closes #19. + + +## [0.3.0] - 2011-11-09 +### Added +- Added browserified version. Closes #13. +- Added live demo of browserified version. +- Ported some of the PyYAML tests. See #14. + +### Fixed +- Removed JS.Class dependency. Closes #3. +- Fixed timestamp bug when fraction was given. + + +## [0.2.2] - 2011-11-06 +### Fixed +- Fixed crash on docs without ---. Closes #8. +- Fixed multiline string parse +- Fixed tests/comments for using array as key + + +## [0.2.1] - 2011-11-02 +### Fixed +- Fixed short file read (<4k). Closes #9. + + +## [0.2.0] - 2011-11-02 +### Changed +- First public release + + +[4.1.0]: https://github.com/nodeca/js-yaml/compare/4.0.0...4.1.0 +[4.0.0]: https://github.com/nodeca/js-yaml/compare/3.14.0...4.0.0 +[3.14.0]: https://github.com/nodeca/js-yaml/compare/3.13.1...3.14.0 +[3.13.1]: https://github.com/nodeca/js-yaml/compare/3.13.0...3.13.1 +[3.13.0]: https://github.com/nodeca/js-yaml/compare/3.12.2...3.13.0 +[3.12.2]: https://github.com/nodeca/js-yaml/compare/3.12.1...3.12.2 +[3.12.1]: https://github.com/nodeca/js-yaml/compare/3.12.0...3.12.1 +[3.12.0]: https://github.com/nodeca/js-yaml/compare/3.11.0...3.12.0 +[3.11.0]: https://github.com/nodeca/js-yaml/compare/3.10.0...3.11.0 +[3.10.0]: https://github.com/nodeca/js-yaml/compare/3.9.1...3.10.0 +[3.9.1]: https://github.com/nodeca/js-yaml/compare/3.9.0...3.9.1 +[3.9.0]: https://github.com/nodeca/js-yaml/compare/3.8.4...3.9.0 +[3.8.4]: https://github.com/nodeca/js-yaml/compare/3.8.3...3.8.4 +[3.8.3]: https://github.com/nodeca/js-yaml/compare/3.8.2...3.8.3 +[3.8.2]: https://github.com/nodeca/js-yaml/compare/3.8.1...3.8.2 +[3.8.1]: https://github.com/nodeca/js-yaml/compare/3.8.0...3.8.1 +[3.8.0]: https://github.com/nodeca/js-yaml/compare/3.7.0...3.8.0 +[3.7.0]: https://github.com/nodeca/js-yaml/compare/3.6.1...3.7.0 +[3.6.1]: https://github.com/nodeca/js-yaml/compare/3.6.0...3.6.1 +[3.6.0]: https://github.com/nodeca/js-yaml/compare/3.5.5...3.6.0 +[3.5.5]: https://github.com/nodeca/js-yaml/compare/3.5.4...3.5.5 +[3.5.4]: https://github.com/nodeca/js-yaml/compare/3.5.3...3.5.4 +[3.5.3]: https://github.com/nodeca/js-yaml/compare/3.5.2...3.5.3 +[3.5.2]: https://github.com/nodeca/js-yaml/compare/3.5.1...3.5.2 +[3.5.1]: https://github.com/nodeca/js-yaml/compare/3.5.0...3.5.1 +[3.5.0]: https://github.com/nodeca/js-yaml/compare/3.4.6...3.5.0 +[3.4.6]: https://github.com/nodeca/js-yaml/compare/3.4.5...3.4.6 +[3.4.5]: https://github.com/nodeca/js-yaml/compare/3.4.4...3.4.5 +[3.4.4]: https://github.com/nodeca/js-yaml/compare/3.4.3...3.4.4 +[3.4.3]: https://github.com/nodeca/js-yaml/compare/3.4.2...3.4.3 +[3.4.2]: https://github.com/nodeca/js-yaml/compare/3.4.1...3.4.2 +[3.4.1]: https://github.com/nodeca/js-yaml/compare/3.4.0...3.4.1 +[3.4.0]: https://github.com/nodeca/js-yaml/compare/3.3.1...3.4.0 +[3.3.1]: https://github.com/nodeca/js-yaml/compare/3.3.0...3.3.1 +[3.3.0]: https://github.com/nodeca/js-yaml/compare/3.2.7...3.3.0 +[3.2.7]: https://github.com/nodeca/js-yaml/compare/3.2.6...3.2.7 +[3.2.6]: https://github.com/nodeca/js-yaml/compare/3.2.5...3.2.6 +[3.2.5]: https://github.com/nodeca/js-yaml/compare/3.2.4...3.2.5 +[3.2.4]: https://github.com/nodeca/js-yaml/compare/3.2.3...3.2.4 +[3.2.3]: https://github.com/nodeca/js-yaml/compare/3.2.2...3.2.3 +[3.2.2]: https://github.com/nodeca/js-yaml/compare/3.2.1...3.2.2 +[3.2.1]: https://github.com/nodeca/js-yaml/compare/3.2.0...3.2.1 +[3.2.0]: https://github.com/nodeca/js-yaml/compare/3.1.0...3.2.0 +[3.1.0]: https://github.com/nodeca/js-yaml/compare/3.0.2...3.1.0 +[3.0.2]: https://github.com/nodeca/js-yaml/compare/3.0.1...3.0.2 +[3.0.1]: https://github.com/nodeca/js-yaml/compare/3.0.0...3.0.1 +[3.0.0]: https://github.com/nodeca/js-yaml/compare/2.1.3...3.0.0 +[2.1.3]: https://github.com/nodeca/js-yaml/compare/2.1.2...2.1.3 +[2.1.2]: https://github.com/nodeca/js-yaml/compare/2.1.1...2.1.2 +[2.1.1]: https://github.com/nodeca/js-yaml/compare/2.1.0...2.1.1 +[2.1.0]: https://github.com/nodeca/js-yaml/compare/2.0.5...2.1.0 +[2.0.5]: https://github.com/nodeca/js-yaml/compare/2.0.4...2.0.5 +[2.0.4]: https://github.com/nodeca/js-yaml/compare/2.0.3...2.0.4 +[2.0.3]: https://github.com/nodeca/js-yaml/compare/2.0.2...2.0.3 +[2.0.2]: https://github.com/nodeca/js-yaml/compare/2.0.1...2.0.2 +[2.0.1]: https://github.com/nodeca/js-yaml/compare/2.0.0...2.0.1 +[2.0.0]: https://github.com/nodeca/js-yaml/compare/1.0.3...2.0.0 +[1.0.3]: https://github.com/nodeca/js-yaml/compare/1.0.2...1.0.3 +[1.0.2]: https://github.com/nodeca/js-yaml/compare/1.0.1...1.0.2 +[1.0.1]: https://github.com/nodeca/js-yaml/compare/1.0.0...1.0.1 +[1.0.0]: https://github.com/nodeca/js-yaml/compare/0.3.7...1.0.0 +[0.3.7]: https://github.com/nodeca/js-yaml/compare/0.3.6...0.3.7 +[0.3.6]: https://github.com/nodeca/js-yaml/compare/0.3.5...0.3.6 +[0.3.5]: https://github.com/nodeca/js-yaml/compare/0.3.4...0.3.5 +[0.3.4]: https://github.com/nodeca/js-yaml/compare/0.3.3...0.3.4 +[0.3.3]: https://github.com/nodeca/js-yaml/compare/0.3.2...0.3.3 +[0.3.2]: https://github.com/nodeca/js-yaml/compare/0.3.1...0.3.2 +[0.3.1]: https://github.com/nodeca/js-yaml/compare/0.3.0...0.3.1 +[0.3.0]: https://github.com/nodeca/js-yaml/compare/0.2.2...0.3.0 +[0.2.2]: https://github.com/nodeca/js-yaml/compare/0.2.1...0.2.2 +[0.2.1]: https://github.com/nodeca/js-yaml/compare/0.2.0...0.2.1 +[0.2.0]: https://github.com/nodeca/js-yaml/releases/tag/0.2.0 diff --git a/node_modules/js-yaml/LICENSE b/node_modules/js-yaml/LICENSE new file mode 100644 index 0000000..09d3a29 --- /dev/null +++ b/node_modules/js-yaml/LICENSE @@ -0,0 +1,21 @@ +(The MIT License) + +Copyright (C) 2011-2015 by Vitaly Puzrin + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/js-yaml/README.md b/node_modules/js-yaml/README.md new file mode 100644 index 0000000..3cbc4bd --- /dev/null +++ b/node_modules/js-yaml/README.md @@ -0,0 +1,246 @@ +JS-YAML - YAML 1.2 parser / writer for JavaScript +================================================= + +[![CI](https://github.com/nodeca/js-yaml/workflows/CI/badge.svg?branch=master)](https://github.com/nodeca/js-yaml/actions) +[![NPM version](https://img.shields.io/npm/v/js-yaml.svg)](https://www.npmjs.org/package/js-yaml) + +__[Online Demo](http://nodeca.github.com/js-yaml/)__ + + +This is an implementation of [YAML](http://yaml.org/), a human-friendly data +serialization language. Started as [PyYAML](http://pyyaml.org/) port, it was +completely rewritten from scratch. Now it's very fast, and supports 1.2 spec. + + +Installation +------------ + +### YAML module for node.js + +``` +npm install js-yaml +``` + + +### CLI executable + +If you want to inspect your YAML files from CLI, install js-yaml globally: + +``` +npm install -g js-yaml +``` + +#### Usage + +``` +usage: js-yaml [-h] [-v] [-c] [-t] file + +Positional arguments: + file File with YAML document(s) + +Optional arguments: + -h, --help Show this help message and exit. + -v, --version Show program's version number and exit. + -c, --compact Display errors in compact mode + -t, --trace Show stack trace on error +``` + + +API +--- + +Here we cover the most 'useful' methods. If you need advanced details (creating +your own tags), see [examples](https://github.com/nodeca/js-yaml/tree/master/examples) +for more info. + +``` javascript +const yaml = require('js-yaml'); +const fs = require('fs'); + +// Get document, or throw exception on error +try { + const doc = yaml.load(fs.readFileSync('/home/ixti/example.yml', 'utf8')); + console.log(doc); +} catch (e) { + console.log(e); +} +``` + + +### load (string [ , options ]) + +Parses `string` as single YAML document. Returns either a +plain object, a string, a number, `null` or `undefined`, or throws `YAMLException` on error. By default, does +not support regexps, functions and undefined. + +options: + +- `filename` _(default: null)_ - string to be used as a file path in + error/warning messages. +- `onWarning` _(default: null)_ - function to call on warning messages. + Loader will call this function with an instance of `YAMLException` for each warning. +- `schema` _(default: `DEFAULT_SCHEMA`)_ - specifies a schema to use. + - `FAILSAFE_SCHEMA` - only strings, arrays and plain objects: + http://www.yaml.org/spec/1.2/spec.html#id2802346 + - `JSON_SCHEMA` - all JSON-supported types: + http://www.yaml.org/spec/1.2/spec.html#id2803231 + - `CORE_SCHEMA` - same as `JSON_SCHEMA`: + http://www.yaml.org/spec/1.2/spec.html#id2804923 + - `DEFAULT_SCHEMA` - all supported YAML types. +- `json` _(default: false)_ - compatibility with JSON.parse behaviour. If true, then duplicate keys in a mapping will override values rather than throwing an error. + +NOTE: This function **does not** understand multi-document sources, it throws +exception on those. + +NOTE: JS-YAML **does not** support schema-specific tag resolution restrictions. +So, the JSON schema is not as strictly defined in the YAML specification. +It allows numbers in any notation, use `Null` and `NULL` as `null`, etc. +The core schema also has no such restrictions. It allows binary notation for integers. + + +### loadAll (string [, iterator] [, options ]) + +Same as `load()`, but understands multi-document sources. Applies +`iterator` to each document if specified, or returns array of documents. + +``` javascript +const yaml = require('js-yaml'); + +yaml.loadAll(data, function (doc) { + console.log(doc); +}); +``` + + +### dump (object [ , options ]) + +Serializes `object` as a YAML document. Uses `DEFAULT_SCHEMA`, so it will +throw an exception if you try to dump regexps or functions. However, you can +disable exceptions by setting the `skipInvalid` option to `true`. + +options: + +- `indent` _(default: 2)_ - indentation width to use (in spaces). +- `noArrayIndent` _(default: false)_ - when true, will not add an indentation level to array elements +- `skipInvalid` _(default: false)_ - do not throw on invalid types (like function + in the safe schema) and skip pairs and single values with such types. +- `flowLevel` _(default: -1)_ - specifies level of nesting, when to switch from + block to flow style for collections. -1 means block style everwhere +- `styles` - "tag" => "style" map. Each tag may have own set of styles. +- `schema` _(default: `DEFAULT_SCHEMA`)_ specifies a schema to use. +- `sortKeys` _(default: `false`)_ - if `true`, sort keys when dumping YAML. If a + function, use the function to sort the keys. +- `lineWidth` _(default: `80`)_ - set max line width. Set `-1` for unlimited width. +- `noRefs` _(default: `false`)_ - if `true`, don't convert duplicate objects into references +- `noCompatMode` _(default: `false`)_ - if `true` don't try to be compatible with older + yaml versions. Currently: don't quote "yes", "no" and so on, as required for YAML 1.1 +- `condenseFlow` _(default: `false`)_ - if `true` flow sequences will be condensed, omitting the space between `a, b`. Eg. `'[a,b]'`, and omitting the space between `key: value` and quoting the key. Eg. `'{"a":b}'` Can be useful when using yaml for pretty URL query params as spaces are %-encoded. +- `quotingType` _(`'` or `"`, default: `'`)_ - strings will be quoted using this quoting style. If you specify single quotes, double quotes will still be used for non-printable characters. +- `forceQuotes` _(default: `false`)_ - if `true`, all non-key strings will be quoted even if they normally don't need to. +- `replacer` - callback `function (key, value)` called recursively on each key/value in source object (see `replacer` docs for `JSON.stringify`). + +The following table show availlable styles (e.g. "canonical", +"binary"...) available for each tag (.e.g. !!null, !!int ...). Yaml +output is shown on the right side after `=>` (default setting) or `->`: + +``` none +!!null + "canonical" -> "~" + "lowercase" => "null" + "uppercase" -> "NULL" + "camelcase" -> "Null" + +!!int + "binary" -> "0b1", "0b101010", "0b1110001111010" + "octal" -> "0o1", "0o52", "0o16172" + "decimal" => "1", "42", "7290" + "hexadecimal" -> "0x1", "0x2A", "0x1C7A" + +!!bool + "lowercase" => "true", "false" + "uppercase" -> "TRUE", "FALSE" + "camelcase" -> "True", "False" + +!!float + "lowercase" => ".nan", '.inf' + "uppercase" -> ".NAN", '.INF' + "camelcase" -> ".NaN", '.Inf' +``` + +Example: + +``` javascript +dump(object, { + 'styles': { + '!!null': 'canonical' // dump null as ~ + }, + 'sortKeys': true // sort object keys +}); +``` + +Supported YAML types +-------------------- + +The list of standard YAML tags and corresponding JavaScript types. See also +[YAML tag discussion](http://pyyaml.org/wiki/YAMLTagDiscussion) and +[YAML types repository](http://yaml.org/type/). + +``` +!!null '' # null +!!bool 'yes' # bool +!!int '3...' # number +!!float '3.14...' # number +!!binary '...base64...' # buffer +!!timestamp 'YYYY-...' # date +!!omap [ ... ] # array of key-value pairs +!!pairs [ ... ] # array or array pairs +!!set { ... } # array of objects with given keys and null values +!!str '...' # string +!!seq [ ... ] # array +!!map { ... } # object +``` + +**JavaScript-specific tags** + +See [js-yaml-js-types](https://github.com/nodeca/js-yaml-js-types) for +extra types. + + +Caveats +------- + +Note, that you use arrays or objects as key in JS-YAML. JS does not allow objects +or arrays as keys, and stringifies (by calling `toString()` method) them at the +moment of adding them. + +``` yaml +--- +? [ foo, bar ] +: - baz +? { foo: bar } +: - baz + - baz +``` + +``` javascript +{ "foo,bar": ["baz"], "[object Object]": ["baz", "baz"] } +``` + +Also, reading of properties on implicit block mapping keys is not supported yet. +So, the following YAML document cannot be loaded. + +``` yaml +&anchor foo: + foo: bar + *anchor: duplicate key + baz: bat + *anchor: duplicate key +``` + + +js-yaml for enterprise +---------------------- + +Available as part of the Tidelift Subscription + +The maintainers of js-yaml and thousands of other packages are working with Tidelift to deliver commercial support and maintenance for the open source dependencies you use to build your applications. Save time, reduce risk, and improve code health, while paying the maintainers of the exact dependencies you use. [Learn more.](https://tidelift.com/subscription/pkg/npm-js-yaml?utm_source=npm-js-yaml&utm_medium=referral&utm_campaign=enterprise&utm_term=repo) diff --git a/node_modules/js-yaml/bin/js-yaml.js b/node_modules/js-yaml/bin/js-yaml.js new file mode 100755 index 0000000..a182f1a --- /dev/null +++ b/node_modules/js-yaml/bin/js-yaml.js @@ -0,0 +1,126 @@ +#!/usr/bin/env node + + +'use strict'; + +/*eslint-disable no-console*/ + + +var fs = require('fs'); +var argparse = require('argparse'); +var yaml = require('..'); + + +//////////////////////////////////////////////////////////////////////////////// + + +var cli = new argparse.ArgumentParser({ + prog: 'js-yaml', + add_help: true +}); + +cli.add_argument('-v', '--version', { + action: 'version', + version: require('../package.json').version +}); + +cli.add_argument('-c', '--compact', { + help: 'Display errors in compact mode', + action: 'store_true' +}); + +// deprecated (not needed after we removed output colors) +// option suppressed, but not completely removed for compatibility +cli.add_argument('-j', '--to-json', { + help: argparse.SUPPRESS, + dest: 'json', + action: 'store_true' +}); + +cli.add_argument('-t', '--trace', { + help: 'Show stack trace on error', + action: 'store_true' +}); + +cli.add_argument('file', { + help: 'File to read, utf-8 encoded without BOM', + nargs: '?', + default: '-' +}); + + +//////////////////////////////////////////////////////////////////////////////// + + +var options = cli.parse_args(); + + +//////////////////////////////////////////////////////////////////////////////// + +function readFile(filename, encoding, callback) { + if (options.file === '-') { + // read from stdin + + var chunks = []; + + process.stdin.on('data', function (chunk) { + chunks.push(chunk); + }); + + process.stdin.on('end', function () { + return callback(null, Buffer.concat(chunks).toString(encoding)); + }); + } else { + fs.readFile(filename, encoding, callback); + } +} + +readFile(options.file, 'utf8', function (error, input) { + var output, isYaml; + + if (error) { + if (error.code === 'ENOENT') { + console.error('File not found: ' + options.file); + process.exit(2); + } + + console.error( + options.trace && error.stack || + error.message || + String(error)); + + process.exit(1); + } + + try { + output = JSON.parse(input); + isYaml = false; + } catch (err) { + if (err instanceof SyntaxError) { + try { + output = []; + yaml.loadAll(input, function (doc) { output.push(doc); }, {}); + isYaml = true; + + if (output.length === 0) output = null; + else if (output.length === 1) output = output[0]; + + } catch (e) { + if (options.trace && err.stack) console.error(e.stack); + else console.error(e.toString(options.compact)); + + process.exit(1); + } + } else { + console.error( + options.trace && err.stack || + err.message || + String(err)); + + process.exit(1); + } + } + + if (isYaml) console.log(JSON.stringify(output, null, ' ')); + else console.log(yaml.dump(output)); +}); diff --git a/node_modules/js-yaml/dist/js-yaml.js b/node_modules/js-yaml/dist/js-yaml.js new file mode 100644 index 0000000..4cc0ddf --- /dev/null +++ b/node_modules/js-yaml/dist/js-yaml.js @@ -0,0 +1,3874 @@ + +/*! js-yaml 4.1.0 https://github.com/nodeca/js-yaml @license MIT */ +(function (global, factory) { + typeof exports === 'object' && typeof module !== 'undefined' ? factory(exports) : + typeof define === 'function' && define.amd ? define(['exports'], factory) : + (global = typeof globalThis !== 'undefined' ? globalThis : global || self, factory(global.jsyaml = {})); +}(this, (function (exports) { 'use strict'; + + function isNothing(subject) { + return (typeof subject === 'undefined') || (subject === null); + } + + + function isObject(subject) { + return (typeof subject === 'object') && (subject !== null); + } + + + function toArray(sequence) { + if (Array.isArray(sequence)) return sequence; + else if (isNothing(sequence)) return []; + + return [ sequence ]; + } + + + function extend(target, source) { + var index, length, key, sourceKeys; + + if (source) { + sourceKeys = Object.keys(source); + + for (index = 0, length = sourceKeys.length; index < length; index += 1) { + key = sourceKeys[index]; + target[key] = source[key]; + } + } + + return target; + } + + + function repeat(string, count) { + var result = '', cycle; + + for (cycle = 0; cycle < count; cycle += 1) { + result += string; + } + + return result; + } + + + function isNegativeZero(number) { + return (number === 0) && (Number.NEGATIVE_INFINITY === 1 / number); + } + + + var isNothing_1 = isNothing; + var isObject_1 = isObject; + var toArray_1 = toArray; + var repeat_1 = repeat; + var isNegativeZero_1 = isNegativeZero; + var extend_1 = extend; + + var common = { + isNothing: isNothing_1, + isObject: isObject_1, + toArray: toArray_1, + repeat: repeat_1, + isNegativeZero: isNegativeZero_1, + extend: extend_1 + }; + + // YAML error class. http://stackoverflow.com/questions/8458984 + + + function formatError(exception, compact) { + var where = '', message = exception.reason || '(unknown reason)'; + + if (!exception.mark) return message; + + if (exception.mark.name) { + where += 'in "' + exception.mark.name + '" '; + } + + where += '(' + (exception.mark.line + 1) + ':' + (exception.mark.column + 1) + ')'; + + if (!compact && exception.mark.snippet) { + where += '\n\n' + exception.mark.snippet; + } + + return message + ' ' + where; + } + + + function YAMLException$1(reason, mark) { + // Super constructor + Error.call(this); + + this.name = 'YAMLException'; + this.reason = reason; + this.mark = mark; + this.message = formatError(this, false); + + // Include stack trace in error object + if (Error.captureStackTrace) { + // Chrome and NodeJS + Error.captureStackTrace(this, this.constructor); + } else { + // FF, IE 10+ and Safari 6+. Fallback for others + this.stack = (new Error()).stack || ''; + } + } + + + // Inherit from Error + YAMLException$1.prototype = Object.create(Error.prototype); + YAMLException$1.prototype.constructor = YAMLException$1; + + + YAMLException$1.prototype.toString = function toString(compact) { + return this.name + ': ' + formatError(this, compact); + }; + + + var exception = YAMLException$1; + + // get snippet for a single line, respecting maxLength + function getLine(buffer, lineStart, lineEnd, position, maxLineLength) { + var head = ''; + var tail = ''; + var maxHalfLength = Math.floor(maxLineLength / 2) - 1; + + if (position - lineStart > maxHalfLength) { + head = ' ... '; + lineStart = position - maxHalfLength + head.length; + } + + if (lineEnd - position > maxHalfLength) { + tail = ' ...'; + lineEnd = position + maxHalfLength - tail.length; + } + + return { + str: head + buffer.slice(lineStart, lineEnd).replace(/\t/g, '→') + tail, + pos: position - lineStart + head.length // relative position + }; + } + + + function padStart(string, max) { + return common.repeat(' ', max - string.length) + string; + } + + + function makeSnippet(mark, options) { + options = Object.create(options || null); + + if (!mark.buffer) return null; + + if (!options.maxLength) options.maxLength = 79; + if (typeof options.indent !== 'number') options.indent = 1; + if (typeof options.linesBefore !== 'number') options.linesBefore = 3; + if (typeof options.linesAfter !== 'number') options.linesAfter = 2; + + var re = /\r?\n|\r|\0/g; + var lineStarts = [ 0 ]; + var lineEnds = []; + var match; + var foundLineNo = -1; + + while ((match = re.exec(mark.buffer))) { + lineEnds.push(match.index); + lineStarts.push(match.index + match[0].length); + + if (mark.position <= match.index && foundLineNo < 0) { + foundLineNo = lineStarts.length - 2; + } + } + + if (foundLineNo < 0) foundLineNo = lineStarts.length - 1; + + var result = '', i, line; + var lineNoLength = Math.min(mark.line + options.linesAfter, lineEnds.length).toString().length; + var maxLineLength = options.maxLength - (options.indent + lineNoLength + 3); + + for (i = 1; i <= options.linesBefore; i++) { + if (foundLineNo - i < 0) break; + line = getLine( + mark.buffer, + lineStarts[foundLineNo - i], + lineEnds[foundLineNo - i], + mark.position - (lineStarts[foundLineNo] - lineStarts[foundLineNo - i]), + maxLineLength + ); + result = common.repeat(' ', options.indent) + padStart((mark.line - i + 1).toString(), lineNoLength) + + ' | ' + line.str + '\n' + result; + } + + line = getLine(mark.buffer, lineStarts[foundLineNo], lineEnds[foundLineNo], mark.position, maxLineLength); + result += common.repeat(' ', options.indent) + padStart((mark.line + 1).toString(), lineNoLength) + + ' | ' + line.str + '\n'; + result += common.repeat('-', options.indent + lineNoLength + 3 + line.pos) + '^' + '\n'; + + for (i = 1; i <= options.linesAfter; i++) { + if (foundLineNo + i >= lineEnds.length) break; + line = getLine( + mark.buffer, + lineStarts[foundLineNo + i], + lineEnds[foundLineNo + i], + mark.position - (lineStarts[foundLineNo] - lineStarts[foundLineNo + i]), + maxLineLength + ); + result += common.repeat(' ', options.indent) + padStart((mark.line + i + 1).toString(), lineNoLength) + + ' | ' + line.str + '\n'; + } + + return result.replace(/\n$/, ''); + } + + + var snippet = makeSnippet; + + var TYPE_CONSTRUCTOR_OPTIONS = [ + 'kind', + 'multi', + 'resolve', + 'construct', + 'instanceOf', + 'predicate', + 'represent', + 'representName', + 'defaultStyle', + 'styleAliases' + ]; + + var YAML_NODE_KINDS = [ + 'scalar', + 'sequence', + 'mapping' + ]; + + function compileStyleAliases(map) { + var result = {}; + + if (map !== null) { + Object.keys(map).forEach(function (style) { + map[style].forEach(function (alias) { + result[String(alias)] = style; + }); + }); + } + + return result; + } + + function Type$1(tag, options) { + options = options || {}; + + Object.keys(options).forEach(function (name) { + if (TYPE_CONSTRUCTOR_OPTIONS.indexOf(name) === -1) { + throw new exception('Unknown option "' + name + '" is met in definition of "' + tag + '" YAML type.'); + } + }); + + // TODO: Add tag format check. + this.options = options; // keep original options in case user wants to extend this type later + this.tag = tag; + this.kind = options['kind'] || null; + this.resolve = options['resolve'] || function () { return true; }; + this.construct = options['construct'] || function (data) { return data; }; + this.instanceOf = options['instanceOf'] || null; + this.predicate = options['predicate'] || null; + this.represent = options['represent'] || null; + this.representName = options['representName'] || null; + this.defaultStyle = options['defaultStyle'] || null; + this.multi = options['multi'] || false; + this.styleAliases = compileStyleAliases(options['styleAliases'] || null); + + if (YAML_NODE_KINDS.indexOf(this.kind) === -1) { + throw new exception('Unknown kind "' + this.kind + '" is specified for "' + tag + '" YAML type.'); + } + } + + var type = Type$1; + + /*eslint-disable max-len*/ + + + + + + function compileList(schema, name) { + var result = []; + + schema[name].forEach(function (currentType) { + var newIndex = result.length; + + result.forEach(function (previousType, previousIndex) { + if (previousType.tag === currentType.tag && + previousType.kind === currentType.kind && + previousType.multi === currentType.multi) { + + newIndex = previousIndex; + } + }); + + result[newIndex] = currentType; + }); + + return result; + } + + + function compileMap(/* lists... */) { + var result = { + scalar: {}, + sequence: {}, + mapping: {}, + fallback: {}, + multi: { + scalar: [], + sequence: [], + mapping: [], + fallback: [] + } + }, index, length; + + function collectType(type) { + if (type.multi) { + result.multi[type.kind].push(type); + result.multi['fallback'].push(type); + } else { + result[type.kind][type.tag] = result['fallback'][type.tag] = type; + } + } + + for (index = 0, length = arguments.length; index < length; index += 1) { + arguments[index].forEach(collectType); + } + return result; + } + + + function Schema$1(definition) { + return this.extend(definition); + } + + + Schema$1.prototype.extend = function extend(definition) { + var implicit = []; + var explicit = []; + + if (definition instanceof type) { + // Schema.extend(type) + explicit.push(definition); + + } else if (Array.isArray(definition)) { + // Schema.extend([ type1, type2, ... ]) + explicit = explicit.concat(definition); + + } else if (definition && (Array.isArray(definition.implicit) || Array.isArray(definition.explicit))) { + // Schema.extend({ explicit: [ type1, type2, ... ], implicit: [ type1, type2, ... ] }) + if (definition.implicit) implicit = implicit.concat(definition.implicit); + if (definition.explicit) explicit = explicit.concat(definition.explicit); + + } else { + throw new exception('Schema.extend argument should be a Type, [ Type ], ' + + 'or a schema definition ({ implicit: [...], explicit: [...] })'); + } + + implicit.forEach(function (type$1) { + if (!(type$1 instanceof type)) { + throw new exception('Specified list of YAML types (or a single Type object) contains a non-Type object.'); + } + + if (type$1.loadKind && type$1.loadKind !== 'scalar') { + throw new exception('There is a non-scalar type in the implicit list of a schema. Implicit resolving of such types is not supported.'); + } + + if (type$1.multi) { + throw new exception('There is a multi type in the implicit list of a schema. Multi tags can only be listed as explicit.'); + } + }); + + explicit.forEach(function (type$1) { + if (!(type$1 instanceof type)) { + throw new exception('Specified list of YAML types (or a single Type object) contains a non-Type object.'); + } + }); + + var result = Object.create(Schema$1.prototype); + + result.implicit = (this.implicit || []).concat(implicit); + result.explicit = (this.explicit || []).concat(explicit); + + result.compiledImplicit = compileList(result, 'implicit'); + result.compiledExplicit = compileList(result, 'explicit'); + result.compiledTypeMap = compileMap(result.compiledImplicit, result.compiledExplicit); + + return result; + }; + + + var schema = Schema$1; + + var str = new type('tag:yaml.org,2002:str', { + kind: 'scalar', + construct: function (data) { return data !== null ? data : ''; } + }); + + var seq = new type('tag:yaml.org,2002:seq', { + kind: 'sequence', + construct: function (data) { return data !== null ? data : []; } + }); + + var map = new type('tag:yaml.org,2002:map', { + kind: 'mapping', + construct: function (data) { return data !== null ? data : {}; } + }); + + var failsafe = new schema({ + explicit: [ + str, + seq, + map + ] + }); + + function resolveYamlNull(data) { + if (data === null) return true; + + var max = data.length; + + return (max === 1 && data === '~') || + (max === 4 && (data === 'null' || data === 'Null' || data === 'NULL')); + } + + function constructYamlNull() { + return null; + } + + function isNull(object) { + return object === null; + } + + var _null = new type('tag:yaml.org,2002:null', { + kind: 'scalar', + resolve: resolveYamlNull, + construct: constructYamlNull, + predicate: isNull, + represent: { + canonical: function () { return '~'; }, + lowercase: function () { return 'null'; }, + uppercase: function () { return 'NULL'; }, + camelcase: function () { return 'Null'; }, + empty: function () { return ''; } + }, + defaultStyle: 'lowercase' + }); + + function resolveYamlBoolean(data) { + if (data === null) return false; + + var max = data.length; + + return (max === 4 && (data === 'true' || data === 'True' || data === 'TRUE')) || + (max === 5 && (data === 'false' || data === 'False' || data === 'FALSE')); + } + + function constructYamlBoolean(data) { + return data === 'true' || + data === 'True' || + data === 'TRUE'; + } + + function isBoolean(object) { + return Object.prototype.toString.call(object) === '[object Boolean]'; + } + + var bool = new type('tag:yaml.org,2002:bool', { + kind: 'scalar', + resolve: resolveYamlBoolean, + construct: constructYamlBoolean, + predicate: isBoolean, + represent: { + lowercase: function (object) { return object ? 'true' : 'false'; }, + uppercase: function (object) { return object ? 'TRUE' : 'FALSE'; }, + camelcase: function (object) { return object ? 'True' : 'False'; } + }, + defaultStyle: 'lowercase' + }); + + function isHexCode(c) { + return ((0x30/* 0 */ <= c) && (c <= 0x39/* 9 */)) || + ((0x41/* A */ <= c) && (c <= 0x46/* F */)) || + ((0x61/* a */ <= c) && (c <= 0x66/* f */)); + } + + function isOctCode(c) { + return ((0x30/* 0 */ <= c) && (c <= 0x37/* 7 */)); + } + + function isDecCode(c) { + return ((0x30/* 0 */ <= c) && (c <= 0x39/* 9 */)); + } + + function resolveYamlInteger(data) { + if (data === null) return false; + + var max = data.length, + index = 0, + hasDigits = false, + ch; + + if (!max) return false; + + ch = data[index]; + + // sign + if (ch === '-' || ch === '+') { + ch = data[++index]; + } + + if (ch === '0') { + // 0 + if (index + 1 === max) return true; + ch = data[++index]; + + // base 2, base 8, base 16 + + if (ch === 'b') { + // base 2 + index++; + + for (; index < max; index++) { + ch = data[index]; + if (ch === '_') continue; + if (ch !== '0' && ch !== '1') return false; + hasDigits = true; + } + return hasDigits && ch !== '_'; + } + + + if (ch === 'x') { + // base 16 + index++; + + for (; index < max; index++) { + ch = data[index]; + if (ch === '_') continue; + if (!isHexCode(data.charCodeAt(index))) return false; + hasDigits = true; + } + return hasDigits && ch !== '_'; + } + + + if (ch === 'o') { + // base 8 + index++; + + for (; index < max; index++) { + ch = data[index]; + if (ch === '_') continue; + if (!isOctCode(data.charCodeAt(index))) return false; + hasDigits = true; + } + return hasDigits && ch !== '_'; + } + } + + // base 10 (except 0) + + // value should not start with `_`; + if (ch === '_') return false; + + for (; index < max; index++) { + ch = data[index]; + if (ch === '_') continue; + if (!isDecCode(data.charCodeAt(index))) { + return false; + } + hasDigits = true; + } + + // Should have digits and should not end with `_` + if (!hasDigits || ch === '_') return false; + + return true; + } + + function constructYamlInteger(data) { + var value = data, sign = 1, ch; + + if (value.indexOf('_') !== -1) { + value = value.replace(/_/g, ''); + } + + ch = value[0]; + + if (ch === '-' || ch === '+') { + if (ch === '-') sign = -1; + value = value.slice(1); + ch = value[0]; + } + + if (value === '0') return 0; + + if (ch === '0') { + if (value[1] === 'b') return sign * parseInt(value.slice(2), 2); + if (value[1] === 'x') return sign * parseInt(value.slice(2), 16); + if (value[1] === 'o') return sign * parseInt(value.slice(2), 8); + } + + return sign * parseInt(value, 10); + } + + function isInteger(object) { + return (Object.prototype.toString.call(object)) === '[object Number]' && + (object % 1 === 0 && !common.isNegativeZero(object)); + } + + var int = new type('tag:yaml.org,2002:int', { + kind: 'scalar', + resolve: resolveYamlInteger, + construct: constructYamlInteger, + predicate: isInteger, + represent: { + binary: function (obj) { return obj >= 0 ? '0b' + obj.toString(2) : '-0b' + obj.toString(2).slice(1); }, + octal: function (obj) { return obj >= 0 ? '0o' + obj.toString(8) : '-0o' + obj.toString(8).slice(1); }, + decimal: function (obj) { return obj.toString(10); }, + /* eslint-disable max-len */ + hexadecimal: function (obj) { return obj >= 0 ? '0x' + obj.toString(16).toUpperCase() : '-0x' + obj.toString(16).toUpperCase().slice(1); } + }, + defaultStyle: 'decimal', + styleAliases: { + binary: [ 2, 'bin' ], + octal: [ 8, 'oct' ], + decimal: [ 10, 'dec' ], + hexadecimal: [ 16, 'hex' ] + } + }); + + var YAML_FLOAT_PATTERN = new RegExp( + // 2.5e4, 2.5 and integers + '^(?:[-+]?(?:[0-9][0-9_]*)(?:\\.[0-9_]*)?(?:[eE][-+]?[0-9]+)?' + + // .2e4, .2 + // special case, seems not from spec + '|\\.[0-9_]+(?:[eE][-+]?[0-9]+)?' + + // .inf + '|[-+]?\\.(?:inf|Inf|INF)' + + // .nan + '|\\.(?:nan|NaN|NAN))$'); + + function resolveYamlFloat(data) { + if (data === null) return false; + + if (!YAML_FLOAT_PATTERN.test(data) || + // Quick hack to not allow integers end with `_` + // Probably should update regexp & check speed + data[data.length - 1] === '_') { + return false; + } + + return true; + } + + function constructYamlFloat(data) { + var value, sign; + + value = data.replace(/_/g, '').toLowerCase(); + sign = value[0] === '-' ? -1 : 1; + + if ('+-'.indexOf(value[0]) >= 0) { + value = value.slice(1); + } + + if (value === '.inf') { + return (sign === 1) ? Number.POSITIVE_INFINITY : Number.NEGATIVE_INFINITY; + + } else if (value === '.nan') { + return NaN; + } + return sign * parseFloat(value, 10); + } + + + var SCIENTIFIC_WITHOUT_DOT = /^[-+]?[0-9]+e/; + + function representYamlFloat(object, style) { + var res; + + if (isNaN(object)) { + switch (style) { + case 'lowercase': return '.nan'; + case 'uppercase': return '.NAN'; + case 'camelcase': return '.NaN'; + } + } else if (Number.POSITIVE_INFINITY === object) { + switch (style) { + case 'lowercase': return '.inf'; + case 'uppercase': return '.INF'; + case 'camelcase': return '.Inf'; + } + } else if (Number.NEGATIVE_INFINITY === object) { + switch (style) { + case 'lowercase': return '-.inf'; + case 'uppercase': return '-.INF'; + case 'camelcase': return '-.Inf'; + } + } else if (common.isNegativeZero(object)) { + return '-0.0'; + } + + res = object.toString(10); + + // JS stringifier can build scientific format without dots: 5e-100, + // while YAML requres dot: 5.e-100. Fix it with simple hack + + return SCIENTIFIC_WITHOUT_DOT.test(res) ? res.replace('e', '.e') : res; + } + + function isFloat(object) { + return (Object.prototype.toString.call(object) === '[object Number]') && + (object % 1 !== 0 || common.isNegativeZero(object)); + } + + var float = new type('tag:yaml.org,2002:float', { + kind: 'scalar', + resolve: resolveYamlFloat, + construct: constructYamlFloat, + predicate: isFloat, + represent: representYamlFloat, + defaultStyle: 'lowercase' + }); + + var json = failsafe.extend({ + implicit: [ + _null, + bool, + int, + float + ] + }); + + var core = json; + + var YAML_DATE_REGEXP = new RegExp( + '^([0-9][0-9][0-9][0-9])' + // [1] year + '-([0-9][0-9])' + // [2] month + '-([0-9][0-9])$'); // [3] day + + var YAML_TIMESTAMP_REGEXP = new RegExp( + '^([0-9][0-9][0-9][0-9])' + // [1] year + '-([0-9][0-9]?)' + // [2] month + '-([0-9][0-9]?)' + // [3] day + '(?:[Tt]|[ \\t]+)' + // ... + '([0-9][0-9]?)' + // [4] hour + ':([0-9][0-9])' + // [5] minute + ':([0-9][0-9])' + // [6] second + '(?:\\.([0-9]*))?' + // [7] fraction + '(?:[ \\t]*(Z|([-+])([0-9][0-9]?)' + // [8] tz [9] tz_sign [10] tz_hour + '(?::([0-9][0-9]))?))?$'); // [11] tz_minute + + function resolveYamlTimestamp(data) { + if (data === null) return false; + if (YAML_DATE_REGEXP.exec(data) !== null) return true; + if (YAML_TIMESTAMP_REGEXP.exec(data) !== null) return true; + return false; + } + + function constructYamlTimestamp(data) { + var match, year, month, day, hour, minute, second, fraction = 0, + delta = null, tz_hour, tz_minute, date; + + match = YAML_DATE_REGEXP.exec(data); + if (match === null) match = YAML_TIMESTAMP_REGEXP.exec(data); + + if (match === null) throw new Error('Date resolve error'); + + // match: [1] year [2] month [3] day + + year = +(match[1]); + month = +(match[2]) - 1; // JS month starts with 0 + day = +(match[3]); + + if (!match[4]) { // no hour + return new Date(Date.UTC(year, month, day)); + } + + // match: [4] hour [5] minute [6] second [7] fraction + + hour = +(match[4]); + minute = +(match[5]); + second = +(match[6]); + + if (match[7]) { + fraction = match[7].slice(0, 3); + while (fraction.length < 3) { // milli-seconds + fraction += '0'; + } + fraction = +fraction; + } + + // match: [8] tz [9] tz_sign [10] tz_hour [11] tz_minute + + if (match[9]) { + tz_hour = +(match[10]); + tz_minute = +(match[11] || 0); + delta = (tz_hour * 60 + tz_minute) * 60000; // delta in mili-seconds + if (match[9] === '-') delta = -delta; + } + + date = new Date(Date.UTC(year, month, day, hour, minute, second, fraction)); + + if (delta) date.setTime(date.getTime() - delta); + + return date; + } + + function representYamlTimestamp(object /*, style*/) { + return object.toISOString(); + } + + var timestamp = new type('tag:yaml.org,2002:timestamp', { + kind: 'scalar', + resolve: resolveYamlTimestamp, + construct: constructYamlTimestamp, + instanceOf: Date, + represent: representYamlTimestamp + }); + + function resolveYamlMerge(data) { + return data === '<<' || data === null; + } + + var merge = new type('tag:yaml.org,2002:merge', { + kind: 'scalar', + resolve: resolveYamlMerge + }); + + /*eslint-disable no-bitwise*/ + + + + + + // [ 64, 65, 66 ] -> [ padding, CR, LF ] + var BASE64_MAP = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=\n\r'; + + + function resolveYamlBinary(data) { + if (data === null) return false; + + var code, idx, bitlen = 0, max = data.length, map = BASE64_MAP; + + // Convert one by one. + for (idx = 0; idx < max; idx++) { + code = map.indexOf(data.charAt(idx)); + + // Skip CR/LF + if (code > 64) continue; + + // Fail on illegal characters + if (code < 0) return false; + + bitlen += 6; + } + + // If there are any bits left, source was corrupted + return (bitlen % 8) === 0; + } + + function constructYamlBinary(data) { + var idx, tailbits, + input = data.replace(/[\r\n=]/g, ''), // remove CR/LF & padding to simplify scan + max = input.length, + map = BASE64_MAP, + bits = 0, + result = []; + + // Collect by 6*4 bits (3 bytes) + + for (idx = 0; idx < max; idx++) { + if ((idx % 4 === 0) && idx) { + result.push((bits >> 16) & 0xFF); + result.push((bits >> 8) & 0xFF); + result.push(bits & 0xFF); + } + + bits = (bits << 6) | map.indexOf(input.charAt(idx)); + } + + // Dump tail + + tailbits = (max % 4) * 6; + + if (tailbits === 0) { + result.push((bits >> 16) & 0xFF); + result.push((bits >> 8) & 0xFF); + result.push(bits & 0xFF); + } else if (tailbits === 18) { + result.push((bits >> 10) & 0xFF); + result.push((bits >> 2) & 0xFF); + } else if (tailbits === 12) { + result.push((bits >> 4) & 0xFF); + } + + return new Uint8Array(result); + } + + function representYamlBinary(object /*, style*/) { + var result = '', bits = 0, idx, tail, + max = object.length, + map = BASE64_MAP; + + // Convert every three bytes to 4 ASCII characters. + + for (idx = 0; idx < max; idx++) { + if ((idx % 3 === 0) && idx) { + result += map[(bits >> 18) & 0x3F]; + result += map[(bits >> 12) & 0x3F]; + result += map[(bits >> 6) & 0x3F]; + result += map[bits & 0x3F]; + } + + bits = (bits << 8) + object[idx]; + } + + // Dump tail + + tail = max % 3; + + if (tail === 0) { + result += map[(bits >> 18) & 0x3F]; + result += map[(bits >> 12) & 0x3F]; + result += map[(bits >> 6) & 0x3F]; + result += map[bits & 0x3F]; + } else if (tail === 2) { + result += map[(bits >> 10) & 0x3F]; + result += map[(bits >> 4) & 0x3F]; + result += map[(bits << 2) & 0x3F]; + result += map[64]; + } else if (tail === 1) { + result += map[(bits >> 2) & 0x3F]; + result += map[(bits << 4) & 0x3F]; + result += map[64]; + result += map[64]; + } + + return result; + } + + function isBinary(obj) { + return Object.prototype.toString.call(obj) === '[object Uint8Array]'; + } + + var binary = new type('tag:yaml.org,2002:binary', { + kind: 'scalar', + resolve: resolveYamlBinary, + construct: constructYamlBinary, + predicate: isBinary, + represent: representYamlBinary + }); + + var _hasOwnProperty$3 = Object.prototype.hasOwnProperty; + var _toString$2 = Object.prototype.toString; + + function resolveYamlOmap(data) { + if (data === null) return true; + + var objectKeys = [], index, length, pair, pairKey, pairHasKey, + object = data; + + for (index = 0, length = object.length; index < length; index += 1) { + pair = object[index]; + pairHasKey = false; + + if (_toString$2.call(pair) !== '[object Object]') return false; + + for (pairKey in pair) { + if (_hasOwnProperty$3.call(pair, pairKey)) { + if (!pairHasKey) pairHasKey = true; + else return false; + } + } + + if (!pairHasKey) return false; + + if (objectKeys.indexOf(pairKey) === -1) objectKeys.push(pairKey); + else return false; + } + + return true; + } + + function constructYamlOmap(data) { + return data !== null ? data : []; + } + + var omap = new type('tag:yaml.org,2002:omap', { + kind: 'sequence', + resolve: resolveYamlOmap, + construct: constructYamlOmap + }); + + var _toString$1 = Object.prototype.toString; + + function resolveYamlPairs(data) { + if (data === null) return true; + + var index, length, pair, keys, result, + object = data; + + result = new Array(object.length); + + for (index = 0, length = object.length; index < length; index += 1) { + pair = object[index]; + + if (_toString$1.call(pair) !== '[object Object]') return false; + + keys = Object.keys(pair); + + if (keys.length !== 1) return false; + + result[index] = [ keys[0], pair[keys[0]] ]; + } + + return true; + } + + function constructYamlPairs(data) { + if (data === null) return []; + + var index, length, pair, keys, result, + object = data; + + result = new Array(object.length); + + for (index = 0, length = object.length; index < length; index += 1) { + pair = object[index]; + + keys = Object.keys(pair); + + result[index] = [ keys[0], pair[keys[0]] ]; + } + + return result; + } + + var pairs = new type('tag:yaml.org,2002:pairs', { + kind: 'sequence', + resolve: resolveYamlPairs, + construct: constructYamlPairs + }); + + var _hasOwnProperty$2 = Object.prototype.hasOwnProperty; + + function resolveYamlSet(data) { + if (data === null) return true; + + var key, object = data; + + for (key in object) { + if (_hasOwnProperty$2.call(object, key)) { + if (object[key] !== null) return false; + } + } + + return true; + } + + function constructYamlSet(data) { + return data !== null ? data : {}; + } + + var set = new type('tag:yaml.org,2002:set', { + kind: 'mapping', + resolve: resolveYamlSet, + construct: constructYamlSet + }); + + var _default = core.extend({ + implicit: [ + timestamp, + merge + ], + explicit: [ + binary, + omap, + pairs, + set + ] + }); + + /*eslint-disable max-len,no-use-before-define*/ + + + + + + + + var _hasOwnProperty$1 = Object.prototype.hasOwnProperty; + + + var CONTEXT_FLOW_IN = 1; + var CONTEXT_FLOW_OUT = 2; + var CONTEXT_BLOCK_IN = 3; + var CONTEXT_BLOCK_OUT = 4; + + + var CHOMPING_CLIP = 1; + var CHOMPING_STRIP = 2; + var CHOMPING_KEEP = 3; + + + var PATTERN_NON_PRINTABLE = /[\x00-\x08\x0B\x0C\x0E-\x1F\x7F-\x84\x86-\x9F\uFFFE\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]/; + var PATTERN_NON_ASCII_LINE_BREAKS = /[\x85\u2028\u2029]/; + var PATTERN_FLOW_INDICATORS = /[,\[\]\{\}]/; + var PATTERN_TAG_HANDLE = /^(?:!|!!|![a-z\-]+!)$/i; + var PATTERN_TAG_URI = /^(?:!|[^,\[\]\{\}])(?:%[0-9a-f]{2}|[0-9a-z\-#;\/\?:@&=\+\$,_\.!~\*'\(\)\[\]])*$/i; + + + function _class(obj) { return Object.prototype.toString.call(obj); } + + function is_EOL(c) { + return (c === 0x0A/* LF */) || (c === 0x0D/* CR */); + } + + function is_WHITE_SPACE(c) { + return (c === 0x09/* Tab */) || (c === 0x20/* Space */); + } + + function is_WS_OR_EOL(c) { + return (c === 0x09/* Tab */) || + (c === 0x20/* Space */) || + (c === 0x0A/* LF */) || + (c === 0x0D/* CR */); + } + + function is_FLOW_INDICATOR(c) { + return c === 0x2C/* , */ || + c === 0x5B/* [ */ || + c === 0x5D/* ] */ || + c === 0x7B/* { */ || + c === 0x7D/* } */; + } + + function fromHexCode(c) { + var lc; + + if ((0x30/* 0 */ <= c) && (c <= 0x39/* 9 */)) { + return c - 0x30; + } + + /*eslint-disable no-bitwise*/ + lc = c | 0x20; + + if ((0x61/* a */ <= lc) && (lc <= 0x66/* f */)) { + return lc - 0x61 + 10; + } + + return -1; + } + + function escapedHexLen(c) { + if (c === 0x78/* x */) { return 2; } + if (c === 0x75/* u */) { return 4; } + if (c === 0x55/* U */) { return 8; } + return 0; + } + + function fromDecimalCode(c) { + if ((0x30/* 0 */ <= c) && (c <= 0x39/* 9 */)) { + return c - 0x30; + } + + return -1; + } + + function simpleEscapeSequence(c) { + /* eslint-disable indent */ + return (c === 0x30/* 0 */) ? '\x00' : + (c === 0x61/* a */) ? '\x07' : + (c === 0x62/* b */) ? '\x08' : + (c === 0x74/* t */) ? '\x09' : + (c === 0x09/* Tab */) ? '\x09' : + (c === 0x6E/* n */) ? '\x0A' : + (c === 0x76/* v */) ? '\x0B' : + (c === 0x66/* f */) ? '\x0C' : + (c === 0x72/* r */) ? '\x0D' : + (c === 0x65/* e */) ? '\x1B' : + (c === 0x20/* Space */) ? ' ' : + (c === 0x22/* " */) ? '\x22' : + (c === 0x2F/* / */) ? '/' : + (c === 0x5C/* \ */) ? '\x5C' : + (c === 0x4E/* N */) ? '\x85' : + (c === 0x5F/* _ */) ? '\xA0' : + (c === 0x4C/* L */) ? '\u2028' : + (c === 0x50/* P */) ? '\u2029' : ''; + } + + function charFromCodepoint(c) { + if (c <= 0xFFFF) { + return String.fromCharCode(c); + } + // Encode UTF-16 surrogate pair + // https://en.wikipedia.org/wiki/UTF-16#Code_points_U.2B010000_to_U.2B10FFFF + return String.fromCharCode( + ((c - 0x010000) >> 10) + 0xD800, + ((c - 0x010000) & 0x03FF) + 0xDC00 + ); + } + + var simpleEscapeCheck = new Array(256); // integer, for fast access + var simpleEscapeMap = new Array(256); + for (var i = 0; i < 256; i++) { + simpleEscapeCheck[i] = simpleEscapeSequence(i) ? 1 : 0; + simpleEscapeMap[i] = simpleEscapeSequence(i); + } + + + function State$1(input, options) { + this.input = input; + + this.filename = options['filename'] || null; + this.schema = options['schema'] || _default; + this.onWarning = options['onWarning'] || null; + // (Hidden) Remove? makes the loader to expect YAML 1.1 documents + // if such documents have no explicit %YAML directive + this.legacy = options['legacy'] || false; + + this.json = options['json'] || false; + this.listener = options['listener'] || null; + + this.implicitTypes = this.schema.compiledImplicit; + this.typeMap = this.schema.compiledTypeMap; + + this.length = input.length; + this.position = 0; + this.line = 0; + this.lineStart = 0; + this.lineIndent = 0; + + // position of first leading tab in the current line, + // used to make sure there are no tabs in the indentation + this.firstTabInLine = -1; + + this.documents = []; + + /* + this.version; + this.checkLineBreaks; + this.tagMap; + this.anchorMap; + this.tag; + this.anchor; + this.kind; + this.result;*/ + + } + + + function generateError(state, message) { + var mark = { + name: state.filename, + buffer: state.input.slice(0, -1), // omit trailing \0 + position: state.position, + line: state.line, + column: state.position - state.lineStart + }; + + mark.snippet = snippet(mark); + + return new exception(message, mark); + } + + function throwError(state, message) { + throw generateError(state, message); + } + + function throwWarning(state, message) { + if (state.onWarning) { + state.onWarning.call(null, generateError(state, message)); + } + } + + + var directiveHandlers = { + + YAML: function handleYamlDirective(state, name, args) { + + var match, major, minor; + + if (state.version !== null) { + throwError(state, 'duplication of %YAML directive'); + } + + if (args.length !== 1) { + throwError(state, 'YAML directive accepts exactly one argument'); + } + + match = /^([0-9]+)\.([0-9]+)$/.exec(args[0]); + + if (match === null) { + throwError(state, 'ill-formed argument of the YAML directive'); + } + + major = parseInt(match[1], 10); + minor = parseInt(match[2], 10); + + if (major !== 1) { + throwError(state, 'unacceptable YAML version of the document'); + } + + state.version = args[0]; + state.checkLineBreaks = (minor < 2); + + if (minor !== 1 && minor !== 2) { + throwWarning(state, 'unsupported YAML version of the document'); + } + }, + + TAG: function handleTagDirective(state, name, args) { + + var handle, prefix; + + if (args.length !== 2) { + throwError(state, 'TAG directive accepts exactly two arguments'); + } + + handle = args[0]; + prefix = args[1]; + + if (!PATTERN_TAG_HANDLE.test(handle)) { + throwError(state, 'ill-formed tag handle (first argument) of the TAG directive'); + } + + if (_hasOwnProperty$1.call(state.tagMap, handle)) { + throwError(state, 'there is a previously declared suffix for "' + handle + '" tag handle'); + } + + if (!PATTERN_TAG_URI.test(prefix)) { + throwError(state, 'ill-formed tag prefix (second argument) of the TAG directive'); + } + + try { + prefix = decodeURIComponent(prefix); + } catch (err) { + throwError(state, 'tag prefix is malformed: ' + prefix); + } + + state.tagMap[handle] = prefix; + } + }; + + + function captureSegment(state, start, end, checkJson) { + var _position, _length, _character, _result; + + if (start < end) { + _result = state.input.slice(start, end); + + if (checkJson) { + for (_position = 0, _length = _result.length; _position < _length; _position += 1) { + _character = _result.charCodeAt(_position); + if (!(_character === 0x09 || + (0x20 <= _character && _character <= 0x10FFFF))) { + throwError(state, 'expected valid JSON character'); + } + } + } else if (PATTERN_NON_PRINTABLE.test(_result)) { + throwError(state, 'the stream contains non-printable characters'); + } + + state.result += _result; + } + } + + function mergeMappings(state, destination, source, overridableKeys) { + var sourceKeys, key, index, quantity; + + if (!common.isObject(source)) { + throwError(state, 'cannot merge mappings; the provided source object is unacceptable'); + } + + sourceKeys = Object.keys(source); + + for (index = 0, quantity = sourceKeys.length; index < quantity; index += 1) { + key = sourceKeys[index]; + + if (!_hasOwnProperty$1.call(destination, key)) { + destination[key] = source[key]; + overridableKeys[key] = true; + } + } + } + + function storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, valueNode, + startLine, startLineStart, startPos) { + + var index, quantity; + + // The output is a plain object here, so keys can only be strings. + // We need to convert keyNode to a string, but doing so can hang the process + // (deeply nested arrays that explode exponentially using aliases). + if (Array.isArray(keyNode)) { + keyNode = Array.prototype.slice.call(keyNode); + + for (index = 0, quantity = keyNode.length; index < quantity; index += 1) { + if (Array.isArray(keyNode[index])) { + throwError(state, 'nested arrays are not supported inside keys'); + } + + if (typeof keyNode === 'object' && _class(keyNode[index]) === '[object Object]') { + keyNode[index] = '[object Object]'; + } + } + } + + // Avoid code execution in load() via toString property + // (still use its own toString for arrays, timestamps, + // and whatever user schema extensions happen to have @@toStringTag) + if (typeof keyNode === 'object' && _class(keyNode) === '[object Object]') { + keyNode = '[object Object]'; + } + + + keyNode = String(keyNode); + + if (_result === null) { + _result = {}; + } + + if (keyTag === 'tag:yaml.org,2002:merge') { + if (Array.isArray(valueNode)) { + for (index = 0, quantity = valueNode.length; index < quantity; index += 1) { + mergeMappings(state, _result, valueNode[index], overridableKeys); + } + } else { + mergeMappings(state, _result, valueNode, overridableKeys); + } + } else { + if (!state.json && + !_hasOwnProperty$1.call(overridableKeys, keyNode) && + _hasOwnProperty$1.call(_result, keyNode)) { + state.line = startLine || state.line; + state.lineStart = startLineStart || state.lineStart; + state.position = startPos || state.position; + throwError(state, 'duplicated mapping key'); + } + + // used for this specific key only because Object.defineProperty is slow + if (keyNode === '__proto__') { + Object.defineProperty(_result, keyNode, { + configurable: true, + enumerable: true, + writable: true, + value: valueNode + }); + } else { + _result[keyNode] = valueNode; + } + delete overridableKeys[keyNode]; + } + + return _result; + } + + function readLineBreak(state) { + var ch; + + ch = state.input.charCodeAt(state.position); + + if (ch === 0x0A/* LF */) { + state.position++; + } else if (ch === 0x0D/* CR */) { + state.position++; + if (state.input.charCodeAt(state.position) === 0x0A/* LF */) { + state.position++; + } + } else { + throwError(state, 'a line break is expected'); + } + + state.line += 1; + state.lineStart = state.position; + state.firstTabInLine = -1; + } + + function skipSeparationSpace(state, allowComments, checkIndent) { + var lineBreaks = 0, + ch = state.input.charCodeAt(state.position); + + while (ch !== 0) { + while (is_WHITE_SPACE(ch)) { + if (ch === 0x09/* Tab */ && state.firstTabInLine === -1) { + state.firstTabInLine = state.position; + } + ch = state.input.charCodeAt(++state.position); + } + + if (allowComments && ch === 0x23/* # */) { + do { + ch = state.input.charCodeAt(++state.position); + } while (ch !== 0x0A/* LF */ && ch !== 0x0D/* CR */ && ch !== 0); + } + + if (is_EOL(ch)) { + readLineBreak(state); + + ch = state.input.charCodeAt(state.position); + lineBreaks++; + state.lineIndent = 0; + + while (ch === 0x20/* Space */) { + state.lineIndent++; + ch = state.input.charCodeAt(++state.position); + } + } else { + break; + } + } + + if (checkIndent !== -1 && lineBreaks !== 0 && state.lineIndent < checkIndent) { + throwWarning(state, 'deficient indentation'); + } + + return lineBreaks; + } + + function testDocumentSeparator(state) { + var _position = state.position, + ch; + + ch = state.input.charCodeAt(_position); + + // Condition state.position === state.lineStart is tested + // in parent on each call, for efficiency. No needs to test here again. + if ((ch === 0x2D/* - */ || ch === 0x2E/* . */) && + ch === state.input.charCodeAt(_position + 1) && + ch === state.input.charCodeAt(_position + 2)) { + + _position += 3; + + ch = state.input.charCodeAt(_position); + + if (ch === 0 || is_WS_OR_EOL(ch)) { + return true; + } + } + + return false; + } + + function writeFoldedLines(state, count) { + if (count === 1) { + state.result += ' '; + } else if (count > 1) { + state.result += common.repeat('\n', count - 1); + } + } + + + function readPlainScalar(state, nodeIndent, withinFlowCollection) { + var preceding, + following, + captureStart, + captureEnd, + hasPendingContent, + _line, + _lineStart, + _lineIndent, + _kind = state.kind, + _result = state.result, + ch; + + ch = state.input.charCodeAt(state.position); + + if (is_WS_OR_EOL(ch) || + is_FLOW_INDICATOR(ch) || + ch === 0x23/* # */ || + ch === 0x26/* & */ || + ch === 0x2A/* * */ || + ch === 0x21/* ! */ || + ch === 0x7C/* | */ || + ch === 0x3E/* > */ || + ch === 0x27/* ' */ || + ch === 0x22/* " */ || + ch === 0x25/* % */ || + ch === 0x40/* @ */ || + ch === 0x60/* ` */) { + return false; + } + + if (ch === 0x3F/* ? */ || ch === 0x2D/* - */) { + following = state.input.charCodeAt(state.position + 1); + + if (is_WS_OR_EOL(following) || + withinFlowCollection && is_FLOW_INDICATOR(following)) { + return false; + } + } + + state.kind = 'scalar'; + state.result = ''; + captureStart = captureEnd = state.position; + hasPendingContent = false; + + while (ch !== 0) { + if (ch === 0x3A/* : */) { + following = state.input.charCodeAt(state.position + 1); + + if (is_WS_OR_EOL(following) || + withinFlowCollection && is_FLOW_INDICATOR(following)) { + break; + } + + } else if (ch === 0x23/* # */) { + preceding = state.input.charCodeAt(state.position - 1); + + if (is_WS_OR_EOL(preceding)) { + break; + } + + } else if ((state.position === state.lineStart && testDocumentSeparator(state)) || + withinFlowCollection && is_FLOW_INDICATOR(ch)) { + break; + + } else if (is_EOL(ch)) { + _line = state.line; + _lineStart = state.lineStart; + _lineIndent = state.lineIndent; + skipSeparationSpace(state, false, -1); + + if (state.lineIndent >= nodeIndent) { + hasPendingContent = true; + ch = state.input.charCodeAt(state.position); + continue; + } else { + state.position = captureEnd; + state.line = _line; + state.lineStart = _lineStart; + state.lineIndent = _lineIndent; + break; + } + } + + if (hasPendingContent) { + captureSegment(state, captureStart, captureEnd, false); + writeFoldedLines(state, state.line - _line); + captureStart = captureEnd = state.position; + hasPendingContent = false; + } + + if (!is_WHITE_SPACE(ch)) { + captureEnd = state.position + 1; + } + + ch = state.input.charCodeAt(++state.position); + } + + captureSegment(state, captureStart, captureEnd, false); + + if (state.result) { + return true; + } + + state.kind = _kind; + state.result = _result; + return false; + } + + function readSingleQuotedScalar(state, nodeIndent) { + var ch, + captureStart, captureEnd; + + ch = state.input.charCodeAt(state.position); + + if (ch !== 0x27/* ' */) { + return false; + } + + state.kind = 'scalar'; + state.result = ''; + state.position++; + captureStart = captureEnd = state.position; + + while ((ch = state.input.charCodeAt(state.position)) !== 0) { + if (ch === 0x27/* ' */) { + captureSegment(state, captureStart, state.position, true); + ch = state.input.charCodeAt(++state.position); + + if (ch === 0x27/* ' */) { + captureStart = state.position; + state.position++; + captureEnd = state.position; + } else { + return true; + } + + } else if (is_EOL(ch)) { + captureSegment(state, captureStart, captureEnd, true); + writeFoldedLines(state, skipSeparationSpace(state, false, nodeIndent)); + captureStart = captureEnd = state.position; + + } else if (state.position === state.lineStart && testDocumentSeparator(state)) { + throwError(state, 'unexpected end of the document within a single quoted scalar'); + + } else { + state.position++; + captureEnd = state.position; + } + } + + throwError(state, 'unexpected end of the stream within a single quoted scalar'); + } + + function readDoubleQuotedScalar(state, nodeIndent) { + var captureStart, + captureEnd, + hexLength, + hexResult, + tmp, + ch; + + ch = state.input.charCodeAt(state.position); + + if (ch !== 0x22/* " */) { + return false; + } + + state.kind = 'scalar'; + state.result = ''; + state.position++; + captureStart = captureEnd = state.position; + + while ((ch = state.input.charCodeAt(state.position)) !== 0) { + if (ch === 0x22/* " */) { + captureSegment(state, captureStart, state.position, true); + state.position++; + return true; + + } else if (ch === 0x5C/* \ */) { + captureSegment(state, captureStart, state.position, true); + ch = state.input.charCodeAt(++state.position); + + if (is_EOL(ch)) { + skipSeparationSpace(state, false, nodeIndent); + + // TODO: rework to inline fn with no type cast? + } else if (ch < 256 && simpleEscapeCheck[ch]) { + state.result += simpleEscapeMap[ch]; + state.position++; + + } else if ((tmp = escapedHexLen(ch)) > 0) { + hexLength = tmp; + hexResult = 0; + + for (; hexLength > 0; hexLength--) { + ch = state.input.charCodeAt(++state.position); + + if ((tmp = fromHexCode(ch)) >= 0) { + hexResult = (hexResult << 4) + tmp; + + } else { + throwError(state, 'expected hexadecimal character'); + } + } + + state.result += charFromCodepoint(hexResult); + + state.position++; + + } else { + throwError(state, 'unknown escape sequence'); + } + + captureStart = captureEnd = state.position; + + } else if (is_EOL(ch)) { + captureSegment(state, captureStart, captureEnd, true); + writeFoldedLines(state, skipSeparationSpace(state, false, nodeIndent)); + captureStart = captureEnd = state.position; + + } else if (state.position === state.lineStart && testDocumentSeparator(state)) { + throwError(state, 'unexpected end of the document within a double quoted scalar'); + + } else { + state.position++; + captureEnd = state.position; + } + } + + throwError(state, 'unexpected end of the stream within a double quoted scalar'); + } + + function readFlowCollection(state, nodeIndent) { + var readNext = true, + _line, + _lineStart, + _pos, + _tag = state.tag, + _result, + _anchor = state.anchor, + following, + terminator, + isPair, + isExplicitPair, + isMapping, + overridableKeys = Object.create(null), + keyNode, + keyTag, + valueNode, + ch; + + ch = state.input.charCodeAt(state.position); + + if (ch === 0x5B/* [ */) { + terminator = 0x5D;/* ] */ + isMapping = false; + _result = []; + } else if (ch === 0x7B/* { */) { + terminator = 0x7D;/* } */ + isMapping = true; + _result = {}; + } else { + return false; + } + + if (state.anchor !== null) { + state.anchorMap[state.anchor] = _result; + } + + ch = state.input.charCodeAt(++state.position); + + while (ch !== 0) { + skipSeparationSpace(state, true, nodeIndent); + + ch = state.input.charCodeAt(state.position); + + if (ch === terminator) { + state.position++; + state.tag = _tag; + state.anchor = _anchor; + state.kind = isMapping ? 'mapping' : 'sequence'; + state.result = _result; + return true; + } else if (!readNext) { + throwError(state, 'missed comma between flow collection entries'); + } else if (ch === 0x2C/* , */) { + // "flow collection entries can never be completely empty", as per YAML 1.2, section 7.4 + throwError(state, "expected the node content, but found ','"); + } + + keyTag = keyNode = valueNode = null; + isPair = isExplicitPair = false; + + if (ch === 0x3F/* ? */) { + following = state.input.charCodeAt(state.position + 1); + + if (is_WS_OR_EOL(following)) { + isPair = isExplicitPair = true; + state.position++; + skipSeparationSpace(state, true, nodeIndent); + } + } + + _line = state.line; // Save the current line. + _lineStart = state.lineStart; + _pos = state.position; + composeNode(state, nodeIndent, CONTEXT_FLOW_IN, false, true); + keyTag = state.tag; + keyNode = state.result; + skipSeparationSpace(state, true, nodeIndent); + + ch = state.input.charCodeAt(state.position); + + if ((isExplicitPair || state.line === _line) && ch === 0x3A/* : */) { + isPair = true; + ch = state.input.charCodeAt(++state.position); + skipSeparationSpace(state, true, nodeIndent); + composeNode(state, nodeIndent, CONTEXT_FLOW_IN, false, true); + valueNode = state.result; + } + + if (isMapping) { + storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, valueNode, _line, _lineStart, _pos); + } else if (isPair) { + _result.push(storeMappingPair(state, null, overridableKeys, keyTag, keyNode, valueNode, _line, _lineStart, _pos)); + } else { + _result.push(keyNode); + } + + skipSeparationSpace(state, true, nodeIndent); + + ch = state.input.charCodeAt(state.position); + + if (ch === 0x2C/* , */) { + readNext = true; + ch = state.input.charCodeAt(++state.position); + } else { + readNext = false; + } + } + + throwError(state, 'unexpected end of the stream within a flow collection'); + } + + function readBlockScalar(state, nodeIndent) { + var captureStart, + folding, + chomping = CHOMPING_CLIP, + didReadContent = false, + detectedIndent = false, + textIndent = nodeIndent, + emptyLines = 0, + atMoreIndented = false, + tmp, + ch; + + ch = state.input.charCodeAt(state.position); + + if (ch === 0x7C/* | */) { + folding = false; + } else if (ch === 0x3E/* > */) { + folding = true; + } else { + return false; + } + + state.kind = 'scalar'; + state.result = ''; + + while (ch !== 0) { + ch = state.input.charCodeAt(++state.position); + + if (ch === 0x2B/* + */ || ch === 0x2D/* - */) { + if (CHOMPING_CLIP === chomping) { + chomping = (ch === 0x2B/* + */) ? CHOMPING_KEEP : CHOMPING_STRIP; + } else { + throwError(state, 'repeat of a chomping mode identifier'); + } + + } else if ((tmp = fromDecimalCode(ch)) >= 0) { + if (tmp === 0) { + throwError(state, 'bad explicit indentation width of a block scalar; it cannot be less than one'); + } else if (!detectedIndent) { + textIndent = nodeIndent + tmp - 1; + detectedIndent = true; + } else { + throwError(state, 'repeat of an indentation width identifier'); + } + + } else { + break; + } + } + + if (is_WHITE_SPACE(ch)) { + do { ch = state.input.charCodeAt(++state.position); } + while (is_WHITE_SPACE(ch)); + + if (ch === 0x23/* # */) { + do { ch = state.input.charCodeAt(++state.position); } + while (!is_EOL(ch) && (ch !== 0)); + } + } + + while (ch !== 0) { + readLineBreak(state); + state.lineIndent = 0; + + ch = state.input.charCodeAt(state.position); + + while ((!detectedIndent || state.lineIndent < textIndent) && + (ch === 0x20/* Space */)) { + state.lineIndent++; + ch = state.input.charCodeAt(++state.position); + } + + if (!detectedIndent && state.lineIndent > textIndent) { + textIndent = state.lineIndent; + } + + if (is_EOL(ch)) { + emptyLines++; + continue; + } + + // End of the scalar. + if (state.lineIndent < textIndent) { + + // Perform the chomping. + if (chomping === CHOMPING_KEEP) { + state.result += common.repeat('\n', didReadContent ? 1 + emptyLines : emptyLines); + } else if (chomping === CHOMPING_CLIP) { + if (didReadContent) { // i.e. only if the scalar is not empty. + state.result += '\n'; + } + } + + // Break this `while` cycle and go to the funciton's epilogue. + break; + } + + // Folded style: use fancy rules to handle line breaks. + if (folding) { + + // Lines starting with white space characters (more-indented lines) are not folded. + if (is_WHITE_SPACE(ch)) { + atMoreIndented = true; + // except for the first content line (cf. Example 8.1) + state.result += common.repeat('\n', didReadContent ? 1 + emptyLines : emptyLines); + + // End of more-indented block. + } else if (atMoreIndented) { + atMoreIndented = false; + state.result += common.repeat('\n', emptyLines + 1); + + // Just one line break - perceive as the same line. + } else if (emptyLines === 0) { + if (didReadContent) { // i.e. only if we have already read some scalar content. + state.result += ' '; + } + + // Several line breaks - perceive as different lines. + } else { + state.result += common.repeat('\n', emptyLines); + } + + // Literal style: just add exact number of line breaks between content lines. + } else { + // Keep all line breaks except the header line break. + state.result += common.repeat('\n', didReadContent ? 1 + emptyLines : emptyLines); + } + + didReadContent = true; + detectedIndent = true; + emptyLines = 0; + captureStart = state.position; + + while (!is_EOL(ch) && (ch !== 0)) { + ch = state.input.charCodeAt(++state.position); + } + + captureSegment(state, captureStart, state.position, false); + } + + return true; + } + + function readBlockSequence(state, nodeIndent) { + var _line, + _tag = state.tag, + _anchor = state.anchor, + _result = [], + following, + detected = false, + ch; + + // there is a leading tab before this token, so it can't be a block sequence/mapping; + // it can still be flow sequence/mapping or a scalar + if (state.firstTabInLine !== -1) return false; + + if (state.anchor !== null) { + state.anchorMap[state.anchor] = _result; + } + + ch = state.input.charCodeAt(state.position); + + while (ch !== 0) { + if (state.firstTabInLine !== -1) { + state.position = state.firstTabInLine; + throwError(state, 'tab characters must not be used in indentation'); + } + + if (ch !== 0x2D/* - */) { + break; + } + + following = state.input.charCodeAt(state.position + 1); + + if (!is_WS_OR_EOL(following)) { + break; + } + + detected = true; + state.position++; + + if (skipSeparationSpace(state, true, -1)) { + if (state.lineIndent <= nodeIndent) { + _result.push(null); + ch = state.input.charCodeAt(state.position); + continue; + } + } + + _line = state.line; + composeNode(state, nodeIndent, CONTEXT_BLOCK_IN, false, true); + _result.push(state.result); + skipSeparationSpace(state, true, -1); + + ch = state.input.charCodeAt(state.position); + + if ((state.line === _line || state.lineIndent > nodeIndent) && (ch !== 0)) { + throwError(state, 'bad indentation of a sequence entry'); + } else if (state.lineIndent < nodeIndent) { + break; + } + } + + if (detected) { + state.tag = _tag; + state.anchor = _anchor; + state.kind = 'sequence'; + state.result = _result; + return true; + } + return false; + } + + function readBlockMapping(state, nodeIndent, flowIndent) { + var following, + allowCompact, + _line, + _keyLine, + _keyLineStart, + _keyPos, + _tag = state.tag, + _anchor = state.anchor, + _result = {}, + overridableKeys = Object.create(null), + keyTag = null, + keyNode = null, + valueNode = null, + atExplicitKey = false, + detected = false, + ch; + + // there is a leading tab before this token, so it can't be a block sequence/mapping; + // it can still be flow sequence/mapping or a scalar + if (state.firstTabInLine !== -1) return false; + + if (state.anchor !== null) { + state.anchorMap[state.anchor] = _result; + } + + ch = state.input.charCodeAt(state.position); + + while (ch !== 0) { + if (!atExplicitKey && state.firstTabInLine !== -1) { + state.position = state.firstTabInLine; + throwError(state, 'tab characters must not be used in indentation'); + } + + following = state.input.charCodeAt(state.position + 1); + _line = state.line; // Save the current line. + + // + // Explicit notation case. There are two separate blocks: + // first for the key (denoted by "?") and second for the value (denoted by ":") + // + if ((ch === 0x3F/* ? */ || ch === 0x3A/* : */) && is_WS_OR_EOL(following)) { + + if (ch === 0x3F/* ? */) { + if (atExplicitKey) { + storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, null, _keyLine, _keyLineStart, _keyPos); + keyTag = keyNode = valueNode = null; + } + + detected = true; + atExplicitKey = true; + allowCompact = true; + + } else if (atExplicitKey) { + // i.e. 0x3A/* : */ === character after the explicit key. + atExplicitKey = false; + allowCompact = true; + + } else { + throwError(state, 'incomplete explicit mapping pair; a key node is missed; or followed by a non-tabulated empty line'); + } + + state.position += 1; + ch = following; + + // + // Implicit notation case. Flow-style node as the key first, then ":", and the value. + // + } else { + _keyLine = state.line; + _keyLineStart = state.lineStart; + _keyPos = state.position; + + if (!composeNode(state, flowIndent, CONTEXT_FLOW_OUT, false, true)) { + // Neither implicit nor explicit notation. + // Reading is done. Go to the epilogue. + break; + } + + if (state.line === _line) { + ch = state.input.charCodeAt(state.position); + + while (is_WHITE_SPACE(ch)) { + ch = state.input.charCodeAt(++state.position); + } + + if (ch === 0x3A/* : */) { + ch = state.input.charCodeAt(++state.position); + + if (!is_WS_OR_EOL(ch)) { + throwError(state, 'a whitespace character is expected after the key-value separator within a block mapping'); + } + + if (atExplicitKey) { + storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, null, _keyLine, _keyLineStart, _keyPos); + keyTag = keyNode = valueNode = null; + } + + detected = true; + atExplicitKey = false; + allowCompact = false; + keyTag = state.tag; + keyNode = state.result; + + } else if (detected) { + throwError(state, 'can not read an implicit mapping pair; a colon is missed'); + + } else { + state.tag = _tag; + state.anchor = _anchor; + return true; // Keep the result of `composeNode`. + } + + } else if (detected) { + throwError(state, 'can not read a block mapping entry; a multiline key may not be an implicit key'); + + } else { + state.tag = _tag; + state.anchor = _anchor; + return true; // Keep the result of `composeNode`. + } + } + + // + // Common reading code for both explicit and implicit notations. + // + if (state.line === _line || state.lineIndent > nodeIndent) { + if (atExplicitKey) { + _keyLine = state.line; + _keyLineStart = state.lineStart; + _keyPos = state.position; + } + + if (composeNode(state, nodeIndent, CONTEXT_BLOCK_OUT, true, allowCompact)) { + if (atExplicitKey) { + keyNode = state.result; + } else { + valueNode = state.result; + } + } + + if (!atExplicitKey) { + storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, valueNode, _keyLine, _keyLineStart, _keyPos); + keyTag = keyNode = valueNode = null; + } + + skipSeparationSpace(state, true, -1); + ch = state.input.charCodeAt(state.position); + } + + if ((state.line === _line || state.lineIndent > nodeIndent) && (ch !== 0)) { + throwError(state, 'bad indentation of a mapping entry'); + } else if (state.lineIndent < nodeIndent) { + break; + } + } + + // + // Epilogue. + // + + // Special case: last mapping's node contains only the key in explicit notation. + if (atExplicitKey) { + storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, null, _keyLine, _keyLineStart, _keyPos); + } + + // Expose the resulting mapping. + if (detected) { + state.tag = _tag; + state.anchor = _anchor; + state.kind = 'mapping'; + state.result = _result; + } + + return detected; + } + + function readTagProperty(state) { + var _position, + isVerbatim = false, + isNamed = false, + tagHandle, + tagName, + ch; + + ch = state.input.charCodeAt(state.position); + + if (ch !== 0x21/* ! */) return false; + + if (state.tag !== null) { + throwError(state, 'duplication of a tag property'); + } + + ch = state.input.charCodeAt(++state.position); + + if (ch === 0x3C/* < */) { + isVerbatim = true; + ch = state.input.charCodeAt(++state.position); + + } else if (ch === 0x21/* ! */) { + isNamed = true; + tagHandle = '!!'; + ch = state.input.charCodeAt(++state.position); + + } else { + tagHandle = '!'; + } + + _position = state.position; + + if (isVerbatim) { + do { ch = state.input.charCodeAt(++state.position); } + while (ch !== 0 && ch !== 0x3E/* > */); + + if (state.position < state.length) { + tagName = state.input.slice(_position, state.position); + ch = state.input.charCodeAt(++state.position); + } else { + throwError(state, 'unexpected end of the stream within a verbatim tag'); + } + } else { + while (ch !== 0 && !is_WS_OR_EOL(ch)) { + + if (ch === 0x21/* ! */) { + if (!isNamed) { + tagHandle = state.input.slice(_position - 1, state.position + 1); + + if (!PATTERN_TAG_HANDLE.test(tagHandle)) { + throwError(state, 'named tag handle cannot contain such characters'); + } + + isNamed = true; + _position = state.position + 1; + } else { + throwError(state, 'tag suffix cannot contain exclamation marks'); + } + } + + ch = state.input.charCodeAt(++state.position); + } + + tagName = state.input.slice(_position, state.position); + + if (PATTERN_FLOW_INDICATORS.test(tagName)) { + throwError(state, 'tag suffix cannot contain flow indicator characters'); + } + } + + if (tagName && !PATTERN_TAG_URI.test(tagName)) { + throwError(state, 'tag name cannot contain such characters: ' + tagName); + } + + try { + tagName = decodeURIComponent(tagName); + } catch (err) { + throwError(state, 'tag name is malformed: ' + tagName); + } + + if (isVerbatim) { + state.tag = tagName; + + } else if (_hasOwnProperty$1.call(state.tagMap, tagHandle)) { + state.tag = state.tagMap[tagHandle] + tagName; + + } else if (tagHandle === '!') { + state.tag = '!' + tagName; + + } else if (tagHandle === '!!') { + state.tag = 'tag:yaml.org,2002:' + tagName; + + } else { + throwError(state, 'undeclared tag handle "' + tagHandle + '"'); + } + + return true; + } + + function readAnchorProperty(state) { + var _position, + ch; + + ch = state.input.charCodeAt(state.position); + + if (ch !== 0x26/* & */) return false; + + if (state.anchor !== null) { + throwError(state, 'duplication of an anchor property'); + } + + ch = state.input.charCodeAt(++state.position); + _position = state.position; + + while (ch !== 0 && !is_WS_OR_EOL(ch) && !is_FLOW_INDICATOR(ch)) { + ch = state.input.charCodeAt(++state.position); + } + + if (state.position === _position) { + throwError(state, 'name of an anchor node must contain at least one character'); + } + + state.anchor = state.input.slice(_position, state.position); + return true; + } + + function readAlias(state) { + var _position, alias, + ch; + + ch = state.input.charCodeAt(state.position); + + if (ch !== 0x2A/* * */) return false; + + ch = state.input.charCodeAt(++state.position); + _position = state.position; + + while (ch !== 0 && !is_WS_OR_EOL(ch) && !is_FLOW_INDICATOR(ch)) { + ch = state.input.charCodeAt(++state.position); + } + + if (state.position === _position) { + throwError(state, 'name of an alias node must contain at least one character'); + } + + alias = state.input.slice(_position, state.position); + + if (!_hasOwnProperty$1.call(state.anchorMap, alias)) { + throwError(state, 'unidentified alias "' + alias + '"'); + } + + state.result = state.anchorMap[alias]; + skipSeparationSpace(state, true, -1); + return true; + } + + function composeNode(state, parentIndent, nodeContext, allowToSeek, allowCompact) { + var allowBlockStyles, + allowBlockScalars, + allowBlockCollections, + indentStatus = 1, // 1: this>parent, 0: this=parent, -1: this parentIndent) { + indentStatus = 1; + } else if (state.lineIndent === parentIndent) { + indentStatus = 0; + } else if (state.lineIndent < parentIndent) { + indentStatus = -1; + } + } + } + + if (indentStatus === 1) { + while (readTagProperty(state) || readAnchorProperty(state)) { + if (skipSeparationSpace(state, true, -1)) { + atNewLine = true; + allowBlockCollections = allowBlockStyles; + + if (state.lineIndent > parentIndent) { + indentStatus = 1; + } else if (state.lineIndent === parentIndent) { + indentStatus = 0; + } else if (state.lineIndent < parentIndent) { + indentStatus = -1; + } + } else { + allowBlockCollections = false; + } + } + } + + if (allowBlockCollections) { + allowBlockCollections = atNewLine || allowCompact; + } + + if (indentStatus === 1 || CONTEXT_BLOCK_OUT === nodeContext) { + if (CONTEXT_FLOW_IN === nodeContext || CONTEXT_FLOW_OUT === nodeContext) { + flowIndent = parentIndent; + } else { + flowIndent = parentIndent + 1; + } + + blockIndent = state.position - state.lineStart; + + if (indentStatus === 1) { + if (allowBlockCollections && + (readBlockSequence(state, blockIndent) || + readBlockMapping(state, blockIndent, flowIndent)) || + readFlowCollection(state, flowIndent)) { + hasContent = true; + } else { + if ((allowBlockScalars && readBlockScalar(state, flowIndent)) || + readSingleQuotedScalar(state, flowIndent) || + readDoubleQuotedScalar(state, flowIndent)) { + hasContent = true; + + } else if (readAlias(state)) { + hasContent = true; + + if (state.tag !== null || state.anchor !== null) { + throwError(state, 'alias node should not have any properties'); + } + + } else if (readPlainScalar(state, flowIndent, CONTEXT_FLOW_IN === nodeContext)) { + hasContent = true; + + if (state.tag === null) { + state.tag = '?'; + } + } + + if (state.anchor !== null) { + state.anchorMap[state.anchor] = state.result; + } + } + } else if (indentStatus === 0) { + // Special case: block sequences are allowed to have same indentation level as the parent. + // http://www.yaml.org/spec/1.2/spec.html#id2799784 + hasContent = allowBlockCollections && readBlockSequence(state, blockIndent); + } + } + + if (state.tag === null) { + if (state.anchor !== null) { + state.anchorMap[state.anchor] = state.result; + } + + } else if (state.tag === '?') { + // Implicit resolving is not allowed for non-scalar types, and '?' + // non-specific tag is only automatically assigned to plain scalars. + // + // We only need to check kind conformity in case user explicitly assigns '?' + // tag, for example like this: "! [0]" + // + if (state.result !== null && state.kind !== 'scalar') { + throwError(state, 'unacceptable node kind for ! tag; it should be "scalar", not "' + state.kind + '"'); + } + + for (typeIndex = 0, typeQuantity = state.implicitTypes.length; typeIndex < typeQuantity; typeIndex += 1) { + type = state.implicitTypes[typeIndex]; + + if (type.resolve(state.result)) { // `state.result` updated in resolver if matched + state.result = type.construct(state.result); + state.tag = type.tag; + if (state.anchor !== null) { + state.anchorMap[state.anchor] = state.result; + } + break; + } + } + } else if (state.tag !== '!') { + if (_hasOwnProperty$1.call(state.typeMap[state.kind || 'fallback'], state.tag)) { + type = state.typeMap[state.kind || 'fallback'][state.tag]; + } else { + // looking for multi type + type = null; + typeList = state.typeMap.multi[state.kind || 'fallback']; + + for (typeIndex = 0, typeQuantity = typeList.length; typeIndex < typeQuantity; typeIndex += 1) { + if (state.tag.slice(0, typeList[typeIndex].tag.length) === typeList[typeIndex].tag) { + type = typeList[typeIndex]; + break; + } + } + } + + if (!type) { + throwError(state, 'unknown tag !<' + state.tag + '>'); + } + + if (state.result !== null && type.kind !== state.kind) { + throwError(state, 'unacceptable node kind for !<' + state.tag + '> tag; it should be "' + type.kind + '", not "' + state.kind + '"'); + } + + if (!type.resolve(state.result, state.tag)) { // `state.result` updated in resolver if matched + throwError(state, 'cannot resolve a node with !<' + state.tag + '> explicit tag'); + } else { + state.result = type.construct(state.result, state.tag); + if (state.anchor !== null) { + state.anchorMap[state.anchor] = state.result; + } + } + } + + if (state.listener !== null) { + state.listener('close', state); + } + return state.tag !== null || state.anchor !== null || hasContent; + } + + function readDocument(state) { + var documentStart = state.position, + _position, + directiveName, + directiveArgs, + hasDirectives = false, + ch; + + state.version = null; + state.checkLineBreaks = state.legacy; + state.tagMap = Object.create(null); + state.anchorMap = Object.create(null); + + while ((ch = state.input.charCodeAt(state.position)) !== 0) { + skipSeparationSpace(state, true, -1); + + ch = state.input.charCodeAt(state.position); + + if (state.lineIndent > 0 || ch !== 0x25/* % */) { + break; + } + + hasDirectives = true; + ch = state.input.charCodeAt(++state.position); + _position = state.position; + + while (ch !== 0 && !is_WS_OR_EOL(ch)) { + ch = state.input.charCodeAt(++state.position); + } + + directiveName = state.input.slice(_position, state.position); + directiveArgs = []; + + if (directiveName.length < 1) { + throwError(state, 'directive name must not be less than one character in length'); + } + + while (ch !== 0) { + while (is_WHITE_SPACE(ch)) { + ch = state.input.charCodeAt(++state.position); + } + + if (ch === 0x23/* # */) { + do { ch = state.input.charCodeAt(++state.position); } + while (ch !== 0 && !is_EOL(ch)); + break; + } + + if (is_EOL(ch)) break; + + _position = state.position; + + while (ch !== 0 && !is_WS_OR_EOL(ch)) { + ch = state.input.charCodeAt(++state.position); + } + + directiveArgs.push(state.input.slice(_position, state.position)); + } + + if (ch !== 0) readLineBreak(state); + + if (_hasOwnProperty$1.call(directiveHandlers, directiveName)) { + directiveHandlers[directiveName](state, directiveName, directiveArgs); + } else { + throwWarning(state, 'unknown document directive "' + directiveName + '"'); + } + } + + skipSeparationSpace(state, true, -1); + + if (state.lineIndent === 0 && + state.input.charCodeAt(state.position) === 0x2D/* - */ && + state.input.charCodeAt(state.position + 1) === 0x2D/* - */ && + state.input.charCodeAt(state.position + 2) === 0x2D/* - */) { + state.position += 3; + skipSeparationSpace(state, true, -1); + + } else if (hasDirectives) { + throwError(state, 'directives end mark is expected'); + } + + composeNode(state, state.lineIndent - 1, CONTEXT_BLOCK_OUT, false, true); + skipSeparationSpace(state, true, -1); + + if (state.checkLineBreaks && + PATTERN_NON_ASCII_LINE_BREAKS.test(state.input.slice(documentStart, state.position))) { + throwWarning(state, 'non-ASCII line breaks are interpreted as content'); + } + + state.documents.push(state.result); + + if (state.position === state.lineStart && testDocumentSeparator(state)) { + + if (state.input.charCodeAt(state.position) === 0x2E/* . */) { + state.position += 3; + skipSeparationSpace(state, true, -1); + } + return; + } + + if (state.position < (state.length - 1)) { + throwError(state, 'end of the stream or a document separator is expected'); + } else { + return; + } + } + + + function loadDocuments(input, options) { + input = String(input); + options = options || {}; + + if (input.length !== 0) { + + // Add tailing `\n` if not exists + if (input.charCodeAt(input.length - 1) !== 0x0A/* LF */ && + input.charCodeAt(input.length - 1) !== 0x0D/* CR */) { + input += '\n'; + } + + // Strip BOM + if (input.charCodeAt(0) === 0xFEFF) { + input = input.slice(1); + } + } + + var state = new State$1(input, options); + + var nullpos = input.indexOf('\0'); + + if (nullpos !== -1) { + state.position = nullpos; + throwError(state, 'null byte is not allowed in input'); + } + + // Use 0 as string terminator. That significantly simplifies bounds check. + state.input += '\0'; + + while (state.input.charCodeAt(state.position) === 0x20/* Space */) { + state.lineIndent += 1; + state.position += 1; + } + + while (state.position < (state.length - 1)) { + readDocument(state); + } + + return state.documents; + } + + + function loadAll$1(input, iterator, options) { + if (iterator !== null && typeof iterator === 'object' && typeof options === 'undefined') { + options = iterator; + iterator = null; + } + + var documents = loadDocuments(input, options); + + if (typeof iterator !== 'function') { + return documents; + } + + for (var index = 0, length = documents.length; index < length; index += 1) { + iterator(documents[index]); + } + } + + + function load$1(input, options) { + var documents = loadDocuments(input, options); + + if (documents.length === 0) { + /*eslint-disable no-undefined*/ + return undefined; + } else if (documents.length === 1) { + return documents[0]; + } + throw new exception('expected a single document in the stream, but found more'); + } + + + var loadAll_1 = loadAll$1; + var load_1 = load$1; + + var loader = { + loadAll: loadAll_1, + load: load_1 + }; + + /*eslint-disable no-use-before-define*/ + + + + + + var _toString = Object.prototype.toString; + var _hasOwnProperty = Object.prototype.hasOwnProperty; + + var CHAR_BOM = 0xFEFF; + var CHAR_TAB = 0x09; /* Tab */ + var CHAR_LINE_FEED = 0x0A; /* LF */ + var CHAR_CARRIAGE_RETURN = 0x0D; /* CR */ + var CHAR_SPACE = 0x20; /* Space */ + var CHAR_EXCLAMATION = 0x21; /* ! */ + var CHAR_DOUBLE_QUOTE = 0x22; /* " */ + var CHAR_SHARP = 0x23; /* # */ + var CHAR_PERCENT = 0x25; /* % */ + var CHAR_AMPERSAND = 0x26; /* & */ + var CHAR_SINGLE_QUOTE = 0x27; /* ' */ + var CHAR_ASTERISK = 0x2A; /* * */ + var CHAR_COMMA = 0x2C; /* , */ + var CHAR_MINUS = 0x2D; /* - */ + var CHAR_COLON = 0x3A; /* : */ + var CHAR_EQUALS = 0x3D; /* = */ + var CHAR_GREATER_THAN = 0x3E; /* > */ + var CHAR_QUESTION = 0x3F; /* ? */ + var CHAR_COMMERCIAL_AT = 0x40; /* @ */ + var CHAR_LEFT_SQUARE_BRACKET = 0x5B; /* [ */ + var CHAR_RIGHT_SQUARE_BRACKET = 0x5D; /* ] */ + var CHAR_GRAVE_ACCENT = 0x60; /* ` */ + var CHAR_LEFT_CURLY_BRACKET = 0x7B; /* { */ + var CHAR_VERTICAL_LINE = 0x7C; /* | */ + var CHAR_RIGHT_CURLY_BRACKET = 0x7D; /* } */ + + var ESCAPE_SEQUENCES = {}; + + ESCAPE_SEQUENCES[0x00] = '\\0'; + ESCAPE_SEQUENCES[0x07] = '\\a'; + ESCAPE_SEQUENCES[0x08] = '\\b'; + ESCAPE_SEQUENCES[0x09] = '\\t'; + ESCAPE_SEQUENCES[0x0A] = '\\n'; + ESCAPE_SEQUENCES[0x0B] = '\\v'; + ESCAPE_SEQUENCES[0x0C] = '\\f'; + ESCAPE_SEQUENCES[0x0D] = '\\r'; + ESCAPE_SEQUENCES[0x1B] = '\\e'; + ESCAPE_SEQUENCES[0x22] = '\\"'; + ESCAPE_SEQUENCES[0x5C] = '\\\\'; + ESCAPE_SEQUENCES[0x85] = '\\N'; + ESCAPE_SEQUENCES[0xA0] = '\\_'; + ESCAPE_SEQUENCES[0x2028] = '\\L'; + ESCAPE_SEQUENCES[0x2029] = '\\P'; + + var DEPRECATED_BOOLEANS_SYNTAX = [ + 'y', 'Y', 'yes', 'Yes', 'YES', 'on', 'On', 'ON', + 'n', 'N', 'no', 'No', 'NO', 'off', 'Off', 'OFF' + ]; + + var DEPRECATED_BASE60_SYNTAX = /^[-+]?[0-9_]+(?::[0-9_]+)+(?:\.[0-9_]*)?$/; + + function compileStyleMap(schema, map) { + var result, keys, index, length, tag, style, type; + + if (map === null) return {}; + + result = {}; + keys = Object.keys(map); + + for (index = 0, length = keys.length; index < length; index += 1) { + tag = keys[index]; + style = String(map[tag]); + + if (tag.slice(0, 2) === '!!') { + tag = 'tag:yaml.org,2002:' + tag.slice(2); + } + type = schema.compiledTypeMap['fallback'][tag]; + + if (type && _hasOwnProperty.call(type.styleAliases, style)) { + style = type.styleAliases[style]; + } + + result[tag] = style; + } + + return result; + } + + function encodeHex(character) { + var string, handle, length; + + string = character.toString(16).toUpperCase(); + + if (character <= 0xFF) { + handle = 'x'; + length = 2; + } else if (character <= 0xFFFF) { + handle = 'u'; + length = 4; + } else if (character <= 0xFFFFFFFF) { + handle = 'U'; + length = 8; + } else { + throw new exception('code point within a string may not be greater than 0xFFFFFFFF'); + } + + return '\\' + handle + common.repeat('0', length - string.length) + string; + } + + + var QUOTING_TYPE_SINGLE = 1, + QUOTING_TYPE_DOUBLE = 2; + + function State(options) { + this.schema = options['schema'] || _default; + this.indent = Math.max(1, (options['indent'] || 2)); + this.noArrayIndent = options['noArrayIndent'] || false; + this.skipInvalid = options['skipInvalid'] || false; + this.flowLevel = (common.isNothing(options['flowLevel']) ? -1 : options['flowLevel']); + this.styleMap = compileStyleMap(this.schema, options['styles'] || null); + this.sortKeys = options['sortKeys'] || false; + this.lineWidth = options['lineWidth'] || 80; + this.noRefs = options['noRefs'] || false; + this.noCompatMode = options['noCompatMode'] || false; + this.condenseFlow = options['condenseFlow'] || false; + this.quotingType = options['quotingType'] === '"' ? QUOTING_TYPE_DOUBLE : QUOTING_TYPE_SINGLE; + this.forceQuotes = options['forceQuotes'] || false; + this.replacer = typeof options['replacer'] === 'function' ? options['replacer'] : null; + + this.implicitTypes = this.schema.compiledImplicit; + this.explicitTypes = this.schema.compiledExplicit; + + this.tag = null; + this.result = ''; + + this.duplicates = []; + this.usedDuplicates = null; + } + + // Indents every line in a string. Empty lines (\n only) are not indented. + function indentString(string, spaces) { + var ind = common.repeat(' ', spaces), + position = 0, + next = -1, + result = '', + line, + length = string.length; + + while (position < length) { + next = string.indexOf('\n', position); + if (next === -1) { + line = string.slice(position); + position = length; + } else { + line = string.slice(position, next + 1); + position = next + 1; + } + + if (line.length && line !== '\n') result += ind; + + result += line; + } + + return result; + } + + function generateNextLine(state, level) { + return '\n' + common.repeat(' ', state.indent * level); + } + + function testImplicitResolving(state, str) { + var index, length, type; + + for (index = 0, length = state.implicitTypes.length; index < length; index += 1) { + type = state.implicitTypes[index]; + + if (type.resolve(str)) { + return true; + } + } + + return false; + } + + // [33] s-white ::= s-space | s-tab + function isWhitespace(c) { + return c === CHAR_SPACE || c === CHAR_TAB; + } + + // Returns true if the character can be printed without escaping. + // From YAML 1.2: "any allowed characters known to be non-printable + // should also be escaped. [However,] This isn’t mandatory" + // Derived from nb-char - \t - #x85 - #xA0 - #x2028 - #x2029. + function isPrintable(c) { + return (0x00020 <= c && c <= 0x00007E) + || ((0x000A1 <= c && c <= 0x00D7FF) && c !== 0x2028 && c !== 0x2029) + || ((0x0E000 <= c && c <= 0x00FFFD) && c !== CHAR_BOM) + || (0x10000 <= c && c <= 0x10FFFF); + } + + // [34] ns-char ::= nb-char - s-white + // [27] nb-char ::= c-printable - b-char - c-byte-order-mark + // [26] b-char ::= b-line-feed | b-carriage-return + // Including s-white (for some reason, examples doesn't match specs in this aspect) + // ns-char ::= c-printable - b-line-feed - b-carriage-return - c-byte-order-mark + function isNsCharOrWhitespace(c) { + return isPrintable(c) + && c !== CHAR_BOM + // - b-char + && c !== CHAR_CARRIAGE_RETURN + && c !== CHAR_LINE_FEED; + } + + // [127] ns-plain-safe(c) ::= c = flow-out ⇒ ns-plain-safe-out + // c = flow-in ⇒ ns-plain-safe-in + // c = block-key ⇒ ns-plain-safe-out + // c = flow-key ⇒ ns-plain-safe-in + // [128] ns-plain-safe-out ::= ns-char + // [129] ns-plain-safe-in ::= ns-char - c-flow-indicator + // [130] ns-plain-char(c) ::= ( ns-plain-safe(c) - “:” - “#” ) + // | ( /* An ns-char preceding */ “#” ) + // | ( “:” /* Followed by an ns-plain-safe(c) */ ) + function isPlainSafe(c, prev, inblock) { + var cIsNsCharOrWhitespace = isNsCharOrWhitespace(c); + var cIsNsChar = cIsNsCharOrWhitespace && !isWhitespace(c); + return ( + // ns-plain-safe + inblock ? // c = flow-in + cIsNsCharOrWhitespace + : cIsNsCharOrWhitespace + // - c-flow-indicator + && c !== CHAR_COMMA + && c !== CHAR_LEFT_SQUARE_BRACKET + && c !== CHAR_RIGHT_SQUARE_BRACKET + && c !== CHAR_LEFT_CURLY_BRACKET + && c !== CHAR_RIGHT_CURLY_BRACKET + ) + // ns-plain-char + && c !== CHAR_SHARP // false on '#' + && !(prev === CHAR_COLON && !cIsNsChar) // false on ': ' + || (isNsCharOrWhitespace(prev) && !isWhitespace(prev) && c === CHAR_SHARP) // change to true on '[^ ]#' + || (prev === CHAR_COLON && cIsNsChar); // change to true on ':[^ ]' + } + + // Simplified test for values allowed as the first character in plain style. + function isPlainSafeFirst(c) { + // Uses a subset of ns-char - c-indicator + // where ns-char = nb-char - s-white. + // No support of ( ( “?” | “:” | “-” ) /* Followed by an ns-plain-safe(c)) */ ) part + return isPrintable(c) && c !== CHAR_BOM + && !isWhitespace(c) // - s-white + // - (c-indicator ::= + // “-” | “?” | “:” | “,” | “[” | “]” | “{” | “}” + && c !== CHAR_MINUS + && c !== CHAR_QUESTION + && c !== CHAR_COLON + && c !== CHAR_COMMA + && c !== CHAR_LEFT_SQUARE_BRACKET + && c !== CHAR_RIGHT_SQUARE_BRACKET + && c !== CHAR_LEFT_CURLY_BRACKET + && c !== CHAR_RIGHT_CURLY_BRACKET + // | “#” | “&” | “*” | “!” | “|” | “=” | “>” | “'” | “"” + && c !== CHAR_SHARP + && c !== CHAR_AMPERSAND + && c !== CHAR_ASTERISK + && c !== CHAR_EXCLAMATION + && c !== CHAR_VERTICAL_LINE + && c !== CHAR_EQUALS + && c !== CHAR_GREATER_THAN + && c !== CHAR_SINGLE_QUOTE + && c !== CHAR_DOUBLE_QUOTE + // | “%” | “@” | “`”) + && c !== CHAR_PERCENT + && c !== CHAR_COMMERCIAL_AT + && c !== CHAR_GRAVE_ACCENT; + } + + // Simplified test for values allowed as the last character in plain style. + function isPlainSafeLast(c) { + // just not whitespace or colon, it will be checked to be plain character later + return !isWhitespace(c) && c !== CHAR_COLON; + } + + // Same as 'string'.codePointAt(pos), but works in older browsers. + function codePointAt(string, pos) { + var first = string.charCodeAt(pos), second; + if (first >= 0xD800 && first <= 0xDBFF && pos + 1 < string.length) { + second = string.charCodeAt(pos + 1); + if (second >= 0xDC00 && second <= 0xDFFF) { + // https://mathiasbynens.be/notes/javascript-encoding#surrogate-formulae + return (first - 0xD800) * 0x400 + second - 0xDC00 + 0x10000; + } + } + return first; + } + + // Determines whether block indentation indicator is required. + function needIndentIndicator(string) { + var leadingSpaceRe = /^\n* /; + return leadingSpaceRe.test(string); + } + + var STYLE_PLAIN = 1, + STYLE_SINGLE = 2, + STYLE_LITERAL = 3, + STYLE_FOLDED = 4, + STYLE_DOUBLE = 5; + + // Determines which scalar styles are possible and returns the preferred style. + // lineWidth = -1 => no limit. + // Pre-conditions: str.length > 0. + // Post-conditions: + // STYLE_PLAIN or STYLE_SINGLE => no \n are in the string. + // STYLE_LITERAL => no lines are suitable for folding (or lineWidth is -1). + // STYLE_FOLDED => a line > lineWidth and can be folded (and lineWidth != -1). + function chooseScalarStyle(string, singleLineOnly, indentPerLevel, lineWidth, + testAmbiguousType, quotingType, forceQuotes, inblock) { + + var i; + var char = 0; + var prevChar = null; + var hasLineBreak = false; + var hasFoldableLine = false; // only checked if shouldTrackWidth + var shouldTrackWidth = lineWidth !== -1; + var previousLineBreak = -1; // count the first line correctly + var plain = isPlainSafeFirst(codePointAt(string, 0)) + && isPlainSafeLast(codePointAt(string, string.length - 1)); + + if (singleLineOnly || forceQuotes) { + // Case: no block styles. + // Check for disallowed characters to rule out plain and single. + for (i = 0; i < string.length; char >= 0x10000 ? i += 2 : i++) { + char = codePointAt(string, i); + if (!isPrintable(char)) { + return STYLE_DOUBLE; + } + plain = plain && isPlainSafe(char, prevChar, inblock); + prevChar = char; + } + } else { + // Case: block styles permitted. + for (i = 0; i < string.length; char >= 0x10000 ? i += 2 : i++) { + char = codePointAt(string, i); + if (char === CHAR_LINE_FEED) { + hasLineBreak = true; + // Check if any line can be folded. + if (shouldTrackWidth) { + hasFoldableLine = hasFoldableLine || + // Foldable line = too long, and not more-indented. + (i - previousLineBreak - 1 > lineWidth && + string[previousLineBreak + 1] !== ' '); + previousLineBreak = i; + } + } else if (!isPrintable(char)) { + return STYLE_DOUBLE; + } + plain = plain && isPlainSafe(char, prevChar, inblock); + prevChar = char; + } + // in case the end is missing a \n + hasFoldableLine = hasFoldableLine || (shouldTrackWidth && + (i - previousLineBreak - 1 > lineWidth && + string[previousLineBreak + 1] !== ' ')); + } + // Although every style can represent \n without escaping, prefer block styles + // for multiline, since they're more readable and they don't add empty lines. + // Also prefer folding a super-long line. + if (!hasLineBreak && !hasFoldableLine) { + // Strings interpretable as another type have to be quoted; + // e.g. the string 'true' vs. the boolean true. + if (plain && !forceQuotes && !testAmbiguousType(string)) { + return STYLE_PLAIN; + } + return quotingType === QUOTING_TYPE_DOUBLE ? STYLE_DOUBLE : STYLE_SINGLE; + } + // Edge case: block indentation indicator can only have one digit. + if (indentPerLevel > 9 && needIndentIndicator(string)) { + return STYLE_DOUBLE; + } + // At this point we know block styles are valid. + // Prefer literal style unless we want to fold. + if (!forceQuotes) { + return hasFoldableLine ? STYLE_FOLDED : STYLE_LITERAL; + } + return quotingType === QUOTING_TYPE_DOUBLE ? STYLE_DOUBLE : STYLE_SINGLE; + } + + // Note: line breaking/folding is implemented for only the folded style. + // NB. We drop the last trailing newline (if any) of a returned block scalar + // since the dumper adds its own newline. This always works: + // • No ending newline => unaffected; already using strip "-" chomping. + // • Ending newline => removed then restored. + // Importantly, this keeps the "+" chomp indicator from gaining an extra line. + function writeScalar(state, string, level, iskey, inblock) { + state.dump = (function () { + if (string.length === 0) { + return state.quotingType === QUOTING_TYPE_DOUBLE ? '""' : "''"; + } + if (!state.noCompatMode) { + if (DEPRECATED_BOOLEANS_SYNTAX.indexOf(string) !== -1 || DEPRECATED_BASE60_SYNTAX.test(string)) { + return state.quotingType === QUOTING_TYPE_DOUBLE ? ('"' + string + '"') : ("'" + string + "'"); + } + } + + var indent = state.indent * Math.max(1, level); // no 0-indent scalars + // As indentation gets deeper, let the width decrease monotonically + // to the lower bound min(state.lineWidth, 40). + // Note that this implies + // state.lineWidth ≤ 40 + state.indent: width is fixed at the lower bound. + // state.lineWidth > 40 + state.indent: width decreases until the lower bound. + // This behaves better than a constant minimum width which disallows narrower options, + // or an indent threshold which causes the width to suddenly increase. + var lineWidth = state.lineWidth === -1 + ? -1 : Math.max(Math.min(state.lineWidth, 40), state.lineWidth - indent); + + // Without knowing if keys are implicit/explicit, assume implicit for safety. + var singleLineOnly = iskey + // No block styles in flow mode. + || (state.flowLevel > -1 && level >= state.flowLevel); + function testAmbiguity(string) { + return testImplicitResolving(state, string); + } + + switch (chooseScalarStyle(string, singleLineOnly, state.indent, lineWidth, + testAmbiguity, state.quotingType, state.forceQuotes && !iskey, inblock)) { + + case STYLE_PLAIN: + return string; + case STYLE_SINGLE: + return "'" + string.replace(/'/g, "''") + "'"; + case STYLE_LITERAL: + return '|' + blockHeader(string, state.indent) + + dropEndingNewline(indentString(string, indent)); + case STYLE_FOLDED: + return '>' + blockHeader(string, state.indent) + + dropEndingNewline(indentString(foldString(string, lineWidth), indent)); + case STYLE_DOUBLE: + return '"' + escapeString(string) + '"'; + default: + throw new exception('impossible error: invalid scalar style'); + } + }()); + } + + // Pre-conditions: string is valid for a block scalar, 1 <= indentPerLevel <= 9. + function blockHeader(string, indentPerLevel) { + var indentIndicator = needIndentIndicator(string) ? String(indentPerLevel) : ''; + + // note the special case: the string '\n' counts as a "trailing" empty line. + var clip = string[string.length - 1] === '\n'; + var keep = clip && (string[string.length - 2] === '\n' || string === '\n'); + var chomp = keep ? '+' : (clip ? '' : '-'); + + return indentIndicator + chomp + '\n'; + } + + // (See the note for writeScalar.) + function dropEndingNewline(string) { + return string[string.length - 1] === '\n' ? string.slice(0, -1) : string; + } + + // Note: a long line without a suitable break point will exceed the width limit. + // Pre-conditions: every char in str isPrintable, str.length > 0, width > 0. + function foldString(string, width) { + // In folded style, $k$ consecutive newlines output as $k+1$ newlines— + // unless they're before or after a more-indented line, or at the very + // beginning or end, in which case $k$ maps to $k$. + // Therefore, parse each chunk as newline(s) followed by a content line. + var lineRe = /(\n+)([^\n]*)/g; + + // first line (possibly an empty line) + var result = (function () { + var nextLF = string.indexOf('\n'); + nextLF = nextLF !== -1 ? nextLF : string.length; + lineRe.lastIndex = nextLF; + return foldLine(string.slice(0, nextLF), width); + }()); + // If we haven't reached the first content line yet, don't add an extra \n. + var prevMoreIndented = string[0] === '\n' || string[0] === ' '; + var moreIndented; + + // rest of the lines + var match; + while ((match = lineRe.exec(string))) { + var prefix = match[1], line = match[2]; + moreIndented = (line[0] === ' '); + result += prefix + + (!prevMoreIndented && !moreIndented && line !== '' + ? '\n' : '') + + foldLine(line, width); + prevMoreIndented = moreIndented; + } + + return result; + } + + // Greedy line breaking. + // Picks the longest line under the limit each time, + // otherwise settles for the shortest line over the limit. + // NB. More-indented lines *cannot* be folded, as that would add an extra \n. + function foldLine(line, width) { + if (line === '' || line[0] === ' ') return line; + + // Since a more-indented line adds a \n, breaks can't be followed by a space. + var breakRe = / [^ ]/g; // note: the match index will always be <= length-2. + var match; + // start is an inclusive index. end, curr, and next are exclusive. + var start = 0, end, curr = 0, next = 0; + var result = ''; + + // Invariants: 0 <= start <= length-1. + // 0 <= curr <= next <= max(0, length-2). curr - start <= width. + // Inside the loop: + // A match implies length >= 2, so curr and next are <= length-2. + while ((match = breakRe.exec(line))) { + next = match.index; + // maintain invariant: curr - start <= width + if (next - start > width) { + end = (curr > start) ? curr : next; // derive end <= length-2 + result += '\n' + line.slice(start, end); + // skip the space that was output as \n + start = end + 1; // derive start <= length-1 + } + curr = next; + } + + // By the invariants, start <= length-1, so there is something left over. + // It is either the whole string or a part starting from non-whitespace. + result += '\n'; + // Insert a break if the remainder is too long and there is a break available. + if (line.length - start > width && curr > start) { + result += line.slice(start, curr) + '\n' + line.slice(curr + 1); + } else { + result += line.slice(start); + } + + return result.slice(1); // drop extra \n joiner + } + + // Escapes a double-quoted string. + function escapeString(string) { + var result = ''; + var char = 0; + var escapeSeq; + + for (var i = 0; i < string.length; char >= 0x10000 ? i += 2 : i++) { + char = codePointAt(string, i); + escapeSeq = ESCAPE_SEQUENCES[char]; + + if (!escapeSeq && isPrintable(char)) { + result += string[i]; + if (char >= 0x10000) result += string[i + 1]; + } else { + result += escapeSeq || encodeHex(char); + } + } + + return result; + } + + function writeFlowSequence(state, level, object) { + var _result = '', + _tag = state.tag, + index, + length, + value; + + for (index = 0, length = object.length; index < length; index += 1) { + value = object[index]; + + if (state.replacer) { + value = state.replacer.call(object, String(index), value); + } + + // Write only valid elements, put null instead of invalid elements. + if (writeNode(state, level, value, false, false) || + (typeof value === 'undefined' && + writeNode(state, level, null, false, false))) { + + if (_result !== '') _result += ',' + (!state.condenseFlow ? ' ' : ''); + _result += state.dump; + } + } + + state.tag = _tag; + state.dump = '[' + _result + ']'; + } + + function writeBlockSequence(state, level, object, compact) { + var _result = '', + _tag = state.tag, + index, + length, + value; + + for (index = 0, length = object.length; index < length; index += 1) { + value = object[index]; + + if (state.replacer) { + value = state.replacer.call(object, String(index), value); + } + + // Write only valid elements, put null instead of invalid elements. + if (writeNode(state, level + 1, value, true, true, false, true) || + (typeof value === 'undefined' && + writeNode(state, level + 1, null, true, true, false, true))) { + + if (!compact || _result !== '') { + _result += generateNextLine(state, level); + } + + if (state.dump && CHAR_LINE_FEED === state.dump.charCodeAt(0)) { + _result += '-'; + } else { + _result += '- '; + } + + _result += state.dump; + } + } + + state.tag = _tag; + state.dump = _result || '[]'; // Empty sequence if no valid values. + } + + function writeFlowMapping(state, level, object) { + var _result = '', + _tag = state.tag, + objectKeyList = Object.keys(object), + index, + length, + objectKey, + objectValue, + pairBuffer; + + for (index = 0, length = objectKeyList.length; index < length; index += 1) { + + pairBuffer = ''; + if (_result !== '') pairBuffer += ', '; + + if (state.condenseFlow) pairBuffer += '"'; + + objectKey = objectKeyList[index]; + objectValue = object[objectKey]; + + if (state.replacer) { + objectValue = state.replacer.call(object, objectKey, objectValue); + } + + if (!writeNode(state, level, objectKey, false, false)) { + continue; // Skip this pair because of invalid key; + } + + if (state.dump.length > 1024) pairBuffer += '? '; + + pairBuffer += state.dump + (state.condenseFlow ? '"' : '') + ':' + (state.condenseFlow ? '' : ' '); + + if (!writeNode(state, level, objectValue, false, false)) { + continue; // Skip this pair because of invalid value. + } + + pairBuffer += state.dump; + + // Both key and value are valid. + _result += pairBuffer; + } + + state.tag = _tag; + state.dump = '{' + _result + '}'; + } + + function writeBlockMapping(state, level, object, compact) { + var _result = '', + _tag = state.tag, + objectKeyList = Object.keys(object), + index, + length, + objectKey, + objectValue, + explicitPair, + pairBuffer; + + // Allow sorting keys so that the output file is deterministic + if (state.sortKeys === true) { + // Default sorting + objectKeyList.sort(); + } else if (typeof state.sortKeys === 'function') { + // Custom sort function + objectKeyList.sort(state.sortKeys); + } else if (state.sortKeys) { + // Something is wrong + throw new exception('sortKeys must be a boolean or a function'); + } + + for (index = 0, length = objectKeyList.length; index < length; index += 1) { + pairBuffer = ''; + + if (!compact || _result !== '') { + pairBuffer += generateNextLine(state, level); + } + + objectKey = objectKeyList[index]; + objectValue = object[objectKey]; + + if (state.replacer) { + objectValue = state.replacer.call(object, objectKey, objectValue); + } + + if (!writeNode(state, level + 1, objectKey, true, true, true)) { + continue; // Skip this pair because of invalid key. + } + + explicitPair = (state.tag !== null && state.tag !== '?') || + (state.dump && state.dump.length > 1024); + + if (explicitPair) { + if (state.dump && CHAR_LINE_FEED === state.dump.charCodeAt(0)) { + pairBuffer += '?'; + } else { + pairBuffer += '? '; + } + } + + pairBuffer += state.dump; + + if (explicitPair) { + pairBuffer += generateNextLine(state, level); + } + + if (!writeNode(state, level + 1, objectValue, true, explicitPair)) { + continue; // Skip this pair because of invalid value. + } + + if (state.dump && CHAR_LINE_FEED === state.dump.charCodeAt(0)) { + pairBuffer += ':'; + } else { + pairBuffer += ': '; + } + + pairBuffer += state.dump; + + // Both key and value are valid. + _result += pairBuffer; + } + + state.tag = _tag; + state.dump = _result || '{}'; // Empty mapping if no valid pairs. + } + + function detectType(state, object, explicit) { + var _result, typeList, index, length, type, style; + + typeList = explicit ? state.explicitTypes : state.implicitTypes; + + for (index = 0, length = typeList.length; index < length; index += 1) { + type = typeList[index]; + + if ((type.instanceOf || type.predicate) && + (!type.instanceOf || ((typeof object === 'object') && (object instanceof type.instanceOf))) && + (!type.predicate || type.predicate(object))) { + + if (explicit) { + if (type.multi && type.representName) { + state.tag = type.representName(object); + } else { + state.tag = type.tag; + } + } else { + state.tag = '?'; + } + + if (type.represent) { + style = state.styleMap[type.tag] || type.defaultStyle; + + if (_toString.call(type.represent) === '[object Function]') { + _result = type.represent(object, style); + } else if (_hasOwnProperty.call(type.represent, style)) { + _result = type.represent[style](object, style); + } else { + throw new exception('!<' + type.tag + '> tag resolver accepts not "' + style + '" style'); + } + + state.dump = _result; + } + + return true; + } + } + + return false; + } + + // Serializes `object` and writes it to global `result`. + // Returns true on success, or false on invalid object. + // + function writeNode(state, level, object, block, compact, iskey, isblockseq) { + state.tag = null; + state.dump = object; + + if (!detectType(state, object, false)) { + detectType(state, object, true); + } + + var type = _toString.call(state.dump); + var inblock = block; + var tagStr; + + if (block) { + block = (state.flowLevel < 0 || state.flowLevel > level); + } + + var objectOrArray = type === '[object Object]' || type === '[object Array]', + duplicateIndex, + duplicate; + + if (objectOrArray) { + duplicateIndex = state.duplicates.indexOf(object); + duplicate = duplicateIndex !== -1; + } + + if ((state.tag !== null && state.tag !== '?') || duplicate || (state.indent !== 2 && level > 0)) { + compact = false; + } + + if (duplicate && state.usedDuplicates[duplicateIndex]) { + state.dump = '*ref_' + duplicateIndex; + } else { + if (objectOrArray && duplicate && !state.usedDuplicates[duplicateIndex]) { + state.usedDuplicates[duplicateIndex] = true; + } + if (type === '[object Object]') { + if (block && (Object.keys(state.dump).length !== 0)) { + writeBlockMapping(state, level, state.dump, compact); + if (duplicate) { + state.dump = '&ref_' + duplicateIndex + state.dump; + } + } else { + writeFlowMapping(state, level, state.dump); + if (duplicate) { + state.dump = '&ref_' + duplicateIndex + ' ' + state.dump; + } + } + } else if (type === '[object Array]') { + if (block && (state.dump.length !== 0)) { + if (state.noArrayIndent && !isblockseq && level > 0) { + writeBlockSequence(state, level - 1, state.dump, compact); + } else { + writeBlockSequence(state, level, state.dump, compact); + } + if (duplicate) { + state.dump = '&ref_' + duplicateIndex + state.dump; + } + } else { + writeFlowSequence(state, level, state.dump); + if (duplicate) { + state.dump = '&ref_' + duplicateIndex + ' ' + state.dump; + } + } + } else if (type === '[object String]') { + if (state.tag !== '?') { + writeScalar(state, state.dump, level, iskey, inblock); + } + } else if (type === '[object Undefined]') { + return false; + } else { + if (state.skipInvalid) return false; + throw new exception('unacceptable kind of an object to dump ' + type); + } + + if (state.tag !== null && state.tag !== '?') { + // Need to encode all characters except those allowed by the spec: + // + // [35] ns-dec-digit ::= [#x30-#x39] /* 0-9 */ + // [36] ns-hex-digit ::= ns-dec-digit + // | [#x41-#x46] /* A-F */ | [#x61-#x66] /* a-f */ + // [37] ns-ascii-letter ::= [#x41-#x5A] /* A-Z */ | [#x61-#x7A] /* a-z */ + // [38] ns-word-char ::= ns-dec-digit | ns-ascii-letter | “-” + // [39] ns-uri-char ::= “%” ns-hex-digit ns-hex-digit | ns-word-char | “#” + // | “;” | “/” | “?” | “:” | “@” | “&” | “=” | “+” | “$” | “,” + // | “_” | “.” | “!” | “~” | “*” | “'” | “(” | “)” | “[” | “]” + // + // Also need to encode '!' because it has special meaning (end of tag prefix). + // + tagStr = encodeURI( + state.tag[0] === '!' ? state.tag.slice(1) : state.tag + ).replace(/!/g, '%21'); + + if (state.tag[0] === '!') { + tagStr = '!' + tagStr; + } else if (tagStr.slice(0, 18) === 'tag:yaml.org,2002:') { + tagStr = '!!' + tagStr.slice(18); + } else { + tagStr = '!<' + tagStr + '>'; + } + + state.dump = tagStr + ' ' + state.dump; + } + } + + return true; + } + + function getDuplicateReferences(object, state) { + var objects = [], + duplicatesIndexes = [], + index, + length; + + inspectNode(object, objects, duplicatesIndexes); + + for (index = 0, length = duplicatesIndexes.length; index < length; index += 1) { + state.duplicates.push(objects[duplicatesIndexes[index]]); + } + state.usedDuplicates = new Array(length); + } + + function inspectNode(object, objects, duplicatesIndexes) { + var objectKeyList, + index, + length; + + if (object !== null && typeof object === 'object') { + index = objects.indexOf(object); + if (index !== -1) { + if (duplicatesIndexes.indexOf(index) === -1) { + duplicatesIndexes.push(index); + } + } else { + objects.push(object); + + if (Array.isArray(object)) { + for (index = 0, length = object.length; index < length; index += 1) { + inspectNode(object[index], objects, duplicatesIndexes); + } + } else { + objectKeyList = Object.keys(object); + + for (index = 0, length = objectKeyList.length; index < length; index += 1) { + inspectNode(object[objectKeyList[index]], objects, duplicatesIndexes); + } + } + } + } + } + + function dump$1(input, options) { + options = options || {}; + + var state = new State(options); + + if (!state.noRefs) getDuplicateReferences(input, state); + + var value = input; + + if (state.replacer) { + value = state.replacer.call({ '': value }, '', value); + } + + if (writeNode(state, 0, value, true, true)) return state.dump + '\n'; + + return ''; + } + + var dump_1 = dump$1; + + var dumper = { + dump: dump_1 + }; + + function renamed(from, to) { + return function () { + throw new Error('Function yaml.' + from + ' is removed in js-yaml 4. ' + + 'Use yaml.' + to + ' instead, which is now safe by default.'); + }; + } + + + var Type = type; + var Schema = schema; + var FAILSAFE_SCHEMA = failsafe; + var JSON_SCHEMA = json; + var CORE_SCHEMA = core; + var DEFAULT_SCHEMA = _default; + var load = loader.load; + var loadAll = loader.loadAll; + var dump = dumper.dump; + var YAMLException = exception; + + // Re-export all types in case user wants to create custom schema + var types = { + binary: binary, + float: float, + map: map, + null: _null, + pairs: pairs, + set: set, + timestamp: timestamp, + bool: bool, + int: int, + merge: merge, + omap: omap, + seq: seq, + str: str + }; + + // Removed functions from JS-YAML 3.0.x + var safeLoad = renamed('safeLoad', 'load'); + var safeLoadAll = renamed('safeLoadAll', 'loadAll'); + var safeDump = renamed('safeDump', 'dump'); + + var jsYaml = { + Type: Type, + Schema: Schema, + FAILSAFE_SCHEMA: FAILSAFE_SCHEMA, + JSON_SCHEMA: JSON_SCHEMA, + CORE_SCHEMA: CORE_SCHEMA, + DEFAULT_SCHEMA: DEFAULT_SCHEMA, + load: load, + loadAll: loadAll, + dump: dump, + YAMLException: YAMLException, + types: types, + safeLoad: safeLoad, + safeLoadAll: safeLoadAll, + safeDump: safeDump + }; + + exports.CORE_SCHEMA = CORE_SCHEMA; + exports.DEFAULT_SCHEMA = DEFAULT_SCHEMA; + exports.FAILSAFE_SCHEMA = FAILSAFE_SCHEMA; + exports.JSON_SCHEMA = JSON_SCHEMA; + exports.Schema = Schema; + exports.Type = Type; + exports.YAMLException = YAMLException; + exports.default = jsYaml; + exports.dump = dump; + exports.load = load; + exports.loadAll = loadAll; + exports.safeDump = safeDump; + exports.safeLoad = safeLoad; + exports.safeLoadAll = safeLoadAll; + exports.types = types; + + Object.defineProperty(exports, '__esModule', { value: true }); + +}))); diff --git a/node_modules/js-yaml/dist/js-yaml.min.js b/node_modules/js-yaml/dist/js-yaml.min.js new file mode 100644 index 0000000..bdd8eef --- /dev/null +++ b/node_modules/js-yaml/dist/js-yaml.min.js @@ -0,0 +1,2 @@ +/*! js-yaml 4.1.0 https://github.com/nodeca/js-yaml @license MIT */ +!function(e,t){"object"==typeof exports&&"undefined"!=typeof module?t(exports):"function"==typeof define&&define.amd?define(["exports"],t):t((e="undefined"!=typeof globalThis?globalThis:e||self).jsyaml={})}(this,(function(e){"use strict";function t(e){return null==e}var n={isNothing:t,isObject:function(e){return"object"==typeof e&&null!==e},toArray:function(e){return Array.isArray(e)?e:t(e)?[]:[e]},repeat:function(e,t){var n,i="";for(n=0;nl&&(t=i-l+(o=" ... ").length),n-i>l&&(n=i+l-(a=" ...").length),{str:o+e.slice(t,n).replace(/\t/g,"→")+a,pos:i-t+o.length}}function l(e,t){return n.repeat(" ",t-e.length)+e}var c=function(e,t){if(t=Object.create(t||null),!e.buffer)return null;t.maxLength||(t.maxLength=79),"number"!=typeof t.indent&&(t.indent=1),"number"!=typeof t.linesBefore&&(t.linesBefore=3),"number"!=typeof t.linesAfter&&(t.linesAfter=2);for(var i,r=/\r?\n|\r|\0/g,o=[0],c=[],s=-1;i=r.exec(e.buffer);)c.push(i.index),o.push(i.index+i[0].length),e.position<=i.index&&s<0&&(s=o.length-2);s<0&&(s=o.length-1);var u,p,f="",d=Math.min(e.line+t.linesAfter,c.length).toString().length,h=t.maxLength-(t.indent+d+3);for(u=1;u<=t.linesBefore&&!(s-u<0);u++)p=a(e.buffer,o[s-u],c[s-u],e.position-(o[s]-o[s-u]),h),f=n.repeat(" ",t.indent)+l((e.line-u+1).toString(),d)+" | "+p.str+"\n"+f;for(p=a(e.buffer,o[s],c[s],e.position,h),f+=n.repeat(" ",t.indent)+l((e.line+1).toString(),d)+" | "+p.str+"\n",f+=n.repeat("-",t.indent+d+3+p.pos)+"^\n",u=1;u<=t.linesAfter&&!(s+u>=c.length);u++)p=a(e.buffer,o[s+u],c[s+u],e.position-(o[s]-o[s+u]),h),f+=n.repeat(" ",t.indent)+l((e.line+u+1).toString(),d)+" | "+p.str+"\n";return f.replace(/\n$/,"")},s=["kind","multi","resolve","construct","instanceOf","predicate","represent","representName","defaultStyle","styleAliases"],u=["scalar","sequence","mapping"];var p=function(e,t){if(t=t||{},Object.keys(t).forEach((function(t){if(-1===s.indexOf(t))throw new o('Unknown option "'+t+'" is met in definition of "'+e+'" YAML type.')})),this.options=t,this.tag=e,this.kind=t.kind||null,this.resolve=t.resolve||function(){return!0},this.construct=t.construct||function(e){return e},this.instanceOf=t.instanceOf||null,this.predicate=t.predicate||null,this.represent=t.represent||null,this.representName=t.representName||null,this.defaultStyle=t.defaultStyle||null,this.multi=t.multi||!1,this.styleAliases=function(e){var t={};return null!==e&&Object.keys(e).forEach((function(n){e[n].forEach((function(e){t[String(e)]=n}))})),t}(t.styleAliases||null),-1===u.indexOf(this.kind))throw new o('Unknown kind "'+this.kind+'" is specified for "'+e+'" YAML type.')};function f(e,t){var n=[];return e[t].forEach((function(e){var t=n.length;n.forEach((function(n,i){n.tag===e.tag&&n.kind===e.kind&&n.multi===e.multi&&(t=i)})),n[t]=e})),n}function d(e){return this.extend(e)}d.prototype.extend=function(e){var t=[],n=[];if(e instanceof p)n.push(e);else if(Array.isArray(e))n=n.concat(e);else{if(!e||!Array.isArray(e.implicit)&&!Array.isArray(e.explicit))throw new o("Schema.extend argument should be a Type, [ Type ], or a schema definition ({ implicit: [...], explicit: [...] })");e.implicit&&(t=t.concat(e.implicit)),e.explicit&&(n=n.concat(e.explicit))}t.forEach((function(e){if(!(e instanceof p))throw new o("Specified list of YAML types (or a single Type object) contains a non-Type object.");if(e.loadKind&&"scalar"!==e.loadKind)throw new o("There is a non-scalar type in the implicit list of a schema. Implicit resolving of such types is not supported.");if(e.multi)throw new o("There is a multi type in the implicit list of a schema. Multi tags can only be listed as explicit.")})),n.forEach((function(e){if(!(e instanceof p))throw new o("Specified list of YAML types (or a single Type object) contains a non-Type object.")}));var i=Object.create(d.prototype);return i.implicit=(this.implicit||[]).concat(t),i.explicit=(this.explicit||[]).concat(n),i.compiledImplicit=f(i,"implicit"),i.compiledExplicit=f(i,"explicit"),i.compiledTypeMap=function(){var e,t,n={scalar:{},sequence:{},mapping:{},fallback:{},multi:{scalar:[],sequence:[],mapping:[],fallback:[]}};function i(e){e.multi?(n.multi[e.kind].push(e),n.multi.fallback.push(e)):n[e.kind][e.tag]=n.fallback[e.tag]=e}for(e=0,t=arguments.length;e=0?"0b"+e.toString(2):"-0b"+e.toString(2).slice(1)},octal:function(e){return e>=0?"0o"+e.toString(8):"-0o"+e.toString(8).slice(1)},decimal:function(e){return e.toString(10)},hexadecimal:function(e){return e>=0?"0x"+e.toString(16).toUpperCase():"-0x"+e.toString(16).toUpperCase().slice(1)}},defaultStyle:"decimal",styleAliases:{binary:[2,"bin"],octal:[8,"oct"],decimal:[10,"dec"],hexadecimal:[16,"hex"]}}),x=new RegExp("^(?:[-+]?(?:[0-9][0-9_]*)(?:\\.[0-9_]*)?(?:[eE][-+]?[0-9]+)?|\\.[0-9_]+(?:[eE][-+]?[0-9]+)?|[-+]?\\.(?:inf|Inf|INF)|\\.(?:nan|NaN|NAN))$");var I=/^[-+]?[0-9]+e/;var S=new p("tag:yaml.org,2002:float",{kind:"scalar",resolve:function(e){return null!==e&&!(!x.test(e)||"_"===e[e.length-1])},construct:function(e){var t,n;return n="-"===(t=e.replace(/_/g,"").toLowerCase())[0]?-1:1,"+-".indexOf(t[0])>=0&&(t=t.slice(1)),".inf"===t?1===n?Number.POSITIVE_INFINITY:Number.NEGATIVE_INFINITY:".nan"===t?NaN:n*parseFloat(t,10)},predicate:function(e){return"[object Number]"===Object.prototype.toString.call(e)&&(e%1!=0||n.isNegativeZero(e))},represent:function(e,t){var i;if(isNaN(e))switch(t){case"lowercase":return".nan";case"uppercase":return".NAN";case"camelcase":return".NaN"}else if(Number.POSITIVE_INFINITY===e)switch(t){case"lowercase":return".inf";case"uppercase":return".INF";case"camelcase":return".Inf"}else if(Number.NEGATIVE_INFINITY===e)switch(t){case"lowercase":return"-.inf";case"uppercase":return"-.INF";case"camelcase":return"-.Inf"}else if(n.isNegativeZero(e))return"-0.0";return i=e.toString(10),I.test(i)?i.replace("e",".e"):i},defaultStyle:"lowercase"}),O=b.extend({implicit:[A,v,C,S]}),j=O,T=new RegExp("^([0-9][0-9][0-9][0-9])-([0-9][0-9])-([0-9][0-9])$"),N=new RegExp("^([0-9][0-9][0-9][0-9])-([0-9][0-9]?)-([0-9][0-9]?)(?:[Tt]|[ \\t]+)([0-9][0-9]?):([0-9][0-9]):([0-9][0-9])(?:\\.([0-9]*))?(?:[ \\t]*(Z|([-+])([0-9][0-9]?)(?::([0-9][0-9]))?))?$");var F=new p("tag:yaml.org,2002:timestamp",{kind:"scalar",resolve:function(e){return null!==e&&(null!==T.exec(e)||null!==N.exec(e))},construct:function(e){var t,n,i,r,o,a,l,c,s=0,u=null;if(null===(t=T.exec(e))&&(t=N.exec(e)),null===t)throw new Error("Date resolve error");if(n=+t[1],i=+t[2]-1,r=+t[3],!t[4])return new Date(Date.UTC(n,i,r));if(o=+t[4],a=+t[5],l=+t[6],t[7]){for(s=t[7].slice(0,3);s.length<3;)s+="0";s=+s}return t[9]&&(u=6e4*(60*+t[10]+ +(t[11]||0)),"-"===t[9]&&(u=-u)),c=new Date(Date.UTC(n,i,r,o,a,l,s)),u&&c.setTime(c.getTime()-u),c},instanceOf:Date,represent:function(e){return e.toISOString()}});var E=new p("tag:yaml.org,2002:merge",{kind:"scalar",resolve:function(e){return"<<"===e||null===e}}),M="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=\n\r";var L=new p("tag:yaml.org,2002:binary",{kind:"scalar",resolve:function(e){if(null===e)return!1;var t,n,i=0,r=e.length,o=M;for(n=0;n64)){if(t<0)return!1;i+=6}return i%8==0},construct:function(e){var t,n,i=e.replace(/[\r\n=]/g,""),r=i.length,o=M,a=0,l=[];for(t=0;t>16&255),l.push(a>>8&255),l.push(255&a)),a=a<<6|o.indexOf(i.charAt(t));return 0===(n=r%4*6)?(l.push(a>>16&255),l.push(a>>8&255),l.push(255&a)):18===n?(l.push(a>>10&255),l.push(a>>2&255)):12===n&&l.push(a>>4&255),new Uint8Array(l)},predicate:function(e){return"[object Uint8Array]"===Object.prototype.toString.call(e)},represent:function(e){var t,n,i="",r=0,o=e.length,a=M;for(t=0;t>18&63],i+=a[r>>12&63],i+=a[r>>6&63],i+=a[63&r]),r=(r<<8)+e[t];return 0===(n=o%3)?(i+=a[r>>18&63],i+=a[r>>12&63],i+=a[r>>6&63],i+=a[63&r]):2===n?(i+=a[r>>10&63],i+=a[r>>4&63],i+=a[r<<2&63],i+=a[64]):1===n&&(i+=a[r>>2&63],i+=a[r<<4&63],i+=a[64],i+=a[64]),i}}),_=Object.prototype.hasOwnProperty,D=Object.prototype.toString;var U=new p("tag:yaml.org,2002:omap",{kind:"sequence",resolve:function(e){if(null===e)return!0;var t,n,i,r,o,a=[],l=e;for(t=0,n=l.length;t>10),56320+(e-65536&1023))}for(var ie=new Array(256),re=new Array(256),oe=0;oe<256;oe++)ie[oe]=te(oe)?1:0,re[oe]=te(oe);function ae(e,t){this.input=e,this.filename=t.filename||null,this.schema=t.schema||K,this.onWarning=t.onWarning||null,this.legacy=t.legacy||!1,this.json=t.json||!1,this.listener=t.listener||null,this.implicitTypes=this.schema.compiledImplicit,this.typeMap=this.schema.compiledTypeMap,this.length=e.length,this.position=0,this.line=0,this.lineStart=0,this.lineIndent=0,this.firstTabInLine=-1,this.documents=[]}function le(e,t){var n={name:e.filename,buffer:e.input.slice(0,-1),position:e.position,line:e.line,column:e.position-e.lineStart};return n.snippet=c(n),new o(t,n)}function ce(e,t){throw le(e,t)}function se(e,t){e.onWarning&&e.onWarning.call(null,le(e,t))}var ue={YAML:function(e,t,n){var i,r,o;null!==e.version&&ce(e,"duplication of %YAML directive"),1!==n.length&&ce(e,"YAML directive accepts exactly one argument"),null===(i=/^([0-9]+)\.([0-9]+)$/.exec(n[0]))&&ce(e,"ill-formed argument of the YAML directive"),r=parseInt(i[1],10),o=parseInt(i[2],10),1!==r&&ce(e,"unacceptable YAML version of the document"),e.version=n[0],e.checkLineBreaks=o<2,1!==o&&2!==o&&se(e,"unsupported YAML version of the document")},TAG:function(e,t,n){var i,r;2!==n.length&&ce(e,"TAG directive accepts exactly two arguments"),i=n[0],r=n[1],G.test(i)||ce(e,"ill-formed tag handle (first argument) of the TAG directive"),P.call(e.tagMap,i)&&ce(e,'there is a previously declared suffix for "'+i+'" tag handle'),V.test(r)||ce(e,"ill-formed tag prefix (second argument) of the TAG directive");try{r=decodeURIComponent(r)}catch(t){ce(e,"tag prefix is malformed: "+r)}e.tagMap[i]=r}};function pe(e,t,n,i){var r,o,a,l;if(t1&&(e.result+=n.repeat("\n",t-1))}function be(e,t){var n,i,r=e.tag,o=e.anchor,a=[],l=!1;if(-1!==e.firstTabInLine)return!1;for(null!==e.anchor&&(e.anchorMap[e.anchor]=a),i=e.input.charCodeAt(e.position);0!==i&&(-1!==e.firstTabInLine&&(e.position=e.firstTabInLine,ce(e,"tab characters must not be used in indentation")),45===i)&&z(e.input.charCodeAt(e.position+1));)if(l=!0,e.position++,ge(e,!0,-1)&&e.lineIndent<=t)a.push(null),i=e.input.charCodeAt(e.position);else if(n=e.line,we(e,t,3,!1,!0),a.push(e.result),ge(e,!0,-1),i=e.input.charCodeAt(e.position),(e.line===n||e.lineIndent>t)&&0!==i)ce(e,"bad indentation of a sequence entry");else if(e.lineIndentt?g=1:e.lineIndent===t?g=0:e.lineIndentt?g=1:e.lineIndent===t?g=0:e.lineIndentt)&&(y&&(a=e.line,l=e.lineStart,c=e.position),we(e,t,4,!0,r)&&(y?g=e.result:m=e.result),y||(de(e,f,d,h,g,m,a,l,c),h=g=m=null),ge(e,!0,-1),s=e.input.charCodeAt(e.position)),(e.line===o||e.lineIndent>t)&&0!==s)ce(e,"bad indentation of a mapping entry");else if(e.lineIndent=0))break;0===o?ce(e,"bad explicit indentation width of a block scalar; it cannot be less than one"):u?ce(e,"repeat of an indentation width identifier"):(p=t+o-1,u=!0)}if(Q(a)){do{a=e.input.charCodeAt(++e.position)}while(Q(a));if(35===a)do{a=e.input.charCodeAt(++e.position)}while(!J(a)&&0!==a)}for(;0!==a;){for(he(e),e.lineIndent=0,a=e.input.charCodeAt(e.position);(!u||e.lineIndentp&&(p=e.lineIndent),J(a))f++;else{if(e.lineIndent0){for(r=a,o=0;r>0;r--)(a=ee(l=e.input.charCodeAt(++e.position)))>=0?o=(o<<4)+a:ce(e,"expected hexadecimal character");e.result+=ne(o),e.position++}else ce(e,"unknown escape sequence");n=i=e.position}else J(l)?(pe(e,n,i,!0),ye(e,ge(e,!1,t)),n=i=e.position):e.position===e.lineStart&&me(e)?ce(e,"unexpected end of the document within a double quoted scalar"):(e.position++,i=e.position)}ce(e,"unexpected end of the stream within a double quoted scalar")}(e,d)?y=!0:!function(e){var t,n,i;if(42!==(i=e.input.charCodeAt(e.position)))return!1;for(i=e.input.charCodeAt(++e.position),t=e.position;0!==i&&!z(i)&&!X(i);)i=e.input.charCodeAt(++e.position);return e.position===t&&ce(e,"name of an alias node must contain at least one character"),n=e.input.slice(t,e.position),P.call(e.anchorMap,n)||ce(e,'unidentified alias "'+n+'"'),e.result=e.anchorMap[n],ge(e,!0,-1),!0}(e)?function(e,t,n){var i,r,o,a,l,c,s,u,p=e.kind,f=e.result;if(z(u=e.input.charCodeAt(e.position))||X(u)||35===u||38===u||42===u||33===u||124===u||62===u||39===u||34===u||37===u||64===u||96===u)return!1;if((63===u||45===u)&&(z(i=e.input.charCodeAt(e.position+1))||n&&X(i)))return!1;for(e.kind="scalar",e.result="",r=o=e.position,a=!1;0!==u;){if(58===u){if(z(i=e.input.charCodeAt(e.position+1))||n&&X(i))break}else if(35===u){if(z(e.input.charCodeAt(e.position-1)))break}else{if(e.position===e.lineStart&&me(e)||n&&X(u))break;if(J(u)){if(l=e.line,c=e.lineStart,s=e.lineIndent,ge(e,!1,-1),e.lineIndent>=t){a=!0,u=e.input.charCodeAt(e.position);continue}e.position=o,e.line=l,e.lineStart=c,e.lineIndent=s;break}}a&&(pe(e,r,o,!1),ye(e,e.line-l),r=o=e.position,a=!1),Q(u)||(o=e.position+1),u=e.input.charCodeAt(++e.position)}return pe(e,r,o,!1),!!e.result||(e.kind=p,e.result=f,!1)}(e,d,1===i)&&(y=!0,null===e.tag&&(e.tag="?")):(y=!0,null===e.tag&&null===e.anchor||ce(e,"alias node should not have any properties")),null!==e.anchor&&(e.anchorMap[e.anchor]=e.result)):0===g&&(y=c&&be(e,h))),null===e.tag)null!==e.anchor&&(e.anchorMap[e.anchor]=e.result);else if("?"===e.tag){for(null!==e.result&&"scalar"!==e.kind&&ce(e,'unacceptable node kind for ! tag; it should be "scalar", not "'+e.kind+'"'),s=0,u=e.implicitTypes.length;s"),null!==e.result&&f.kind!==e.kind&&ce(e,"unacceptable node kind for !<"+e.tag+'> tag; it should be "'+f.kind+'", not "'+e.kind+'"'),f.resolve(e.result,e.tag)?(e.result=f.construct(e.result,e.tag),null!==e.anchor&&(e.anchorMap[e.anchor]=e.result)):ce(e,"cannot resolve a node with !<"+e.tag+"> explicit tag")}return null!==e.listener&&e.listener("close",e),null!==e.tag||null!==e.anchor||y}function ke(e){var t,n,i,r,o=e.position,a=!1;for(e.version=null,e.checkLineBreaks=e.legacy,e.tagMap=Object.create(null),e.anchorMap=Object.create(null);0!==(r=e.input.charCodeAt(e.position))&&(ge(e,!0,-1),r=e.input.charCodeAt(e.position),!(e.lineIndent>0||37!==r));){for(a=!0,r=e.input.charCodeAt(++e.position),t=e.position;0!==r&&!z(r);)r=e.input.charCodeAt(++e.position);for(i=[],(n=e.input.slice(t,e.position)).length<1&&ce(e,"directive name must not be less than one character in length");0!==r;){for(;Q(r);)r=e.input.charCodeAt(++e.position);if(35===r){do{r=e.input.charCodeAt(++e.position)}while(0!==r&&!J(r));break}if(J(r))break;for(t=e.position;0!==r&&!z(r);)r=e.input.charCodeAt(++e.position);i.push(e.input.slice(t,e.position))}0!==r&&he(e),P.call(ue,n)?ue[n](e,n,i):se(e,'unknown document directive "'+n+'"')}ge(e,!0,-1),0===e.lineIndent&&45===e.input.charCodeAt(e.position)&&45===e.input.charCodeAt(e.position+1)&&45===e.input.charCodeAt(e.position+2)?(e.position+=3,ge(e,!0,-1)):a&&ce(e,"directives end mark is expected"),we(e,e.lineIndent-1,4,!1,!0),ge(e,!0,-1),e.checkLineBreaks&&H.test(e.input.slice(o,e.position))&&se(e,"non-ASCII line breaks are interpreted as content"),e.documents.push(e.result),e.position===e.lineStart&&me(e)?46===e.input.charCodeAt(e.position)&&(e.position+=3,ge(e,!0,-1)):e.position=55296&&i<=56319&&t+1=56320&&n<=57343?1024*(i-55296)+n-56320+65536:i}function Re(e){return/^\n* /.test(e)}function Be(e,t,n,i,r,o,a,l){var c,s,u=0,p=null,f=!1,d=!1,h=-1!==i,g=-1,m=De(s=Ye(e,0))&&s!==Oe&&!_e(s)&&45!==s&&63!==s&&58!==s&&44!==s&&91!==s&&93!==s&&123!==s&&125!==s&&35!==s&&38!==s&&42!==s&&33!==s&&124!==s&&61!==s&&62!==s&&39!==s&&34!==s&&37!==s&&64!==s&&96!==s&&function(e){return!_e(e)&&58!==e}(Ye(e,e.length-1));if(t||a)for(c=0;c=65536?c+=2:c++){if(!De(u=Ye(e,c)))return 5;m=m&&qe(u,p,l),p=u}else{for(c=0;c=65536?c+=2:c++){if(10===(u=Ye(e,c)))f=!0,h&&(d=d||c-g-1>i&&" "!==e[g+1],g=c);else if(!De(u))return 5;m=m&&qe(u,p,l),p=u}d=d||h&&c-g-1>i&&" "!==e[g+1]}return f||d?n>9&&Re(e)?5:a?2===o?5:2:d?4:3:!m||a||r(e)?2===o?5:2:1}function Ke(e,t,n,i,r){e.dump=function(){if(0===t.length)return 2===e.quotingType?'""':"''";if(!e.noCompatMode&&(-1!==Te.indexOf(t)||Ne.test(t)))return 2===e.quotingType?'"'+t+'"':"'"+t+"'";var a=e.indent*Math.max(1,n),l=-1===e.lineWidth?-1:Math.max(Math.min(e.lineWidth,40),e.lineWidth-a),c=i||e.flowLevel>-1&&n>=e.flowLevel;switch(Be(t,c,e.indent,l,(function(t){return function(e,t){var n,i;for(n=0,i=e.implicitTypes.length;n"+Pe(t,e.indent)+We(Me(function(e,t){var n,i,r=/(\n+)([^\n]*)/g,o=(l=e.indexOf("\n"),l=-1!==l?l:e.length,r.lastIndex=l,He(e.slice(0,l),t)),a="\n"===e[0]||" "===e[0];var l;for(;i=r.exec(e);){var c=i[1],s=i[2];n=" "===s[0],o+=c+(a||n||""===s?"":"\n")+He(s,t),a=n}return o}(t,l),a));case 5:return'"'+function(e){for(var t,n="",i=0,r=0;r=65536?r+=2:r++)i=Ye(e,r),!(t=je[i])&&De(i)?(n+=e[r],i>=65536&&(n+=e[r+1])):n+=t||Fe(i);return n}(t)+'"';default:throw new o("impossible error: invalid scalar style")}}()}function Pe(e,t){var n=Re(e)?String(t):"",i="\n"===e[e.length-1];return n+(i&&("\n"===e[e.length-2]||"\n"===e)?"+":i?"":"-")+"\n"}function We(e){return"\n"===e[e.length-1]?e.slice(0,-1):e}function He(e,t){if(""===e||" "===e[0])return e;for(var n,i,r=/ [^ ]/g,o=0,a=0,l=0,c="";n=r.exec(e);)(l=n.index)-o>t&&(i=a>o?a:l,c+="\n"+e.slice(o,i),o=i+1),a=l;return c+="\n",e.length-o>t&&a>o?c+=e.slice(o,a)+"\n"+e.slice(a+1):c+=e.slice(o),c.slice(1)}function $e(e,t,n,i){var r,o,a,l="",c=e.tag;for(r=0,o=n.length;r tag resolver accepts not "'+s+'" style');i=c.represent[s](t,s)}e.dump=i}return!0}return!1}function Ve(e,t,n,i,r,a,l){e.tag=null,e.dump=n,Ge(e,n,!1)||Ge(e,n,!0);var c,s=Ie.call(e.dump),u=i;i&&(i=e.flowLevel<0||e.flowLevel>t);var p,f,d="[object Object]"===s||"[object Array]"===s;if(d&&(f=-1!==(p=e.duplicates.indexOf(n))),(null!==e.tag&&"?"!==e.tag||f||2!==e.indent&&t>0)&&(r=!1),f&&e.usedDuplicates[p])e.dump="*ref_"+p;else{if(d&&f&&!e.usedDuplicates[p]&&(e.usedDuplicates[p]=!0),"[object Object]"===s)i&&0!==Object.keys(e.dump).length?(!function(e,t,n,i){var r,a,l,c,s,u,p="",f=e.tag,d=Object.keys(n);if(!0===e.sortKeys)d.sort();else if("function"==typeof e.sortKeys)d.sort(e.sortKeys);else if(e.sortKeys)throw new o("sortKeys must be a boolean or a function");for(r=0,a=d.length;r1024)&&(e.dump&&10===e.dump.charCodeAt(0)?u+="?":u+="? "),u+=e.dump,s&&(u+=Le(e,t)),Ve(e,t+1,c,!0,s)&&(e.dump&&10===e.dump.charCodeAt(0)?u+=":":u+=": ",p+=u+=e.dump));e.tag=f,e.dump=p||"{}"}(e,t,e.dump,r),f&&(e.dump="&ref_"+p+e.dump)):(!function(e,t,n){var i,r,o,a,l,c="",s=e.tag,u=Object.keys(n);for(i=0,r=u.length;i1024&&(l+="? "),l+=e.dump+(e.condenseFlow?'"':"")+":"+(e.condenseFlow?"":" "),Ve(e,t,a,!1,!1)&&(c+=l+=e.dump));e.tag=s,e.dump="{"+c+"}"}(e,t,e.dump),f&&(e.dump="&ref_"+p+" "+e.dump));else if("[object Array]"===s)i&&0!==e.dump.length?(e.noArrayIndent&&!l&&t>0?$e(e,t-1,e.dump,r):$e(e,t,e.dump,r),f&&(e.dump="&ref_"+p+e.dump)):(!function(e,t,n){var i,r,o,a="",l=e.tag;for(i=0,r=n.length;i",e.dump=c+" "+e.dump)}return!0}function Ze(e,t){var n,i,r=[],o=[];for(Je(e,r,o),n=0,i=o.length;n maxHalfLength) { + head = ' ... '; + lineStart = position - maxHalfLength + head.length; + } + + if (lineEnd - position > maxHalfLength) { + tail = ' ...'; + lineEnd = position + maxHalfLength - tail.length; + } + + return { + str: head + buffer.slice(lineStart, lineEnd).replace(/\t/g, '→') + tail, + pos: position - lineStart + head.length // relative position + }; +} + + +function padStart(string, max) { + return common.repeat(' ', max - string.length) + string; +} + + +function makeSnippet(mark, options) { + options = Object.create(options || null); + + if (!mark.buffer) return null; + + if (!options.maxLength) options.maxLength = 79; + if (typeof options.indent !== 'number') options.indent = 1; + if (typeof options.linesBefore !== 'number') options.linesBefore = 3; + if (typeof options.linesAfter !== 'number') options.linesAfter = 2; + + var re = /\r?\n|\r|\0/g; + var lineStarts = [ 0 ]; + var lineEnds = []; + var match; + var foundLineNo = -1; + + while ((match = re.exec(mark.buffer))) { + lineEnds.push(match.index); + lineStarts.push(match.index + match[0].length); + + if (mark.position <= match.index && foundLineNo < 0) { + foundLineNo = lineStarts.length - 2; + } + } + + if (foundLineNo < 0) foundLineNo = lineStarts.length - 1; + + var result = '', i, line; + var lineNoLength = Math.min(mark.line + options.linesAfter, lineEnds.length).toString().length; + var maxLineLength = options.maxLength - (options.indent + lineNoLength + 3); + + for (i = 1; i <= options.linesBefore; i++) { + if (foundLineNo - i < 0) break; + line = getLine( + mark.buffer, + lineStarts[foundLineNo - i], + lineEnds[foundLineNo - i], + mark.position - (lineStarts[foundLineNo] - lineStarts[foundLineNo - i]), + maxLineLength + ); + result = common.repeat(' ', options.indent) + padStart((mark.line - i + 1).toString(), lineNoLength) + + ' | ' + line.str + '\n' + result; + } + + line = getLine(mark.buffer, lineStarts[foundLineNo], lineEnds[foundLineNo], mark.position, maxLineLength); + result += common.repeat(' ', options.indent) + padStart((mark.line + 1).toString(), lineNoLength) + + ' | ' + line.str + '\n'; + result += common.repeat('-', options.indent + lineNoLength + 3 + line.pos) + '^' + '\n'; + + for (i = 1; i <= options.linesAfter; i++) { + if (foundLineNo + i >= lineEnds.length) break; + line = getLine( + mark.buffer, + lineStarts[foundLineNo + i], + lineEnds[foundLineNo + i], + mark.position - (lineStarts[foundLineNo] - lineStarts[foundLineNo + i]), + maxLineLength + ); + result += common.repeat(' ', options.indent) + padStart((mark.line + i + 1).toString(), lineNoLength) + + ' | ' + line.str + '\n'; + } + + return result.replace(/\n$/, ''); +} + + +var snippet = makeSnippet; + +var TYPE_CONSTRUCTOR_OPTIONS = [ + 'kind', + 'multi', + 'resolve', + 'construct', + 'instanceOf', + 'predicate', + 'represent', + 'representName', + 'defaultStyle', + 'styleAliases' +]; + +var YAML_NODE_KINDS = [ + 'scalar', + 'sequence', + 'mapping' +]; + +function compileStyleAliases(map) { + var result = {}; + + if (map !== null) { + Object.keys(map).forEach(function (style) { + map[style].forEach(function (alias) { + result[String(alias)] = style; + }); + }); + } + + return result; +} + +function Type$1(tag, options) { + options = options || {}; + + Object.keys(options).forEach(function (name) { + if (TYPE_CONSTRUCTOR_OPTIONS.indexOf(name) === -1) { + throw new exception('Unknown option "' + name + '" is met in definition of "' + tag + '" YAML type.'); + } + }); + + // TODO: Add tag format check. + this.options = options; // keep original options in case user wants to extend this type later + this.tag = tag; + this.kind = options['kind'] || null; + this.resolve = options['resolve'] || function () { return true; }; + this.construct = options['construct'] || function (data) { return data; }; + this.instanceOf = options['instanceOf'] || null; + this.predicate = options['predicate'] || null; + this.represent = options['represent'] || null; + this.representName = options['representName'] || null; + this.defaultStyle = options['defaultStyle'] || null; + this.multi = options['multi'] || false; + this.styleAliases = compileStyleAliases(options['styleAliases'] || null); + + if (YAML_NODE_KINDS.indexOf(this.kind) === -1) { + throw new exception('Unknown kind "' + this.kind + '" is specified for "' + tag + '" YAML type.'); + } +} + +var type = Type$1; + +/*eslint-disable max-len*/ + + + + + +function compileList(schema, name) { + var result = []; + + schema[name].forEach(function (currentType) { + var newIndex = result.length; + + result.forEach(function (previousType, previousIndex) { + if (previousType.tag === currentType.tag && + previousType.kind === currentType.kind && + previousType.multi === currentType.multi) { + + newIndex = previousIndex; + } + }); + + result[newIndex] = currentType; + }); + + return result; +} + + +function compileMap(/* lists... */) { + var result = { + scalar: {}, + sequence: {}, + mapping: {}, + fallback: {}, + multi: { + scalar: [], + sequence: [], + mapping: [], + fallback: [] + } + }, index, length; + + function collectType(type) { + if (type.multi) { + result.multi[type.kind].push(type); + result.multi['fallback'].push(type); + } else { + result[type.kind][type.tag] = result['fallback'][type.tag] = type; + } + } + + for (index = 0, length = arguments.length; index < length; index += 1) { + arguments[index].forEach(collectType); + } + return result; +} + + +function Schema$1(definition) { + return this.extend(definition); +} + + +Schema$1.prototype.extend = function extend(definition) { + var implicit = []; + var explicit = []; + + if (definition instanceof type) { + // Schema.extend(type) + explicit.push(definition); + + } else if (Array.isArray(definition)) { + // Schema.extend([ type1, type2, ... ]) + explicit = explicit.concat(definition); + + } else if (definition && (Array.isArray(definition.implicit) || Array.isArray(definition.explicit))) { + // Schema.extend({ explicit: [ type1, type2, ... ], implicit: [ type1, type2, ... ] }) + if (definition.implicit) implicit = implicit.concat(definition.implicit); + if (definition.explicit) explicit = explicit.concat(definition.explicit); + + } else { + throw new exception('Schema.extend argument should be a Type, [ Type ], ' + + 'or a schema definition ({ implicit: [...], explicit: [...] })'); + } + + implicit.forEach(function (type$1) { + if (!(type$1 instanceof type)) { + throw new exception('Specified list of YAML types (or a single Type object) contains a non-Type object.'); + } + + if (type$1.loadKind && type$1.loadKind !== 'scalar') { + throw new exception('There is a non-scalar type in the implicit list of a schema. Implicit resolving of such types is not supported.'); + } + + if (type$1.multi) { + throw new exception('There is a multi type in the implicit list of a schema. Multi tags can only be listed as explicit.'); + } + }); + + explicit.forEach(function (type$1) { + if (!(type$1 instanceof type)) { + throw new exception('Specified list of YAML types (or a single Type object) contains a non-Type object.'); + } + }); + + var result = Object.create(Schema$1.prototype); + + result.implicit = (this.implicit || []).concat(implicit); + result.explicit = (this.explicit || []).concat(explicit); + + result.compiledImplicit = compileList(result, 'implicit'); + result.compiledExplicit = compileList(result, 'explicit'); + result.compiledTypeMap = compileMap(result.compiledImplicit, result.compiledExplicit); + + return result; +}; + + +var schema = Schema$1; + +var str = new type('tag:yaml.org,2002:str', { + kind: 'scalar', + construct: function (data) { return data !== null ? data : ''; } +}); + +var seq = new type('tag:yaml.org,2002:seq', { + kind: 'sequence', + construct: function (data) { return data !== null ? data : []; } +}); + +var map = new type('tag:yaml.org,2002:map', { + kind: 'mapping', + construct: function (data) { return data !== null ? data : {}; } +}); + +var failsafe = new schema({ + explicit: [ + str, + seq, + map + ] +}); + +function resolveYamlNull(data) { + if (data === null) return true; + + var max = data.length; + + return (max === 1 && data === '~') || + (max === 4 && (data === 'null' || data === 'Null' || data === 'NULL')); +} + +function constructYamlNull() { + return null; +} + +function isNull(object) { + return object === null; +} + +var _null = new type('tag:yaml.org,2002:null', { + kind: 'scalar', + resolve: resolveYamlNull, + construct: constructYamlNull, + predicate: isNull, + represent: { + canonical: function () { return '~'; }, + lowercase: function () { return 'null'; }, + uppercase: function () { return 'NULL'; }, + camelcase: function () { return 'Null'; }, + empty: function () { return ''; } + }, + defaultStyle: 'lowercase' +}); + +function resolveYamlBoolean(data) { + if (data === null) return false; + + var max = data.length; + + return (max === 4 && (data === 'true' || data === 'True' || data === 'TRUE')) || + (max === 5 && (data === 'false' || data === 'False' || data === 'FALSE')); +} + +function constructYamlBoolean(data) { + return data === 'true' || + data === 'True' || + data === 'TRUE'; +} + +function isBoolean(object) { + return Object.prototype.toString.call(object) === '[object Boolean]'; +} + +var bool = new type('tag:yaml.org,2002:bool', { + kind: 'scalar', + resolve: resolveYamlBoolean, + construct: constructYamlBoolean, + predicate: isBoolean, + represent: { + lowercase: function (object) { return object ? 'true' : 'false'; }, + uppercase: function (object) { return object ? 'TRUE' : 'FALSE'; }, + camelcase: function (object) { return object ? 'True' : 'False'; } + }, + defaultStyle: 'lowercase' +}); + +function isHexCode(c) { + return ((0x30/* 0 */ <= c) && (c <= 0x39/* 9 */)) || + ((0x41/* A */ <= c) && (c <= 0x46/* F */)) || + ((0x61/* a */ <= c) && (c <= 0x66/* f */)); +} + +function isOctCode(c) { + return ((0x30/* 0 */ <= c) && (c <= 0x37/* 7 */)); +} + +function isDecCode(c) { + return ((0x30/* 0 */ <= c) && (c <= 0x39/* 9 */)); +} + +function resolveYamlInteger(data) { + if (data === null) return false; + + var max = data.length, + index = 0, + hasDigits = false, + ch; + + if (!max) return false; + + ch = data[index]; + + // sign + if (ch === '-' || ch === '+') { + ch = data[++index]; + } + + if (ch === '0') { + // 0 + if (index + 1 === max) return true; + ch = data[++index]; + + // base 2, base 8, base 16 + + if (ch === 'b') { + // base 2 + index++; + + for (; index < max; index++) { + ch = data[index]; + if (ch === '_') continue; + if (ch !== '0' && ch !== '1') return false; + hasDigits = true; + } + return hasDigits && ch !== '_'; + } + + + if (ch === 'x') { + // base 16 + index++; + + for (; index < max; index++) { + ch = data[index]; + if (ch === '_') continue; + if (!isHexCode(data.charCodeAt(index))) return false; + hasDigits = true; + } + return hasDigits && ch !== '_'; + } + + + if (ch === 'o') { + // base 8 + index++; + + for (; index < max; index++) { + ch = data[index]; + if (ch === '_') continue; + if (!isOctCode(data.charCodeAt(index))) return false; + hasDigits = true; + } + return hasDigits && ch !== '_'; + } + } + + // base 10 (except 0) + + // value should not start with `_`; + if (ch === '_') return false; + + for (; index < max; index++) { + ch = data[index]; + if (ch === '_') continue; + if (!isDecCode(data.charCodeAt(index))) { + return false; + } + hasDigits = true; + } + + // Should have digits and should not end with `_` + if (!hasDigits || ch === '_') return false; + + return true; +} + +function constructYamlInteger(data) { + var value = data, sign = 1, ch; + + if (value.indexOf('_') !== -1) { + value = value.replace(/_/g, ''); + } + + ch = value[0]; + + if (ch === '-' || ch === '+') { + if (ch === '-') sign = -1; + value = value.slice(1); + ch = value[0]; + } + + if (value === '0') return 0; + + if (ch === '0') { + if (value[1] === 'b') return sign * parseInt(value.slice(2), 2); + if (value[1] === 'x') return sign * parseInt(value.slice(2), 16); + if (value[1] === 'o') return sign * parseInt(value.slice(2), 8); + } + + return sign * parseInt(value, 10); +} + +function isInteger(object) { + return (Object.prototype.toString.call(object)) === '[object Number]' && + (object % 1 === 0 && !common.isNegativeZero(object)); +} + +var int = new type('tag:yaml.org,2002:int', { + kind: 'scalar', + resolve: resolveYamlInteger, + construct: constructYamlInteger, + predicate: isInteger, + represent: { + binary: function (obj) { return obj >= 0 ? '0b' + obj.toString(2) : '-0b' + obj.toString(2).slice(1); }, + octal: function (obj) { return obj >= 0 ? '0o' + obj.toString(8) : '-0o' + obj.toString(8).slice(1); }, + decimal: function (obj) { return obj.toString(10); }, + /* eslint-disable max-len */ + hexadecimal: function (obj) { return obj >= 0 ? '0x' + obj.toString(16).toUpperCase() : '-0x' + obj.toString(16).toUpperCase().slice(1); } + }, + defaultStyle: 'decimal', + styleAliases: { + binary: [ 2, 'bin' ], + octal: [ 8, 'oct' ], + decimal: [ 10, 'dec' ], + hexadecimal: [ 16, 'hex' ] + } +}); + +var YAML_FLOAT_PATTERN = new RegExp( + // 2.5e4, 2.5 and integers + '^(?:[-+]?(?:[0-9][0-9_]*)(?:\\.[0-9_]*)?(?:[eE][-+]?[0-9]+)?' + + // .2e4, .2 + // special case, seems not from spec + '|\\.[0-9_]+(?:[eE][-+]?[0-9]+)?' + + // .inf + '|[-+]?\\.(?:inf|Inf|INF)' + + // .nan + '|\\.(?:nan|NaN|NAN))$'); + +function resolveYamlFloat(data) { + if (data === null) return false; + + if (!YAML_FLOAT_PATTERN.test(data) || + // Quick hack to not allow integers end with `_` + // Probably should update regexp & check speed + data[data.length - 1] === '_') { + return false; + } + + return true; +} + +function constructYamlFloat(data) { + var value, sign; + + value = data.replace(/_/g, '').toLowerCase(); + sign = value[0] === '-' ? -1 : 1; + + if ('+-'.indexOf(value[0]) >= 0) { + value = value.slice(1); + } + + if (value === '.inf') { + return (sign === 1) ? Number.POSITIVE_INFINITY : Number.NEGATIVE_INFINITY; + + } else if (value === '.nan') { + return NaN; + } + return sign * parseFloat(value, 10); +} + + +var SCIENTIFIC_WITHOUT_DOT = /^[-+]?[0-9]+e/; + +function representYamlFloat(object, style) { + var res; + + if (isNaN(object)) { + switch (style) { + case 'lowercase': return '.nan'; + case 'uppercase': return '.NAN'; + case 'camelcase': return '.NaN'; + } + } else if (Number.POSITIVE_INFINITY === object) { + switch (style) { + case 'lowercase': return '.inf'; + case 'uppercase': return '.INF'; + case 'camelcase': return '.Inf'; + } + } else if (Number.NEGATIVE_INFINITY === object) { + switch (style) { + case 'lowercase': return '-.inf'; + case 'uppercase': return '-.INF'; + case 'camelcase': return '-.Inf'; + } + } else if (common.isNegativeZero(object)) { + return '-0.0'; + } + + res = object.toString(10); + + // JS stringifier can build scientific format without dots: 5e-100, + // while YAML requres dot: 5.e-100. Fix it with simple hack + + return SCIENTIFIC_WITHOUT_DOT.test(res) ? res.replace('e', '.e') : res; +} + +function isFloat(object) { + return (Object.prototype.toString.call(object) === '[object Number]') && + (object % 1 !== 0 || common.isNegativeZero(object)); +} + +var float = new type('tag:yaml.org,2002:float', { + kind: 'scalar', + resolve: resolveYamlFloat, + construct: constructYamlFloat, + predicate: isFloat, + represent: representYamlFloat, + defaultStyle: 'lowercase' +}); + +var json = failsafe.extend({ + implicit: [ + _null, + bool, + int, + float + ] +}); + +var core = json; + +var YAML_DATE_REGEXP = new RegExp( + '^([0-9][0-9][0-9][0-9])' + // [1] year + '-([0-9][0-9])' + // [2] month + '-([0-9][0-9])$'); // [3] day + +var YAML_TIMESTAMP_REGEXP = new RegExp( + '^([0-9][0-9][0-9][0-9])' + // [1] year + '-([0-9][0-9]?)' + // [2] month + '-([0-9][0-9]?)' + // [3] day + '(?:[Tt]|[ \\t]+)' + // ... + '([0-9][0-9]?)' + // [4] hour + ':([0-9][0-9])' + // [5] minute + ':([0-9][0-9])' + // [6] second + '(?:\\.([0-9]*))?' + // [7] fraction + '(?:[ \\t]*(Z|([-+])([0-9][0-9]?)' + // [8] tz [9] tz_sign [10] tz_hour + '(?::([0-9][0-9]))?))?$'); // [11] tz_minute + +function resolveYamlTimestamp(data) { + if (data === null) return false; + if (YAML_DATE_REGEXP.exec(data) !== null) return true; + if (YAML_TIMESTAMP_REGEXP.exec(data) !== null) return true; + return false; +} + +function constructYamlTimestamp(data) { + var match, year, month, day, hour, minute, second, fraction = 0, + delta = null, tz_hour, tz_minute, date; + + match = YAML_DATE_REGEXP.exec(data); + if (match === null) match = YAML_TIMESTAMP_REGEXP.exec(data); + + if (match === null) throw new Error('Date resolve error'); + + // match: [1] year [2] month [3] day + + year = +(match[1]); + month = +(match[2]) - 1; // JS month starts with 0 + day = +(match[3]); + + if (!match[4]) { // no hour + return new Date(Date.UTC(year, month, day)); + } + + // match: [4] hour [5] minute [6] second [7] fraction + + hour = +(match[4]); + minute = +(match[5]); + second = +(match[6]); + + if (match[7]) { + fraction = match[7].slice(0, 3); + while (fraction.length < 3) { // milli-seconds + fraction += '0'; + } + fraction = +fraction; + } + + // match: [8] tz [9] tz_sign [10] tz_hour [11] tz_minute + + if (match[9]) { + tz_hour = +(match[10]); + tz_minute = +(match[11] || 0); + delta = (tz_hour * 60 + tz_minute) * 60000; // delta in mili-seconds + if (match[9] === '-') delta = -delta; + } + + date = new Date(Date.UTC(year, month, day, hour, minute, second, fraction)); + + if (delta) date.setTime(date.getTime() - delta); + + return date; +} + +function representYamlTimestamp(object /*, style*/) { + return object.toISOString(); +} + +var timestamp = new type('tag:yaml.org,2002:timestamp', { + kind: 'scalar', + resolve: resolveYamlTimestamp, + construct: constructYamlTimestamp, + instanceOf: Date, + represent: representYamlTimestamp +}); + +function resolveYamlMerge(data) { + return data === '<<' || data === null; +} + +var merge = new type('tag:yaml.org,2002:merge', { + kind: 'scalar', + resolve: resolveYamlMerge +}); + +/*eslint-disable no-bitwise*/ + + + + + +// [ 64, 65, 66 ] -> [ padding, CR, LF ] +var BASE64_MAP = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=\n\r'; + + +function resolveYamlBinary(data) { + if (data === null) return false; + + var code, idx, bitlen = 0, max = data.length, map = BASE64_MAP; + + // Convert one by one. + for (idx = 0; idx < max; idx++) { + code = map.indexOf(data.charAt(idx)); + + // Skip CR/LF + if (code > 64) continue; + + // Fail on illegal characters + if (code < 0) return false; + + bitlen += 6; + } + + // If there are any bits left, source was corrupted + return (bitlen % 8) === 0; +} + +function constructYamlBinary(data) { + var idx, tailbits, + input = data.replace(/[\r\n=]/g, ''), // remove CR/LF & padding to simplify scan + max = input.length, + map = BASE64_MAP, + bits = 0, + result = []; + + // Collect by 6*4 bits (3 bytes) + + for (idx = 0; idx < max; idx++) { + if ((idx % 4 === 0) && idx) { + result.push((bits >> 16) & 0xFF); + result.push((bits >> 8) & 0xFF); + result.push(bits & 0xFF); + } + + bits = (bits << 6) | map.indexOf(input.charAt(idx)); + } + + // Dump tail + + tailbits = (max % 4) * 6; + + if (tailbits === 0) { + result.push((bits >> 16) & 0xFF); + result.push((bits >> 8) & 0xFF); + result.push(bits & 0xFF); + } else if (tailbits === 18) { + result.push((bits >> 10) & 0xFF); + result.push((bits >> 2) & 0xFF); + } else if (tailbits === 12) { + result.push((bits >> 4) & 0xFF); + } + + return new Uint8Array(result); +} + +function representYamlBinary(object /*, style*/) { + var result = '', bits = 0, idx, tail, + max = object.length, + map = BASE64_MAP; + + // Convert every three bytes to 4 ASCII characters. + + for (idx = 0; idx < max; idx++) { + if ((idx % 3 === 0) && idx) { + result += map[(bits >> 18) & 0x3F]; + result += map[(bits >> 12) & 0x3F]; + result += map[(bits >> 6) & 0x3F]; + result += map[bits & 0x3F]; + } + + bits = (bits << 8) + object[idx]; + } + + // Dump tail + + tail = max % 3; + + if (tail === 0) { + result += map[(bits >> 18) & 0x3F]; + result += map[(bits >> 12) & 0x3F]; + result += map[(bits >> 6) & 0x3F]; + result += map[bits & 0x3F]; + } else if (tail === 2) { + result += map[(bits >> 10) & 0x3F]; + result += map[(bits >> 4) & 0x3F]; + result += map[(bits << 2) & 0x3F]; + result += map[64]; + } else if (tail === 1) { + result += map[(bits >> 2) & 0x3F]; + result += map[(bits << 4) & 0x3F]; + result += map[64]; + result += map[64]; + } + + return result; +} + +function isBinary(obj) { + return Object.prototype.toString.call(obj) === '[object Uint8Array]'; +} + +var binary = new type('tag:yaml.org,2002:binary', { + kind: 'scalar', + resolve: resolveYamlBinary, + construct: constructYamlBinary, + predicate: isBinary, + represent: representYamlBinary +}); + +var _hasOwnProperty$3 = Object.prototype.hasOwnProperty; +var _toString$2 = Object.prototype.toString; + +function resolveYamlOmap(data) { + if (data === null) return true; + + var objectKeys = [], index, length, pair, pairKey, pairHasKey, + object = data; + + for (index = 0, length = object.length; index < length; index += 1) { + pair = object[index]; + pairHasKey = false; + + if (_toString$2.call(pair) !== '[object Object]') return false; + + for (pairKey in pair) { + if (_hasOwnProperty$3.call(pair, pairKey)) { + if (!pairHasKey) pairHasKey = true; + else return false; + } + } + + if (!pairHasKey) return false; + + if (objectKeys.indexOf(pairKey) === -1) objectKeys.push(pairKey); + else return false; + } + + return true; +} + +function constructYamlOmap(data) { + return data !== null ? data : []; +} + +var omap = new type('tag:yaml.org,2002:omap', { + kind: 'sequence', + resolve: resolveYamlOmap, + construct: constructYamlOmap +}); + +var _toString$1 = Object.prototype.toString; + +function resolveYamlPairs(data) { + if (data === null) return true; + + var index, length, pair, keys, result, + object = data; + + result = new Array(object.length); + + for (index = 0, length = object.length; index < length; index += 1) { + pair = object[index]; + + if (_toString$1.call(pair) !== '[object Object]') return false; + + keys = Object.keys(pair); + + if (keys.length !== 1) return false; + + result[index] = [ keys[0], pair[keys[0]] ]; + } + + return true; +} + +function constructYamlPairs(data) { + if (data === null) return []; + + var index, length, pair, keys, result, + object = data; + + result = new Array(object.length); + + for (index = 0, length = object.length; index < length; index += 1) { + pair = object[index]; + + keys = Object.keys(pair); + + result[index] = [ keys[0], pair[keys[0]] ]; + } + + return result; +} + +var pairs = new type('tag:yaml.org,2002:pairs', { + kind: 'sequence', + resolve: resolveYamlPairs, + construct: constructYamlPairs +}); + +var _hasOwnProperty$2 = Object.prototype.hasOwnProperty; + +function resolveYamlSet(data) { + if (data === null) return true; + + var key, object = data; + + for (key in object) { + if (_hasOwnProperty$2.call(object, key)) { + if (object[key] !== null) return false; + } + } + + return true; +} + +function constructYamlSet(data) { + return data !== null ? data : {}; +} + +var set = new type('tag:yaml.org,2002:set', { + kind: 'mapping', + resolve: resolveYamlSet, + construct: constructYamlSet +}); + +var _default = core.extend({ + implicit: [ + timestamp, + merge + ], + explicit: [ + binary, + omap, + pairs, + set + ] +}); + +/*eslint-disable max-len,no-use-before-define*/ + + + + + + + +var _hasOwnProperty$1 = Object.prototype.hasOwnProperty; + + +var CONTEXT_FLOW_IN = 1; +var CONTEXT_FLOW_OUT = 2; +var CONTEXT_BLOCK_IN = 3; +var CONTEXT_BLOCK_OUT = 4; + + +var CHOMPING_CLIP = 1; +var CHOMPING_STRIP = 2; +var CHOMPING_KEEP = 3; + + +var PATTERN_NON_PRINTABLE = /[\x00-\x08\x0B\x0C\x0E-\x1F\x7F-\x84\x86-\x9F\uFFFE\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]/; +var PATTERN_NON_ASCII_LINE_BREAKS = /[\x85\u2028\u2029]/; +var PATTERN_FLOW_INDICATORS = /[,\[\]\{\}]/; +var PATTERN_TAG_HANDLE = /^(?:!|!!|![a-z\-]+!)$/i; +var PATTERN_TAG_URI = /^(?:!|[^,\[\]\{\}])(?:%[0-9a-f]{2}|[0-9a-z\-#;\/\?:@&=\+\$,_\.!~\*'\(\)\[\]])*$/i; + + +function _class(obj) { return Object.prototype.toString.call(obj); } + +function is_EOL(c) { + return (c === 0x0A/* LF */) || (c === 0x0D/* CR */); +} + +function is_WHITE_SPACE(c) { + return (c === 0x09/* Tab */) || (c === 0x20/* Space */); +} + +function is_WS_OR_EOL(c) { + return (c === 0x09/* Tab */) || + (c === 0x20/* Space */) || + (c === 0x0A/* LF */) || + (c === 0x0D/* CR */); +} + +function is_FLOW_INDICATOR(c) { + return c === 0x2C/* , */ || + c === 0x5B/* [ */ || + c === 0x5D/* ] */ || + c === 0x7B/* { */ || + c === 0x7D/* } */; +} + +function fromHexCode(c) { + var lc; + + if ((0x30/* 0 */ <= c) && (c <= 0x39/* 9 */)) { + return c - 0x30; + } + + /*eslint-disable no-bitwise*/ + lc = c | 0x20; + + if ((0x61/* a */ <= lc) && (lc <= 0x66/* f */)) { + return lc - 0x61 + 10; + } + + return -1; +} + +function escapedHexLen(c) { + if (c === 0x78/* x */) { return 2; } + if (c === 0x75/* u */) { return 4; } + if (c === 0x55/* U */) { return 8; } + return 0; +} + +function fromDecimalCode(c) { + if ((0x30/* 0 */ <= c) && (c <= 0x39/* 9 */)) { + return c - 0x30; + } + + return -1; +} + +function simpleEscapeSequence(c) { + /* eslint-disable indent */ + return (c === 0x30/* 0 */) ? '\x00' : + (c === 0x61/* a */) ? '\x07' : + (c === 0x62/* b */) ? '\x08' : + (c === 0x74/* t */) ? '\x09' : + (c === 0x09/* Tab */) ? '\x09' : + (c === 0x6E/* n */) ? '\x0A' : + (c === 0x76/* v */) ? '\x0B' : + (c === 0x66/* f */) ? '\x0C' : + (c === 0x72/* r */) ? '\x0D' : + (c === 0x65/* e */) ? '\x1B' : + (c === 0x20/* Space */) ? ' ' : + (c === 0x22/* " */) ? '\x22' : + (c === 0x2F/* / */) ? '/' : + (c === 0x5C/* \ */) ? '\x5C' : + (c === 0x4E/* N */) ? '\x85' : + (c === 0x5F/* _ */) ? '\xA0' : + (c === 0x4C/* L */) ? '\u2028' : + (c === 0x50/* P */) ? '\u2029' : ''; +} + +function charFromCodepoint(c) { + if (c <= 0xFFFF) { + return String.fromCharCode(c); + } + // Encode UTF-16 surrogate pair + // https://en.wikipedia.org/wiki/UTF-16#Code_points_U.2B010000_to_U.2B10FFFF + return String.fromCharCode( + ((c - 0x010000) >> 10) + 0xD800, + ((c - 0x010000) & 0x03FF) + 0xDC00 + ); +} + +var simpleEscapeCheck = new Array(256); // integer, for fast access +var simpleEscapeMap = new Array(256); +for (var i = 0; i < 256; i++) { + simpleEscapeCheck[i] = simpleEscapeSequence(i) ? 1 : 0; + simpleEscapeMap[i] = simpleEscapeSequence(i); +} + + +function State$1(input, options) { + this.input = input; + + this.filename = options['filename'] || null; + this.schema = options['schema'] || _default; + this.onWarning = options['onWarning'] || null; + // (Hidden) Remove? makes the loader to expect YAML 1.1 documents + // if such documents have no explicit %YAML directive + this.legacy = options['legacy'] || false; + + this.json = options['json'] || false; + this.listener = options['listener'] || null; + + this.implicitTypes = this.schema.compiledImplicit; + this.typeMap = this.schema.compiledTypeMap; + + this.length = input.length; + this.position = 0; + this.line = 0; + this.lineStart = 0; + this.lineIndent = 0; + + // position of first leading tab in the current line, + // used to make sure there are no tabs in the indentation + this.firstTabInLine = -1; + + this.documents = []; + + /* + this.version; + this.checkLineBreaks; + this.tagMap; + this.anchorMap; + this.tag; + this.anchor; + this.kind; + this.result;*/ + +} + + +function generateError(state, message) { + var mark = { + name: state.filename, + buffer: state.input.slice(0, -1), // omit trailing \0 + position: state.position, + line: state.line, + column: state.position - state.lineStart + }; + + mark.snippet = snippet(mark); + + return new exception(message, mark); +} + +function throwError(state, message) { + throw generateError(state, message); +} + +function throwWarning(state, message) { + if (state.onWarning) { + state.onWarning.call(null, generateError(state, message)); + } +} + + +var directiveHandlers = { + + YAML: function handleYamlDirective(state, name, args) { + + var match, major, minor; + + if (state.version !== null) { + throwError(state, 'duplication of %YAML directive'); + } + + if (args.length !== 1) { + throwError(state, 'YAML directive accepts exactly one argument'); + } + + match = /^([0-9]+)\.([0-9]+)$/.exec(args[0]); + + if (match === null) { + throwError(state, 'ill-formed argument of the YAML directive'); + } + + major = parseInt(match[1], 10); + minor = parseInt(match[2], 10); + + if (major !== 1) { + throwError(state, 'unacceptable YAML version of the document'); + } + + state.version = args[0]; + state.checkLineBreaks = (minor < 2); + + if (minor !== 1 && minor !== 2) { + throwWarning(state, 'unsupported YAML version of the document'); + } + }, + + TAG: function handleTagDirective(state, name, args) { + + var handle, prefix; + + if (args.length !== 2) { + throwError(state, 'TAG directive accepts exactly two arguments'); + } + + handle = args[0]; + prefix = args[1]; + + if (!PATTERN_TAG_HANDLE.test(handle)) { + throwError(state, 'ill-formed tag handle (first argument) of the TAG directive'); + } + + if (_hasOwnProperty$1.call(state.tagMap, handle)) { + throwError(state, 'there is a previously declared suffix for "' + handle + '" tag handle'); + } + + if (!PATTERN_TAG_URI.test(prefix)) { + throwError(state, 'ill-formed tag prefix (second argument) of the TAG directive'); + } + + try { + prefix = decodeURIComponent(prefix); + } catch (err) { + throwError(state, 'tag prefix is malformed: ' + prefix); + } + + state.tagMap[handle] = prefix; + } +}; + + +function captureSegment(state, start, end, checkJson) { + var _position, _length, _character, _result; + + if (start < end) { + _result = state.input.slice(start, end); + + if (checkJson) { + for (_position = 0, _length = _result.length; _position < _length; _position += 1) { + _character = _result.charCodeAt(_position); + if (!(_character === 0x09 || + (0x20 <= _character && _character <= 0x10FFFF))) { + throwError(state, 'expected valid JSON character'); + } + } + } else if (PATTERN_NON_PRINTABLE.test(_result)) { + throwError(state, 'the stream contains non-printable characters'); + } + + state.result += _result; + } +} + +function mergeMappings(state, destination, source, overridableKeys) { + var sourceKeys, key, index, quantity; + + if (!common.isObject(source)) { + throwError(state, 'cannot merge mappings; the provided source object is unacceptable'); + } + + sourceKeys = Object.keys(source); + + for (index = 0, quantity = sourceKeys.length; index < quantity; index += 1) { + key = sourceKeys[index]; + + if (!_hasOwnProperty$1.call(destination, key)) { + destination[key] = source[key]; + overridableKeys[key] = true; + } + } +} + +function storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, valueNode, + startLine, startLineStart, startPos) { + + var index, quantity; + + // The output is a plain object here, so keys can only be strings. + // We need to convert keyNode to a string, but doing so can hang the process + // (deeply nested arrays that explode exponentially using aliases). + if (Array.isArray(keyNode)) { + keyNode = Array.prototype.slice.call(keyNode); + + for (index = 0, quantity = keyNode.length; index < quantity; index += 1) { + if (Array.isArray(keyNode[index])) { + throwError(state, 'nested arrays are not supported inside keys'); + } + + if (typeof keyNode === 'object' && _class(keyNode[index]) === '[object Object]') { + keyNode[index] = '[object Object]'; + } + } + } + + // Avoid code execution in load() via toString property + // (still use its own toString for arrays, timestamps, + // and whatever user schema extensions happen to have @@toStringTag) + if (typeof keyNode === 'object' && _class(keyNode) === '[object Object]') { + keyNode = '[object Object]'; + } + + + keyNode = String(keyNode); + + if (_result === null) { + _result = {}; + } + + if (keyTag === 'tag:yaml.org,2002:merge') { + if (Array.isArray(valueNode)) { + for (index = 0, quantity = valueNode.length; index < quantity; index += 1) { + mergeMappings(state, _result, valueNode[index], overridableKeys); + } + } else { + mergeMappings(state, _result, valueNode, overridableKeys); + } + } else { + if (!state.json && + !_hasOwnProperty$1.call(overridableKeys, keyNode) && + _hasOwnProperty$1.call(_result, keyNode)) { + state.line = startLine || state.line; + state.lineStart = startLineStart || state.lineStart; + state.position = startPos || state.position; + throwError(state, 'duplicated mapping key'); + } + + // used for this specific key only because Object.defineProperty is slow + if (keyNode === '__proto__') { + Object.defineProperty(_result, keyNode, { + configurable: true, + enumerable: true, + writable: true, + value: valueNode + }); + } else { + _result[keyNode] = valueNode; + } + delete overridableKeys[keyNode]; + } + + return _result; +} + +function readLineBreak(state) { + var ch; + + ch = state.input.charCodeAt(state.position); + + if (ch === 0x0A/* LF */) { + state.position++; + } else if (ch === 0x0D/* CR */) { + state.position++; + if (state.input.charCodeAt(state.position) === 0x0A/* LF */) { + state.position++; + } + } else { + throwError(state, 'a line break is expected'); + } + + state.line += 1; + state.lineStart = state.position; + state.firstTabInLine = -1; +} + +function skipSeparationSpace(state, allowComments, checkIndent) { + var lineBreaks = 0, + ch = state.input.charCodeAt(state.position); + + while (ch !== 0) { + while (is_WHITE_SPACE(ch)) { + if (ch === 0x09/* Tab */ && state.firstTabInLine === -1) { + state.firstTabInLine = state.position; + } + ch = state.input.charCodeAt(++state.position); + } + + if (allowComments && ch === 0x23/* # */) { + do { + ch = state.input.charCodeAt(++state.position); + } while (ch !== 0x0A/* LF */ && ch !== 0x0D/* CR */ && ch !== 0); + } + + if (is_EOL(ch)) { + readLineBreak(state); + + ch = state.input.charCodeAt(state.position); + lineBreaks++; + state.lineIndent = 0; + + while (ch === 0x20/* Space */) { + state.lineIndent++; + ch = state.input.charCodeAt(++state.position); + } + } else { + break; + } + } + + if (checkIndent !== -1 && lineBreaks !== 0 && state.lineIndent < checkIndent) { + throwWarning(state, 'deficient indentation'); + } + + return lineBreaks; +} + +function testDocumentSeparator(state) { + var _position = state.position, + ch; + + ch = state.input.charCodeAt(_position); + + // Condition state.position === state.lineStart is tested + // in parent on each call, for efficiency. No needs to test here again. + if ((ch === 0x2D/* - */ || ch === 0x2E/* . */) && + ch === state.input.charCodeAt(_position + 1) && + ch === state.input.charCodeAt(_position + 2)) { + + _position += 3; + + ch = state.input.charCodeAt(_position); + + if (ch === 0 || is_WS_OR_EOL(ch)) { + return true; + } + } + + return false; +} + +function writeFoldedLines(state, count) { + if (count === 1) { + state.result += ' '; + } else if (count > 1) { + state.result += common.repeat('\n', count - 1); + } +} + + +function readPlainScalar(state, nodeIndent, withinFlowCollection) { + var preceding, + following, + captureStart, + captureEnd, + hasPendingContent, + _line, + _lineStart, + _lineIndent, + _kind = state.kind, + _result = state.result, + ch; + + ch = state.input.charCodeAt(state.position); + + if (is_WS_OR_EOL(ch) || + is_FLOW_INDICATOR(ch) || + ch === 0x23/* # */ || + ch === 0x26/* & */ || + ch === 0x2A/* * */ || + ch === 0x21/* ! */ || + ch === 0x7C/* | */ || + ch === 0x3E/* > */ || + ch === 0x27/* ' */ || + ch === 0x22/* " */ || + ch === 0x25/* % */ || + ch === 0x40/* @ */ || + ch === 0x60/* ` */) { + return false; + } + + if (ch === 0x3F/* ? */ || ch === 0x2D/* - */) { + following = state.input.charCodeAt(state.position + 1); + + if (is_WS_OR_EOL(following) || + withinFlowCollection && is_FLOW_INDICATOR(following)) { + return false; + } + } + + state.kind = 'scalar'; + state.result = ''; + captureStart = captureEnd = state.position; + hasPendingContent = false; + + while (ch !== 0) { + if (ch === 0x3A/* : */) { + following = state.input.charCodeAt(state.position + 1); + + if (is_WS_OR_EOL(following) || + withinFlowCollection && is_FLOW_INDICATOR(following)) { + break; + } + + } else if (ch === 0x23/* # */) { + preceding = state.input.charCodeAt(state.position - 1); + + if (is_WS_OR_EOL(preceding)) { + break; + } + + } else if ((state.position === state.lineStart && testDocumentSeparator(state)) || + withinFlowCollection && is_FLOW_INDICATOR(ch)) { + break; + + } else if (is_EOL(ch)) { + _line = state.line; + _lineStart = state.lineStart; + _lineIndent = state.lineIndent; + skipSeparationSpace(state, false, -1); + + if (state.lineIndent >= nodeIndent) { + hasPendingContent = true; + ch = state.input.charCodeAt(state.position); + continue; + } else { + state.position = captureEnd; + state.line = _line; + state.lineStart = _lineStart; + state.lineIndent = _lineIndent; + break; + } + } + + if (hasPendingContent) { + captureSegment(state, captureStart, captureEnd, false); + writeFoldedLines(state, state.line - _line); + captureStart = captureEnd = state.position; + hasPendingContent = false; + } + + if (!is_WHITE_SPACE(ch)) { + captureEnd = state.position + 1; + } + + ch = state.input.charCodeAt(++state.position); + } + + captureSegment(state, captureStart, captureEnd, false); + + if (state.result) { + return true; + } + + state.kind = _kind; + state.result = _result; + return false; +} + +function readSingleQuotedScalar(state, nodeIndent) { + var ch, + captureStart, captureEnd; + + ch = state.input.charCodeAt(state.position); + + if (ch !== 0x27/* ' */) { + return false; + } + + state.kind = 'scalar'; + state.result = ''; + state.position++; + captureStart = captureEnd = state.position; + + while ((ch = state.input.charCodeAt(state.position)) !== 0) { + if (ch === 0x27/* ' */) { + captureSegment(state, captureStart, state.position, true); + ch = state.input.charCodeAt(++state.position); + + if (ch === 0x27/* ' */) { + captureStart = state.position; + state.position++; + captureEnd = state.position; + } else { + return true; + } + + } else if (is_EOL(ch)) { + captureSegment(state, captureStart, captureEnd, true); + writeFoldedLines(state, skipSeparationSpace(state, false, nodeIndent)); + captureStart = captureEnd = state.position; + + } else if (state.position === state.lineStart && testDocumentSeparator(state)) { + throwError(state, 'unexpected end of the document within a single quoted scalar'); + + } else { + state.position++; + captureEnd = state.position; + } + } + + throwError(state, 'unexpected end of the stream within a single quoted scalar'); +} + +function readDoubleQuotedScalar(state, nodeIndent) { + var captureStart, + captureEnd, + hexLength, + hexResult, + tmp, + ch; + + ch = state.input.charCodeAt(state.position); + + if (ch !== 0x22/* " */) { + return false; + } + + state.kind = 'scalar'; + state.result = ''; + state.position++; + captureStart = captureEnd = state.position; + + while ((ch = state.input.charCodeAt(state.position)) !== 0) { + if (ch === 0x22/* " */) { + captureSegment(state, captureStart, state.position, true); + state.position++; + return true; + + } else if (ch === 0x5C/* \ */) { + captureSegment(state, captureStart, state.position, true); + ch = state.input.charCodeAt(++state.position); + + if (is_EOL(ch)) { + skipSeparationSpace(state, false, nodeIndent); + + // TODO: rework to inline fn with no type cast? + } else if (ch < 256 && simpleEscapeCheck[ch]) { + state.result += simpleEscapeMap[ch]; + state.position++; + + } else if ((tmp = escapedHexLen(ch)) > 0) { + hexLength = tmp; + hexResult = 0; + + for (; hexLength > 0; hexLength--) { + ch = state.input.charCodeAt(++state.position); + + if ((tmp = fromHexCode(ch)) >= 0) { + hexResult = (hexResult << 4) + tmp; + + } else { + throwError(state, 'expected hexadecimal character'); + } + } + + state.result += charFromCodepoint(hexResult); + + state.position++; + + } else { + throwError(state, 'unknown escape sequence'); + } + + captureStart = captureEnd = state.position; + + } else if (is_EOL(ch)) { + captureSegment(state, captureStart, captureEnd, true); + writeFoldedLines(state, skipSeparationSpace(state, false, nodeIndent)); + captureStart = captureEnd = state.position; + + } else if (state.position === state.lineStart && testDocumentSeparator(state)) { + throwError(state, 'unexpected end of the document within a double quoted scalar'); + + } else { + state.position++; + captureEnd = state.position; + } + } + + throwError(state, 'unexpected end of the stream within a double quoted scalar'); +} + +function readFlowCollection(state, nodeIndent) { + var readNext = true, + _line, + _lineStart, + _pos, + _tag = state.tag, + _result, + _anchor = state.anchor, + following, + terminator, + isPair, + isExplicitPair, + isMapping, + overridableKeys = Object.create(null), + keyNode, + keyTag, + valueNode, + ch; + + ch = state.input.charCodeAt(state.position); + + if (ch === 0x5B/* [ */) { + terminator = 0x5D;/* ] */ + isMapping = false; + _result = []; + } else if (ch === 0x7B/* { */) { + terminator = 0x7D;/* } */ + isMapping = true; + _result = {}; + } else { + return false; + } + + if (state.anchor !== null) { + state.anchorMap[state.anchor] = _result; + } + + ch = state.input.charCodeAt(++state.position); + + while (ch !== 0) { + skipSeparationSpace(state, true, nodeIndent); + + ch = state.input.charCodeAt(state.position); + + if (ch === terminator) { + state.position++; + state.tag = _tag; + state.anchor = _anchor; + state.kind = isMapping ? 'mapping' : 'sequence'; + state.result = _result; + return true; + } else if (!readNext) { + throwError(state, 'missed comma between flow collection entries'); + } else if (ch === 0x2C/* , */) { + // "flow collection entries can never be completely empty", as per YAML 1.2, section 7.4 + throwError(state, "expected the node content, but found ','"); + } + + keyTag = keyNode = valueNode = null; + isPair = isExplicitPair = false; + + if (ch === 0x3F/* ? */) { + following = state.input.charCodeAt(state.position + 1); + + if (is_WS_OR_EOL(following)) { + isPair = isExplicitPair = true; + state.position++; + skipSeparationSpace(state, true, nodeIndent); + } + } + + _line = state.line; // Save the current line. + _lineStart = state.lineStart; + _pos = state.position; + composeNode(state, nodeIndent, CONTEXT_FLOW_IN, false, true); + keyTag = state.tag; + keyNode = state.result; + skipSeparationSpace(state, true, nodeIndent); + + ch = state.input.charCodeAt(state.position); + + if ((isExplicitPair || state.line === _line) && ch === 0x3A/* : */) { + isPair = true; + ch = state.input.charCodeAt(++state.position); + skipSeparationSpace(state, true, nodeIndent); + composeNode(state, nodeIndent, CONTEXT_FLOW_IN, false, true); + valueNode = state.result; + } + + if (isMapping) { + storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, valueNode, _line, _lineStart, _pos); + } else if (isPair) { + _result.push(storeMappingPair(state, null, overridableKeys, keyTag, keyNode, valueNode, _line, _lineStart, _pos)); + } else { + _result.push(keyNode); + } + + skipSeparationSpace(state, true, nodeIndent); + + ch = state.input.charCodeAt(state.position); + + if (ch === 0x2C/* , */) { + readNext = true; + ch = state.input.charCodeAt(++state.position); + } else { + readNext = false; + } + } + + throwError(state, 'unexpected end of the stream within a flow collection'); +} + +function readBlockScalar(state, nodeIndent) { + var captureStart, + folding, + chomping = CHOMPING_CLIP, + didReadContent = false, + detectedIndent = false, + textIndent = nodeIndent, + emptyLines = 0, + atMoreIndented = false, + tmp, + ch; + + ch = state.input.charCodeAt(state.position); + + if (ch === 0x7C/* | */) { + folding = false; + } else if (ch === 0x3E/* > */) { + folding = true; + } else { + return false; + } + + state.kind = 'scalar'; + state.result = ''; + + while (ch !== 0) { + ch = state.input.charCodeAt(++state.position); + + if (ch === 0x2B/* + */ || ch === 0x2D/* - */) { + if (CHOMPING_CLIP === chomping) { + chomping = (ch === 0x2B/* + */) ? CHOMPING_KEEP : CHOMPING_STRIP; + } else { + throwError(state, 'repeat of a chomping mode identifier'); + } + + } else if ((tmp = fromDecimalCode(ch)) >= 0) { + if (tmp === 0) { + throwError(state, 'bad explicit indentation width of a block scalar; it cannot be less than one'); + } else if (!detectedIndent) { + textIndent = nodeIndent + tmp - 1; + detectedIndent = true; + } else { + throwError(state, 'repeat of an indentation width identifier'); + } + + } else { + break; + } + } + + if (is_WHITE_SPACE(ch)) { + do { ch = state.input.charCodeAt(++state.position); } + while (is_WHITE_SPACE(ch)); + + if (ch === 0x23/* # */) { + do { ch = state.input.charCodeAt(++state.position); } + while (!is_EOL(ch) && (ch !== 0)); + } + } + + while (ch !== 0) { + readLineBreak(state); + state.lineIndent = 0; + + ch = state.input.charCodeAt(state.position); + + while ((!detectedIndent || state.lineIndent < textIndent) && + (ch === 0x20/* Space */)) { + state.lineIndent++; + ch = state.input.charCodeAt(++state.position); + } + + if (!detectedIndent && state.lineIndent > textIndent) { + textIndent = state.lineIndent; + } + + if (is_EOL(ch)) { + emptyLines++; + continue; + } + + // End of the scalar. + if (state.lineIndent < textIndent) { + + // Perform the chomping. + if (chomping === CHOMPING_KEEP) { + state.result += common.repeat('\n', didReadContent ? 1 + emptyLines : emptyLines); + } else if (chomping === CHOMPING_CLIP) { + if (didReadContent) { // i.e. only if the scalar is not empty. + state.result += '\n'; + } + } + + // Break this `while` cycle and go to the funciton's epilogue. + break; + } + + // Folded style: use fancy rules to handle line breaks. + if (folding) { + + // Lines starting with white space characters (more-indented lines) are not folded. + if (is_WHITE_SPACE(ch)) { + atMoreIndented = true; + // except for the first content line (cf. Example 8.1) + state.result += common.repeat('\n', didReadContent ? 1 + emptyLines : emptyLines); + + // End of more-indented block. + } else if (atMoreIndented) { + atMoreIndented = false; + state.result += common.repeat('\n', emptyLines + 1); + + // Just one line break - perceive as the same line. + } else if (emptyLines === 0) { + if (didReadContent) { // i.e. only if we have already read some scalar content. + state.result += ' '; + } + + // Several line breaks - perceive as different lines. + } else { + state.result += common.repeat('\n', emptyLines); + } + + // Literal style: just add exact number of line breaks between content lines. + } else { + // Keep all line breaks except the header line break. + state.result += common.repeat('\n', didReadContent ? 1 + emptyLines : emptyLines); + } + + didReadContent = true; + detectedIndent = true; + emptyLines = 0; + captureStart = state.position; + + while (!is_EOL(ch) && (ch !== 0)) { + ch = state.input.charCodeAt(++state.position); + } + + captureSegment(state, captureStart, state.position, false); + } + + return true; +} + +function readBlockSequence(state, nodeIndent) { + var _line, + _tag = state.tag, + _anchor = state.anchor, + _result = [], + following, + detected = false, + ch; + + // there is a leading tab before this token, so it can't be a block sequence/mapping; + // it can still be flow sequence/mapping or a scalar + if (state.firstTabInLine !== -1) return false; + + if (state.anchor !== null) { + state.anchorMap[state.anchor] = _result; + } + + ch = state.input.charCodeAt(state.position); + + while (ch !== 0) { + if (state.firstTabInLine !== -1) { + state.position = state.firstTabInLine; + throwError(state, 'tab characters must not be used in indentation'); + } + + if (ch !== 0x2D/* - */) { + break; + } + + following = state.input.charCodeAt(state.position + 1); + + if (!is_WS_OR_EOL(following)) { + break; + } + + detected = true; + state.position++; + + if (skipSeparationSpace(state, true, -1)) { + if (state.lineIndent <= nodeIndent) { + _result.push(null); + ch = state.input.charCodeAt(state.position); + continue; + } + } + + _line = state.line; + composeNode(state, nodeIndent, CONTEXT_BLOCK_IN, false, true); + _result.push(state.result); + skipSeparationSpace(state, true, -1); + + ch = state.input.charCodeAt(state.position); + + if ((state.line === _line || state.lineIndent > nodeIndent) && (ch !== 0)) { + throwError(state, 'bad indentation of a sequence entry'); + } else if (state.lineIndent < nodeIndent) { + break; + } + } + + if (detected) { + state.tag = _tag; + state.anchor = _anchor; + state.kind = 'sequence'; + state.result = _result; + return true; + } + return false; +} + +function readBlockMapping(state, nodeIndent, flowIndent) { + var following, + allowCompact, + _line, + _keyLine, + _keyLineStart, + _keyPos, + _tag = state.tag, + _anchor = state.anchor, + _result = {}, + overridableKeys = Object.create(null), + keyTag = null, + keyNode = null, + valueNode = null, + atExplicitKey = false, + detected = false, + ch; + + // there is a leading tab before this token, so it can't be a block sequence/mapping; + // it can still be flow sequence/mapping or a scalar + if (state.firstTabInLine !== -1) return false; + + if (state.anchor !== null) { + state.anchorMap[state.anchor] = _result; + } + + ch = state.input.charCodeAt(state.position); + + while (ch !== 0) { + if (!atExplicitKey && state.firstTabInLine !== -1) { + state.position = state.firstTabInLine; + throwError(state, 'tab characters must not be used in indentation'); + } + + following = state.input.charCodeAt(state.position + 1); + _line = state.line; // Save the current line. + + // + // Explicit notation case. There are two separate blocks: + // first for the key (denoted by "?") and second for the value (denoted by ":") + // + if ((ch === 0x3F/* ? */ || ch === 0x3A/* : */) && is_WS_OR_EOL(following)) { + + if (ch === 0x3F/* ? */) { + if (atExplicitKey) { + storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, null, _keyLine, _keyLineStart, _keyPos); + keyTag = keyNode = valueNode = null; + } + + detected = true; + atExplicitKey = true; + allowCompact = true; + + } else if (atExplicitKey) { + // i.e. 0x3A/* : */ === character after the explicit key. + atExplicitKey = false; + allowCompact = true; + + } else { + throwError(state, 'incomplete explicit mapping pair; a key node is missed; or followed by a non-tabulated empty line'); + } + + state.position += 1; + ch = following; + + // + // Implicit notation case. Flow-style node as the key first, then ":", and the value. + // + } else { + _keyLine = state.line; + _keyLineStart = state.lineStart; + _keyPos = state.position; + + if (!composeNode(state, flowIndent, CONTEXT_FLOW_OUT, false, true)) { + // Neither implicit nor explicit notation. + // Reading is done. Go to the epilogue. + break; + } + + if (state.line === _line) { + ch = state.input.charCodeAt(state.position); + + while (is_WHITE_SPACE(ch)) { + ch = state.input.charCodeAt(++state.position); + } + + if (ch === 0x3A/* : */) { + ch = state.input.charCodeAt(++state.position); + + if (!is_WS_OR_EOL(ch)) { + throwError(state, 'a whitespace character is expected after the key-value separator within a block mapping'); + } + + if (atExplicitKey) { + storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, null, _keyLine, _keyLineStart, _keyPos); + keyTag = keyNode = valueNode = null; + } + + detected = true; + atExplicitKey = false; + allowCompact = false; + keyTag = state.tag; + keyNode = state.result; + + } else if (detected) { + throwError(state, 'can not read an implicit mapping pair; a colon is missed'); + + } else { + state.tag = _tag; + state.anchor = _anchor; + return true; // Keep the result of `composeNode`. + } + + } else if (detected) { + throwError(state, 'can not read a block mapping entry; a multiline key may not be an implicit key'); + + } else { + state.tag = _tag; + state.anchor = _anchor; + return true; // Keep the result of `composeNode`. + } + } + + // + // Common reading code for both explicit and implicit notations. + // + if (state.line === _line || state.lineIndent > nodeIndent) { + if (atExplicitKey) { + _keyLine = state.line; + _keyLineStart = state.lineStart; + _keyPos = state.position; + } + + if (composeNode(state, nodeIndent, CONTEXT_BLOCK_OUT, true, allowCompact)) { + if (atExplicitKey) { + keyNode = state.result; + } else { + valueNode = state.result; + } + } + + if (!atExplicitKey) { + storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, valueNode, _keyLine, _keyLineStart, _keyPos); + keyTag = keyNode = valueNode = null; + } + + skipSeparationSpace(state, true, -1); + ch = state.input.charCodeAt(state.position); + } + + if ((state.line === _line || state.lineIndent > nodeIndent) && (ch !== 0)) { + throwError(state, 'bad indentation of a mapping entry'); + } else if (state.lineIndent < nodeIndent) { + break; + } + } + + // + // Epilogue. + // + + // Special case: last mapping's node contains only the key in explicit notation. + if (atExplicitKey) { + storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, null, _keyLine, _keyLineStart, _keyPos); + } + + // Expose the resulting mapping. + if (detected) { + state.tag = _tag; + state.anchor = _anchor; + state.kind = 'mapping'; + state.result = _result; + } + + return detected; +} + +function readTagProperty(state) { + var _position, + isVerbatim = false, + isNamed = false, + tagHandle, + tagName, + ch; + + ch = state.input.charCodeAt(state.position); + + if (ch !== 0x21/* ! */) return false; + + if (state.tag !== null) { + throwError(state, 'duplication of a tag property'); + } + + ch = state.input.charCodeAt(++state.position); + + if (ch === 0x3C/* < */) { + isVerbatim = true; + ch = state.input.charCodeAt(++state.position); + + } else if (ch === 0x21/* ! */) { + isNamed = true; + tagHandle = '!!'; + ch = state.input.charCodeAt(++state.position); + + } else { + tagHandle = '!'; + } + + _position = state.position; + + if (isVerbatim) { + do { ch = state.input.charCodeAt(++state.position); } + while (ch !== 0 && ch !== 0x3E/* > */); + + if (state.position < state.length) { + tagName = state.input.slice(_position, state.position); + ch = state.input.charCodeAt(++state.position); + } else { + throwError(state, 'unexpected end of the stream within a verbatim tag'); + } + } else { + while (ch !== 0 && !is_WS_OR_EOL(ch)) { + + if (ch === 0x21/* ! */) { + if (!isNamed) { + tagHandle = state.input.slice(_position - 1, state.position + 1); + + if (!PATTERN_TAG_HANDLE.test(tagHandle)) { + throwError(state, 'named tag handle cannot contain such characters'); + } + + isNamed = true; + _position = state.position + 1; + } else { + throwError(state, 'tag suffix cannot contain exclamation marks'); + } + } + + ch = state.input.charCodeAt(++state.position); + } + + tagName = state.input.slice(_position, state.position); + + if (PATTERN_FLOW_INDICATORS.test(tagName)) { + throwError(state, 'tag suffix cannot contain flow indicator characters'); + } + } + + if (tagName && !PATTERN_TAG_URI.test(tagName)) { + throwError(state, 'tag name cannot contain such characters: ' + tagName); + } + + try { + tagName = decodeURIComponent(tagName); + } catch (err) { + throwError(state, 'tag name is malformed: ' + tagName); + } + + if (isVerbatim) { + state.tag = tagName; + + } else if (_hasOwnProperty$1.call(state.tagMap, tagHandle)) { + state.tag = state.tagMap[tagHandle] + tagName; + + } else if (tagHandle === '!') { + state.tag = '!' + tagName; + + } else if (tagHandle === '!!') { + state.tag = 'tag:yaml.org,2002:' + tagName; + + } else { + throwError(state, 'undeclared tag handle "' + tagHandle + '"'); + } + + return true; +} + +function readAnchorProperty(state) { + var _position, + ch; + + ch = state.input.charCodeAt(state.position); + + if (ch !== 0x26/* & */) return false; + + if (state.anchor !== null) { + throwError(state, 'duplication of an anchor property'); + } + + ch = state.input.charCodeAt(++state.position); + _position = state.position; + + while (ch !== 0 && !is_WS_OR_EOL(ch) && !is_FLOW_INDICATOR(ch)) { + ch = state.input.charCodeAt(++state.position); + } + + if (state.position === _position) { + throwError(state, 'name of an anchor node must contain at least one character'); + } + + state.anchor = state.input.slice(_position, state.position); + return true; +} + +function readAlias(state) { + var _position, alias, + ch; + + ch = state.input.charCodeAt(state.position); + + if (ch !== 0x2A/* * */) return false; + + ch = state.input.charCodeAt(++state.position); + _position = state.position; + + while (ch !== 0 && !is_WS_OR_EOL(ch) && !is_FLOW_INDICATOR(ch)) { + ch = state.input.charCodeAt(++state.position); + } + + if (state.position === _position) { + throwError(state, 'name of an alias node must contain at least one character'); + } + + alias = state.input.slice(_position, state.position); + + if (!_hasOwnProperty$1.call(state.anchorMap, alias)) { + throwError(state, 'unidentified alias "' + alias + '"'); + } + + state.result = state.anchorMap[alias]; + skipSeparationSpace(state, true, -1); + return true; +} + +function composeNode(state, parentIndent, nodeContext, allowToSeek, allowCompact) { + var allowBlockStyles, + allowBlockScalars, + allowBlockCollections, + indentStatus = 1, // 1: this>parent, 0: this=parent, -1: this parentIndent) { + indentStatus = 1; + } else if (state.lineIndent === parentIndent) { + indentStatus = 0; + } else if (state.lineIndent < parentIndent) { + indentStatus = -1; + } + } + } + + if (indentStatus === 1) { + while (readTagProperty(state) || readAnchorProperty(state)) { + if (skipSeparationSpace(state, true, -1)) { + atNewLine = true; + allowBlockCollections = allowBlockStyles; + + if (state.lineIndent > parentIndent) { + indentStatus = 1; + } else if (state.lineIndent === parentIndent) { + indentStatus = 0; + } else if (state.lineIndent < parentIndent) { + indentStatus = -1; + } + } else { + allowBlockCollections = false; + } + } + } + + if (allowBlockCollections) { + allowBlockCollections = atNewLine || allowCompact; + } + + if (indentStatus === 1 || CONTEXT_BLOCK_OUT === nodeContext) { + if (CONTEXT_FLOW_IN === nodeContext || CONTEXT_FLOW_OUT === nodeContext) { + flowIndent = parentIndent; + } else { + flowIndent = parentIndent + 1; + } + + blockIndent = state.position - state.lineStart; + + if (indentStatus === 1) { + if (allowBlockCollections && + (readBlockSequence(state, blockIndent) || + readBlockMapping(state, blockIndent, flowIndent)) || + readFlowCollection(state, flowIndent)) { + hasContent = true; + } else { + if ((allowBlockScalars && readBlockScalar(state, flowIndent)) || + readSingleQuotedScalar(state, flowIndent) || + readDoubleQuotedScalar(state, flowIndent)) { + hasContent = true; + + } else if (readAlias(state)) { + hasContent = true; + + if (state.tag !== null || state.anchor !== null) { + throwError(state, 'alias node should not have any properties'); + } + + } else if (readPlainScalar(state, flowIndent, CONTEXT_FLOW_IN === nodeContext)) { + hasContent = true; + + if (state.tag === null) { + state.tag = '?'; + } + } + + if (state.anchor !== null) { + state.anchorMap[state.anchor] = state.result; + } + } + } else if (indentStatus === 0) { + // Special case: block sequences are allowed to have same indentation level as the parent. + // http://www.yaml.org/spec/1.2/spec.html#id2799784 + hasContent = allowBlockCollections && readBlockSequence(state, blockIndent); + } + } + + if (state.tag === null) { + if (state.anchor !== null) { + state.anchorMap[state.anchor] = state.result; + } + + } else if (state.tag === '?') { + // Implicit resolving is not allowed for non-scalar types, and '?' + // non-specific tag is only automatically assigned to plain scalars. + // + // We only need to check kind conformity in case user explicitly assigns '?' + // tag, for example like this: "! [0]" + // + if (state.result !== null && state.kind !== 'scalar') { + throwError(state, 'unacceptable node kind for ! tag; it should be "scalar", not "' + state.kind + '"'); + } + + for (typeIndex = 0, typeQuantity = state.implicitTypes.length; typeIndex < typeQuantity; typeIndex += 1) { + type = state.implicitTypes[typeIndex]; + + if (type.resolve(state.result)) { // `state.result` updated in resolver if matched + state.result = type.construct(state.result); + state.tag = type.tag; + if (state.anchor !== null) { + state.anchorMap[state.anchor] = state.result; + } + break; + } + } + } else if (state.tag !== '!') { + if (_hasOwnProperty$1.call(state.typeMap[state.kind || 'fallback'], state.tag)) { + type = state.typeMap[state.kind || 'fallback'][state.tag]; + } else { + // looking for multi type + type = null; + typeList = state.typeMap.multi[state.kind || 'fallback']; + + for (typeIndex = 0, typeQuantity = typeList.length; typeIndex < typeQuantity; typeIndex += 1) { + if (state.tag.slice(0, typeList[typeIndex].tag.length) === typeList[typeIndex].tag) { + type = typeList[typeIndex]; + break; + } + } + } + + if (!type) { + throwError(state, 'unknown tag !<' + state.tag + '>'); + } + + if (state.result !== null && type.kind !== state.kind) { + throwError(state, 'unacceptable node kind for !<' + state.tag + '> tag; it should be "' + type.kind + '", not "' + state.kind + '"'); + } + + if (!type.resolve(state.result, state.tag)) { // `state.result` updated in resolver if matched + throwError(state, 'cannot resolve a node with !<' + state.tag + '> explicit tag'); + } else { + state.result = type.construct(state.result, state.tag); + if (state.anchor !== null) { + state.anchorMap[state.anchor] = state.result; + } + } + } + + if (state.listener !== null) { + state.listener('close', state); + } + return state.tag !== null || state.anchor !== null || hasContent; +} + +function readDocument(state) { + var documentStart = state.position, + _position, + directiveName, + directiveArgs, + hasDirectives = false, + ch; + + state.version = null; + state.checkLineBreaks = state.legacy; + state.tagMap = Object.create(null); + state.anchorMap = Object.create(null); + + while ((ch = state.input.charCodeAt(state.position)) !== 0) { + skipSeparationSpace(state, true, -1); + + ch = state.input.charCodeAt(state.position); + + if (state.lineIndent > 0 || ch !== 0x25/* % */) { + break; + } + + hasDirectives = true; + ch = state.input.charCodeAt(++state.position); + _position = state.position; + + while (ch !== 0 && !is_WS_OR_EOL(ch)) { + ch = state.input.charCodeAt(++state.position); + } + + directiveName = state.input.slice(_position, state.position); + directiveArgs = []; + + if (directiveName.length < 1) { + throwError(state, 'directive name must not be less than one character in length'); + } + + while (ch !== 0) { + while (is_WHITE_SPACE(ch)) { + ch = state.input.charCodeAt(++state.position); + } + + if (ch === 0x23/* # */) { + do { ch = state.input.charCodeAt(++state.position); } + while (ch !== 0 && !is_EOL(ch)); + break; + } + + if (is_EOL(ch)) break; + + _position = state.position; + + while (ch !== 0 && !is_WS_OR_EOL(ch)) { + ch = state.input.charCodeAt(++state.position); + } + + directiveArgs.push(state.input.slice(_position, state.position)); + } + + if (ch !== 0) readLineBreak(state); + + if (_hasOwnProperty$1.call(directiveHandlers, directiveName)) { + directiveHandlers[directiveName](state, directiveName, directiveArgs); + } else { + throwWarning(state, 'unknown document directive "' + directiveName + '"'); + } + } + + skipSeparationSpace(state, true, -1); + + if (state.lineIndent === 0 && + state.input.charCodeAt(state.position) === 0x2D/* - */ && + state.input.charCodeAt(state.position + 1) === 0x2D/* - */ && + state.input.charCodeAt(state.position + 2) === 0x2D/* - */) { + state.position += 3; + skipSeparationSpace(state, true, -1); + + } else if (hasDirectives) { + throwError(state, 'directives end mark is expected'); + } + + composeNode(state, state.lineIndent - 1, CONTEXT_BLOCK_OUT, false, true); + skipSeparationSpace(state, true, -1); + + if (state.checkLineBreaks && + PATTERN_NON_ASCII_LINE_BREAKS.test(state.input.slice(documentStart, state.position))) { + throwWarning(state, 'non-ASCII line breaks are interpreted as content'); + } + + state.documents.push(state.result); + + if (state.position === state.lineStart && testDocumentSeparator(state)) { + + if (state.input.charCodeAt(state.position) === 0x2E/* . */) { + state.position += 3; + skipSeparationSpace(state, true, -1); + } + return; + } + + if (state.position < (state.length - 1)) { + throwError(state, 'end of the stream or a document separator is expected'); + } else { + return; + } +} + + +function loadDocuments(input, options) { + input = String(input); + options = options || {}; + + if (input.length !== 0) { + + // Add tailing `\n` if not exists + if (input.charCodeAt(input.length - 1) !== 0x0A/* LF */ && + input.charCodeAt(input.length - 1) !== 0x0D/* CR */) { + input += '\n'; + } + + // Strip BOM + if (input.charCodeAt(0) === 0xFEFF) { + input = input.slice(1); + } + } + + var state = new State$1(input, options); + + var nullpos = input.indexOf('\0'); + + if (nullpos !== -1) { + state.position = nullpos; + throwError(state, 'null byte is not allowed in input'); + } + + // Use 0 as string terminator. That significantly simplifies bounds check. + state.input += '\0'; + + while (state.input.charCodeAt(state.position) === 0x20/* Space */) { + state.lineIndent += 1; + state.position += 1; + } + + while (state.position < (state.length - 1)) { + readDocument(state); + } + + return state.documents; +} + + +function loadAll$1(input, iterator, options) { + if (iterator !== null && typeof iterator === 'object' && typeof options === 'undefined') { + options = iterator; + iterator = null; + } + + var documents = loadDocuments(input, options); + + if (typeof iterator !== 'function') { + return documents; + } + + for (var index = 0, length = documents.length; index < length; index += 1) { + iterator(documents[index]); + } +} + + +function load$1(input, options) { + var documents = loadDocuments(input, options); + + if (documents.length === 0) { + /*eslint-disable no-undefined*/ + return undefined; + } else if (documents.length === 1) { + return documents[0]; + } + throw new exception('expected a single document in the stream, but found more'); +} + + +var loadAll_1 = loadAll$1; +var load_1 = load$1; + +var loader = { + loadAll: loadAll_1, + load: load_1 +}; + +/*eslint-disable no-use-before-define*/ + + + + + +var _toString = Object.prototype.toString; +var _hasOwnProperty = Object.prototype.hasOwnProperty; + +var CHAR_BOM = 0xFEFF; +var CHAR_TAB = 0x09; /* Tab */ +var CHAR_LINE_FEED = 0x0A; /* LF */ +var CHAR_CARRIAGE_RETURN = 0x0D; /* CR */ +var CHAR_SPACE = 0x20; /* Space */ +var CHAR_EXCLAMATION = 0x21; /* ! */ +var CHAR_DOUBLE_QUOTE = 0x22; /* " */ +var CHAR_SHARP = 0x23; /* # */ +var CHAR_PERCENT = 0x25; /* % */ +var CHAR_AMPERSAND = 0x26; /* & */ +var CHAR_SINGLE_QUOTE = 0x27; /* ' */ +var CHAR_ASTERISK = 0x2A; /* * */ +var CHAR_COMMA = 0x2C; /* , */ +var CHAR_MINUS = 0x2D; /* - */ +var CHAR_COLON = 0x3A; /* : */ +var CHAR_EQUALS = 0x3D; /* = */ +var CHAR_GREATER_THAN = 0x3E; /* > */ +var CHAR_QUESTION = 0x3F; /* ? */ +var CHAR_COMMERCIAL_AT = 0x40; /* @ */ +var CHAR_LEFT_SQUARE_BRACKET = 0x5B; /* [ */ +var CHAR_RIGHT_SQUARE_BRACKET = 0x5D; /* ] */ +var CHAR_GRAVE_ACCENT = 0x60; /* ` */ +var CHAR_LEFT_CURLY_BRACKET = 0x7B; /* { */ +var CHAR_VERTICAL_LINE = 0x7C; /* | */ +var CHAR_RIGHT_CURLY_BRACKET = 0x7D; /* } */ + +var ESCAPE_SEQUENCES = {}; + +ESCAPE_SEQUENCES[0x00] = '\\0'; +ESCAPE_SEQUENCES[0x07] = '\\a'; +ESCAPE_SEQUENCES[0x08] = '\\b'; +ESCAPE_SEQUENCES[0x09] = '\\t'; +ESCAPE_SEQUENCES[0x0A] = '\\n'; +ESCAPE_SEQUENCES[0x0B] = '\\v'; +ESCAPE_SEQUENCES[0x0C] = '\\f'; +ESCAPE_SEQUENCES[0x0D] = '\\r'; +ESCAPE_SEQUENCES[0x1B] = '\\e'; +ESCAPE_SEQUENCES[0x22] = '\\"'; +ESCAPE_SEQUENCES[0x5C] = '\\\\'; +ESCAPE_SEQUENCES[0x85] = '\\N'; +ESCAPE_SEQUENCES[0xA0] = '\\_'; +ESCAPE_SEQUENCES[0x2028] = '\\L'; +ESCAPE_SEQUENCES[0x2029] = '\\P'; + +var DEPRECATED_BOOLEANS_SYNTAX = [ + 'y', 'Y', 'yes', 'Yes', 'YES', 'on', 'On', 'ON', + 'n', 'N', 'no', 'No', 'NO', 'off', 'Off', 'OFF' +]; + +var DEPRECATED_BASE60_SYNTAX = /^[-+]?[0-9_]+(?::[0-9_]+)+(?:\.[0-9_]*)?$/; + +function compileStyleMap(schema, map) { + var result, keys, index, length, tag, style, type; + + if (map === null) return {}; + + result = {}; + keys = Object.keys(map); + + for (index = 0, length = keys.length; index < length; index += 1) { + tag = keys[index]; + style = String(map[tag]); + + if (tag.slice(0, 2) === '!!') { + tag = 'tag:yaml.org,2002:' + tag.slice(2); + } + type = schema.compiledTypeMap['fallback'][tag]; + + if (type && _hasOwnProperty.call(type.styleAliases, style)) { + style = type.styleAliases[style]; + } + + result[tag] = style; + } + + return result; +} + +function encodeHex(character) { + var string, handle, length; + + string = character.toString(16).toUpperCase(); + + if (character <= 0xFF) { + handle = 'x'; + length = 2; + } else if (character <= 0xFFFF) { + handle = 'u'; + length = 4; + } else if (character <= 0xFFFFFFFF) { + handle = 'U'; + length = 8; + } else { + throw new exception('code point within a string may not be greater than 0xFFFFFFFF'); + } + + return '\\' + handle + common.repeat('0', length - string.length) + string; +} + + +var QUOTING_TYPE_SINGLE = 1, + QUOTING_TYPE_DOUBLE = 2; + +function State(options) { + this.schema = options['schema'] || _default; + this.indent = Math.max(1, (options['indent'] || 2)); + this.noArrayIndent = options['noArrayIndent'] || false; + this.skipInvalid = options['skipInvalid'] || false; + this.flowLevel = (common.isNothing(options['flowLevel']) ? -1 : options['flowLevel']); + this.styleMap = compileStyleMap(this.schema, options['styles'] || null); + this.sortKeys = options['sortKeys'] || false; + this.lineWidth = options['lineWidth'] || 80; + this.noRefs = options['noRefs'] || false; + this.noCompatMode = options['noCompatMode'] || false; + this.condenseFlow = options['condenseFlow'] || false; + this.quotingType = options['quotingType'] === '"' ? QUOTING_TYPE_DOUBLE : QUOTING_TYPE_SINGLE; + this.forceQuotes = options['forceQuotes'] || false; + this.replacer = typeof options['replacer'] === 'function' ? options['replacer'] : null; + + this.implicitTypes = this.schema.compiledImplicit; + this.explicitTypes = this.schema.compiledExplicit; + + this.tag = null; + this.result = ''; + + this.duplicates = []; + this.usedDuplicates = null; +} + +// Indents every line in a string. Empty lines (\n only) are not indented. +function indentString(string, spaces) { + var ind = common.repeat(' ', spaces), + position = 0, + next = -1, + result = '', + line, + length = string.length; + + while (position < length) { + next = string.indexOf('\n', position); + if (next === -1) { + line = string.slice(position); + position = length; + } else { + line = string.slice(position, next + 1); + position = next + 1; + } + + if (line.length && line !== '\n') result += ind; + + result += line; + } + + return result; +} + +function generateNextLine(state, level) { + return '\n' + common.repeat(' ', state.indent * level); +} + +function testImplicitResolving(state, str) { + var index, length, type; + + for (index = 0, length = state.implicitTypes.length; index < length; index += 1) { + type = state.implicitTypes[index]; + + if (type.resolve(str)) { + return true; + } + } + + return false; +} + +// [33] s-white ::= s-space | s-tab +function isWhitespace(c) { + return c === CHAR_SPACE || c === CHAR_TAB; +} + +// Returns true if the character can be printed without escaping. +// From YAML 1.2: "any allowed characters known to be non-printable +// should also be escaped. [However,] This isn’t mandatory" +// Derived from nb-char - \t - #x85 - #xA0 - #x2028 - #x2029. +function isPrintable(c) { + return (0x00020 <= c && c <= 0x00007E) + || ((0x000A1 <= c && c <= 0x00D7FF) && c !== 0x2028 && c !== 0x2029) + || ((0x0E000 <= c && c <= 0x00FFFD) && c !== CHAR_BOM) + || (0x10000 <= c && c <= 0x10FFFF); +} + +// [34] ns-char ::= nb-char - s-white +// [27] nb-char ::= c-printable - b-char - c-byte-order-mark +// [26] b-char ::= b-line-feed | b-carriage-return +// Including s-white (for some reason, examples doesn't match specs in this aspect) +// ns-char ::= c-printable - b-line-feed - b-carriage-return - c-byte-order-mark +function isNsCharOrWhitespace(c) { + return isPrintable(c) + && c !== CHAR_BOM + // - b-char + && c !== CHAR_CARRIAGE_RETURN + && c !== CHAR_LINE_FEED; +} + +// [127] ns-plain-safe(c) ::= c = flow-out ⇒ ns-plain-safe-out +// c = flow-in ⇒ ns-plain-safe-in +// c = block-key ⇒ ns-plain-safe-out +// c = flow-key ⇒ ns-plain-safe-in +// [128] ns-plain-safe-out ::= ns-char +// [129] ns-plain-safe-in ::= ns-char - c-flow-indicator +// [130] ns-plain-char(c) ::= ( ns-plain-safe(c) - “:” - “#” ) +// | ( /* An ns-char preceding */ “#” ) +// | ( “:” /* Followed by an ns-plain-safe(c) */ ) +function isPlainSafe(c, prev, inblock) { + var cIsNsCharOrWhitespace = isNsCharOrWhitespace(c); + var cIsNsChar = cIsNsCharOrWhitespace && !isWhitespace(c); + return ( + // ns-plain-safe + inblock ? // c = flow-in + cIsNsCharOrWhitespace + : cIsNsCharOrWhitespace + // - c-flow-indicator + && c !== CHAR_COMMA + && c !== CHAR_LEFT_SQUARE_BRACKET + && c !== CHAR_RIGHT_SQUARE_BRACKET + && c !== CHAR_LEFT_CURLY_BRACKET + && c !== CHAR_RIGHT_CURLY_BRACKET + ) + // ns-plain-char + && c !== CHAR_SHARP // false on '#' + && !(prev === CHAR_COLON && !cIsNsChar) // false on ': ' + || (isNsCharOrWhitespace(prev) && !isWhitespace(prev) && c === CHAR_SHARP) // change to true on '[^ ]#' + || (prev === CHAR_COLON && cIsNsChar); // change to true on ':[^ ]' +} + +// Simplified test for values allowed as the first character in plain style. +function isPlainSafeFirst(c) { + // Uses a subset of ns-char - c-indicator + // where ns-char = nb-char - s-white. + // No support of ( ( “?” | “:” | “-” ) /* Followed by an ns-plain-safe(c)) */ ) part + return isPrintable(c) && c !== CHAR_BOM + && !isWhitespace(c) // - s-white + // - (c-indicator ::= + // “-” | “?” | “:” | “,” | “[” | “]” | “{” | “}” + && c !== CHAR_MINUS + && c !== CHAR_QUESTION + && c !== CHAR_COLON + && c !== CHAR_COMMA + && c !== CHAR_LEFT_SQUARE_BRACKET + && c !== CHAR_RIGHT_SQUARE_BRACKET + && c !== CHAR_LEFT_CURLY_BRACKET + && c !== CHAR_RIGHT_CURLY_BRACKET + // | “#” | “&” | “*” | “!” | “|” | “=” | “>” | “'” | “"” + && c !== CHAR_SHARP + && c !== CHAR_AMPERSAND + && c !== CHAR_ASTERISK + && c !== CHAR_EXCLAMATION + && c !== CHAR_VERTICAL_LINE + && c !== CHAR_EQUALS + && c !== CHAR_GREATER_THAN + && c !== CHAR_SINGLE_QUOTE + && c !== CHAR_DOUBLE_QUOTE + // | “%” | “@” | “`”) + && c !== CHAR_PERCENT + && c !== CHAR_COMMERCIAL_AT + && c !== CHAR_GRAVE_ACCENT; +} + +// Simplified test for values allowed as the last character in plain style. +function isPlainSafeLast(c) { + // just not whitespace or colon, it will be checked to be plain character later + return !isWhitespace(c) && c !== CHAR_COLON; +} + +// Same as 'string'.codePointAt(pos), but works in older browsers. +function codePointAt(string, pos) { + var first = string.charCodeAt(pos), second; + if (first >= 0xD800 && first <= 0xDBFF && pos + 1 < string.length) { + second = string.charCodeAt(pos + 1); + if (second >= 0xDC00 && second <= 0xDFFF) { + // https://mathiasbynens.be/notes/javascript-encoding#surrogate-formulae + return (first - 0xD800) * 0x400 + second - 0xDC00 + 0x10000; + } + } + return first; +} + +// Determines whether block indentation indicator is required. +function needIndentIndicator(string) { + var leadingSpaceRe = /^\n* /; + return leadingSpaceRe.test(string); +} + +var STYLE_PLAIN = 1, + STYLE_SINGLE = 2, + STYLE_LITERAL = 3, + STYLE_FOLDED = 4, + STYLE_DOUBLE = 5; + +// Determines which scalar styles are possible and returns the preferred style. +// lineWidth = -1 => no limit. +// Pre-conditions: str.length > 0. +// Post-conditions: +// STYLE_PLAIN or STYLE_SINGLE => no \n are in the string. +// STYLE_LITERAL => no lines are suitable for folding (or lineWidth is -1). +// STYLE_FOLDED => a line > lineWidth and can be folded (and lineWidth != -1). +function chooseScalarStyle(string, singleLineOnly, indentPerLevel, lineWidth, + testAmbiguousType, quotingType, forceQuotes, inblock) { + + var i; + var char = 0; + var prevChar = null; + var hasLineBreak = false; + var hasFoldableLine = false; // only checked if shouldTrackWidth + var shouldTrackWidth = lineWidth !== -1; + var previousLineBreak = -1; // count the first line correctly + var plain = isPlainSafeFirst(codePointAt(string, 0)) + && isPlainSafeLast(codePointAt(string, string.length - 1)); + + if (singleLineOnly || forceQuotes) { + // Case: no block styles. + // Check for disallowed characters to rule out plain and single. + for (i = 0; i < string.length; char >= 0x10000 ? i += 2 : i++) { + char = codePointAt(string, i); + if (!isPrintable(char)) { + return STYLE_DOUBLE; + } + plain = plain && isPlainSafe(char, prevChar, inblock); + prevChar = char; + } + } else { + // Case: block styles permitted. + for (i = 0; i < string.length; char >= 0x10000 ? i += 2 : i++) { + char = codePointAt(string, i); + if (char === CHAR_LINE_FEED) { + hasLineBreak = true; + // Check if any line can be folded. + if (shouldTrackWidth) { + hasFoldableLine = hasFoldableLine || + // Foldable line = too long, and not more-indented. + (i - previousLineBreak - 1 > lineWidth && + string[previousLineBreak + 1] !== ' '); + previousLineBreak = i; + } + } else if (!isPrintable(char)) { + return STYLE_DOUBLE; + } + plain = plain && isPlainSafe(char, prevChar, inblock); + prevChar = char; + } + // in case the end is missing a \n + hasFoldableLine = hasFoldableLine || (shouldTrackWidth && + (i - previousLineBreak - 1 > lineWidth && + string[previousLineBreak + 1] !== ' ')); + } + // Although every style can represent \n without escaping, prefer block styles + // for multiline, since they're more readable and they don't add empty lines. + // Also prefer folding a super-long line. + if (!hasLineBreak && !hasFoldableLine) { + // Strings interpretable as another type have to be quoted; + // e.g. the string 'true' vs. the boolean true. + if (plain && !forceQuotes && !testAmbiguousType(string)) { + return STYLE_PLAIN; + } + return quotingType === QUOTING_TYPE_DOUBLE ? STYLE_DOUBLE : STYLE_SINGLE; + } + // Edge case: block indentation indicator can only have one digit. + if (indentPerLevel > 9 && needIndentIndicator(string)) { + return STYLE_DOUBLE; + } + // At this point we know block styles are valid. + // Prefer literal style unless we want to fold. + if (!forceQuotes) { + return hasFoldableLine ? STYLE_FOLDED : STYLE_LITERAL; + } + return quotingType === QUOTING_TYPE_DOUBLE ? STYLE_DOUBLE : STYLE_SINGLE; +} + +// Note: line breaking/folding is implemented for only the folded style. +// NB. We drop the last trailing newline (if any) of a returned block scalar +// since the dumper adds its own newline. This always works: +// • No ending newline => unaffected; already using strip "-" chomping. +// • Ending newline => removed then restored. +// Importantly, this keeps the "+" chomp indicator from gaining an extra line. +function writeScalar(state, string, level, iskey, inblock) { + state.dump = (function () { + if (string.length === 0) { + return state.quotingType === QUOTING_TYPE_DOUBLE ? '""' : "''"; + } + if (!state.noCompatMode) { + if (DEPRECATED_BOOLEANS_SYNTAX.indexOf(string) !== -1 || DEPRECATED_BASE60_SYNTAX.test(string)) { + return state.quotingType === QUOTING_TYPE_DOUBLE ? ('"' + string + '"') : ("'" + string + "'"); + } + } + + var indent = state.indent * Math.max(1, level); // no 0-indent scalars + // As indentation gets deeper, let the width decrease monotonically + // to the lower bound min(state.lineWidth, 40). + // Note that this implies + // state.lineWidth ≤ 40 + state.indent: width is fixed at the lower bound. + // state.lineWidth > 40 + state.indent: width decreases until the lower bound. + // This behaves better than a constant minimum width which disallows narrower options, + // or an indent threshold which causes the width to suddenly increase. + var lineWidth = state.lineWidth === -1 + ? -1 : Math.max(Math.min(state.lineWidth, 40), state.lineWidth - indent); + + // Without knowing if keys are implicit/explicit, assume implicit for safety. + var singleLineOnly = iskey + // No block styles in flow mode. + || (state.flowLevel > -1 && level >= state.flowLevel); + function testAmbiguity(string) { + return testImplicitResolving(state, string); + } + + switch (chooseScalarStyle(string, singleLineOnly, state.indent, lineWidth, + testAmbiguity, state.quotingType, state.forceQuotes && !iskey, inblock)) { + + case STYLE_PLAIN: + return string; + case STYLE_SINGLE: + return "'" + string.replace(/'/g, "''") + "'"; + case STYLE_LITERAL: + return '|' + blockHeader(string, state.indent) + + dropEndingNewline(indentString(string, indent)); + case STYLE_FOLDED: + return '>' + blockHeader(string, state.indent) + + dropEndingNewline(indentString(foldString(string, lineWidth), indent)); + case STYLE_DOUBLE: + return '"' + escapeString(string) + '"'; + default: + throw new exception('impossible error: invalid scalar style'); + } + }()); +} + +// Pre-conditions: string is valid for a block scalar, 1 <= indentPerLevel <= 9. +function blockHeader(string, indentPerLevel) { + var indentIndicator = needIndentIndicator(string) ? String(indentPerLevel) : ''; + + // note the special case: the string '\n' counts as a "trailing" empty line. + var clip = string[string.length - 1] === '\n'; + var keep = clip && (string[string.length - 2] === '\n' || string === '\n'); + var chomp = keep ? '+' : (clip ? '' : '-'); + + return indentIndicator + chomp + '\n'; +} + +// (See the note for writeScalar.) +function dropEndingNewline(string) { + return string[string.length - 1] === '\n' ? string.slice(0, -1) : string; +} + +// Note: a long line without a suitable break point will exceed the width limit. +// Pre-conditions: every char in str isPrintable, str.length > 0, width > 0. +function foldString(string, width) { + // In folded style, $k$ consecutive newlines output as $k+1$ newlines— + // unless they're before or after a more-indented line, or at the very + // beginning or end, in which case $k$ maps to $k$. + // Therefore, parse each chunk as newline(s) followed by a content line. + var lineRe = /(\n+)([^\n]*)/g; + + // first line (possibly an empty line) + var result = (function () { + var nextLF = string.indexOf('\n'); + nextLF = nextLF !== -1 ? nextLF : string.length; + lineRe.lastIndex = nextLF; + return foldLine(string.slice(0, nextLF), width); + }()); + // If we haven't reached the first content line yet, don't add an extra \n. + var prevMoreIndented = string[0] === '\n' || string[0] === ' '; + var moreIndented; + + // rest of the lines + var match; + while ((match = lineRe.exec(string))) { + var prefix = match[1], line = match[2]; + moreIndented = (line[0] === ' '); + result += prefix + + (!prevMoreIndented && !moreIndented && line !== '' + ? '\n' : '') + + foldLine(line, width); + prevMoreIndented = moreIndented; + } + + return result; +} + +// Greedy line breaking. +// Picks the longest line under the limit each time, +// otherwise settles for the shortest line over the limit. +// NB. More-indented lines *cannot* be folded, as that would add an extra \n. +function foldLine(line, width) { + if (line === '' || line[0] === ' ') return line; + + // Since a more-indented line adds a \n, breaks can't be followed by a space. + var breakRe = / [^ ]/g; // note: the match index will always be <= length-2. + var match; + // start is an inclusive index. end, curr, and next are exclusive. + var start = 0, end, curr = 0, next = 0; + var result = ''; + + // Invariants: 0 <= start <= length-1. + // 0 <= curr <= next <= max(0, length-2). curr - start <= width. + // Inside the loop: + // A match implies length >= 2, so curr and next are <= length-2. + while ((match = breakRe.exec(line))) { + next = match.index; + // maintain invariant: curr - start <= width + if (next - start > width) { + end = (curr > start) ? curr : next; // derive end <= length-2 + result += '\n' + line.slice(start, end); + // skip the space that was output as \n + start = end + 1; // derive start <= length-1 + } + curr = next; + } + + // By the invariants, start <= length-1, so there is something left over. + // It is either the whole string or a part starting from non-whitespace. + result += '\n'; + // Insert a break if the remainder is too long and there is a break available. + if (line.length - start > width && curr > start) { + result += line.slice(start, curr) + '\n' + line.slice(curr + 1); + } else { + result += line.slice(start); + } + + return result.slice(1); // drop extra \n joiner +} + +// Escapes a double-quoted string. +function escapeString(string) { + var result = ''; + var char = 0; + var escapeSeq; + + for (var i = 0; i < string.length; char >= 0x10000 ? i += 2 : i++) { + char = codePointAt(string, i); + escapeSeq = ESCAPE_SEQUENCES[char]; + + if (!escapeSeq && isPrintable(char)) { + result += string[i]; + if (char >= 0x10000) result += string[i + 1]; + } else { + result += escapeSeq || encodeHex(char); + } + } + + return result; +} + +function writeFlowSequence(state, level, object) { + var _result = '', + _tag = state.tag, + index, + length, + value; + + for (index = 0, length = object.length; index < length; index += 1) { + value = object[index]; + + if (state.replacer) { + value = state.replacer.call(object, String(index), value); + } + + // Write only valid elements, put null instead of invalid elements. + if (writeNode(state, level, value, false, false) || + (typeof value === 'undefined' && + writeNode(state, level, null, false, false))) { + + if (_result !== '') _result += ',' + (!state.condenseFlow ? ' ' : ''); + _result += state.dump; + } + } + + state.tag = _tag; + state.dump = '[' + _result + ']'; +} + +function writeBlockSequence(state, level, object, compact) { + var _result = '', + _tag = state.tag, + index, + length, + value; + + for (index = 0, length = object.length; index < length; index += 1) { + value = object[index]; + + if (state.replacer) { + value = state.replacer.call(object, String(index), value); + } + + // Write only valid elements, put null instead of invalid elements. + if (writeNode(state, level + 1, value, true, true, false, true) || + (typeof value === 'undefined' && + writeNode(state, level + 1, null, true, true, false, true))) { + + if (!compact || _result !== '') { + _result += generateNextLine(state, level); + } + + if (state.dump && CHAR_LINE_FEED === state.dump.charCodeAt(0)) { + _result += '-'; + } else { + _result += '- '; + } + + _result += state.dump; + } + } + + state.tag = _tag; + state.dump = _result || '[]'; // Empty sequence if no valid values. +} + +function writeFlowMapping(state, level, object) { + var _result = '', + _tag = state.tag, + objectKeyList = Object.keys(object), + index, + length, + objectKey, + objectValue, + pairBuffer; + + for (index = 0, length = objectKeyList.length; index < length; index += 1) { + + pairBuffer = ''; + if (_result !== '') pairBuffer += ', '; + + if (state.condenseFlow) pairBuffer += '"'; + + objectKey = objectKeyList[index]; + objectValue = object[objectKey]; + + if (state.replacer) { + objectValue = state.replacer.call(object, objectKey, objectValue); + } + + if (!writeNode(state, level, objectKey, false, false)) { + continue; // Skip this pair because of invalid key; + } + + if (state.dump.length > 1024) pairBuffer += '? '; + + pairBuffer += state.dump + (state.condenseFlow ? '"' : '') + ':' + (state.condenseFlow ? '' : ' '); + + if (!writeNode(state, level, objectValue, false, false)) { + continue; // Skip this pair because of invalid value. + } + + pairBuffer += state.dump; + + // Both key and value are valid. + _result += pairBuffer; + } + + state.tag = _tag; + state.dump = '{' + _result + '}'; +} + +function writeBlockMapping(state, level, object, compact) { + var _result = '', + _tag = state.tag, + objectKeyList = Object.keys(object), + index, + length, + objectKey, + objectValue, + explicitPair, + pairBuffer; + + // Allow sorting keys so that the output file is deterministic + if (state.sortKeys === true) { + // Default sorting + objectKeyList.sort(); + } else if (typeof state.sortKeys === 'function') { + // Custom sort function + objectKeyList.sort(state.sortKeys); + } else if (state.sortKeys) { + // Something is wrong + throw new exception('sortKeys must be a boolean or a function'); + } + + for (index = 0, length = objectKeyList.length; index < length; index += 1) { + pairBuffer = ''; + + if (!compact || _result !== '') { + pairBuffer += generateNextLine(state, level); + } + + objectKey = objectKeyList[index]; + objectValue = object[objectKey]; + + if (state.replacer) { + objectValue = state.replacer.call(object, objectKey, objectValue); + } + + if (!writeNode(state, level + 1, objectKey, true, true, true)) { + continue; // Skip this pair because of invalid key. + } + + explicitPair = (state.tag !== null && state.tag !== '?') || + (state.dump && state.dump.length > 1024); + + if (explicitPair) { + if (state.dump && CHAR_LINE_FEED === state.dump.charCodeAt(0)) { + pairBuffer += '?'; + } else { + pairBuffer += '? '; + } + } + + pairBuffer += state.dump; + + if (explicitPair) { + pairBuffer += generateNextLine(state, level); + } + + if (!writeNode(state, level + 1, objectValue, true, explicitPair)) { + continue; // Skip this pair because of invalid value. + } + + if (state.dump && CHAR_LINE_FEED === state.dump.charCodeAt(0)) { + pairBuffer += ':'; + } else { + pairBuffer += ': '; + } + + pairBuffer += state.dump; + + // Both key and value are valid. + _result += pairBuffer; + } + + state.tag = _tag; + state.dump = _result || '{}'; // Empty mapping if no valid pairs. +} + +function detectType(state, object, explicit) { + var _result, typeList, index, length, type, style; + + typeList = explicit ? state.explicitTypes : state.implicitTypes; + + for (index = 0, length = typeList.length; index < length; index += 1) { + type = typeList[index]; + + if ((type.instanceOf || type.predicate) && + (!type.instanceOf || ((typeof object === 'object') && (object instanceof type.instanceOf))) && + (!type.predicate || type.predicate(object))) { + + if (explicit) { + if (type.multi && type.representName) { + state.tag = type.representName(object); + } else { + state.tag = type.tag; + } + } else { + state.tag = '?'; + } + + if (type.represent) { + style = state.styleMap[type.tag] || type.defaultStyle; + + if (_toString.call(type.represent) === '[object Function]') { + _result = type.represent(object, style); + } else if (_hasOwnProperty.call(type.represent, style)) { + _result = type.represent[style](object, style); + } else { + throw new exception('!<' + type.tag + '> tag resolver accepts not "' + style + '" style'); + } + + state.dump = _result; + } + + return true; + } + } + + return false; +} + +// Serializes `object` and writes it to global `result`. +// Returns true on success, or false on invalid object. +// +function writeNode(state, level, object, block, compact, iskey, isblockseq) { + state.tag = null; + state.dump = object; + + if (!detectType(state, object, false)) { + detectType(state, object, true); + } + + var type = _toString.call(state.dump); + var inblock = block; + var tagStr; + + if (block) { + block = (state.flowLevel < 0 || state.flowLevel > level); + } + + var objectOrArray = type === '[object Object]' || type === '[object Array]', + duplicateIndex, + duplicate; + + if (objectOrArray) { + duplicateIndex = state.duplicates.indexOf(object); + duplicate = duplicateIndex !== -1; + } + + if ((state.tag !== null && state.tag !== '?') || duplicate || (state.indent !== 2 && level > 0)) { + compact = false; + } + + if (duplicate && state.usedDuplicates[duplicateIndex]) { + state.dump = '*ref_' + duplicateIndex; + } else { + if (objectOrArray && duplicate && !state.usedDuplicates[duplicateIndex]) { + state.usedDuplicates[duplicateIndex] = true; + } + if (type === '[object Object]') { + if (block && (Object.keys(state.dump).length !== 0)) { + writeBlockMapping(state, level, state.dump, compact); + if (duplicate) { + state.dump = '&ref_' + duplicateIndex + state.dump; + } + } else { + writeFlowMapping(state, level, state.dump); + if (duplicate) { + state.dump = '&ref_' + duplicateIndex + ' ' + state.dump; + } + } + } else if (type === '[object Array]') { + if (block && (state.dump.length !== 0)) { + if (state.noArrayIndent && !isblockseq && level > 0) { + writeBlockSequence(state, level - 1, state.dump, compact); + } else { + writeBlockSequence(state, level, state.dump, compact); + } + if (duplicate) { + state.dump = '&ref_' + duplicateIndex + state.dump; + } + } else { + writeFlowSequence(state, level, state.dump); + if (duplicate) { + state.dump = '&ref_' + duplicateIndex + ' ' + state.dump; + } + } + } else if (type === '[object String]') { + if (state.tag !== '?') { + writeScalar(state, state.dump, level, iskey, inblock); + } + } else if (type === '[object Undefined]') { + return false; + } else { + if (state.skipInvalid) return false; + throw new exception('unacceptable kind of an object to dump ' + type); + } + + if (state.tag !== null && state.tag !== '?') { + // Need to encode all characters except those allowed by the spec: + // + // [35] ns-dec-digit ::= [#x30-#x39] /* 0-9 */ + // [36] ns-hex-digit ::= ns-dec-digit + // | [#x41-#x46] /* A-F */ | [#x61-#x66] /* a-f */ + // [37] ns-ascii-letter ::= [#x41-#x5A] /* A-Z */ | [#x61-#x7A] /* a-z */ + // [38] ns-word-char ::= ns-dec-digit | ns-ascii-letter | “-” + // [39] ns-uri-char ::= “%” ns-hex-digit ns-hex-digit | ns-word-char | “#” + // | “;” | “/” | “?” | “:” | “@” | “&” | “=” | “+” | “$” | “,” + // | “_” | “.” | “!” | “~” | “*” | “'” | “(” | “)” | “[” | “]” + // + // Also need to encode '!' because it has special meaning (end of tag prefix). + // + tagStr = encodeURI( + state.tag[0] === '!' ? state.tag.slice(1) : state.tag + ).replace(/!/g, '%21'); + + if (state.tag[0] === '!') { + tagStr = '!' + tagStr; + } else if (tagStr.slice(0, 18) === 'tag:yaml.org,2002:') { + tagStr = '!!' + tagStr.slice(18); + } else { + tagStr = '!<' + tagStr + '>'; + } + + state.dump = tagStr + ' ' + state.dump; + } + } + + return true; +} + +function getDuplicateReferences(object, state) { + var objects = [], + duplicatesIndexes = [], + index, + length; + + inspectNode(object, objects, duplicatesIndexes); + + for (index = 0, length = duplicatesIndexes.length; index < length; index += 1) { + state.duplicates.push(objects[duplicatesIndexes[index]]); + } + state.usedDuplicates = new Array(length); +} + +function inspectNode(object, objects, duplicatesIndexes) { + var objectKeyList, + index, + length; + + if (object !== null && typeof object === 'object') { + index = objects.indexOf(object); + if (index !== -1) { + if (duplicatesIndexes.indexOf(index) === -1) { + duplicatesIndexes.push(index); + } + } else { + objects.push(object); + + if (Array.isArray(object)) { + for (index = 0, length = object.length; index < length; index += 1) { + inspectNode(object[index], objects, duplicatesIndexes); + } + } else { + objectKeyList = Object.keys(object); + + for (index = 0, length = objectKeyList.length; index < length; index += 1) { + inspectNode(object[objectKeyList[index]], objects, duplicatesIndexes); + } + } + } + } +} + +function dump$1(input, options) { + options = options || {}; + + var state = new State(options); + + if (!state.noRefs) getDuplicateReferences(input, state); + + var value = input; + + if (state.replacer) { + value = state.replacer.call({ '': value }, '', value); + } + + if (writeNode(state, 0, value, true, true)) return state.dump + '\n'; + + return ''; +} + +var dump_1 = dump$1; + +var dumper = { + dump: dump_1 +}; + +function renamed(from, to) { + return function () { + throw new Error('Function yaml.' + from + ' is removed in js-yaml 4. ' + + 'Use yaml.' + to + ' instead, which is now safe by default.'); + }; +} + + +var Type = type; +var Schema = schema; +var FAILSAFE_SCHEMA = failsafe; +var JSON_SCHEMA = json; +var CORE_SCHEMA = core; +var DEFAULT_SCHEMA = _default; +var load = loader.load; +var loadAll = loader.loadAll; +var dump = dumper.dump; +var YAMLException = exception; + +// Re-export all types in case user wants to create custom schema +var types = { + binary: binary, + float: float, + map: map, + null: _null, + pairs: pairs, + set: set, + timestamp: timestamp, + bool: bool, + int: int, + merge: merge, + omap: omap, + seq: seq, + str: str +}; + +// Removed functions from JS-YAML 3.0.x +var safeLoad = renamed('safeLoad', 'load'); +var safeLoadAll = renamed('safeLoadAll', 'loadAll'); +var safeDump = renamed('safeDump', 'dump'); + +var jsYaml = { + Type: Type, + Schema: Schema, + FAILSAFE_SCHEMA: FAILSAFE_SCHEMA, + JSON_SCHEMA: JSON_SCHEMA, + CORE_SCHEMA: CORE_SCHEMA, + DEFAULT_SCHEMA: DEFAULT_SCHEMA, + load: load, + loadAll: loadAll, + dump: dump, + YAMLException: YAMLException, + types: types, + safeLoad: safeLoad, + safeLoadAll: safeLoadAll, + safeDump: safeDump +}; + +export default jsYaml; +export { CORE_SCHEMA, DEFAULT_SCHEMA, FAILSAFE_SCHEMA, JSON_SCHEMA, Schema, Type, YAMLException, dump, load, loadAll, safeDump, safeLoad, safeLoadAll, types }; diff --git a/node_modules/js-yaml/index.js b/node_modules/js-yaml/index.js new file mode 100644 index 0000000..bcb7eba --- /dev/null +++ b/node_modules/js-yaml/index.js @@ -0,0 +1,47 @@ +'use strict'; + + +var loader = require('./lib/loader'); +var dumper = require('./lib/dumper'); + + +function renamed(from, to) { + return function () { + throw new Error('Function yaml.' + from + ' is removed in js-yaml 4. ' + + 'Use yaml.' + to + ' instead, which is now safe by default.'); + }; +} + + +module.exports.Type = require('./lib/type'); +module.exports.Schema = require('./lib/schema'); +module.exports.FAILSAFE_SCHEMA = require('./lib/schema/failsafe'); +module.exports.JSON_SCHEMA = require('./lib/schema/json'); +module.exports.CORE_SCHEMA = require('./lib/schema/core'); +module.exports.DEFAULT_SCHEMA = require('./lib/schema/default'); +module.exports.load = loader.load; +module.exports.loadAll = loader.loadAll; +module.exports.dump = dumper.dump; +module.exports.YAMLException = require('./lib/exception'); + +// Re-export all types in case user wants to create custom schema +module.exports.types = { + binary: require('./lib/type/binary'), + float: require('./lib/type/float'), + map: require('./lib/type/map'), + null: require('./lib/type/null'), + pairs: require('./lib/type/pairs'), + set: require('./lib/type/set'), + timestamp: require('./lib/type/timestamp'), + bool: require('./lib/type/bool'), + int: require('./lib/type/int'), + merge: require('./lib/type/merge'), + omap: require('./lib/type/omap'), + seq: require('./lib/type/seq'), + str: require('./lib/type/str') +}; + +// Removed functions from JS-YAML 3.0.x +module.exports.safeLoad = renamed('safeLoad', 'load'); +module.exports.safeLoadAll = renamed('safeLoadAll', 'loadAll'); +module.exports.safeDump = renamed('safeDump', 'dump'); diff --git a/node_modules/js-yaml/lib/common.js b/node_modules/js-yaml/lib/common.js new file mode 100644 index 0000000..25ef7d8 --- /dev/null +++ b/node_modules/js-yaml/lib/common.js @@ -0,0 +1,59 @@ +'use strict'; + + +function isNothing(subject) { + return (typeof subject === 'undefined') || (subject === null); +} + + +function isObject(subject) { + return (typeof subject === 'object') && (subject !== null); +} + + +function toArray(sequence) { + if (Array.isArray(sequence)) return sequence; + else if (isNothing(sequence)) return []; + + return [ sequence ]; +} + + +function extend(target, source) { + var index, length, key, sourceKeys; + + if (source) { + sourceKeys = Object.keys(source); + + for (index = 0, length = sourceKeys.length; index < length; index += 1) { + key = sourceKeys[index]; + target[key] = source[key]; + } + } + + return target; +} + + +function repeat(string, count) { + var result = '', cycle; + + for (cycle = 0; cycle < count; cycle += 1) { + result += string; + } + + return result; +} + + +function isNegativeZero(number) { + return (number === 0) && (Number.NEGATIVE_INFINITY === 1 / number); +} + + +module.exports.isNothing = isNothing; +module.exports.isObject = isObject; +module.exports.toArray = toArray; +module.exports.repeat = repeat; +module.exports.isNegativeZero = isNegativeZero; +module.exports.extend = extend; diff --git a/node_modules/js-yaml/lib/dumper.js b/node_modules/js-yaml/lib/dumper.js new file mode 100644 index 0000000..f357a6a --- /dev/null +++ b/node_modules/js-yaml/lib/dumper.js @@ -0,0 +1,965 @@ +'use strict'; + +/*eslint-disable no-use-before-define*/ + +var common = require('./common'); +var YAMLException = require('./exception'); +var DEFAULT_SCHEMA = require('./schema/default'); + +var _toString = Object.prototype.toString; +var _hasOwnProperty = Object.prototype.hasOwnProperty; + +var CHAR_BOM = 0xFEFF; +var CHAR_TAB = 0x09; /* Tab */ +var CHAR_LINE_FEED = 0x0A; /* LF */ +var CHAR_CARRIAGE_RETURN = 0x0D; /* CR */ +var CHAR_SPACE = 0x20; /* Space */ +var CHAR_EXCLAMATION = 0x21; /* ! */ +var CHAR_DOUBLE_QUOTE = 0x22; /* " */ +var CHAR_SHARP = 0x23; /* # */ +var CHAR_PERCENT = 0x25; /* % */ +var CHAR_AMPERSAND = 0x26; /* & */ +var CHAR_SINGLE_QUOTE = 0x27; /* ' */ +var CHAR_ASTERISK = 0x2A; /* * */ +var CHAR_COMMA = 0x2C; /* , */ +var CHAR_MINUS = 0x2D; /* - */ +var CHAR_COLON = 0x3A; /* : */ +var CHAR_EQUALS = 0x3D; /* = */ +var CHAR_GREATER_THAN = 0x3E; /* > */ +var CHAR_QUESTION = 0x3F; /* ? */ +var CHAR_COMMERCIAL_AT = 0x40; /* @ */ +var CHAR_LEFT_SQUARE_BRACKET = 0x5B; /* [ */ +var CHAR_RIGHT_SQUARE_BRACKET = 0x5D; /* ] */ +var CHAR_GRAVE_ACCENT = 0x60; /* ` */ +var CHAR_LEFT_CURLY_BRACKET = 0x7B; /* { */ +var CHAR_VERTICAL_LINE = 0x7C; /* | */ +var CHAR_RIGHT_CURLY_BRACKET = 0x7D; /* } */ + +var ESCAPE_SEQUENCES = {}; + +ESCAPE_SEQUENCES[0x00] = '\\0'; +ESCAPE_SEQUENCES[0x07] = '\\a'; +ESCAPE_SEQUENCES[0x08] = '\\b'; +ESCAPE_SEQUENCES[0x09] = '\\t'; +ESCAPE_SEQUENCES[0x0A] = '\\n'; +ESCAPE_SEQUENCES[0x0B] = '\\v'; +ESCAPE_SEQUENCES[0x0C] = '\\f'; +ESCAPE_SEQUENCES[0x0D] = '\\r'; +ESCAPE_SEQUENCES[0x1B] = '\\e'; +ESCAPE_SEQUENCES[0x22] = '\\"'; +ESCAPE_SEQUENCES[0x5C] = '\\\\'; +ESCAPE_SEQUENCES[0x85] = '\\N'; +ESCAPE_SEQUENCES[0xA0] = '\\_'; +ESCAPE_SEQUENCES[0x2028] = '\\L'; +ESCAPE_SEQUENCES[0x2029] = '\\P'; + +var DEPRECATED_BOOLEANS_SYNTAX = [ + 'y', 'Y', 'yes', 'Yes', 'YES', 'on', 'On', 'ON', + 'n', 'N', 'no', 'No', 'NO', 'off', 'Off', 'OFF' +]; + +var DEPRECATED_BASE60_SYNTAX = /^[-+]?[0-9_]+(?::[0-9_]+)+(?:\.[0-9_]*)?$/; + +function compileStyleMap(schema, map) { + var result, keys, index, length, tag, style, type; + + if (map === null) return {}; + + result = {}; + keys = Object.keys(map); + + for (index = 0, length = keys.length; index < length; index += 1) { + tag = keys[index]; + style = String(map[tag]); + + if (tag.slice(0, 2) === '!!') { + tag = 'tag:yaml.org,2002:' + tag.slice(2); + } + type = schema.compiledTypeMap['fallback'][tag]; + + if (type && _hasOwnProperty.call(type.styleAliases, style)) { + style = type.styleAliases[style]; + } + + result[tag] = style; + } + + return result; +} + +function encodeHex(character) { + var string, handle, length; + + string = character.toString(16).toUpperCase(); + + if (character <= 0xFF) { + handle = 'x'; + length = 2; + } else if (character <= 0xFFFF) { + handle = 'u'; + length = 4; + } else if (character <= 0xFFFFFFFF) { + handle = 'U'; + length = 8; + } else { + throw new YAMLException('code point within a string may not be greater than 0xFFFFFFFF'); + } + + return '\\' + handle + common.repeat('0', length - string.length) + string; +} + + +var QUOTING_TYPE_SINGLE = 1, + QUOTING_TYPE_DOUBLE = 2; + +function State(options) { + this.schema = options['schema'] || DEFAULT_SCHEMA; + this.indent = Math.max(1, (options['indent'] || 2)); + this.noArrayIndent = options['noArrayIndent'] || false; + this.skipInvalid = options['skipInvalid'] || false; + this.flowLevel = (common.isNothing(options['flowLevel']) ? -1 : options['flowLevel']); + this.styleMap = compileStyleMap(this.schema, options['styles'] || null); + this.sortKeys = options['sortKeys'] || false; + this.lineWidth = options['lineWidth'] || 80; + this.noRefs = options['noRefs'] || false; + this.noCompatMode = options['noCompatMode'] || false; + this.condenseFlow = options['condenseFlow'] || false; + this.quotingType = options['quotingType'] === '"' ? QUOTING_TYPE_DOUBLE : QUOTING_TYPE_SINGLE; + this.forceQuotes = options['forceQuotes'] || false; + this.replacer = typeof options['replacer'] === 'function' ? options['replacer'] : null; + + this.implicitTypes = this.schema.compiledImplicit; + this.explicitTypes = this.schema.compiledExplicit; + + this.tag = null; + this.result = ''; + + this.duplicates = []; + this.usedDuplicates = null; +} + +// Indents every line in a string. Empty lines (\n only) are not indented. +function indentString(string, spaces) { + var ind = common.repeat(' ', spaces), + position = 0, + next = -1, + result = '', + line, + length = string.length; + + while (position < length) { + next = string.indexOf('\n', position); + if (next === -1) { + line = string.slice(position); + position = length; + } else { + line = string.slice(position, next + 1); + position = next + 1; + } + + if (line.length && line !== '\n') result += ind; + + result += line; + } + + return result; +} + +function generateNextLine(state, level) { + return '\n' + common.repeat(' ', state.indent * level); +} + +function testImplicitResolving(state, str) { + var index, length, type; + + for (index = 0, length = state.implicitTypes.length; index < length; index += 1) { + type = state.implicitTypes[index]; + + if (type.resolve(str)) { + return true; + } + } + + return false; +} + +// [33] s-white ::= s-space | s-tab +function isWhitespace(c) { + return c === CHAR_SPACE || c === CHAR_TAB; +} + +// Returns true if the character can be printed without escaping. +// From YAML 1.2: "any allowed characters known to be non-printable +// should also be escaped. [However,] This isn’t mandatory" +// Derived from nb-char - \t - #x85 - #xA0 - #x2028 - #x2029. +function isPrintable(c) { + return (0x00020 <= c && c <= 0x00007E) + || ((0x000A1 <= c && c <= 0x00D7FF) && c !== 0x2028 && c !== 0x2029) + || ((0x0E000 <= c && c <= 0x00FFFD) && c !== CHAR_BOM) + || (0x10000 <= c && c <= 0x10FFFF); +} + +// [34] ns-char ::= nb-char - s-white +// [27] nb-char ::= c-printable - b-char - c-byte-order-mark +// [26] b-char ::= b-line-feed | b-carriage-return +// Including s-white (for some reason, examples doesn't match specs in this aspect) +// ns-char ::= c-printable - b-line-feed - b-carriage-return - c-byte-order-mark +function isNsCharOrWhitespace(c) { + return isPrintable(c) + && c !== CHAR_BOM + // - b-char + && c !== CHAR_CARRIAGE_RETURN + && c !== CHAR_LINE_FEED; +} + +// [127] ns-plain-safe(c) ::= c = flow-out ⇒ ns-plain-safe-out +// c = flow-in ⇒ ns-plain-safe-in +// c = block-key ⇒ ns-plain-safe-out +// c = flow-key ⇒ ns-plain-safe-in +// [128] ns-plain-safe-out ::= ns-char +// [129] ns-plain-safe-in ::= ns-char - c-flow-indicator +// [130] ns-plain-char(c) ::= ( ns-plain-safe(c) - “:” - “#” ) +// | ( /* An ns-char preceding */ “#” ) +// | ( “:” /* Followed by an ns-plain-safe(c) */ ) +function isPlainSafe(c, prev, inblock) { + var cIsNsCharOrWhitespace = isNsCharOrWhitespace(c); + var cIsNsChar = cIsNsCharOrWhitespace && !isWhitespace(c); + return ( + // ns-plain-safe + inblock ? // c = flow-in + cIsNsCharOrWhitespace + : cIsNsCharOrWhitespace + // - c-flow-indicator + && c !== CHAR_COMMA + && c !== CHAR_LEFT_SQUARE_BRACKET + && c !== CHAR_RIGHT_SQUARE_BRACKET + && c !== CHAR_LEFT_CURLY_BRACKET + && c !== CHAR_RIGHT_CURLY_BRACKET + ) + // ns-plain-char + && c !== CHAR_SHARP // false on '#' + && !(prev === CHAR_COLON && !cIsNsChar) // false on ': ' + || (isNsCharOrWhitespace(prev) && !isWhitespace(prev) && c === CHAR_SHARP) // change to true on '[^ ]#' + || (prev === CHAR_COLON && cIsNsChar); // change to true on ':[^ ]' +} + +// Simplified test for values allowed as the first character in plain style. +function isPlainSafeFirst(c) { + // Uses a subset of ns-char - c-indicator + // where ns-char = nb-char - s-white. + // No support of ( ( “?” | “:” | “-” ) /* Followed by an ns-plain-safe(c)) */ ) part + return isPrintable(c) && c !== CHAR_BOM + && !isWhitespace(c) // - s-white + // - (c-indicator ::= + // “-” | “?” | “:” | “,” | “[” | “]” | “{” | “}” + && c !== CHAR_MINUS + && c !== CHAR_QUESTION + && c !== CHAR_COLON + && c !== CHAR_COMMA + && c !== CHAR_LEFT_SQUARE_BRACKET + && c !== CHAR_RIGHT_SQUARE_BRACKET + && c !== CHAR_LEFT_CURLY_BRACKET + && c !== CHAR_RIGHT_CURLY_BRACKET + // | “#” | “&” | “*” | “!” | “|” | “=” | “>” | “'” | “"” + && c !== CHAR_SHARP + && c !== CHAR_AMPERSAND + && c !== CHAR_ASTERISK + && c !== CHAR_EXCLAMATION + && c !== CHAR_VERTICAL_LINE + && c !== CHAR_EQUALS + && c !== CHAR_GREATER_THAN + && c !== CHAR_SINGLE_QUOTE + && c !== CHAR_DOUBLE_QUOTE + // | “%” | “@” | “`”) + && c !== CHAR_PERCENT + && c !== CHAR_COMMERCIAL_AT + && c !== CHAR_GRAVE_ACCENT; +} + +// Simplified test for values allowed as the last character in plain style. +function isPlainSafeLast(c) { + // just not whitespace or colon, it will be checked to be plain character later + return !isWhitespace(c) && c !== CHAR_COLON; +} + +// Same as 'string'.codePointAt(pos), but works in older browsers. +function codePointAt(string, pos) { + var first = string.charCodeAt(pos), second; + if (first >= 0xD800 && first <= 0xDBFF && pos + 1 < string.length) { + second = string.charCodeAt(pos + 1); + if (second >= 0xDC00 && second <= 0xDFFF) { + // https://mathiasbynens.be/notes/javascript-encoding#surrogate-formulae + return (first - 0xD800) * 0x400 + second - 0xDC00 + 0x10000; + } + } + return first; +} + +// Determines whether block indentation indicator is required. +function needIndentIndicator(string) { + var leadingSpaceRe = /^\n* /; + return leadingSpaceRe.test(string); +} + +var STYLE_PLAIN = 1, + STYLE_SINGLE = 2, + STYLE_LITERAL = 3, + STYLE_FOLDED = 4, + STYLE_DOUBLE = 5; + +// Determines which scalar styles are possible and returns the preferred style. +// lineWidth = -1 => no limit. +// Pre-conditions: str.length > 0. +// Post-conditions: +// STYLE_PLAIN or STYLE_SINGLE => no \n are in the string. +// STYLE_LITERAL => no lines are suitable for folding (or lineWidth is -1). +// STYLE_FOLDED => a line > lineWidth and can be folded (and lineWidth != -1). +function chooseScalarStyle(string, singleLineOnly, indentPerLevel, lineWidth, + testAmbiguousType, quotingType, forceQuotes, inblock) { + + var i; + var char = 0; + var prevChar = null; + var hasLineBreak = false; + var hasFoldableLine = false; // only checked if shouldTrackWidth + var shouldTrackWidth = lineWidth !== -1; + var previousLineBreak = -1; // count the first line correctly + var plain = isPlainSafeFirst(codePointAt(string, 0)) + && isPlainSafeLast(codePointAt(string, string.length - 1)); + + if (singleLineOnly || forceQuotes) { + // Case: no block styles. + // Check for disallowed characters to rule out plain and single. + for (i = 0; i < string.length; char >= 0x10000 ? i += 2 : i++) { + char = codePointAt(string, i); + if (!isPrintable(char)) { + return STYLE_DOUBLE; + } + plain = plain && isPlainSafe(char, prevChar, inblock); + prevChar = char; + } + } else { + // Case: block styles permitted. + for (i = 0; i < string.length; char >= 0x10000 ? i += 2 : i++) { + char = codePointAt(string, i); + if (char === CHAR_LINE_FEED) { + hasLineBreak = true; + // Check if any line can be folded. + if (shouldTrackWidth) { + hasFoldableLine = hasFoldableLine || + // Foldable line = too long, and not more-indented. + (i - previousLineBreak - 1 > lineWidth && + string[previousLineBreak + 1] !== ' '); + previousLineBreak = i; + } + } else if (!isPrintable(char)) { + return STYLE_DOUBLE; + } + plain = plain && isPlainSafe(char, prevChar, inblock); + prevChar = char; + } + // in case the end is missing a \n + hasFoldableLine = hasFoldableLine || (shouldTrackWidth && + (i - previousLineBreak - 1 > lineWidth && + string[previousLineBreak + 1] !== ' ')); + } + // Although every style can represent \n without escaping, prefer block styles + // for multiline, since they're more readable and they don't add empty lines. + // Also prefer folding a super-long line. + if (!hasLineBreak && !hasFoldableLine) { + // Strings interpretable as another type have to be quoted; + // e.g. the string 'true' vs. the boolean true. + if (plain && !forceQuotes && !testAmbiguousType(string)) { + return STYLE_PLAIN; + } + return quotingType === QUOTING_TYPE_DOUBLE ? STYLE_DOUBLE : STYLE_SINGLE; + } + // Edge case: block indentation indicator can only have one digit. + if (indentPerLevel > 9 && needIndentIndicator(string)) { + return STYLE_DOUBLE; + } + // At this point we know block styles are valid. + // Prefer literal style unless we want to fold. + if (!forceQuotes) { + return hasFoldableLine ? STYLE_FOLDED : STYLE_LITERAL; + } + return quotingType === QUOTING_TYPE_DOUBLE ? STYLE_DOUBLE : STYLE_SINGLE; +} + +// Note: line breaking/folding is implemented for only the folded style. +// NB. We drop the last trailing newline (if any) of a returned block scalar +// since the dumper adds its own newline. This always works: +// • No ending newline => unaffected; already using strip "-" chomping. +// • Ending newline => removed then restored. +// Importantly, this keeps the "+" chomp indicator from gaining an extra line. +function writeScalar(state, string, level, iskey, inblock) { + state.dump = (function () { + if (string.length === 0) { + return state.quotingType === QUOTING_TYPE_DOUBLE ? '""' : "''"; + } + if (!state.noCompatMode) { + if (DEPRECATED_BOOLEANS_SYNTAX.indexOf(string) !== -1 || DEPRECATED_BASE60_SYNTAX.test(string)) { + return state.quotingType === QUOTING_TYPE_DOUBLE ? ('"' + string + '"') : ("'" + string + "'"); + } + } + + var indent = state.indent * Math.max(1, level); // no 0-indent scalars + // As indentation gets deeper, let the width decrease monotonically + // to the lower bound min(state.lineWidth, 40). + // Note that this implies + // state.lineWidth ≤ 40 + state.indent: width is fixed at the lower bound. + // state.lineWidth > 40 + state.indent: width decreases until the lower bound. + // This behaves better than a constant minimum width which disallows narrower options, + // or an indent threshold which causes the width to suddenly increase. + var lineWidth = state.lineWidth === -1 + ? -1 : Math.max(Math.min(state.lineWidth, 40), state.lineWidth - indent); + + // Without knowing if keys are implicit/explicit, assume implicit for safety. + var singleLineOnly = iskey + // No block styles in flow mode. + || (state.flowLevel > -1 && level >= state.flowLevel); + function testAmbiguity(string) { + return testImplicitResolving(state, string); + } + + switch (chooseScalarStyle(string, singleLineOnly, state.indent, lineWidth, + testAmbiguity, state.quotingType, state.forceQuotes && !iskey, inblock)) { + + case STYLE_PLAIN: + return string; + case STYLE_SINGLE: + return "'" + string.replace(/'/g, "''") + "'"; + case STYLE_LITERAL: + return '|' + blockHeader(string, state.indent) + + dropEndingNewline(indentString(string, indent)); + case STYLE_FOLDED: + return '>' + blockHeader(string, state.indent) + + dropEndingNewline(indentString(foldString(string, lineWidth), indent)); + case STYLE_DOUBLE: + return '"' + escapeString(string, lineWidth) + '"'; + default: + throw new YAMLException('impossible error: invalid scalar style'); + } + }()); +} + +// Pre-conditions: string is valid for a block scalar, 1 <= indentPerLevel <= 9. +function blockHeader(string, indentPerLevel) { + var indentIndicator = needIndentIndicator(string) ? String(indentPerLevel) : ''; + + // note the special case: the string '\n' counts as a "trailing" empty line. + var clip = string[string.length - 1] === '\n'; + var keep = clip && (string[string.length - 2] === '\n' || string === '\n'); + var chomp = keep ? '+' : (clip ? '' : '-'); + + return indentIndicator + chomp + '\n'; +} + +// (See the note for writeScalar.) +function dropEndingNewline(string) { + return string[string.length - 1] === '\n' ? string.slice(0, -1) : string; +} + +// Note: a long line without a suitable break point will exceed the width limit. +// Pre-conditions: every char in str isPrintable, str.length > 0, width > 0. +function foldString(string, width) { + // In folded style, $k$ consecutive newlines output as $k+1$ newlines— + // unless they're before or after a more-indented line, or at the very + // beginning or end, in which case $k$ maps to $k$. + // Therefore, parse each chunk as newline(s) followed by a content line. + var lineRe = /(\n+)([^\n]*)/g; + + // first line (possibly an empty line) + var result = (function () { + var nextLF = string.indexOf('\n'); + nextLF = nextLF !== -1 ? nextLF : string.length; + lineRe.lastIndex = nextLF; + return foldLine(string.slice(0, nextLF), width); + }()); + // If we haven't reached the first content line yet, don't add an extra \n. + var prevMoreIndented = string[0] === '\n' || string[0] === ' '; + var moreIndented; + + // rest of the lines + var match; + while ((match = lineRe.exec(string))) { + var prefix = match[1], line = match[2]; + moreIndented = (line[0] === ' '); + result += prefix + + (!prevMoreIndented && !moreIndented && line !== '' + ? '\n' : '') + + foldLine(line, width); + prevMoreIndented = moreIndented; + } + + return result; +} + +// Greedy line breaking. +// Picks the longest line under the limit each time, +// otherwise settles for the shortest line over the limit. +// NB. More-indented lines *cannot* be folded, as that would add an extra \n. +function foldLine(line, width) { + if (line === '' || line[0] === ' ') return line; + + // Since a more-indented line adds a \n, breaks can't be followed by a space. + var breakRe = / [^ ]/g; // note: the match index will always be <= length-2. + var match; + // start is an inclusive index. end, curr, and next are exclusive. + var start = 0, end, curr = 0, next = 0; + var result = ''; + + // Invariants: 0 <= start <= length-1. + // 0 <= curr <= next <= max(0, length-2). curr - start <= width. + // Inside the loop: + // A match implies length >= 2, so curr and next are <= length-2. + while ((match = breakRe.exec(line))) { + next = match.index; + // maintain invariant: curr - start <= width + if (next - start > width) { + end = (curr > start) ? curr : next; // derive end <= length-2 + result += '\n' + line.slice(start, end); + // skip the space that was output as \n + start = end + 1; // derive start <= length-1 + } + curr = next; + } + + // By the invariants, start <= length-1, so there is something left over. + // It is either the whole string or a part starting from non-whitespace. + result += '\n'; + // Insert a break if the remainder is too long and there is a break available. + if (line.length - start > width && curr > start) { + result += line.slice(start, curr) + '\n' + line.slice(curr + 1); + } else { + result += line.slice(start); + } + + return result.slice(1); // drop extra \n joiner +} + +// Escapes a double-quoted string. +function escapeString(string) { + var result = ''; + var char = 0; + var escapeSeq; + + for (var i = 0; i < string.length; char >= 0x10000 ? i += 2 : i++) { + char = codePointAt(string, i); + escapeSeq = ESCAPE_SEQUENCES[char]; + + if (!escapeSeq && isPrintable(char)) { + result += string[i]; + if (char >= 0x10000) result += string[i + 1]; + } else { + result += escapeSeq || encodeHex(char); + } + } + + return result; +} + +function writeFlowSequence(state, level, object) { + var _result = '', + _tag = state.tag, + index, + length, + value; + + for (index = 0, length = object.length; index < length; index += 1) { + value = object[index]; + + if (state.replacer) { + value = state.replacer.call(object, String(index), value); + } + + // Write only valid elements, put null instead of invalid elements. + if (writeNode(state, level, value, false, false) || + (typeof value === 'undefined' && + writeNode(state, level, null, false, false))) { + + if (_result !== '') _result += ',' + (!state.condenseFlow ? ' ' : ''); + _result += state.dump; + } + } + + state.tag = _tag; + state.dump = '[' + _result + ']'; +} + +function writeBlockSequence(state, level, object, compact) { + var _result = '', + _tag = state.tag, + index, + length, + value; + + for (index = 0, length = object.length; index < length; index += 1) { + value = object[index]; + + if (state.replacer) { + value = state.replacer.call(object, String(index), value); + } + + // Write only valid elements, put null instead of invalid elements. + if (writeNode(state, level + 1, value, true, true, false, true) || + (typeof value === 'undefined' && + writeNode(state, level + 1, null, true, true, false, true))) { + + if (!compact || _result !== '') { + _result += generateNextLine(state, level); + } + + if (state.dump && CHAR_LINE_FEED === state.dump.charCodeAt(0)) { + _result += '-'; + } else { + _result += '- '; + } + + _result += state.dump; + } + } + + state.tag = _tag; + state.dump = _result || '[]'; // Empty sequence if no valid values. +} + +function writeFlowMapping(state, level, object) { + var _result = '', + _tag = state.tag, + objectKeyList = Object.keys(object), + index, + length, + objectKey, + objectValue, + pairBuffer; + + for (index = 0, length = objectKeyList.length; index < length; index += 1) { + + pairBuffer = ''; + if (_result !== '') pairBuffer += ', '; + + if (state.condenseFlow) pairBuffer += '"'; + + objectKey = objectKeyList[index]; + objectValue = object[objectKey]; + + if (state.replacer) { + objectValue = state.replacer.call(object, objectKey, objectValue); + } + + if (!writeNode(state, level, objectKey, false, false)) { + continue; // Skip this pair because of invalid key; + } + + if (state.dump.length > 1024) pairBuffer += '? '; + + pairBuffer += state.dump + (state.condenseFlow ? '"' : '') + ':' + (state.condenseFlow ? '' : ' '); + + if (!writeNode(state, level, objectValue, false, false)) { + continue; // Skip this pair because of invalid value. + } + + pairBuffer += state.dump; + + // Both key and value are valid. + _result += pairBuffer; + } + + state.tag = _tag; + state.dump = '{' + _result + '}'; +} + +function writeBlockMapping(state, level, object, compact) { + var _result = '', + _tag = state.tag, + objectKeyList = Object.keys(object), + index, + length, + objectKey, + objectValue, + explicitPair, + pairBuffer; + + // Allow sorting keys so that the output file is deterministic + if (state.sortKeys === true) { + // Default sorting + objectKeyList.sort(); + } else if (typeof state.sortKeys === 'function') { + // Custom sort function + objectKeyList.sort(state.sortKeys); + } else if (state.sortKeys) { + // Something is wrong + throw new YAMLException('sortKeys must be a boolean or a function'); + } + + for (index = 0, length = objectKeyList.length; index < length; index += 1) { + pairBuffer = ''; + + if (!compact || _result !== '') { + pairBuffer += generateNextLine(state, level); + } + + objectKey = objectKeyList[index]; + objectValue = object[objectKey]; + + if (state.replacer) { + objectValue = state.replacer.call(object, objectKey, objectValue); + } + + if (!writeNode(state, level + 1, objectKey, true, true, true)) { + continue; // Skip this pair because of invalid key. + } + + explicitPair = (state.tag !== null && state.tag !== '?') || + (state.dump && state.dump.length > 1024); + + if (explicitPair) { + if (state.dump && CHAR_LINE_FEED === state.dump.charCodeAt(0)) { + pairBuffer += '?'; + } else { + pairBuffer += '? '; + } + } + + pairBuffer += state.dump; + + if (explicitPair) { + pairBuffer += generateNextLine(state, level); + } + + if (!writeNode(state, level + 1, objectValue, true, explicitPair)) { + continue; // Skip this pair because of invalid value. + } + + if (state.dump && CHAR_LINE_FEED === state.dump.charCodeAt(0)) { + pairBuffer += ':'; + } else { + pairBuffer += ': '; + } + + pairBuffer += state.dump; + + // Both key and value are valid. + _result += pairBuffer; + } + + state.tag = _tag; + state.dump = _result || '{}'; // Empty mapping if no valid pairs. +} + +function detectType(state, object, explicit) { + var _result, typeList, index, length, type, style; + + typeList = explicit ? state.explicitTypes : state.implicitTypes; + + for (index = 0, length = typeList.length; index < length; index += 1) { + type = typeList[index]; + + if ((type.instanceOf || type.predicate) && + (!type.instanceOf || ((typeof object === 'object') && (object instanceof type.instanceOf))) && + (!type.predicate || type.predicate(object))) { + + if (explicit) { + if (type.multi && type.representName) { + state.tag = type.representName(object); + } else { + state.tag = type.tag; + } + } else { + state.tag = '?'; + } + + if (type.represent) { + style = state.styleMap[type.tag] || type.defaultStyle; + + if (_toString.call(type.represent) === '[object Function]') { + _result = type.represent(object, style); + } else if (_hasOwnProperty.call(type.represent, style)) { + _result = type.represent[style](object, style); + } else { + throw new YAMLException('!<' + type.tag + '> tag resolver accepts not "' + style + '" style'); + } + + state.dump = _result; + } + + return true; + } + } + + return false; +} + +// Serializes `object` and writes it to global `result`. +// Returns true on success, or false on invalid object. +// +function writeNode(state, level, object, block, compact, iskey, isblockseq) { + state.tag = null; + state.dump = object; + + if (!detectType(state, object, false)) { + detectType(state, object, true); + } + + var type = _toString.call(state.dump); + var inblock = block; + var tagStr; + + if (block) { + block = (state.flowLevel < 0 || state.flowLevel > level); + } + + var objectOrArray = type === '[object Object]' || type === '[object Array]', + duplicateIndex, + duplicate; + + if (objectOrArray) { + duplicateIndex = state.duplicates.indexOf(object); + duplicate = duplicateIndex !== -1; + } + + if ((state.tag !== null && state.tag !== '?') || duplicate || (state.indent !== 2 && level > 0)) { + compact = false; + } + + if (duplicate && state.usedDuplicates[duplicateIndex]) { + state.dump = '*ref_' + duplicateIndex; + } else { + if (objectOrArray && duplicate && !state.usedDuplicates[duplicateIndex]) { + state.usedDuplicates[duplicateIndex] = true; + } + if (type === '[object Object]') { + if (block && (Object.keys(state.dump).length !== 0)) { + writeBlockMapping(state, level, state.dump, compact); + if (duplicate) { + state.dump = '&ref_' + duplicateIndex + state.dump; + } + } else { + writeFlowMapping(state, level, state.dump); + if (duplicate) { + state.dump = '&ref_' + duplicateIndex + ' ' + state.dump; + } + } + } else if (type === '[object Array]') { + if (block && (state.dump.length !== 0)) { + if (state.noArrayIndent && !isblockseq && level > 0) { + writeBlockSequence(state, level - 1, state.dump, compact); + } else { + writeBlockSequence(state, level, state.dump, compact); + } + if (duplicate) { + state.dump = '&ref_' + duplicateIndex + state.dump; + } + } else { + writeFlowSequence(state, level, state.dump); + if (duplicate) { + state.dump = '&ref_' + duplicateIndex + ' ' + state.dump; + } + } + } else if (type === '[object String]') { + if (state.tag !== '?') { + writeScalar(state, state.dump, level, iskey, inblock); + } + } else if (type === '[object Undefined]') { + return false; + } else { + if (state.skipInvalid) return false; + throw new YAMLException('unacceptable kind of an object to dump ' + type); + } + + if (state.tag !== null && state.tag !== '?') { + // Need to encode all characters except those allowed by the spec: + // + // [35] ns-dec-digit ::= [#x30-#x39] /* 0-9 */ + // [36] ns-hex-digit ::= ns-dec-digit + // | [#x41-#x46] /* A-F */ | [#x61-#x66] /* a-f */ + // [37] ns-ascii-letter ::= [#x41-#x5A] /* A-Z */ | [#x61-#x7A] /* a-z */ + // [38] ns-word-char ::= ns-dec-digit | ns-ascii-letter | “-” + // [39] ns-uri-char ::= “%” ns-hex-digit ns-hex-digit | ns-word-char | “#” + // | “;” | “/” | “?” | “:” | “@” | “&” | “=” | “+” | “$” | “,” + // | “_” | “.” | “!” | “~” | “*” | “'” | “(” | “)” | “[” | “]” + // + // Also need to encode '!' because it has special meaning (end of tag prefix). + // + tagStr = encodeURI( + state.tag[0] === '!' ? state.tag.slice(1) : state.tag + ).replace(/!/g, '%21'); + + if (state.tag[0] === '!') { + tagStr = '!' + tagStr; + } else if (tagStr.slice(0, 18) === 'tag:yaml.org,2002:') { + tagStr = '!!' + tagStr.slice(18); + } else { + tagStr = '!<' + tagStr + '>'; + } + + state.dump = tagStr + ' ' + state.dump; + } + } + + return true; +} + +function getDuplicateReferences(object, state) { + var objects = [], + duplicatesIndexes = [], + index, + length; + + inspectNode(object, objects, duplicatesIndexes); + + for (index = 0, length = duplicatesIndexes.length; index < length; index += 1) { + state.duplicates.push(objects[duplicatesIndexes[index]]); + } + state.usedDuplicates = new Array(length); +} + +function inspectNode(object, objects, duplicatesIndexes) { + var objectKeyList, + index, + length; + + if (object !== null && typeof object === 'object') { + index = objects.indexOf(object); + if (index !== -1) { + if (duplicatesIndexes.indexOf(index) === -1) { + duplicatesIndexes.push(index); + } + } else { + objects.push(object); + + if (Array.isArray(object)) { + for (index = 0, length = object.length; index < length; index += 1) { + inspectNode(object[index], objects, duplicatesIndexes); + } + } else { + objectKeyList = Object.keys(object); + + for (index = 0, length = objectKeyList.length; index < length; index += 1) { + inspectNode(object[objectKeyList[index]], objects, duplicatesIndexes); + } + } + } + } +} + +function dump(input, options) { + options = options || {}; + + var state = new State(options); + + if (!state.noRefs) getDuplicateReferences(input, state); + + var value = input; + + if (state.replacer) { + value = state.replacer.call({ '': value }, '', value); + } + + if (writeNode(state, 0, value, true, true)) return state.dump + '\n'; + + return ''; +} + +module.exports.dump = dump; diff --git a/node_modules/js-yaml/lib/exception.js b/node_modules/js-yaml/lib/exception.js new file mode 100644 index 0000000..7f62daa --- /dev/null +++ b/node_modules/js-yaml/lib/exception.js @@ -0,0 +1,55 @@ +// YAML error class. http://stackoverflow.com/questions/8458984 +// +'use strict'; + + +function formatError(exception, compact) { + var where = '', message = exception.reason || '(unknown reason)'; + + if (!exception.mark) return message; + + if (exception.mark.name) { + where += 'in "' + exception.mark.name + '" '; + } + + where += '(' + (exception.mark.line + 1) + ':' + (exception.mark.column + 1) + ')'; + + if (!compact && exception.mark.snippet) { + where += '\n\n' + exception.mark.snippet; + } + + return message + ' ' + where; +} + + +function YAMLException(reason, mark) { + // Super constructor + Error.call(this); + + this.name = 'YAMLException'; + this.reason = reason; + this.mark = mark; + this.message = formatError(this, false); + + // Include stack trace in error object + if (Error.captureStackTrace) { + // Chrome and NodeJS + Error.captureStackTrace(this, this.constructor); + } else { + // FF, IE 10+ and Safari 6+. Fallback for others + this.stack = (new Error()).stack || ''; + } +} + + +// Inherit from Error +YAMLException.prototype = Object.create(Error.prototype); +YAMLException.prototype.constructor = YAMLException; + + +YAMLException.prototype.toString = function toString(compact) { + return this.name + ': ' + formatError(this, compact); +}; + + +module.exports = YAMLException; diff --git a/node_modules/js-yaml/lib/loader.js b/node_modules/js-yaml/lib/loader.js new file mode 100644 index 0000000..39f13f5 --- /dev/null +++ b/node_modules/js-yaml/lib/loader.js @@ -0,0 +1,1727 @@ +'use strict'; + +/*eslint-disable max-len,no-use-before-define*/ + +var common = require('./common'); +var YAMLException = require('./exception'); +var makeSnippet = require('./snippet'); +var DEFAULT_SCHEMA = require('./schema/default'); + + +var _hasOwnProperty = Object.prototype.hasOwnProperty; + + +var CONTEXT_FLOW_IN = 1; +var CONTEXT_FLOW_OUT = 2; +var CONTEXT_BLOCK_IN = 3; +var CONTEXT_BLOCK_OUT = 4; + + +var CHOMPING_CLIP = 1; +var CHOMPING_STRIP = 2; +var CHOMPING_KEEP = 3; + + +var PATTERN_NON_PRINTABLE = /[\x00-\x08\x0B\x0C\x0E-\x1F\x7F-\x84\x86-\x9F\uFFFE\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]/; +var PATTERN_NON_ASCII_LINE_BREAKS = /[\x85\u2028\u2029]/; +var PATTERN_FLOW_INDICATORS = /[,\[\]\{\}]/; +var PATTERN_TAG_HANDLE = /^(?:!|!!|![a-z\-]+!)$/i; +var PATTERN_TAG_URI = /^(?:!|[^,\[\]\{\}])(?:%[0-9a-f]{2}|[0-9a-z\-#;\/\?:@&=\+\$,_\.!~\*'\(\)\[\]])*$/i; + + +function _class(obj) { return Object.prototype.toString.call(obj); } + +function is_EOL(c) { + return (c === 0x0A/* LF */) || (c === 0x0D/* CR */); +} + +function is_WHITE_SPACE(c) { + return (c === 0x09/* Tab */) || (c === 0x20/* Space */); +} + +function is_WS_OR_EOL(c) { + return (c === 0x09/* Tab */) || + (c === 0x20/* Space */) || + (c === 0x0A/* LF */) || + (c === 0x0D/* CR */); +} + +function is_FLOW_INDICATOR(c) { + return c === 0x2C/* , */ || + c === 0x5B/* [ */ || + c === 0x5D/* ] */ || + c === 0x7B/* { */ || + c === 0x7D/* } */; +} + +function fromHexCode(c) { + var lc; + + if ((0x30/* 0 */ <= c) && (c <= 0x39/* 9 */)) { + return c - 0x30; + } + + /*eslint-disable no-bitwise*/ + lc = c | 0x20; + + if ((0x61/* a */ <= lc) && (lc <= 0x66/* f */)) { + return lc - 0x61 + 10; + } + + return -1; +} + +function escapedHexLen(c) { + if (c === 0x78/* x */) { return 2; } + if (c === 0x75/* u */) { return 4; } + if (c === 0x55/* U */) { return 8; } + return 0; +} + +function fromDecimalCode(c) { + if ((0x30/* 0 */ <= c) && (c <= 0x39/* 9 */)) { + return c - 0x30; + } + + return -1; +} + +function simpleEscapeSequence(c) { + /* eslint-disable indent */ + return (c === 0x30/* 0 */) ? '\x00' : + (c === 0x61/* a */) ? '\x07' : + (c === 0x62/* b */) ? '\x08' : + (c === 0x74/* t */) ? '\x09' : + (c === 0x09/* Tab */) ? '\x09' : + (c === 0x6E/* n */) ? '\x0A' : + (c === 0x76/* v */) ? '\x0B' : + (c === 0x66/* f */) ? '\x0C' : + (c === 0x72/* r */) ? '\x0D' : + (c === 0x65/* e */) ? '\x1B' : + (c === 0x20/* Space */) ? ' ' : + (c === 0x22/* " */) ? '\x22' : + (c === 0x2F/* / */) ? '/' : + (c === 0x5C/* \ */) ? '\x5C' : + (c === 0x4E/* N */) ? '\x85' : + (c === 0x5F/* _ */) ? '\xA0' : + (c === 0x4C/* L */) ? '\u2028' : + (c === 0x50/* P */) ? '\u2029' : ''; +} + +function charFromCodepoint(c) { + if (c <= 0xFFFF) { + return String.fromCharCode(c); + } + // Encode UTF-16 surrogate pair + // https://en.wikipedia.org/wiki/UTF-16#Code_points_U.2B010000_to_U.2B10FFFF + return String.fromCharCode( + ((c - 0x010000) >> 10) + 0xD800, + ((c - 0x010000) & 0x03FF) + 0xDC00 + ); +} + +var simpleEscapeCheck = new Array(256); // integer, for fast access +var simpleEscapeMap = new Array(256); +for (var i = 0; i < 256; i++) { + simpleEscapeCheck[i] = simpleEscapeSequence(i) ? 1 : 0; + simpleEscapeMap[i] = simpleEscapeSequence(i); +} + + +function State(input, options) { + this.input = input; + + this.filename = options['filename'] || null; + this.schema = options['schema'] || DEFAULT_SCHEMA; + this.onWarning = options['onWarning'] || null; + // (Hidden) Remove? makes the loader to expect YAML 1.1 documents + // if such documents have no explicit %YAML directive + this.legacy = options['legacy'] || false; + + this.json = options['json'] || false; + this.listener = options['listener'] || null; + + this.implicitTypes = this.schema.compiledImplicit; + this.typeMap = this.schema.compiledTypeMap; + + this.length = input.length; + this.position = 0; + this.line = 0; + this.lineStart = 0; + this.lineIndent = 0; + + // position of first leading tab in the current line, + // used to make sure there are no tabs in the indentation + this.firstTabInLine = -1; + + this.documents = []; + + /* + this.version; + this.checkLineBreaks; + this.tagMap; + this.anchorMap; + this.tag; + this.anchor; + this.kind; + this.result;*/ + +} + + +function generateError(state, message) { + var mark = { + name: state.filename, + buffer: state.input.slice(0, -1), // omit trailing \0 + position: state.position, + line: state.line, + column: state.position - state.lineStart + }; + + mark.snippet = makeSnippet(mark); + + return new YAMLException(message, mark); +} + +function throwError(state, message) { + throw generateError(state, message); +} + +function throwWarning(state, message) { + if (state.onWarning) { + state.onWarning.call(null, generateError(state, message)); + } +} + + +var directiveHandlers = { + + YAML: function handleYamlDirective(state, name, args) { + + var match, major, minor; + + if (state.version !== null) { + throwError(state, 'duplication of %YAML directive'); + } + + if (args.length !== 1) { + throwError(state, 'YAML directive accepts exactly one argument'); + } + + match = /^([0-9]+)\.([0-9]+)$/.exec(args[0]); + + if (match === null) { + throwError(state, 'ill-formed argument of the YAML directive'); + } + + major = parseInt(match[1], 10); + minor = parseInt(match[2], 10); + + if (major !== 1) { + throwError(state, 'unacceptable YAML version of the document'); + } + + state.version = args[0]; + state.checkLineBreaks = (minor < 2); + + if (minor !== 1 && minor !== 2) { + throwWarning(state, 'unsupported YAML version of the document'); + } + }, + + TAG: function handleTagDirective(state, name, args) { + + var handle, prefix; + + if (args.length !== 2) { + throwError(state, 'TAG directive accepts exactly two arguments'); + } + + handle = args[0]; + prefix = args[1]; + + if (!PATTERN_TAG_HANDLE.test(handle)) { + throwError(state, 'ill-formed tag handle (first argument) of the TAG directive'); + } + + if (_hasOwnProperty.call(state.tagMap, handle)) { + throwError(state, 'there is a previously declared suffix for "' + handle + '" tag handle'); + } + + if (!PATTERN_TAG_URI.test(prefix)) { + throwError(state, 'ill-formed tag prefix (second argument) of the TAG directive'); + } + + try { + prefix = decodeURIComponent(prefix); + } catch (err) { + throwError(state, 'tag prefix is malformed: ' + prefix); + } + + state.tagMap[handle] = prefix; + } +}; + + +function captureSegment(state, start, end, checkJson) { + var _position, _length, _character, _result; + + if (start < end) { + _result = state.input.slice(start, end); + + if (checkJson) { + for (_position = 0, _length = _result.length; _position < _length; _position += 1) { + _character = _result.charCodeAt(_position); + if (!(_character === 0x09 || + (0x20 <= _character && _character <= 0x10FFFF))) { + throwError(state, 'expected valid JSON character'); + } + } + } else if (PATTERN_NON_PRINTABLE.test(_result)) { + throwError(state, 'the stream contains non-printable characters'); + } + + state.result += _result; + } +} + +function mergeMappings(state, destination, source, overridableKeys) { + var sourceKeys, key, index, quantity; + + if (!common.isObject(source)) { + throwError(state, 'cannot merge mappings; the provided source object is unacceptable'); + } + + sourceKeys = Object.keys(source); + + for (index = 0, quantity = sourceKeys.length; index < quantity; index += 1) { + key = sourceKeys[index]; + + if (!_hasOwnProperty.call(destination, key)) { + destination[key] = source[key]; + overridableKeys[key] = true; + } + } +} + +function storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, valueNode, + startLine, startLineStart, startPos) { + + var index, quantity; + + // The output is a plain object here, so keys can only be strings. + // We need to convert keyNode to a string, but doing so can hang the process + // (deeply nested arrays that explode exponentially using aliases). + if (Array.isArray(keyNode)) { + keyNode = Array.prototype.slice.call(keyNode); + + for (index = 0, quantity = keyNode.length; index < quantity; index += 1) { + if (Array.isArray(keyNode[index])) { + throwError(state, 'nested arrays are not supported inside keys'); + } + + if (typeof keyNode === 'object' && _class(keyNode[index]) === '[object Object]') { + keyNode[index] = '[object Object]'; + } + } + } + + // Avoid code execution in load() via toString property + // (still use its own toString for arrays, timestamps, + // and whatever user schema extensions happen to have @@toStringTag) + if (typeof keyNode === 'object' && _class(keyNode) === '[object Object]') { + keyNode = '[object Object]'; + } + + + keyNode = String(keyNode); + + if (_result === null) { + _result = {}; + } + + if (keyTag === 'tag:yaml.org,2002:merge') { + if (Array.isArray(valueNode)) { + for (index = 0, quantity = valueNode.length; index < quantity; index += 1) { + mergeMappings(state, _result, valueNode[index], overridableKeys); + } + } else { + mergeMappings(state, _result, valueNode, overridableKeys); + } + } else { + if (!state.json && + !_hasOwnProperty.call(overridableKeys, keyNode) && + _hasOwnProperty.call(_result, keyNode)) { + state.line = startLine || state.line; + state.lineStart = startLineStart || state.lineStart; + state.position = startPos || state.position; + throwError(state, 'duplicated mapping key'); + } + + // used for this specific key only because Object.defineProperty is slow + if (keyNode === '__proto__') { + Object.defineProperty(_result, keyNode, { + configurable: true, + enumerable: true, + writable: true, + value: valueNode + }); + } else { + _result[keyNode] = valueNode; + } + delete overridableKeys[keyNode]; + } + + return _result; +} + +function readLineBreak(state) { + var ch; + + ch = state.input.charCodeAt(state.position); + + if (ch === 0x0A/* LF */) { + state.position++; + } else if (ch === 0x0D/* CR */) { + state.position++; + if (state.input.charCodeAt(state.position) === 0x0A/* LF */) { + state.position++; + } + } else { + throwError(state, 'a line break is expected'); + } + + state.line += 1; + state.lineStart = state.position; + state.firstTabInLine = -1; +} + +function skipSeparationSpace(state, allowComments, checkIndent) { + var lineBreaks = 0, + ch = state.input.charCodeAt(state.position); + + while (ch !== 0) { + while (is_WHITE_SPACE(ch)) { + if (ch === 0x09/* Tab */ && state.firstTabInLine === -1) { + state.firstTabInLine = state.position; + } + ch = state.input.charCodeAt(++state.position); + } + + if (allowComments && ch === 0x23/* # */) { + do { + ch = state.input.charCodeAt(++state.position); + } while (ch !== 0x0A/* LF */ && ch !== 0x0D/* CR */ && ch !== 0); + } + + if (is_EOL(ch)) { + readLineBreak(state); + + ch = state.input.charCodeAt(state.position); + lineBreaks++; + state.lineIndent = 0; + + while (ch === 0x20/* Space */) { + state.lineIndent++; + ch = state.input.charCodeAt(++state.position); + } + } else { + break; + } + } + + if (checkIndent !== -1 && lineBreaks !== 0 && state.lineIndent < checkIndent) { + throwWarning(state, 'deficient indentation'); + } + + return lineBreaks; +} + +function testDocumentSeparator(state) { + var _position = state.position, + ch; + + ch = state.input.charCodeAt(_position); + + // Condition state.position === state.lineStart is tested + // in parent on each call, for efficiency. No needs to test here again. + if ((ch === 0x2D/* - */ || ch === 0x2E/* . */) && + ch === state.input.charCodeAt(_position + 1) && + ch === state.input.charCodeAt(_position + 2)) { + + _position += 3; + + ch = state.input.charCodeAt(_position); + + if (ch === 0 || is_WS_OR_EOL(ch)) { + return true; + } + } + + return false; +} + +function writeFoldedLines(state, count) { + if (count === 1) { + state.result += ' '; + } else if (count > 1) { + state.result += common.repeat('\n', count - 1); + } +} + + +function readPlainScalar(state, nodeIndent, withinFlowCollection) { + var preceding, + following, + captureStart, + captureEnd, + hasPendingContent, + _line, + _lineStart, + _lineIndent, + _kind = state.kind, + _result = state.result, + ch; + + ch = state.input.charCodeAt(state.position); + + if (is_WS_OR_EOL(ch) || + is_FLOW_INDICATOR(ch) || + ch === 0x23/* # */ || + ch === 0x26/* & */ || + ch === 0x2A/* * */ || + ch === 0x21/* ! */ || + ch === 0x7C/* | */ || + ch === 0x3E/* > */ || + ch === 0x27/* ' */ || + ch === 0x22/* " */ || + ch === 0x25/* % */ || + ch === 0x40/* @ */ || + ch === 0x60/* ` */) { + return false; + } + + if (ch === 0x3F/* ? */ || ch === 0x2D/* - */) { + following = state.input.charCodeAt(state.position + 1); + + if (is_WS_OR_EOL(following) || + withinFlowCollection && is_FLOW_INDICATOR(following)) { + return false; + } + } + + state.kind = 'scalar'; + state.result = ''; + captureStart = captureEnd = state.position; + hasPendingContent = false; + + while (ch !== 0) { + if (ch === 0x3A/* : */) { + following = state.input.charCodeAt(state.position + 1); + + if (is_WS_OR_EOL(following) || + withinFlowCollection && is_FLOW_INDICATOR(following)) { + break; + } + + } else if (ch === 0x23/* # */) { + preceding = state.input.charCodeAt(state.position - 1); + + if (is_WS_OR_EOL(preceding)) { + break; + } + + } else if ((state.position === state.lineStart && testDocumentSeparator(state)) || + withinFlowCollection && is_FLOW_INDICATOR(ch)) { + break; + + } else if (is_EOL(ch)) { + _line = state.line; + _lineStart = state.lineStart; + _lineIndent = state.lineIndent; + skipSeparationSpace(state, false, -1); + + if (state.lineIndent >= nodeIndent) { + hasPendingContent = true; + ch = state.input.charCodeAt(state.position); + continue; + } else { + state.position = captureEnd; + state.line = _line; + state.lineStart = _lineStart; + state.lineIndent = _lineIndent; + break; + } + } + + if (hasPendingContent) { + captureSegment(state, captureStart, captureEnd, false); + writeFoldedLines(state, state.line - _line); + captureStart = captureEnd = state.position; + hasPendingContent = false; + } + + if (!is_WHITE_SPACE(ch)) { + captureEnd = state.position + 1; + } + + ch = state.input.charCodeAt(++state.position); + } + + captureSegment(state, captureStart, captureEnd, false); + + if (state.result) { + return true; + } + + state.kind = _kind; + state.result = _result; + return false; +} + +function readSingleQuotedScalar(state, nodeIndent) { + var ch, + captureStart, captureEnd; + + ch = state.input.charCodeAt(state.position); + + if (ch !== 0x27/* ' */) { + return false; + } + + state.kind = 'scalar'; + state.result = ''; + state.position++; + captureStart = captureEnd = state.position; + + while ((ch = state.input.charCodeAt(state.position)) !== 0) { + if (ch === 0x27/* ' */) { + captureSegment(state, captureStart, state.position, true); + ch = state.input.charCodeAt(++state.position); + + if (ch === 0x27/* ' */) { + captureStart = state.position; + state.position++; + captureEnd = state.position; + } else { + return true; + } + + } else if (is_EOL(ch)) { + captureSegment(state, captureStart, captureEnd, true); + writeFoldedLines(state, skipSeparationSpace(state, false, nodeIndent)); + captureStart = captureEnd = state.position; + + } else if (state.position === state.lineStart && testDocumentSeparator(state)) { + throwError(state, 'unexpected end of the document within a single quoted scalar'); + + } else { + state.position++; + captureEnd = state.position; + } + } + + throwError(state, 'unexpected end of the stream within a single quoted scalar'); +} + +function readDoubleQuotedScalar(state, nodeIndent) { + var captureStart, + captureEnd, + hexLength, + hexResult, + tmp, + ch; + + ch = state.input.charCodeAt(state.position); + + if (ch !== 0x22/* " */) { + return false; + } + + state.kind = 'scalar'; + state.result = ''; + state.position++; + captureStart = captureEnd = state.position; + + while ((ch = state.input.charCodeAt(state.position)) !== 0) { + if (ch === 0x22/* " */) { + captureSegment(state, captureStart, state.position, true); + state.position++; + return true; + + } else if (ch === 0x5C/* \ */) { + captureSegment(state, captureStart, state.position, true); + ch = state.input.charCodeAt(++state.position); + + if (is_EOL(ch)) { + skipSeparationSpace(state, false, nodeIndent); + + // TODO: rework to inline fn with no type cast? + } else if (ch < 256 && simpleEscapeCheck[ch]) { + state.result += simpleEscapeMap[ch]; + state.position++; + + } else if ((tmp = escapedHexLen(ch)) > 0) { + hexLength = tmp; + hexResult = 0; + + for (; hexLength > 0; hexLength--) { + ch = state.input.charCodeAt(++state.position); + + if ((tmp = fromHexCode(ch)) >= 0) { + hexResult = (hexResult << 4) + tmp; + + } else { + throwError(state, 'expected hexadecimal character'); + } + } + + state.result += charFromCodepoint(hexResult); + + state.position++; + + } else { + throwError(state, 'unknown escape sequence'); + } + + captureStart = captureEnd = state.position; + + } else if (is_EOL(ch)) { + captureSegment(state, captureStart, captureEnd, true); + writeFoldedLines(state, skipSeparationSpace(state, false, nodeIndent)); + captureStart = captureEnd = state.position; + + } else if (state.position === state.lineStart && testDocumentSeparator(state)) { + throwError(state, 'unexpected end of the document within a double quoted scalar'); + + } else { + state.position++; + captureEnd = state.position; + } + } + + throwError(state, 'unexpected end of the stream within a double quoted scalar'); +} + +function readFlowCollection(state, nodeIndent) { + var readNext = true, + _line, + _lineStart, + _pos, + _tag = state.tag, + _result, + _anchor = state.anchor, + following, + terminator, + isPair, + isExplicitPair, + isMapping, + overridableKeys = Object.create(null), + keyNode, + keyTag, + valueNode, + ch; + + ch = state.input.charCodeAt(state.position); + + if (ch === 0x5B/* [ */) { + terminator = 0x5D;/* ] */ + isMapping = false; + _result = []; + } else if (ch === 0x7B/* { */) { + terminator = 0x7D;/* } */ + isMapping = true; + _result = {}; + } else { + return false; + } + + if (state.anchor !== null) { + state.anchorMap[state.anchor] = _result; + } + + ch = state.input.charCodeAt(++state.position); + + while (ch !== 0) { + skipSeparationSpace(state, true, nodeIndent); + + ch = state.input.charCodeAt(state.position); + + if (ch === terminator) { + state.position++; + state.tag = _tag; + state.anchor = _anchor; + state.kind = isMapping ? 'mapping' : 'sequence'; + state.result = _result; + return true; + } else if (!readNext) { + throwError(state, 'missed comma between flow collection entries'); + } else if (ch === 0x2C/* , */) { + // "flow collection entries can never be completely empty", as per YAML 1.2, section 7.4 + throwError(state, "expected the node content, but found ','"); + } + + keyTag = keyNode = valueNode = null; + isPair = isExplicitPair = false; + + if (ch === 0x3F/* ? */) { + following = state.input.charCodeAt(state.position + 1); + + if (is_WS_OR_EOL(following)) { + isPair = isExplicitPair = true; + state.position++; + skipSeparationSpace(state, true, nodeIndent); + } + } + + _line = state.line; // Save the current line. + _lineStart = state.lineStart; + _pos = state.position; + composeNode(state, nodeIndent, CONTEXT_FLOW_IN, false, true); + keyTag = state.tag; + keyNode = state.result; + skipSeparationSpace(state, true, nodeIndent); + + ch = state.input.charCodeAt(state.position); + + if ((isExplicitPair || state.line === _line) && ch === 0x3A/* : */) { + isPair = true; + ch = state.input.charCodeAt(++state.position); + skipSeparationSpace(state, true, nodeIndent); + composeNode(state, nodeIndent, CONTEXT_FLOW_IN, false, true); + valueNode = state.result; + } + + if (isMapping) { + storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, valueNode, _line, _lineStart, _pos); + } else if (isPair) { + _result.push(storeMappingPair(state, null, overridableKeys, keyTag, keyNode, valueNode, _line, _lineStart, _pos)); + } else { + _result.push(keyNode); + } + + skipSeparationSpace(state, true, nodeIndent); + + ch = state.input.charCodeAt(state.position); + + if (ch === 0x2C/* , */) { + readNext = true; + ch = state.input.charCodeAt(++state.position); + } else { + readNext = false; + } + } + + throwError(state, 'unexpected end of the stream within a flow collection'); +} + +function readBlockScalar(state, nodeIndent) { + var captureStart, + folding, + chomping = CHOMPING_CLIP, + didReadContent = false, + detectedIndent = false, + textIndent = nodeIndent, + emptyLines = 0, + atMoreIndented = false, + tmp, + ch; + + ch = state.input.charCodeAt(state.position); + + if (ch === 0x7C/* | */) { + folding = false; + } else if (ch === 0x3E/* > */) { + folding = true; + } else { + return false; + } + + state.kind = 'scalar'; + state.result = ''; + + while (ch !== 0) { + ch = state.input.charCodeAt(++state.position); + + if (ch === 0x2B/* + */ || ch === 0x2D/* - */) { + if (CHOMPING_CLIP === chomping) { + chomping = (ch === 0x2B/* + */) ? CHOMPING_KEEP : CHOMPING_STRIP; + } else { + throwError(state, 'repeat of a chomping mode identifier'); + } + + } else if ((tmp = fromDecimalCode(ch)) >= 0) { + if (tmp === 0) { + throwError(state, 'bad explicit indentation width of a block scalar; it cannot be less than one'); + } else if (!detectedIndent) { + textIndent = nodeIndent + tmp - 1; + detectedIndent = true; + } else { + throwError(state, 'repeat of an indentation width identifier'); + } + + } else { + break; + } + } + + if (is_WHITE_SPACE(ch)) { + do { ch = state.input.charCodeAt(++state.position); } + while (is_WHITE_SPACE(ch)); + + if (ch === 0x23/* # */) { + do { ch = state.input.charCodeAt(++state.position); } + while (!is_EOL(ch) && (ch !== 0)); + } + } + + while (ch !== 0) { + readLineBreak(state); + state.lineIndent = 0; + + ch = state.input.charCodeAt(state.position); + + while ((!detectedIndent || state.lineIndent < textIndent) && + (ch === 0x20/* Space */)) { + state.lineIndent++; + ch = state.input.charCodeAt(++state.position); + } + + if (!detectedIndent && state.lineIndent > textIndent) { + textIndent = state.lineIndent; + } + + if (is_EOL(ch)) { + emptyLines++; + continue; + } + + // End of the scalar. + if (state.lineIndent < textIndent) { + + // Perform the chomping. + if (chomping === CHOMPING_KEEP) { + state.result += common.repeat('\n', didReadContent ? 1 + emptyLines : emptyLines); + } else if (chomping === CHOMPING_CLIP) { + if (didReadContent) { // i.e. only if the scalar is not empty. + state.result += '\n'; + } + } + + // Break this `while` cycle and go to the funciton's epilogue. + break; + } + + // Folded style: use fancy rules to handle line breaks. + if (folding) { + + // Lines starting with white space characters (more-indented lines) are not folded. + if (is_WHITE_SPACE(ch)) { + atMoreIndented = true; + // except for the first content line (cf. Example 8.1) + state.result += common.repeat('\n', didReadContent ? 1 + emptyLines : emptyLines); + + // End of more-indented block. + } else if (atMoreIndented) { + atMoreIndented = false; + state.result += common.repeat('\n', emptyLines + 1); + + // Just one line break - perceive as the same line. + } else if (emptyLines === 0) { + if (didReadContent) { // i.e. only if we have already read some scalar content. + state.result += ' '; + } + + // Several line breaks - perceive as different lines. + } else { + state.result += common.repeat('\n', emptyLines); + } + + // Literal style: just add exact number of line breaks between content lines. + } else { + // Keep all line breaks except the header line break. + state.result += common.repeat('\n', didReadContent ? 1 + emptyLines : emptyLines); + } + + didReadContent = true; + detectedIndent = true; + emptyLines = 0; + captureStart = state.position; + + while (!is_EOL(ch) && (ch !== 0)) { + ch = state.input.charCodeAt(++state.position); + } + + captureSegment(state, captureStart, state.position, false); + } + + return true; +} + +function readBlockSequence(state, nodeIndent) { + var _line, + _tag = state.tag, + _anchor = state.anchor, + _result = [], + following, + detected = false, + ch; + + // there is a leading tab before this token, so it can't be a block sequence/mapping; + // it can still be flow sequence/mapping or a scalar + if (state.firstTabInLine !== -1) return false; + + if (state.anchor !== null) { + state.anchorMap[state.anchor] = _result; + } + + ch = state.input.charCodeAt(state.position); + + while (ch !== 0) { + if (state.firstTabInLine !== -1) { + state.position = state.firstTabInLine; + throwError(state, 'tab characters must not be used in indentation'); + } + + if (ch !== 0x2D/* - */) { + break; + } + + following = state.input.charCodeAt(state.position + 1); + + if (!is_WS_OR_EOL(following)) { + break; + } + + detected = true; + state.position++; + + if (skipSeparationSpace(state, true, -1)) { + if (state.lineIndent <= nodeIndent) { + _result.push(null); + ch = state.input.charCodeAt(state.position); + continue; + } + } + + _line = state.line; + composeNode(state, nodeIndent, CONTEXT_BLOCK_IN, false, true); + _result.push(state.result); + skipSeparationSpace(state, true, -1); + + ch = state.input.charCodeAt(state.position); + + if ((state.line === _line || state.lineIndent > nodeIndent) && (ch !== 0)) { + throwError(state, 'bad indentation of a sequence entry'); + } else if (state.lineIndent < nodeIndent) { + break; + } + } + + if (detected) { + state.tag = _tag; + state.anchor = _anchor; + state.kind = 'sequence'; + state.result = _result; + return true; + } + return false; +} + +function readBlockMapping(state, nodeIndent, flowIndent) { + var following, + allowCompact, + _line, + _keyLine, + _keyLineStart, + _keyPos, + _tag = state.tag, + _anchor = state.anchor, + _result = {}, + overridableKeys = Object.create(null), + keyTag = null, + keyNode = null, + valueNode = null, + atExplicitKey = false, + detected = false, + ch; + + // there is a leading tab before this token, so it can't be a block sequence/mapping; + // it can still be flow sequence/mapping or a scalar + if (state.firstTabInLine !== -1) return false; + + if (state.anchor !== null) { + state.anchorMap[state.anchor] = _result; + } + + ch = state.input.charCodeAt(state.position); + + while (ch !== 0) { + if (!atExplicitKey && state.firstTabInLine !== -1) { + state.position = state.firstTabInLine; + throwError(state, 'tab characters must not be used in indentation'); + } + + following = state.input.charCodeAt(state.position + 1); + _line = state.line; // Save the current line. + + // + // Explicit notation case. There are two separate blocks: + // first for the key (denoted by "?") and second for the value (denoted by ":") + // + if ((ch === 0x3F/* ? */ || ch === 0x3A/* : */) && is_WS_OR_EOL(following)) { + + if (ch === 0x3F/* ? */) { + if (atExplicitKey) { + storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, null, _keyLine, _keyLineStart, _keyPos); + keyTag = keyNode = valueNode = null; + } + + detected = true; + atExplicitKey = true; + allowCompact = true; + + } else if (atExplicitKey) { + // i.e. 0x3A/* : */ === character after the explicit key. + atExplicitKey = false; + allowCompact = true; + + } else { + throwError(state, 'incomplete explicit mapping pair; a key node is missed; or followed by a non-tabulated empty line'); + } + + state.position += 1; + ch = following; + + // + // Implicit notation case. Flow-style node as the key first, then ":", and the value. + // + } else { + _keyLine = state.line; + _keyLineStart = state.lineStart; + _keyPos = state.position; + + if (!composeNode(state, flowIndent, CONTEXT_FLOW_OUT, false, true)) { + // Neither implicit nor explicit notation. + // Reading is done. Go to the epilogue. + break; + } + + if (state.line === _line) { + ch = state.input.charCodeAt(state.position); + + while (is_WHITE_SPACE(ch)) { + ch = state.input.charCodeAt(++state.position); + } + + if (ch === 0x3A/* : */) { + ch = state.input.charCodeAt(++state.position); + + if (!is_WS_OR_EOL(ch)) { + throwError(state, 'a whitespace character is expected after the key-value separator within a block mapping'); + } + + if (atExplicitKey) { + storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, null, _keyLine, _keyLineStart, _keyPos); + keyTag = keyNode = valueNode = null; + } + + detected = true; + atExplicitKey = false; + allowCompact = false; + keyTag = state.tag; + keyNode = state.result; + + } else if (detected) { + throwError(state, 'can not read an implicit mapping pair; a colon is missed'); + + } else { + state.tag = _tag; + state.anchor = _anchor; + return true; // Keep the result of `composeNode`. + } + + } else if (detected) { + throwError(state, 'can not read a block mapping entry; a multiline key may not be an implicit key'); + + } else { + state.tag = _tag; + state.anchor = _anchor; + return true; // Keep the result of `composeNode`. + } + } + + // + // Common reading code for both explicit and implicit notations. + // + if (state.line === _line || state.lineIndent > nodeIndent) { + if (atExplicitKey) { + _keyLine = state.line; + _keyLineStart = state.lineStart; + _keyPos = state.position; + } + + if (composeNode(state, nodeIndent, CONTEXT_BLOCK_OUT, true, allowCompact)) { + if (atExplicitKey) { + keyNode = state.result; + } else { + valueNode = state.result; + } + } + + if (!atExplicitKey) { + storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, valueNode, _keyLine, _keyLineStart, _keyPos); + keyTag = keyNode = valueNode = null; + } + + skipSeparationSpace(state, true, -1); + ch = state.input.charCodeAt(state.position); + } + + if ((state.line === _line || state.lineIndent > nodeIndent) && (ch !== 0)) { + throwError(state, 'bad indentation of a mapping entry'); + } else if (state.lineIndent < nodeIndent) { + break; + } + } + + // + // Epilogue. + // + + // Special case: last mapping's node contains only the key in explicit notation. + if (atExplicitKey) { + storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, null, _keyLine, _keyLineStart, _keyPos); + } + + // Expose the resulting mapping. + if (detected) { + state.tag = _tag; + state.anchor = _anchor; + state.kind = 'mapping'; + state.result = _result; + } + + return detected; +} + +function readTagProperty(state) { + var _position, + isVerbatim = false, + isNamed = false, + tagHandle, + tagName, + ch; + + ch = state.input.charCodeAt(state.position); + + if (ch !== 0x21/* ! */) return false; + + if (state.tag !== null) { + throwError(state, 'duplication of a tag property'); + } + + ch = state.input.charCodeAt(++state.position); + + if (ch === 0x3C/* < */) { + isVerbatim = true; + ch = state.input.charCodeAt(++state.position); + + } else if (ch === 0x21/* ! */) { + isNamed = true; + tagHandle = '!!'; + ch = state.input.charCodeAt(++state.position); + + } else { + tagHandle = '!'; + } + + _position = state.position; + + if (isVerbatim) { + do { ch = state.input.charCodeAt(++state.position); } + while (ch !== 0 && ch !== 0x3E/* > */); + + if (state.position < state.length) { + tagName = state.input.slice(_position, state.position); + ch = state.input.charCodeAt(++state.position); + } else { + throwError(state, 'unexpected end of the stream within a verbatim tag'); + } + } else { + while (ch !== 0 && !is_WS_OR_EOL(ch)) { + + if (ch === 0x21/* ! */) { + if (!isNamed) { + tagHandle = state.input.slice(_position - 1, state.position + 1); + + if (!PATTERN_TAG_HANDLE.test(tagHandle)) { + throwError(state, 'named tag handle cannot contain such characters'); + } + + isNamed = true; + _position = state.position + 1; + } else { + throwError(state, 'tag suffix cannot contain exclamation marks'); + } + } + + ch = state.input.charCodeAt(++state.position); + } + + tagName = state.input.slice(_position, state.position); + + if (PATTERN_FLOW_INDICATORS.test(tagName)) { + throwError(state, 'tag suffix cannot contain flow indicator characters'); + } + } + + if (tagName && !PATTERN_TAG_URI.test(tagName)) { + throwError(state, 'tag name cannot contain such characters: ' + tagName); + } + + try { + tagName = decodeURIComponent(tagName); + } catch (err) { + throwError(state, 'tag name is malformed: ' + tagName); + } + + if (isVerbatim) { + state.tag = tagName; + + } else if (_hasOwnProperty.call(state.tagMap, tagHandle)) { + state.tag = state.tagMap[tagHandle] + tagName; + + } else if (tagHandle === '!') { + state.tag = '!' + tagName; + + } else if (tagHandle === '!!') { + state.tag = 'tag:yaml.org,2002:' + tagName; + + } else { + throwError(state, 'undeclared tag handle "' + tagHandle + '"'); + } + + return true; +} + +function readAnchorProperty(state) { + var _position, + ch; + + ch = state.input.charCodeAt(state.position); + + if (ch !== 0x26/* & */) return false; + + if (state.anchor !== null) { + throwError(state, 'duplication of an anchor property'); + } + + ch = state.input.charCodeAt(++state.position); + _position = state.position; + + while (ch !== 0 && !is_WS_OR_EOL(ch) && !is_FLOW_INDICATOR(ch)) { + ch = state.input.charCodeAt(++state.position); + } + + if (state.position === _position) { + throwError(state, 'name of an anchor node must contain at least one character'); + } + + state.anchor = state.input.slice(_position, state.position); + return true; +} + +function readAlias(state) { + var _position, alias, + ch; + + ch = state.input.charCodeAt(state.position); + + if (ch !== 0x2A/* * */) return false; + + ch = state.input.charCodeAt(++state.position); + _position = state.position; + + while (ch !== 0 && !is_WS_OR_EOL(ch) && !is_FLOW_INDICATOR(ch)) { + ch = state.input.charCodeAt(++state.position); + } + + if (state.position === _position) { + throwError(state, 'name of an alias node must contain at least one character'); + } + + alias = state.input.slice(_position, state.position); + + if (!_hasOwnProperty.call(state.anchorMap, alias)) { + throwError(state, 'unidentified alias "' + alias + '"'); + } + + state.result = state.anchorMap[alias]; + skipSeparationSpace(state, true, -1); + return true; +} + +function composeNode(state, parentIndent, nodeContext, allowToSeek, allowCompact) { + var allowBlockStyles, + allowBlockScalars, + allowBlockCollections, + indentStatus = 1, // 1: this>parent, 0: this=parent, -1: this parentIndent) { + indentStatus = 1; + } else if (state.lineIndent === parentIndent) { + indentStatus = 0; + } else if (state.lineIndent < parentIndent) { + indentStatus = -1; + } + } + } + + if (indentStatus === 1) { + while (readTagProperty(state) || readAnchorProperty(state)) { + if (skipSeparationSpace(state, true, -1)) { + atNewLine = true; + allowBlockCollections = allowBlockStyles; + + if (state.lineIndent > parentIndent) { + indentStatus = 1; + } else if (state.lineIndent === parentIndent) { + indentStatus = 0; + } else if (state.lineIndent < parentIndent) { + indentStatus = -1; + } + } else { + allowBlockCollections = false; + } + } + } + + if (allowBlockCollections) { + allowBlockCollections = atNewLine || allowCompact; + } + + if (indentStatus === 1 || CONTEXT_BLOCK_OUT === nodeContext) { + if (CONTEXT_FLOW_IN === nodeContext || CONTEXT_FLOW_OUT === nodeContext) { + flowIndent = parentIndent; + } else { + flowIndent = parentIndent + 1; + } + + blockIndent = state.position - state.lineStart; + + if (indentStatus === 1) { + if (allowBlockCollections && + (readBlockSequence(state, blockIndent) || + readBlockMapping(state, blockIndent, flowIndent)) || + readFlowCollection(state, flowIndent)) { + hasContent = true; + } else { + if ((allowBlockScalars && readBlockScalar(state, flowIndent)) || + readSingleQuotedScalar(state, flowIndent) || + readDoubleQuotedScalar(state, flowIndent)) { + hasContent = true; + + } else if (readAlias(state)) { + hasContent = true; + + if (state.tag !== null || state.anchor !== null) { + throwError(state, 'alias node should not have any properties'); + } + + } else if (readPlainScalar(state, flowIndent, CONTEXT_FLOW_IN === nodeContext)) { + hasContent = true; + + if (state.tag === null) { + state.tag = '?'; + } + } + + if (state.anchor !== null) { + state.anchorMap[state.anchor] = state.result; + } + } + } else if (indentStatus === 0) { + // Special case: block sequences are allowed to have same indentation level as the parent. + // http://www.yaml.org/spec/1.2/spec.html#id2799784 + hasContent = allowBlockCollections && readBlockSequence(state, blockIndent); + } + } + + if (state.tag === null) { + if (state.anchor !== null) { + state.anchorMap[state.anchor] = state.result; + } + + } else if (state.tag === '?') { + // Implicit resolving is not allowed for non-scalar types, and '?' + // non-specific tag is only automatically assigned to plain scalars. + // + // We only need to check kind conformity in case user explicitly assigns '?' + // tag, for example like this: "! [0]" + // + if (state.result !== null && state.kind !== 'scalar') { + throwError(state, 'unacceptable node kind for ! tag; it should be "scalar", not "' + state.kind + '"'); + } + + for (typeIndex = 0, typeQuantity = state.implicitTypes.length; typeIndex < typeQuantity; typeIndex += 1) { + type = state.implicitTypes[typeIndex]; + + if (type.resolve(state.result)) { // `state.result` updated in resolver if matched + state.result = type.construct(state.result); + state.tag = type.tag; + if (state.anchor !== null) { + state.anchorMap[state.anchor] = state.result; + } + break; + } + } + } else if (state.tag !== '!') { + if (_hasOwnProperty.call(state.typeMap[state.kind || 'fallback'], state.tag)) { + type = state.typeMap[state.kind || 'fallback'][state.tag]; + } else { + // looking for multi type + type = null; + typeList = state.typeMap.multi[state.kind || 'fallback']; + + for (typeIndex = 0, typeQuantity = typeList.length; typeIndex < typeQuantity; typeIndex += 1) { + if (state.tag.slice(0, typeList[typeIndex].tag.length) === typeList[typeIndex].tag) { + type = typeList[typeIndex]; + break; + } + } + } + + if (!type) { + throwError(state, 'unknown tag !<' + state.tag + '>'); + } + + if (state.result !== null && type.kind !== state.kind) { + throwError(state, 'unacceptable node kind for !<' + state.tag + '> tag; it should be "' + type.kind + '", not "' + state.kind + '"'); + } + + if (!type.resolve(state.result, state.tag)) { // `state.result` updated in resolver if matched + throwError(state, 'cannot resolve a node with !<' + state.tag + '> explicit tag'); + } else { + state.result = type.construct(state.result, state.tag); + if (state.anchor !== null) { + state.anchorMap[state.anchor] = state.result; + } + } + } + + if (state.listener !== null) { + state.listener('close', state); + } + return state.tag !== null || state.anchor !== null || hasContent; +} + +function readDocument(state) { + var documentStart = state.position, + _position, + directiveName, + directiveArgs, + hasDirectives = false, + ch; + + state.version = null; + state.checkLineBreaks = state.legacy; + state.tagMap = Object.create(null); + state.anchorMap = Object.create(null); + + while ((ch = state.input.charCodeAt(state.position)) !== 0) { + skipSeparationSpace(state, true, -1); + + ch = state.input.charCodeAt(state.position); + + if (state.lineIndent > 0 || ch !== 0x25/* % */) { + break; + } + + hasDirectives = true; + ch = state.input.charCodeAt(++state.position); + _position = state.position; + + while (ch !== 0 && !is_WS_OR_EOL(ch)) { + ch = state.input.charCodeAt(++state.position); + } + + directiveName = state.input.slice(_position, state.position); + directiveArgs = []; + + if (directiveName.length < 1) { + throwError(state, 'directive name must not be less than one character in length'); + } + + while (ch !== 0) { + while (is_WHITE_SPACE(ch)) { + ch = state.input.charCodeAt(++state.position); + } + + if (ch === 0x23/* # */) { + do { ch = state.input.charCodeAt(++state.position); } + while (ch !== 0 && !is_EOL(ch)); + break; + } + + if (is_EOL(ch)) break; + + _position = state.position; + + while (ch !== 0 && !is_WS_OR_EOL(ch)) { + ch = state.input.charCodeAt(++state.position); + } + + directiveArgs.push(state.input.slice(_position, state.position)); + } + + if (ch !== 0) readLineBreak(state); + + if (_hasOwnProperty.call(directiveHandlers, directiveName)) { + directiveHandlers[directiveName](state, directiveName, directiveArgs); + } else { + throwWarning(state, 'unknown document directive "' + directiveName + '"'); + } + } + + skipSeparationSpace(state, true, -1); + + if (state.lineIndent === 0 && + state.input.charCodeAt(state.position) === 0x2D/* - */ && + state.input.charCodeAt(state.position + 1) === 0x2D/* - */ && + state.input.charCodeAt(state.position + 2) === 0x2D/* - */) { + state.position += 3; + skipSeparationSpace(state, true, -1); + + } else if (hasDirectives) { + throwError(state, 'directives end mark is expected'); + } + + composeNode(state, state.lineIndent - 1, CONTEXT_BLOCK_OUT, false, true); + skipSeparationSpace(state, true, -1); + + if (state.checkLineBreaks && + PATTERN_NON_ASCII_LINE_BREAKS.test(state.input.slice(documentStart, state.position))) { + throwWarning(state, 'non-ASCII line breaks are interpreted as content'); + } + + state.documents.push(state.result); + + if (state.position === state.lineStart && testDocumentSeparator(state)) { + + if (state.input.charCodeAt(state.position) === 0x2E/* . */) { + state.position += 3; + skipSeparationSpace(state, true, -1); + } + return; + } + + if (state.position < (state.length - 1)) { + throwError(state, 'end of the stream or a document separator is expected'); + } else { + return; + } +} + + +function loadDocuments(input, options) { + input = String(input); + options = options || {}; + + if (input.length !== 0) { + + // Add tailing `\n` if not exists + if (input.charCodeAt(input.length - 1) !== 0x0A/* LF */ && + input.charCodeAt(input.length - 1) !== 0x0D/* CR */) { + input += '\n'; + } + + // Strip BOM + if (input.charCodeAt(0) === 0xFEFF) { + input = input.slice(1); + } + } + + var state = new State(input, options); + + var nullpos = input.indexOf('\0'); + + if (nullpos !== -1) { + state.position = nullpos; + throwError(state, 'null byte is not allowed in input'); + } + + // Use 0 as string terminator. That significantly simplifies bounds check. + state.input += '\0'; + + while (state.input.charCodeAt(state.position) === 0x20/* Space */) { + state.lineIndent += 1; + state.position += 1; + } + + while (state.position < (state.length - 1)) { + readDocument(state); + } + + return state.documents; +} + + +function loadAll(input, iterator, options) { + if (iterator !== null && typeof iterator === 'object' && typeof options === 'undefined') { + options = iterator; + iterator = null; + } + + var documents = loadDocuments(input, options); + + if (typeof iterator !== 'function') { + return documents; + } + + for (var index = 0, length = documents.length; index < length; index += 1) { + iterator(documents[index]); + } +} + + +function load(input, options) { + var documents = loadDocuments(input, options); + + if (documents.length === 0) { + /*eslint-disable no-undefined*/ + return undefined; + } else if (documents.length === 1) { + return documents[0]; + } + throw new YAMLException('expected a single document in the stream, but found more'); +} + + +module.exports.loadAll = loadAll; +module.exports.load = load; diff --git a/node_modules/js-yaml/lib/schema.js b/node_modules/js-yaml/lib/schema.js new file mode 100644 index 0000000..65b41f4 --- /dev/null +++ b/node_modules/js-yaml/lib/schema.js @@ -0,0 +1,121 @@ +'use strict'; + +/*eslint-disable max-len*/ + +var YAMLException = require('./exception'); +var Type = require('./type'); + + +function compileList(schema, name) { + var result = []; + + schema[name].forEach(function (currentType) { + var newIndex = result.length; + + result.forEach(function (previousType, previousIndex) { + if (previousType.tag === currentType.tag && + previousType.kind === currentType.kind && + previousType.multi === currentType.multi) { + + newIndex = previousIndex; + } + }); + + result[newIndex] = currentType; + }); + + return result; +} + + +function compileMap(/* lists... */) { + var result = { + scalar: {}, + sequence: {}, + mapping: {}, + fallback: {}, + multi: { + scalar: [], + sequence: [], + mapping: [], + fallback: [] + } + }, index, length; + + function collectType(type) { + if (type.multi) { + result.multi[type.kind].push(type); + result.multi['fallback'].push(type); + } else { + result[type.kind][type.tag] = result['fallback'][type.tag] = type; + } + } + + for (index = 0, length = arguments.length; index < length; index += 1) { + arguments[index].forEach(collectType); + } + return result; +} + + +function Schema(definition) { + return this.extend(definition); +} + + +Schema.prototype.extend = function extend(definition) { + var implicit = []; + var explicit = []; + + if (definition instanceof Type) { + // Schema.extend(type) + explicit.push(definition); + + } else if (Array.isArray(definition)) { + // Schema.extend([ type1, type2, ... ]) + explicit = explicit.concat(definition); + + } else if (definition && (Array.isArray(definition.implicit) || Array.isArray(definition.explicit))) { + // Schema.extend({ explicit: [ type1, type2, ... ], implicit: [ type1, type2, ... ] }) + if (definition.implicit) implicit = implicit.concat(definition.implicit); + if (definition.explicit) explicit = explicit.concat(definition.explicit); + + } else { + throw new YAMLException('Schema.extend argument should be a Type, [ Type ], ' + + 'or a schema definition ({ implicit: [...], explicit: [...] })'); + } + + implicit.forEach(function (type) { + if (!(type instanceof Type)) { + throw new YAMLException('Specified list of YAML types (or a single Type object) contains a non-Type object.'); + } + + if (type.loadKind && type.loadKind !== 'scalar') { + throw new YAMLException('There is a non-scalar type in the implicit list of a schema. Implicit resolving of such types is not supported.'); + } + + if (type.multi) { + throw new YAMLException('There is a multi type in the implicit list of a schema. Multi tags can only be listed as explicit.'); + } + }); + + explicit.forEach(function (type) { + if (!(type instanceof Type)) { + throw new YAMLException('Specified list of YAML types (or a single Type object) contains a non-Type object.'); + } + }); + + var result = Object.create(Schema.prototype); + + result.implicit = (this.implicit || []).concat(implicit); + result.explicit = (this.explicit || []).concat(explicit); + + result.compiledImplicit = compileList(result, 'implicit'); + result.compiledExplicit = compileList(result, 'explicit'); + result.compiledTypeMap = compileMap(result.compiledImplicit, result.compiledExplicit); + + return result; +}; + + +module.exports = Schema; diff --git a/node_modules/js-yaml/lib/schema/core.js b/node_modules/js-yaml/lib/schema/core.js new file mode 100644 index 0000000..608b26d --- /dev/null +++ b/node_modules/js-yaml/lib/schema/core.js @@ -0,0 +1,11 @@ +// Standard YAML's Core schema. +// http://www.yaml.org/spec/1.2/spec.html#id2804923 +// +// NOTE: JS-YAML does not support schema-specific tag resolution restrictions. +// So, Core schema has no distinctions from JSON schema is JS-YAML. + + +'use strict'; + + +module.exports = require('./json'); diff --git a/node_modules/js-yaml/lib/schema/default.js b/node_modules/js-yaml/lib/schema/default.js new file mode 100644 index 0000000..3af0520 --- /dev/null +++ b/node_modules/js-yaml/lib/schema/default.js @@ -0,0 +1,22 @@ +// JS-YAML's default schema for `safeLoad` function. +// It is not described in the YAML specification. +// +// This schema is based on standard YAML's Core schema and includes most of +// extra types described at YAML tag repository. (http://yaml.org/type/) + + +'use strict'; + + +module.exports = require('./core').extend({ + implicit: [ + require('../type/timestamp'), + require('../type/merge') + ], + explicit: [ + require('../type/binary'), + require('../type/omap'), + require('../type/pairs'), + require('../type/set') + ] +}); diff --git a/node_modules/js-yaml/lib/schema/failsafe.js b/node_modules/js-yaml/lib/schema/failsafe.js new file mode 100644 index 0000000..b7a33eb --- /dev/null +++ b/node_modules/js-yaml/lib/schema/failsafe.js @@ -0,0 +1,17 @@ +// Standard YAML's Failsafe schema. +// http://www.yaml.org/spec/1.2/spec.html#id2802346 + + +'use strict'; + + +var Schema = require('../schema'); + + +module.exports = new Schema({ + explicit: [ + require('../type/str'), + require('../type/seq'), + require('../type/map') + ] +}); diff --git a/node_modules/js-yaml/lib/schema/json.js b/node_modules/js-yaml/lib/schema/json.js new file mode 100644 index 0000000..b73df78 --- /dev/null +++ b/node_modules/js-yaml/lib/schema/json.js @@ -0,0 +1,19 @@ +// Standard YAML's JSON schema. +// http://www.yaml.org/spec/1.2/spec.html#id2803231 +// +// NOTE: JS-YAML does not support schema-specific tag resolution restrictions. +// So, this schema is not such strict as defined in the YAML specification. +// It allows numbers in binary notaion, use `Null` and `NULL` as `null`, etc. + + +'use strict'; + + +module.exports = require('./failsafe').extend({ + implicit: [ + require('../type/null'), + require('../type/bool'), + require('../type/int'), + require('../type/float') + ] +}); diff --git a/node_modules/js-yaml/lib/snippet.js b/node_modules/js-yaml/lib/snippet.js new file mode 100644 index 0000000..00e2133 --- /dev/null +++ b/node_modules/js-yaml/lib/snippet.js @@ -0,0 +1,101 @@ +'use strict'; + + +var common = require('./common'); + + +// get snippet for a single line, respecting maxLength +function getLine(buffer, lineStart, lineEnd, position, maxLineLength) { + var head = ''; + var tail = ''; + var maxHalfLength = Math.floor(maxLineLength / 2) - 1; + + if (position - lineStart > maxHalfLength) { + head = ' ... '; + lineStart = position - maxHalfLength + head.length; + } + + if (lineEnd - position > maxHalfLength) { + tail = ' ...'; + lineEnd = position + maxHalfLength - tail.length; + } + + return { + str: head + buffer.slice(lineStart, lineEnd).replace(/\t/g, '→') + tail, + pos: position - lineStart + head.length // relative position + }; +} + + +function padStart(string, max) { + return common.repeat(' ', max - string.length) + string; +} + + +function makeSnippet(mark, options) { + options = Object.create(options || null); + + if (!mark.buffer) return null; + + if (!options.maxLength) options.maxLength = 79; + if (typeof options.indent !== 'number') options.indent = 1; + if (typeof options.linesBefore !== 'number') options.linesBefore = 3; + if (typeof options.linesAfter !== 'number') options.linesAfter = 2; + + var re = /\r?\n|\r|\0/g; + var lineStarts = [ 0 ]; + var lineEnds = []; + var match; + var foundLineNo = -1; + + while ((match = re.exec(mark.buffer))) { + lineEnds.push(match.index); + lineStarts.push(match.index + match[0].length); + + if (mark.position <= match.index && foundLineNo < 0) { + foundLineNo = lineStarts.length - 2; + } + } + + if (foundLineNo < 0) foundLineNo = lineStarts.length - 1; + + var result = '', i, line; + var lineNoLength = Math.min(mark.line + options.linesAfter, lineEnds.length).toString().length; + var maxLineLength = options.maxLength - (options.indent + lineNoLength + 3); + + for (i = 1; i <= options.linesBefore; i++) { + if (foundLineNo - i < 0) break; + line = getLine( + mark.buffer, + lineStarts[foundLineNo - i], + lineEnds[foundLineNo - i], + mark.position - (lineStarts[foundLineNo] - lineStarts[foundLineNo - i]), + maxLineLength + ); + result = common.repeat(' ', options.indent) + padStart((mark.line - i + 1).toString(), lineNoLength) + + ' | ' + line.str + '\n' + result; + } + + line = getLine(mark.buffer, lineStarts[foundLineNo], lineEnds[foundLineNo], mark.position, maxLineLength); + result += common.repeat(' ', options.indent) + padStart((mark.line + 1).toString(), lineNoLength) + + ' | ' + line.str + '\n'; + result += common.repeat('-', options.indent + lineNoLength + 3 + line.pos) + '^' + '\n'; + + for (i = 1; i <= options.linesAfter; i++) { + if (foundLineNo + i >= lineEnds.length) break; + line = getLine( + mark.buffer, + lineStarts[foundLineNo + i], + lineEnds[foundLineNo + i], + mark.position - (lineStarts[foundLineNo] - lineStarts[foundLineNo + i]), + maxLineLength + ); + result += common.repeat(' ', options.indent) + padStart((mark.line + i + 1).toString(), lineNoLength) + + ' | ' + line.str + '\n'; + } + + return result.replace(/\n$/, ''); +} + + +module.exports = makeSnippet; diff --git a/node_modules/js-yaml/lib/type.js b/node_modules/js-yaml/lib/type.js new file mode 100644 index 0000000..5e57877 --- /dev/null +++ b/node_modules/js-yaml/lib/type.js @@ -0,0 +1,66 @@ +'use strict'; + +var YAMLException = require('./exception'); + +var TYPE_CONSTRUCTOR_OPTIONS = [ + 'kind', + 'multi', + 'resolve', + 'construct', + 'instanceOf', + 'predicate', + 'represent', + 'representName', + 'defaultStyle', + 'styleAliases' +]; + +var YAML_NODE_KINDS = [ + 'scalar', + 'sequence', + 'mapping' +]; + +function compileStyleAliases(map) { + var result = {}; + + if (map !== null) { + Object.keys(map).forEach(function (style) { + map[style].forEach(function (alias) { + result[String(alias)] = style; + }); + }); + } + + return result; +} + +function Type(tag, options) { + options = options || {}; + + Object.keys(options).forEach(function (name) { + if (TYPE_CONSTRUCTOR_OPTIONS.indexOf(name) === -1) { + throw new YAMLException('Unknown option "' + name + '" is met in definition of "' + tag + '" YAML type.'); + } + }); + + // TODO: Add tag format check. + this.options = options; // keep original options in case user wants to extend this type later + this.tag = tag; + this.kind = options['kind'] || null; + this.resolve = options['resolve'] || function () { return true; }; + this.construct = options['construct'] || function (data) { return data; }; + this.instanceOf = options['instanceOf'] || null; + this.predicate = options['predicate'] || null; + this.represent = options['represent'] || null; + this.representName = options['representName'] || null; + this.defaultStyle = options['defaultStyle'] || null; + this.multi = options['multi'] || false; + this.styleAliases = compileStyleAliases(options['styleAliases'] || null); + + if (YAML_NODE_KINDS.indexOf(this.kind) === -1) { + throw new YAMLException('Unknown kind "' + this.kind + '" is specified for "' + tag + '" YAML type.'); + } +} + +module.exports = Type; diff --git a/node_modules/js-yaml/lib/type/binary.js b/node_modules/js-yaml/lib/type/binary.js new file mode 100644 index 0000000..e152351 --- /dev/null +++ b/node_modules/js-yaml/lib/type/binary.js @@ -0,0 +1,125 @@ +'use strict'; + +/*eslint-disable no-bitwise*/ + + +var Type = require('../type'); + + +// [ 64, 65, 66 ] -> [ padding, CR, LF ] +var BASE64_MAP = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=\n\r'; + + +function resolveYamlBinary(data) { + if (data === null) return false; + + var code, idx, bitlen = 0, max = data.length, map = BASE64_MAP; + + // Convert one by one. + for (idx = 0; idx < max; idx++) { + code = map.indexOf(data.charAt(idx)); + + // Skip CR/LF + if (code > 64) continue; + + // Fail on illegal characters + if (code < 0) return false; + + bitlen += 6; + } + + // If there are any bits left, source was corrupted + return (bitlen % 8) === 0; +} + +function constructYamlBinary(data) { + var idx, tailbits, + input = data.replace(/[\r\n=]/g, ''), // remove CR/LF & padding to simplify scan + max = input.length, + map = BASE64_MAP, + bits = 0, + result = []; + + // Collect by 6*4 bits (3 bytes) + + for (idx = 0; idx < max; idx++) { + if ((idx % 4 === 0) && idx) { + result.push((bits >> 16) & 0xFF); + result.push((bits >> 8) & 0xFF); + result.push(bits & 0xFF); + } + + bits = (bits << 6) | map.indexOf(input.charAt(idx)); + } + + // Dump tail + + tailbits = (max % 4) * 6; + + if (tailbits === 0) { + result.push((bits >> 16) & 0xFF); + result.push((bits >> 8) & 0xFF); + result.push(bits & 0xFF); + } else if (tailbits === 18) { + result.push((bits >> 10) & 0xFF); + result.push((bits >> 2) & 0xFF); + } else if (tailbits === 12) { + result.push((bits >> 4) & 0xFF); + } + + return new Uint8Array(result); +} + +function representYamlBinary(object /*, style*/) { + var result = '', bits = 0, idx, tail, + max = object.length, + map = BASE64_MAP; + + // Convert every three bytes to 4 ASCII characters. + + for (idx = 0; idx < max; idx++) { + if ((idx % 3 === 0) && idx) { + result += map[(bits >> 18) & 0x3F]; + result += map[(bits >> 12) & 0x3F]; + result += map[(bits >> 6) & 0x3F]; + result += map[bits & 0x3F]; + } + + bits = (bits << 8) + object[idx]; + } + + // Dump tail + + tail = max % 3; + + if (tail === 0) { + result += map[(bits >> 18) & 0x3F]; + result += map[(bits >> 12) & 0x3F]; + result += map[(bits >> 6) & 0x3F]; + result += map[bits & 0x3F]; + } else if (tail === 2) { + result += map[(bits >> 10) & 0x3F]; + result += map[(bits >> 4) & 0x3F]; + result += map[(bits << 2) & 0x3F]; + result += map[64]; + } else if (tail === 1) { + result += map[(bits >> 2) & 0x3F]; + result += map[(bits << 4) & 0x3F]; + result += map[64]; + result += map[64]; + } + + return result; +} + +function isBinary(obj) { + return Object.prototype.toString.call(obj) === '[object Uint8Array]'; +} + +module.exports = new Type('tag:yaml.org,2002:binary', { + kind: 'scalar', + resolve: resolveYamlBinary, + construct: constructYamlBinary, + predicate: isBinary, + represent: representYamlBinary +}); diff --git a/node_modules/js-yaml/lib/type/bool.js b/node_modules/js-yaml/lib/type/bool.js new file mode 100644 index 0000000..cb77459 --- /dev/null +++ b/node_modules/js-yaml/lib/type/bool.js @@ -0,0 +1,35 @@ +'use strict'; + +var Type = require('../type'); + +function resolveYamlBoolean(data) { + if (data === null) return false; + + var max = data.length; + + return (max === 4 && (data === 'true' || data === 'True' || data === 'TRUE')) || + (max === 5 && (data === 'false' || data === 'False' || data === 'FALSE')); +} + +function constructYamlBoolean(data) { + return data === 'true' || + data === 'True' || + data === 'TRUE'; +} + +function isBoolean(object) { + return Object.prototype.toString.call(object) === '[object Boolean]'; +} + +module.exports = new Type('tag:yaml.org,2002:bool', { + kind: 'scalar', + resolve: resolveYamlBoolean, + construct: constructYamlBoolean, + predicate: isBoolean, + represent: { + lowercase: function (object) { return object ? 'true' : 'false'; }, + uppercase: function (object) { return object ? 'TRUE' : 'FALSE'; }, + camelcase: function (object) { return object ? 'True' : 'False'; } + }, + defaultStyle: 'lowercase' +}); diff --git a/node_modules/js-yaml/lib/type/float.js b/node_modules/js-yaml/lib/type/float.js new file mode 100644 index 0000000..74d77ec --- /dev/null +++ b/node_modules/js-yaml/lib/type/float.js @@ -0,0 +1,97 @@ +'use strict'; + +var common = require('../common'); +var Type = require('../type'); + +var YAML_FLOAT_PATTERN = new RegExp( + // 2.5e4, 2.5 and integers + '^(?:[-+]?(?:[0-9][0-9_]*)(?:\\.[0-9_]*)?(?:[eE][-+]?[0-9]+)?' + + // .2e4, .2 + // special case, seems not from spec + '|\\.[0-9_]+(?:[eE][-+]?[0-9]+)?' + + // .inf + '|[-+]?\\.(?:inf|Inf|INF)' + + // .nan + '|\\.(?:nan|NaN|NAN))$'); + +function resolveYamlFloat(data) { + if (data === null) return false; + + if (!YAML_FLOAT_PATTERN.test(data) || + // Quick hack to not allow integers end with `_` + // Probably should update regexp & check speed + data[data.length - 1] === '_') { + return false; + } + + return true; +} + +function constructYamlFloat(data) { + var value, sign; + + value = data.replace(/_/g, '').toLowerCase(); + sign = value[0] === '-' ? -1 : 1; + + if ('+-'.indexOf(value[0]) >= 0) { + value = value.slice(1); + } + + if (value === '.inf') { + return (sign === 1) ? Number.POSITIVE_INFINITY : Number.NEGATIVE_INFINITY; + + } else if (value === '.nan') { + return NaN; + } + return sign * parseFloat(value, 10); +} + + +var SCIENTIFIC_WITHOUT_DOT = /^[-+]?[0-9]+e/; + +function representYamlFloat(object, style) { + var res; + + if (isNaN(object)) { + switch (style) { + case 'lowercase': return '.nan'; + case 'uppercase': return '.NAN'; + case 'camelcase': return '.NaN'; + } + } else if (Number.POSITIVE_INFINITY === object) { + switch (style) { + case 'lowercase': return '.inf'; + case 'uppercase': return '.INF'; + case 'camelcase': return '.Inf'; + } + } else if (Number.NEGATIVE_INFINITY === object) { + switch (style) { + case 'lowercase': return '-.inf'; + case 'uppercase': return '-.INF'; + case 'camelcase': return '-.Inf'; + } + } else if (common.isNegativeZero(object)) { + return '-0.0'; + } + + res = object.toString(10); + + // JS stringifier can build scientific format without dots: 5e-100, + // while YAML requres dot: 5.e-100. Fix it with simple hack + + return SCIENTIFIC_WITHOUT_DOT.test(res) ? res.replace('e', '.e') : res; +} + +function isFloat(object) { + return (Object.prototype.toString.call(object) === '[object Number]') && + (object % 1 !== 0 || common.isNegativeZero(object)); +} + +module.exports = new Type('tag:yaml.org,2002:float', { + kind: 'scalar', + resolve: resolveYamlFloat, + construct: constructYamlFloat, + predicate: isFloat, + represent: representYamlFloat, + defaultStyle: 'lowercase' +}); diff --git a/node_modules/js-yaml/lib/type/int.js b/node_modules/js-yaml/lib/type/int.js new file mode 100644 index 0000000..3fe3a44 --- /dev/null +++ b/node_modules/js-yaml/lib/type/int.js @@ -0,0 +1,156 @@ +'use strict'; + +var common = require('../common'); +var Type = require('../type'); + +function isHexCode(c) { + return ((0x30/* 0 */ <= c) && (c <= 0x39/* 9 */)) || + ((0x41/* A */ <= c) && (c <= 0x46/* F */)) || + ((0x61/* a */ <= c) && (c <= 0x66/* f */)); +} + +function isOctCode(c) { + return ((0x30/* 0 */ <= c) && (c <= 0x37/* 7 */)); +} + +function isDecCode(c) { + return ((0x30/* 0 */ <= c) && (c <= 0x39/* 9 */)); +} + +function resolveYamlInteger(data) { + if (data === null) return false; + + var max = data.length, + index = 0, + hasDigits = false, + ch; + + if (!max) return false; + + ch = data[index]; + + // sign + if (ch === '-' || ch === '+') { + ch = data[++index]; + } + + if (ch === '0') { + // 0 + if (index + 1 === max) return true; + ch = data[++index]; + + // base 2, base 8, base 16 + + if (ch === 'b') { + // base 2 + index++; + + for (; index < max; index++) { + ch = data[index]; + if (ch === '_') continue; + if (ch !== '0' && ch !== '1') return false; + hasDigits = true; + } + return hasDigits && ch !== '_'; + } + + + if (ch === 'x') { + // base 16 + index++; + + for (; index < max; index++) { + ch = data[index]; + if (ch === '_') continue; + if (!isHexCode(data.charCodeAt(index))) return false; + hasDigits = true; + } + return hasDigits && ch !== '_'; + } + + + if (ch === 'o') { + // base 8 + index++; + + for (; index < max; index++) { + ch = data[index]; + if (ch === '_') continue; + if (!isOctCode(data.charCodeAt(index))) return false; + hasDigits = true; + } + return hasDigits && ch !== '_'; + } + } + + // base 10 (except 0) + + // value should not start with `_`; + if (ch === '_') return false; + + for (; index < max; index++) { + ch = data[index]; + if (ch === '_') continue; + if (!isDecCode(data.charCodeAt(index))) { + return false; + } + hasDigits = true; + } + + // Should have digits and should not end with `_` + if (!hasDigits || ch === '_') return false; + + return true; +} + +function constructYamlInteger(data) { + var value = data, sign = 1, ch; + + if (value.indexOf('_') !== -1) { + value = value.replace(/_/g, ''); + } + + ch = value[0]; + + if (ch === '-' || ch === '+') { + if (ch === '-') sign = -1; + value = value.slice(1); + ch = value[0]; + } + + if (value === '0') return 0; + + if (ch === '0') { + if (value[1] === 'b') return sign * parseInt(value.slice(2), 2); + if (value[1] === 'x') return sign * parseInt(value.slice(2), 16); + if (value[1] === 'o') return sign * parseInt(value.slice(2), 8); + } + + return sign * parseInt(value, 10); +} + +function isInteger(object) { + return (Object.prototype.toString.call(object)) === '[object Number]' && + (object % 1 === 0 && !common.isNegativeZero(object)); +} + +module.exports = new Type('tag:yaml.org,2002:int', { + kind: 'scalar', + resolve: resolveYamlInteger, + construct: constructYamlInteger, + predicate: isInteger, + represent: { + binary: function (obj) { return obj >= 0 ? '0b' + obj.toString(2) : '-0b' + obj.toString(2).slice(1); }, + octal: function (obj) { return obj >= 0 ? '0o' + obj.toString(8) : '-0o' + obj.toString(8).slice(1); }, + decimal: function (obj) { return obj.toString(10); }, + /* eslint-disable max-len */ + hexadecimal: function (obj) { return obj >= 0 ? '0x' + obj.toString(16).toUpperCase() : '-0x' + obj.toString(16).toUpperCase().slice(1); } + }, + defaultStyle: 'decimal', + styleAliases: { + binary: [ 2, 'bin' ], + octal: [ 8, 'oct' ], + decimal: [ 10, 'dec' ], + hexadecimal: [ 16, 'hex' ] + } +}); diff --git a/node_modules/js-yaml/lib/type/map.js b/node_modules/js-yaml/lib/type/map.js new file mode 100644 index 0000000..f327bee --- /dev/null +++ b/node_modules/js-yaml/lib/type/map.js @@ -0,0 +1,8 @@ +'use strict'; + +var Type = require('../type'); + +module.exports = new Type('tag:yaml.org,2002:map', { + kind: 'mapping', + construct: function (data) { return data !== null ? data : {}; } +}); diff --git a/node_modules/js-yaml/lib/type/merge.js b/node_modules/js-yaml/lib/type/merge.js new file mode 100644 index 0000000..ae08a86 --- /dev/null +++ b/node_modules/js-yaml/lib/type/merge.js @@ -0,0 +1,12 @@ +'use strict'; + +var Type = require('../type'); + +function resolveYamlMerge(data) { + return data === '<<' || data === null; +} + +module.exports = new Type('tag:yaml.org,2002:merge', { + kind: 'scalar', + resolve: resolveYamlMerge +}); diff --git a/node_modules/js-yaml/lib/type/null.js b/node_modules/js-yaml/lib/type/null.js new file mode 100644 index 0000000..315ca4e --- /dev/null +++ b/node_modules/js-yaml/lib/type/null.js @@ -0,0 +1,35 @@ +'use strict'; + +var Type = require('../type'); + +function resolveYamlNull(data) { + if (data === null) return true; + + var max = data.length; + + return (max === 1 && data === '~') || + (max === 4 && (data === 'null' || data === 'Null' || data === 'NULL')); +} + +function constructYamlNull() { + return null; +} + +function isNull(object) { + return object === null; +} + +module.exports = new Type('tag:yaml.org,2002:null', { + kind: 'scalar', + resolve: resolveYamlNull, + construct: constructYamlNull, + predicate: isNull, + represent: { + canonical: function () { return '~'; }, + lowercase: function () { return 'null'; }, + uppercase: function () { return 'NULL'; }, + camelcase: function () { return 'Null'; }, + empty: function () { return ''; } + }, + defaultStyle: 'lowercase' +}); diff --git a/node_modules/js-yaml/lib/type/omap.js b/node_modules/js-yaml/lib/type/omap.js new file mode 100644 index 0000000..b2b5323 --- /dev/null +++ b/node_modules/js-yaml/lib/type/omap.js @@ -0,0 +1,44 @@ +'use strict'; + +var Type = require('../type'); + +var _hasOwnProperty = Object.prototype.hasOwnProperty; +var _toString = Object.prototype.toString; + +function resolveYamlOmap(data) { + if (data === null) return true; + + var objectKeys = [], index, length, pair, pairKey, pairHasKey, + object = data; + + for (index = 0, length = object.length; index < length; index += 1) { + pair = object[index]; + pairHasKey = false; + + if (_toString.call(pair) !== '[object Object]') return false; + + for (pairKey in pair) { + if (_hasOwnProperty.call(pair, pairKey)) { + if (!pairHasKey) pairHasKey = true; + else return false; + } + } + + if (!pairHasKey) return false; + + if (objectKeys.indexOf(pairKey) === -1) objectKeys.push(pairKey); + else return false; + } + + return true; +} + +function constructYamlOmap(data) { + return data !== null ? data : []; +} + +module.exports = new Type('tag:yaml.org,2002:omap', { + kind: 'sequence', + resolve: resolveYamlOmap, + construct: constructYamlOmap +}); diff --git a/node_modules/js-yaml/lib/type/pairs.js b/node_modules/js-yaml/lib/type/pairs.js new file mode 100644 index 0000000..74b5240 --- /dev/null +++ b/node_modules/js-yaml/lib/type/pairs.js @@ -0,0 +1,53 @@ +'use strict'; + +var Type = require('../type'); + +var _toString = Object.prototype.toString; + +function resolveYamlPairs(data) { + if (data === null) return true; + + var index, length, pair, keys, result, + object = data; + + result = new Array(object.length); + + for (index = 0, length = object.length; index < length; index += 1) { + pair = object[index]; + + if (_toString.call(pair) !== '[object Object]') return false; + + keys = Object.keys(pair); + + if (keys.length !== 1) return false; + + result[index] = [ keys[0], pair[keys[0]] ]; + } + + return true; +} + +function constructYamlPairs(data) { + if (data === null) return []; + + var index, length, pair, keys, result, + object = data; + + result = new Array(object.length); + + for (index = 0, length = object.length; index < length; index += 1) { + pair = object[index]; + + keys = Object.keys(pair); + + result[index] = [ keys[0], pair[keys[0]] ]; + } + + return result; +} + +module.exports = new Type('tag:yaml.org,2002:pairs', { + kind: 'sequence', + resolve: resolveYamlPairs, + construct: constructYamlPairs +}); diff --git a/node_modules/js-yaml/lib/type/seq.js b/node_modules/js-yaml/lib/type/seq.js new file mode 100644 index 0000000..be8f77f --- /dev/null +++ b/node_modules/js-yaml/lib/type/seq.js @@ -0,0 +1,8 @@ +'use strict'; + +var Type = require('../type'); + +module.exports = new Type('tag:yaml.org,2002:seq', { + kind: 'sequence', + construct: function (data) { return data !== null ? data : []; } +}); diff --git a/node_modules/js-yaml/lib/type/set.js b/node_modules/js-yaml/lib/type/set.js new file mode 100644 index 0000000..f885a32 --- /dev/null +++ b/node_modules/js-yaml/lib/type/set.js @@ -0,0 +1,29 @@ +'use strict'; + +var Type = require('../type'); + +var _hasOwnProperty = Object.prototype.hasOwnProperty; + +function resolveYamlSet(data) { + if (data === null) return true; + + var key, object = data; + + for (key in object) { + if (_hasOwnProperty.call(object, key)) { + if (object[key] !== null) return false; + } + } + + return true; +} + +function constructYamlSet(data) { + return data !== null ? data : {}; +} + +module.exports = new Type('tag:yaml.org,2002:set', { + kind: 'mapping', + resolve: resolveYamlSet, + construct: constructYamlSet +}); diff --git a/node_modules/js-yaml/lib/type/str.js b/node_modules/js-yaml/lib/type/str.js new file mode 100644 index 0000000..27acc10 --- /dev/null +++ b/node_modules/js-yaml/lib/type/str.js @@ -0,0 +1,8 @@ +'use strict'; + +var Type = require('../type'); + +module.exports = new Type('tag:yaml.org,2002:str', { + kind: 'scalar', + construct: function (data) { return data !== null ? data : ''; } +}); diff --git a/node_modules/js-yaml/lib/type/timestamp.js b/node_modules/js-yaml/lib/type/timestamp.js new file mode 100644 index 0000000..8fa9c58 --- /dev/null +++ b/node_modules/js-yaml/lib/type/timestamp.js @@ -0,0 +1,88 @@ +'use strict'; + +var Type = require('../type'); + +var YAML_DATE_REGEXP = new RegExp( + '^([0-9][0-9][0-9][0-9])' + // [1] year + '-([0-9][0-9])' + // [2] month + '-([0-9][0-9])$'); // [3] day + +var YAML_TIMESTAMP_REGEXP = new RegExp( + '^([0-9][0-9][0-9][0-9])' + // [1] year + '-([0-9][0-9]?)' + // [2] month + '-([0-9][0-9]?)' + // [3] day + '(?:[Tt]|[ \\t]+)' + // ... + '([0-9][0-9]?)' + // [4] hour + ':([0-9][0-9])' + // [5] minute + ':([0-9][0-9])' + // [6] second + '(?:\\.([0-9]*))?' + // [7] fraction + '(?:[ \\t]*(Z|([-+])([0-9][0-9]?)' + // [8] tz [9] tz_sign [10] tz_hour + '(?::([0-9][0-9]))?))?$'); // [11] tz_minute + +function resolveYamlTimestamp(data) { + if (data === null) return false; + if (YAML_DATE_REGEXP.exec(data) !== null) return true; + if (YAML_TIMESTAMP_REGEXP.exec(data) !== null) return true; + return false; +} + +function constructYamlTimestamp(data) { + var match, year, month, day, hour, minute, second, fraction = 0, + delta = null, tz_hour, tz_minute, date; + + match = YAML_DATE_REGEXP.exec(data); + if (match === null) match = YAML_TIMESTAMP_REGEXP.exec(data); + + if (match === null) throw new Error('Date resolve error'); + + // match: [1] year [2] month [3] day + + year = +(match[1]); + month = +(match[2]) - 1; // JS month starts with 0 + day = +(match[3]); + + if (!match[4]) { // no hour + return new Date(Date.UTC(year, month, day)); + } + + // match: [4] hour [5] minute [6] second [7] fraction + + hour = +(match[4]); + minute = +(match[5]); + second = +(match[6]); + + if (match[7]) { + fraction = match[7].slice(0, 3); + while (fraction.length < 3) { // milli-seconds + fraction += '0'; + } + fraction = +fraction; + } + + // match: [8] tz [9] tz_sign [10] tz_hour [11] tz_minute + + if (match[9]) { + tz_hour = +(match[10]); + tz_minute = +(match[11] || 0); + delta = (tz_hour * 60 + tz_minute) * 60000; // delta in mili-seconds + if (match[9] === '-') delta = -delta; + } + + date = new Date(Date.UTC(year, month, day, hour, minute, second, fraction)); + + if (delta) date.setTime(date.getTime() - delta); + + return date; +} + +function representYamlTimestamp(object /*, style*/) { + return object.toISOString(); +} + +module.exports = new Type('tag:yaml.org,2002:timestamp', { + kind: 'scalar', + resolve: resolveYamlTimestamp, + construct: constructYamlTimestamp, + instanceOf: Date, + represent: representYamlTimestamp +}); diff --git a/node_modules/js-yaml/package.json b/node_modules/js-yaml/package.json new file mode 100644 index 0000000..17574da --- /dev/null +++ b/node_modules/js-yaml/package.json @@ -0,0 +1,66 @@ +{ + "name": "js-yaml", + "version": "4.1.0", + "description": "YAML 1.2 parser and serializer", + "keywords": [ + "yaml", + "parser", + "serializer", + "pyyaml" + ], + "author": "Vladimir Zapparov ", + "contributors": [ + "Aleksey V Zapparov (http://www.ixti.net/)", + "Vitaly Puzrin (https://github.com/puzrin)", + "Martin Grenfell (http://got-ravings.blogspot.com)" + ], + "license": "MIT", + "repository": "nodeca/js-yaml", + "files": [ + "index.js", + "lib/", + "bin/", + "dist/" + ], + "bin": { + "js-yaml": "bin/js-yaml.js" + }, + "module": "./dist/js-yaml.mjs", + "exports": { + ".": { + "import": "./dist/js-yaml.mjs", + "require": "./index.js" + }, + "./package.json": "./package.json" + }, + "scripts": { + "lint": "eslint .", + "test": "npm run lint && mocha", + "coverage": "npm run lint && nyc mocha && nyc report --reporter html", + "demo": "npm run lint && node support/build_demo.js", + "gh-demo": "npm run demo && gh-pages -d demo -f", + "browserify": "rollup -c support/rollup.config.js", + "prepublishOnly": "npm run gh-demo" + }, + "unpkg": "dist/js-yaml.min.js", + "jsdelivr": "dist/js-yaml.min.js", + "dependencies": { + "argparse": "^2.0.1" + }, + "devDependencies": { + "@rollup/plugin-commonjs": "^17.0.0", + "@rollup/plugin-node-resolve": "^11.0.0", + "ansi": "^0.3.1", + "benchmark": "^2.1.4", + "codemirror": "^5.13.4", + "eslint": "^7.0.0", + "fast-check": "^2.8.0", + "gh-pages": "^3.1.0", + "mocha": "^8.2.1", + "nyc": "^15.1.0", + "rollup": "^2.34.1", + "rollup-plugin-node-polyfills": "^0.2.1", + "rollup-plugin-terser": "^7.0.2", + "shelljs": "^0.8.4" + } +} diff --git a/node_modules/ms/index.js b/node_modules/ms/index.js deleted file mode 100644 index 6a522b1..0000000 --- a/node_modules/ms/index.js +++ /dev/null @@ -1,152 +0,0 @@ -/** - * Helpers. - */ - -var s = 1000; -var m = s * 60; -var h = m * 60; -var d = h * 24; -var y = d * 365.25; - -/** - * Parse or format the given `val`. - * - * Options: - * - * - `long` verbose formatting [false] - * - * @param {String|Number} val - * @param {Object} [options] - * @throws {Error} throw an error if val is not a non-empty string or a number - * @return {String|Number} - * @api public - */ - -module.exports = function(val, options) { - options = options || {}; - var type = typeof val; - if (type === 'string' && val.length > 0) { - return parse(val); - } else if (type === 'number' && isNaN(val) === false) { - return options.long ? fmtLong(val) : fmtShort(val); - } - throw new Error( - 'val is not a non-empty string or a valid number. val=' + - JSON.stringify(val) - ); -}; - -/** - * Parse the given `str` and return milliseconds. - * - * @param {String} str - * @return {Number} - * @api private - */ - -function parse(str) { - str = String(str); - if (str.length > 100) { - return; - } - var match = /^((?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|years?|yrs?|y)?$/i.exec( - str - ); - if (!match) { - return; - } - var n = parseFloat(match[1]); - var type = (match[2] || 'ms').toLowerCase(); - switch (type) { - case 'years': - case 'year': - case 'yrs': - case 'yr': - case 'y': - return n * y; - case 'days': - case 'day': - case 'd': - return n * d; - case 'hours': - case 'hour': - case 'hrs': - case 'hr': - case 'h': - return n * h; - case 'minutes': - case 'minute': - case 'mins': - case 'min': - case 'm': - return n * m; - case 'seconds': - case 'second': - case 'secs': - case 'sec': - case 's': - return n * s; - case 'milliseconds': - case 'millisecond': - case 'msecs': - case 'msec': - case 'ms': - return n; - default: - return undefined; - } -} - -/** - * Short format for `ms`. - * - * @param {Number} ms - * @return {String} - * @api private - */ - -function fmtShort(ms) { - if (ms >= d) { - return Math.round(ms / d) + 'd'; - } - if (ms >= h) { - return Math.round(ms / h) + 'h'; - } - if (ms >= m) { - return Math.round(ms / m) + 'm'; - } - if (ms >= s) { - return Math.round(ms / s) + 's'; - } - return ms + 'ms'; -} - -/** - * Long format for `ms`. - * - * @param {Number} ms - * @return {String} - * @api private - */ - -function fmtLong(ms) { - return plural(ms, d, 'day') || - plural(ms, h, 'hour') || - plural(ms, m, 'minute') || - plural(ms, s, 'second') || - ms + ' ms'; -} - -/** - * Pluralization helper. - */ - -function plural(ms, n, name) { - if (ms < n) { - return; - } - if (ms < n * 1.5) { - return Math.floor(ms / n) + ' ' + name; - } - return Math.ceil(ms / n) + ' ' + name + 's'; -} diff --git a/node_modules/ms/package.json b/node_modules/ms/package.json deleted file mode 100644 index ba02dea..0000000 --- a/node_modules/ms/package.json +++ /dev/null @@ -1,72 +0,0 @@ -{ - "_args": [ - [ - "ms@2.0.0", - "/Users/wphromma/workspace/actions-curl" - ] - ], - "_from": "ms@2.0.0", - "_id": "ms@2.0.0", - "_inBundle": false, - "_integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=", - "_location": "/ms", - "_phantomChildren": {}, - "_requested": { - "type": "version", - "registry": true, - "raw": "ms@2.0.0", - "name": "ms", - "escapedName": "ms", - "rawSpec": "2.0.0", - "saveSpec": null, - "fetchSpec": "2.0.0" - }, - "_requiredBy": [ - "/debug" - ], - "_resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", - "_spec": "2.0.0", - "_where": "/Users/wphromma/workspace/actions-curl", - "bugs": { - "url": "https://github.com/zeit/ms/issues" - }, - "description": "Tiny milisecond conversion utility", - "devDependencies": { - "eslint": "3.19.0", - "expect.js": "0.3.1", - "husky": "0.13.3", - "lint-staged": "3.4.1", - "mocha": "3.4.1" - }, - "eslintConfig": { - "extends": "eslint:recommended", - "env": { - "node": true, - "es6": true - } - }, - "files": [ - "index.js" - ], - "homepage": "https://github.com/zeit/ms#readme", - "license": "MIT", - "lint-staged": { - "*.js": [ - "npm run lint", - "prettier --single-quote --write", - "git add" - ] - }, - "main": "./index", - "name": "ms", - "repository": { - "type": "git", - "url": "git+https://github.com/zeit/ms.git" - }, - "scripts": { - "lint": "eslint lib/* bin/*", - "precommit": "lint-staged", - "test": "mocha tests.js" - }, - "version": "2.0.0" -} diff --git a/node_modules/ms/readme.md b/node_modules/ms/readme.md deleted file mode 100644 index 84a9974..0000000 --- a/node_modules/ms/readme.md +++ /dev/null @@ -1,51 +0,0 @@ -# ms - -[![Build Status](https://travis-ci.org/zeit/ms.svg?branch=master)](https://travis-ci.org/zeit/ms) -[![Slack Channel](http://zeit-slackin.now.sh/badge.svg)](https://zeit.chat/) - -Use this package to easily convert various time formats to milliseconds. - -## Examples - -```js -ms('2 days') // 172800000 -ms('1d') // 86400000 -ms('10h') // 36000000 -ms('2.5 hrs') // 9000000 -ms('2h') // 7200000 -ms('1m') // 60000 -ms('5s') // 5000 -ms('1y') // 31557600000 -ms('100') // 100 -``` - -### Convert from milliseconds - -```js -ms(60000) // "1m" -ms(2 * 60000) // "2m" -ms(ms('10 hours')) // "10h" -``` - -### Time format written-out - -```js -ms(60000, { long: true }) // "1 minute" -ms(2 * 60000, { long: true }) // "2 minutes" -ms(ms('10 hours'), { long: true }) // "10 hours" -``` - -## Features - -- Works both in [node](https://nodejs.org) and in the browser. -- If a number is supplied to `ms`, a string with a unit is returned. -- If a string that contains the number is supplied, it returns it as a number (e.g.: it returns `100` for `'100'`). -- If you pass a string with a number and a valid unit, the number of equivalent ms is returned. - -## Caught a bug? - -1. [Fork](https://help.github.com/articles/fork-a-repo/) this repository to your own GitHub account and then [clone](https://help.github.com/articles/cloning-a-repository/) it to your local device -2. Link the package to the global module directory: `npm link` -3. Within the module you want to test your local development instance of ms, just link it to the dependencies: `npm link ms`. Instead of the default one from npm, node will now use your clone of ms! - -As always, you can run the tests using: `npm test` diff --git a/node_modules/ms/license.md b/node_modules/regenerator-runtime/LICENSE similarity index 94% rename from node_modules/ms/license.md rename to node_modules/regenerator-runtime/LICENSE index 69b6125..cde61b6 100644 --- a/node_modules/ms/license.md +++ b/node_modules/regenerator-runtime/LICENSE @@ -1,6 +1,6 @@ -The MIT License (MIT) +MIT License -Copyright (c) 2016 Zeit, Inc. +Copyright (c) 2014-present, Facebook, Inc. Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal diff --git a/node_modules/regenerator-runtime/README.md b/node_modules/regenerator-runtime/README.md new file mode 100644 index 0000000..e8702ba --- /dev/null +++ b/node_modules/regenerator-runtime/README.md @@ -0,0 +1,31 @@ +# regenerator-runtime + +Standalone runtime for +[Regenerator](https://github.com/facebook/regenerator)-compiled generator +and `async` functions. + +To import the runtime as a module (recommended), either of the following +import styles will work: +```js +// CommonJS +const regeneratorRuntime = require("regenerator-runtime"); + +// ECMAScript 2015 +import regeneratorRuntime from "regenerator-runtime"; +``` + +To ensure that `regeneratorRuntime` is defined globally, either of the +following styles will work: +```js +// CommonJS +require("regenerator-runtime/runtime"); + +// ECMAScript 2015 +import "regenerator-runtime/runtime.js"; +``` + +To get the absolute file system path of `runtime.js`, evaluate the +following expression: +```js +require("regenerator-runtime/path").path +``` diff --git a/node_modules/regenerator-runtime/package.json b/node_modules/regenerator-runtime/package.json new file mode 100644 index 0000000..23575f4 --- /dev/null +++ b/node_modules/regenerator-runtime/package.json @@ -0,0 +1,19 @@ +{ + "name": "regenerator-runtime", + "author": "Ben Newman ", + "description": "Runtime for Regenerator-compiled generator and async functions.", + "version": "0.13.9", + "main": "runtime.js", + "keywords": [ + "regenerator", + "runtime", + "generator", + "async" + ], + "sideEffects": true, + "repository": { + "type": "git", + "url": "https://github.com/facebook/regenerator/tree/master/packages/runtime" + }, + "license": "MIT" +} diff --git a/node_modules/regenerator-runtime/path.js b/node_modules/regenerator-runtime/path.js new file mode 100644 index 0000000..ced878b --- /dev/null +++ b/node_modules/regenerator-runtime/path.js @@ -0,0 +1,11 @@ +/** + * Copyright (c) 2014-present, Facebook, Inc. + * + * This source code is licensed under the MIT license found in the + * LICENSE file in the root directory of this source tree. + */ + +exports.path = require("path").join( + __dirname, + "runtime.js" +); diff --git a/node_modules/regenerator-runtime/runtime.js b/node_modules/regenerator-runtime/runtime.js new file mode 100644 index 0000000..a64424e --- /dev/null +++ b/node_modules/regenerator-runtime/runtime.js @@ -0,0 +1,754 @@ +/** + * Copyright (c) 2014-present, Facebook, Inc. + * + * This source code is licensed under the MIT license found in the + * LICENSE file in the root directory of this source tree. + */ + +var runtime = (function (exports) { + "use strict"; + + var Op = Object.prototype; + var hasOwn = Op.hasOwnProperty; + var undefined; // More compressible than void 0. + var $Symbol = typeof Symbol === "function" ? Symbol : {}; + var iteratorSymbol = $Symbol.iterator || "@@iterator"; + var asyncIteratorSymbol = $Symbol.asyncIterator || "@@asyncIterator"; + var toStringTagSymbol = $Symbol.toStringTag || "@@toStringTag"; + + function define(obj, key, value) { + Object.defineProperty(obj, key, { + value: value, + enumerable: true, + configurable: true, + writable: true + }); + return obj[key]; + } + try { + // IE 8 has a broken Object.defineProperty that only works on DOM objects. + define({}, ""); + } catch (err) { + define = function(obj, key, value) { + return obj[key] = value; + }; + } + + function wrap(innerFn, outerFn, self, tryLocsList) { + // If outerFn provided and outerFn.prototype is a Generator, then outerFn.prototype instanceof Generator. + var protoGenerator = outerFn && outerFn.prototype instanceof Generator ? outerFn : Generator; + var generator = Object.create(protoGenerator.prototype); + var context = new Context(tryLocsList || []); + + // The ._invoke method unifies the implementations of the .next, + // .throw, and .return methods. + generator._invoke = makeInvokeMethod(innerFn, self, context); + + return generator; + } + exports.wrap = wrap; + + // Try/catch helper to minimize deoptimizations. Returns a completion + // record like context.tryEntries[i].completion. This interface could + // have been (and was previously) designed to take a closure to be + // invoked without arguments, but in all the cases we care about we + // already have an existing method we want to call, so there's no need + // to create a new function object. We can even get away with assuming + // the method takes exactly one argument, since that happens to be true + // in every case, so we don't have to touch the arguments object. The + // only additional allocation required is the completion record, which + // has a stable shape and so hopefully should be cheap to allocate. + function tryCatch(fn, obj, arg) { + try { + return { type: "normal", arg: fn.call(obj, arg) }; + } catch (err) { + return { type: "throw", arg: err }; + } + } + + var GenStateSuspendedStart = "suspendedStart"; + var GenStateSuspendedYield = "suspendedYield"; + var GenStateExecuting = "executing"; + var GenStateCompleted = "completed"; + + // Returning this object from the innerFn has the same effect as + // breaking out of the dispatch switch statement. + var ContinueSentinel = {}; + + // Dummy constructor functions that we use as the .constructor and + // .constructor.prototype properties for functions that return Generator + // objects. For full spec compliance, you may wish to configure your + // minifier not to mangle the names of these two functions. + function Generator() {} + function GeneratorFunction() {} + function GeneratorFunctionPrototype() {} + + // This is a polyfill for %IteratorPrototype% for environments that + // don't natively support it. + var IteratorPrototype = {}; + define(IteratorPrototype, iteratorSymbol, function () { + return this; + }); + + var getProto = Object.getPrototypeOf; + var NativeIteratorPrototype = getProto && getProto(getProto(values([]))); + if (NativeIteratorPrototype && + NativeIteratorPrototype !== Op && + hasOwn.call(NativeIteratorPrototype, iteratorSymbol)) { + // This environment has a native %IteratorPrototype%; use it instead + // of the polyfill. + IteratorPrototype = NativeIteratorPrototype; + } + + var Gp = GeneratorFunctionPrototype.prototype = + Generator.prototype = Object.create(IteratorPrototype); + GeneratorFunction.prototype = GeneratorFunctionPrototype; + define(Gp, "constructor", GeneratorFunctionPrototype); + define(GeneratorFunctionPrototype, "constructor", GeneratorFunction); + GeneratorFunction.displayName = define( + GeneratorFunctionPrototype, + toStringTagSymbol, + "GeneratorFunction" + ); + + // Helper for defining the .next, .throw, and .return methods of the + // Iterator interface in terms of a single ._invoke method. + function defineIteratorMethods(prototype) { + ["next", "throw", "return"].forEach(function(method) { + define(prototype, method, function(arg) { + return this._invoke(method, arg); + }); + }); + } + + exports.isGeneratorFunction = function(genFun) { + var ctor = typeof genFun === "function" && genFun.constructor; + return ctor + ? ctor === GeneratorFunction || + // For the native GeneratorFunction constructor, the best we can + // do is to check its .name property. + (ctor.displayName || ctor.name) === "GeneratorFunction" + : false; + }; + + exports.mark = function(genFun) { + if (Object.setPrototypeOf) { + Object.setPrototypeOf(genFun, GeneratorFunctionPrototype); + } else { + genFun.__proto__ = GeneratorFunctionPrototype; + define(genFun, toStringTagSymbol, "GeneratorFunction"); + } + genFun.prototype = Object.create(Gp); + return genFun; + }; + + // Within the body of any async function, `await x` is transformed to + // `yield regeneratorRuntime.awrap(x)`, so that the runtime can test + // `hasOwn.call(value, "__await")` to determine if the yielded value is + // meant to be awaited. + exports.awrap = function(arg) { + return { __await: arg }; + }; + + function AsyncIterator(generator, PromiseImpl) { + function invoke(method, arg, resolve, reject) { + var record = tryCatch(generator[method], generator, arg); + if (record.type === "throw") { + reject(record.arg); + } else { + var result = record.arg; + var value = result.value; + if (value && + typeof value === "object" && + hasOwn.call(value, "__await")) { + return PromiseImpl.resolve(value.__await).then(function(value) { + invoke("next", value, resolve, reject); + }, function(err) { + invoke("throw", err, resolve, reject); + }); + } + + return PromiseImpl.resolve(value).then(function(unwrapped) { + // When a yielded Promise is resolved, its final value becomes + // the .value of the Promise<{value,done}> result for the + // current iteration. + result.value = unwrapped; + resolve(result); + }, function(error) { + // If a rejected Promise was yielded, throw the rejection back + // into the async generator function so it can be handled there. + return invoke("throw", error, resolve, reject); + }); + } + } + + var previousPromise; + + function enqueue(method, arg) { + function callInvokeWithMethodAndArg() { + return new PromiseImpl(function(resolve, reject) { + invoke(method, arg, resolve, reject); + }); + } + + return previousPromise = + // If enqueue has been called before, then we want to wait until + // all previous Promises have been resolved before calling invoke, + // so that results are always delivered in the correct order. If + // enqueue has not been called before, then it is important to + // call invoke immediately, without waiting on a callback to fire, + // so that the async generator function has the opportunity to do + // any necessary setup in a predictable way. This predictability + // is why the Promise constructor synchronously invokes its + // executor callback, and why async functions synchronously + // execute code before the first await. Since we implement simple + // async functions in terms of async generators, it is especially + // important to get this right, even though it requires care. + previousPromise ? previousPromise.then( + callInvokeWithMethodAndArg, + // Avoid propagating failures to Promises returned by later + // invocations of the iterator. + callInvokeWithMethodAndArg + ) : callInvokeWithMethodAndArg(); + } + + // Define the unified helper method that is used to implement .next, + // .throw, and .return (see defineIteratorMethods). + this._invoke = enqueue; + } + + defineIteratorMethods(AsyncIterator.prototype); + define(AsyncIterator.prototype, asyncIteratorSymbol, function () { + return this; + }); + exports.AsyncIterator = AsyncIterator; + + // Note that simple async functions are implemented on top of + // AsyncIterator objects; they just return a Promise for the value of + // the final result produced by the iterator. + exports.async = function(innerFn, outerFn, self, tryLocsList, PromiseImpl) { + if (PromiseImpl === void 0) PromiseImpl = Promise; + + var iter = new AsyncIterator( + wrap(innerFn, outerFn, self, tryLocsList), + PromiseImpl + ); + + return exports.isGeneratorFunction(outerFn) + ? iter // If outerFn is a generator, return the full iterator. + : iter.next().then(function(result) { + return result.done ? result.value : iter.next(); + }); + }; + + function makeInvokeMethod(innerFn, self, context) { + var state = GenStateSuspendedStart; + + return function invoke(method, arg) { + if (state === GenStateExecuting) { + throw new Error("Generator is already running"); + } + + if (state === GenStateCompleted) { + if (method === "throw") { + throw arg; + } + + // Be forgiving, per 25.3.3.3.3 of the spec: + // https://people.mozilla.org/~jorendorff/es6-draft.html#sec-generatorresume + return doneResult(); + } + + context.method = method; + context.arg = arg; + + while (true) { + var delegate = context.delegate; + if (delegate) { + var delegateResult = maybeInvokeDelegate(delegate, context); + if (delegateResult) { + if (delegateResult === ContinueSentinel) continue; + return delegateResult; + } + } + + if (context.method === "next") { + // Setting context._sent for legacy support of Babel's + // function.sent implementation. + context.sent = context._sent = context.arg; + + } else if (context.method === "throw") { + if (state === GenStateSuspendedStart) { + state = GenStateCompleted; + throw context.arg; + } + + context.dispatchException(context.arg); + + } else if (context.method === "return") { + context.abrupt("return", context.arg); + } + + state = GenStateExecuting; + + var record = tryCatch(innerFn, self, context); + if (record.type === "normal") { + // If an exception is thrown from innerFn, we leave state === + // GenStateExecuting and loop back for another invocation. + state = context.done + ? GenStateCompleted + : GenStateSuspendedYield; + + if (record.arg === ContinueSentinel) { + continue; + } + + return { + value: record.arg, + done: context.done + }; + + } else if (record.type === "throw") { + state = GenStateCompleted; + // Dispatch the exception by looping back around to the + // context.dispatchException(context.arg) call above. + context.method = "throw"; + context.arg = record.arg; + } + } + }; + } + + // Call delegate.iterator[context.method](context.arg) and handle the + // result, either by returning a { value, done } result from the + // delegate iterator, or by modifying context.method and context.arg, + // setting context.delegate to null, and returning the ContinueSentinel. + function maybeInvokeDelegate(delegate, context) { + var method = delegate.iterator[context.method]; + if (method === undefined) { + // A .throw or .return when the delegate iterator has no .throw + // method always terminates the yield* loop. + context.delegate = null; + + if (context.method === "throw") { + // Note: ["return"] must be used for ES3 parsing compatibility. + if (delegate.iterator["return"]) { + // If the delegate iterator has a return method, give it a + // chance to clean up. + context.method = "return"; + context.arg = undefined; + maybeInvokeDelegate(delegate, context); + + if (context.method === "throw") { + // If maybeInvokeDelegate(context) changed context.method from + // "return" to "throw", let that override the TypeError below. + return ContinueSentinel; + } + } + + context.method = "throw"; + context.arg = new TypeError( + "The iterator does not provide a 'throw' method"); + } + + return ContinueSentinel; + } + + var record = tryCatch(method, delegate.iterator, context.arg); + + if (record.type === "throw") { + context.method = "throw"; + context.arg = record.arg; + context.delegate = null; + return ContinueSentinel; + } + + var info = record.arg; + + if (! info) { + context.method = "throw"; + context.arg = new TypeError("iterator result is not an object"); + context.delegate = null; + return ContinueSentinel; + } + + if (info.done) { + // Assign the result of the finished delegate to the temporary + // variable specified by delegate.resultName (see delegateYield). + context[delegate.resultName] = info.value; + + // Resume execution at the desired location (see delegateYield). + context.next = delegate.nextLoc; + + // If context.method was "throw" but the delegate handled the + // exception, let the outer generator proceed normally. If + // context.method was "next", forget context.arg since it has been + // "consumed" by the delegate iterator. If context.method was + // "return", allow the original .return call to continue in the + // outer generator. + if (context.method !== "return") { + context.method = "next"; + context.arg = undefined; + } + + } else { + // Re-yield the result returned by the delegate method. + return info; + } + + // The delegate iterator is finished, so forget it and continue with + // the outer generator. + context.delegate = null; + return ContinueSentinel; + } + + // Define Generator.prototype.{next,throw,return} in terms of the + // unified ._invoke helper method. + defineIteratorMethods(Gp); + + define(Gp, toStringTagSymbol, "Generator"); + + // A Generator should always return itself as the iterator object when the + // @@iterator function is called on it. Some browsers' implementations of the + // iterator prototype chain incorrectly implement this, causing the Generator + // object to not be returned from this call. This ensures that doesn't happen. + // See https://github.com/facebook/regenerator/issues/274 for more details. + define(Gp, iteratorSymbol, function() { + return this; + }); + + define(Gp, "toString", function() { + return "[object Generator]"; + }); + + function pushTryEntry(locs) { + var entry = { tryLoc: locs[0] }; + + if (1 in locs) { + entry.catchLoc = locs[1]; + } + + if (2 in locs) { + entry.finallyLoc = locs[2]; + entry.afterLoc = locs[3]; + } + + this.tryEntries.push(entry); + } + + function resetTryEntry(entry) { + var record = entry.completion || {}; + record.type = "normal"; + delete record.arg; + entry.completion = record; + } + + function Context(tryLocsList) { + // The root entry object (effectively a try statement without a catch + // or a finally block) gives us a place to store values thrown from + // locations where there is no enclosing try statement. + this.tryEntries = [{ tryLoc: "root" }]; + tryLocsList.forEach(pushTryEntry, this); + this.reset(true); + } + + exports.keys = function(object) { + var keys = []; + for (var key in object) { + keys.push(key); + } + keys.reverse(); + + // Rather than returning an object with a next method, we keep + // things simple and return the next function itself. + return function next() { + while (keys.length) { + var key = keys.pop(); + if (key in object) { + next.value = key; + next.done = false; + return next; + } + } + + // To avoid creating an additional object, we just hang the .value + // and .done properties off the next function object itself. This + // also ensures that the minifier will not anonymize the function. + next.done = true; + return next; + }; + }; + + function values(iterable) { + if (iterable) { + var iteratorMethod = iterable[iteratorSymbol]; + if (iteratorMethod) { + return iteratorMethod.call(iterable); + } + + if (typeof iterable.next === "function") { + return iterable; + } + + if (!isNaN(iterable.length)) { + var i = -1, next = function next() { + while (++i < iterable.length) { + if (hasOwn.call(iterable, i)) { + next.value = iterable[i]; + next.done = false; + return next; + } + } + + next.value = undefined; + next.done = true; + + return next; + }; + + return next.next = next; + } + } + + // Return an iterator with no values. + return { next: doneResult }; + } + exports.values = values; + + function doneResult() { + return { value: undefined, done: true }; + } + + Context.prototype = { + constructor: Context, + + reset: function(skipTempReset) { + this.prev = 0; + this.next = 0; + // Resetting context._sent for legacy support of Babel's + // function.sent implementation. + this.sent = this._sent = undefined; + this.done = false; + this.delegate = null; + + this.method = "next"; + this.arg = undefined; + + this.tryEntries.forEach(resetTryEntry); + + if (!skipTempReset) { + for (var name in this) { + // Not sure about the optimal order of these conditions: + if (name.charAt(0) === "t" && + hasOwn.call(this, name) && + !isNaN(+name.slice(1))) { + this[name] = undefined; + } + } + } + }, + + stop: function() { + this.done = true; + + var rootEntry = this.tryEntries[0]; + var rootRecord = rootEntry.completion; + if (rootRecord.type === "throw") { + throw rootRecord.arg; + } + + return this.rval; + }, + + dispatchException: function(exception) { + if (this.done) { + throw exception; + } + + var context = this; + function handle(loc, caught) { + record.type = "throw"; + record.arg = exception; + context.next = loc; + + if (caught) { + // If the dispatched exception was caught by a catch block, + // then let that catch block handle the exception normally. + context.method = "next"; + context.arg = undefined; + } + + return !! caught; + } + + for (var i = this.tryEntries.length - 1; i >= 0; --i) { + var entry = this.tryEntries[i]; + var record = entry.completion; + + if (entry.tryLoc === "root") { + // Exception thrown outside of any try block that could handle + // it, so set the completion value of the entire function to + // throw the exception. + return handle("end"); + } + + if (entry.tryLoc <= this.prev) { + var hasCatch = hasOwn.call(entry, "catchLoc"); + var hasFinally = hasOwn.call(entry, "finallyLoc"); + + if (hasCatch && hasFinally) { + if (this.prev < entry.catchLoc) { + return handle(entry.catchLoc, true); + } else if (this.prev < entry.finallyLoc) { + return handle(entry.finallyLoc); + } + + } else if (hasCatch) { + if (this.prev < entry.catchLoc) { + return handle(entry.catchLoc, true); + } + + } else if (hasFinally) { + if (this.prev < entry.finallyLoc) { + return handle(entry.finallyLoc); + } + + } else { + throw new Error("try statement without catch or finally"); + } + } + } + }, + + abrupt: function(type, arg) { + for (var i = this.tryEntries.length - 1; i >= 0; --i) { + var entry = this.tryEntries[i]; + if (entry.tryLoc <= this.prev && + hasOwn.call(entry, "finallyLoc") && + this.prev < entry.finallyLoc) { + var finallyEntry = entry; + break; + } + } + + if (finallyEntry && + (type === "break" || + type === "continue") && + finallyEntry.tryLoc <= arg && + arg <= finallyEntry.finallyLoc) { + // Ignore the finally entry if control is not jumping to a + // location outside the try/catch block. + finallyEntry = null; + } + + var record = finallyEntry ? finallyEntry.completion : {}; + record.type = type; + record.arg = arg; + + if (finallyEntry) { + this.method = "next"; + this.next = finallyEntry.finallyLoc; + return ContinueSentinel; + } + + return this.complete(record); + }, + + complete: function(record, afterLoc) { + if (record.type === "throw") { + throw record.arg; + } + + if (record.type === "break" || + record.type === "continue") { + this.next = record.arg; + } else if (record.type === "return") { + this.rval = this.arg = record.arg; + this.method = "return"; + this.next = "end"; + } else if (record.type === "normal" && afterLoc) { + this.next = afterLoc; + } + + return ContinueSentinel; + }, + + finish: function(finallyLoc) { + for (var i = this.tryEntries.length - 1; i >= 0; --i) { + var entry = this.tryEntries[i]; + if (entry.finallyLoc === finallyLoc) { + this.complete(entry.completion, entry.afterLoc); + resetTryEntry(entry); + return ContinueSentinel; + } + } + }, + + "catch": function(tryLoc) { + for (var i = this.tryEntries.length - 1; i >= 0; --i) { + var entry = this.tryEntries[i]; + if (entry.tryLoc === tryLoc) { + var record = entry.completion; + if (record.type === "throw") { + var thrown = record.arg; + resetTryEntry(entry); + } + return thrown; + } + } + + // The context.catch method must only be called with a location + // argument that corresponds to a known catch block. + throw new Error("illegal catch attempt"); + }, + + delegateYield: function(iterable, resultName, nextLoc) { + this.delegate = { + iterator: values(iterable), + resultName: resultName, + nextLoc: nextLoc + }; + + if (this.method === "next") { + // Deliberately forget the last sent value so that we don't + // accidentally pass it on to the delegate. + this.arg = undefined; + } + + return ContinueSentinel; + } + }; + + // Regardless of whether this script is executing as a CommonJS module + // or not, return the runtime object so that we can declare the variable + // regeneratorRuntime in the outer scope, which allows this module to be + // injected easily by `bin/regenerator --include-runtime script.js`. + return exports; + +}( + // If this script is executing as a CommonJS module, use module.exports + // as the regeneratorRuntime namespace. Otherwise create a new empty + // object. Either way, the resulting object will be used to initialize + // the regeneratorRuntime variable at the top of this file. + typeof module === "object" ? module.exports : {} +)); + +try { + regeneratorRuntime = runtime; +} catch (accidentalStrictMode) { + // This module should not be running in strict mode, so the above + // assignment should always work unless something is misconfigured. Just + // in case runtime.js accidentally runs in strict mode, in modern engines + // we can explicitly access globalThis. In older engines we can escape + // strict mode using a global Function call. This could conceivably fail + // if a Content Security Policy forbids using Function, but in that case + // the proper solution is to fix the accidental strict mode problem. If + // you've misconfigured your bundler to force strict mode and applied a + // CSP to forbid Function, and you're not willing to fix either of those + // problems, please detail your unique predicament in a GitHub issue. + if (typeof globalThis === "object") { + globalThis.regeneratorRuntime = runtime; + } else { + Function("r", "regeneratorRuntime = r")(runtime); + } +} diff --git a/node_modules/retry-axios/LICENSE b/node_modules/retry-axios/LICENSE new file mode 100644 index 0000000..b7c9ed1 --- /dev/null +++ b/node_modules/retry-axios/LICENSE @@ -0,0 +1,202 @@ + + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright 2013 Google Inc. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/node_modules/retry-axios/README.md b/node_modules/retry-axios/README.md new file mode 100644 index 0000000..b15781d --- /dev/null +++ b/node_modules/retry-axios/README.md @@ -0,0 +1,170 @@ +# retry-axios + +> Use Axios interceptors to automatically retry failed requests. Super flexible. Built in exponential backoff. + +[![NPM Version][npm-image]][npm-url] +[![GitHub Actions][github-image]][github-url] +[![Known Vulnerabilities][snyk-image]][snyk-url] +[![codecov][codecov-image]][codecov-url] +[![style badge][gts-image]][gts-url] + +## Installation + +```sh +npm install retry-axios +``` + +## Usage + +To use this library, import it alongside of `axios`: + +```js +// Just import rax and your favorite version of axios +const rax = require('retry-axios'); +const axios = require('axios'); +``` + +Or, if you're using TypeScript / es modules: + +```js +import * as rax from 'retry-axios'; +import axios from 'axios'; +``` + +You can attach to the global `axios` object, and retry 3 times by default: + +```js +const interceptorId = rax.attach(); +const res = await axios('https://test.local'); +``` + +Or you can create your own axios instance to make scoped requests: + +```js +const myAxiosInstance = axios.create(); +myAxiosInstance.defaults.raxConfig = { + instance: myAxiosInstance +}; +const interceptorId = rax.attach(myAxiosInstance); +const res = await myAxiosInstance.get('https://test.local'); +``` + +You have a lot of options... + +```js +const interceptorId = rax.attach(); +const res = await axios({ + url: 'https://test.local', + raxConfig: { + // Retry 3 times on requests that return a response (500, etc) before giving up. Defaults to 3. + retry: 3, + + // Retry twice on errors that don't return a response (ENOTFOUND, ETIMEDOUT, etc). + noResponseRetries: 2, + + // Milliseconds to delay at first. Defaults to 100. Only considered when backoffType is 'static' + retryDelay: 100, + + // HTTP methods to automatically retry. Defaults to: + // ['GET', 'HEAD', 'OPTIONS', 'DELETE', 'PUT'] + httpMethodsToRetry: ['GET', 'HEAD', 'OPTIONS', 'DELETE', 'PUT'], + + // The response status codes to retry. Supports a double + // array with a list of ranges. Defaults to: + // [[100, 199], [429, 429], [500, 599]] + statusCodesToRetry: [[100, 199], [429, 429], [500, 599]], + + // If you are using a non static instance of Axios you need + // to pass that instance here (const ax = axios.create()) + instance: ax, + + // You can set the backoff type. + // options are 'exponential' (default), 'static' or 'linear' + backoffType: 'exponential', + + // You can detect when a retry is happening, and figure out how many + // retry attempts have been made + onRetryAttempt: err => { + const cfg = rax.getConfig(err); + console.log(`Retry attempt #${cfg.currentRetryAttempt}`); + } + } +}); +``` + +If the logic in onRetryAttempt requires to be asynchronous, you can return a promise, then retry will be executed only after the promise is resolved: + +```js +const res = await axios({ + url: 'https://test.local', + raxConfig: { + onRetryAttempt: err => { + return new Promise((resolve, reject) => { + // call a custom asynchronous function + refreshToken(err, function(token, error) { + if (!error) { + window.localStorage.setItem('token', token); + resolve(); + } else { + reject(); + } + }); + }); + } + } +}); +``` + +Or if you want, you can just decide if it should retry or not: + +```js +const res = await axios({ + url: 'https://test.local', + raxConfig: { + // Override the decision making process on if you should retry + shouldRetry: err => { + const cfg = rax.getConfig(err); + return true; + } + } +}); +``` + +If you want to add custom retry logic without duplicating too much of the built-in logic, `rax.shouldRetryRequest` will tell you if a request would normally be retried: +```js +const res = await axios({ + url: 'https://test.local', + raxConfig: { + // Override the decision making process on if you should retry + shouldRetry: err => { + const cfg = rax.getConfig(err); + if (cfg.currentRetryAttempt >= cfg.retry) return false // ensure max retries is always respected + + // Always retry this status text, regardless of code or request type + if (err.response.statusText.includes('Try again')) return true + + // Handle the request based on your other config options, e.g. `statusCodesToRetry` + return rax.shouldRetryRequest(err) + } + } +}); +``` + +## How it works + +This library attaches an `interceptor` to an axios instance you pass to the API. This way you get to choose which version of `axios` you want to run, and you can compose many interceptors on the same request pipeline. + +## License + +[Apache-2.0](LICENSE) + +[github-image]: https://github.com/JustinBeckwith/retry-axios/workflows/ci/badge.svg +[github-url]: https://github.com/JustinBeckwith/retry-axios/actions/ +[codecov-image]: https://codecov.io/gh/JustinBeckwith/retry-axios/branch/main/graph/badge.svg +[codecov-url]: https://codecov.io/gh/JustinBeckwith/retry-axios +[gts-image]: https://img.shields.io/badge/code%20style-Google%20%E2%98%82%EF%B8%8F-blue.svg +[gts-url]: https://www.npmjs.com/package/gts +[npm-image]: https://img.shields.io/npm/v/retry-axios.svg +[npm-url]: https://npmjs.org/package/retry-axios +[snyk-image]: https://snyk.io/test/github/JustinBeckwith/retry-axios/badge.svg +[snyk-url]: https://snyk.io/test/github/JustinBeckwith/retry-axios diff --git a/node_modules/retry-axios/dist/index.js b/node_modules/retry-axios/dist/index.js new file mode 100644 index 0000000..2c50350 --- /dev/null +++ b/node_modules/retry-axios/dist/index.js @@ -0,0 +1,2 @@ +var e,t=(e=require("axios"))&&"object"==typeof e&&"default"in e?e.default:e;function r(e){return e}function n(e){var t=[];if(e)return Array.isArray(e)?e:("object"==typeof e&&Object.keys(e).forEach(function(r){"number"==typeof r&&(t[r]=e[r])}),t)}function o(e){if(t.isCancel(e))return Promise.reject(e);var r=f(e)||{};if(r.currentRetryAttempt=r.currentRetryAttempt||0,r.retry="number"==typeof r.retry?r.retry:3,r.retryDelay="number"==typeof r.retryDelay?r.retryDelay:100,r.instance=r.instance||t,r.backoffType=r.backoffType||"exponential",r.httpMethodsToRetry=n(r.httpMethodsToRetry)||["GET","HEAD","PUT","OPTIONS","DELETE"],r.noResponseRetries="number"==typeof r.noResponseRetries?r.noResponseRetries:2,r.checkRetryAfter="boolean"!=typeof r.checkRetryAfter||r.checkRetryAfter,r.maxRetryAfter="number"==typeof r.maxRetryAfter?r.maxRetryAfter:3e5,r.statusCodesToRetry=n(r.statusCodesToRetry)||[[100,199],[429,429],[500,599]],e.config=e.config||{},e.config.raxConfig=Object.assign({},r),!(r.shouldRetry||s)(e))return Promise.reject(e);var o=new Promise(function(t,n){var o=0;if(r.checkRetryAfter&&e.response&&e.response.headers["retry-after"]){var s=function(e){var t=Number(e);if(!Number.isNaN(t))return 1e3*t;var r=Date.parse(e);return Number.isNaN(r)?void 0:r-Date.now()}(e.response.headers["retry-after"]);if(!(s&&s>0&&s<=r.maxRetryAfter))return n(e);o=s}e.config.raxConfig.currentRetryAttempt+=1;var f=e.config.raxConfig.currentRetryAttempt;0===o&&(o="linear"===r.backoffType?1e3*f:"static"===r.backoffType?r.retryDelay:(Math.pow(2,f)-1)/2*1e3,"number"==typeof r.maxRetryDelay&&(o=Math.min(o,r.maxRetryDelay))),setTimeout(t,o)}),i=r.onRetryAttempt?Promise.resolve(r.onRetryAttempt(e)):Promise.resolve();return Promise.resolve().then(function(){return o}).then(function(){return i}).then(function(){return r.instance.request(e.config)})}function s(e){var t=e.config.raxConfig;if(!t||0===t.retry)return!1;if(!e.response&&(t.currentRetryAttempt||0)>=t.noResponseRetries)return!1;if(!e.config.method||t.httpMethodsToRetry.indexOf(e.config.method.toUpperCase())<0)return!1;if(e.response&&e.response.status){for(var r=!1,n=0,o=t.statusCodesToRetry;n=s[0]&&f<=s[1]){r=!0;break}}if(!r)return!1}return t.currentRetryAttempt=t.currentRetryAttempt||0,!(t.currentRetryAttempt>=t.retry)}function f(e){if(e&&e.config)return e.config.raxConfig}exports.attach=function(e){return(e=e||t).interceptors.response.use(r,o)},exports.detach=function(e,r){(r=r||t).interceptors.response.eject(e)},exports.shouldRetryRequest=s,exports.getConfig=f; +//# sourceMappingURL=index.js.map diff --git a/node_modules/retry-axios/dist/index.js.map b/node_modules/retry-axios/dist/index.js.map new file mode 100644 index 0000000..3b91f70 --- /dev/null +++ b/node_modules/retry-axios/dist/index.js.map @@ -0,0 +1 @@ +{"version":3,"file":"index.js","sources":["../src/index.ts"],"sourcesContent":["import axios, {\n AxiosError,\n AxiosInstance,\n AxiosRequestConfig,\n AxiosResponse,\n} from 'axios';\n\n/**\n * Configuration for the Axios `request` method.\n */\nexport interface RetryConfig {\n /**\n * The number of times to retry the request. Defaults to 3.\n */\n retry?: number;\n\n /**\n * The number of retries already attempted.\n */\n currentRetryAttempt?: number;\n\n /**\n * The amount of time to initially delay the retry. Defaults to 100.\n */\n retryDelay?: number;\n\n /**\n * The instance of the axios object to which the interceptor is attached.\n */\n instance?: AxiosInstance;\n\n /**\n * The HTTP Methods that will be automatically retried.\n * Defaults to ['GET','PUT','HEAD','OPTIONS','DELETE']\n */\n httpMethodsToRetry?: string[];\n\n /**\n * The HTTP response status codes that will automatically be retried.\n * Defaults to: [[100, 199], [429, 429], [500, 599]]\n */\n statusCodesToRetry?: number[][];\n\n /**\n * Function to invoke when a retry attempt is made.\n */\n onRetryAttempt?: (err: AxiosError) => void;\n\n /**\n * Function to invoke which determines if you should retry\n */\n shouldRetry?: (err: AxiosError) => boolean;\n\n /**\n * When there is no response, the number of retries to attempt. Defaults to 2.\n */\n noResponseRetries?: number;\n\n /**\n * Backoff Type; 'linear', 'static' or 'exponential'.\n */\n backoffType?: 'linear' | 'static' | 'exponential';\n\n /**\n * Whether to check for 'Retry-After' header in response and use value as delay. Defaults to true.\n */\n checkRetryAfter?: boolean;\n\n /**\n * Max permitted Retry-After value (in ms) - rejects if greater. Defaults to 5 mins.\n */\n maxRetryAfter?: number;\n\n /**\n * Ceiling for calculated delay (in ms) - delay will not exceed this value.\n */\n maxRetryDelay?: number;\n}\n\nexport type RaxConfig = {\n raxConfig: RetryConfig;\n} & AxiosRequestConfig;\n\n/**\n * Attach the interceptor to the Axios instance.\n * @param instance The optional Axios instance on which to attach the\n * interceptor.\n * @returns The id of the interceptor attached to the axios instance.\n */\nexport function attach(instance?: AxiosInstance) {\n instance = instance || axios;\n return instance.interceptors.response.use(onFulfilled, onError);\n}\n\n/**\n * Eject the Axios interceptor that is providing retry capabilities.\n * @param interceptorId The interceptorId provided in the config.\n * @param instance The axios instance using this interceptor.\n */\nexport function detach(interceptorId: number, instance?: AxiosInstance) {\n instance = instance || axios;\n instance.interceptors.response.eject(interceptorId);\n}\n\nfunction onFulfilled(res: AxiosResponse) {\n return res;\n}\n\n/**\n * Some versions of axios are converting arrays into objects during retries.\n * This will attempt to convert an object with the following structure into\n * an array, where the keys correspond to the indices:\n * {\n * 0: {\n * // some property\n * },\n * 1: {\n * // another\n * }\n * }\n * @param obj The object that (may) have integers that correspond to an index\n * @returns An array with the pucked values\n */\nfunction normalizeArray(obj?: T[]): T[] | undefined {\n const arr: T[] = [];\n if (!obj) {\n return undefined;\n }\n if (Array.isArray(obj)) {\n return obj;\n }\n if (typeof obj === 'object') {\n Object.keys(obj).forEach(key => {\n if (typeof key === 'number') {\n arr[key] = obj[key];\n }\n });\n }\n return arr;\n}\n\n/**\n * Parse the Retry-After header.\n * https://developer.mozilla.org/en-US/docs/Web/HTTP/Headers/Retry-After\n * @param header Retry-After header value\n * @returns Number of milliseconds, or undefined if invalid\n */\nfunction parseRetryAfter(header: string): number | undefined {\n // Header value may be string containing integer seconds\n const value = Number(header);\n if (!Number.isNaN(value)) {\n return value * 1000;\n }\n // Or HTTP date time string\n const dateTime = Date.parse(header);\n if (!Number.isNaN(dateTime)) {\n return dateTime - Date.now();\n }\n return undefined;\n}\n\nfunction onError(err: AxiosError) {\n if (axios.isCancel(err)) {\n return Promise.reject(err);\n }\n\n const config = getConfig(err) || {};\n config.currentRetryAttempt = config.currentRetryAttempt || 0;\n config.retry = typeof config.retry === 'number' ? config.retry : 3;\n config.retryDelay =\n typeof config.retryDelay === 'number' ? config.retryDelay : 100;\n config.instance = config.instance || axios;\n config.backoffType = config.backoffType || 'exponential';\n config.httpMethodsToRetry = normalizeArray(config.httpMethodsToRetry) || [\n 'GET',\n 'HEAD',\n 'PUT',\n 'OPTIONS',\n 'DELETE',\n ];\n config.noResponseRetries =\n typeof config.noResponseRetries === 'number' ? config.noResponseRetries : 2;\n config.checkRetryAfter =\n typeof config.checkRetryAfter === 'boolean' ? config.checkRetryAfter : true;\n config.maxRetryAfter =\n typeof config.maxRetryAfter === 'number' ? config.maxRetryAfter : 60000 * 5;\n\n // If this wasn't in the list of status codes where we want\n // to automatically retry, return.\n const retryRanges = [\n // https://en.wikipedia.org/wiki/List_of_HTTP_status_codes\n // 1xx - Retry (Informational, request still processing)\n // 2xx - Do not retry (Success)\n // 3xx - Do not retry (Redirect)\n // 4xx - Do not retry (Client errors)\n // 429 - Retry (\"Too Many Requests\")\n // 5xx - Retry (Server errors)\n [100, 199],\n [429, 429],\n [500, 599],\n ];\n config.statusCodesToRetry =\n normalizeArray(config.statusCodesToRetry) || retryRanges;\n\n // Put the config back into the err\n err.config = err.config || {}; // allow for wider range of errors\n (err.config as RaxConfig).raxConfig = {...config};\n\n // Determine if we should retry the request\n const shouldRetryFn = config.shouldRetry || shouldRetryRequest;\n if (!shouldRetryFn(err)) {\n return Promise.reject(err);\n }\n\n // Create a promise that invokes the retry after the backOffDelay\n const onBackoffPromise = new Promise((resolve, reject) => {\n let delay = 0;\n // If enabled, check for 'Retry-After' header in response to use as delay\n if (\n config.checkRetryAfter &&\n err.response &&\n err.response.headers['retry-after']\n ) {\n const retryAfter = parseRetryAfter(err.response.headers['retry-after']);\n if (retryAfter && retryAfter > 0 && retryAfter <= config.maxRetryAfter!) {\n delay = retryAfter;\n } else {\n return reject(err);\n }\n }\n\n // Now it's certain that a retry is supposed to happen. Incremenent the\n // counter, critical for linear and exp backoff delay calc. Note that\n // `config.currentRetryAttempt` is local to this function whereas\n // `(err.config as RaxConfig).raxConfig` is state that is tranferred across\n // retries. That is, we want to mutate `(err.config as\n // RaxConfig).raxConfig`. Another important note is about the definition of\n // `currentRetryAttempt`: When we are here becasue the first and actual\n // HTTP request attempt failed then `currentRetryAttempt` is still zero. We\n // have found that a retry is indeed required. Since that is (will be)\n // indeed the first retry it makes sense to now increase\n // `currentRetryAttempt` by 1. So that it is in fact 1 for the first retry\n // (as opposed to 0 or 2); an intuitive convention to use for the math\n // below.\n (err.config as RaxConfig).raxConfig!.currentRetryAttempt! += 1;\n\n // store with shorter and more expressive variable name.\n const retrycount = (err.config as RaxConfig).raxConfig!\n .currentRetryAttempt!;\n\n // Calculate delay according to chosen strategy\n // Default to exponential backoff - formula: ((2^c - 1) / 2) * 1000\n if (delay === 0) {\n // was not set by Retry-After logic\n if (config.backoffType === 'linear') {\n // The delay between the first (actual) attempt and the first retry\n // should be non-zero. Rely on the convention that `retrycount` is\n // equal to 1 for the first retry when we are in here (was once 0,\n // which was a bug -- see #122).\n delay = retrycount * 1000;\n } else if (config.backoffType === 'static') {\n delay = config.retryDelay!;\n } else {\n delay = ((Math.pow(2, retrycount) - 1) / 2) * 1000;\n }\n if (typeof config.maxRetryDelay === 'number') {\n delay = Math.min(delay, config.maxRetryDelay);\n }\n }\n setTimeout(resolve, delay);\n });\n\n // Notify the user if they added an `onRetryAttempt` handler\n const onRetryAttemptPromise = config.onRetryAttempt\n ? Promise.resolve(config.onRetryAttempt(err))\n : Promise.resolve();\n\n // Return the promise in which recalls axios to retry the request\n return Promise.resolve()\n .then(() => onBackoffPromise)\n .then(() => onRetryAttemptPromise)\n .then(() => config.instance!.request(err.config));\n}\n\n/**\n * Determine based on config if we should retry the request.\n * @param err The AxiosError passed to the interceptor.\n */\nexport function shouldRetryRequest(err: AxiosError) {\n const config = (err.config as RaxConfig).raxConfig;\n\n // If there's no config, or retries are disabled, return.\n if (!config || config.retry === 0) {\n return false;\n }\n\n // Check if this error has no response (ETIMEDOUT, ENOTFOUND, etc)\n if (\n !err.response &&\n (config.currentRetryAttempt || 0) >= config.noResponseRetries!\n ) {\n return false;\n }\n\n // Only retry with configured HttpMethods.\n if (\n !err.config.method ||\n config.httpMethodsToRetry!.indexOf(err.config.method.toUpperCase()) < 0\n ) {\n return false;\n }\n\n // If this wasn't in the list of status codes where we want\n // to automatically retry, return.\n if (err.response && err.response.status) {\n let isInRange = false;\n for (const [min, max] of config.statusCodesToRetry!) {\n const status = err.response.status;\n if (status >= min && status <= max) {\n isInRange = true;\n break;\n }\n }\n if (!isInRange) {\n return false;\n }\n }\n\n // If we are out of retry attempts, return\n config.currentRetryAttempt = config.currentRetryAttempt || 0;\n if (config.currentRetryAttempt >= config.retry!) {\n return false;\n }\n\n return true;\n}\n\n/**\n * Acquire the raxConfig object from an AxiosError if available.\n * @param err The Axios error with a config object.\n */\nexport function getConfig(err: AxiosError) {\n if (err && err.config) {\n return (err.config as RaxConfig).raxConfig;\n }\n return;\n}\n\n// Include this so `config.raxConfig` works easily.\n// See https://github.com/JustinBeckwith/retry-axios/issues/64.\ndeclare module 'axios' {\n export interface AxiosRequestConfig {\n raxConfig?: RetryConfig;\n }\n}\n"],"names":["onFulfilled","res","normalizeArray","obj","arr","Array","isArray","Object","keys","forEach","key","onError","err","axios","isCancel","Promise","reject","config","getConfig","currentRetryAttempt","retry","retryDelay","instance","backoffType","httpMethodsToRetry","noResponseRetries","checkRetryAfter","maxRetryAfter","statusCodesToRetry","raxConfig","shouldRetry","shouldRetryRequest","onBackoffPromise","resolve","delay","response","headers","retryAfter","header","value","Number","isNaN","dateTime","Date","parse","now","parseRetryAfter","retrycount","Math","pow","maxRetryDelay","min","setTimeout","onRetryAttemptPromise","onRetryAttempt","then","request","method","indexOf","toUpperCase","status","isInRange","const","interceptors","use","interceptorId","eject"],"mappings":"4EAwGA,SAASA,EAAYC,UACZA,EAkBT,SAASC,EAAkBC,OACnBC,EAAW,MACZD,SAGDE,MAAMC,QAAQH,GACTA,GAEU,iBAARA,GACTI,OAAOC,KAAKL,GAAKM,iBAAQC,GACJ,iBAARA,IACTN,EAAIM,GAAOP,EAAIO,MAIdN,GAuBT,SAASO,EAAQC,MACXC,EAAMC,SAASF,UACVG,QAAQC,OAAOJ,OAGlBK,EAASC,EAAUN,IAAQ,MACjCK,EAAOE,oBAAsBF,EAAOE,qBAAuB,EAC3DF,EAAOG,MAAgC,iBAAjBH,EAAOG,MAAqBH,EAAOG,MAAQ,EACjEH,EAAOI,WACwB,iBAAtBJ,EAAOI,WAA0BJ,EAAOI,WAAa,IAC9DJ,EAAOK,SAAWL,EAAOK,UAAYT,EACrCI,EAAOM,YAAcN,EAAOM,aAAe,cAC3CN,EAAOO,mBAAqBtB,EAAee,EAAOO,qBAAuB,CACvE,MACA,OACA,MACA,UACA,UAEFP,EAAOQ,kBAC+B,iBAA7BR,EAAOQ,kBAAiCR,EAAOQ,kBAAoB,EAC5ER,EAAOS,gBAC6B,kBAA3BT,EAAOS,iBAAgCT,EAAOS,gBACvDT,EAAOU,cAC2B,iBAAzBV,EAAOU,cAA6BV,EAAOU,cAAgB,IAgBpEV,EAAOW,mBACL1B,EAAee,EAAOW,qBAbJ,EAQjB,IAAK,KACN,CAAC,IAAK,KACN,CAAC,IAAK,MAMRhB,EAAIK,OAASL,EAAIK,QAAU,GAC1BL,EAAIK,OAAqBY,UAAYtB,iBAAIU,KAGpBA,EAAOa,aAAeC,GACzBnB,UACVG,QAAQC,OAAOJ,OAIlBoB,EAAmB,IAAIjB,iBAASkB,EAASjB,OACzCkB,EAAQ,KAGVjB,EAAOS,iBACPd,EAAIuB,UACJvB,EAAIuB,SAASC,QAAQ,eACrB,KACMC,EA5EZ,SAAyBC,OAEjBC,EAAQC,OAAOF,OAChBE,OAAOC,MAAMF,UACD,IAARA,MAGHG,EAAWC,KAAKC,MAAMN,UACvBE,OAAOC,MAAMC,UACTA,EAAWC,KAAKE,MAmEFC,CAAgBlC,EAAIuB,SAASC,QAAQ,qBACpDC,GAAcA,EAAa,GAAKA,GAAcpB,EAAOU,sBAGhDX,EAAOJ,GAFdsB,EAAQG,EAmBXzB,EAAIK,OAAqBY,UAAWV,qBAAwB,MAGvD4B,EAAcnC,EAAIK,OAAqBY,UAC1CV,oBAIW,IAAVe,IAOAA,EALyB,WAAvBjB,EAAOM,YAKY,IAAbwB,EACwB,WAAvB9B,EAAOM,YACRN,EAAOI,YAEL2B,KAAKC,IAAI,EAAGF,GAAc,GAAK,EAAK,IAEZ,iBAAzB9B,EAAOiC,gBAChBhB,EAAQc,KAAKG,IAAIjB,EAAOjB,EAAOiC,iBAGnCE,WAAWnB,EAASC,KAIhBmB,EAAwBpC,EAAOqC,eACjCvC,QAAQkB,QAAQhB,EAAOqC,eAAe1C,IACtCG,QAAQkB,iBAGLlB,QAAQkB,UACZsB,uBAAWvB,IACXuB,uBAAWF,IACXE,uBAAWtC,EAAOK,SAAUkC,QAAQ5C,EAAIK,mBAO7Bc,EAAmBnB,OAC3BK,EAAUL,EAAIK,OAAqBY,cAGpCZ,GAA2B,IAAjBA,EAAOG,aACb,MAKNR,EAAIuB,WACJlB,EAAOE,qBAAuB,IAAMF,EAAOQ,yBAErC,MAKNb,EAAIK,OAAOwC,QACZxC,EAAOO,mBAAoBkC,QAAQ9C,EAAIK,OAAOwC,OAAOE,eAAiB,SAE/D,KAKL/C,EAAIuB,UAAYvB,EAAIuB,SAASyB,OAAQ,SACnCC,GAAY,QACS5C,EAAOW,mCAAqB,CAAhDkC,WACGF,EAAShD,EAAIuB,SAASyB,UACxBA,SAAiBA,QAAe,CAClCC,GAAY,aAIXA,SACI,SAKX5C,EAAOE,oBAAsBF,EAAOE,qBAAuB,IACvDF,EAAOE,qBAAuBF,EAAOG,gBAW3BF,EAAUN,MACpBA,GAAOA,EAAIK,cACLL,EAAIK,OAAqBY,kCA9PdP,UACrBA,EAAWA,GAAYT,GACPkD,aAAa5B,SAAS6B,IAAIhE,EAAaW,4BAQlCsD,EAAuB3C,IAC5CA,EAAWA,GAAYT,GACdkD,aAAa5B,SAAS+B,MAAMD"} \ No newline at end of file diff --git a/node_modules/retry-axios/dist/index.module.js b/node_modules/retry-axios/dist/index.module.js new file mode 100644 index 0000000..a84ad18 --- /dev/null +++ b/node_modules/retry-axios/dist/index.module.js @@ -0,0 +1,2 @@ +import e from"axios";function r(r){return(r=r||e).interceptors.response.use(n,s)}function t(r,t){(t=t||e).interceptors.response.eject(r)}function n(e){return e}function o(e){var r=[];if(e)return Array.isArray(e)?e:("object"==typeof e&&Object.keys(e).forEach(function(t){"number"==typeof t&&(r[t]=e[t])}),r)}function s(r){if(e.isCancel(r))return Promise.reject(r);var t=i(r)||{};if(t.currentRetryAttempt=t.currentRetryAttempt||0,t.retry="number"==typeof t.retry?t.retry:3,t.retryDelay="number"==typeof t.retryDelay?t.retryDelay:100,t.instance=t.instance||e,t.backoffType=t.backoffType||"exponential",t.httpMethodsToRetry=o(t.httpMethodsToRetry)||["GET","HEAD","PUT","OPTIONS","DELETE"],t.noResponseRetries="number"==typeof t.noResponseRetries?t.noResponseRetries:2,t.checkRetryAfter="boolean"!=typeof t.checkRetryAfter||t.checkRetryAfter,t.maxRetryAfter="number"==typeof t.maxRetryAfter?t.maxRetryAfter:3e5,t.statusCodesToRetry=o(t.statusCodesToRetry)||[[100,199],[429,429],[500,599]],r.config=r.config||{},r.config.raxConfig=Object.assign({},t),!(t.shouldRetry||f)(r))return Promise.reject(r);var n=new Promise(function(e,n){var o=0;if(t.checkRetryAfter&&r.response&&r.response.headers["retry-after"]){var s=function(e){var r=Number(e);if(!Number.isNaN(r))return 1e3*r;var t=Date.parse(e);return Number.isNaN(t)?void 0:t-Date.now()}(r.response.headers["retry-after"]);if(!(s&&s>0&&s<=t.maxRetryAfter))return n(r);o=s}r.config.raxConfig.currentRetryAttempt+=1;var f=r.config.raxConfig.currentRetryAttempt;0===o&&(o="linear"===t.backoffType?1e3*f:"static"===t.backoffType?t.retryDelay:(Math.pow(2,f)-1)/2*1e3,"number"==typeof t.maxRetryDelay&&(o=Math.min(o,t.maxRetryDelay))),setTimeout(e,o)}),s=t.onRetryAttempt?Promise.resolve(t.onRetryAttempt(r)):Promise.resolve();return Promise.resolve().then(function(){return n}).then(function(){return s}).then(function(){return t.instance.request(r.config)})}function f(e){var r=e.config.raxConfig;if(!r||0===r.retry)return!1;if(!e.response&&(r.currentRetryAttempt||0)>=r.noResponseRetries)return!1;if(!e.config.method||r.httpMethodsToRetry.indexOf(e.config.method.toUpperCase())<0)return!1;if(e.response&&e.response.status){for(var t=!1,n=0,o=r.statusCodesToRetry;n=s[0]&&f<=s[1]){t=!0;break}}if(!t)return!1}return r.currentRetryAttempt=r.currentRetryAttempt||0,!(r.currentRetryAttempt>=r.retry)}function i(e){if(e&&e.config)return e.config.raxConfig}export{r as attach,t as detach,f as shouldRetryRequest,i as getConfig}; +//# sourceMappingURL=index.module.js.map diff --git a/node_modules/retry-axios/dist/index.module.js.map b/node_modules/retry-axios/dist/index.module.js.map new file mode 100644 index 0000000..9134e1c --- /dev/null +++ b/node_modules/retry-axios/dist/index.module.js.map @@ -0,0 +1 @@ +{"version":3,"file":"index.module.js","sources":["../src/index.ts"],"sourcesContent":["import axios, {\n AxiosError,\n AxiosInstance,\n AxiosRequestConfig,\n AxiosResponse,\n} from 'axios';\n\n/**\n * Configuration for the Axios `request` method.\n */\nexport interface RetryConfig {\n /**\n * The number of times to retry the request. Defaults to 3.\n */\n retry?: number;\n\n /**\n * The number of retries already attempted.\n */\n currentRetryAttempt?: number;\n\n /**\n * The amount of time to initially delay the retry. Defaults to 100.\n */\n retryDelay?: number;\n\n /**\n * The instance of the axios object to which the interceptor is attached.\n */\n instance?: AxiosInstance;\n\n /**\n * The HTTP Methods that will be automatically retried.\n * Defaults to ['GET','PUT','HEAD','OPTIONS','DELETE']\n */\n httpMethodsToRetry?: string[];\n\n /**\n * The HTTP response status codes that will automatically be retried.\n * Defaults to: [[100, 199], [429, 429], [500, 599]]\n */\n statusCodesToRetry?: number[][];\n\n /**\n * Function to invoke when a retry attempt is made.\n */\n onRetryAttempt?: (err: AxiosError) => void;\n\n /**\n * Function to invoke which determines if you should retry\n */\n shouldRetry?: (err: AxiosError) => boolean;\n\n /**\n * When there is no response, the number of retries to attempt. Defaults to 2.\n */\n noResponseRetries?: number;\n\n /**\n * Backoff Type; 'linear', 'static' or 'exponential'.\n */\n backoffType?: 'linear' | 'static' | 'exponential';\n\n /**\n * Whether to check for 'Retry-After' header in response and use value as delay. Defaults to true.\n */\n checkRetryAfter?: boolean;\n\n /**\n * Max permitted Retry-After value (in ms) - rejects if greater. Defaults to 5 mins.\n */\n maxRetryAfter?: number;\n\n /**\n * Ceiling for calculated delay (in ms) - delay will not exceed this value.\n */\n maxRetryDelay?: number;\n}\n\nexport type RaxConfig = {\n raxConfig: RetryConfig;\n} & AxiosRequestConfig;\n\n/**\n * Attach the interceptor to the Axios instance.\n * @param instance The optional Axios instance on which to attach the\n * interceptor.\n * @returns The id of the interceptor attached to the axios instance.\n */\nexport function attach(instance?: AxiosInstance) {\n instance = instance || axios;\n return instance.interceptors.response.use(onFulfilled, onError);\n}\n\n/**\n * Eject the Axios interceptor that is providing retry capabilities.\n * @param interceptorId The interceptorId provided in the config.\n * @param instance The axios instance using this interceptor.\n */\nexport function detach(interceptorId: number, instance?: AxiosInstance) {\n instance = instance || axios;\n instance.interceptors.response.eject(interceptorId);\n}\n\nfunction onFulfilled(res: AxiosResponse) {\n return res;\n}\n\n/**\n * Some versions of axios are converting arrays into objects during retries.\n * This will attempt to convert an object with the following structure into\n * an array, where the keys correspond to the indices:\n * {\n * 0: {\n * // some property\n * },\n * 1: {\n * // another\n * }\n * }\n * @param obj The object that (may) have integers that correspond to an index\n * @returns An array with the pucked values\n */\nfunction normalizeArray(obj?: T[]): T[] | undefined {\n const arr: T[] = [];\n if (!obj) {\n return undefined;\n }\n if (Array.isArray(obj)) {\n return obj;\n }\n if (typeof obj === 'object') {\n Object.keys(obj).forEach(key => {\n if (typeof key === 'number') {\n arr[key] = obj[key];\n }\n });\n }\n return arr;\n}\n\n/**\n * Parse the Retry-After header.\n * https://developer.mozilla.org/en-US/docs/Web/HTTP/Headers/Retry-After\n * @param header Retry-After header value\n * @returns Number of milliseconds, or undefined if invalid\n */\nfunction parseRetryAfter(header: string): number | undefined {\n // Header value may be string containing integer seconds\n const value = Number(header);\n if (!Number.isNaN(value)) {\n return value * 1000;\n }\n // Or HTTP date time string\n const dateTime = Date.parse(header);\n if (!Number.isNaN(dateTime)) {\n return dateTime - Date.now();\n }\n return undefined;\n}\n\nfunction onError(err: AxiosError) {\n if (axios.isCancel(err)) {\n return Promise.reject(err);\n }\n\n const config = getConfig(err) || {};\n config.currentRetryAttempt = config.currentRetryAttempt || 0;\n config.retry = typeof config.retry === 'number' ? config.retry : 3;\n config.retryDelay =\n typeof config.retryDelay === 'number' ? config.retryDelay : 100;\n config.instance = config.instance || axios;\n config.backoffType = config.backoffType || 'exponential';\n config.httpMethodsToRetry = normalizeArray(config.httpMethodsToRetry) || [\n 'GET',\n 'HEAD',\n 'PUT',\n 'OPTIONS',\n 'DELETE',\n ];\n config.noResponseRetries =\n typeof config.noResponseRetries === 'number' ? config.noResponseRetries : 2;\n config.checkRetryAfter =\n typeof config.checkRetryAfter === 'boolean' ? config.checkRetryAfter : true;\n config.maxRetryAfter =\n typeof config.maxRetryAfter === 'number' ? config.maxRetryAfter : 60000 * 5;\n\n // If this wasn't in the list of status codes where we want\n // to automatically retry, return.\n const retryRanges = [\n // https://en.wikipedia.org/wiki/List_of_HTTP_status_codes\n // 1xx - Retry (Informational, request still processing)\n // 2xx - Do not retry (Success)\n // 3xx - Do not retry (Redirect)\n // 4xx - Do not retry (Client errors)\n // 429 - Retry (\"Too Many Requests\")\n // 5xx - Retry (Server errors)\n [100, 199],\n [429, 429],\n [500, 599],\n ];\n config.statusCodesToRetry =\n normalizeArray(config.statusCodesToRetry) || retryRanges;\n\n // Put the config back into the err\n err.config = err.config || {}; // allow for wider range of errors\n (err.config as RaxConfig).raxConfig = {...config};\n\n // Determine if we should retry the request\n const shouldRetryFn = config.shouldRetry || shouldRetryRequest;\n if (!shouldRetryFn(err)) {\n return Promise.reject(err);\n }\n\n // Create a promise that invokes the retry after the backOffDelay\n const onBackoffPromise = new Promise((resolve, reject) => {\n let delay = 0;\n // If enabled, check for 'Retry-After' header in response to use as delay\n if (\n config.checkRetryAfter &&\n err.response &&\n err.response.headers['retry-after']\n ) {\n const retryAfter = parseRetryAfter(err.response.headers['retry-after']);\n if (retryAfter && retryAfter > 0 && retryAfter <= config.maxRetryAfter!) {\n delay = retryAfter;\n } else {\n return reject(err);\n }\n }\n\n // Now it's certain that a retry is supposed to happen. Incremenent the\n // counter, critical for linear and exp backoff delay calc. Note that\n // `config.currentRetryAttempt` is local to this function whereas\n // `(err.config as RaxConfig).raxConfig` is state that is tranferred across\n // retries. That is, we want to mutate `(err.config as\n // RaxConfig).raxConfig`. Another important note is about the definition of\n // `currentRetryAttempt`: When we are here becasue the first and actual\n // HTTP request attempt failed then `currentRetryAttempt` is still zero. We\n // have found that a retry is indeed required. Since that is (will be)\n // indeed the first retry it makes sense to now increase\n // `currentRetryAttempt` by 1. So that it is in fact 1 for the first retry\n // (as opposed to 0 or 2); an intuitive convention to use for the math\n // below.\n (err.config as RaxConfig).raxConfig!.currentRetryAttempt! += 1;\n\n // store with shorter and more expressive variable name.\n const retrycount = (err.config as RaxConfig).raxConfig!\n .currentRetryAttempt!;\n\n // Calculate delay according to chosen strategy\n // Default to exponential backoff - formula: ((2^c - 1) / 2) * 1000\n if (delay === 0) {\n // was not set by Retry-After logic\n if (config.backoffType === 'linear') {\n // The delay between the first (actual) attempt and the first retry\n // should be non-zero. Rely on the convention that `retrycount` is\n // equal to 1 for the first retry when we are in here (was once 0,\n // which was a bug -- see #122).\n delay = retrycount * 1000;\n } else if (config.backoffType === 'static') {\n delay = config.retryDelay!;\n } else {\n delay = ((Math.pow(2, retrycount) - 1) / 2) * 1000;\n }\n if (typeof config.maxRetryDelay === 'number') {\n delay = Math.min(delay, config.maxRetryDelay);\n }\n }\n setTimeout(resolve, delay);\n });\n\n // Notify the user if they added an `onRetryAttempt` handler\n const onRetryAttemptPromise = config.onRetryAttempt\n ? Promise.resolve(config.onRetryAttempt(err))\n : Promise.resolve();\n\n // Return the promise in which recalls axios to retry the request\n return Promise.resolve()\n .then(() => onBackoffPromise)\n .then(() => onRetryAttemptPromise)\n .then(() => config.instance!.request(err.config));\n}\n\n/**\n * Determine based on config if we should retry the request.\n * @param err The AxiosError passed to the interceptor.\n */\nexport function shouldRetryRequest(err: AxiosError) {\n const config = (err.config as RaxConfig).raxConfig;\n\n // If there's no config, or retries are disabled, return.\n if (!config || config.retry === 0) {\n return false;\n }\n\n // Check if this error has no response (ETIMEDOUT, ENOTFOUND, etc)\n if (\n !err.response &&\n (config.currentRetryAttempt || 0) >= config.noResponseRetries!\n ) {\n return false;\n }\n\n // Only retry with configured HttpMethods.\n if (\n !err.config.method ||\n config.httpMethodsToRetry!.indexOf(err.config.method.toUpperCase()) < 0\n ) {\n return false;\n }\n\n // If this wasn't in the list of status codes where we want\n // to automatically retry, return.\n if (err.response && err.response.status) {\n let isInRange = false;\n for (const [min, max] of config.statusCodesToRetry!) {\n const status = err.response.status;\n if (status >= min && status <= max) {\n isInRange = true;\n break;\n }\n }\n if (!isInRange) {\n return false;\n }\n }\n\n // If we are out of retry attempts, return\n config.currentRetryAttempt = config.currentRetryAttempt || 0;\n if (config.currentRetryAttempt >= config.retry!) {\n return false;\n }\n\n return true;\n}\n\n/**\n * Acquire the raxConfig object from an AxiosError if available.\n * @param err The Axios error with a config object.\n */\nexport function getConfig(err: AxiosError) {\n if (err && err.config) {\n return (err.config as RaxConfig).raxConfig;\n }\n return;\n}\n\n// Include this so `config.raxConfig` works easily.\n// See https://github.com/JustinBeckwith/retry-axios/issues/64.\ndeclare module 'axios' {\n export interface AxiosRequestConfig {\n raxConfig?: RetryConfig;\n }\n}\n"],"names":["attach","instance","axios","interceptors","response","use","onFulfilled","onError","detach","interceptorId","eject","res","normalizeArray","obj","arr","Array","isArray","Object","keys","forEach","key","err","isCancel","Promise","reject","config","getConfig","currentRetryAttempt","retry","retryDelay","backoffType","httpMethodsToRetry","noResponseRetries","checkRetryAfter","maxRetryAfter","statusCodesToRetry","raxConfig","shouldRetry","shouldRetryRequest","onBackoffPromise","resolve","delay","headers","retryAfter","header","value","Number","isNaN","dateTime","Date","parse","now","parseRetryAfter","retrycount","Math","pow","maxRetryDelay","min","setTimeout","onRetryAttemptPromise","onRetryAttempt","then","request","method","indexOf","toUpperCase","status","isInRange","const"],"mappings":"8BAyFgBA,EAAOC,UACrBA,EAAWA,GAAYC,GACPC,aAAaC,SAASC,IAAIC,EAAaC,YAQzCC,EAAOC,EAAuBR,IAC5CA,EAAWA,GAAYC,GACdC,aAAaC,SAASM,MAAMD,GAGvC,SAASH,EAAYK,UACZA,EAkBT,SAASC,EAAkBC,OACnBC,EAAW,MACZD,SAGDE,MAAMC,QAAQH,GACTA,GAEU,iBAARA,GACTI,OAAOC,KAAKL,GAAKM,iBAAQC,GACJ,iBAARA,IACTN,EAAIM,GAAOP,EAAIO,MAIdN,GAuBT,SAASP,EAAQc,MACXnB,EAAMoB,SAASD,UACVE,QAAQC,OAAOH,OAGlBI,EAASC,EAAUL,IAAQ,MACjCI,EAAOE,oBAAsBF,EAAOE,qBAAuB,EAC3DF,EAAOG,MAAgC,iBAAjBH,EAAOG,MAAqBH,EAAOG,MAAQ,EACjEH,EAAOI,WACwB,iBAAtBJ,EAAOI,WAA0BJ,EAAOI,WAAa,IAC9DJ,EAAOxB,SAAWwB,EAAOxB,UAAYC,EACrCuB,EAAOK,YAAcL,EAAOK,aAAe,cAC3CL,EAAOM,mBAAqBnB,EAAea,EAAOM,qBAAuB,CACvE,MACA,OACA,MACA,UACA,UAEFN,EAAOO,kBAC+B,iBAA7BP,EAAOO,kBAAiCP,EAAOO,kBAAoB,EAC5EP,EAAOQ,gBAC6B,kBAA3BR,EAAOQ,iBAAgCR,EAAOQ,gBACvDR,EAAOS,cAC2B,iBAAzBT,EAAOS,cAA6BT,EAAOS,cAAgB,IAgBpET,EAAOU,mBACLvB,EAAea,EAAOU,qBAbJ,EAQjB,IAAK,KACN,CAAC,IAAK,KACN,CAAC,IAAK,MAMRd,EAAII,OAASJ,EAAII,QAAU,GAC1BJ,EAAII,OAAqBW,UAAYnB,iBAAIQ,KAGpBA,EAAOY,aAAeC,GACzBjB,UACVE,QAAQC,OAAOH,OAIlBkB,EAAmB,IAAIhB,iBAASiB,EAAShB,OACzCiB,EAAQ,KAGVhB,EAAOQ,iBACPZ,EAAIjB,UACJiB,EAAIjB,SAASsC,QAAQ,eACrB,KACMC,EA5EZ,SAAyBC,OAEjBC,EAAQC,OAAOF,OAChBE,OAAOC,MAAMF,UACD,IAARA,MAGHG,EAAWC,KAAKC,MAAMN,UACvBE,OAAOC,MAAMC,UACTA,EAAWC,KAAKE,MAmEFC,CAAgB/B,EAAIjB,SAASsC,QAAQ,qBACpDC,GAAcA,EAAa,GAAKA,GAAclB,EAAOS,sBAGhDV,EAAOH,GAFdoB,EAAQE,EAmBXtB,EAAII,OAAqBW,UAAWT,qBAAwB,MAGvD0B,EAAchC,EAAII,OAAqBW,UAC1CT,oBAIW,IAAVc,IAOAA,EALyB,WAAvBhB,EAAOK,YAKY,IAAbuB,EACwB,WAAvB5B,EAAOK,YACRL,EAAOI,YAELyB,KAAKC,IAAI,EAAGF,GAAc,GAAK,EAAK,IAEZ,iBAAzB5B,EAAO+B,gBAChBf,EAAQa,KAAKG,IAAIhB,EAAOhB,EAAO+B,iBAGnCE,WAAWlB,EAASC,KAIhBkB,EAAwBlC,EAAOmC,eACjCrC,QAAQiB,QAAQf,EAAOmC,eAAevC,IACtCE,QAAQiB,iBAGLjB,QAAQiB,UACZqB,uBAAWtB,IACXsB,uBAAWF,IACXE,uBAAWpC,EAAOxB,SAAU6D,QAAQzC,EAAII,mBAO7Ba,EAAmBjB,OAC3BI,EAAUJ,EAAII,OAAqBW,cAGpCX,GAA2B,IAAjBA,EAAOG,aACb,MAKNP,EAAIjB,WACJqB,EAAOE,qBAAuB,IAAMF,EAAOO,yBAErC,MAKNX,EAAII,OAAOsC,QACZtC,EAAOM,mBAAoBiC,QAAQ3C,EAAII,OAAOsC,OAAOE,eAAiB,SAE/D,KAKL5C,EAAIjB,UAAYiB,EAAIjB,SAAS8D,OAAQ,SACnCC,GAAY,QACS1C,EAAOU,mCAAqB,CAAhDiC,WACGF,EAAS7C,EAAIjB,SAAS8D,UACxBA,SAAiBA,QAAe,CAClCC,GAAY,aAIXA,SACI,SAKX1C,EAAOE,oBAAsBF,EAAOE,qBAAuB,IACvDF,EAAOE,qBAAuBF,EAAOG,gBAW3BF,EAAUL,MACpBA,GAAOA,EAAII,cACLJ,EAAII,OAAqBW"} \ No newline at end of file diff --git a/node_modules/retry-axios/dist/index.umd.js b/node_modules/retry-axios/dist/index.umd.js new file mode 100644 index 0000000..0fd8e2f --- /dev/null +++ b/node_modules/retry-axios/dist/index.umd.js @@ -0,0 +1,2 @@ +!function(e,t){"object"==typeof exports&&"undefined"!=typeof module?t(exports,require("axios")):"function"==typeof define&&define.amd?define(["exports","axios"],t):t(e.retryAxios={},e.axios)}(this,function(e,t){function r(e){return e}function n(e){var t=[];if(e)return Array.isArray(e)?e:("object"==typeof e&&Object.keys(e).forEach(function(r){"number"==typeof r&&(t[r]=e[r])}),t)}function o(e){if(t.isCancel(e))return Promise.reject(e);var r=f(e)||{};if(r.currentRetryAttempt=r.currentRetryAttempt||0,r.retry="number"==typeof r.retry?r.retry:3,r.retryDelay="number"==typeof r.retryDelay?r.retryDelay:100,r.instance=r.instance||t,r.backoffType=r.backoffType||"exponential",r.httpMethodsToRetry=n(r.httpMethodsToRetry)||["GET","HEAD","PUT","OPTIONS","DELETE"],r.noResponseRetries="number"==typeof r.noResponseRetries?r.noResponseRetries:2,r.checkRetryAfter="boolean"!=typeof r.checkRetryAfter||r.checkRetryAfter,r.maxRetryAfter="number"==typeof r.maxRetryAfter?r.maxRetryAfter:3e5,r.statusCodesToRetry=n(r.statusCodesToRetry)||[[100,199],[429,429],[500,599]],e.config=e.config||{},e.config.raxConfig=Object.assign({},r),!(r.shouldRetry||s)(e))return Promise.reject(e);var o=new Promise(function(t,n){var o=0;if(r.checkRetryAfter&&e.response&&e.response.headers["retry-after"]){var s=function(e){var t=Number(e);if(!Number.isNaN(t))return 1e3*t;var r=Date.parse(e);return Number.isNaN(r)?void 0:r-Date.now()}(e.response.headers["retry-after"]);if(!(s&&s>0&&s<=r.maxRetryAfter))return n(e);o=s}e.config.raxConfig.currentRetryAttempt+=1;var f=e.config.raxConfig.currentRetryAttempt;0===o&&(o="linear"===r.backoffType?1e3*f:"static"===r.backoffType?r.retryDelay:(Math.pow(2,f)-1)/2*1e3,"number"==typeof r.maxRetryDelay&&(o=Math.min(o,r.maxRetryDelay))),setTimeout(t,o)}),i=r.onRetryAttempt?Promise.resolve(r.onRetryAttempt(e)):Promise.resolve();return Promise.resolve().then(function(){return o}).then(function(){return i}).then(function(){return r.instance.request(e.config)})}function s(e){var t=e.config.raxConfig;if(!t||0===t.retry)return!1;if(!e.response&&(t.currentRetryAttempt||0)>=t.noResponseRetries)return!1;if(!e.config.method||t.httpMethodsToRetry.indexOf(e.config.method.toUpperCase())<0)return!1;if(e.response&&e.response.status){for(var r=!1,n=0,o=t.statusCodesToRetry;n=s[0]&&f<=s[1]){r=!0;break}}if(!r)return!1}return t.currentRetryAttempt=t.currentRetryAttempt||0,!(t.currentRetryAttempt>=t.retry)}function f(e){if(e&&e.config)return e.config.raxConfig}t=t&&t.hasOwnProperty("default")?t.default:t,e.attach=function(e){return(e=e||t).interceptors.response.use(r,o)},e.detach=function(e,r){(r=r||t).interceptors.response.eject(e)},e.shouldRetryRequest=s,e.getConfig=f}); +//# sourceMappingURL=index.umd.js.map diff --git a/node_modules/retry-axios/dist/index.umd.js.map b/node_modules/retry-axios/dist/index.umd.js.map new file mode 100644 index 0000000..07d95ce --- /dev/null +++ b/node_modules/retry-axios/dist/index.umd.js.map @@ -0,0 +1 @@ +{"version":3,"file":"index.umd.js","sources":["../src/index.ts"],"sourcesContent":["import axios, {\n AxiosError,\n AxiosInstance,\n AxiosRequestConfig,\n AxiosResponse,\n} from 'axios';\n\n/**\n * Configuration for the Axios `request` method.\n */\nexport interface RetryConfig {\n /**\n * The number of times to retry the request. Defaults to 3.\n */\n retry?: number;\n\n /**\n * The number of retries already attempted.\n */\n currentRetryAttempt?: number;\n\n /**\n * The amount of time to initially delay the retry. Defaults to 100.\n */\n retryDelay?: number;\n\n /**\n * The instance of the axios object to which the interceptor is attached.\n */\n instance?: AxiosInstance;\n\n /**\n * The HTTP Methods that will be automatically retried.\n * Defaults to ['GET','PUT','HEAD','OPTIONS','DELETE']\n */\n httpMethodsToRetry?: string[];\n\n /**\n * The HTTP response status codes that will automatically be retried.\n * Defaults to: [[100, 199], [429, 429], [500, 599]]\n */\n statusCodesToRetry?: number[][];\n\n /**\n * Function to invoke when a retry attempt is made.\n */\n onRetryAttempt?: (err: AxiosError) => void;\n\n /**\n * Function to invoke which determines if you should retry\n */\n shouldRetry?: (err: AxiosError) => boolean;\n\n /**\n * When there is no response, the number of retries to attempt. Defaults to 2.\n */\n noResponseRetries?: number;\n\n /**\n * Backoff Type; 'linear', 'static' or 'exponential'.\n */\n backoffType?: 'linear' | 'static' | 'exponential';\n\n /**\n * Whether to check for 'Retry-After' header in response and use value as delay. Defaults to true.\n */\n checkRetryAfter?: boolean;\n\n /**\n * Max permitted Retry-After value (in ms) - rejects if greater. Defaults to 5 mins.\n */\n maxRetryAfter?: number;\n\n /**\n * Ceiling for calculated delay (in ms) - delay will not exceed this value.\n */\n maxRetryDelay?: number;\n}\n\nexport type RaxConfig = {\n raxConfig: RetryConfig;\n} & AxiosRequestConfig;\n\n/**\n * Attach the interceptor to the Axios instance.\n * @param instance The optional Axios instance on which to attach the\n * interceptor.\n * @returns The id of the interceptor attached to the axios instance.\n */\nexport function attach(instance?: AxiosInstance) {\n instance = instance || axios;\n return instance.interceptors.response.use(onFulfilled, onError);\n}\n\n/**\n * Eject the Axios interceptor that is providing retry capabilities.\n * @param interceptorId The interceptorId provided in the config.\n * @param instance The axios instance using this interceptor.\n */\nexport function detach(interceptorId: number, instance?: AxiosInstance) {\n instance = instance || axios;\n instance.interceptors.response.eject(interceptorId);\n}\n\nfunction onFulfilled(res: AxiosResponse) {\n return res;\n}\n\n/**\n * Some versions of axios are converting arrays into objects during retries.\n * This will attempt to convert an object with the following structure into\n * an array, where the keys correspond to the indices:\n * {\n * 0: {\n * // some property\n * },\n * 1: {\n * // another\n * }\n * }\n * @param obj The object that (may) have integers that correspond to an index\n * @returns An array with the pucked values\n */\nfunction normalizeArray(obj?: T[]): T[] | undefined {\n const arr: T[] = [];\n if (!obj) {\n return undefined;\n }\n if (Array.isArray(obj)) {\n return obj;\n }\n if (typeof obj === 'object') {\n Object.keys(obj).forEach(key => {\n if (typeof key === 'number') {\n arr[key] = obj[key];\n }\n });\n }\n return arr;\n}\n\n/**\n * Parse the Retry-After header.\n * https://developer.mozilla.org/en-US/docs/Web/HTTP/Headers/Retry-After\n * @param header Retry-After header value\n * @returns Number of milliseconds, or undefined if invalid\n */\nfunction parseRetryAfter(header: string): number | undefined {\n // Header value may be string containing integer seconds\n const value = Number(header);\n if (!Number.isNaN(value)) {\n return value * 1000;\n }\n // Or HTTP date time string\n const dateTime = Date.parse(header);\n if (!Number.isNaN(dateTime)) {\n return dateTime - Date.now();\n }\n return undefined;\n}\n\nfunction onError(err: AxiosError) {\n if (axios.isCancel(err)) {\n return Promise.reject(err);\n }\n\n const config = getConfig(err) || {};\n config.currentRetryAttempt = config.currentRetryAttempt || 0;\n config.retry = typeof config.retry === 'number' ? config.retry : 3;\n config.retryDelay =\n typeof config.retryDelay === 'number' ? config.retryDelay : 100;\n config.instance = config.instance || axios;\n config.backoffType = config.backoffType || 'exponential';\n config.httpMethodsToRetry = normalizeArray(config.httpMethodsToRetry) || [\n 'GET',\n 'HEAD',\n 'PUT',\n 'OPTIONS',\n 'DELETE',\n ];\n config.noResponseRetries =\n typeof config.noResponseRetries === 'number' ? config.noResponseRetries : 2;\n config.checkRetryAfter =\n typeof config.checkRetryAfter === 'boolean' ? config.checkRetryAfter : true;\n config.maxRetryAfter =\n typeof config.maxRetryAfter === 'number' ? config.maxRetryAfter : 60000 * 5;\n\n // If this wasn't in the list of status codes where we want\n // to automatically retry, return.\n const retryRanges = [\n // https://en.wikipedia.org/wiki/List_of_HTTP_status_codes\n // 1xx - Retry (Informational, request still processing)\n // 2xx - Do not retry (Success)\n // 3xx - Do not retry (Redirect)\n // 4xx - Do not retry (Client errors)\n // 429 - Retry (\"Too Many Requests\")\n // 5xx - Retry (Server errors)\n [100, 199],\n [429, 429],\n [500, 599],\n ];\n config.statusCodesToRetry =\n normalizeArray(config.statusCodesToRetry) || retryRanges;\n\n // Put the config back into the err\n err.config = err.config || {}; // allow for wider range of errors\n (err.config as RaxConfig).raxConfig = {...config};\n\n // Determine if we should retry the request\n const shouldRetryFn = config.shouldRetry || shouldRetryRequest;\n if (!shouldRetryFn(err)) {\n return Promise.reject(err);\n }\n\n // Create a promise that invokes the retry after the backOffDelay\n const onBackoffPromise = new Promise((resolve, reject) => {\n let delay = 0;\n // If enabled, check for 'Retry-After' header in response to use as delay\n if (\n config.checkRetryAfter &&\n err.response &&\n err.response.headers['retry-after']\n ) {\n const retryAfter = parseRetryAfter(err.response.headers['retry-after']);\n if (retryAfter && retryAfter > 0 && retryAfter <= config.maxRetryAfter!) {\n delay = retryAfter;\n } else {\n return reject(err);\n }\n }\n\n // Now it's certain that a retry is supposed to happen. Incremenent the\n // counter, critical for linear and exp backoff delay calc. Note that\n // `config.currentRetryAttempt` is local to this function whereas\n // `(err.config as RaxConfig).raxConfig` is state that is tranferred across\n // retries. That is, we want to mutate `(err.config as\n // RaxConfig).raxConfig`. Another important note is about the definition of\n // `currentRetryAttempt`: When we are here becasue the first and actual\n // HTTP request attempt failed then `currentRetryAttempt` is still zero. We\n // have found that a retry is indeed required. Since that is (will be)\n // indeed the first retry it makes sense to now increase\n // `currentRetryAttempt` by 1. So that it is in fact 1 for the first retry\n // (as opposed to 0 or 2); an intuitive convention to use for the math\n // below.\n (err.config as RaxConfig).raxConfig!.currentRetryAttempt! += 1;\n\n // store with shorter and more expressive variable name.\n const retrycount = (err.config as RaxConfig).raxConfig!\n .currentRetryAttempt!;\n\n // Calculate delay according to chosen strategy\n // Default to exponential backoff - formula: ((2^c - 1) / 2) * 1000\n if (delay === 0) {\n // was not set by Retry-After logic\n if (config.backoffType === 'linear') {\n // The delay between the first (actual) attempt and the first retry\n // should be non-zero. Rely on the convention that `retrycount` is\n // equal to 1 for the first retry when we are in here (was once 0,\n // which was a bug -- see #122).\n delay = retrycount * 1000;\n } else if (config.backoffType === 'static') {\n delay = config.retryDelay!;\n } else {\n delay = ((Math.pow(2, retrycount) - 1) / 2) * 1000;\n }\n if (typeof config.maxRetryDelay === 'number') {\n delay = Math.min(delay, config.maxRetryDelay);\n }\n }\n setTimeout(resolve, delay);\n });\n\n // Notify the user if they added an `onRetryAttempt` handler\n const onRetryAttemptPromise = config.onRetryAttempt\n ? Promise.resolve(config.onRetryAttempt(err))\n : Promise.resolve();\n\n // Return the promise in which recalls axios to retry the request\n return Promise.resolve()\n .then(() => onBackoffPromise)\n .then(() => onRetryAttemptPromise)\n .then(() => config.instance!.request(err.config));\n}\n\n/**\n * Determine based on config if we should retry the request.\n * @param err The AxiosError passed to the interceptor.\n */\nexport function shouldRetryRequest(err: AxiosError) {\n const config = (err.config as RaxConfig).raxConfig;\n\n // If there's no config, or retries are disabled, return.\n if (!config || config.retry === 0) {\n return false;\n }\n\n // Check if this error has no response (ETIMEDOUT, ENOTFOUND, etc)\n if (\n !err.response &&\n (config.currentRetryAttempt || 0) >= config.noResponseRetries!\n ) {\n return false;\n }\n\n // Only retry with configured HttpMethods.\n if (\n !err.config.method ||\n config.httpMethodsToRetry!.indexOf(err.config.method.toUpperCase()) < 0\n ) {\n return false;\n }\n\n // If this wasn't in the list of status codes where we want\n // to automatically retry, return.\n if (err.response && err.response.status) {\n let isInRange = false;\n for (const [min, max] of config.statusCodesToRetry!) {\n const status = err.response.status;\n if (status >= min && status <= max) {\n isInRange = true;\n break;\n }\n }\n if (!isInRange) {\n return false;\n }\n }\n\n // If we are out of retry attempts, return\n config.currentRetryAttempt = config.currentRetryAttempt || 0;\n if (config.currentRetryAttempt >= config.retry!) {\n return false;\n }\n\n return true;\n}\n\n/**\n * Acquire the raxConfig object from an AxiosError if available.\n * @param err The Axios error with a config object.\n */\nexport function getConfig(err: AxiosError) {\n if (err && err.config) {\n return (err.config as RaxConfig).raxConfig;\n }\n return;\n}\n\n// Include this so `config.raxConfig` works easily.\n// See https://github.com/JustinBeckwith/retry-axios/issues/64.\ndeclare module 'axios' {\n export interface AxiosRequestConfig {\n raxConfig?: RetryConfig;\n }\n}\n"],"names":["onFulfilled","res","normalizeArray","obj","arr","Array","isArray","Object","keys","forEach","key","onError","err","axios","isCancel","Promise","reject","config","getConfig","currentRetryAttempt","retry","retryDelay","instance","backoffType","httpMethodsToRetry","noResponseRetries","checkRetryAfter","maxRetryAfter","statusCodesToRetry","raxConfig","shouldRetry","shouldRetryRequest","onBackoffPromise","resolve","delay","response","headers","retryAfter","header","value","Number","isNaN","dateTime","Date","parse","now","parseRetryAfter","retrycount","Math","pow","maxRetryDelay","min","setTimeout","onRetryAttemptPromise","onRetryAttempt","then","request","method","indexOf","toUpperCase","status","isInRange","const","interceptors","use","interceptorId","eject"],"mappings":"mNAwGA,SAASA,EAAYC,UACZA,EAkBT,SAASC,EAAkBC,OACnBC,EAAW,MACZD,SAGDE,MAAMC,QAAQH,GACTA,GAEU,iBAARA,GACTI,OAAOC,KAAKL,GAAKM,iBAAQC,GACJ,iBAARA,IACTN,EAAIM,GAAOP,EAAIO,MAIdN,GAuBT,SAASO,EAAQC,MACXC,EAAMC,SAASF,UACVG,QAAQC,OAAOJ,OAGlBK,EAASC,EAAUN,IAAQ,MACjCK,EAAOE,oBAAsBF,EAAOE,qBAAuB,EAC3DF,EAAOG,MAAgC,iBAAjBH,EAAOG,MAAqBH,EAAOG,MAAQ,EACjEH,EAAOI,WACwB,iBAAtBJ,EAAOI,WAA0BJ,EAAOI,WAAa,IAC9DJ,EAAOK,SAAWL,EAAOK,UAAYT,EACrCI,EAAOM,YAAcN,EAAOM,aAAe,cAC3CN,EAAOO,mBAAqBtB,EAAee,EAAOO,qBAAuB,CACvE,MACA,OACA,MACA,UACA,UAEFP,EAAOQ,kBAC+B,iBAA7BR,EAAOQ,kBAAiCR,EAAOQ,kBAAoB,EAC5ER,EAAOS,gBAC6B,kBAA3BT,EAAOS,iBAAgCT,EAAOS,gBACvDT,EAAOU,cAC2B,iBAAzBV,EAAOU,cAA6BV,EAAOU,cAAgB,IAgBpEV,EAAOW,mBACL1B,EAAee,EAAOW,qBAbJ,EAQjB,IAAK,KACN,CAAC,IAAK,KACN,CAAC,IAAK,MAMRhB,EAAIK,OAASL,EAAIK,QAAU,GAC1BL,EAAIK,OAAqBY,UAAYtB,iBAAIU,KAGpBA,EAAOa,aAAeC,GACzBnB,UACVG,QAAQC,OAAOJ,OAIlBoB,EAAmB,IAAIjB,iBAASkB,EAASjB,OACzCkB,EAAQ,KAGVjB,EAAOS,iBACPd,EAAIuB,UACJvB,EAAIuB,SAASC,QAAQ,eACrB,KACMC,EA5EZ,SAAyBC,OAEjBC,EAAQC,OAAOF,OAChBE,OAAOC,MAAMF,UACD,IAARA,MAGHG,EAAWC,KAAKC,MAAMN,UACvBE,OAAOC,MAAMC,UACTA,EAAWC,KAAKE,MAmEFC,CAAgBlC,EAAIuB,SAASC,QAAQ,qBACpDC,GAAcA,EAAa,GAAKA,GAAcpB,EAAOU,sBAGhDX,EAAOJ,GAFdsB,EAAQG,EAmBXzB,EAAIK,OAAqBY,UAAWV,qBAAwB,MAGvD4B,EAAcnC,EAAIK,OAAqBY,UAC1CV,oBAIW,IAAVe,IAOAA,EALyB,WAAvBjB,EAAOM,YAKY,IAAbwB,EACwB,WAAvB9B,EAAOM,YACRN,EAAOI,YAEL2B,KAAKC,IAAI,EAAGF,GAAc,GAAK,EAAK,IAEZ,iBAAzB9B,EAAOiC,gBAChBhB,EAAQc,KAAKG,IAAIjB,EAAOjB,EAAOiC,iBAGnCE,WAAWnB,EAASC,KAIhBmB,EAAwBpC,EAAOqC,eACjCvC,QAAQkB,QAAQhB,EAAOqC,eAAe1C,IACtCG,QAAQkB,iBAGLlB,QAAQkB,UACZsB,uBAAWvB,IACXuB,uBAAWF,IACXE,uBAAWtC,EAAOK,SAAUkC,QAAQ5C,EAAIK,mBAO7Bc,EAAmBnB,OAC3BK,EAAUL,EAAIK,OAAqBY,cAGpCZ,GAA2B,IAAjBA,EAAOG,aACb,MAKNR,EAAIuB,WACJlB,EAAOE,qBAAuB,IAAMF,EAAOQ,yBAErC,MAKNb,EAAIK,OAAOwC,QACZxC,EAAOO,mBAAoBkC,QAAQ9C,EAAIK,OAAOwC,OAAOE,eAAiB,SAE/D,KAKL/C,EAAIuB,UAAYvB,EAAIuB,SAASyB,OAAQ,SACnCC,GAAY,QACS5C,EAAOW,mCAAqB,CAAhDkC,WACGF,EAAShD,EAAIuB,SAASyB,UACxBA,SAAiBA,QAAe,CAClCC,GAAY,aAIXA,SACI,SAKX5C,EAAOE,oBAAsBF,EAAOE,qBAAuB,IACvDF,EAAOE,qBAAuBF,EAAOG,gBAW3BF,EAAUN,MACpBA,GAAOA,EAAIK,cACLL,EAAIK,OAAqBY,yEA9PdP,UACrBA,EAAWA,GAAYT,GACPkD,aAAa5B,SAAS6B,IAAIhE,EAAaW,sBAQlCsD,EAAuB3C,IAC5CA,EAAWA,GAAYT,GACdkD,aAAa5B,SAAS+B,MAAMD"} \ No newline at end of file diff --git a/node_modules/retry-axios/dist/src/index.d.ts b/node_modules/retry-axios/dist/src/index.d.ts new file mode 100644 index 0000000..fe92965 --- /dev/null +++ b/node_modules/retry-axios/dist/src/index.d.ts @@ -0,0 +1,91 @@ +import { AxiosError, AxiosInstance, AxiosRequestConfig } from 'axios'; +/** + * Configuration for the Axios `request` method. + */ +export interface RetryConfig { + /** + * The number of times to retry the request. Defaults to 3. + */ + retry?: number; + /** + * The number of retries already attempted. + */ + currentRetryAttempt?: number; + /** + * The amount of time to initially delay the retry. Defaults to 100. + */ + retryDelay?: number; + /** + * The instance of the axios object to which the interceptor is attached. + */ + instance?: AxiosInstance; + /** + * The HTTP Methods that will be automatically retried. + * Defaults to ['GET','PUT','HEAD','OPTIONS','DELETE'] + */ + httpMethodsToRetry?: string[]; + /** + * The HTTP response status codes that will automatically be retried. + * Defaults to: [[100, 199], [429, 429], [500, 599]] + */ + statusCodesToRetry?: number[][]; + /** + * Function to invoke when a retry attempt is made. + */ + onRetryAttempt?: (err: AxiosError) => void; + /** + * Function to invoke which determines if you should retry + */ + shouldRetry?: (err: AxiosError) => boolean; + /** + * When there is no response, the number of retries to attempt. Defaults to 2. + */ + noResponseRetries?: number; + /** + * Backoff Type; 'linear', 'static' or 'exponential'. + */ + backoffType?: 'linear' | 'static' | 'exponential'; + /** + * Whether to check for 'Retry-After' header in response and use value as delay. Defaults to true. + */ + checkRetryAfter?: boolean; + /** + * Max permitted Retry-After value (in ms) - rejects if greater. Defaults to 5 mins. + */ + maxRetryAfter?: number; + /** + * Ceiling for calculated delay (in ms) - delay will not exceed this value. + */ + maxRetryDelay?: number; +} +export declare type RaxConfig = { + raxConfig: RetryConfig; +} & AxiosRequestConfig; +/** + * Attach the interceptor to the Axios instance. + * @param instance The optional Axios instance on which to attach the + * interceptor. + * @returns The id of the interceptor attached to the axios instance. + */ +export declare function attach(instance?: AxiosInstance): number; +/** + * Eject the Axios interceptor that is providing retry capabilities. + * @param interceptorId The interceptorId provided in the config. + * @param instance The axios instance using this interceptor. + */ +export declare function detach(interceptorId: number, instance?: AxiosInstance): void; +/** + * Determine based on config if we should retry the request. + * @param err The AxiosError passed to the interceptor. + */ +export declare function shouldRetryRequest(err: AxiosError): boolean; +/** + * Acquire the raxConfig object from an AxiosError if available. + * @param err The Axios error with a config object. + */ +export declare function getConfig(err: AxiosError): RetryConfig | undefined; +declare module 'axios' { + interface AxiosRequestConfig { + raxConfig?: RetryConfig; + } +} diff --git a/node_modules/retry-axios/dist/test/index.d.ts b/node_modules/retry-axios/dist/test/index.d.ts new file mode 100644 index 0000000..509db18 --- /dev/null +++ b/node_modules/retry-axios/dist/test/index.d.ts @@ -0,0 +1 @@ +export {}; diff --git a/node_modules/retry-axios/package.json b/node_modules/retry-axios/package.json new file mode 100644 index 0000000..f87459e --- /dev/null +++ b/node_modules/retry-axios/package.json @@ -0,0 +1,68 @@ +{ + "name": "retry-axios", + "version": "2.6.0", + "description": "Retry HTTP requests with Axios.", + "source": "src/index.ts", + "main": "dist/index.js", + "module": "dist/index.module.js", + "unpkg": "dist/index.umd.js", + "types": "dist/src/index.d.ts", + "engines": { + "node": ">=10.7.0" + }, + "repository": { + "type": "git", + "url": "https://github.com/JustinBeckwith/retry-axios.git" + }, + "scripts": { + "lint": "gts check", + "clean": "gts clean", + "fix": "gts fix", + "compile": "tsc --target ES5 --module CommonJS", + "build-web": "microbundle", + "umd": "rm -rf umd && babel build/src -d umd --source-maps", + "test": "c8 mocha build/test", + "prepare": "npm run build-web", + "pretest": "npm run compile", + "license-check": "jsgl --local ." + }, + "keywords": [ + "axios", + "retry" + ], + "author": { + "name": "Justin Beckwith" + }, + "license": "Apache-2.0", + "peerDependencies": { + "axios": "*" + }, + "devDependencies": { + "@babel/cli": "^7.4.4", + "@babel/preset-env": "^7.4.5", + "@types/mocha": "^9.0.0", + "@types/sinon": "^10.0.0", + "@types/node": "^14.0.0", + "axios": "^0.21.0", + "babel-plugin-transform-es2015-modules-umd": "^6.24.1", + "c8": "^7.0.0", + "gts": "^3.0.0", + "js-green-licenses": "^3.0.0", + "microbundle": "^0.11.0", + "mocha": "^9.0.0", + "nock": "^13.0.0", + "semantic-release": "^17.0.4", + "sinon": "^11.0.0", + "typescript": "~4.3.0" + }, + "files": [ + "dist" + ], + "c8": { + "exclude": [ + "build/test", + "dist" + ] + }, + "browserslist": "> 1%, last 2 versions, Firefox ESR" +} diff --git a/node_modules/tunnel/.idea/encodings.xml b/node_modules/tunnel/.idea/encodings.xml new file mode 100644 index 0000000..97626ba --- /dev/null +++ b/node_modules/tunnel/.idea/encodings.xml @@ -0,0 +1,6 @@ + + + + + + \ No newline at end of file diff --git a/node_modules/tunnel/.idea/modules.xml b/node_modules/tunnel/.idea/modules.xml new file mode 100644 index 0000000..27bf888 --- /dev/null +++ b/node_modules/tunnel/.idea/modules.xml @@ -0,0 +1,8 @@ + + + + + + + + \ No newline at end of file diff --git a/node_modules/tunnel/.idea/node-tunnel.iml b/node_modules/tunnel/.idea/node-tunnel.iml new file mode 100644 index 0000000..24643cc --- /dev/null +++ b/node_modules/tunnel/.idea/node-tunnel.iml @@ -0,0 +1,12 @@ + + + + + + + + + + + + \ No newline at end of file diff --git a/node_modules/tunnel/.idea/vcs.xml b/node_modules/tunnel/.idea/vcs.xml new file mode 100644 index 0000000..94a25f7 --- /dev/null +++ b/node_modules/tunnel/.idea/vcs.xml @@ -0,0 +1,6 @@ + + + + + + \ No newline at end of file diff --git a/node_modules/tunnel/.idea/workspace.xml b/node_modules/tunnel/.idea/workspace.xml new file mode 100644 index 0000000..1a318c8 --- /dev/null +++ b/node_modules/tunnel/.idea/workspace.xml @@ -0,0 +1,797 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + max + onconne + + + + + + + + + + + + + false + + false + false + true + + + true + DEFINITION_ORDER + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +